{
  "version": 3,
  "sources": ["../../build/_snowpack/env.js", "../../build/_snowpack/pkg/common/index-c07ea359.js", "../../build/dist/util.js", "../../build/_snowpack/pkg/common/index-110b9d63.js", "../../build/_snowpack/pkg/svelte-routing.js", "../../build/dist/routing/Redirect.svelte.js", "../../build/dist/ApiClient.js", "../../build/dist/components/Hero.svelte.js", "../../build/_snowpack/pkg/svelte-simple-modal.js", "../../build/dist/components/PlayCredentials.svelte.js", "../../build/dist/stores.js", "../../build/dist/components/MediaQuery.svelte.js", "../../build/dist/components/NavBar.svelte.js", "../../build/dist/components/ProductCTA.svelte.js", "../../build/dist/components/Products.svelte.js", "../../build/dist/components/About.svelte.js", "../../build/dist/components/Infomercial.svelte.js", "../../build/dist/components/FAQ.svelte.js", "../../build/dist/components/Banner.svelte.js", "../../build/dist/components/OffsetButtons.svelte.js", "../../build/dist/components/BuyNow.svelte.js", "../../build/dist/components/ContactUs.svelte.js", "../../build/dist/components/Footer.svelte.js", "../../build/_snowpack/pkg/common/_commonjsHelpers-eb5a497e.js", "../../build/_snowpack/pkg/svelte-carousel.js", "../../build/dist/components/Testimonial.svelte.js", "../../build/dist/components/TestimonialCarousel.svelte.js", "../../build/dist/screens/Front.svelte.js", "../../build/_snowpack/pkg/common/lazy-json-f4438c0b.js", "../../build/_snowpack/pkg/common/v4-c5ee5148.js", "../../build/_snowpack/pkg/common/resolveDefaultsModeConfig-3d61721d.js", "../../build/_snowpack/pkg/common/object-mapping-ce2960b7.js", "../../build/_snowpack/pkg/@aws-sdk/client-s3.js", "../../build/_snowpack/pkg/@aws-sdk/client-cognito-identity.js", "../../build/_snowpack/pkg/@aws-sdk/credential-provider-cognito-identity.js", "../../build/dist/UploadClient.js", "../../build/dist/components/LoadingAnimation.svelte.js", "../../build/dist/components/ThemePreview.svelte.js", "../../build/dist/components/ImagePreview.svelte.js", "../../build/dist/components/VideoPreview.svelte.js", "../../build/dist/screens/Product.svelte.js", "../../build/dist/components/CartItem.svelte.js", "../../build/dist/components/CartCheckout.svelte.js", "../../build/dist/screens/Cart.svelte.js", "../../build/dist/screens/TermsAndConditions.svelte.js", "../../build/dist/screens/ReturnPolicy.svelte.js", "../../build/dist/screens/PrivacyPolicy.svelte.js", "../../build/dist/components/AffiliateForm.svelte.js", "../../build/dist/components/Loader.svelte.js", "../../build/dist/screens/AffiliateScreen.svelte.js", "../../build/dist/screens/AffiliateAgreement.svelte.js", "../../build/dist/routing/Routes.svelte.js", "../../build/dist/App.svelte.js", "../../build/dist/index.js"],
  "sourcesContent": ["export const SNOWPACK_PUBLIC_API_URL = \"https://mypetar.com/api\";\nexport const SNOWPACK_PUBLIC_SHOPIFY_TOKEN = \"3e8d8dfa38ff1e3821731c6f43c0e9ac\";\nexport const SNOWPACK_PUBLIC_SHOPIFY_ADDRESS = \"https://mypetar.myshopify.com\";\nexport const RUN_ENV = \"production\";\nexport const MODE = \"production\";\nexport const NODE_ENV = \"production\";\nexport const SSR = false;", "function noop() {\n}\nconst identity = (x) => x;\nfunction assign(tar, src) {\n  for (const k in src)\n    tar[k] = src[k];\n  return tar;\n}\nfunction is_promise(value) {\n  return !!value && (typeof value === \"object\" || typeof value === \"function\") && typeof value.then === \"function\";\n}\nfunction run(fn) {\n  return fn();\n}\nfunction blank_object() {\n  return Object.create(null);\n}\nfunction run_all(fns) {\n  fns.forEach(run);\n}\nfunction is_function(thing) {\n  return typeof thing === \"function\";\n}\nfunction safe_not_equal(a, b) {\n  return a != a ? b == b : a !== b || (a && typeof a === \"object\" || typeof a === \"function\");\n}\nlet src_url_equal_anchor;\nfunction src_url_equal(element_src, url) {\n  if (!src_url_equal_anchor) {\n    src_url_equal_anchor = document.createElement(\"a\");\n  }\n  src_url_equal_anchor.href = url;\n  return element_src === src_url_equal_anchor.href;\n}\nfunction is_empty(obj) {\n  return Object.keys(obj).length === 0;\n}\nfunction subscribe(store, ...callbacks) {\n  if (store == null) {\n    return noop;\n  }\n  const unsub = store.subscribe(...callbacks);\n  return unsub.unsubscribe ? () => unsub.unsubscribe() : unsub;\n}\nfunction component_subscribe(component, store, callback) {\n  component.$$.on_destroy.push(subscribe(store, callback));\n}\nfunction create_slot(definition, ctx, $$scope, fn) {\n  if (definition) {\n    const slot_ctx = get_slot_context(definition, ctx, $$scope, fn);\n    return definition[0](slot_ctx);\n  }\n}\nfunction get_slot_context(definition, ctx, $$scope, fn) {\n  return definition[1] && fn ? assign($$scope.ctx.slice(), definition[1](fn(ctx))) : $$scope.ctx;\n}\nfunction get_slot_changes(definition, $$scope, dirty, fn) {\n  if (definition[2] && fn) {\n    const lets = definition[2](fn(dirty));\n    if ($$scope.dirty === void 0) {\n      return lets;\n    }\n    if (typeof lets === \"object\") {\n      const merged = [];\n      const len = Math.max($$scope.dirty.length, lets.length);\n      for (let i = 0; i < len; i += 1) {\n        merged[i] = $$scope.dirty[i] | lets[i];\n      }\n      return merged;\n    }\n    return $$scope.dirty | lets;\n  }\n  return $$scope.dirty;\n}\nfunction update_slot_base(slot, slot_definition, ctx, $$scope, slot_changes, get_slot_context_fn) {\n  if (slot_changes) {\n    const slot_context = get_slot_context(slot_definition, ctx, $$scope, get_slot_context_fn);\n    slot.p(slot_context, slot_changes);\n  }\n}\nfunction get_all_dirty_from_scope($$scope) {\n  if ($$scope.ctx.length > 32) {\n    const dirty = [];\n    const length = $$scope.ctx.length / 32;\n    for (let i = 0; i < length; i++) {\n      dirty[i] = -1;\n    }\n    return dirty;\n  }\n  return -1;\n}\nfunction exclude_internal_props(props) {\n  const result = {};\n  for (const k in props)\n    if (k[0] !== \"$\")\n      result[k] = props[k];\n  return result;\n}\nfunction compute_rest_props(props, keys) {\n  const rest = {};\n  keys = new Set(keys);\n  for (const k in props)\n    if (!keys.has(k) && k[0] !== \"$\")\n      rest[k] = props[k];\n  return rest;\n}\nfunction action_destroyer(action_result) {\n  return action_result && is_function(action_result.destroy) ? action_result.destroy : noop;\n}\nconst is_client = typeof window !== \"undefined\";\nlet now = is_client ? () => window.performance.now() : () => Date.now();\nlet raf = is_client ? (cb) => requestAnimationFrame(cb) : noop;\nconst tasks = new Set();\nfunction run_tasks(now2) {\n  tasks.forEach((task) => {\n    if (!task.c(now2)) {\n      tasks.delete(task);\n      task.f();\n    }\n  });\n  if (tasks.size !== 0)\n    raf(run_tasks);\n}\nfunction loop(callback) {\n  let task;\n  if (tasks.size === 0)\n    raf(run_tasks);\n  return {\n    promise: new Promise((fulfill) => {\n      tasks.add(task = {c: callback, f: fulfill});\n    }),\n    abort() {\n      tasks.delete(task);\n    }\n  };\n}\nconst globals = typeof window !== \"undefined\" ? window : typeof globalThis !== \"undefined\" ? globalThis : global;\nfunction append(target, node) {\n  target.appendChild(node);\n}\nfunction append_styles(target, style_sheet_id, styles) {\n  const append_styles_to = get_root_for_style(target);\n  if (!append_styles_to.getElementById(style_sheet_id)) {\n    const style = element(\"style\");\n    style.id = style_sheet_id;\n    style.textContent = styles;\n    append_stylesheet(append_styles_to, style);\n  }\n}\nfunction get_root_for_style(node) {\n  if (!node)\n    return document;\n  const root = node.getRootNode ? node.getRootNode() : node.ownerDocument;\n  if (root && root.host) {\n    return root;\n  }\n  return node.ownerDocument;\n}\nfunction append_empty_stylesheet(node) {\n  const style_element = element(\"style\");\n  append_stylesheet(get_root_for_style(node), style_element);\n  return style_element.sheet;\n}\nfunction append_stylesheet(node, style) {\n  append(node.head || node, style);\n  return style.sheet;\n}\nfunction insert(target, node, anchor) {\n  target.insertBefore(node, anchor || null);\n}\nfunction detach(node) {\n  if (node.parentNode) {\n    node.parentNode.removeChild(node);\n  }\n}\nfunction destroy_each(iterations, detaching) {\n  for (let i = 0; i < iterations.length; i += 1) {\n    if (iterations[i])\n      iterations[i].d(detaching);\n  }\n}\nfunction element(name) {\n  return document.createElement(name);\n}\nfunction text(data) {\n  return document.createTextNode(data);\n}\nfunction space() {\n  return text(\" \");\n}\nfunction empty() {\n  return text(\"\");\n}\nfunction listen(node, event, handler, options) {\n  node.addEventListener(event, handler, options);\n  return () => node.removeEventListener(event, handler, options);\n}\nfunction prevent_default(fn) {\n  return function(event) {\n    event.preventDefault();\n    return fn.call(this, event);\n  };\n}\nfunction attr(node, attribute, value) {\n  if (value == null)\n    node.removeAttribute(attribute);\n  else if (node.getAttribute(attribute) !== value)\n    node.setAttribute(attribute, value);\n}\nconst always_set_through_set_attribute = [\"width\", \"height\"];\nfunction set_attributes(node, attributes) {\n  const descriptors = Object.getOwnPropertyDescriptors(node.__proto__);\n  for (const key in attributes) {\n    if (attributes[key] == null) {\n      node.removeAttribute(key);\n    } else if (key === \"style\") {\n      node.style.cssText = attributes[key];\n    } else if (key === \"__value\") {\n      node.value = node[key] = attributes[key];\n    } else if (descriptors[key] && descriptors[key].set && always_set_through_set_attribute.indexOf(key) === -1) {\n      node[key] = attributes[key];\n    } else {\n      attr(node, key, attributes[key]);\n    }\n  }\n}\nfunction init_binding_group(group) {\n  let _inputs;\n  return {\n    p(...inputs) {\n      _inputs = inputs;\n      _inputs.forEach((input) => group.push(input));\n    },\n    r() {\n      _inputs.forEach((input) => group.splice(group.indexOf(input), 1));\n    }\n  };\n}\nfunction children(element2) {\n  return Array.from(element2.childNodes);\n}\nfunction set_data(text2, data) {\n  data = \"\" + data;\n  if (text2.data === data)\n    return;\n  text2.data = data;\n}\nfunction set_input_value(input, value) {\n  input.value = value == null ? \"\" : value;\n}\nfunction set_style(node, key, value, important) {\n  if (value == null) {\n    node.style.removeProperty(key);\n  } else {\n    node.style.setProperty(key, value, important ? \"important\" : \"\");\n  }\n}\nfunction select_option(select, value, mounting) {\n  for (let i = 0; i < select.options.length; i += 1) {\n    const option = select.options[i];\n    if (option.__value === value) {\n      option.selected = true;\n      return;\n    }\n  }\n  if (!mounting || value !== void 0) {\n    select.selectedIndex = -1;\n  }\n}\nfunction select_value(select) {\n  const selected_option = select.querySelector(\":checked\");\n  return selected_option && selected_option.__value;\n}\nfunction toggle_class(element2, name, toggle) {\n  element2.classList[toggle ? \"add\" : \"remove\"](name);\n}\nfunction custom_event(type, detail, {bubbles = false, cancelable = false} = {}) {\n  const e = document.createEvent(\"CustomEvent\");\n  e.initCustomEvent(type, bubbles, cancelable, detail);\n  return e;\n}\nfunction construct_svelte_component(component, props) {\n  return new component(props);\n}\nconst managed_styles = new Map();\nlet active = 0;\nfunction hash(str) {\n  let hash2 = 5381;\n  let i = str.length;\n  while (i--)\n    hash2 = (hash2 << 5) - hash2 ^ str.charCodeAt(i);\n  return hash2 >>> 0;\n}\nfunction create_style_information(doc, node) {\n  const info = {stylesheet: append_empty_stylesheet(node), rules: {}};\n  managed_styles.set(doc, info);\n  return info;\n}\nfunction create_rule(node, a, b, duration, delay, ease, fn, uid = 0) {\n  const step = 16.666 / duration;\n  let keyframes = \"{\\n\";\n  for (let p = 0; p <= 1; p += step) {\n    const t = a + (b - a) * ease(p);\n    keyframes += p * 100 + `%{${fn(t, 1 - t)}}\n`;\n  }\n  const rule = keyframes + `100% {${fn(b, 1 - b)}}\n}`;\n  const name = `__svelte_${hash(rule)}_${uid}`;\n  const doc = get_root_for_style(node);\n  const {stylesheet, rules} = managed_styles.get(doc) || create_style_information(doc, node);\n  if (!rules[name]) {\n    rules[name] = true;\n    stylesheet.insertRule(`@keyframes ${name} ${rule}`, stylesheet.cssRules.length);\n  }\n  const animation = node.style.animation || \"\";\n  node.style.animation = `${animation ? `${animation}, ` : \"\"}${name} ${duration}ms linear ${delay}ms 1 both`;\n  active += 1;\n  return name;\n}\nfunction delete_rule(node, name) {\n  const previous = (node.style.animation || \"\").split(\", \");\n  const next = previous.filter(name ? (anim) => anim.indexOf(name) < 0 : (anim) => anim.indexOf(\"__svelte\") === -1);\n  const deleted = previous.length - next.length;\n  if (deleted) {\n    node.style.animation = next.join(\", \");\n    active -= deleted;\n    if (!active)\n      clear_rules();\n  }\n}\nfunction clear_rules() {\n  raf(() => {\n    if (active)\n      return;\n    managed_styles.forEach((info) => {\n      const {ownerNode} = info.stylesheet;\n      if (ownerNode)\n        detach(ownerNode);\n    });\n    managed_styles.clear();\n  });\n}\nlet current_component;\nfunction set_current_component(component) {\n  current_component = component;\n}\nfunction get_current_component() {\n  if (!current_component)\n    throw new Error(\"Function called outside component initialization\");\n  return current_component;\n}\nfunction onMount(fn) {\n  get_current_component().$$.on_mount.push(fn);\n}\nfunction onDestroy(fn) {\n  get_current_component().$$.on_destroy.push(fn);\n}\nfunction createEventDispatcher() {\n  const component = get_current_component();\n  return (type, detail, {cancelable = false} = {}) => {\n    const callbacks = component.$$.callbacks[type];\n    if (callbacks) {\n      const event = custom_event(type, detail, {cancelable});\n      callbacks.slice().forEach((fn) => {\n        fn.call(component, event);\n      });\n      return !event.defaultPrevented;\n    }\n    return true;\n  };\n}\nfunction setContext(key, context) {\n  get_current_component().$$.context.set(key, context);\n  return context;\n}\nfunction getContext(key) {\n  return get_current_component().$$.context.get(key);\n}\nfunction bubble(component, event) {\n  const callbacks = component.$$.callbacks[event.type];\n  if (callbacks) {\n    callbacks.slice().forEach((fn) => fn.call(this, event));\n  }\n}\nconst dirty_components = [];\nconst binding_callbacks = [];\nlet render_callbacks = [];\nconst flush_callbacks = [];\nconst resolved_promise = /* @__PURE__ */ Promise.resolve();\nlet update_scheduled = false;\nfunction schedule_update() {\n  if (!update_scheduled) {\n    update_scheduled = true;\n    resolved_promise.then(flush);\n  }\n}\nfunction tick() {\n  schedule_update();\n  return resolved_promise;\n}\nfunction add_render_callback(fn) {\n  render_callbacks.push(fn);\n}\nconst seen_callbacks = new Set();\nlet flushidx = 0;\nfunction flush() {\n  if (flushidx !== 0) {\n    return;\n  }\n  const saved_component = current_component;\n  do {\n    try {\n      while (flushidx < dirty_components.length) {\n        const component = dirty_components[flushidx];\n        flushidx++;\n        set_current_component(component);\n        update(component.$$);\n      }\n    } catch (e) {\n      dirty_components.length = 0;\n      flushidx = 0;\n      throw e;\n    }\n    set_current_component(null);\n    dirty_components.length = 0;\n    flushidx = 0;\n    while (binding_callbacks.length)\n      binding_callbacks.pop()();\n    for (let i = 0; i < render_callbacks.length; i += 1) {\n      const callback = render_callbacks[i];\n      if (!seen_callbacks.has(callback)) {\n        seen_callbacks.add(callback);\n        callback();\n      }\n    }\n    render_callbacks.length = 0;\n  } while (dirty_components.length);\n  while (flush_callbacks.length) {\n    flush_callbacks.pop()();\n  }\n  update_scheduled = false;\n  seen_callbacks.clear();\n  set_current_component(saved_component);\n}\nfunction update($$) {\n  if ($$.fragment !== null) {\n    $$.update();\n    run_all($$.before_update);\n    const dirty = $$.dirty;\n    $$.dirty = [-1];\n    $$.fragment && $$.fragment.p($$.ctx, dirty);\n    $$.after_update.forEach(add_render_callback);\n  }\n}\nfunction flush_render_callbacks(fns) {\n  const filtered = [];\n  const targets = [];\n  render_callbacks.forEach((c) => fns.indexOf(c) === -1 ? filtered.push(c) : targets.push(c));\n  targets.forEach((c) => c());\n  render_callbacks = filtered;\n}\nlet promise;\nfunction wait() {\n  if (!promise) {\n    promise = Promise.resolve();\n    promise.then(() => {\n      promise = null;\n    });\n  }\n  return promise;\n}\nfunction dispatch(node, direction, kind) {\n  node.dispatchEvent(custom_event(`${direction ? \"intro\" : \"outro\"}${kind}`));\n}\nconst outroing = new Set();\nlet outros;\nfunction group_outros() {\n  outros = {\n    r: 0,\n    c: [],\n    p: outros\n  };\n}\nfunction check_outros() {\n  if (!outros.r) {\n    run_all(outros.c);\n  }\n  outros = outros.p;\n}\nfunction transition_in(block, local) {\n  if (block && block.i) {\n    outroing.delete(block);\n    block.i(local);\n  }\n}\nfunction transition_out(block, local, detach2, callback) {\n  if (block && block.o) {\n    if (outroing.has(block))\n      return;\n    outroing.add(block);\n    outros.c.push(() => {\n      outroing.delete(block);\n      if (callback) {\n        if (detach2)\n          block.d(1);\n        callback();\n      }\n    });\n    block.o(local);\n  } else if (callback) {\n    callback();\n  }\n}\nconst null_transition = {duration: 0};\nfunction create_bidirectional_transition(node, fn, params, intro) {\n  const options = {direction: \"both\"};\n  let config = fn(node, params, options);\n  let t = intro ? 0 : 1;\n  let running_program = null;\n  let pending_program = null;\n  let animation_name = null;\n  function clear_animation() {\n    if (animation_name)\n      delete_rule(node, animation_name);\n  }\n  function init2(program, duration) {\n    const d = program.b - t;\n    duration *= Math.abs(d);\n    return {\n      a: t,\n      b: program.b,\n      d,\n      duration,\n      start: program.start,\n      end: program.start + duration,\n      group: program.group\n    };\n  }\n  function go(b) {\n    const {delay = 0, duration = 300, easing = identity, tick: tick2 = noop, css} = config || null_transition;\n    const program = {\n      start: now() + delay,\n      b\n    };\n    if (!b) {\n      program.group = outros;\n      outros.r += 1;\n    }\n    if (running_program || pending_program) {\n      pending_program = program;\n    } else {\n      if (css) {\n        clear_animation();\n        animation_name = create_rule(node, t, b, duration, delay, easing, css);\n      }\n      if (b)\n        tick2(0, 1);\n      running_program = init2(program, duration);\n      add_render_callback(() => dispatch(node, b, \"start\"));\n      loop((now2) => {\n        if (pending_program && now2 > pending_program.start) {\n          running_program = init2(pending_program, duration);\n          pending_program = null;\n          dispatch(node, running_program.b, \"start\");\n          if (css) {\n            clear_animation();\n            animation_name = create_rule(node, t, running_program.b, running_program.duration, 0, easing, config.css);\n          }\n        }\n        if (running_program) {\n          if (now2 >= running_program.end) {\n            tick2(t = running_program.b, 1 - t);\n            dispatch(node, running_program.b, \"end\");\n            if (!pending_program) {\n              if (running_program.b) {\n                clear_animation();\n              } else {\n                if (!--running_program.group.r)\n                  run_all(running_program.group.c);\n              }\n            }\n            running_program = null;\n          } else if (now2 >= running_program.start) {\n            const p = now2 - running_program.start;\n            t = running_program.a + running_program.d * easing(p / running_program.duration);\n            tick2(t, 1 - t);\n          }\n        }\n        return !!(running_program || pending_program);\n      });\n    }\n  }\n  return {\n    run(b) {\n      if (is_function(config)) {\n        wait().then(() => {\n          config = config(options);\n          go(b);\n        });\n      } else {\n        go(b);\n      }\n    },\n    end() {\n      clear_animation();\n      running_program = pending_program = null;\n    }\n  };\n}\nfunction handle_promise(promise2, info) {\n  const token = info.token = {};\n  function update2(type, index, key, value) {\n    if (info.token !== token)\n      return;\n    info.resolved = value;\n    let child_ctx = info.ctx;\n    if (key !== void 0) {\n      child_ctx = child_ctx.slice();\n      child_ctx[key] = value;\n    }\n    const block = type && (info.current = type)(child_ctx);\n    let needs_flush = false;\n    if (info.block) {\n      if (info.blocks) {\n        info.blocks.forEach((block2, i) => {\n          if (i !== index && block2) {\n            group_outros();\n            transition_out(block2, 1, 1, () => {\n              if (info.blocks[i] === block2) {\n                info.blocks[i] = null;\n              }\n            });\n            check_outros();\n          }\n        });\n      } else {\n        info.block.d(1);\n      }\n      block.c();\n      transition_in(block, 1);\n      block.m(info.mount(), info.anchor);\n      needs_flush = true;\n    }\n    info.block = block;\n    if (info.blocks)\n      info.blocks[index] = block;\n    if (needs_flush) {\n      flush();\n    }\n  }\n  if (is_promise(promise2)) {\n    const current_component2 = get_current_component();\n    promise2.then((value) => {\n      set_current_component(current_component2);\n      update2(info.then, 1, info.value, value);\n      set_current_component(null);\n    }, (error) => {\n      set_current_component(current_component2);\n      update2(info.catch, 2, info.error, error);\n      set_current_component(null);\n      if (!info.hasCatch) {\n        throw error;\n      }\n    });\n    if (info.current !== info.pending) {\n      update2(info.pending, 0);\n      return true;\n    }\n  } else {\n    if (info.current !== info.then) {\n      update2(info.then, 1, info.value, promise2);\n      return true;\n    }\n    info.resolved = promise2;\n  }\n}\nfunction update_await_block_branch(info, ctx, dirty) {\n  const child_ctx = ctx.slice();\n  const {resolved} = info;\n  if (info.current === info.then) {\n    child_ctx[info.value] = resolved;\n  }\n  if (info.current === info.catch) {\n    child_ctx[info.error] = resolved;\n  }\n  info.block.p(child_ctx, dirty);\n}\nfunction outro_and_destroy_block(block, lookup) {\n  transition_out(block, 1, 1, () => {\n    lookup.delete(block.key);\n  });\n}\nfunction update_keyed_each(old_blocks, dirty, get_key, dynamic, ctx, list, lookup, node, destroy, create_each_block, next, get_context) {\n  let o = old_blocks.length;\n  let n = list.length;\n  let i = o;\n  const old_indexes = {};\n  while (i--)\n    old_indexes[old_blocks[i].key] = i;\n  const new_blocks = [];\n  const new_lookup = new Map();\n  const deltas = new Map();\n  const updates = [];\n  i = n;\n  while (i--) {\n    const child_ctx = get_context(ctx, list, i);\n    const key = get_key(child_ctx);\n    let block = lookup.get(key);\n    if (!block) {\n      block = create_each_block(key, child_ctx);\n      block.c();\n    } else if (dynamic) {\n      updates.push(() => block.p(child_ctx, dirty));\n    }\n    new_lookup.set(key, new_blocks[i] = block);\n    if (key in old_indexes)\n      deltas.set(key, Math.abs(i - old_indexes[key]));\n  }\n  const will_move = new Set();\n  const did_move = new Set();\n  function insert2(block) {\n    transition_in(block, 1);\n    block.m(node, next);\n    lookup.set(block.key, block);\n    next = block.first;\n    n--;\n  }\n  while (o && n) {\n    const new_block = new_blocks[n - 1];\n    const old_block = old_blocks[o - 1];\n    const new_key = new_block.key;\n    const old_key = old_block.key;\n    if (new_block === old_block) {\n      next = new_block.first;\n      o--;\n      n--;\n    } else if (!new_lookup.has(old_key)) {\n      destroy(old_block, lookup);\n      o--;\n    } else if (!lookup.has(new_key) || will_move.has(new_key)) {\n      insert2(new_block);\n    } else if (did_move.has(old_key)) {\n      o--;\n    } else if (deltas.get(new_key) > deltas.get(old_key)) {\n      did_move.add(new_key);\n      insert2(new_block);\n    } else {\n      will_move.add(old_key);\n      o--;\n    }\n  }\n  while (o--) {\n    const old_block = old_blocks[o];\n    if (!new_lookup.has(old_block.key))\n      destroy(old_block, lookup);\n  }\n  while (n)\n    insert2(new_blocks[n - 1]);\n  run_all(updates);\n  return new_blocks;\n}\nfunction get_spread_update(levels, updates) {\n  const update2 = {};\n  const to_null_out = {};\n  const accounted_for = {$$scope: 1};\n  let i = levels.length;\n  while (i--) {\n    const o = levels[i];\n    const n = updates[i];\n    if (n) {\n      for (const key in o) {\n        if (!(key in n))\n          to_null_out[key] = 1;\n      }\n      for (const key in n) {\n        if (!accounted_for[key]) {\n          update2[key] = n[key];\n          accounted_for[key] = 1;\n        }\n      }\n      levels[i] = n;\n    } else {\n      for (const key in o) {\n        accounted_for[key] = 1;\n      }\n    }\n  }\n  for (const key in to_null_out) {\n    if (!(key in update2))\n      update2[key] = void 0;\n  }\n  return update2;\n}\nfunction get_spread_object(spread_props) {\n  return typeof spread_props === \"object\" && spread_props !== null ? spread_props : {};\n}\nfunction create_component(block) {\n  block && block.c();\n}\nfunction mount_component(component, target, anchor, customElement) {\n  const {fragment, after_update} = component.$$;\n  fragment && fragment.m(target, anchor);\n  if (!customElement) {\n    add_render_callback(() => {\n      const new_on_destroy = component.$$.on_mount.map(run).filter(is_function);\n      if (component.$$.on_destroy) {\n        component.$$.on_destroy.push(...new_on_destroy);\n      } else {\n        run_all(new_on_destroy);\n      }\n      component.$$.on_mount = [];\n    });\n  }\n  after_update.forEach(add_render_callback);\n}\nfunction destroy_component(component, detaching) {\n  const $$ = component.$$;\n  if ($$.fragment !== null) {\n    flush_render_callbacks($$.after_update);\n    run_all($$.on_destroy);\n    $$.fragment && $$.fragment.d(detaching);\n    $$.on_destroy = $$.fragment = null;\n    $$.ctx = [];\n  }\n}\nfunction make_dirty(component, i) {\n  if (component.$$.dirty[0] === -1) {\n    dirty_components.push(component);\n    schedule_update();\n    component.$$.dirty.fill(0);\n  }\n  component.$$.dirty[i / 31 | 0] |= 1 << i % 31;\n}\nfunction init(component, options, instance, create_fragment, not_equal2, props, append_styles2, dirty = [-1]) {\n  const parent_component = current_component;\n  set_current_component(component);\n  const $$ = component.$$ = {\n    fragment: null,\n    ctx: [],\n    props,\n    update: noop,\n    not_equal: not_equal2,\n    bound: blank_object(),\n    on_mount: [],\n    on_destroy: [],\n    on_disconnect: [],\n    before_update: [],\n    after_update: [],\n    context: new Map(options.context || (parent_component ? parent_component.$$.context : [])),\n    callbacks: blank_object(),\n    dirty,\n    skip_bound: false,\n    root: options.target || parent_component.$$.root\n  };\n  append_styles2 && append_styles2($$.root);\n  let ready = false;\n  $$.ctx = instance ? instance(component, options.props || {}, (i, ret, ...rest) => {\n    const value = rest.length ? rest[0] : ret;\n    if ($$.ctx && not_equal2($$.ctx[i], $$.ctx[i] = value)) {\n      if (!$$.skip_bound && $$.bound[i])\n        $$.bound[i](value);\n      if (ready)\n        make_dirty(component, i);\n    }\n    return ret;\n  }) : [];\n  $$.update();\n  ready = true;\n  run_all($$.before_update);\n  $$.fragment = create_fragment ? create_fragment($$.ctx) : false;\n  if (options.target) {\n    if (options.hydrate) {\n      const nodes = children(options.target);\n      $$.fragment && $$.fragment.l(nodes);\n      nodes.forEach(detach);\n    } else {\n      $$.fragment && $$.fragment.c();\n    }\n    if (options.intro)\n      transition_in(component.$$.fragment);\n    mount_component(component, options.target, options.anchor, options.customElement);\n    flush();\n  }\n  set_current_component(parent_component);\n}\nclass SvelteComponent {\n  $destroy() {\n    destroy_component(this, 1);\n    this.$destroy = noop;\n  }\n  $on(type, callback) {\n    if (!is_function(callback)) {\n      return noop;\n    }\n    const callbacks = this.$$.callbacks[type] || (this.$$.callbacks[type] = []);\n    callbacks.push(callback);\n    return () => {\n      const index = callbacks.indexOf(callback);\n      if (index !== -1)\n        callbacks.splice(index, 1);\n    };\n  }\n  $set($$props) {\n    if (this.$$set && !is_empty($$props)) {\n      this.$$.skip_bound = true;\n      this.$$set($$props);\n      this.$$.skip_bound = false;\n    }\n  }\n}\n\nexport { globals as $, update_slot_base as A, get_all_dirty_from_scope as B, get_slot_changes as C, create_slot as D, action_destroyer as E, is_function as F, run_all as G, tick as H, binding_callbacks as I, assign as J, set_attributes as K, get_spread_update as L, compute_rest_props as M, getContext as N, component_subscribe as O, exclude_internal_props as P, empty as Q, handle_promise as R, SvelteComponent as S, update_await_block_branch as T, construct_svelte_component as U, get_spread_object as V, setContext as W, subscribe as X, identity as Y, add_render_callback as Z, create_bidirectional_transition as _, onDestroy as a, prevent_default as a0, set_input_value as a1, src_url_equal as a2, set_data as a3, text as a4, destroy_each as a5, init_binding_group as a6, select_option as a7, select_value as a8, append_styles as b, createEventDispatcher as c, attr as d, element as e, insert as f, detach as g, bubble as h, init as i, create_component as j, space as k, listen as l, mount_component as m, noop as n, onMount as o, append as p, transition_in as q, transition_out as r, safe_not_equal as s, toggle_class as t, destroy_component as u, group_outros as v, update_keyed_each as w, check_outros as x, outro_and_destroy_block as y, set_style as z };\n", "import * as __SNOWPACK_ENV__ from '../_snowpack/env.js';\n\nexport function getShopifyStoreAddress() {\n  let url = __SNOWPACK_ENV__.SNOWPACK_PUBLIC_SHOPIFY_ADDRESS\n\n  if (!url) {\n    console.log(\"ERROR: SNOWPACK_PUBLIC_SHOPIFY_ADDRESS env var not correctly configured.\")\n    url = \"http://localhost:3000\"\n  }\n\n  return url;\n}\n\nexport function getStorefrontToken() {\n  let token = __SNOWPACK_ENV__.SNOWPACK_PUBLIC_SHOPIFY_TOKEN\n\n  if (!token) {\n    console.log(\"ERROR: SNOWPACK_PUBLIC_SHOPIFY_TOKEN env var not correctly configured.\")\n    token = \"token\"\n  }\n\n  return token;\n}\n\nexport function getSavedCheckoutId() {\n  return window.localStorage.getItem(\"checkoutId\");\n}\n\nexport function setSavedCheckoutId(checkoutId) {\n  window.localStorage.setItem(\"checkoutId\", checkoutId);\n}\n\nexport function isDevelopment() {\n  return __SNOWPACK_ENV__.MODE === 'development';\n}\n\nexport function isMobile() {\n  let check = false;\n  (function(a){if(/(android|bb\\d+|meego).+mobile|avantgo|bada\\/|blackberry|blazer|compal|elaine|fennec|hiptop|iemobile|ip(hone|od)|iris|kindle|lge |maemo|midp|mmp|mobile.+firefox|netfront|opera m(ob|in)i|palm( os)?|phone|p(ixi|re)\\/|plucker|pocket|psp|series(4|6)0|symbian|treo|up\\.(browser|link)|vodafone|wap|windows ce|xda|xiino|android|ipad|playbook|silk/i.test(a)||/1207|6310|6590|3gso|4thp|50[1-6]i|770s|802s|a wa|abac|ac(er|oo|s\\-)|ai(ko|rn)|al(av|ca|co)|amoi|an(ex|ny|yw)|aptu|ar(ch|go)|as(te|us)|attw|au(di|\\-m|r |s )|avan|be(ck|ll|nq)|bi(lb|rd)|bl(ac|az)|br(e|v)w|bumb|bw\\-(n|u)|c55\\/|capi|ccwa|cdm\\-|cell|chtm|cldc|cmd\\-|co(mp|nd)|craw|da(it|ll|ng)|dbte|dc\\-s|devi|dica|dmob|do(c|p)o|ds(12|\\-d)|el(49|ai)|em(l2|ul)|er(ic|k0)|esl8|ez([4-7]0|os|wa|ze)|fetc|fly(\\-|_)|g1 u|g560|gene|gf\\-5|g\\-mo|go(\\.w|od)|gr(ad|un)|haie|hcit|hd\\-(m|p|t)|hei\\-|hi(pt|ta)|hp( i|ip)|hs\\-c|ht(c(\\-| |_|a|g|p|s|t)|tp)|hu(aw|tc)|i\\-(20|go|ma)|i230|iac( |\\-|\\/)|ibro|idea|ig01|ikom|im1k|inno|ipaq|iris|ja(t|v)a|jbro|jemu|jigs|kddi|keji|kgt( |\\/)|klon|kpt |kwc\\-|kyo(c|k)|le(no|xi)|lg( g|\\/(k|l|u)|50|54|\\-[a-w])|libw|lynx|m1\\-w|m3ga|m50\\/|ma(te|ui|xo)|mc(01|21|ca)|m\\-cr|me(rc|ri)|mi(o8|oa|ts)|mmef|mo(01|02|bi|de|do|t(\\-| |o|v)|zz)|mt(50|p1|v )|mwbp|mywa|n10[0-2]|n20[2-3]|n30(0|2)|n50(0|2|5)|n7(0(0|1)|10)|ne((c|m)\\-|on|tf|wf|wg|wt)|nok(6|i)|nzph|o2im|op(ti|wv)|oran|owg1|p800|pan(a|d|t)|pdxg|pg(13|\\-([1-8]|c))|phil|pire|pl(ay|uc)|pn\\-2|po(ck|rt|se)|prox|psio|pt\\-g|qa\\-a|qc(07|12|21|32|60|\\-[2-7]|i\\-)|qtek|r380|r600|raks|rim9|ro(ve|zo)|s55\\/|sa(ge|ma|mm|ms|ny|va)|sc(01|h\\-|oo|p\\-)|sdk\\/|se(c(\\-|0|1)|47|mc|nd|ri)|sgh\\-|shar|sie(\\-|m)|sk\\-0|sl(45|id)|sm(al|ar|b3|it|t5)|so(ft|ny)|sp(01|h\\-|v\\-|v )|sy(01|mb)|t2(18|50)|t6(00|10|18)|ta(gt|lk)|tcl\\-|tdg\\-|tel(i|m)|tim\\-|t\\-mo|to(pl|sh)|ts(70|m\\-|m3|m5)|tx\\-9|up(\\.b|g1|si)|utst|v400|v750|veri|vi(rg|te)|vk(40|5[0-3]|\\-v)|vm40|voda|vulc|vx(52|53|60|61|70|80|81|83|85|98)|w3c(\\-| )|webc|whit|wi(g |nc|nw)|wmlb|wonu|x700|yas\\-|your|zeto|zte\\-/i.test(a.substr(0,4))) check = true;})(navigator.userAgent||navigator.vendor||window.opera);\n  return check;\n};\n", "import { n as noop, s as safe_not_equal, X as subscribe, G as run_all, F as is_function } from './index-c07ea359.js';\n\nconst subscriber_queue = [];\nfunction readable(value, start) {\n  return {\n    subscribe: writable(value, start).subscribe\n  };\n}\nfunction writable(value, start = noop) {\n  let stop;\n  const subscribers = new Set();\n  function set(new_value) {\n    if (safe_not_equal(value, new_value)) {\n      value = new_value;\n      if (stop) {\n        const run_queue = !subscriber_queue.length;\n        for (const subscriber of subscribers) {\n          subscriber[1]();\n          subscriber_queue.push(subscriber, value);\n        }\n        if (run_queue) {\n          for (let i = 0; i < subscriber_queue.length; i += 2) {\n            subscriber_queue[i][0](subscriber_queue[i + 1]);\n          }\n          subscriber_queue.length = 0;\n        }\n      }\n    }\n  }\n  function update(fn) {\n    set(fn(value));\n  }\n  function subscribe2(run, invalidate = noop) {\n    const subscriber = [run, invalidate];\n    subscribers.add(subscriber);\n    if (subscribers.size === 1) {\n      stop = start(set) || noop;\n    }\n    run(value);\n    return () => {\n      subscribers.delete(subscriber);\n      if (subscribers.size === 0 && stop) {\n        stop();\n        stop = null;\n      }\n    };\n  }\n  return {set, update, subscribe: subscribe2};\n}\nfunction derived(stores, fn, initial_value) {\n  const single = !Array.isArray(stores);\n  const stores_array = single ? [stores] : stores;\n  const auto = fn.length < 2;\n  return readable(initial_value, (set) => {\n    let started = false;\n    const values = [];\n    let pending = 0;\n    let cleanup = noop;\n    const sync = () => {\n      if (pending) {\n        return;\n      }\n      cleanup();\n      const result = fn(single ? values[0] : values, set);\n      if (auto) {\n        set(result);\n      } else {\n        cleanup = is_function(result) ? result : noop;\n      }\n    };\n    const unsubscribers = stores_array.map((store, i) => subscribe(store, (value) => {\n      values[i] = value;\n      pending &= ~(1 << i);\n      if (started) {\n        sync();\n      }\n    }, () => {\n      pending |= 1 << i;\n    }));\n    started = true;\n    sync();\n    return function stop() {\n      run_all(unsubscribers);\n      cleanup();\n      started = false;\n    };\n  });\n}\n\nexport { derived as d, writable as w };\n", "import { S as SvelteComponent, i as init, s as safe_not_equal, D as create_slot, J as assign, e as element, K as set_attributes, f as insert, l as listen, A as update_slot_base, B as get_all_dirty_from_scope, C as get_slot_changes, L as get_spread_update, q as transition_in, r as transition_out, g as detach, M as compute_rest_props, N as getContext, O as component_subscribe, c as createEventDispatcher, P as exclude_internal_props, Q as empty, v as group_outros, x as check_outros, a as onDestroy, R as handle_promise, T as update_await_block_branch, n as noop, U as construct_svelte_component, j as create_component, m as mount_component, V as get_spread_object, u as destroy_component, W as setContext, o as onMount } from './common/index-c07ea359.js';\nimport { w as writable, d as derived } from './common/index-110b9d63.js';\n\nconst LOCATION = {};\nconst ROUTER = {};\nconst HISTORY = {};\n\n/**\n * Adapted from https://github.com/reach/router/blob/b60e6dd781d5d3a4bdaaf4de665649c0f6a7e78d/src/lib/utils.js\n * https://github.com/reach/router/blob/master/LICENSE\n */\n\nconst PARAM = /^:(.+)/;\nconst SEGMENT_POINTS = 4;\nconst STATIC_POINTS = 3;\nconst DYNAMIC_POINTS = 2;\nconst SPLAT_PENALTY = 1;\nconst ROOT_POINTS = 1;\n\n/**\n * Split up the URI into segments delimited by `/`\n * Strip starting/ending `/`\n * @param {string} uri\n * @return {string[]}\n */\nconst segmentize = (uri) => uri.replace(/(^\\/+|\\/+$)/g, \"\").split(\"/\");\n/**\n * Strip `str` of potential start and end `/`\n * @param {string} string\n * @return {string}\n */\nconst stripSlashes = (string) => string.replace(/(^\\/+|\\/+$)/g, \"\");\n/**\n * Score a route depending on how its individual segments look\n * @param {object} route\n * @param {number} index\n * @return {object}\n */\nconst rankRoute = (route, index) => {\n    const score = route.default\n        ? 0\n        : segmentize(route.path).reduce((score, segment) => {\n              score += SEGMENT_POINTS;\n\n              if (segment === \"\") {\n                  score += ROOT_POINTS;\n              } else if (PARAM.test(segment)) {\n                  score += DYNAMIC_POINTS;\n              } else if (segment[0] === \"*\") {\n                  score -= SEGMENT_POINTS + SPLAT_PENALTY;\n              } else {\n                  score += STATIC_POINTS;\n              }\n\n              return score;\n          }, 0);\n\n    return { route, score, index };\n};\n/**\n * Give a score to all routes and sort them on that\n * If two routes have the exact same score, we go by index instead\n * @param {object[]} routes\n * @return {object[]}\n */\nconst rankRoutes = (routes) =>\n    routes\n        .map(rankRoute)\n        .sort((a, b) =>\n            a.score < b.score ? 1 : a.score > b.score ? -1 : a.index - b.index\n        );\n/**\n * Ranks and picks the best route to match. Each segment gets the highest\n * amount of points, then the type of segment gets an additional amount of\n * points where\n *\n *  static > dynamic > splat > root\n *\n * This way we don't have to worry about the order of our routes, let the\n * computers do it.\n *\n * A route looks like this\n *\n *  { path, default, value }\n *\n * And a returned match looks like:\n *\n *  { route, params, uri }\n *\n * @param {object[]} routes\n * @param {string} uri\n * @return {?object}\n */\nconst pick = (routes, uri) => {\n    let match;\n    let default_;\n\n    const [uriPathname] = uri.split(\"?\");\n    const uriSegments = segmentize(uriPathname);\n    const isRootUri = uriSegments[0] === \"\";\n    const ranked = rankRoutes(routes);\n\n    for (let i = 0, l = ranked.length; i < l; i++) {\n        const route = ranked[i].route;\n        let missed = false;\n\n        if (route.default) {\n            default_ = {\n                route,\n                params: {},\n                uri,\n            };\n            continue;\n        }\n\n        const routeSegments = segmentize(route.path);\n        const params = {};\n        const max = Math.max(uriSegments.length, routeSegments.length);\n        let index = 0;\n\n        for (; index < max; index++) {\n            const routeSegment = routeSegments[index];\n            const uriSegment = uriSegments[index];\n\n            if (routeSegment && routeSegment[0] === \"*\") {\n                // Hit a splat, just grab the rest, and return a match\n                // uri:   /files/documents/work\n                // route: /files/* or /files/*splatname\n                const splatName =\n                    routeSegment === \"*\" ? \"*\" : routeSegment.slice(1);\n\n                params[splatName] = uriSegments\n                    .slice(index)\n                    .map(decodeURIComponent)\n                    .join(\"/\");\n                break;\n            }\n\n            if (typeof uriSegment === \"undefined\") {\n                // URI is shorter than the route, no match\n                // uri:   /users\n                // route: /users/:userId\n                missed = true;\n                break;\n            }\n\n            const dynamicMatch = PARAM.exec(routeSegment);\n\n            if (dynamicMatch && !isRootUri) {\n                const value = decodeURIComponent(uriSegment);\n                params[dynamicMatch[1]] = value;\n            } else if (routeSegment !== uriSegment) {\n                // Current segments don't match, not dynamic, not splat, so no match\n                // uri:   /users/123/settings\n                // route: /users/:id/profile\n                missed = true;\n                break;\n            }\n        }\n\n        if (!missed) {\n            match = {\n                route,\n                params,\n                uri: \"/\" + uriSegments.slice(0, index).join(\"/\"),\n            };\n            break;\n        }\n    }\n\n    return match || default_ || null;\n};\n/**\n * Add the query to the pathname if a query is given\n * @param {string} pathname\n * @param {string} [query]\n * @return {string}\n */\nconst addQuery = (pathname, query) => pathname + (query ? `?${query}` : \"\");\n/**\n * Resolve URIs as though every path is a directory, no files. Relative URIs\n * in the browser can feel awkward because not only can you be \"in a directory\",\n * you can be \"at a file\", too. For example:\n *\n *  browserSpecResolve('foo', '/bar/') => /bar/foo\n *  browserSpecResolve('foo', '/bar') => /foo\n *\n * But on the command line of a file system, it's not as complicated. You can't\n * `cd` from a file, only directories. This way, links have to know less about\n * their current path. To go deeper you can do this:\n *\n *  <Link to=\"deeper\"/>\n *  // instead of\n *  <Link to=`{${props.uri}/deeper}`/>\n *\n * Just like `cd`, if you want to go deeper from the command line, you do this:\n *\n *  cd deeper\n *  # not\n *  cd $(pwd)/deeper\n *\n * By treating every path as a directory, linking to relative paths should\n * require less contextual information and (fingers crossed) be more intuitive.\n * @param {string} to\n * @param {string} base\n * @return {string}\n */\nconst resolve = (to, base) => {\n    // /foo/bar, /baz/qux => /foo/bar\n    if (to.startsWith(\"/\")) return to;\n\n    const [toPathname, toQuery] = to.split(\"?\");\n    const [basePathname] = base.split(\"?\");\n    const toSegments = segmentize(toPathname);\n    const baseSegments = segmentize(basePathname);\n\n    // ?a=b, /users?b=c => /users?a=b\n    if (toSegments[0] === \"\") return addQuery(basePathname, toQuery);\n\n    // profile, /users/789 => /users/789/profile\n\n    if (!toSegments[0].startsWith(\".\")) {\n        const pathname = baseSegments.concat(toSegments).join(\"/\");\n        return addQuery((basePathname === \"/\" ? \"\" : \"/\") + pathname, toQuery);\n    }\n\n    // ./       , /users/123 => /users/123\n    // ../      , /users/123 => /users\n    // ../..    , /users/123 => /\n    // ../../one, /a/b/c/d   => /a/b/one\n    // .././one , /a/b/c/d   => /a/b/c/one\n    const allSegments = baseSegments.concat(toSegments);\n    const segments = [];\n\n    allSegments.forEach((segment) => {\n        if (segment === \"..\") segments.pop();\n        else if (segment !== \".\") segments.push(segment);\n    });\n\n    return addQuery(\"/\" + segments.join(\"/\"), toQuery);\n};\n/**\n * Combines the `basepath` and the `path` into one path.\n * @param {string} basepath\n * @param {string} path\n */\nconst combinePaths = (basepath, path) =>\n    `${stripSlashes(\n        path === \"/\"\n            ? basepath\n            : `${stripSlashes(basepath)}/${stripSlashes(path)}`\n    )}/`;\n/**\n * Decides whether a given `event` should result in a navigation or not.\n * @param {object} event\n */\nconst shouldNavigate = (event) =>\n    !event.defaultPrevented &&\n    event.button === 0 &&\n    !(event.metaKey || event.altKey || event.ctrlKey || event.shiftKey);\n\nconst canUseDOM = () =>\n    typeof window !== \"undefined\" &&\n    \"document\" in window &&\n    \"location\" in window;\n\n/* node_modules/svelte-routing/src/Link.svelte generated by Svelte v3.59.2 */\nconst get_default_slot_changes = dirty => ({ active: dirty & /*ariaCurrent*/ 4 });\nconst get_default_slot_context = ctx => ({ active: !!/*ariaCurrent*/ ctx[2] });\n\nfunction create_fragment(ctx) {\n\tlet a;\n\tlet current;\n\tlet mounted;\n\tlet dispose;\n\tconst default_slot_template = /*#slots*/ ctx[16].default;\n\tconst default_slot = create_slot(default_slot_template, ctx, /*$$scope*/ ctx[15], get_default_slot_context);\n\n\tlet a_levels = [\n\t\t{ href: /*href*/ ctx[0] },\n\t\t{ \"aria-current\": /*ariaCurrent*/ ctx[2] },\n\t\t/*props*/ ctx[1],\n\t\t/*$$restProps*/ ctx[6]\n\t];\n\n\tlet a_data = {};\n\n\tfor (let i = 0; i < a_levels.length; i += 1) {\n\t\ta_data = assign(a_data, a_levels[i]);\n\t}\n\n\treturn {\n\t\tc() {\n\t\t\ta = element(\"a\");\n\t\t\tif (default_slot) default_slot.c();\n\t\t\tset_attributes(a, a_data);\n\t\t},\n\t\tm(target, anchor) {\n\t\t\tinsert(target, a, anchor);\n\n\t\t\tif (default_slot) {\n\t\t\t\tdefault_slot.m(a, null);\n\t\t\t}\n\n\t\t\tcurrent = true;\n\n\t\t\tif (!mounted) {\n\t\t\t\tdispose = listen(a, \"click\", /*onClick*/ ctx[5]);\n\t\t\t\tmounted = true;\n\t\t\t}\n\t\t},\n\t\tp(ctx, [dirty]) {\n\t\t\tif (default_slot) {\n\t\t\t\tif (default_slot.p && (!current || dirty & /*$$scope, ariaCurrent*/ 32772)) {\n\t\t\t\t\tupdate_slot_base(\n\t\t\t\t\t\tdefault_slot,\n\t\t\t\t\t\tdefault_slot_template,\n\t\t\t\t\t\tctx,\n\t\t\t\t\t\t/*$$scope*/ ctx[15],\n\t\t\t\t\t\t!current\n\t\t\t\t\t\t? get_all_dirty_from_scope(/*$$scope*/ ctx[15])\n\t\t\t\t\t\t: get_slot_changes(default_slot_template, /*$$scope*/ ctx[15], dirty, get_default_slot_changes),\n\t\t\t\t\t\tget_default_slot_context\n\t\t\t\t\t);\n\t\t\t\t}\n\t\t\t}\n\n\t\t\tset_attributes(a, a_data = get_spread_update(a_levels, [\n\t\t\t\t(!current || dirty & /*href*/ 1) && { href: /*href*/ ctx[0] },\n\t\t\t\t(!current || dirty & /*ariaCurrent*/ 4) && { \"aria-current\": /*ariaCurrent*/ ctx[2] },\n\t\t\t\tdirty & /*props*/ 2 && /*props*/ ctx[1],\n\t\t\t\tdirty & /*$$restProps*/ 64 && /*$$restProps*/ ctx[6]\n\t\t\t]));\n\t\t},\n\t\ti(local) {\n\t\t\tif (current) return;\n\t\t\ttransition_in(default_slot, local);\n\t\t\tcurrent = true;\n\t\t},\n\t\to(local) {\n\t\t\ttransition_out(default_slot, local);\n\t\t\tcurrent = false;\n\t\t},\n\t\td(detaching) {\n\t\t\tif (detaching) detach(a);\n\t\t\tif (default_slot) default_slot.d(detaching);\n\t\t\tmounted = false;\n\t\t\tdispose();\n\t\t}\n\t};\n}\n\nfunction instance($$self, $$props, $$invalidate) {\n\tlet ariaCurrent;\n\tconst omit_props_names = [\"to\",\"replace\",\"state\",\"getProps\"];\n\tlet $$restProps = compute_rest_props($$props, omit_props_names);\n\tlet $location;\n\tlet $base;\n\tlet { $$slots: slots = {}, $$scope } = $$props;\n\tlet { to = \"#\" } = $$props;\n\tlet { replace = false } = $$props;\n\tlet { state = {} } = $$props;\n\tlet { getProps = () => ({}) } = $$props;\n\tconst location = getContext(LOCATION);\n\tcomponent_subscribe($$self, location, value => $$invalidate(13, $location = value));\n\tconst { base } = getContext(ROUTER);\n\tcomponent_subscribe($$self, base, value => $$invalidate(14, $base = value));\n\tconst { navigate } = getContext(HISTORY);\n\tconst dispatch = createEventDispatcher();\n\tlet href, isPartiallyCurrent, isCurrent, props;\n\n\tconst onClick = event => {\n\t\tdispatch(\"click\", event);\n\n\t\tif (shouldNavigate(event)) {\n\t\t\tevent.preventDefault();\n\n\t\t\t// Don't push another entry to the history stack when the user\n\t\t\t// clicks on a Link to the page they are currently on.\n\t\t\tconst shouldReplace = $location.pathname === href || replace;\n\n\t\t\tnavigate(href, { state, replace: shouldReplace });\n\t\t}\n\t};\n\n\t$$self.$$set = $$new_props => {\n\t\t$$props = assign(assign({}, $$props), exclude_internal_props($$new_props));\n\t\t$$invalidate(6, $$restProps = compute_rest_props($$props, omit_props_names));\n\t\tif ('to' in $$new_props) $$invalidate(7, to = $$new_props.to);\n\t\tif ('replace' in $$new_props) $$invalidate(8, replace = $$new_props.replace);\n\t\tif ('state' in $$new_props) $$invalidate(9, state = $$new_props.state);\n\t\tif ('getProps' in $$new_props) $$invalidate(10, getProps = $$new_props.getProps);\n\t\tif ('$$scope' in $$new_props) $$invalidate(15, $$scope = $$new_props.$$scope);\n\t};\n\n\t$$self.$$.update = () => {\n\t\tif ($$self.$$.dirty & /*to, $base*/ 16512) {\n\t\t\t $$invalidate(0, href = to === \"/\" ? $base.uri : resolve(to, $base.uri));\n\t\t}\n\n\t\tif ($$self.$$.dirty & /*$location, href*/ 8193) {\n\t\t\t $$invalidate(11, isPartiallyCurrent = $location.pathname.startsWith(href));\n\t\t}\n\n\t\tif ($$self.$$.dirty & /*href, $location*/ 8193) {\n\t\t\t $$invalidate(12, isCurrent = href === $location.pathname);\n\t\t}\n\n\t\tif ($$self.$$.dirty & /*isCurrent*/ 4096) {\n\t\t\t $$invalidate(2, ariaCurrent = isCurrent ? \"page\" : undefined);\n\t\t}\n\n\t\t $$invalidate(1, props = getProps({\n\t\t\tlocation: $location,\n\t\t\thref,\n\t\t\tisPartiallyCurrent,\n\t\t\tisCurrent,\n\t\t\texistingProps: $$restProps\n\t\t}));\n\t};\n\n\treturn [\n\t\thref,\n\t\tprops,\n\t\tariaCurrent,\n\t\tlocation,\n\t\tbase,\n\t\tonClick,\n\t\t$$restProps,\n\t\tto,\n\t\treplace,\n\t\tstate,\n\t\tgetProps,\n\t\tisPartiallyCurrent,\n\t\tisCurrent,\n\t\t$location,\n\t\t$base,\n\t\t$$scope,\n\t\tslots\n\t];\n}\n\nclass Link extends SvelteComponent {\n\tconstructor(options) {\n\t\tsuper();\n\n\t\tinit(this, options, instance, create_fragment, safe_not_equal, {\n\t\t\tto: 7,\n\t\t\treplace: 8,\n\t\t\tstate: 9,\n\t\t\tgetProps: 10\n\t\t});\n\t}\n}\n\n/* node_modules/svelte-routing/src/Route.svelte generated by Svelte v3.59.2 */\nconst get_default_slot_changes$1 = dirty => ({ params: dirty & /*routeParams*/ 4 });\nconst get_default_slot_context$1 = ctx => ({ params: /*routeParams*/ ctx[2] });\n\n// (42:0) {#if $activeRoute && $activeRoute.route === route}\nfunction create_if_block(ctx) {\n\tlet current_block_type_index;\n\tlet if_block;\n\tlet if_block_anchor;\n\tlet current;\n\tconst if_block_creators = [create_if_block_1, create_else_block];\n\tconst if_blocks = [];\n\n\tfunction select_block_type(ctx, dirty) {\n\t\tif (/*component*/ ctx[0]) return 0;\n\t\treturn 1;\n\t}\n\n\tcurrent_block_type_index = select_block_type(ctx);\n\tif_block = if_blocks[current_block_type_index] = if_block_creators[current_block_type_index](ctx);\n\n\treturn {\n\t\tc() {\n\t\t\tif_block.c();\n\t\t\tif_block_anchor = empty();\n\t\t},\n\t\tm(target, anchor) {\n\t\t\tif_blocks[current_block_type_index].m(target, anchor);\n\t\t\tinsert(target, if_block_anchor, anchor);\n\t\t\tcurrent = true;\n\t\t},\n\t\tp(ctx, dirty) {\n\t\t\tlet previous_block_index = current_block_type_index;\n\t\t\tcurrent_block_type_index = select_block_type(ctx);\n\n\t\t\tif (current_block_type_index === previous_block_index) {\n\t\t\t\tif_blocks[current_block_type_index].p(ctx, dirty);\n\t\t\t} else {\n\t\t\t\tgroup_outros();\n\n\t\t\t\ttransition_out(if_blocks[previous_block_index], 1, 1, () => {\n\t\t\t\t\tif_blocks[previous_block_index] = null;\n\t\t\t\t});\n\n\t\t\t\tcheck_outros();\n\t\t\t\tif_block = if_blocks[current_block_type_index];\n\n\t\t\t\tif (!if_block) {\n\t\t\t\t\tif_block = if_blocks[current_block_type_index] = if_block_creators[current_block_type_index](ctx);\n\t\t\t\t\tif_block.c();\n\t\t\t\t} else {\n\t\t\t\t\tif_block.p(ctx, dirty);\n\t\t\t\t}\n\n\t\t\t\ttransition_in(if_block, 1);\n\t\t\t\tif_block.m(if_block_anchor.parentNode, if_block_anchor);\n\t\t\t}\n\t\t},\n\t\ti(local) {\n\t\t\tif (current) return;\n\t\t\ttransition_in(if_block);\n\t\t\tcurrent = true;\n\t\t},\n\t\to(local) {\n\t\t\ttransition_out(if_block);\n\t\t\tcurrent = false;\n\t\t},\n\t\td(detaching) {\n\t\t\tif_blocks[current_block_type_index].d(detaching);\n\t\t\tif (detaching) detach(if_block_anchor);\n\t\t}\n\t};\n}\n\n// (51:4) {:else}\nfunction create_else_block(ctx) {\n\tlet current;\n\tconst default_slot_template = /*#slots*/ ctx[8].default;\n\tconst default_slot = create_slot(default_slot_template, ctx, /*$$scope*/ ctx[7], get_default_slot_context$1);\n\n\treturn {\n\t\tc() {\n\t\t\tif (default_slot) default_slot.c();\n\t\t},\n\t\tm(target, anchor) {\n\t\t\tif (default_slot) {\n\t\t\t\tdefault_slot.m(target, anchor);\n\t\t\t}\n\n\t\t\tcurrent = true;\n\t\t},\n\t\tp(ctx, dirty) {\n\t\t\tif (default_slot) {\n\t\t\t\tif (default_slot.p && (!current || dirty & /*$$scope, routeParams*/ 132)) {\n\t\t\t\t\tupdate_slot_base(\n\t\t\t\t\t\tdefault_slot,\n\t\t\t\t\t\tdefault_slot_template,\n\t\t\t\t\t\tctx,\n\t\t\t\t\t\t/*$$scope*/ ctx[7],\n\t\t\t\t\t\t!current\n\t\t\t\t\t\t? get_all_dirty_from_scope(/*$$scope*/ ctx[7])\n\t\t\t\t\t\t: get_slot_changes(default_slot_template, /*$$scope*/ ctx[7], dirty, get_default_slot_changes$1),\n\t\t\t\t\t\tget_default_slot_context$1\n\t\t\t\t\t);\n\t\t\t\t}\n\t\t\t}\n\t\t},\n\t\ti(local) {\n\t\t\tif (current) return;\n\t\t\ttransition_in(default_slot, local);\n\t\t\tcurrent = true;\n\t\t},\n\t\to(local) {\n\t\t\ttransition_out(default_slot, local);\n\t\t\tcurrent = false;\n\t\t},\n\t\td(detaching) {\n\t\t\tif (default_slot) default_slot.d(detaching);\n\t\t}\n\t};\n}\n\n// (43:4) {#if component}\nfunction create_if_block_1(ctx) {\n\tlet await_block_anchor;\n\tlet promise;\n\tlet current;\n\n\tlet info = {\n\t\tctx,\n\t\tcurrent: null,\n\t\ttoken: null,\n\t\thasCatch: false,\n\t\tpending: create_pending_block,\n\t\tthen: create_then_block,\n\t\tcatch: create_catch_block,\n\t\tvalue: 12,\n\t\tblocks: [,,,]\n\t};\n\n\thandle_promise(promise = /*component*/ ctx[0], info);\n\n\treturn {\n\t\tc() {\n\t\t\tawait_block_anchor = empty();\n\t\t\tinfo.block.c();\n\t\t},\n\t\tm(target, anchor) {\n\t\t\tinsert(target, await_block_anchor, anchor);\n\t\t\tinfo.block.m(target, info.anchor = anchor);\n\t\t\tinfo.mount = () => await_block_anchor.parentNode;\n\t\t\tinfo.anchor = await_block_anchor;\n\t\t\tcurrent = true;\n\t\t},\n\t\tp(new_ctx, dirty) {\n\t\t\tctx = new_ctx;\n\t\t\tinfo.ctx = ctx;\n\n\t\t\tif (dirty & /*component*/ 1 && promise !== (promise = /*component*/ ctx[0]) && handle_promise(promise, info)) ; else {\n\t\t\t\tupdate_await_block_branch(info, ctx, dirty);\n\t\t\t}\n\t\t},\n\t\ti(local) {\n\t\t\tif (current) return;\n\t\t\ttransition_in(info.block);\n\t\t\tcurrent = true;\n\t\t},\n\t\to(local) {\n\t\t\tfor (let i = 0; i < 3; i += 1) {\n\t\t\t\tconst block = info.blocks[i];\n\t\t\t\ttransition_out(block);\n\t\t\t}\n\n\t\t\tcurrent = false;\n\t\t},\n\t\td(detaching) {\n\t\t\tif (detaching) detach(await_block_anchor);\n\t\t\tinfo.block.d(detaching);\n\t\t\tinfo.token = null;\n\t\t\tinfo = null;\n\t\t}\n\t};\n}\n\n// (1:0) <script>     import { getContext, onDestroy }\nfunction create_catch_block(ctx) {\n\treturn {\n\t\tc: noop,\n\t\tm: noop,\n\t\tp: noop,\n\t\ti: noop,\n\t\to: noop,\n\t\td: noop\n\t};\n}\n\n// (44:49)              <svelte:component                 this={resolvedComponent?.default || resolvedComponent}\nfunction create_then_block(ctx) {\n\tlet switch_instance;\n\tlet switch_instance_anchor;\n\tlet current;\n\tconst switch_instance_spread_levels = [/*routeParams*/ ctx[2], /*routeProps*/ ctx[3]];\n\tvar switch_value = /*resolvedComponent*/ ctx[12]?.default || /*resolvedComponent*/ ctx[12];\n\n\tfunction switch_props(ctx) {\n\t\tlet switch_instance_props = {};\n\n\t\tfor (let i = 0; i < switch_instance_spread_levels.length; i += 1) {\n\t\t\tswitch_instance_props = assign(switch_instance_props, switch_instance_spread_levels[i]);\n\t\t}\n\n\t\treturn { props: switch_instance_props };\n\t}\n\n\tif (switch_value) {\n\t\tswitch_instance = construct_svelte_component(switch_value, switch_props());\n\t}\n\n\treturn {\n\t\tc() {\n\t\t\tif (switch_instance) create_component(switch_instance.$$.fragment);\n\t\t\tswitch_instance_anchor = empty();\n\t\t},\n\t\tm(target, anchor) {\n\t\t\tif (switch_instance) mount_component(switch_instance, target, anchor);\n\t\t\tinsert(target, switch_instance_anchor, anchor);\n\t\t\tcurrent = true;\n\t\t},\n\t\tp(ctx, dirty) {\n\t\t\tconst switch_instance_changes = (dirty & /*routeParams, routeProps*/ 12)\n\t\t\t? get_spread_update(switch_instance_spread_levels, [\n\t\t\t\t\tdirty & /*routeParams*/ 4 && get_spread_object(/*routeParams*/ ctx[2]),\n\t\t\t\t\tdirty & /*routeProps*/ 8 && get_spread_object(/*routeProps*/ ctx[3])\n\t\t\t\t])\n\t\t\t: {};\n\n\t\t\tif (dirty & /*component*/ 1 && switch_value !== (switch_value = /*resolvedComponent*/ ctx[12]?.default || /*resolvedComponent*/ ctx[12])) {\n\t\t\t\tif (switch_instance) {\n\t\t\t\t\tgroup_outros();\n\t\t\t\t\tconst old_component = switch_instance;\n\n\t\t\t\t\ttransition_out(old_component.$$.fragment, 1, 0, () => {\n\t\t\t\t\t\tdestroy_component(old_component, 1);\n\t\t\t\t\t});\n\n\t\t\t\t\tcheck_outros();\n\t\t\t\t}\n\n\t\t\t\tif (switch_value) {\n\t\t\t\t\tswitch_instance = construct_svelte_component(switch_value, switch_props());\n\t\t\t\t\tcreate_component(switch_instance.$$.fragment);\n\t\t\t\t\ttransition_in(switch_instance.$$.fragment, 1);\n\t\t\t\t\tmount_component(switch_instance, switch_instance_anchor.parentNode, switch_instance_anchor);\n\t\t\t\t} else {\n\t\t\t\t\tswitch_instance = null;\n\t\t\t\t}\n\t\t\t} else if (switch_value) {\n\t\t\t\tswitch_instance.$set(switch_instance_changes);\n\t\t\t}\n\t\t},\n\t\ti(local) {\n\t\t\tif (current) return;\n\t\t\tif (switch_instance) transition_in(switch_instance.$$.fragment, local);\n\t\t\tcurrent = true;\n\t\t},\n\t\to(local) {\n\t\t\tif (switch_instance) transition_out(switch_instance.$$.fragment, local);\n\t\t\tcurrent = false;\n\t\t},\n\t\td(detaching) {\n\t\t\tif (detaching) detach(switch_instance_anchor);\n\t\t\tif (switch_instance) destroy_component(switch_instance, detaching);\n\t\t}\n\t};\n}\n\n// (1:0) <script>     import { getContext, onDestroy }\nfunction create_pending_block(ctx) {\n\treturn {\n\t\tc: noop,\n\t\tm: noop,\n\t\tp: noop,\n\t\ti: noop,\n\t\to: noop,\n\t\td: noop\n\t};\n}\n\nfunction create_fragment$1(ctx) {\n\tlet if_block_anchor;\n\tlet current;\n\tlet if_block = /*$activeRoute*/ ctx[1] && /*$activeRoute*/ ctx[1].route === /*route*/ ctx[5] && create_if_block(ctx);\n\n\treturn {\n\t\tc() {\n\t\t\tif (if_block) if_block.c();\n\t\t\tif_block_anchor = empty();\n\t\t},\n\t\tm(target, anchor) {\n\t\t\tif (if_block) if_block.m(target, anchor);\n\t\t\tinsert(target, if_block_anchor, anchor);\n\t\t\tcurrent = true;\n\t\t},\n\t\tp(ctx, [dirty]) {\n\t\t\tif (/*$activeRoute*/ ctx[1] && /*$activeRoute*/ ctx[1].route === /*route*/ ctx[5]) {\n\t\t\t\tif (if_block) {\n\t\t\t\t\tif_block.p(ctx, dirty);\n\n\t\t\t\t\tif (dirty & /*$activeRoute*/ 2) {\n\t\t\t\t\t\ttransition_in(if_block, 1);\n\t\t\t\t\t}\n\t\t\t\t} else {\n\t\t\t\t\tif_block = create_if_block(ctx);\n\t\t\t\t\tif_block.c();\n\t\t\t\t\ttransition_in(if_block, 1);\n\t\t\t\t\tif_block.m(if_block_anchor.parentNode, if_block_anchor);\n\t\t\t\t}\n\t\t\t} else if (if_block) {\n\t\t\t\tgroup_outros();\n\n\t\t\t\ttransition_out(if_block, 1, 1, () => {\n\t\t\t\t\tif_block = null;\n\t\t\t\t});\n\n\t\t\t\tcheck_outros();\n\t\t\t}\n\t\t},\n\t\ti(local) {\n\t\t\tif (current) return;\n\t\t\ttransition_in(if_block);\n\t\t\tcurrent = true;\n\t\t},\n\t\to(local) {\n\t\t\ttransition_out(if_block);\n\t\t\tcurrent = false;\n\t\t},\n\t\td(detaching) {\n\t\t\tif (if_block) if_block.d(detaching);\n\t\t\tif (detaching) detach(if_block_anchor);\n\t\t}\n\t};\n}\n\nfunction instance$1($$self, $$props, $$invalidate) {\n\tlet $activeRoute;\n\tlet { $$slots: slots = {}, $$scope } = $$props;\n\tlet { path = \"\" } = $$props;\n\tlet { component = null } = $$props;\n\tlet routeParams = {};\n\tlet routeProps = {};\n\tconst { registerRoute, unregisterRoute, activeRoute } = getContext(ROUTER);\n\tcomponent_subscribe($$self, activeRoute, value => $$invalidate(1, $activeRoute = value));\n\n\tconst route = {\n\t\tpath,\n\t\t// If no path prop is given, this Route will act as the default Route\n\t\t// that is rendered if no other Route in the Router is a match.\n\t\tdefault: path === \"\"\n\t};\n\n\tregisterRoute(route);\n\n\tonDestroy(() => {\n\t\tunregisterRoute(route);\n\t});\n\n\t$$self.$$set = $$new_props => {\n\t\t$$invalidate(11, $$props = assign(assign({}, $$props), exclude_internal_props($$new_props)));\n\t\tif ('path' in $$new_props) $$invalidate(6, path = $$new_props.path);\n\t\tif ('component' in $$new_props) $$invalidate(0, component = $$new_props.component);\n\t\tif ('$$scope' in $$new_props) $$invalidate(7, $$scope = $$new_props.$$scope);\n\t};\n\n\t$$self.$$.update = () => {\n\t\t if ($activeRoute && $activeRoute.route === route) {\n\t\t\t$$invalidate(2, routeParams = $activeRoute.params);\n\t\t\tconst { component: c, path, ...rest } = $$props;\n\t\t\t$$invalidate(3, routeProps = rest);\n\n\t\t\tif (c) {\n\t\t\t\tif (c.toString().startsWith(\"class \")) $$invalidate(0, component = c); else $$invalidate(0, component = c());\n\t\t\t}\n\n\t\t\tcanUseDOM() && window?.scrollTo(0, 0);\n\t\t}\n\t};\n\n\t$$props = exclude_internal_props($$props);\n\n\treturn [\n\t\tcomponent,\n\t\t$activeRoute,\n\t\trouteParams,\n\t\trouteProps,\n\t\tactiveRoute,\n\t\troute,\n\t\tpath,\n\t\t$$scope,\n\t\tslots\n\t];\n}\n\nclass Route extends SvelteComponent {\n\tconstructor(options) {\n\t\tsuper();\n\t\tinit(this, options, instance$1, create_fragment$1, safe_not_equal, { path: 6, component: 0 });\n\t}\n}\n\n/**\n * Adapted from https://github.com/reach/router/blob/b60e6dd781d5d3a4bdaaf4de665649c0f6a7e78d/src/lib/history.js\n * https://github.com/reach/router/blob/master/LICENSE\n */\n\nconst getLocation = (source) => {\n    return {\n        ...source.location,\n        state: source.history.state,\n        key: (source.history.state && source.history.state.key) || \"initial\",\n    };\n};\nconst createHistory = (source) => {\n    const listeners = [];\n    let location = getLocation(source);\n\n    return {\n        get location() {\n            return location;\n        },\n\n        listen(listener) {\n            listeners.push(listener);\n\n            const popstateListener = () => {\n                location = getLocation(source);\n                listener({ location, action: \"POP\" });\n            };\n\n            source.addEventListener(\"popstate\", popstateListener);\n\n            return () => {\n                source.removeEventListener(\"popstate\", popstateListener);\n                const index = listeners.indexOf(listener);\n                listeners.splice(index, 1);\n            };\n        },\n\n        navigate(to, { state, replace = false } = {}) {\n            state = { ...state, key: Date.now() + \"\" };\n            // try...catch iOS Safari limits to 100 pushState calls\n            try {\n                if (replace) source.history.replaceState(state, \"\", to);\n                else source.history.pushState(state, \"\", to);\n            } catch (e) {\n                source.location[replace ? \"replace\" : \"assign\"](to);\n            }\n            location = getLocation(source);\n            listeners.forEach((listener) =>\n                listener({ location, action: \"PUSH\" })\n            );\n            document.activeElement.blur();\n        },\n    };\n};\n// Stores history entries in memory for testing or other platforms like Native\nconst createMemorySource = (initialPathname = \"/\") => {\n    let index = 0;\n    const stack = [{ pathname: initialPathname, search: \"\" }];\n    const states = [];\n\n    return {\n        get location() {\n            return stack[index];\n        },\n        addEventListener(name, fn) {},\n        removeEventListener(name, fn) {},\n        history: {\n            get entries() {\n                return stack;\n            },\n            get index() {\n                return index;\n            },\n            get state() {\n                return states[index];\n            },\n            pushState(state, _, uri) {\n                const [pathname, search = \"\"] = uri.split(\"?\");\n                index++;\n                stack.push({ pathname, search });\n                states.push(state);\n            },\n            replaceState(state, _, uri) {\n                const [pathname, search = \"\"] = uri.split(\"?\");\n                stack[index] = { pathname, search };\n                states[index] = state;\n            },\n        },\n    };\n};\n// Global history uses window.history as the source if available,\n// otherwise a memory history\nconst globalHistory = createHistory(\n    canUseDOM() ? window : createMemorySource()\n);\nconst { navigate } = globalHistory;\n\n/* node_modules/svelte-routing/src/Router.svelte generated by Svelte v3.59.2 */\n\nconst get_default_slot_changes$2 = dirty => ({\n\troute: dirty & /*$activeRoute*/ 2,\n\tlocation: dirty & /*$location*/ 1\n});\n\nconst get_default_slot_context$2 = ctx => ({\n\troute: /*$activeRoute*/ ctx[1] && /*$activeRoute*/ ctx[1].uri,\n\tlocation: /*$location*/ ctx[0]\n});\n\nfunction create_fragment$2(ctx) {\n\tlet current;\n\tconst default_slot_template = /*#slots*/ ctx[12].default;\n\tconst default_slot = create_slot(default_slot_template, ctx, /*$$scope*/ ctx[11], get_default_slot_context$2);\n\n\treturn {\n\t\tc() {\n\t\t\tif (default_slot) default_slot.c();\n\t\t},\n\t\tm(target, anchor) {\n\t\t\tif (default_slot) {\n\t\t\t\tdefault_slot.m(target, anchor);\n\t\t\t}\n\n\t\t\tcurrent = true;\n\t\t},\n\t\tp(ctx, [dirty]) {\n\t\t\tif (default_slot) {\n\t\t\t\tif (default_slot.p && (!current || dirty & /*$$scope, $activeRoute, $location*/ 2051)) {\n\t\t\t\t\tupdate_slot_base(\n\t\t\t\t\t\tdefault_slot,\n\t\t\t\t\t\tdefault_slot_template,\n\t\t\t\t\t\tctx,\n\t\t\t\t\t\t/*$$scope*/ ctx[11],\n\t\t\t\t\t\t!current\n\t\t\t\t\t\t? get_all_dirty_from_scope(/*$$scope*/ ctx[11])\n\t\t\t\t\t\t: get_slot_changes(default_slot_template, /*$$scope*/ ctx[11], dirty, get_default_slot_changes$2),\n\t\t\t\t\t\tget_default_slot_context$2\n\t\t\t\t\t);\n\t\t\t\t}\n\t\t\t}\n\t\t},\n\t\ti(local) {\n\t\t\tif (current) return;\n\t\t\ttransition_in(default_slot, local);\n\t\t\tcurrent = true;\n\t\t},\n\t\to(local) {\n\t\t\ttransition_out(default_slot, local);\n\t\t\tcurrent = false;\n\t\t},\n\t\td(detaching) {\n\t\t\tif (default_slot) default_slot.d(detaching);\n\t\t}\n\t};\n}\n\nfunction instance$2($$self, $$props, $$invalidate) {\n\tlet $location;\n\tlet $routes;\n\tlet $base;\n\tlet $activeRoute;\n\tlet { $$slots: slots = {}, $$scope } = $$props;\n\tlet { basepath = \"/\" } = $$props;\n\tlet { url = null } = $$props;\n\tlet { history = globalHistory } = $$props;\n\tsetContext(HISTORY, history);\n\tconst locationContext = getContext(LOCATION);\n\tconst routerContext = getContext(ROUTER);\n\tconst routes = writable([]);\n\tcomponent_subscribe($$self, routes, value => $$invalidate(9, $routes = value));\n\tconst activeRoute = writable(null);\n\tcomponent_subscribe($$self, activeRoute, value => $$invalidate(1, $activeRoute = value));\n\tlet hasActiveRoute = false; // Used in SSR to synchronously set that a Route is active.\n\n\t// If locationContext is not set, this is the topmost Router in the tree.\n\t// If the `url` prop is given we force the location to it.\n\tconst location = locationContext || writable(url ? { pathname: url } : history.location);\n\n\tcomponent_subscribe($$self, location, value => $$invalidate(0, $location = value));\n\n\t// If routerContext is set, the routerBase of the parent Router\n\t// will be the base for this Router's descendants.\n\t// If routerContext is not set, the path and resolved uri will both\n\t// have the value of the basepath prop.\n\tconst base = routerContext\n\t? routerContext.routerBase\n\t: writable({ path: basepath, uri: basepath });\n\n\tcomponent_subscribe($$self, base, value => $$invalidate(10, $base = value));\n\n\tconst routerBase = derived([base, activeRoute], ([base, activeRoute]) => {\n\t\t// If there is no activeRoute, the routerBase will be identical to the base.\n\t\tif (!activeRoute) return base;\n\n\t\tconst { path: basepath } = base;\n\t\tconst { route, uri } = activeRoute;\n\n\t\t// Remove the potential /* or /*splatname from\n\t\t// the end of the child Routes relative paths.\n\t\tconst path = route.default\n\t\t? basepath\n\t\t: route.path.replace(/\\*.*$/, \"\");\n\n\t\treturn { path, uri };\n\t});\n\n\tconst registerRoute = route => {\n\t\tconst { path: basepath } = $base;\n\t\tlet { path } = route;\n\n\t\t// We store the original path in the _path property so we can reuse\n\t\t// it when the basepath changes. The only thing that matters is that\n\t\t// the route reference is intact, so mutation is fine.\n\t\troute._path = path;\n\n\t\troute.path = combinePaths(basepath, path);\n\n\t\tif (typeof window === \"undefined\") {\n\t\t\t// In SSR we should set the activeRoute immediately if it is a match.\n\t\t\t// If there are more Routes being registered after a match is found,\n\t\t\t// we just skip them.\n\t\t\tif (hasActiveRoute) return;\n\n\t\t\tconst matchingRoute = pick([route], $location.pathname);\n\n\t\t\tif (matchingRoute) {\n\t\t\t\tactiveRoute.set(matchingRoute);\n\t\t\t\thasActiveRoute = true;\n\t\t\t}\n\t\t} else {\n\t\t\troutes.update(rs => [...rs, route]);\n\t\t}\n\t};\n\n\tconst unregisterRoute = route => {\n\t\troutes.update(rs => rs.filter(r => r !== route));\n\t};\n\n\tif (!locationContext) {\n\t\t// The topmost Router in the tree is responsible for updating\n\t\t// the location store and supplying it through context.\n\t\tonMount(() => {\n\t\t\tconst unlisten = history.listen(event => {\n\t\t\t\tlocation.set(event.location);\n\t\t\t});\n\n\t\t\treturn unlisten;\n\t\t});\n\n\t\tsetContext(LOCATION, location);\n\t}\n\n\tsetContext(ROUTER, {\n\t\tactiveRoute,\n\t\tbase,\n\t\trouterBase,\n\t\tregisterRoute,\n\t\tunregisterRoute\n\t});\n\n\t$$self.$$set = $$props => {\n\t\tif ('basepath' in $$props) $$invalidate(6, basepath = $$props.basepath);\n\t\tif ('url' in $$props) $$invalidate(7, url = $$props.url);\n\t\tif ('history' in $$props) $$invalidate(8, history = $$props.history);\n\t\tif ('$$scope' in $$props) $$invalidate(11, $$scope = $$props.$$scope);\n\t};\n\n\t$$self.$$.update = () => {\n\t\tif ($$self.$$.dirty & /*$base*/ 1024) {\n\t\t\t// This reactive statement will update all the Routes' path when\n\t\t\t// the basepath changes.\n\t\t\t {\n\t\t\t\tconst { path: basepath } = $base;\n\t\t\t\troutes.update(rs => rs.map(r => Object.assign(r, { path: combinePaths(basepath, r._path) })));\n\t\t\t}\n\t\t}\n\n\t\tif ($$self.$$.dirty & /*$routes, $location*/ 513) {\n\t\t\t// This reactive statement will be run when the Router is created\n\t\t\t// when there are no Routes and then again the following tick, so it\n\t\t\t// will not find an active Route in SSR and in the browser it will only\n\t\t\t// pick an active Route after all Routes have been registered.\n\t\t\t {\n\t\t\t\tconst bestMatch = pick($routes, $location.pathname);\n\t\t\t\tactiveRoute.set(bestMatch);\n\t\t\t}\n\t\t}\n\t};\n\n\treturn [\n\t\t$location,\n\t\t$activeRoute,\n\t\troutes,\n\t\tactiveRoute,\n\t\tlocation,\n\t\tbase,\n\t\tbasepath,\n\t\turl,\n\t\thistory,\n\t\t$routes,\n\t\t$base,\n\t\t$$scope,\n\t\tslots\n\t];\n}\n\nclass Router extends SvelteComponent {\n\tconstructor(options) {\n\t\tsuper();\n\t\tinit(this, options, instance$2, create_fragment$2, safe_not_equal, { basepath: 6, url: 7, history: 8 });\n\t}\n}\n\nexport { Link, Route, Router, navigate };\n", "/* src/routing/Redirect.svelte generated by Svelte v3.59.2 */\nimport { SvelteComponent, init, safe_not_equal } from \"../../_snowpack/pkg/svelte/internal.js\";\n\nimport { navigate } from \"../../_snowpack/pkg/svelte-routing.js\";\nimport { onMount } from '../../_snowpack/pkg/svelte.js';\n\nfunction instance($$self, $$props, $$invalidate) {\n\tlet { path = \"/404\" } = $$props;\n\n\tonMount(() => {\n\t\tnavigate(path, { replace: true });\n\t});\n\n\t$$self.$$set = $$props => {\n\t\tif ('path' in $$props) $$invalidate(0, path = $$props.path);\n\t};\n\n\treturn [path];\n}\n\nclass Redirect extends SvelteComponent {\n\tconstructor(options) {\n\t\tsuper();\n\t\tinit(this, options, instance, null, safe_not_equal, { path: 0 });\n\t}\n}\n\nexport default Redirect;", "import { getShopifyStoreAddress, getStorefrontToken } from \"./util.js\";\n\nconst storeAddress = getShopifyStoreAddress();\nconst token = getStorefrontToken();\n\nconst fetchGenerator = async (method, path, body, token) => {\n  const requestInfo = {\n    method: method,\n    body: body,\n  }\n\n  requestInfo.headers = {\n    ...requestInfo.headers,\n    'Content-Type': 'application/graphql', \n    'X-Shopify-Storefront-Access-Token': token\n  }\n  \n  //TODO: identify and handle graphql errors\n  let response = await fetch(storeAddress + path, requestInfo);\n  if (response.ok) {\n    let json = await response.json();\n\n    // handle graphql errors\n    if (json.errors) {\n      console.log(json);\n      throw new Error(json.errors.reduce((accum, current) =>  accum + `${current.message}, ` , \"\"));\n    }\n\n    return json;\n  } else {\n    throw new Error(await response.text())\n  }\n}\n\nexport default class ApiClient {\n  static async getShopifyName() {\n    let query = `{ shop { name description } }`;\n    return await fetchGenerator(\"POST\", '/api/graphql.json', query, token);\n  }\n\n  static async getProduct(id) {\n    let query = `\n    {\n      node(id: \"${id}\") {\n        ... on Product {\n          id\n          title\n          description\n          descriptionHtml\n          variants(first: 10) {\n            edges {\n              cursor\n              node {\n                id\n                title\n                price\n                sku\n                availableForSale\n              }\n            }\n          }\n        }\n      }\n    }\n    `;\n    return await fetchGenerator(\"POST\", '/api/graphql.json', query, token);\n  }\n\n  static async getProductByTitle(title) {\n    let query = `{\n      products (first: 1, query: \"title:${title}\" ) {\n        edges {\n          node {\n            id\n            title\n            description\n            descriptionHtml\n            images(first: 10) {\n              edges {\n                cursor\n                node {\n                  transformedSrc(maxWidth:610)\n                }\n              }\n            }\n            variants(first: 10) {\n              edges {\n                cursor\n                node {\n                  id\n                  title\n                  price\n                  compareAtPrice\n                  sku\n                  availableForSale\n                }\n              }\n            }\n          }\n        }\n      }\n    }`;\n    return await fetchGenerator(\"POST\", '/api/graphql.json', query, token);\n  }\n\n  static async getProductByType(type) {\n    let query = `{\n      products (first: 1, query: \"product_type:${type}\" ) {\n        edges {\n          node {\n            id\n            title\n            description\n            descriptionHtml\n            images(first: 10) {\n              edges {\n                cursor\n                node {\n                  transformedSrc(maxWidth:610)\n                }\n              }\n            }\n            variants(first: 10) {\n              edges {\n                cursor\n                node {\n                  id\n                  title\n                  price\n                  compareAtPrice\n                  sku\n                  availableForSale\n                }\n              }\n            }\n          }\n        }\n      }\n    }`;\n    return await fetchGenerator(\"POST\", '/api/graphql.json', query, token);\n  }\n\n  static async createCheckout() {\n    let query = `\n    mutation {\n      checkoutCreate(input: { lineItems: [] }) \n      {\n        checkout {\n          id\n          webUrl\n        }\n      }\n    }\n    `;\n    return await fetchGenerator(\"POST\", '/api/graphql.json', query, token);\n  }\n\n  static async addToCheckout(checkoutId, variantId, quantity, cartoonize, theme, photoUrl, videoUrl) {\n    let query = `\n    mutation {\n      checkoutLineItemsAdd (\n        lineItems: [\n          { \n            variantId: \"${variantId}\", quantity: ${quantity}, customAttributes: [\n              { key: \"_cartoonize\", value: \"${cartoonize}\" }\n              { key: \"_theme\", value: \"${theme}\" }\n              { key: \"_photoUrl\", value: \"${photoUrl}\" }\n              { key: \"_videoUrl\", value: \"${videoUrl}\" }\n            ] \n          }\n        ], \n        checkoutId: \"${checkoutId}\"\n      )\n      {\n        userErrors {\n          field\n          message\n        }\n        checkout {\n          id\n          lineItems(first: 5) {\n            edges {\n              node {\n                id\n                title\n                quantity\n                variant {\n                  sku\n                }\n                customAttributes {\n                  key\n                  value\n                }\n              }\n            }\n          }\n        }\n      }\n    }\n    `;\n    return await fetchGenerator(\"POST\", '/api/graphql.json', query, token);\n  }\n\n  static async removeFromCheckout(checkoutId, lineItemIds) {\n    let query = `\n      mutation {\n        checkoutLineItemsRemove(checkoutId: \"${checkoutId}\", lineItemIds: \"${lineItemIds}\") {\n          checkout {\n            id\n          }\n          checkoutUserErrors {\n            code\n            field \n            message\n          }\n        }\n      }\n    `;\n    return await fetchGenerator(\"POST\", '/api/graphql.json', query, token);\n  }\n\n  static async updateCheckoutLineItem(checkoutId, lineItemId, quantity, theme, variantId, photoUrl, videoUrl) {\n    let query = `\n      mutation {\n        checkoutLineItemsUpdate(\n          checkoutId: \"${checkoutId}\",\n          lineItems: [\n            { \n              id: \"${lineItemId}\", variantId: \"${variantId}\", quantity: ${quantity}, customAttributes: [\n                { key: \"_theme\", value: \"${theme}\" }\n                { key: \"_photoUrl\", value: \"${photoUrl}\" }\n                { key: \"_videoUrl\", value: \"${videoUrl}\" }\n              ] \n            }\n          ]\n        )\n        {\n          checkout {\n            id\n          }\n          checkoutUserErrors {\n            code\n            field\n            message\n          }\n        }\n      }\n    `;\n    return await fetchGenerator(\"POST\", '/api/graphql.json', query, token);\n  }\n\n\n  static async getCheckout(checkoutId) {\n    const query = `\n    query {\n      node(id: \"${checkoutId}\") {\n        ... on Checkout {\n          id\n          ready\n          currencyCode\n          lineItems(first: 10) {\n            edges {\n              node {\n                id\n                title\n                quantity\n                variant {\n                  id\n                  image {\n                    originalSrc\n                  }\n                  sku\n                  selectedOptions {\n                    name \n                    value\n                  }\n                  price\n                  product {\n                    title\n                  }\n\n                }\n                customAttributes {\n                  key\n                  value\n                }\n              }\n            }\n          }\n          order {\n            id\n            financialStatus\n            fulfillmentStatus\n          }\n          subtotalPrice\n        }\n      }\n    }\n    `;\n    return await fetchGenerator(\"POST\", '/api/graphql.json', query, token);\n  }\n\n  static async getWebCheckoutUrl(checkoutId) {\n    const query = `\n    query {\n      node(id:\"${checkoutId}\" ) {\n        ... on Checkout {\n          id\n          webUrl\n        }\n      }\n    }\n    `;\n    return await fetchGenerator(\"POST\", '/api/graphql.json', query, token);\n  }\n  \n}\n", "import './Hero.svelte.css';\n/* src/components/Hero.svelte generated by Svelte v3.59.2 */\nimport {\n\tSvelteComponent,\n\tattr,\n\tdetach,\n\telement,\n\tinit,\n\tinsert,\n\tnoop,\n\tsafe_not_equal\n} from \"../../_snowpack/pkg/svelte/internal.js\";\n\nfunction create_fragment(ctx) {\n\tlet div2;\n\n\treturn {\n\t\tc() {\n\t\t\tdiv2 = element(\"div\");\n\n\t\t\tdiv2.innerHTML = `<video loop=\"\" autoplay=\"\" muted=\"\" src=\"/vid/hero.mp4\" alt=\"\" class=\"svelte-18rw0ia\"></video> \n  <div class=\"overlay svelte-18rw0ia\"></div> \n  <div class=\"text svelte-18rw0ia\"><h1 class=\"svelte-18rw0ia\">CARTOONIZE YOUR PET&#39;S PHOTOS</h1> \n    <p class=\"svelte-18rw0ia\">Bring them to life with Augmented Reality!</p></div>`;\n\n\t\t\tattr(div2, \"class\", \"container svelte-18rw0ia\");\n\t\t},\n\t\tm(target, anchor) {\n\t\t\tinsert(target, div2, anchor);\n\t\t},\n\t\tp: noop,\n\t\ti: noop,\n\t\to: noop,\n\t\td(detaching) {\n\t\t\tif (detaching) detach(div2);\n\t\t}\n\t};\n}\n\nclass Hero extends SvelteComponent {\n\tconstructor(options) {\n\t\tsuper();\n\t\tinit(this, options, null, create_fragment, safe_not_equal, {});\n\t}\n}\n\nexport default Hero;", "import { Y as identity, S as SvelteComponent, i as init, s as safe_not_equal, b as append_styles, e as element, k as space, d as attr, f as insert, p as append, l as listen, F as is_function, q as transition_in, Q as empty, v as group_outros, r as transition_out, x as check_outros, g as detach, u as destroy_component, U as construct_svelte_component, j as create_component, m as mount_component, Z as add_render_callback, _ as create_bidirectional_transition, G as run_all, D as create_slot, A as update_slot_base, B as get_all_dirty_from_scope, C as get_slot_changes, c as createEventDispatcher, a as onDestroy, o as onMount, $ as globals, n as noop, I as binding_callbacks, W as setContext } from './common/index-c07ea359.js';\n\nfunction fade(node, {delay = 0, duration = 400, easing = identity} = {}) {\n  const o = +getComputedStyle(node).opacity;\n  return {\n    delay,\n    duration,\n    easing,\n    css: (t) => `opacity: ${t * o}`\n  };\n}\n\n/* node_modules/svelte-simple-modal/src/Modal.svelte generated by Svelte v3.59.2 */\n\nconst { window: window_1 } = globals;\n\nfunction add_css(target) {\n\tappend_styles(target, \"svelte-2wx9ab\", \".svelte-2wx9ab{box-sizing:border-box}.bg.svelte-2wx9ab{position:fixed;z-index:1000;top:0;left:0;display:flex;flex-direction:column;justify-content:center;width:100vw;height:100vh;background:rgba(0, 0, 0, 0.66)}.window-wrap.svelte-2wx9ab{position:relative;margin:2rem;max-height:100%}.window.svelte-2wx9ab{position:relative;width:40rem;max-width:100%;max-height:100%;margin:2rem auto;color:black;border-radius:0.5rem;background:white}.content.svelte-2wx9ab{position:relative;padding:1rem;max-height:calc(100vh - 4rem);overflow:auto}.close.svelte-2wx9ab{display:block;box-sizing:border-box;position:absolute;z-index:1000;top:1rem;right:1rem;margin:0;padding:0;width:1.5rem;height:1.5rem;border:0;color:black;border-radius:1.5rem;background:white;box-shadow:0 0 0 1px black;transition:transform 0.2s cubic-bezier(0.25, 0.1, 0.25, 1),\\n                background 0.2s cubic-bezier(0.25, 0.1, 0.25, 1);-webkit-appearance:none}.close.svelte-2wx9ab:before,.close.svelte-2wx9ab:after{content:'';display:block;box-sizing:border-box;position:absolute;top:50%;width:1rem;height:1px;background:black;transform-origin:center;transition:height 0.2s cubic-bezier(0.25, 0.1, 0.25, 1),\\n                background 0.2s cubic-bezier(0.25, 0.1, 0.25, 1)}.close.svelte-2wx9ab:before{-webkit-transform:translate(0, -50%) rotate(45deg);-moz-transform:translate(0, -50%) rotate(45deg);transform:translate(0, -50%) rotate(45deg);left:0.25rem}.close.svelte-2wx9ab:after{-webkit-transform:translate(0, -50%) rotate(-45deg);-moz-transform:translate(0, -50%) rotate(-45deg);transform:translate(0, -50%) rotate(-45deg);left:0.25rem}.close.svelte-2wx9ab:hover{background:black}.close.svelte-2wx9ab:hover:before,.close.svelte-2wx9ab:hover:after{height:2px;background:white}.close.svelte-2wx9ab:focus{border-color:#3399ff;box-shadow:0 0 0 2px #3399ff}.close.svelte-2wx9ab:active{transform:scale(0.9)}.close.svelte-2wx9ab:hover,.close.svelte-2wx9ab:focus,.close.svelte-2wx9ab:active{outline:none}\");\n}\n\n// (334:0) {#if Component}\nfunction create_if_block(ctx) {\n\tlet div3;\n\tlet div2;\n\tlet div1;\n\tlet t;\n\tlet div0;\n\tlet switch_instance;\n\tlet div1_transition;\n\tlet div3_transition;\n\tlet current;\n\tlet mounted;\n\tlet dispose;\n\tlet if_block = /*state*/ ctx[0].closeButton && create_if_block_1(ctx);\n\tvar switch_value = /*Component*/ ctx[1];\n\n\tfunction switch_props(ctx) {\n\t\treturn {};\n\t}\n\n\tif (switch_value) {\n\t\tswitch_instance = construct_svelte_component(switch_value, switch_props());\n\t}\n\n\treturn {\n\t\tc() {\n\t\t\tdiv3 = element(\"div\");\n\t\t\tdiv2 = element(\"div\");\n\t\t\tdiv1 = element(\"div\");\n\t\t\tif (if_block) if_block.c();\n\t\t\tt = space();\n\t\t\tdiv0 = element(\"div\");\n\t\t\tif (switch_instance) create_component(switch_instance.$$.fragment);\n\t\t\tattr(div0, \"class\", \"content svelte-2wx9ab\");\n\t\t\tattr(div0, \"style\", /*cssContent*/ ctx[8]);\n\t\t\tattr(div1, \"class\", \"window svelte-2wx9ab\");\n\t\t\tattr(div1, \"role\", \"dialog\");\n\t\t\tattr(div1, \"aria-modal\", \"true\");\n\t\t\tattr(div1, \"style\", /*cssWindow*/ ctx[7]);\n\t\t\tattr(div2, \"class\", \"window-wrap svelte-2wx9ab\");\n\t\t\tattr(div2, \"style\", /*cssWindowWrap*/ ctx[6]);\n\t\t\tattr(div3, \"class\", \"bg svelte-2wx9ab\");\n\t\t\tattr(div3, \"style\", /*cssBg*/ ctx[5]);\n\t\t},\n\t\tm(target, anchor) {\n\t\t\tinsert(target, div3, anchor);\n\t\t\tappend(div3, div2);\n\t\t\tappend(div2, div1);\n\t\t\tif (if_block) if_block.m(div1, null);\n\t\t\tappend(div1, t);\n\t\t\tappend(div1, div0);\n\t\t\tif (switch_instance) mount_component(switch_instance, div0, null);\n\t\t\t/*div1_binding*/ ctx[39](div1);\n\t\t\t/*div2_binding*/ ctx[40](div2);\n\t\t\t/*div3_binding*/ ctx[41](div3);\n\t\t\tcurrent = true;\n\n\t\t\tif (!mounted) {\n\t\t\t\tdispose = [\n\t\t\t\t\tlisten(div1, \"introstart\", function () {\n\t\t\t\t\t\tif (is_function(/*onOpen*/ ctx[12])) /*onOpen*/ ctx[12].apply(this, arguments);\n\t\t\t\t\t}),\n\t\t\t\t\tlisten(div1, \"outrostart\", function () {\n\t\t\t\t\t\tif (is_function(/*onClose*/ ctx[13])) /*onClose*/ ctx[13].apply(this, arguments);\n\t\t\t\t\t}),\n\t\t\t\t\tlisten(div1, \"introend\", function () {\n\t\t\t\t\t\tif (is_function(/*onOpened*/ ctx[14])) /*onOpened*/ ctx[14].apply(this, arguments);\n\t\t\t\t\t}),\n\t\t\t\t\tlisten(div1, \"outroend\", function () {\n\t\t\t\t\t\tif (is_function(/*onClosed*/ ctx[15])) /*onClosed*/ ctx[15].apply(this, arguments);\n\t\t\t\t\t}),\n\t\t\t\t\tlisten(div3, \"mousedown\", /*handleOuterMousedown*/ ctx[19]),\n\t\t\t\t\tlisten(div3, \"mouseup\", /*handleOuterMouseup*/ ctx[20])\n\t\t\t\t];\n\n\t\t\t\tmounted = true;\n\t\t\t}\n\t\t},\n\t\tp(new_ctx, dirty) {\n\t\t\tctx = new_ctx;\n\n\t\t\tif (/*state*/ ctx[0].closeButton) {\n\t\t\t\tif (if_block) {\n\t\t\t\t\tif_block.p(ctx, dirty);\n\n\t\t\t\t\tif (dirty[0] & /*state*/ 1) {\n\t\t\t\t\t\ttransition_in(if_block, 1);\n\t\t\t\t\t}\n\t\t\t\t} else {\n\t\t\t\t\tif_block = create_if_block_1(ctx);\n\t\t\t\t\tif_block.c();\n\t\t\t\t\ttransition_in(if_block, 1);\n\t\t\t\t\tif_block.m(div1, t);\n\t\t\t\t}\n\t\t\t} else if (if_block) {\n\t\t\t\tgroup_outros();\n\n\t\t\t\ttransition_out(if_block, 1, 1, () => {\n\t\t\t\t\tif_block = null;\n\t\t\t\t});\n\n\t\t\t\tcheck_outros();\n\t\t\t}\n\n\t\t\tif (dirty[0] & /*Component*/ 2 && switch_value !== (switch_value = /*Component*/ ctx[1])) {\n\t\t\t\tif (switch_instance) {\n\t\t\t\t\tgroup_outros();\n\t\t\t\t\tconst old_component = switch_instance;\n\n\t\t\t\t\ttransition_out(old_component.$$.fragment, 1, 0, () => {\n\t\t\t\t\t\tdestroy_component(old_component, 1);\n\t\t\t\t\t});\n\n\t\t\t\t\tcheck_outros();\n\t\t\t\t}\n\n\t\t\t\tif (switch_value) {\n\t\t\t\t\tswitch_instance = construct_svelte_component(switch_value, switch_props());\n\t\t\t\t\tcreate_component(switch_instance.$$.fragment);\n\t\t\t\t\ttransition_in(switch_instance.$$.fragment, 1);\n\t\t\t\t\tmount_component(switch_instance, div0, null);\n\t\t\t\t} else {\n\t\t\t\t\tswitch_instance = null;\n\t\t\t\t}\n\t\t\t}\n\n\t\t\tif (!current || dirty[0] & /*cssContent*/ 256) {\n\t\t\t\tattr(div0, \"style\", /*cssContent*/ ctx[8]);\n\t\t\t}\n\n\t\t\tif (!current || dirty[0] & /*cssWindow*/ 128) {\n\t\t\t\tattr(div1, \"style\", /*cssWindow*/ ctx[7]);\n\t\t\t}\n\n\t\t\tif (!current || dirty[0] & /*cssWindowWrap*/ 64) {\n\t\t\t\tattr(div2, \"style\", /*cssWindowWrap*/ ctx[6]);\n\t\t\t}\n\n\t\t\tif (!current || dirty[0] & /*cssBg*/ 32) {\n\t\t\t\tattr(div3, \"style\", /*cssBg*/ ctx[5]);\n\t\t\t}\n\t\t},\n\t\ti(local) {\n\t\t\tif (current) return;\n\t\t\ttransition_in(if_block);\n\t\t\tif (switch_instance) transition_in(switch_instance.$$.fragment, local);\n\n\t\t\tadd_render_callback(() => {\n\t\t\t\tif (!current) return;\n\t\t\t\tif (!div1_transition) div1_transition = create_bidirectional_transition(div1, /*currentTransitionWindow*/ ctx[11], /*state*/ ctx[0].transitionWindowProps, true);\n\t\t\t\tdiv1_transition.run(1);\n\t\t\t});\n\n\t\t\tadd_render_callback(() => {\n\t\t\t\tif (!current) return;\n\t\t\t\tif (!div3_transition) div3_transition = create_bidirectional_transition(div3, /*currentTransitionBg*/ ctx[10], /*state*/ ctx[0].transitionBgProps, true);\n\t\t\t\tdiv3_transition.run(1);\n\t\t\t});\n\n\t\t\tcurrent = true;\n\t\t},\n\t\to(local) {\n\t\t\ttransition_out(if_block);\n\t\t\tif (switch_instance) transition_out(switch_instance.$$.fragment, local);\n\t\t\tif (!div1_transition) div1_transition = create_bidirectional_transition(div1, /*currentTransitionWindow*/ ctx[11], /*state*/ ctx[0].transitionWindowProps, false);\n\t\t\tdiv1_transition.run(0);\n\t\t\tif (!div3_transition) div3_transition = create_bidirectional_transition(div3, /*currentTransitionBg*/ ctx[10], /*state*/ ctx[0].transitionBgProps, false);\n\t\t\tdiv3_transition.run(0);\n\t\t\tcurrent = false;\n\t\t},\n\t\td(detaching) {\n\t\t\tif (detaching) detach(div3);\n\t\t\tif (if_block) if_block.d();\n\t\t\tif (switch_instance) destroy_component(switch_instance);\n\t\t\t/*div1_binding*/ ctx[39](null);\n\t\t\tif (detaching && div1_transition) div1_transition.end();\n\t\t\t/*div2_binding*/ ctx[40](null);\n\t\t\t/*div3_binding*/ ctx[41](null);\n\t\t\tif (detaching && div3_transition) div3_transition.end();\n\t\t\tmounted = false;\n\t\t\trun_all(dispose);\n\t\t}\n\t};\n}\n\n// (356:8) {#if state.closeButton}\nfunction create_if_block_1(ctx) {\n\tlet show_if;\n\tlet current_block_type_index;\n\tlet if_block;\n\tlet if_block_anchor;\n\tlet current;\n\tconst if_block_creators = [create_if_block_2, create_else_block];\n\tconst if_blocks = [];\n\n\tfunction select_block_type(ctx, dirty) {\n\t\tif (dirty[0] & /*state*/ 1) show_if = null;\n\t\tif (show_if == null) show_if = !!/*isFunction*/ ctx[16](/*state*/ ctx[0].closeButton);\n\t\tif (show_if) return 0;\n\t\treturn 1;\n\t}\n\n\tcurrent_block_type_index = select_block_type(ctx, [-1, -1]);\n\tif_block = if_blocks[current_block_type_index] = if_block_creators[current_block_type_index](ctx);\n\n\treturn {\n\t\tc() {\n\t\t\tif_block.c();\n\t\t\tif_block_anchor = empty();\n\t\t},\n\t\tm(target, anchor) {\n\t\t\tif_blocks[current_block_type_index].m(target, anchor);\n\t\t\tinsert(target, if_block_anchor, anchor);\n\t\t\tcurrent = true;\n\t\t},\n\t\tp(ctx, dirty) {\n\t\t\tlet previous_block_index = current_block_type_index;\n\t\t\tcurrent_block_type_index = select_block_type(ctx, dirty);\n\n\t\t\tif (current_block_type_index === previous_block_index) {\n\t\t\t\tif_blocks[current_block_type_index].p(ctx, dirty);\n\t\t\t} else {\n\t\t\t\tgroup_outros();\n\n\t\t\t\ttransition_out(if_blocks[previous_block_index], 1, 1, () => {\n\t\t\t\t\tif_blocks[previous_block_index] = null;\n\t\t\t\t});\n\n\t\t\t\tcheck_outros();\n\t\t\t\tif_block = if_blocks[current_block_type_index];\n\n\t\t\t\tif (!if_block) {\n\t\t\t\t\tif_block = if_blocks[current_block_type_index] = if_block_creators[current_block_type_index](ctx);\n\t\t\t\t\tif_block.c();\n\t\t\t\t} else {\n\t\t\t\t\tif_block.p(ctx, dirty);\n\t\t\t\t}\n\n\t\t\t\ttransition_in(if_block, 1);\n\t\t\t\tif_block.m(if_block_anchor.parentNode, if_block_anchor);\n\t\t\t}\n\t\t},\n\t\ti(local) {\n\t\t\tif (current) return;\n\t\t\ttransition_in(if_block);\n\t\t\tcurrent = true;\n\t\t},\n\t\to(local) {\n\t\t\ttransition_out(if_block);\n\t\t\tcurrent = false;\n\t\t},\n\t\td(detaching) {\n\t\t\tif_blocks[current_block_type_index].d(detaching);\n\t\t\tif (detaching) detach(if_block_anchor);\n\t\t}\n\t};\n}\n\n// (359:10) {:else}\nfunction create_else_block(ctx) {\n\tlet button;\n\tlet mounted;\n\tlet dispose;\n\n\treturn {\n\t\tc() {\n\t\t\tbutton = element(\"button\");\n\t\t\tattr(button, \"class\", \"close svelte-2wx9ab\");\n\t\t\tattr(button, \"style\", /*cssCloseButton*/ ctx[9]);\n\t\t},\n\t\tm(target, anchor) {\n\t\t\tinsert(target, button, anchor);\n\n\t\t\tif (!mounted) {\n\t\t\t\tdispose = listen(button, \"click\", /*close*/ ctx[17]);\n\t\t\t\tmounted = true;\n\t\t\t}\n\t\t},\n\t\tp(ctx, dirty) {\n\t\t\tif (dirty[0] & /*cssCloseButton*/ 512) {\n\t\t\t\tattr(button, \"style\", /*cssCloseButton*/ ctx[9]);\n\t\t\t}\n\t\t},\n\t\ti: noop,\n\t\to: noop,\n\t\td(detaching) {\n\t\t\tif (detaching) detach(button);\n\t\t\tmounted = false;\n\t\t\tdispose();\n\t\t}\n\t};\n}\n\n// (357:10) {#if isFunction(state.closeButton)}\nfunction create_if_block_2(ctx) {\n\tlet switch_instance;\n\tlet switch_instance_anchor;\n\tlet current;\n\tvar switch_value = /*state*/ ctx[0].closeButton;\n\n\tfunction switch_props(ctx) {\n\t\treturn { props: { onClose: /*close*/ ctx[17] } };\n\t}\n\n\tif (switch_value) {\n\t\tswitch_instance = construct_svelte_component(switch_value, switch_props(ctx));\n\t}\n\n\treturn {\n\t\tc() {\n\t\t\tif (switch_instance) create_component(switch_instance.$$.fragment);\n\t\t\tswitch_instance_anchor = empty();\n\t\t},\n\t\tm(target, anchor) {\n\t\t\tif (switch_instance) mount_component(switch_instance, target, anchor);\n\t\t\tinsert(target, switch_instance_anchor, anchor);\n\t\t\tcurrent = true;\n\t\t},\n\t\tp(ctx, dirty) {\n\t\t\tif (dirty[0] & /*state*/ 1 && switch_value !== (switch_value = /*state*/ ctx[0].closeButton)) {\n\t\t\t\tif (switch_instance) {\n\t\t\t\t\tgroup_outros();\n\t\t\t\t\tconst old_component = switch_instance;\n\n\t\t\t\t\ttransition_out(old_component.$$.fragment, 1, 0, () => {\n\t\t\t\t\t\tdestroy_component(old_component, 1);\n\t\t\t\t\t});\n\n\t\t\t\t\tcheck_outros();\n\t\t\t\t}\n\n\t\t\t\tif (switch_value) {\n\t\t\t\t\tswitch_instance = construct_svelte_component(switch_value, switch_props(ctx));\n\t\t\t\t\tcreate_component(switch_instance.$$.fragment);\n\t\t\t\t\ttransition_in(switch_instance.$$.fragment, 1);\n\t\t\t\t\tmount_component(switch_instance, switch_instance_anchor.parentNode, switch_instance_anchor);\n\t\t\t\t} else {\n\t\t\t\t\tswitch_instance = null;\n\t\t\t\t}\n\t\t\t}\n\t\t},\n\t\ti(local) {\n\t\t\tif (current) return;\n\t\t\tif (switch_instance) transition_in(switch_instance.$$.fragment, local);\n\t\t\tcurrent = true;\n\t\t},\n\t\to(local) {\n\t\t\tif (switch_instance) transition_out(switch_instance.$$.fragment, local);\n\t\t\tcurrent = false;\n\t\t},\n\t\td(detaching) {\n\t\t\tif (detaching) detach(switch_instance_anchor);\n\t\t\tif (switch_instance) destroy_component(switch_instance, detaching);\n\t\t}\n\t};\n}\n\nfunction create_fragment(ctx) {\n\tlet t;\n\tlet current;\n\tlet mounted;\n\tlet dispose;\n\tlet if_block = /*Component*/ ctx[1] && create_if_block(ctx);\n\tconst default_slot_template = /*#slots*/ ctx[38].default;\n\tconst default_slot = create_slot(default_slot_template, ctx, /*$$scope*/ ctx[37], null);\n\n\treturn {\n\t\tc() {\n\t\t\tif (if_block) if_block.c();\n\t\t\tt = space();\n\t\t\tif (default_slot) default_slot.c();\n\t\t},\n\t\tm(target, anchor) {\n\t\t\tif (if_block) if_block.m(target, anchor);\n\t\t\tinsert(target, t, anchor);\n\n\t\t\tif (default_slot) {\n\t\t\t\tdefault_slot.m(target, anchor);\n\t\t\t}\n\n\t\t\tcurrent = true;\n\n\t\t\tif (!mounted) {\n\t\t\t\tdispose = listen(window_1, \"keydown\", /*handleKeydown*/ ctx[18]);\n\t\t\t\tmounted = true;\n\t\t\t}\n\t\t},\n\t\tp(ctx, dirty) {\n\t\t\tif (/*Component*/ ctx[1]) {\n\t\t\t\tif (if_block) {\n\t\t\t\t\tif_block.p(ctx, dirty);\n\n\t\t\t\t\tif (dirty[0] & /*Component*/ 2) {\n\t\t\t\t\t\ttransition_in(if_block, 1);\n\t\t\t\t\t}\n\t\t\t\t} else {\n\t\t\t\t\tif_block = create_if_block(ctx);\n\t\t\t\t\tif_block.c();\n\t\t\t\t\ttransition_in(if_block, 1);\n\t\t\t\t\tif_block.m(t.parentNode, t);\n\t\t\t\t}\n\t\t\t} else if (if_block) {\n\t\t\t\tgroup_outros();\n\n\t\t\t\ttransition_out(if_block, 1, 1, () => {\n\t\t\t\t\tif_block = null;\n\t\t\t\t});\n\n\t\t\t\tcheck_outros();\n\t\t\t}\n\n\t\t\tif (default_slot) {\n\t\t\t\tif (default_slot.p && (!current || dirty[1] & /*$$scope*/ 64)) {\n\t\t\t\t\tupdate_slot_base(\n\t\t\t\t\t\tdefault_slot,\n\t\t\t\t\t\tdefault_slot_template,\n\t\t\t\t\t\tctx,\n\t\t\t\t\t\t/*$$scope*/ ctx[37],\n\t\t\t\t\t\t!current\n\t\t\t\t\t\t? get_all_dirty_from_scope(/*$$scope*/ ctx[37])\n\t\t\t\t\t\t: get_slot_changes(default_slot_template, /*$$scope*/ ctx[37], dirty, null),\n\t\t\t\t\t\tnull\n\t\t\t\t\t);\n\t\t\t\t}\n\t\t\t}\n\t\t},\n\t\ti(local) {\n\t\t\tif (current) return;\n\t\t\ttransition_in(if_block);\n\t\t\ttransition_in(default_slot, local);\n\t\t\tcurrent = true;\n\t\t},\n\t\to(local) {\n\t\t\ttransition_out(if_block);\n\t\t\ttransition_out(default_slot, local);\n\t\t\tcurrent = false;\n\t\t},\n\t\td(detaching) {\n\t\t\tif (if_block) if_block.d(detaching);\n\t\t\tif (detaching) detach(t);\n\t\t\tif (default_slot) default_slot.d(detaching);\n\t\t\tmounted = false;\n\t\t\tdispose();\n\t\t}\n\t};\n}\n\nfunction bind(Component, props = {}) {\n\treturn function ModalComponent(options) {\n\t\treturn new Component({\n\t\t\t\t...options,\n\t\t\t\tprops: { ...props, ...options.props }\n\t\t\t});\n\t};\n}\n\nfunction instance($$self, $$props, $$invalidate) {\n\tlet { $$slots: slots = {}, $$scope } = $$props;\n\tconst dispatch = createEventDispatcher();\n\tconst baseSetContext = setContext;\n\tlet { show = null } = $$props;\n\tlet { key = 'simple-modal' } = $$props;\n\tlet { closeButton = true } = $$props;\n\tlet { closeOnEsc = true } = $$props;\n\tlet { closeOnOuterClick = true } = $$props;\n\tlet { styleBg = {} } = $$props;\n\tlet { styleWindowWrap = {} } = $$props;\n\tlet { styleWindow = {} } = $$props;\n\tlet { styleContent = {} } = $$props;\n\tlet { styleCloseButton = {} } = $$props;\n\tlet { setContext: setContext$1 = baseSetContext } = $$props;\n\tlet { transitionBg = fade } = $$props;\n\tlet { transitionBgProps = { duration: 250 } } = $$props;\n\tlet { transitionWindow = transitionBg } = $$props;\n\tlet { transitionWindowProps = transitionBgProps } = $$props;\n\n\tconst defaultState = {\n\t\tcloseButton,\n\t\tcloseOnEsc,\n\t\tcloseOnOuterClick,\n\t\tstyleBg,\n\t\tstyleWindowWrap,\n\t\tstyleWindow,\n\t\tstyleContent,\n\t\tstyleCloseButton,\n\t\ttransitionBg,\n\t\ttransitionBgProps,\n\t\ttransitionWindow,\n\t\ttransitionWindowProps\n\t};\n\n\tlet state = { ...defaultState };\n\tlet Component = null;\n\tlet background;\n\tlet wrap;\n\tlet modalWindow;\n\tlet scrollY;\n\tlet cssBg;\n\tlet cssWindowWrap;\n\tlet cssWindow;\n\tlet cssContent;\n\tlet cssCloseButton;\n\tlet currentTransitionBg;\n\tlet currentTransitionWindow;\n\tlet prevBodyPosition;\n\tlet prevBodyOverflow;\n\tlet outerClickTarget;\n\tconst camelCaseToDash = str => str.replace(/([a-zA-Z])(?=[A-Z])/g, '$1-').toLowerCase();\n\n\tconst toCssString = props => props\n\t? Object.keys(props).reduce((str, key) => `${str}; ${camelCaseToDash(key)}: ${props[key]}`, '')\n\t: '';\n\n\tconst isFunction = f => !!(f && f.constructor && f.call && f.apply);\n\n\tconst updateStyleTransition = () => {\n\t\t$$invalidate(5, cssBg = toCssString(Object.assign(\n\t\t\t{},\n\t\t\t{\n\t\t\t\twidth: window.innerWidth,\n\t\t\t\theight: window.innerHeight\n\t\t\t},\n\t\t\tstate.styleBg\n\t\t)));\n\n\t\t$$invalidate(6, cssWindowWrap = toCssString(state.styleWindowWrap));\n\t\t$$invalidate(7, cssWindow = toCssString(state.styleWindow));\n\t\t$$invalidate(8, cssContent = toCssString(state.styleContent));\n\t\t$$invalidate(9, cssCloseButton = toCssString(state.styleCloseButton));\n\t\t$$invalidate(10, currentTransitionBg = state.transitionBg);\n\t\t$$invalidate(11, currentTransitionWindow = state.transitionWindow);\n\t};\n\n\tconst toVoid = () => {\n\t\t\n\t};\n\n\tlet onOpen = toVoid;\n\tlet onClose = toVoid;\n\tlet onOpened = toVoid;\n\tlet onClosed = toVoid;\n\n\tconst open = (NewComponent, newProps = {}, options = {}, callback = {}) => {\n\t\t$$invalidate(1, Component = bind(NewComponent, newProps));\n\t\t$$invalidate(0, state = { ...defaultState, ...options });\n\t\tupdateStyleTransition();\n\t\tdisableScroll();\n\n\t\t($$invalidate(12, onOpen = event => {\n\t\t\tif (callback.onOpen) callback.onOpen(event);\n\t\t\tdispatch('open');\n\t\t\tdispatch('opening'); // Deprecated. Do not use!\n\t\t}), $$invalidate(13, onClose = event => {\n\t\t\tif (callback.onClose) callback.onClose(event);\n\t\t\tdispatch('close');\n\t\t\tdispatch('closing'); // Deprecated. Do not use!\n\t\t}), $$invalidate(14, onOpened = event => {\n\t\t\tif (callback.onOpened) callback.onOpened(event);\n\t\t\tdispatch('opened');\n\t\t}));\n\n\t\t$$invalidate(15, onClosed = event => {\n\t\t\tif (callback.onClosed) callback.onClosed(event);\n\t\t\tdispatch('closed');\n\t\t});\n\t};\n\n\tconst close = (callback = {}) => {\n\t\t$$invalidate(13, onClose = callback.onClose || onClose);\n\t\t$$invalidate(15, onClosed = callback.onClosed || onClosed);\n\t\t$$invalidate(1, Component = null);\n\t\tenableScroll();\n\t};\n\n\tconst handleKeydown = event => {\n\t\tif (state.closeOnEsc && Component && event.key === 'Escape') {\n\t\t\tevent.preventDefault();\n\t\t\tclose();\n\t\t}\n\n\t\tif (Component && event.key === 'Tab') {\n\t\t\t// trap focus\n\t\t\tconst nodes = modalWindow.querySelectorAll('*');\n\n\t\t\tconst tabbable = Array.from(nodes).filter(node => node.tabIndex >= 0);\n\t\t\tlet index = tabbable.indexOf(document.activeElement);\n\t\t\tif (index === -1 && event.shiftKey) index = 0;\n\t\t\tindex += tabbable.length + (event.shiftKey ? -1 : 1);\n\t\t\tindex %= tabbable.length;\n\t\t\ttabbable[index].focus();\n\t\t\tevent.preventDefault();\n\t\t}\n\t};\n\n\tconst handleOuterMousedown = event => {\n\t\tif (state.closeOnOuterClick && (event.target === background || event.target === wrap)) outerClickTarget = event.target;\n\t};\n\n\tconst handleOuterMouseup = event => {\n\t\tif (state.closeOnOuterClick && event.target === outerClickTarget) {\n\t\t\tevent.preventDefault();\n\t\t\tclose();\n\t\t}\n\t};\n\n\tconst disableScroll = () => {\n\t\tscrollY = window.scrollY;\n\t\tprevBodyPosition = document.body.style.position;\n\t\tprevBodyOverflow = document.body.style.overflow;\n\t\tdocument.body.style.position = 'fixed';\n\t\tdocument.body.style.top = `-${scrollY}px`;\n\t\tdocument.body.style.overflow = 'hidden';\n\t};\n\n\tconst enableScroll = () => {\n\t\tdocument.body.style.position = prevBodyPosition || '';\n\t\tdocument.body.style.top = '';\n\t\tdocument.body.style.overflow = prevBodyOverflow || '';\n\t\twindow.scrollTo(0, scrollY);\n\t};\n\n\tsetContext$1(key, { open, close });\n\tlet isMounted = false;\n\n\tonDestroy(() => {\n\t\tif (isMounted) close();\n\t});\n\n\tonMount(() => {\n\t\t$$invalidate(36, isMounted = true);\n\t});\n\n\tfunction div1_binding($$value) {\n\t\tbinding_callbacks[$$value ? 'unshift' : 'push'](() => {\n\t\t\tmodalWindow = $$value;\n\t\t\t$$invalidate(4, modalWindow);\n\t\t});\n\t}\n\n\tfunction div2_binding($$value) {\n\t\tbinding_callbacks[$$value ? 'unshift' : 'push'](() => {\n\t\t\twrap = $$value;\n\t\t\t$$invalidate(3, wrap);\n\t\t});\n\t}\n\n\tfunction div3_binding($$value) {\n\t\tbinding_callbacks[$$value ? 'unshift' : 'push'](() => {\n\t\t\tbackground = $$value;\n\t\t\t$$invalidate(2, background);\n\t\t});\n\t}\n\n\t$$self.$$set = $$props => {\n\t\tif ('show' in $$props) $$invalidate(21, show = $$props.show);\n\t\tif ('key' in $$props) $$invalidate(22, key = $$props.key);\n\t\tif ('closeButton' in $$props) $$invalidate(23, closeButton = $$props.closeButton);\n\t\tif ('closeOnEsc' in $$props) $$invalidate(24, closeOnEsc = $$props.closeOnEsc);\n\t\tif ('closeOnOuterClick' in $$props) $$invalidate(25, closeOnOuterClick = $$props.closeOnOuterClick);\n\t\tif ('styleBg' in $$props) $$invalidate(26, styleBg = $$props.styleBg);\n\t\tif ('styleWindowWrap' in $$props) $$invalidate(27, styleWindowWrap = $$props.styleWindowWrap);\n\t\tif ('styleWindow' in $$props) $$invalidate(28, styleWindow = $$props.styleWindow);\n\t\tif ('styleContent' in $$props) $$invalidate(29, styleContent = $$props.styleContent);\n\t\tif ('styleCloseButton' in $$props) $$invalidate(30, styleCloseButton = $$props.styleCloseButton);\n\t\tif ('setContext' in $$props) $$invalidate(31, setContext$1 = $$props.setContext);\n\t\tif ('transitionBg' in $$props) $$invalidate(32, transitionBg = $$props.transitionBg);\n\t\tif ('transitionBgProps' in $$props) $$invalidate(33, transitionBgProps = $$props.transitionBgProps);\n\t\tif ('transitionWindow' in $$props) $$invalidate(34, transitionWindow = $$props.transitionWindow);\n\t\tif ('transitionWindowProps' in $$props) $$invalidate(35, transitionWindowProps = $$props.transitionWindowProps);\n\t\tif ('$$scope' in $$props) $$invalidate(37, $$scope = $$props.$$scope);\n\t};\n\n\t$$self.$$.update = () => {\n\t\tif ($$self.$$.dirty[0] & /*show*/ 2097152 | $$self.$$.dirty[1] & /*isMounted*/ 32) {\n\t\t\t {\n\t\t\t\tif (isMounted) {\n\t\t\t\t\tif (isFunction(show)) {\n\t\t\t\t\t\topen(show);\n\t\t\t\t\t} else {\n\t\t\t\t\t\tclose();\n\t\t\t\t\t}\n\t\t\t\t}\n\t\t\t}\n\t\t}\n\t};\n\n\treturn [\n\t\tstate,\n\t\tComponent,\n\t\tbackground,\n\t\twrap,\n\t\tmodalWindow,\n\t\tcssBg,\n\t\tcssWindowWrap,\n\t\tcssWindow,\n\t\tcssContent,\n\t\tcssCloseButton,\n\t\tcurrentTransitionBg,\n\t\tcurrentTransitionWindow,\n\t\tonOpen,\n\t\tonClose,\n\t\tonOpened,\n\t\tonClosed,\n\t\tisFunction,\n\t\tclose,\n\t\thandleKeydown,\n\t\thandleOuterMousedown,\n\t\thandleOuterMouseup,\n\t\tshow,\n\t\tkey,\n\t\tcloseButton,\n\t\tcloseOnEsc,\n\t\tcloseOnOuterClick,\n\t\tstyleBg,\n\t\tstyleWindowWrap,\n\t\tstyleWindow,\n\t\tstyleContent,\n\t\tstyleCloseButton,\n\t\tsetContext$1,\n\t\ttransitionBg,\n\t\ttransitionBgProps,\n\t\ttransitionWindow,\n\t\ttransitionWindowProps,\n\t\tisMounted,\n\t\t$$scope,\n\t\tslots,\n\t\tdiv1_binding,\n\t\tdiv2_binding,\n\t\tdiv3_binding\n\t];\n}\n\nclass Modal extends SvelteComponent {\n\tconstructor(options) {\n\t\tsuper();\n\n\t\tinit(\n\t\t\tthis,\n\t\t\toptions,\n\t\t\tinstance,\n\t\t\tcreate_fragment,\n\t\t\tsafe_not_equal,\n\t\t\t{\n\t\t\t\tshow: 21,\n\t\t\t\tkey: 22,\n\t\t\t\tcloseButton: 23,\n\t\t\t\tcloseOnEsc: 24,\n\t\t\t\tcloseOnOuterClick: 25,\n\t\t\t\tstyleBg: 26,\n\t\t\t\tstyleWindowWrap: 27,\n\t\t\t\tstyleWindow: 28,\n\t\t\t\tstyleContent: 29,\n\t\t\t\tstyleCloseButton: 30,\n\t\t\t\tsetContext: 31,\n\t\t\t\ttransitionBg: 32,\n\t\t\t\ttransitionBgProps: 33,\n\t\t\t\ttransitionWindow: 34,\n\t\t\t\ttransitionWindowProps: 35\n\t\t\t},\n\t\t\tadd_css,\n\t\t\t[-1, -1]\n\t\t);\n\t}\n}\n\nexport default Modal;\nexport { bind };\n", "import './PlayCredentials.svelte.css';\n/* src/components/PlayCredentials.svelte generated by Svelte v3.59.2 */\nimport {\n\tSvelteComponent,\n\tappend,\n\tattr,\n\tbinding_callbacks,\n\tdetach,\n\telement,\n\tinit,\n\tinsert,\n\tnoop,\n\tsafe_not_equal,\n\tspace\n} from \"../../_snowpack/pkg/svelte/internal.js\";\n\nimport { onMount } from \"../../_snowpack/pkg/svelte.js\";\n\nfunction create_fragment(ctx) {\n\tlet div;\n\tlet form;\n\tlet span;\n\tlet t1;\n\tlet input0;\n\tlet t2;\n\tlet input1;\n\n\treturn {\n\t\tc() {\n\t\t\tdiv = element(\"div\");\n\t\t\tform = element(\"form\");\n\t\t\tspan = element(\"span\");\n\t\t\tspan.textContent = \"Enter your email below to watch your pets video on your photo, t-shirt or mug\";\n\t\t\tt1 = space();\n\t\t\tinput0 = element(\"input\");\n\t\t\tt2 = space();\n\t\t\tinput1 = element(\"input\");\n\t\t\tattr(span, \"class\", \"label svelte-g8kenw\");\n\t\t\tattr(input0, \"type\", \"email\");\n\t\t\tattr(input0, \"name\", \"gn\");\n\t\t\tattr(input0, \"placeholder\", \"your email address\");\n\t\t\tattr(input0, \"class\", \"svelte-g8kenw\");\n\t\t\tattr(input1, \"type\", \"submit\");\n\t\t\tinput1.value = \"PLAY NOW!\";\n\t\t\tattr(input1, \"class\", \"svelte-g8kenw\");\n\t\t\tattr(form, \"action\", \"https://play.mypetar.com/list\");\n\t\t\tattr(form, \"method\", \"GET\");\n\t\t\tattr(div, \"class\", \"container svelte-g8kenw\");\n\t\t},\n\t\tm(target, anchor) {\n\t\t\tinsert(target, div, anchor);\n\t\t\tappend(div, form);\n\t\t\tappend(form, span);\n\t\t\tappend(form, t1);\n\t\t\tappend(form, input0);\n\t\t\t/*input0_binding*/ ctx[1](input0);\n\t\t\tappend(form, t2);\n\t\t\tappend(form, input1);\n\t\t},\n\t\tp: noop,\n\t\ti: noop,\n\t\to: noop,\n\t\td(detaching) {\n\t\t\tif (detaching) detach(div);\n\t\t\t/*input0_binding*/ ctx[1](null);\n\t\t}\n\t};\n}\n\nfunction instance($$self, $$props, $$invalidate) {\n\tonMount(async () => {\n\t\tgn.focus();\n\t});\n\n\tlet gn;\n\n\tfunction input0_binding($$value) {\n\t\tbinding_callbacks[$$value ? 'unshift' : 'push'](() => {\n\t\t\tgn = $$value;\n\t\t\t$$invalidate(0, gn);\n\t\t});\n\t}\n\n\treturn [gn, input0_binding];\n}\n\nclass PlayCredentials extends SvelteComponent {\n\tconstructor(options) {\n\t\tsuper();\n\t\tinit(this, options, instance, create_fragment, safe_not_equal, {});\n\t}\n}\n\nexport default PlayCredentials;", "import { writable } from '../_snowpack/pkg/svelte/store.js';\n\nexport const jwt = writable(\"\");\nexport const modal = writable(null);\nexport const playModal = writable(null);\nexport const cartItemCount = writable(0);\n", "/* src/components/MediaQuery.svelte generated by Svelte v3.59.2 */\nimport {\n\tSvelteComponent,\n\tcreate_slot,\n\tget_all_dirty_from_scope,\n\tget_slot_changes,\n\tinit,\n\tsafe_not_equal,\n\ttransition_in,\n\ttransition_out,\n\tupdate_slot_base\n} from \"../../_snowpack/pkg/svelte/internal.js\";\n\nimport { onMount } from \"../../_snowpack/pkg/svelte.js\";\nconst get_default_slot_changes = dirty => ({ matches: dirty & /*matches*/ 1 });\nconst get_default_slot_context = ctx => ({ matches: /*matches*/ ctx[0] });\n\nfunction create_fragment(ctx) {\n\tlet current;\n\tconst default_slot_template = /*#slots*/ ctx[4].default;\n\tconst default_slot = create_slot(default_slot_template, ctx, /*$$scope*/ ctx[3], get_default_slot_context);\n\n\treturn {\n\t\tc() {\n\t\t\tif (default_slot) default_slot.c();\n\t\t},\n\t\tm(target, anchor) {\n\t\t\tif (default_slot) {\n\t\t\t\tdefault_slot.m(target, anchor);\n\t\t\t}\n\n\t\t\tcurrent = true;\n\t\t},\n\t\tp(ctx, [dirty]) {\n\t\t\tif (default_slot) {\n\t\t\t\tif (default_slot.p && (!current || dirty & /*$$scope, matches*/ 9)) {\n\t\t\t\t\tupdate_slot_base(\n\t\t\t\t\t\tdefault_slot,\n\t\t\t\t\t\tdefault_slot_template,\n\t\t\t\t\t\tctx,\n\t\t\t\t\t\t/*$$scope*/ ctx[3],\n\t\t\t\t\t\t!current\n\t\t\t\t\t\t? get_all_dirty_from_scope(/*$$scope*/ ctx[3])\n\t\t\t\t\t\t: get_slot_changes(default_slot_template, /*$$scope*/ ctx[3], dirty, get_default_slot_changes),\n\t\t\t\t\t\tget_default_slot_context\n\t\t\t\t\t);\n\t\t\t\t}\n\t\t\t}\n\t\t},\n\t\ti(local) {\n\t\t\tif (current) return;\n\t\t\ttransition_in(default_slot, local);\n\t\t\tcurrent = true;\n\t\t},\n\t\to(local) {\n\t\t\ttransition_out(default_slot, local);\n\t\t\tcurrent = false;\n\t\t},\n\t\td(detaching) {\n\t\t\tif (default_slot) default_slot.d(detaching);\n\t\t}\n\t};\n}\n\nfunction instance($$self, $$props, $$invalidate) {\n\tlet { $$slots: slots = {}, $$scope } = $$props;\n\tlet { query } = $$props;\n\tlet mql;\n\tlet mqlListener;\n\tlet wasMounted = false;\n\tlet matches = false;\n\n\tonMount(() => {\n\t\t$$invalidate(2, wasMounted = true);\n\n\t\treturn () => {\n\t\t\tremoveActiveListener();\n\t\t};\n\t});\n\n\tfunction addNewListener(query) {\n\t\tmql = window.matchMedia(query);\n\t\tmqlListener = v => $$invalidate(0, matches = v.matches);\n\t\tmql.addEventListener(\"change\", mqlListener);\n\t\t$$invalidate(0, matches = mql.matches);\n\t}\n\n\tfunction removeActiveListener() {\n\t\tif (mql && mqlListener) {\n\t\t\tmql.removeEventListener(\"change\", mqlListener);\n\t\t}\n\t}\n\n\t$$self.$$set = $$props => {\n\t\tif ('query' in $$props) $$invalidate(1, query = $$props.query);\n\t\tif ('$$scope' in $$props) $$invalidate(3, $$scope = $$props.$$scope);\n\t};\n\n\t$$self.$$.update = () => {\n\t\tif ($$self.$$.dirty & /*wasMounted, query*/ 6) {\n\t\t\t$: {\n\t\t\t\tif (wasMounted) {\n\t\t\t\t\tremoveActiveListener();\n\t\t\t\t\taddNewListener(query);\n\t\t\t\t}\n\t\t\t}\n\t\t}\n\t};\n\n\treturn [matches, query, wasMounted, $$scope, slots];\n}\n\nclass MediaQuery extends SvelteComponent {\n\tconstructor(options) {\n\t\tsuper();\n\t\tinit(this, options, instance, create_fragment, safe_not_equal, { query: 1 });\n\t}\n}\n\nexport default MediaQuery;", "import './NavBar.svelte.css';\n/* src/components/NavBar.svelte generated by Svelte v3.59.2 */\nimport {\n\tSvelteComponent,\n\tappend,\n\tattr,\n\tcheck_outros,\n\tcomponent_subscribe,\n\tcreate_component,\n\tdestroy_component,\n\tdetach,\n\telement,\n\tempty,\n\tgroup_outros,\n\tinit,\n\tinsert,\n\tlisten,\n\tmount_component,\n\tnoop,\n\trun_all,\n\tsafe_not_equal,\n\tset_data,\n\tspace,\n\tsrc_url_equal,\n\ttext,\n\ttoggle_class,\n\ttransition_in,\n\ttransition_out\n} from \"../../_snowpack/pkg/svelte/internal.js\";\n\nimport { Link } from \"../../_snowpack/pkg/svelte-routing.js\";\nimport api from \"../ApiClient.js\";\nimport { onMount, onDestroy } from \"../../_snowpack/pkg/svelte.js\";\nimport { getSavedCheckoutId, setSavedCheckoutId, isMobile } from \"../util.js\";\nimport Modal from '../../_snowpack/pkg/svelte-simple-modal.js';\nimport { bind } from '../../_snowpack/pkg/svelte-simple-modal.js';\nimport PlayCredentials from \"./PlayCredentials.svelte.js\";\nimport { playModal } from \"../stores.js\";\nimport MediaQuery from \"./MediaQuery.svelte.js\";\nimport { cartItemCount } from '../stores.js';\n\nfunction create_else_block(ctx) {\n\tlet link;\n\tlet current;\n\n\tlink = new Link({\n\t\t\tprops: {\n\t\t\t\tstyle: \"height: 100%; position: absolute; left: 0;\",\n\t\t\t\tto: \"/\",\n\t\t\t\t$$slots: { default: [create_default_slot_2] },\n\t\t\t\t$$scope: { ctx }\n\t\t\t}\n\t\t});\n\n\treturn {\n\t\tc() {\n\t\t\tcreate_component(link.$$.fragment);\n\t\t},\n\t\tm(target, anchor) {\n\t\t\tmount_component(link, target, anchor);\n\t\t\tcurrent = true;\n\t\t},\n\t\ti(local) {\n\t\t\tif (current) return;\n\t\t\ttransition_in(link.$$.fragment, local);\n\t\t\tcurrent = true;\n\t\t},\n\t\to(local) {\n\t\t\ttransition_out(link.$$.fragment, local);\n\t\t\tcurrent = false;\n\t\t},\n\t\td(detaching) {\n\t\t\tdestroy_component(link, detaching);\n\t\t}\n\t};\n}\n\n// (77:4) {#if matches}\nfunction create_if_block_2(ctx) {\n\tlet link;\n\tlet current;\n\n\tlink = new Link({\n\t\t\tprops: {\n\t\t\t\tstyle: \"height: 100%; position: absolute; left: 0;\",\n\t\t\t\tto: \"/\",\n\t\t\t\t$$slots: { default: [create_default_slot_1] },\n\t\t\t\t$$scope: { ctx }\n\t\t\t}\n\t\t});\n\n\treturn {\n\t\tc() {\n\t\t\tcreate_component(link.$$.fragment);\n\t\t},\n\t\tm(target, anchor) {\n\t\t\tmount_component(link, target, anchor);\n\t\t\tcurrent = true;\n\t\t},\n\t\ti(local) {\n\t\t\tif (current) return;\n\t\t\ttransition_in(link.$$.fragment, local);\n\t\t\tcurrent = true;\n\t\t},\n\t\to(local) {\n\t\t\ttransition_out(link.$$.fragment, local);\n\t\t\tcurrent = false;\n\t\t},\n\t\td(detaching) {\n\t\t\tdestroy_component(link, detaching);\n\t\t}\n\t};\n}\n\n// (80:6) <Link style=\"height: 100%; position: absolute; left: 0;\" to=\"/\">\nfunction create_default_slot_2(ctx) {\n\tlet img;\n\tlet img_src_value;\n\n\treturn {\n\t\tc() {\n\t\t\timg = element(\"img\");\n\t\t\tattr(img, \"class\", \"logo svelte-sscidw\");\n\t\t\tif (!src_url_equal(img.src, img_src_value = \"/img/logo.png\")) attr(img, \"src\", img_src_value);\n\t\t\tattr(img, \"alt\", \"\");\n\t\t},\n\t\tm(target, anchor) {\n\t\t\tinsert(target, img, anchor);\n\t\t},\n\t\tp: noop,\n\t\td(detaching) {\n\t\t\tif (detaching) detach(img);\n\t\t}\n\t};\n}\n\n// (78:6) <Link style=\"height: 100%; position: absolute; left: 0;\" to=\"/\">\nfunction create_default_slot_1(ctx) {\n\tlet img;\n\tlet img_src_value;\n\n\treturn {\n\t\tc() {\n\t\t\timg = element(\"img\");\n\t\t\tattr(img, \"class\", \"logo svelte-sscidw\");\n\t\t\tif (!src_url_equal(img.src, img_src_value = \"/img/top-logo.png\")) attr(img, \"src\", img_src_value);\n\t\t\tattr(img, \"alt\", \"\");\n\t\t},\n\t\tm(target, anchor) {\n\t\t\tinsert(target, img, anchor);\n\t\t},\n\t\tp: noop,\n\t\td(detaching) {\n\t\t\tif (detaching) detach(img);\n\t\t}\n\t};\n}\n\n// (76:2) <MediaQuery query=\"only screen and (min-width: 769px)\" let:matches>\nfunction create_default_slot(ctx) {\n\tlet current_block_type_index;\n\tlet if_block;\n\tlet if_block_anchor;\n\tlet current;\n\tconst if_block_creators = [create_if_block_2, create_else_block];\n\tconst if_blocks = [];\n\n\tfunction select_block_type(ctx, dirty) {\n\t\tif (/*matches*/ ctx[11]) return 0;\n\t\treturn 1;\n\t}\n\n\tcurrent_block_type_index = select_block_type(ctx, -1);\n\tif_block = if_blocks[current_block_type_index] = if_block_creators[current_block_type_index](ctx);\n\n\treturn {\n\t\tc() {\n\t\t\tif_block.c();\n\t\t\tif_block_anchor = empty();\n\t\t},\n\t\tm(target, anchor) {\n\t\t\tif_blocks[current_block_type_index].m(target, anchor);\n\t\t\tinsert(target, if_block_anchor, anchor);\n\t\t\tcurrent = true;\n\t\t},\n\t\tp(ctx, dirty) {\n\t\t\tlet previous_block_index = current_block_type_index;\n\t\t\tcurrent_block_type_index = select_block_type(ctx, dirty);\n\n\t\t\tif (current_block_type_index !== previous_block_index) {\n\t\t\t\tgroup_outros();\n\n\t\t\t\ttransition_out(if_blocks[previous_block_index], 1, 1, () => {\n\t\t\t\t\tif_blocks[previous_block_index] = null;\n\t\t\t\t});\n\n\t\t\t\tcheck_outros();\n\t\t\t\tif_block = if_blocks[current_block_type_index];\n\n\t\t\t\tif (!if_block) {\n\t\t\t\t\tif_block = if_blocks[current_block_type_index] = if_block_creators[current_block_type_index](ctx);\n\t\t\t\t\tif_block.c();\n\t\t\t\t} else {\n\t\t\t\t\t\n\t\t\t\t}\n\n\t\t\t\ttransition_in(if_block, 1);\n\t\t\t\tif_block.m(if_block_anchor.parentNode, if_block_anchor);\n\t\t\t}\n\t\t},\n\t\ti(local) {\n\t\t\tif (current) return;\n\t\t\ttransition_in(if_block);\n\t\t\tcurrent = true;\n\t\t},\n\t\to(local) {\n\t\t\ttransition_out(if_block);\n\t\t\tcurrent = false;\n\t\t},\n\t\td(detaching) {\n\t\t\tif_blocks[current_block_type_index].d(detaching);\n\t\t\tif (detaching) detach(if_block_anchor);\n\t\t}\n\t};\n}\n\n// (83:2) {#if isMobile()}\nfunction create_if_block_1(ctx) {\n\tlet div;\n\tlet button;\n\tlet mounted;\n\tlet dispose;\n\n\treturn {\n\t\tc() {\n\t\t\tdiv = element(\"div\");\n\t\t\tbutton = element(\"button\");\n\t\t\tbutton.textContent = \"Watch MyPetAR\";\n\t\t\tattr(button, \"class\", \"watch-button svelte-sscidw\");\n\t\t\tattr(div, \"class\", \"watch-container svelte-sscidw\");\n\t\t},\n\t\tm(target, anchor) {\n\t\t\tinsert(target, div, anchor);\n\t\t\tappend(div, button);\n\n\t\t\tif (!mounted) {\n\t\t\t\tdispose = listen(button, \"click\", /*handlePlayModalOpen*/ ctx[6]);\n\t\t\t\tmounted = true;\n\t\t\t}\n\t\t},\n\t\tp: noop,\n\t\td(detaching) {\n\t\t\tif (detaching) detach(div);\n\t\t\tmounted = false;\n\t\t\tdispose();\n\t\t}\n\t};\n}\n\n// (93:18) {#if itemCount > 0}\nfunction create_if_block(ctx) {\n\tlet t0;\n\tlet t1_value = (/*itemCount*/ ctx[0] = /*itemCount*/ ctx[0]) + \"\";\n\tlet t1;\n\tlet t2;\n\n\treturn {\n\t\tc() {\n\t\t\tt0 = text(\"(\");\n\t\t\tt1 = text(t1_value);\n\t\t\tt2 = text(\")\");\n\t\t},\n\t\tm(target, anchor) {\n\t\t\tinsert(target, t0, anchor);\n\t\t\tinsert(target, t1, anchor);\n\t\t\tinsert(target, t2, anchor);\n\t\t},\n\t\tp(ctx, dirty) {\n\t\t\tif (dirty & /*itemCount*/ 1 && t1_value !== (t1_value = (/*itemCount*/ ctx[0] = /*itemCount*/ ctx[0]) + \"\")) set_data(t1, t1_value);\n\t\t},\n\t\td(detaching) {\n\t\t\tif (detaching) detach(t0);\n\t\t\tif (detaching) detach(t1);\n\t\t\tif (detaching) detach(t2);\n\t\t}\n\t};\n}\n\nfunction create_fragment(ctx) {\n\tlet div2;\n\tlet mediaquery;\n\tlet t0;\n\tlet show_if = isMobile();\n\tlet t1;\n\tlet img;\n\tlet img_src_value;\n\tlet t2;\n\tlet div1;\n\tlet div0;\n\tlet a0;\n\tlet t4;\n\tlet a1;\n\tlet t6;\n\tlet a2;\n\tlet t8;\n\tlet a3;\n\tlet span3;\n\tlet t9;\n\tlet t10;\n\tlet modal;\n\tlet current;\n\tlet mounted;\n\tlet dispose;\n\n\tmediaquery = new MediaQuery({\n\t\t\tprops: {\n\t\t\t\tquery: \"only screen and (min-width: 769px)\",\n\t\t\t\t$$slots: {\n\t\t\t\t\tdefault: [\n\t\t\t\t\t\tcreate_default_slot,\n\t\t\t\t\t\t({ matches }) => ({ 11: matches }),\n\t\t\t\t\t\t({ matches }) => matches ? 2048 : 0\n\t\t\t\t\t]\n\t\t\t\t},\n\t\t\t\t$$scope: { ctx }\n\t\t\t}\n\t\t});\n\n\tlet if_block0 = show_if && create_if_block_1(ctx);\n\tlet if_block1 = /*itemCount*/ ctx[0] > 0 && create_if_block(ctx);\n\n\tmodal = new Modal({\n\t\t\tprops: {\n\t\t\t\tshow: /*$playModal*/ ctx[3],\n\t\t\t\tcloseButton: false,\n\t\t\t\tstyleWindowWrap: { marginTop: \"-38%\" },\n\t\t\t\tstyleWindow: { background: \"#5cbdf9\" }\n\t\t\t}\n\t\t});\n\n\tmodal.$on(\"closed\", /*handlePlayModalClosed*/ ctx[7]);\n\n\treturn {\n\t\tc() {\n\t\t\tdiv2 = element(\"div\");\n\t\t\tcreate_component(mediaquery.$$.fragment);\n\t\t\tt0 = space();\n\t\t\tif (if_block0) if_block0.c();\n\t\t\tt1 = space();\n\t\t\timg = element(\"img\");\n\t\t\tt2 = space();\n\t\t\tdiv1 = element(\"div\");\n\t\t\tdiv0 = element(\"div\");\n\t\t\ta0 = element(\"a\");\n\t\t\ta0.innerHTML = `<span class=\"svelte-sscidw\">HOME</span>`;\n\t\t\tt4 = space();\n\t\t\ta1 = element(\"a\");\n\t\t\ta1.innerHTML = `<span class=\"svelte-sscidw\">ABOUT US</span>`;\n\t\t\tt6 = space();\n\t\t\ta2 = element(\"a\");\n\t\t\ta2.innerHTML = `<span class=\"svelte-sscidw\">FAQ</span>`;\n\t\t\tt8 = space();\n\t\t\ta3 = element(\"a\");\n\t\t\tspan3 = element(\"span\");\n\t\t\tt9 = text(\"CART\");\n\t\t\tif (if_block1) if_block1.c();\n\t\t\tt10 = space();\n\t\t\tcreate_component(modal.$$.fragment);\n\t\t\tif (!src_url_equal(img.src, img_src_value = \"/img/menu-icon.svg\")) attr(img, \"src\", img_src_value);\n\t\t\tattr(img, \"alt\", \"mypetar.com\");\n\t\t\tattr(img, \"class\", \"menu-icon svelte-sscidw\");\n\t\t\tattr(a0, \"href\", \"/\");\n\t\t\tattr(a0, \"class\", \"svelte-sscidw\");\n\t\t\tattr(a1, \"href\", \"/#about\");\n\t\t\tattr(a1, \"class\", \"svelte-sscidw\");\n\t\t\tattr(a2, \"href\", \"/#faq\");\n\t\t\tattr(a2, \"class\", \"svelte-sscidw\");\n\t\t\tattr(span3, \"class\", \"svelte-sscidw\");\n\t\t\tattr(a3, \"href\", \"/cart\");\n\t\t\tattr(a3, \"class\", \"svelte-sscidw\");\n\t\t\tattr(div0, \"class\", \"nav svelte-sscidw\");\n\t\t\tattr(div1, \"class\", \"drawer svelte-sscidw\");\n\t\t\ttoggle_class(div1, \"menuvisible\", /*menuvisible*/ ctx[2]);\n\t\t\tattr(div2, \"class\", \"navbar svelte-sscidw\");\n\t\t\ttoggle_class(div2, \"shadow\", /*shadow*/ ctx[1]);\n\t\t},\n\t\tm(target, anchor) {\n\t\t\tinsert(target, div2, anchor);\n\t\t\tmount_component(mediaquery, div2, null);\n\t\t\tappend(div2, t0);\n\t\t\tif (if_block0) if_block0.m(div2, null);\n\t\t\tappend(div2, t1);\n\t\t\tappend(div2, img);\n\t\t\tappend(div2, t2);\n\t\t\tappend(div2, div1);\n\t\t\tappend(div1, div0);\n\t\t\tappend(div0, a0);\n\t\t\tappend(div0, t4);\n\t\t\tappend(div0, a1);\n\t\t\tappend(div0, t6);\n\t\t\tappend(div0, a2);\n\t\t\tappend(div0, t8);\n\t\t\tappend(div0, a3);\n\t\t\tappend(a3, span3);\n\t\t\tappend(span3, t9);\n\t\t\tif (if_block1) if_block1.m(span3, null);\n\t\t\tinsert(target, t10, anchor);\n\t\t\tmount_component(modal, target, anchor);\n\t\t\tcurrent = true;\n\n\t\t\tif (!mounted) {\n\t\t\t\tdispose = [\n\t\t\t\t\tlisten(img, \"click\", /*handleMenuClick*/ ctx[4]),\n\t\t\t\t\tlisten(div0, \"click\", /*collapseIfMobile*/ ctx[5])\n\t\t\t\t];\n\n\t\t\t\tmounted = true;\n\t\t\t}\n\t\t},\n\t\tp(ctx, [dirty]) {\n\t\t\tconst mediaquery_changes = {};\n\n\t\t\tif (dirty & /*$$scope, matches*/ 6144) {\n\t\t\t\tmediaquery_changes.$$scope = { dirty, ctx };\n\t\t\t}\n\n\t\t\tmediaquery.$set(mediaquery_changes);\n\t\t\tif (show_if) if_block0.p(ctx, dirty);\n\n\t\t\tif (/*itemCount*/ ctx[0] > 0) {\n\t\t\t\tif (if_block1) {\n\t\t\t\t\tif_block1.p(ctx, dirty);\n\t\t\t\t} else {\n\t\t\t\t\tif_block1 = create_if_block(ctx);\n\t\t\t\t\tif_block1.c();\n\t\t\t\t\tif_block1.m(span3, null);\n\t\t\t\t}\n\t\t\t} else if (if_block1) {\n\t\t\t\tif_block1.d(1);\n\t\t\t\tif_block1 = null;\n\t\t\t}\n\n\t\t\tif (!current || dirty & /*menuvisible*/ 4) {\n\t\t\t\ttoggle_class(div1, \"menuvisible\", /*menuvisible*/ ctx[2]);\n\t\t\t}\n\n\t\t\tif (!current || dirty & /*shadow*/ 2) {\n\t\t\t\ttoggle_class(div2, \"shadow\", /*shadow*/ ctx[1]);\n\t\t\t}\n\n\t\t\tconst modal_changes = {};\n\t\t\tif (dirty & /*$playModal*/ 8) modal_changes.show = /*$playModal*/ ctx[3];\n\t\t\tmodal.$set(modal_changes);\n\t\t},\n\t\ti(local) {\n\t\t\tif (current) return;\n\t\t\ttransition_in(mediaquery.$$.fragment, local);\n\t\t\ttransition_in(modal.$$.fragment, local);\n\t\t\tcurrent = true;\n\t\t},\n\t\to(local) {\n\t\t\ttransition_out(mediaquery.$$.fragment, local);\n\t\t\ttransition_out(modal.$$.fragment, local);\n\t\t\tcurrent = false;\n\t\t},\n\t\td(detaching) {\n\t\t\tif (detaching) detach(div2);\n\t\t\tdestroy_component(mediaquery);\n\t\t\tif (if_block0) if_block0.d();\n\t\t\tif (if_block1) if_block1.d();\n\t\t\tif (detaching) detach(t10);\n\t\t\tdestroy_component(modal, detaching);\n\t\t\tmounted = false;\n\t\t\trun_all(dispose);\n\t\t}\n\t};\n}\n\nfunction instance($$self, $$props, $$invalidate) {\n\tlet $playModal;\n\tcomponent_subscribe($$self, playModal, $$value => $$invalidate(3, $playModal = $$value));\n\tlet itemCount = 0;\n\tlet checkoutId;\n\n\tonMount(async () => {\n\t\tplayModal.set();\n\n\t\t// See if the checkout id is still valid. Invalidate if need be.\n\t\tcheckoutId = getSavedCheckoutId();\n\n\t\tif (checkoutId) {\n\t\t\ttry {\n\t\t\t\tlet checkout = await api.getCheckout(checkoutId);\n\n\t\t\t\tif (checkout) {\n\t\t\t\t\t$$invalidate(0, itemCount = checkout.data.node.lineItems.edges.length);\n\n\t\t\t\t\tif (checkout.data.node.order) {\n\t\t\t\t\t\t// Order already created from checkout. Create new checkout.\n\t\t\t\t\t\tawait createCheckout();\n\n\t\t\t\t\t\tsetSavedCheckoutId(checkoutId);\n\t\t\t\t\t\t$$invalidate(0, itemCount = 0);\n\t\t\t\t\t}\n\t\t\t\t}\n\t\t\t} catch(err) {\n\t\t\t\tconsole.log(err);\n\t\t\t}\n\t\t}\n\t});\n\n\tlet shadow = false;\n\tlet menuvisible = false;\n\n\twindow.onscroll = () => {\n\t\tif (window.scrollY > 10) $$invalidate(1, shadow = true); else $$invalidate(1, shadow = false);\n\t};\n\n\tconst handleMenuClick = () => {\n\t\t$$invalidate(2, menuvisible = !menuvisible);\n\t};\n\n\tconst collapseIfMobile = () => menuvisible && handleMenuClick();\n\n\tconst handlePlayModalOpen = () => {\n\t\tplayModal.set(bind(PlayCredentials, {}));\n\t};\n\n\tconst handlePlayModalClosed = () => {\n\t\tplayModal.set();\n\t};\n\n\tconst unsubscribe = cartItemCount.subscribe(value => {\n\t\t$$invalidate(0, itemCount = value);\n\t});\n\n\tasync function createCheckout() {\n\t\tlet checkoutDeets = await api.createCheckout();\n\n\t\t// Set the checkout id, so we can eventually add items to it\n\t\tcheckoutId = checkoutDeets.data.checkoutCreate.checkout.id;\n\t}\n\n\tonDestroy(unsubscribe);\n\n\treturn [\n\t\titemCount,\n\t\tshadow,\n\t\tmenuvisible,\n\t\t$playModal,\n\t\thandleMenuClick,\n\t\tcollapseIfMobile,\n\t\thandlePlayModalOpen,\n\t\thandlePlayModalClosed\n\t];\n}\n\nclass NavBar extends SvelteComponent {\n\tconstructor(options) {\n\t\tsuper();\n\t\tinit(this, options, instance, create_fragment, safe_not_equal, {});\n\t}\n}\n\nexport default NavBar;", "import './ProductCTA.svelte.css';\n/* src/components/ProductCTA.svelte generated by Svelte v3.59.2 */\nimport {\n\tSvelteComponent,\n\tappend,\n\tattr,\n\tcreate_component,\n\tdestroy_component,\n\tdetach,\n\telement,\n\tinit,\n\tinsert,\n\tmount_component,\n\tsafe_not_equal,\n\tset_data,\n\tset_style,\n\tspace,\n\tsrc_url_equal,\n\ttext as text_1,\n\ttransition_in,\n\ttransition_out\n} from \"../../_snowpack/pkg/svelte/internal.js\";\n\nimport { Link } from \"../../_snowpack/pkg/svelte-routing.js\";\n\nfunction create_default_slot(ctx) {\n\tlet img;\n\tlet img_src_value;\n\n\treturn {\n\t\tc() {\n\t\t\timg = element(\"img\");\n\t\t\tset_style(img, \"border-color\", /*borderColor*/ ctx[0]);\n\t\t\tif (!src_url_equal(img.src, img_src_value = /*imgSrc*/ ctx[3])) attr(img, \"src\", img_src_value);\n\t\t\tattr(img, \"alt\", \"\");\n\t\t\tattr(img, \"class\", \"svelte-hw5n6i\");\n\t\t},\n\t\tm(target, anchor) {\n\t\t\tinsert(target, img, anchor);\n\t\t},\n\t\tp(ctx, dirty) {\n\t\t\tif (dirty & /*borderColor*/ 1) {\n\t\t\t\tset_style(img, \"border-color\", /*borderColor*/ ctx[0]);\n\t\t\t}\n\n\t\t\tif (dirty & /*imgSrc*/ 8 && !src_url_equal(img.src, img_src_value = /*imgSrc*/ ctx[3])) {\n\t\t\t\tattr(img, \"src\", img_src_value);\n\t\t\t}\n\t\t},\n\t\td(detaching) {\n\t\t\tif (detaching) detach(img);\n\t\t}\n\t};\n}\n\nfunction create_fragment(ctx) {\n\tlet div;\n\tlet p;\n\tlet t0_value = (/*text*/ ctx[1] ? /*text*/ ctx[1] : \"\") + \"\";\n\tlet t0;\n\tlet t1;\n\tlet link;\n\tlet current;\n\n\tlink = new Link({\n\t\t\tprops: {\n\t\t\t\tto: \"/products/\" + /*type*/ ctx[2],\n\t\t\t\t$$slots: { default: [create_default_slot] },\n\t\t\t\t$$scope: { ctx }\n\t\t\t}\n\t\t});\n\n\treturn {\n\t\tc() {\n\t\t\tdiv = element(\"div\");\n\t\t\tp = element(\"p\");\n\t\t\tt0 = text_1(t0_value);\n\t\t\tt1 = space();\n\t\t\tcreate_component(link.$$.fragment);\n\t\t\tset_style(p, \"color\", /*borderColor*/ ctx[0]);\n\t\t\tattr(p, \"class\", \"svelte-hw5n6i\");\n\t\t\tattr(div, \"class\", \"svelte-hw5n6i\");\n\t\t},\n\t\tm(target, anchor) {\n\t\t\tinsert(target, div, anchor);\n\t\t\tappend(div, p);\n\t\t\tappend(p, t0);\n\t\t\tappend(div, t1);\n\t\t\tmount_component(link, div, null);\n\t\t\tcurrent = true;\n\t\t},\n\t\tp(ctx, [dirty]) {\n\t\t\tif ((!current || dirty & /*text*/ 2) && t0_value !== (t0_value = (/*text*/ ctx[1] ? /*text*/ ctx[1] : \"\") + \"\")) set_data(t0, t0_value);\n\n\t\t\tif (!current || dirty & /*borderColor*/ 1) {\n\t\t\t\tset_style(p, \"color\", /*borderColor*/ ctx[0]);\n\t\t\t}\n\n\t\t\tconst link_changes = {};\n\t\t\tif (dirty & /*type*/ 4) link_changes.to = \"/products/\" + /*type*/ ctx[2];\n\n\t\t\tif (dirty & /*$$scope, borderColor, imgSrc*/ 25) {\n\t\t\t\tlink_changes.$$scope = { dirty, ctx };\n\t\t\t}\n\n\t\t\tlink.$set(link_changes);\n\t\t},\n\t\ti(local) {\n\t\t\tif (current) return;\n\t\t\ttransition_in(link.$$.fragment, local);\n\t\t\tcurrent = true;\n\t\t},\n\t\to(local) {\n\t\t\ttransition_out(link.$$.fragment, local);\n\t\t\tcurrent = false;\n\t\t},\n\t\td(detaching) {\n\t\t\tif (detaching) detach(div);\n\t\t\tdestroy_component(link);\n\t\t}\n\t};\n}\n\nfunction instance($$self, $$props, $$invalidate) {\n\tlet { borderColor } = $$props;\n\tlet { text } = $$props;\n\tlet { type } = $$props;\n\tlet { imgSrc } = $$props;\n\n\t$$self.$$set = $$props => {\n\t\tif ('borderColor' in $$props) $$invalidate(0, borderColor = $$props.borderColor);\n\t\tif ('text' in $$props) $$invalidate(1, text = $$props.text);\n\t\tif ('type' in $$props) $$invalidate(2, type = $$props.type);\n\t\tif ('imgSrc' in $$props) $$invalidate(3, imgSrc = $$props.imgSrc);\n\t};\n\n\treturn [borderColor, text, type, imgSrc];\n}\n\nclass ProductCTA extends SvelteComponent {\n\tconstructor(options) {\n\t\tsuper();\n\n\t\tinit(this, options, instance, create_fragment, safe_not_equal, {\n\t\t\tborderColor: 0,\n\t\t\ttext: 1,\n\t\t\ttype: 2,\n\t\t\timgSrc: 3\n\t\t});\n\t}\n}\n\nexport default ProductCTA;", "import './Products.svelte.css';\n/* src/components/Products.svelte generated by Svelte v3.59.2 */\nimport {\n\tSvelteComponent,\n\tappend,\n\tattr,\n\tcreate_component,\n\tdestroy_component,\n\tdetach,\n\telement,\n\tinit,\n\tinsert,\n\tmount_component,\n\tnoop,\n\tsafe_not_equal,\n\tspace,\n\ttransition_in,\n\ttransition_out\n} from \"../../_snowpack/pkg/svelte/internal.js\";\n\nimport ProductCTA from \"./ProductCTA.svelte.js\";\n\nfunction create_fragment(ctx) {\n\tlet a;\n\tlet t;\n\tlet div2;\n\tlet div1;\n\tlet div0;\n\tlet productcta;\n\tlet current;\n\n\tproductcta = new ProductCTA({\n\t\t\tprops: {\n\t\t\t\tborderColor: \"#ff89de\",\n\t\t\t\ttext: \"BUY PHOTOS\",\n\t\t\t\ttype: \"photo\",\n\t\t\t\timgSrc: \"/img/photo_product.png\"\n\t\t\t}\n\t\t});\n\n\treturn {\n\t\tc() {\n\t\t\ta = element(\"a\");\n\t\t\tt = space();\n\t\t\tdiv2 = element(\"div\");\n\t\t\tdiv1 = element(\"div\");\n\t\t\tdiv0 = element(\"div\");\n\t\t\tcreate_component(productcta.$$.fragment);\n\t\t\tattr(a, \"id\", \"products-anchor\");\n\t\t\tattr(a, \"class\", \"svelte-1n5m1e1\");\n\t\t\tattr(div0, \"class\", \"product svelte-1n5m1e1\");\n\t\t\tattr(div1, \"class\", \"collection svelte-1n5m1e1\");\n\t\t\tattr(div2, \"class\", \"container svelte-1n5m1e1\");\n\t\t},\n\t\tm(target, anchor) {\n\t\t\tinsert(target, a, anchor);\n\t\t\tinsert(target, t, anchor);\n\t\t\tinsert(target, div2, anchor);\n\t\t\tappend(div2, div1);\n\t\t\tappend(div1, div0);\n\t\t\tmount_component(productcta, div0, null);\n\t\t\tcurrent = true;\n\t\t},\n\t\tp: noop,\n\t\ti(local) {\n\t\t\tif (current) return;\n\t\t\ttransition_in(productcta.$$.fragment, local);\n\t\t\tcurrent = true;\n\t\t},\n\t\to(local) {\n\t\t\ttransition_out(productcta.$$.fragment, local);\n\t\t\tcurrent = false;\n\t\t},\n\t\td(detaching) {\n\t\t\tif (detaching) detach(a);\n\t\t\tif (detaching) detach(t);\n\t\t\tif (detaching) detach(div2);\n\t\t\tdestroy_component(productcta);\n\t\t}\n\t};\n}\n\nclass Products extends SvelteComponent {\n\tconstructor(options) {\n\t\tsuper();\n\t\tinit(this, options, null, create_fragment, safe_not_equal, {});\n\t}\n}\n\nexport default Products;", "import './About.svelte.css';\n/* src/components/About.svelte generated by Svelte v3.59.2 */\nimport {\n\tSvelteComponent,\n\tattr,\n\tdetach,\n\telement,\n\tinit,\n\tinsert,\n\tnoop,\n\tsafe_not_equal,\n\tspace\n} from \"../../_snowpack/pkg/svelte/internal.js\";\n\nfunction create_fragment(ctx) {\n\tlet a;\n\tlet t0;\n\tlet div3;\n\n\treturn {\n\t\tc() {\n\t\t\ta = element(\"a\");\n\t\t\tt0 = space();\n\t\t\tdiv3 = element(\"div\");\n\n\t\t\tdiv3.innerHTML = `<div class=\"main svelte-1pcw95m\"><div class=\"header svelte-1pcw95m\"><img src=\"/img/about_us.png\" alt=\"About Us\" class=\"svelte-1pcw95m\"/></div> \n    <div class=\"content svelte-1pcw95m\"><h1 class=\"svelte-1pcw95m\">ABOUT US</h1> \n      <p class=\"svelte-1pcw95m\">We are a team of pet owners and animal lovers who work in the tech industry.  We wanted to create something special and memorable for fellow pet lovers to enjoy so we decided to add an extra layer of love to our products. Through the power of technology, we created memorable keepsakes where you can relive your favorite pet video moments just by placing your smartphone over your customized item.</p></div></div>`;\n\n\t\t\tattr(a, \"id\", \"about\");\n\t\t\tattr(div3, \"class\", \"container svelte-1pcw95m\");\n\t\t},\n\t\tm(target, anchor) {\n\t\t\tinsert(target, a, anchor);\n\t\t\tinsert(target, t0, anchor);\n\t\t\tinsert(target, div3, anchor);\n\t\t},\n\t\tp: noop,\n\t\ti: noop,\n\t\to: noop,\n\t\td(detaching) {\n\t\t\tif (detaching) detach(a);\n\t\t\tif (detaching) detach(t0);\n\t\t\tif (detaching) detach(div3);\n\t\t}\n\t};\n}\n\nclass About extends SvelteComponent {\n\tconstructor(options) {\n\t\tsuper();\n\t\tinit(this, options, null, create_fragment, safe_not_equal, {});\n\t}\n}\n\nexport default About;", "import './Infomercial.svelte.css';\n/* src/components/Infomercial.svelte generated by Svelte v3.59.2 */\nimport {\n\tSvelteComponent,\n\tappend,\n\tattr,\n\tbinding_callbacks,\n\tcreate_component,\n\tdestroy_component,\n\tdetach,\n\telement,\n\tempty,\n\tinit,\n\tinsert,\n\tlisten,\n\tmount_component,\n\tnoop,\n\tsafe_not_equal,\n\tspace,\n\tsrc_url_equal,\n\ttransition_in,\n\ttransition_out\n} from \"../../_snowpack/pkg/svelte/internal.js\";\n\nimport { onMount } from \"../../_snowpack/pkg/svelte.js\";\nimport MediaQuery from \"./MediaQuery.svelte.js\";\n\nfunction create_else_block(ctx) {\n\tlet div0;\n\tlet video;\n\tlet video_src_value;\n\tlet t;\n\tlet div1;\n\tlet mounted;\n\tlet dispose;\n\n\treturn {\n\t\tc() {\n\t\t\tdiv0 = element(\"div\");\n\t\t\tvideo = element(\"video\");\n\t\t\tt = space();\n\t\t\tdiv1 = element(\"div\");\n\t\t\tdiv1.innerHTML = `<img src=\"/img/dog-side.png\" alt=\"Infomercial\" class=\"svelte-hxdzbr\"/>`;\n\t\t\tvideo.controls = true;\n\t\t\tif (!src_url_equal(video.src, video_src_value = \"/vid/infomercial.mp4#t=0.5\")) attr(video, \"src\", video_src_value);\n\t\t\tattr(video, \"class\", \"svelte-hxdzbr\");\n\t\t\tattr(div0, \"class\", \"content svelte-hxdzbr\");\n\t\t\tattr(div1, \"class\", \"header svelte-hxdzbr\");\n\t\t},\n\t\tm(target, anchor) {\n\t\t\tinsert(target, div0, anchor);\n\t\t\tappend(div0, video);\n\t\t\t/*video_binding_1*/ ctx[4](video);\n\t\t\tinsert(target, t, anchor);\n\t\t\tinsert(target, div1, anchor);\n\n\t\t\tif (!mounted) {\n\t\t\t\tdispose = listen(video, \"loadedmetadata\", /*loadedmetadata_handler_1*/ ctx[3]);\n\t\t\t\tmounted = true;\n\t\t\t}\n\t\t},\n\t\tp: noop,\n\t\td(detaching) {\n\t\t\tif (detaching) detach(div0);\n\t\t\t/*video_binding_1*/ ctx[4](null);\n\t\t\tif (detaching) detach(t);\n\t\t\tif (detaching) detach(div1);\n\t\t\tmounted = false;\n\t\t\tdispose();\n\t\t}\n\t};\n}\n\n// (10:6) {#if matches}\nfunction create_if_block(ctx) {\n\tlet div0;\n\tlet t;\n\tlet div1;\n\tlet video;\n\tlet video_src_value;\n\tlet mounted;\n\tlet dispose;\n\n\treturn {\n\t\tc() {\n\t\t\tdiv0 = element(\"div\");\n\t\t\tdiv0.innerHTML = `<img src=\"/img/dog-side.png\" alt=\"Infomercial\" class=\"svelte-hxdzbr\"/>`;\n\t\t\tt = space();\n\t\t\tdiv1 = element(\"div\");\n\t\t\tvideo = element(\"video\");\n\t\t\tattr(div0, \"class\", \"header svelte-hxdzbr\");\n\t\t\tvideo.controls = true;\n\t\t\tif (!src_url_equal(video.src, video_src_value = \"/vid/infomercial.mp4#t=0.5\")) attr(video, \"src\", video_src_value);\n\t\t\tattr(video, \"class\", \"svelte-hxdzbr\");\n\t\t\tattr(div1, \"class\", \"content svelte-hxdzbr\");\n\t\t},\n\t\tm(target, anchor) {\n\t\t\tinsert(target, div0, anchor);\n\t\t\tinsert(target, t, anchor);\n\t\t\tinsert(target, div1, anchor);\n\t\t\tappend(div1, video);\n\t\t\t/*video_binding*/ ctx[2](video);\n\n\t\t\tif (!mounted) {\n\t\t\t\tdispose = listen(video, \"loadedmetadata\", /*loadedmetadata_handler*/ ctx[1]);\n\t\t\t\tmounted = true;\n\t\t\t}\n\t\t},\n\t\tp: noop,\n\t\td(detaching) {\n\t\t\tif (detaching) detach(div0);\n\t\t\tif (detaching) detach(t);\n\t\t\tif (detaching) detach(div1);\n\t\t\t/*video_binding*/ ctx[2](null);\n\t\t\tmounted = false;\n\t\t\tdispose();\n\t\t}\n\t};\n}\n\n// (9:4) <MediaQuery query=\"only screen and (min-width: 769px)\" let:matches>\nfunction create_default_slot(ctx) {\n\tlet if_block_anchor;\n\n\tfunction select_block_type(ctx, dirty) {\n\t\tif (/*matches*/ ctx[5]) return create_if_block;\n\t\treturn create_else_block;\n\t}\n\n\tlet current_block_type = select_block_type(ctx, -1);\n\tlet if_block = current_block_type(ctx);\n\n\treturn {\n\t\tc() {\n\t\t\tif_block.c();\n\t\t\tif_block_anchor = empty();\n\t\t},\n\t\tm(target, anchor) {\n\t\t\tif_block.m(target, anchor);\n\t\t\tinsert(target, if_block_anchor, anchor);\n\t\t},\n\t\tp(ctx, dirty) {\n\t\t\tif (current_block_type === (current_block_type = select_block_type(ctx, dirty)) && if_block) {\n\t\t\t\tif_block.p(ctx, dirty);\n\t\t\t} else {\n\t\t\t\tif_block.d(1);\n\t\t\t\tif_block = current_block_type(ctx);\n\n\t\t\t\tif (if_block) {\n\t\t\t\t\tif_block.c();\n\t\t\t\t\tif_block.m(if_block_anchor.parentNode, if_block_anchor);\n\t\t\t\t}\n\t\t\t}\n\t\t},\n\t\td(detaching) {\n\t\t\tif_block.d(detaching);\n\t\t\tif (detaching) detach(if_block_anchor);\n\t\t}\n\t};\n}\n\nfunction create_fragment(ctx) {\n\tlet div1;\n\tlet div0;\n\tlet mediaquery;\n\tlet current;\n\n\tmediaquery = new MediaQuery({\n\t\t\tprops: {\n\t\t\t\tquery: \"only screen and (min-width: 769px)\",\n\t\t\t\t$$slots: {\n\t\t\t\t\tdefault: [\n\t\t\t\t\t\tcreate_default_slot,\n\t\t\t\t\t\t({ matches }) => ({ 5: matches }),\n\t\t\t\t\t\t({ matches }) => matches ? 32 : 0\n\t\t\t\t\t]\n\t\t\t\t},\n\t\t\t\t$$scope: { ctx }\n\t\t\t}\n\t\t});\n\n\treturn {\n\t\tc() {\n\t\t\tdiv1 = element(\"div\");\n\t\t\tdiv0 = element(\"div\");\n\t\t\tcreate_component(mediaquery.$$.fragment);\n\t\t\tattr(div0, \"class\", \"main svelte-hxdzbr\");\n\t\t\tattr(div1, \"class\", \"container svelte-hxdzbr\");\n\t\t},\n\t\tm(target, anchor) {\n\t\t\tinsert(target, div1, anchor);\n\t\t\tappend(div1, div0);\n\t\t\tmount_component(mediaquery, div0, null);\n\t\t\tcurrent = true;\n\t\t},\n\t\tp(ctx, [dirty]) {\n\t\t\tconst mediaquery_changes = {};\n\n\t\t\tif (dirty & /*$$scope, vid, matches*/ 97) {\n\t\t\t\tmediaquery_changes.$$scope = { dirty, ctx };\n\t\t\t}\n\n\t\t\tmediaquery.$set(mediaquery_changes);\n\t\t},\n\t\ti(local) {\n\t\t\tif (current) return;\n\t\t\ttransition_in(mediaquery.$$.fragment, local);\n\t\t\tcurrent = true;\n\t\t},\n\t\to(local) {\n\t\t\ttransition_out(mediaquery.$$.fragment, local);\n\t\t\tcurrent = false;\n\t\t},\n\t\td(detaching) {\n\t\t\tif (detaching) detach(div1);\n\t\t\tdestroy_component(mediaquery);\n\t\t}\n\t};\n}\n\nfunction instance($$self, $$props, $$invalidate) {\n\tlet vid;\n\tconst loadedmetadata_handler = () => $$invalidate(0, vid.currentTime = 0.5, vid);\n\n\tfunction video_binding($$value) {\n\t\tbinding_callbacks[$$value ? 'unshift' : 'push'](() => {\n\t\t\tvid = $$value;\n\t\t\t$$invalidate(0, vid);\n\t\t});\n\t}\n\n\tconst loadedmetadata_handler_1 = () => $$invalidate(0, vid.currentTime = 0.5, vid);\n\n\tfunction video_binding_1($$value) {\n\t\tbinding_callbacks[$$value ? 'unshift' : 'push'](() => {\n\t\t\tvid = $$value;\n\t\t\t$$invalidate(0, vid);\n\t\t});\n\t}\n\n\treturn [\n\t\tvid,\n\t\tloadedmetadata_handler,\n\t\tvideo_binding,\n\t\tloadedmetadata_handler_1,\n\t\tvideo_binding_1\n\t];\n}\n\nclass Infomercial extends SvelteComponent {\n\tconstructor(options) {\n\t\tsuper();\n\t\tinit(this, options, instance, create_fragment, safe_not_equal, {});\n\t}\n}\n\nexport default Infomercial;", "import './FAQ.svelte.css';\n/* src/components/FAQ.svelte generated by Svelte v3.59.2 */\nimport {\n\tSvelteComponent,\n\tattr,\n\tdetach,\n\telement,\n\tinit,\n\tinsert,\n\tnoop,\n\tsafe_not_equal,\n\tspace\n} from \"../../_snowpack/pkg/svelte/internal.js\";\n\nfunction create_fragment(ctx) {\n\tlet a0;\n\tlet t0;\n\tlet div1;\n\n\treturn {\n\t\tc() {\n\t\t\ta0 = element(\"a\");\n\t\t\tt0 = space();\n\t\t\tdiv1 = element(\"div\");\n\n\t\t\tdiv1.innerHTML = `<div class=\"text svelte-1hovk8v\"><h1 class=\"svelte-1hovk8v\">FAQ</h1> \n    <ul class=\"svelte-1hovk8v\"><li class=\"svelte-1hovk8v\"><span class=\"question svelte-1hovk8v\">How do I view my pet&#39;s video?</span> \n        <ul class=\"svelte-1hovk8v\"><li class=\"svelte-1hovk8v\">Upon receiving your package, head over to MyPetAR.com on your smartphone and click on <strong>Watch MyPetAR</strong> located at the top of your screen. Enter the email address used to place the order, follow the prompts and enjoy!</li></ul></li> \n      <li class=\"svelte-1hovk8v\"><span class=\"question svelte-1hovk8v\">Do you accept returns?</span> \n        <ul class=\"svelte-1hovk8v\"><li class=\"svelte-1hovk8v\">Yes we do.  We have a 100% money back guarantee policy. Please see our return policy <a href=\"/return-policy\">here</a>.</li></ul></li> \n      <li class=\"svelte-1hovk8v\"><span class=\"question svelte-1hovk8v\">Shipping</span> \n        <ul class=\"svelte-1hovk8v\"><li class=\"svelte-1hovk8v\">Do you ship anywhere?\n            <ul class=\"svelte-1hovk8v\"><li class=\"svelte-1hovk8v\">We currently only ship to the United States and Canada.  We currently do not ship to P.O. boxes or APO/FPO addresses.</li></ul></li> \n          <li class=\"svelte-1hovk8v\">Do you have expedited shipping?\n            <ul class=\"svelte-1hovk8v\"><li class=\"svelte-1hovk8v\">Yes. All shipping options and rates will be calculated at checkout.</li></ul></li> \n          <li class=\"svelte-1hovk8v\">Do I have to pay any customs fees?\n            <ul class=\"svelte-1hovk8v\"><li class=\"svelte-1hovk8v\">Customs policies vary from country to country. All applicable fees, taxes and duties are your responsibility.</li></ul></li></ul></li> \n      <li class=\"svelte-1hovk8v\"><span class=\"question svelte-1hovk8v\">How do I become a MyPetAR affiliate?</span> \n        <ul class=\"svelte-1hovk8v\"><li class=\"svelte-1hovk8v\">Please click <a href=\"/affiliate\">here</a> to apply to be a MyPetAR affiliate.</li></ul></li></ul></div>`;\n\n\t\t\tattr(a0, \"id\", \"faq\");\n\t\t\tattr(div1, \"class\", \"container svelte-1hovk8v\");\n\t\t},\n\t\tm(target, anchor) {\n\t\t\tinsert(target, a0, anchor);\n\t\t\tinsert(target, t0, anchor);\n\t\t\tinsert(target, div1, anchor);\n\t\t},\n\t\tp: noop,\n\t\ti: noop,\n\t\to: noop,\n\t\td(detaching) {\n\t\t\tif (detaching) detach(a0);\n\t\t\tif (detaching) detach(t0);\n\t\t\tif (detaching) detach(div1);\n\t\t}\n\t};\n}\n\nclass FAQ extends SvelteComponent {\n\tconstructor(options) {\n\t\tsuper();\n\t\tinit(this, options, null, create_fragment, safe_not_equal, {});\n\t}\n}\n\nexport default FAQ;", "import './Banner.svelte.css';\n/* src/components/Banner.svelte generated by Svelte v3.59.2 */\nimport {\n\tSvelteComponent,\n\tattr,\n\tdetach,\n\telement,\n\tinit,\n\tinsert,\n\tnoop,\n\tsafe_not_equal\n} from \"../../_snowpack/pkg/svelte/internal.js\";\n\nfunction create_fragment(ctx) {\n\tlet div;\n\n\treturn {\n\t\tc() {\n\t\t\tdiv = element(\"div\");\n\t\t\tattr(div, \"class\", \"svelte-1qb2s4y\");\n\t\t},\n\t\tm(target, anchor) {\n\t\t\tinsert(target, div, anchor);\n\t\t},\n\t\tp: noop,\n\t\ti: noop,\n\t\to: noop,\n\t\td(detaching) {\n\t\t\tif (detaching) detach(div);\n\t\t}\n\t};\n}\n\nclass Banner extends SvelteComponent {\n\tconstructor(options) {\n\t\tsuper();\n\t\tinit(this, options, null, create_fragment, safe_not_equal, {});\n\t}\n}\n\nexport default Banner;", "import './OffsetButtons.svelte.css';\n/* src/components/OffsetButtons.svelte generated by Svelte v3.59.2 */\nimport {\n\tSvelteComponent,\n\tattr,\n\tbubble,\n\tcreate_slot,\n\tdetach,\n\telement,\n\tget_all_dirty_from_scope,\n\tget_slot_changes,\n\tinit,\n\tinsert,\n\tlisten,\n\tsafe_not_equal,\n\ttoggle_class,\n\ttransition_in,\n\ttransition_out,\n\tupdate_slot_base\n} from \"../../_snowpack/pkg/svelte/internal.js\";\n\nfunction create_fragment(ctx) {\n\tlet button;\n\tlet button_style_value;\n\tlet current;\n\tlet mounted;\n\tlet dispose;\n\tconst default_slot_template = /*#slots*/ ctx[8].default;\n\tconst default_slot = create_slot(default_slot_template, ctx, /*$$scope*/ ctx[7], null);\n\n\treturn {\n\t\tc() {\n\t\t\tbutton = element(\"button\");\n\t\t\tif (default_slot) default_slot.c();\n\t\t\tattr(button, \"style\", button_style_value = \"--theme-color:\" + /*color*/ ctx[1] + \"; \" + (/*width*/ ctx[2] ? `width: ${/*width*/ ctx[2]};` : '') + \" \" + (/*height*/ ctx[3] ? `height: ${/*height*/ ctx[3]};` : '') + \" \" + /*customStyle*/ ctx[4] + \";\");\n\t\t\tbutton.disabled = /*disabled*/ ctx[6];\n\t\t\tattr(button, \"class\", \"svelte-1rasphl\");\n\t\t\ttoggle_class(button, \"big\", /*big*/ ctx[0]);\n\t\t\ttoggle_class(button, \"dark\", /*theme*/ ctx[5] === 'dark');\n\t\t\ttoggle_class(button, \"disabled\", /*disabled*/ ctx[6]);\n\t\t},\n\t\tm(target, anchor) {\n\t\t\tinsert(target, button, anchor);\n\n\t\t\tif (default_slot) {\n\t\t\t\tdefault_slot.m(button, null);\n\t\t\t}\n\n\t\t\tcurrent = true;\n\n\t\t\tif (!mounted) {\n\t\t\t\tdispose = listen(button, \"click\", /*click_handler*/ ctx[9]);\n\t\t\t\tmounted = true;\n\t\t\t}\n\t\t},\n\t\tp(ctx, [dirty]) {\n\t\t\tif (default_slot) {\n\t\t\t\tif (default_slot.p && (!current || dirty & /*$$scope*/ 128)) {\n\t\t\t\t\tupdate_slot_base(\n\t\t\t\t\t\tdefault_slot,\n\t\t\t\t\t\tdefault_slot_template,\n\t\t\t\t\t\tctx,\n\t\t\t\t\t\t/*$$scope*/ ctx[7],\n\t\t\t\t\t\t!current\n\t\t\t\t\t\t? get_all_dirty_from_scope(/*$$scope*/ ctx[7])\n\t\t\t\t\t\t: get_slot_changes(default_slot_template, /*$$scope*/ ctx[7], dirty, null),\n\t\t\t\t\t\tnull\n\t\t\t\t\t);\n\t\t\t\t}\n\t\t\t}\n\n\t\t\tif (!current || dirty & /*color, width, height, customStyle*/ 30 && button_style_value !== (button_style_value = \"--theme-color:\" + /*color*/ ctx[1] + \"; \" + (/*width*/ ctx[2] ? `width: ${/*width*/ ctx[2]};` : '') + \" \" + (/*height*/ ctx[3] ? `height: ${/*height*/ ctx[3]};` : '') + \" \" + /*customStyle*/ ctx[4] + \";\")) {\n\t\t\t\tattr(button, \"style\", button_style_value);\n\t\t\t}\n\n\t\t\tif (!current || dirty & /*disabled*/ 64) {\n\t\t\t\tbutton.disabled = /*disabled*/ ctx[6];\n\t\t\t}\n\n\t\t\tif (!current || dirty & /*big*/ 1) {\n\t\t\t\ttoggle_class(button, \"big\", /*big*/ ctx[0]);\n\t\t\t}\n\n\t\t\tif (!current || dirty & /*theme*/ 32) {\n\t\t\t\ttoggle_class(button, \"dark\", /*theme*/ ctx[5] === 'dark');\n\t\t\t}\n\n\t\t\tif (!current || dirty & /*disabled*/ 64) {\n\t\t\t\ttoggle_class(button, \"disabled\", /*disabled*/ ctx[6]);\n\t\t\t}\n\t\t},\n\t\ti(local) {\n\t\t\tif (current) return;\n\t\t\ttransition_in(default_slot, local);\n\t\t\tcurrent = true;\n\t\t},\n\t\to(local) {\n\t\t\ttransition_out(default_slot, local);\n\t\t\tcurrent = false;\n\t\t},\n\t\td(detaching) {\n\t\t\tif (detaching) detach(button);\n\t\t\tif (default_slot) default_slot.d(detaching);\n\t\t\tmounted = false;\n\t\t\tdispose();\n\t\t}\n\t};\n}\n\nfunction instance($$self, $$props, $$invalidate) {\n\tlet { $$slots: slots = {}, $$scope } = $$props;\n\tlet { big = false } = $$props;\n\tlet { color = \"lightgreen\" } = $$props;\n\tlet { width } = $$props;\n\tlet { height } = $$props;\n\tlet { customStyle = \"\" } = $$props;\n\tlet { theme } = $$props;\n\tlet { disabled = false } = $$props;\n\n\tfunction click_handler(event) {\n\t\tbubble.call(this, $$self, event);\n\t}\n\n\t$$self.$$set = $$props => {\n\t\tif ('big' in $$props) $$invalidate(0, big = $$props.big);\n\t\tif ('color' in $$props) $$invalidate(1, color = $$props.color);\n\t\tif ('width' in $$props) $$invalidate(2, width = $$props.width);\n\t\tif ('height' in $$props) $$invalidate(3, height = $$props.height);\n\t\tif ('customStyle' in $$props) $$invalidate(4, customStyle = $$props.customStyle);\n\t\tif ('theme' in $$props) $$invalidate(5, theme = $$props.theme);\n\t\tif ('disabled' in $$props) $$invalidate(6, disabled = $$props.disabled);\n\t\tif ('$$scope' in $$props) $$invalidate(7, $$scope = $$props.$$scope);\n\t};\n\n\treturn [\n\t\tbig,\n\t\tcolor,\n\t\twidth,\n\t\theight,\n\t\tcustomStyle,\n\t\ttheme,\n\t\tdisabled,\n\t\t$$scope,\n\t\tslots,\n\t\tclick_handler\n\t];\n}\n\nclass OffsetButtons extends SvelteComponent {\n\tconstructor(options) {\n\t\tsuper();\n\n\t\tinit(this, options, instance, create_fragment, safe_not_equal, {\n\t\t\tbig: 0,\n\t\t\tcolor: 1,\n\t\t\twidth: 2,\n\t\t\theight: 3,\n\t\t\tcustomStyle: 4,\n\t\t\ttheme: 5,\n\t\t\tdisabled: 6\n\t\t});\n\t}\n}\n\nexport default OffsetButtons;", "import './BuyNow.svelte.css';\n/* src/components/BuyNow.svelte generated by Svelte v3.59.2 */\nimport {\n\tSvelteComponent,\n\tappend,\n\tattr,\n\tdetach,\n\telement,\n\tinit,\n\tinsert,\n\tlisten,\n\tnoop,\n\tsafe_not_equal,\n\tsrc_url_equal\n} from \"../../_snowpack/pkg/svelte/internal.js\";\n\nimport { navigate } from \"../../_snowpack/pkg/svelte-routing.js\";\nimport OffsetButton from \"./OffsetButtons.svelte.js\";\n\nfunction create_fragment(ctx) {\n\tlet div1;\n\tlet div0;\n\tlet img;\n\tlet img_src_value;\n\tlet mounted;\n\tlet dispose;\n\n\treturn {\n\t\tc() {\n\t\t\tdiv1 = element(\"div\");\n\t\t\tdiv0 = element(\"div\");\n\t\t\timg = element(\"img\");\n\t\t\tif (!src_url_equal(img.src, img_src_value = \"/img/cat-right.png\")) attr(img, \"src\", img_src_value);\n\t\t\tattr(img, \"alt\", \"Get your MyPetAR Now\");\n\t\t\tattr(img, \"class\", \"svelte-18eqdk7\");\n\t\t\tattr(div0, \"class\", \"content svelte-18eqdk7\");\n\t\t\tattr(div1, \"class\", \"container svelte-18eqdk7\");\n\t\t},\n\t\tm(target, anchor) {\n\t\t\tinsert(target, div1, anchor);\n\t\t\tappend(div1, div0);\n\t\t\tappend(div0, img);\n\n\t\t\tif (!mounted) {\n\t\t\t\tdispose = listen(img, \"click\", /*click_handler*/ ctx[0]);\n\t\t\t\tmounted = true;\n\t\t\t}\n\t\t},\n\t\tp: noop,\n\t\ti: noop,\n\t\to: noop,\n\t\td(detaching) {\n\t\t\tif (detaching) detach(div1);\n\t\t\tmounted = false;\n\t\t\tdispose();\n\t\t}\n\t};\n}\n\nfunction instance($$self) {\n\tconst click_handler = () => navigate(\"/products/photo\");\n\treturn [click_handler];\n}\n\nclass BuyNow extends SvelteComponent {\n\tconstructor(options) {\n\t\tsuper();\n\t\tinit(this, options, instance, create_fragment, safe_not_equal, {});\n\t}\n}\n\nexport default BuyNow;", "import './ContactUs.svelte.css';\n/* src/components/ContactUs.svelte generated by Svelte v3.59.2 */\nimport {\n\tSvelteComponent,\n\tattr,\n\tdetach,\n\telement,\n\tinit,\n\tinsert,\n\tnoop,\n\tsafe_not_equal\n} from \"../../_snowpack/pkg/svelte/internal.js\";\n\nimport { onMount } from \"../../_snowpack/pkg/svelte.js\";\nimport OffsetButton from \"./OffsetButtons.svelte.js\";\n\nfunction create_fragment(ctx) {\n\tlet div3;\n\n\treturn {\n\t\tc() {\n\t\t\tdiv3 = element(\"div\");\n\n\t\t\tdiv3.innerHTML = `<a class=\"anchor\" id=\"form-anchor\"></a> \n  <div class=\"contact-form-container svelte-1g5rsiu\"><div class=\"contact-form-info svelte-1g5rsiu\"><img class=\"contact-form-logo svelte-1g5rsiu\" src=\"/img/logo.png\" alt=\"mypetar.com\"/></div> \n    \n    <div class=\"contact-form-input svelte-1g5rsiu\"><h2 class=\"svelte-1g5rsiu\">Please feel free to contact us at <a href=\"mailto:customerservice@mypetar.com\">customerservice@mypetar.com</a></h2></div></div>`;\n\n\t\t\tattr(div3, \"class\", \"container svelte-1g5rsiu\");\n\t\t},\n\t\tm(target, anchor) {\n\t\t\tinsert(target, div3, anchor);\n\t\t},\n\t\tp: noop,\n\t\ti: noop,\n\t\to: noop,\n\t\td(detaching) {\n\t\t\tif (detaching) detach(div3);\n\t\t}\n\t};\n}\n\nclass ContactUs extends SvelteComponent {\n\tconstructor(options) {\n\t\tsuper();\n\t\tinit(this, options, null, create_fragment, safe_not_equal, {});\n\t}\n}\n\nexport default ContactUs;", "import './Footer.svelte.css';\n/* src/components/Footer.svelte generated by Svelte v3.59.2 */\nimport {\n\tSvelteComponent,\n\tappend,\n\tattr,\n\tcreate_component,\n\tdestroy_component,\n\tdetach,\n\telement,\n\tinit,\n\tinsert,\n\tlisten,\n\tmount_component,\n\tsafe_not_equal,\n\tspace,\n\ttext,\n\ttransition_in,\n\ttransition_out\n} from \"../../_snowpack/pkg/svelte/internal.js\";\n\nimport { navigate } from \"../../_snowpack/pkg/svelte-routing.js\";\nimport OffsetButton from \"./OffsetButtons.svelte.js\";\n\nfunction create_default_slot(ctx) {\n\tlet t;\n\n\treturn {\n\t\tc() {\n\t\t\tt = text(\"Affiliate Application\");\n\t\t},\n\t\tm(target, anchor) {\n\t\t\tinsert(target, t, anchor);\n\t\t},\n\t\td(detaching) {\n\t\t\tif (detaching) detach(t);\n\t\t}\n\t};\n}\n\nfunction create_fragment(ctx) {\n\tlet div7;\n\tlet div0;\n\tlet t1;\n\tlet div6;\n\tlet div1;\n\tlet t5;\n\tlet div2;\n\tlet t7;\n\tlet div3;\n\tlet t9;\n\tlet div4;\n\tlet t11;\n\tlet div5;\n\tlet offsetbutton;\n\tlet current;\n\tlet mounted;\n\tlet dispose;\n\n\toffsetbutton = new OffsetButton({\n\t\t\tprops: {\n\t\t\t\tcolor: \"#f2a240\",\n\t\t\t\t$$slots: { default: [create_default_slot] },\n\t\t\t\t$$scope: { ctx }\n\t\t\t}\n\t\t});\n\n\treturn {\n\t\tc() {\n\t\t\tdiv7 = element(\"div\");\n\t\t\tdiv0 = element(\"div\");\n\n\t\t\tdiv0.innerHTML = `<a href=\"https://www.instagram.com/mypetar\" target=\"_blank\"><img src=\"/img/ig.png\" alt=\"Instagram\" class=\"svelte-1zbjd2\"/></a> \n    <a href=\"https://vm.tiktok.com/ZMdqerjWp/\" target=\"_blank\"><img src=\"/img/tt.png\" alt=\"Instagram\" class=\"svelte-1zbjd2\"/></a>`;\n\n\t\t\tt1 = space();\n\t\t\tdiv6 = element(\"div\");\n\t\t\tdiv1 = element(\"div\");\n\t\t\tdiv1.textContent = `© COPYRIGHT ${/*currentYear*/ ctx[0]} PRO EXP MEDIA INC.`;\n\t\t\tt5 = space();\n\t\t\tdiv2 = element(\"div\");\n\t\t\tdiv2.innerHTML = `<a href=\"/terms-and-conditions\" class=\"svelte-1zbjd2\">TERMS AND CONDITIONS</a>`;\n\t\t\tt7 = space();\n\t\t\tdiv3 = element(\"div\");\n\t\t\tdiv3.innerHTML = `<a href=\"/return-policy\" class=\"svelte-1zbjd2\">RETURN POLICY</a>`;\n\t\t\tt9 = space();\n\t\t\tdiv4 = element(\"div\");\n\t\t\tdiv4.innerHTML = `<a href=\"/privacy-policy\" class=\"svelte-1zbjd2\">PRIVACY POLICY</a>`;\n\t\t\tt11 = space();\n\t\t\tdiv5 = element(\"div\");\n\t\t\tcreate_component(offsetbutton.$$.fragment);\n\t\t\tattr(div0, \"class\", \"social-media svelte-1zbjd2\");\n\t\t\tattr(div1, \"class\", \"svelte-1zbjd2\");\n\t\t\tattr(div2, \"class\", \"svelte-1zbjd2\");\n\t\t\tattr(div3, \"class\", \"svelte-1zbjd2\");\n\t\t\tattr(div4, \"class\", \"svelte-1zbjd2\");\n\t\t\tattr(div5, \"class\", \"affiliate-container svelte-1zbjd2\");\n\t\t\tattr(div6, \"class\", \"legal svelte-1zbjd2\");\n\t\t\tattr(div7, \"class\", \"container svelte-1zbjd2\");\n\t\t},\n\t\tm(target, anchor) {\n\t\t\tinsert(target, div7, anchor);\n\t\t\tappend(div7, div0);\n\t\t\tappend(div7, t1);\n\t\t\tappend(div7, div6);\n\t\t\tappend(div6, div1);\n\t\t\tappend(div6, t5);\n\t\t\tappend(div6, div2);\n\t\t\tappend(div6, t7);\n\t\t\tappend(div6, div3);\n\t\t\tappend(div6, t9);\n\t\t\tappend(div6, div4);\n\t\t\tappend(div6, t11);\n\t\t\tappend(div6, div5);\n\t\t\tmount_component(offsetbutton, div5, null);\n\t\t\tcurrent = true;\n\n\t\t\tif (!mounted) {\n\t\t\t\tdispose = listen(div5, \"click\", /*click_handler*/ ctx[1]);\n\t\t\t\tmounted = true;\n\t\t\t}\n\t\t},\n\t\tp(ctx, [dirty]) {\n\t\t\tconst offsetbutton_changes = {};\n\n\t\t\tif (dirty & /*$$scope*/ 4) {\n\t\t\t\toffsetbutton_changes.$$scope = { dirty, ctx };\n\t\t\t}\n\n\t\t\toffsetbutton.$set(offsetbutton_changes);\n\t\t},\n\t\ti(local) {\n\t\t\tif (current) return;\n\t\t\ttransition_in(offsetbutton.$$.fragment, local);\n\t\t\tcurrent = true;\n\t\t},\n\t\to(local) {\n\t\t\ttransition_out(offsetbutton.$$.fragment, local);\n\t\t\tcurrent = false;\n\t\t},\n\t\td(detaching) {\n\t\t\tif (detaching) detach(div7);\n\t\t\tdestroy_component(offsetbutton);\n\t\t\tmounted = false;\n\t\t\tdispose();\n\t\t}\n\t};\n}\n\nfunction instance($$self) {\n\tlet currentYear = new Date().getFullYear();\n\tconst click_handler = () => navigate(\"/affiliate\");\n\treturn [currentYear, click_handler];\n}\n\nclass Footer extends SvelteComponent {\n\tconstructor(options) {\n\t\tsuper();\n\t\tinit(this, options, instance, create_fragment, safe_not_equal, {});\n\t}\n}\n\nexport default Footer;", "var commonjsGlobal = typeof globalThis !== 'undefined' ? globalThis : typeof window !== 'undefined' ? window : typeof global !== 'undefined' ? global : typeof self !== 'undefined' ? self : {};\n\nfunction createCommonjsModule(fn, basedir, module) {\n\treturn module = {\n\t\tpath: basedir,\n\t\texports: {},\n\t\trequire: function (path, base) {\n\t\t\treturn commonjsRequire(path, (base === undefined || base === null) ? module.path : base);\n\t\t}\n\t}, fn(module, module.exports), module.exports;\n}\n\nfunction commonjsRequire () {\n\tthrow new Error('Dynamic requires are not currently supported by @rollup/plugin-commonjs');\n}\n\nexport { commonjsGlobal as a, createCommonjsModule as c };\n", "import { S as SvelteComponent, i as init, s as safe_not_equal, b as append_styles, e as element, d as attr, t as toggle_class, f as insert, l as listen, n as noop, g as detach, h as bubble, j as create_component, k as space, m as mount_component, p as append, q as transition_in, r as transition_out, u as destroy_component, v as group_outros, w as update_keyed_each, x as check_outros, c as createEventDispatcher, y as outro_and_destroy_block, z as set_style, A as update_slot_base, B as get_all_dirty_from_scope, C as get_slot_changes, D as create_slot, E as action_destroyer, F as is_function, G as run_all, o as onMount, H as tick, a as onDestroy, I as binding_callbacks } from './common/index-c07ea359.js';\nimport { a as commonjsGlobal, c as createCommonjsModule } from './common/_commonjsHelpers-eb5a497e.js';\n\n/* node_modules/svelte-carousel/src/components/Dot/Dot.svelte generated by Svelte v3.59.2 */\n\nfunction add_css(target) {\n\tappend_styles(target, \"svelte-yu7247\", \":root{--sc-dot-size:6px;--sc-active-dot-size:8px;--sc-dot-size-animation-time:250ms}.sc-carousel-dot__dot.svelte-yu7247{background-color:var(--sc-color-rgb-light);border-radius:50%;display:inline-block;opacity:0.5;transition:opacity 100ms ease,\\r\\n      height var(--sc-dot-size-animation-time) ease,\\r\\n      width var(--sc-dot-size-animation-time) ease;cursor:pointer;-webkit-tap-highlight-color:transparent;height:var(--sc-dot-size);width:var(--sc-dot-size)}.sc-carousel-dot__dot.svelte-yu7247:hover{opacity:0.9}.sc-carousel-dot__dot_active.svelte-yu7247{opacity:0.7;height:var(--sc-active-dot-size);width:var(--sc-active-dot-size)}\");\n}\n\nfunction create_fragment(ctx) {\n\tlet button;\n\tlet mounted;\n\tlet dispose;\n\n\treturn {\n\t\tc() {\n\t\t\tbutton = element(\"button\");\n\t\t\tattr(button, \"class\", \"sc-carousel-button sc-carousel-dot__dot svelte-yu7247\");\n\t\t\ttoggle_class(button, \"sc-carousel-dot__dot_active\", /*active*/ ctx[0]);\n\t\t},\n\t\tm(target, anchor) {\n\t\t\tinsert(target, button, anchor);\n\n\t\t\tif (!mounted) {\n\t\t\t\tdispose = listen(button, \"click\", /*click_handler*/ ctx[1]);\n\t\t\t\tmounted = true;\n\t\t\t}\n\t\t},\n\t\tp(ctx, [dirty]) {\n\t\t\tif (dirty & /*active*/ 1) {\n\t\t\t\ttoggle_class(button, \"sc-carousel-dot__dot_active\", /*active*/ ctx[0]);\n\t\t\t}\n\t\t},\n\t\ti: noop,\n\t\to: noop,\n\t\td(detaching) {\n\t\t\tif (detaching) detach(button);\n\t\t\tmounted = false;\n\t\t\tdispose();\n\t\t}\n\t};\n}\n\nfunction instance($$self, $$props, $$invalidate) {\n\tlet { active = false } = $$props;\n\n\tfunction click_handler(event) {\n\t\tbubble.call(this, $$self, event);\n\t}\n\n\t$$self.$$set = $$props => {\n\t\tif ('active' in $$props) $$invalidate(0, active = $$props.active);\n\t};\n\n\treturn [active, click_handler];\n}\n\nclass Dot extends SvelteComponent {\n\tconstructor(options) {\n\t\tsuper();\n\t\tinit(this, options, instance, create_fragment, safe_not_equal, { active: 0 }, add_css);\n\t}\n}\n\n/* node_modules/svelte-carousel/src/components/Dots/Dots.svelte generated by Svelte v3.59.2 */\n\nfunction add_css$1(target) {\n\tappend_styles(target, \"svelte-1oj5bge\", \".sc-carousel-dots__container.svelte-1oj5bge{display:flex;align-items:center;justify-content:center;flex-wrap:wrap;padding:0 30px}.sc-carousel-dots__dot-container.svelte-1oj5bge{height:calc(var(--sc-dot-size) + 14px);width:calc(var(--sc-dot-size) + 10px);display:flex;align-items:center;justify-content:center}\");\n}\n\nfunction get_each_context(ctx, list, i) {\n\tconst child_ctx = ctx.slice();\n\tchild_ctx[5] = list[i];\n\tchild_ctx[7] = i;\n\treturn child_ctx;\n}\n\n// (23:2) {#each Array(pagesCount) as _, pageIndex (pageIndex)}\nfunction create_each_block(key_1, ctx) {\n\tlet div;\n\tlet dot;\n\tlet t;\n\tlet current;\n\n\tfunction click_handler() {\n\t\treturn /*click_handler*/ ctx[3](/*pageIndex*/ ctx[7]);\n\t}\n\n\tdot = new Dot({\n\t\t\tprops: {\n\t\t\t\tactive: /*currentPageIndex*/ ctx[1] === /*pageIndex*/ ctx[7]\n\t\t\t}\n\t\t});\n\n\tdot.$on(\"click\", click_handler);\n\n\treturn {\n\t\tkey: key_1,\n\t\tfirst: null,\n\t\tc() {\n\t\t\tdiv = element(\"div\");\n\t\t\tcreate_component(dot.$$.fragment);\n\t\t\tt = space();\n\t\t\tattr(div, \"class\", \"sc-carousel-dots__dot-container svelte-1oj5bge\");\n\t\t\tthis.first = div;\n\t\t},\n\t\tm(target, anchor) {\n\t\t\tinsert(target, div, anchor);\n\t\t\tmount_component(dot, div, null);\n\t\t\tappend(div, t);\n\t\t\tcurrent = true;\n\t\t},\n\t\tp(new_ctx, dirty) {\n\t\t\tctx = new_ctx;\n\t\t\tconst dot_changes = {};\n\t\t\tif (dirty & /*currentPageIndex, pagesCount*/ 3) dot_changes.active = /*currentPageIndex*/ ctx[1] === /*pageIndex*/ ctx[7];\n\t\t\tdot.$set(dot_changes);\n\t\t},\n\t\ti(local) {\n\t\t\tif (current) return;\n\t\t\ttransition_in(dot.$$.fragment, local);\n\t\t\tcurrent = true;\n\t\t},\n\t\to(local) {\n\t\t\ttransition_out(dot.$$.fragment, local);\n\t\t\tcurrent = false;\n\t\t},\n\t\td(detaching) {\n\t\t\tif (detaching) detach(div);\n\t\t\tdestroy_component(dot);\n\t\t}\n\t};\n}\n\nfunction create_fragment$1(ctx) {\n\tlet div;\n\tlet each_blocks = [];\n\tlet each_1_lookup = new Map();\n\tlet current;\n\tlet each_value = Array(/*pagesCount*/ ctx[0]);\n\tconst get_key = ctx => /*pageIndex*/ ctx[7];\n\n\tfor (let i = 0; i < each_value.length; i += 1) {\n\t\tlet child_ctx = get_each_context(ctx, each_value, i);\n\t\tlet key = get_key(child_ctx);\n\t\teach_1_lookup.set(key, each_blocks[i] = create_each_block(key, child_ctx));\n\t}\n\n\treturn {\n\t\tc() {\n\t\t\tdiv = element(\"div\");\n\n\t\t\tfor (let i = 0; i < each_blocks.length; i += 1) {\n\t\t\t\teach_blocks[i].c();\n\t\t\t}\n\n\t\t\tattr(div, \"class\", \"sc-carousel-dots__container svelte-1oj5bge\");\n\t\t},\n\t\tm(target, anchor) {\n\t\t\tinsert(target, div, anchor);\n\n\t\t\tfor (let i = 0; i < each_blocks.length; i += 1) {\n\t\t\t\tif (each_blocks[i]) {\n\t\t\t\t\teach_blocks[i].m(div, null);\n\t\t\t\t}\n\t\t\t}\n\n\t\t\tcurrent = true;\n\t\t},\n\t\tp(ctx, [dirty]) {\n\t\t\tif (dirty & /*currentPageIndex, Array, pagesCount, handleDotClick*/ 7) {\n\t\t\t\teach_value = Array(/*pagesCount*/ ctx[0]);\n\t\t\t\tgroup_outros();\n\t\t\t\teach_blocks = update_keyed_each(each_blocks, dirty, get_key, 1, ctx, each_value, each_1_lookup, div, outro_and_destroy_block, create_each_block, null, get_each_context);\n\t\t\t\tcheck_outros();\n\t\t\t}\n\t\t},\n\t\ti(local) {\n\t\t\tif (current) return;\n\n\t\t\tfor (let i = 0; i < each_value.length; i += 1) {\n\t\t\t\ttransition_in(each_blocks[i]);\n\t\t\t}\n\n\t\t\tcurrent = true;\n\t\t},\n\t\to(local) {\n\t\t\tfor (let i = 0; i < each_blocks.length; i += 1) {\n\t\t\t\ttransition_out(each_blocks[i]);\n\t\t\t}\n\n\t\t\tcurrent = false;\n\t\t},\n\t\td(detaching) {\n\t\t\tif (detaching) detach(div);\n\n\t\t\tfor (let i = 0; i < each_blocks.length; i += 1) {\n\t\t\t\teach_blocks[i].d();\n\t\t\t}\n\t\t}\n\t};\n}\n\nfunction instance$1($$self, $$props, $$invalidate) {\n\tconst dispatch = createEventDispatcher();\n\tlet { pagesCount = 1 } = $$props;\n\tlet { currentPageIndex = 0 } = $$props;\n\n\tfunction handleDotClick(pageIndex) {\n\t\tdispatch('pageChange', pageIndex);\n\t}\n\n\tconst click_handler = pageIndex => handleDotClick(pageIndex);\n\n\t$$self.$$set = $$props => {\n\t\tif ('pagesCount' in $$props) $$invalidate(0, pagesCount = $$props.pagesCount);\n\t\tif ('currentPageIndex' in $$props) $$invalidate(1, currentPageIndex = $$props.currentPageIndex);\n\t};\n\n\treturn [pagesCount, currentPageIndex, handleDotClick, click_handler];\n}\n\nclass Dots extends SvelteComponent {\n\tconstructor(options) {\n\t\tsuper();\n\t\tinit(this, options, instance$1, create_fragment$1, safe_not_equal, { pagesCount: 0, currentPageIndex: 1 }, add_css$1);\n\t}\n}\n\nconst PREV = 'prev';\r\nconst NEXT = 'next';\n\n/* node_modules/svelte-carousel/src/components/Arrow/Arrow.svelte generated by Svelte v3.59.2 */\n\nfunction add_css$2(target) {\n\tappend_styles(target, \"svelte-9ztt4p\", \":root{--sc-arrow-size:2px}.sc-carousel-arrow__circle.svelte-9ztt4p{width:20px;height:20px;border-radius:50%;background-color:var(--sc-color-rgb-light-50p);display:flex;align-items:center;justify-content:center;transition:opacity 100ms ease;cursor:pointer;-webkit-tap-highlight-color:transparent}.sc-carousel-arrow__circle.svelte-9ztt4p:hover{opacity:0.9}.sc-carousel-arrow__arrow.svelte-9ztt4p{border:solid var(--sc-color-hex-dark);border-width:0 var(--sc-arrow-size) var(--sc-arrow-size) 0;padding:var(--sc-arrow-size);position:relative}.sc-carousel-arrow__arrow-next.svelte-9ztt4p{transform:rotate(-45deg);left:calc(var(--sc-arrow-size) / -2)}.sc-carousel-arrow__arrow-prev.svelte-9ztt4p{transform:rotate(135deg);right:calc(var(--sc-arrow-size) / -2)}.sc-carousel-arrow__circle_disabled.svelte-9ztt4p,.sc-carousel-arrow__circle_disabled.svelte-9ztt4p:hover{opacity:0.5}\");\n}\n\nfunction create_fragment$2(ctx) {\n\tlet button;\n\tlet i;\n\tlet mounted;\n\tlet dispose;\n\n\treturn {\n\t\tc() {\n\t\t\tbutton = element(\"button\");\n\t\t\ti = element(\"i\");\n\t\t\tattr(i, \"class\", \"sc-carousel-arrow__arrow svelte-9ztt4p\");\n\t\t\ttoggle_class(i, \"sc-carousel-arrow__arrow-next\", /*direction*/ ctx[0] === NEXT);\n\t\t\ttoggle_class(i, \"sc-carousel-arrow__arrow-prev\", /*direction*/ ctx[0] === PREV);\n\t\t\tattr(button, \"class\", \"sc-carousel-button sc-carousel-arrow__circle svelte-9ztt4p\");\n\t\t\ttoggle_class(button, \"sc-carousel-arrow__circle_disabled\", /*disabled*/ ctx[1]);\n\t\t},\n\t\tm(target, anchor) {\n\t\t\tinsert(target, button, anchor);\n\t\t\tappend(button, i);\n\n\t\t\tif (!mounted) {\n\t\t\t\tdispose = listen(button, \"click\", /*click_handler*/ ctx[2]);\n\t\t\t\tmounted = true;\n\t\t\t}\n\t\t},\n\t\tp(ctx, [dirty]) {\n\t\t\tif (dirty & /*direction, NEXT*/ 1) {\n\t\t\t\ttoggle_class(i, \"sc-carousel-arrow__arrow-next\", /*direction*/ ctx[0] === NEXT);\n\t\t\t}\n\n\t\t\tif (dirty & /*direction, PREV*/ 1) {\n\t\t\t\ttoggle_class(i, \"sc-carousel-arrow__arrow-prev\", /*direction*/ ctx[0] === PREV);\n\t\t\t}\n\n\t\t\tif (dirty & /*disabled*/ 2) {\n\t\t\t\ttoggle_class(button, \"sc-carousel-arrow__circle_disabled\", /*disabled*/ ctx[1]);\n\t\t\t}\n\t\t},\n\t\ti: noop,\n\t\to: noop,\n\t\td(detaching) {\n\t\t\tif (detaching) detach(button);\n\t\t\tmounted = false;\n\t\t\tdispose();\n\t\t}\n\t};\n}\n\nfunction instance$2($$self, $$props, $$invalidate) {\n\tlet { direction = NEXT } = $$props;\n\tlet { disabled = false } = $$props;\n\n\tfunction click_handler(event) {\n\t\tbubble.call(this, $$self, event);\n\t}\n\n\t$$self.$$set = $$props => {\n\t\tif ('direction' in $$props) $$invalidate(0, direction = $$props.direction);\n\t\tif ('disabled' in $$props) $$invalidate(1, disabled = $$props.disabled);\n\t};\n\n\treturn [direction, disabled, click_handler];\n}\n\nclass Arrow extends SvelteComponent {\n\tconstructor(options) {\n\t\tsuper();\n\t\tinit(this, options, instance$2, create_fragment$2, safe_not_equal, { direction: 0, disabled: 1 }, add_css$2);\n\t}\n}\n\n/* node_modules/svelte-carousel/src/components/Progress/Progress.svelte generated by Svelte v3.59.2 */\n\nfunction add_css$3(target) {\n\tappend_styles(target, \"svelte-nuyenl\", \".sc-carousel-progress__indicator.svelte-nuyenl{height:100%;background-color:var(--sc-color-hex-dark-50p)}\");\n}\n\nfunction create_fragment$3(ctx) {\n\tlet div;\n\n\treturn {\n\t\tc() {\n\t\t\tdiv = element(\"div\");\n\t\t\tattr(div, \"class\", \"sc-carousel-progress__indicator svelte-nuyenl\");\n\t\t\tset_style(div, \"width\", /*width*/ ctx[0] + \"%\");\n\t\t},\n\t\tm(target, anchor) {\n\t\t\tinsert(target, div, anchor);\n\t\t},\n\t\tp(ctx, [dirty]) {\n\t\t\tif (dirty & /*width*/ 1) {\n\t\t\t\tset_style(div, \"width\", /*width*/ ctx[0] + \"%\");\n\t\t\t}\n\t\t},\n\t\ti: noop,\n\t\to: noop,\n\t\td(detaching) {\n\t\t\tif (detaching) detach(div);\n\t\t}\n\t};\n}\n\nconst MAX_PERCENT = 100;\n\nfunction instance$3($$self, $$props, $$invalidate) {\n\tlet width;\n\tlet { value = 0 } = $$props;\n\n\t$$self.$$set = $$props => {\n\t\tif ('value' in $$props) $$invalidate(1, value = $$props.value);\n\t};\n\n\t$$self.$$.update = () => {\n\t\tif ($$self.$$.dirty & /*value*/ 2) {\n\t\t\t $$invalidate(0, width = Math.min(Math.max(value * MAX_PERCENT, 0), MAX_PERCENT));\n\t\t}\n\t};\n\n\treturn [width, value];\n}\n\nclass Progress extends SvelteComponent {\n\tconstructor(options) {\n\t\tsuper();\n\t\tinit(this, options, instance$3, create_fragment$3, safe_not_equal, { value: 1 }, add_css$3);\n\t}\n}\n\n// start event\r\nfunction addStartEventListener(source, cb) {\r\n  source.addEventListener('mousedown', cb);\r\n  source.addEventListener('touchstart', cb, { passive: true });\r\n}\r\nfunction removeStartEventListener(source, cb) {\r\n  source.removeEventListener('mousedown', cb);\r\n  source.removeEventListener('touchstart', cb);\r\n}\r\n\r\n// end event\r\nfunction addEndEventListener(source, cb) {\r\n  source.addEventListener('mouseup', cb);\r\n  source.addEventListener('touchend', cb);\r\n}\r\nfunction removeEndEventListener(source, cb) {\r\n  source.removeEventListener('mouseup', cb);\r\n  source.removeEventListener('touchend', cb);\r\n}\r\n\r\n// move event\r\nfunction addMoveEventListener(source, cb) {\r\n  source.addEventListener('mousemove', cb);\r\n  source.addEventListener('touchmove', cb);\r\n}\r\nfunction removeMoveEventListener(source, cb) {\r\n  source.removeEventListener('mousemove', cb);\r\n  source.removeEventListener('touchmove', cb);\r\n}\n\nfunction createDispatcher(source) {\r\n  return function (event, data) {\r\n    source.dispatchEvent(\r\n      new CustomEvent(event, {\r\n        detail: data,\r\n      })\r\n    );\r\n  }\r\n}\n\nconst TAP_DURATION_MS = 110;\r\nconst TAP_MOVEMENT_PX = 9; // max movement during the tap, keep it small\r\n\r\nconst SWIPE_MIN_DURATION_MS = 111;\r\nconst SWIPE_MIN_DISTANCE_PX = 20;\n\nfunction getCoords(event) {\r\n  if ('TouchEvent' in window && event instanceof TouchEvent) {\r\n    const touch = event.touches[0];\r\n    return {\r\n      x: touch ? touch.clientX : 0,\r\n      y: touch ? touch.clientY : 0,\r\n    }\r\n  }\r\n  return {\r\n    x: event.clientX,\r\n    y: event.clientY,\r\n  }\r\n}\r\n\r\nfunction swipeable(node, { thresholdProvider }) {\r\n  const dispatch = createDispatcher(node);\r\n  let x;\r\n  let y;\r\n  let moved = 0;\r\n  let swipeStartedAt;\r\n  let isTouching = false;\r\n\r\n  function isValidSwipe() {\r\n    const swipeDurationMs = Date.now() - swipeStartedAt;\r\n    return swipeDurationMs >= SWIPE_MIN_DURATION_MS && Math.abs(moved) >= SWIPE_MIN_DISTANCE_PX\r\n  }\r\n\r\n  function handleDown(event) {\r\n    swipeStartedAt = Date.now();\r\n    moved = 0;\r\n    isTouching = true;\r\n    const coords = getCoords(event);\r\n    x = coords.x;\r\n    y = coords.y;\r\n    dispatch('swipeStart', { x, y });\r\n    addMoveEventListener(window, handleMove);\r\n    addEndEventListener(window, handleUp);\r\n  }\r\n\r\n  function handleMove(event) {\r\n    if (!isTouching) return\r\n    const coords = getCoords(event);\r\n    const dx = coords.x - x;\r\n    const dy = coords.y - y;\r\n    x = coords.x;\r\n    y = coords.y;\r\n    dispatch('swipeMove', { x, y, dx, dy });\r\n\r\n    if (dx !== 0 && Math.sign(dx) !== Math.sign(moved)) {\r\n      moved = 0;\r\n    }\r\n    moved += dx;\r\n    if (Math.abs(moved) > thresholdProvider()) {\r\n      dispatch('swipeThresholdReached', { direction: moved > 0 ? PREV : NEXT });\r\n      removeEndEventListener(window, handleUp);\r\n      removeMoveEventListener(window, handleMove);\r\n    }\r\n  }\r\n\r\n  function handleUp(event) {\r\n    removeEndEventListener(window, handleUp);\r\n    removeMoveEventListener(window, handleMove);\r\n\r\n    isTouching = false;\r\n\r\n    if (!isValidSwipe()) {\r\n      dispatch('swipeFailed');\r\n      return\r\n    }\r\n    const coords = getCoords(event);\r\n    dispatch('swipeEnd', { x: coords.x, y: coords.y });\r\n  }\r\n\r\n  addStartEventListener(node, handleDown);\r\n  return {\r\n    destroy() {\r\n      removeStartEventListener(node, handleDown);\r\n    },\r\n  }\r\n}\n\n// in event\r\nfunction addHoverInEventListener(source, cb) {\r\n  source.addEventListener('mouseenter', cb);\r\n}\r\nfunction removeHoverInEventListener(source, cb) {\r\n  source.removeEventListener('mouseenter', cb);\r\n}\r\n\r\n// out event\r\nfunction addHoverOutEventListener(source, cb) {\r\n  source.addEventListener('mouseleave', cb);\r\n}\r\nfunction removeHoverOutEventListener(source, cb) {\r\n  source.removeEventListener('mouseleave', cb);\r\n}\n\n/**\r\n * hoverable events are for mouse events only\r\n */\r\nfunction hoverable(node) {\r\n  const dispatch = createDispatcher(node);\r\n\r\n  function handleHoverIn() {\r\n    addHoverOutEventListener(node, handleHoverOut);\r\n    dispatch('hovered', { value: true });\r\n  }\r\n\r\n  function handleHoverOut() {\r\n    dispatch('hovered', { value: false });\r\n    removeHoverOutEventListener(node, handleHoverOut);\r\n  }\r\n\r\n  addHoverInEventListener(node, handleHoverIn);\r\n  \r\n  return {\r\n    destroy() {\r\n      removeHoverInEventListener(node, handleHoverIn);\r\n      removeHoverOutEventListener(node, handleHoverOut);\r\n    },\r\n  }\r\n}\n\nconst getDistance = (p1, p2) => {\r\n  const xDist = p2.x - p1.x;\r\n  const yDist = p2.y - p1.y;\r\n\r\n  return Math.sqrt((xDist * xDist) + (yDist * yDist));\r\n};\r\n\r\nfunction getValueInRange(min, value, max) {\r\n  return Math.max(min, Math.min(value, max))\r\n}\n\n// tap start event\r\nfunction addFocusinEventListener(source, cb) {\r\n  source.addEventListener('touchstart', cb, { passive: true });\r\n}\r\nfunction removeFocusinEventListener(source, cb) {\r\n  source.removeEventListener('touchstart', cb);\r\n}\r\n\r\n// tap end event\r\nfunction addFocusoutEventListener(source, cb) {\r\n  source.addEventListener('touchend', cb);\r\n}\r\nfunction removeFocusoutEventListener(source, cb) {\r\n  source.removeEventListener('touchend', cb);\r\n}\n\n/**\r\n * tappable events are for touchable devices only\r\n */\r\nfunction tappable(node) {\r\n  const dispatch = createDispatcher(node);\r\n\r\n  let tapStartedAt = 0;\r\n  let tapStartPos = { x: 0, y: 0 };\r\n\r\n  function getIsValidTap({\r\n    tapEndedAt,\r\n    tapEndedPos\r\n  }) {\r\n    const tapTime = tapEndedAt - tapStartedAt;\r\n    const tapDist = getDistance(tapStartPos, tapEndedPos);\r\n    return (\r\n      tapTime <= TAP_DURATION_MS &&\r\n      tapDist <= TAP_MOVEMENT_PX\r\n    )\r\n  }\r\n\r\n  function handleTapstart(event) {\r\n    tapStartedAt = Date.now();\r\n\r\n    const touch = event.touches[0];\r\n    tapStartPos = { x: touch.clientX, y: touch.clientY };\r\n\r\n    addFocusoutEventListener(node, handleTapend);\r\n  }\r\n\r\n  function handleTapend(event) {\r\n    removeFocusoutEventListener(node, handleTapend);\r\n\r\n    const touch = event.changedTouches[0];\r\n    if (getIsValidTap({\r\n      tapEndedAt: Date.now(),\r\n      tapEndedPos: { x: touch.clientX, y: touch.clientY }\r\n    })) {\r\n      dispatch('tapped');\r\n    }\r\n  }\r\n\r\n  addFocusinEventListener(node, handleTapstart);\r\n  \r\n  return {\r\n    destroy() {\r\n      removeFocusinEventListener(node, handleTapstart);\r\n      removeFocusoutEventListener(node, handleTapend);\r\n    },\r\n  }\r\n}\n\n// getCurrentPageIndexByCurrentParticleIndex\r\n\r\nfunction _getCurrentPageIndexByCurrentParticleIndexInfinite({\r\n  currentParticleIndex,\r\n  particlesCount,\r\n  clonesCountHead,\r\n  clonesCountTotal,\r\n  particlesToScroll,\r\n}) {\r\n  if (currentParticleIndex === particlesCount - clonesCountHead) return 0\r\n  if (currentParticleIndex === 0) return _getPagesCountByParticlesCountInfinite({\r\n    particlesCountWithoutClones: particlesCount - clonesCountTotal,\r\n    particlesToScroll,\r\n  }) - 1\r\n  return Math.floor((currentParticleIndex - clonesCountHead) / particlesToScroll)\r\n}\r\n\r\nfunction _getCurrentPageIndexByCurrentParticleIndexLimited({\r\n  currentParticleIndex,\r\n  particlesToScroll,\r\n}) {\r\n  return Math.ceil(currentParticleIndex / particlesToScroll)\r\n}\r\n\r\nfunction getCurrentPageIndexByCurrentParticleIndex({\r\n  currentParticleIndex,\r\n  particlesCount,\r\n  clonesCountHead,\r\n  clonesCountTotal,\r\n  infinite,\r\n  particlesToScroll,\r\n}) {\r\n  return infinite\r\n    ? _getCurrentPageIndexByCurrentParticleIndexInfinite({\r\n      currentParticleIndex,\r\n      particlesCount,\r\n      clonesCountHead,\r\n      clonesCountTotal,\r\n      particlesToScroll,\r\n    })\r\n    : _getCurrentPageIndexByCurrentParticleIndexLimited({\r\n      currentParticleIndex,\r\n      particlesToScroll,\r\n    })\r\n}\r\n\r\n// getPagesCountByParticlesCount\r\n\r\nfunction _getPagesCountByParticlesCountInfinite({\r\n  particlesCountWithoutClones,\r\n  particlesToScroll,\r\n}) {\r\n  return Math.ceil(particlesCountWithoutClones / particlesToScroll)\r\n}\r\n\r\nfunction _getPagesCountByParticlesCountLimited({\r\n  particlesCountWithoutClones,\r\n  particlesToScroll,\r\n  particlesToShow,\r\n}) {\r\n  const partialPageSize = getPartialPageSize({\r\n    particlesCountWithoutClones,\r\n    particlesToScroll,\r\n    particlesToShow,\r\n  });\r\n  return Math.ceil(particlesCountWithoutClones / particlesToScroll) - partialPageSize\r\n}\r\n\r\nfunction getPagesCountByParticlesCount({\r\n  infinite,\r\n  particlesCountWithoutClones,\r\n  particlesToScroll,\r\n  particlesToShow,\r\n}) {\r\n  return infinite\r\n    ? _getPagesCountByParticlesCountInfinite({\r\n      particlesCountWithoutClones,\r\n      particlesToScroll,\r\n    })\r\n    : _getPagesCountByParticlesCountLimited({\r\n      particlesCountWithoutClones,\r\n      particlesToScroll,\r\n      particlesToShow,\r\n    })\r\n}\r\n\r\n// getParticleIndexByPageIndex\r\n\r\nfunction _getParticleIndexByPageIndexInfinite({\r\n  pageIndex,\r\n  clonesCountHead,\r\n  clonesCountTail,\r\n  particlesToScroll,\r\n  particlesCount,\r\n}) {\r\n  return getValueInRange(\r\n    0,\r\n    Math.min(clonesCountHead + pageIndex * particlesToScroll, particlesCount - clonesCountTail),\r\n    particlesCount - 1\r\n  )\r\n}\r\n\r\nfunction _getParticleIndexByPageIndexLimited({\r\n  pageIndex,\r\n  particlesToScroll,\r\n  particlesCount,\r\n  particlesToShow,\r\n}) {\r\n  return getValueInRange(\r\n    0,\r\n    Math.min(pageIndex * particlesToScroll, particlesCount - particlesToShow),\r\n    particlesCount - 1\r\n  ) \r\n}\r\n\r\nfunction getParticleIndexByPageIndex({\r\n  infinite,\r\n  pageIndex,\r\n  clonesCountHead,\r\n  clonesCountTail,\r\n  particlesToScroll,\r\n  particlesCount,\r\n  particlesToShow,\r\n}) {\r\n  return infinite\r\n    ? _getParticleIndexByPageIndexInfinite({\r\n      pageIndex,\r\n      clonesCountHead,\r\n      clonesCountTail,\r\n      particlesToScroll,\r\n      particlesCount,\r\n    })\r\n    : _getParticleIndexByPageIndexLimited({\r\n      pageIndex,\r\n      particlesToScroll,\r\n      particlesCount,\r\n      particlesToShow,\r\n    })\r\n}\r\n\r\nfunction applyParticleSizes({\r\n  particlesContainerChildren,\r\n  particleWidth,\r\n}) {\r\n  for (let particleIndex=0; particleIndex<particlesContainerChildren.length; particleIndex++) {\r\n    particlesContainerChildren[particleIndex].style.minWidth = `${particleWidth}px`;\r\n    particlesContainerChildren[particleIndex].style.maxWidth = `${particleWidth}px`;\r\n  }\r\n}\r\n\r\nfunction getPartialPageSize({\r\n  particlesToScroll,\r\n  particlesToShow,\r\n  particlesCountWithoutClones, \r\n}) {\r\n  const overlap = particlesToScroll - particlesToShow;\r\n  let particlesCount = particlesToShow;\r\n\r\n  while(true) {\r\n    const diff = particlesCountWithoutClones - particlesCount - overlap;\r\n    if (diff < particlesToShow) {\r\n      return Math.max(diff, 0) // show: 2; scroll: 3, n: 5 => -1\r\n    }\r\n    particlesCount += particlesToShow + overlap;\r\n  }\r\n}\r\n\r\nfunction createResizeObserver(onResize) {\r\n  return new ResizeObserver(entries => {\r\n    onResize({\r\n      width: entries[0].contentRect.width,\r\n    });\r\n  });\r\n}\n\nfunction getClones({\r\n  clonesCountHead,\r\n  clonesCountTail,\r\n  particlesContainerChildren,\r\n}) {\r\n  // TODO: add fns to remove clones if needed\r\n  const clonesToAppend = [];\r\n  for (let i=0; i<clonesCountTail; i++) {\r\n    clonesToAppend.push(particlesContainerChildren[i].cloneNode(true));\r\n  }\r\n\r\n  const clonesToPrepend = [];\r\n  const len = particlesContainerChildren.length;\r\n  for (let i=len-1; i>len-1-clonesCountHead; i--) {\r\n    clonesToPrepend.push(particlesContainerChildren[i].cloneNode(true));\r\n  }\r\n\r\n  return {\r\n    clonesToAppend,\r\n    clonesToPrepend,\r\n  }\r\n}\r\n\r\nfunction applyClones({\r\n  particlesContainer,\r\n  clonesToAppend,\r\n  clonesToPrepend,\r\n}) {\r\n  for (let i=0; i<clonesToAppend.length; i++) {\r\n    particlesContainer.append(clonesToAppend[i]);\r\n  }\r\n  for (let i=0; i<clonesToPrepend.length; i++) {\r\n    particlesContainer.prepend(clonesToPrepend[i]);\r\n  }\r\n}\r\n\r\nfunction getClonesCount({\r\n  infinite,\r\n  particlesToShow,\r\n  partialPageSize,\r\n}) {\r\n  const clonesCount = infinite\r\n    ? {\r\n      // need to round with ceil as particlesToShow, particlesToShow can be floating (e.g. 1.5, 3.75)\r\n      head: Math.ceil(partialPageSize || particlesToShow),\r\n      tail: Math.ceil(particlesToShow),\r\n    } : {\r\n      head: 0,\r\n      tail: 0,\r\n    };\r\n\r\n  return {\r\n    ...clonesCount,\r\n    total: clonesCount.head + clonesCount.tail,\r\n  }\r\n}\n\nconst get = (object, fieldName, defaultValue) => {\r\n  if (object && object.hasOwnProperty(fieldName)) {\r\n    return object[fieldName]\r\n  }\r\n  if (defaultValue === undefined) {\r\n    throw new Error(`Required arg \"${fieldName}\" was not provided`)\r\n  }\r\n  return defaultValue\r\n};\r\n\r\nconst switcher = (description) => (key) => {\r\n  description[key] && description[key]();\r\n};\n\n/**\n * lodash (Custom Build) <https://lodash.com/>\n * Build: `lodash modularize exports=\"npm\" -o ./`\n * Copyright jQuery Foundation and other contributors <https://jquery.org/>\n * Released under MIT license <https://lodash.com/license>\n * Based on Underscore.js 1.8.3 <http://underscorejs.org/LICENSE>\n * Copyright Jeremy Ashkenas, DocumentCloud and Investigative Reporters & Editors\n */\n\n/** Used as the `TypeError` message for \"Functions\" methods. */\nvar FUNC_ERROR_TEXT = 'Expected a function';\n\n/** Used to stand-in for `undefined` hash values. */\nvar HASH_UNDEFINED = '__lodash_hash_undefined__';\n\n/** Used as references for various `Number` constants. */\nvar INFINITY = 1 / 0;\n\n/** `Object#toString` result references. */\nvar funcTag = '[object Function]',\n    genTag = '[object GeneratorFunction]',\n    symbolTag = '[object Symbol]';\n\n/** Used to match property names within property paths. */\nvar reIsDeepProp = /\\.|\\[(?:[^[\\]]*|([\"'])(?:(?!\\1)[^\\\\]|\\\\.)*?\\1)\\]/,\n    reIsPlainProp = /^\\w*$/,\n    reLeadingDot = /^\\./,\n    rePropName = /[^.[\\]]+|\\[(?:(-?\\d+(?:\\.\\d+)?)|([\"'])((?:(?!\\2)[^\\\\]|\\\\.)*?)\\2)\\]|(?=(?:\\.|\\[\\])(?:\\.|\\[\\]|$))/g;\n\n/**\n * Used to match `RegExp`\n * [syntax characters](http://ecma-international.org/ecma-262/7.0/#sec-patterns).\n */\nvar reRegExpChar = /[\\\\^$.*+?()[\\]{}|]/g;\n\n/** Used to match backslashes in property paths. */\nvar reEscapeChar = /\\\\(\\\\)?/g;\n\n/** Used to detect host constructors (Safari). */\nvar reIsHostCtor = /^\\[object .+?Constructor\\]$/;\n\n/** Detect free variable `global` from Node.js. */\nvar freeGlobal = typeof commonjsGlobal == 'object' && commonjsGlobal && commonjsGlobal.Object === Object && commonjsGlobal;\n\n/** Detect free variable `self`. */\nvar freeSelf = typeof self == 'object' && self && self.Object === Object && self;\n\n/** Used as a reference to the global object. */\nvar root = freeGlobal || freeSelf || Function('return this')();\n\n/**\n * Gets the value at `key` of `object`.\n *\n * @private\n * @param {Object} [object] The object to query.\n * @param {string} key The key of the property to get.\n * @returns {*} Returns the property value.\n */\nfunction getValue(object, key) {\n  return object == null ? undefined : object[key];\n}\n\n/**\n * Checks if `value` is a host object in IE < 9.\n *\n * @private\n * @param {*} value The value to check.\n * @returns {boolean} Returns `true` if `value` is a host object, else `false`.\n */\nfunction isHostObject(value) {\n  // Many host objects are `Object` objects that can coerce to strings\n  // despite having improperly defined `toString` methods.\n  var result = false;\n  if (value != null && typeof value.toString != 'function') {\n    try {\n      result = !!(value + '');\n    } catch (e) {}\n  }\n  return result;\n}\n\n/** Used for built-in method references. */\nvar arrayProto = Array.prototype,\n    funcProto = Function.prototype,\n    objectProto = Object.prototype;\n\n/** Used to detect overreaching core-js shims. */\nvar coreJsData = root['__core-js_shared__'];\n\n/** Used to detect methods masquerading as native. */\nvar maskSrcKey = (function() {\n  var uid = /[^.]+$/.exec(coreJsData && coreJsData.keys && coreJsData.keys.IE_PROTO || '');\n  return uid ? ('Symbol(src)_1.' + uid) : '';\n}());\n\n/** Used to resolve the decompiled source of functions. */\nvar funcToString = funcProto.toString;\n\n/** Used to check objects for own properties. */\nvar hasOwnProperty = objectProto.hasOwnProperty;\n\n/**\n * Used to resolve the\n * [`toStringTag`](http://ecma-international.org/ecma-262/7.0/#sec-object.prototype.tostring)\n * of values.\n */\nvar objectToString = objectProto.toString;\n\n/** Used to detect if a method is native. */\nvar reIsNative = RegExp('^' +\n  funcToString.call(hasOwnProperty).replace(reRegExpChar, '\\\\$&')\n  .replace(/hasOwnProperty|(function).*?(?=\\\\\\()| for .+?(?=\\\\\\])/g, '$1.*?') + '$'\n);\n\n/** Built-in value references. */\nvar Symbol = root.Symbol,\n    splice = arrayProto.splice;\n\n/* Built-in method references that are verified to be native. */\nvar Map$1 = getNative(root, 'Map'),\n    nativeCreate = getNative(Object, 'create');\n\n/** Used to convert symbols to primitives and strings. */\nvar symbolProto = Symbol ? Symbol.prototype : undefined,\n    symbolToString = symbolProto ? symbolProto.toString : undefined;\n\n/**\n * Creates a hash object.\n *\n * @private\n * @constructor\n * @param {Array} [entries] The key-value pairs to cache.\n */\nfunction Hash(entries) {\n  var index = -1,\n      length = entries ? entries.length : 0;\n\n  this.clear();\n  while (++index < length) {\n    var entry = entries[index];\n    this.set(entry[0], entry[1]);\n  }\n}\n\n/**\n * Removes all key-value entries from the hash.\n *\n * @private\n * @name clear\n * @memberOf Hash\n */\nfunction hashClear() {\n  this.__data__ = nativeCreate ? nativeCreate(null) : {};\n}\n\n/**\n * Removes `key` and its value from the hash.\n *\n * @private\n * @name delete\n * @memberOf Hash\n * @param {Object} hash The hash to modify.\n * @param {string} key The key of the value to remove.\n * @returns {boolean} Returns `true` if the entry was removed, else `false`.\n */\nfunction hashDelete(key) {\n  return this.has(key) && delete this.__data__[key];\n}\n\n/**\n * Gets the hash value for `key`.\n *\n * @private\n * @name get\n * @memberOf Hash\n * @param {string} key The key of the value to get.\n * @returns {*} Returns the entry value.\n */\nfunction hashGet(key) {\n  var data = this.__data__;\n  if (nativeCreate) {\n    var result = data[key];\n    return result === HASH_UNDEFINED ? undefined : result;\n  }\n  return hasOwnProperty.call(data, key) ? data[key] : undefined;\n}\n\n/**\n * Checks if a hash value for `key` exists.\n *\n * @private\n * @name has\n * @memberOf Hash\n * @param {string} key The key of the entry to check.\n * @returns {boolean} Returns `true` if an entry for `key` exists, else `false`.\n */\nfunction hashHas(key) {\n  var data = this.__data__;\n  return nativeCreate ? data[key] !== undefined : hasOwnProperty.call(data, key);\n}\n\n/**\n * Sets the hash `key` to `value`.\n *\n * @private\n * @name set\n * @memberOf Hash\n * @param {string} key The key of the value to set.\n * @param {*} value The value to set.\n * @returns {Object} Returns the hash instance.\n */\nfunction hashSet(key, value) {\n  var data = this.__data__;\n  data[key] = (nativeCreate && value === undefined) ? HASH_UNDEFINED : value;\n  return this;\n}\n\n// Add methods to `Hash`.\nHash.prototype.clear = hashClear;\nHash.prototype['delete'] = hashDelete;\nHash.prototype.get = hashGet;\nHash.prototype.has = hashHas;\nHash.prototype.set = hashSet;\n\n/**\n * Creates an list cache object.\n *\n * @private\n * @constructor\n * @param {Array} [entries] The key-value pairs to cache.\n */\nfunction ListCache(entries) {\n  var index = -1,\n      length = entries ? entries.length : 0;\n\n  this.clear();\n  while (++index < length) {\n    var entry = entries[index];\n    this.set(entry[0], entry[1]);\n  }\n}\n\n/**\n * Removes all key-value entries from the list cache.\n *\n * @private\n * @name clear\n * @memberOf ListCache\n */\nfunction listCacheClear() {\n  this.__data__ = [];\n}\n\n/**\n * Removes `key` and its value from the list cache.\n *\n * @private\n * @name delete\n * @memberOf ListCache\n * @param {string} key The key of the value to remove.\n * @returns {boolean} Returns `true` if the entry was removed, else `false`.\n */\nfunction listCacheDelete(key) {\n  var data = this.__data__,\n      index = assocIndexOf(data, key);\n\n  if (index < 0) {\n    return false;\n  }\n  var lastIndex = data.length - 1;\n  if (index == lastIndex) {\n    data.pop();\n  } else {\n    splice.call(data, index, 1);\n  }\n  return true;\n}\n\n/**\n * Gets the list cache value for `key`.\n *\n * @private\n * @name get\n * @memberOf ListCache\n * @param {string} key The key of the value to get.\n * @returns {*} Returns the entry value.\n */\nfunction listCacheGet(key) {\n  var data = this.__data__,\n      index = assocIndexOf(data, key);\n\n  return index < 0 ? undefined : data[index][1];\n}\n\n/**\n * Checks if a list cache value for `key` exists.\n *\n * @private\n * @name has\n * @memberOf ListCache\n * @param {string} key The key of the entry to check.\n * @returns {boolean} Returns `true` if an entry for `key` exists, else `false`.\n */\nfunction listCacheHas(key) {\n  return assocIndexOf(this.__data__, key) > -1;\n}\n\n/**\n * Sets the list cache `key` to `value`.\n *\n * @private\n * @name set\n * @memberOf ListCache\n * @param {string} key The key of the value to set.\n * @param {*} value The value to set.\n * @returns {Object} Returns the list cache instance.\n */\nfunction listCacheSet(key, value) {\n  var data = this.__data__,\n      index = assocIndexOf(data, key);\n\n  if (index < 0) {\n    data.push([key, value]);\n  } else {\n    data[index][1] = value;\n  }\n  return this;\n}\n\n// Add methods to `ListCache`.\nListCache.prototype.clear = listCacheClear;\nListCache.prototype['delete'] = listCacheDelete;\nListCache.prototype.get = listCacheGet;\nListCache.prototype.has = listCacheHas;\nListCache.prototype.set = listCacheSet;\n\n/**\n * Creates a map cache object to store key-value pairs.\n *\n * @private\n * @constructor\n * @param {Array} [entries] The key-value pairs to cache.\n */\nfunction MapCache(entries) {\n  var index = -1,\n      length = entries ? entries.length : 0;\n\n  this.clear();\n  while (++index < length) {\n    var entry = entries[index];\n    this.set(entry[0], entry[1]);\n  }\n}\n\n/**\n * Removes all key-value entries from the map.\n *\n * @private\n * @name clear\n * @memberOf MapCache\n */\nfunction mapCacheClear() {\n  this.__data__ = {\n    'hash': new Hash,\n    'map': new (Map$1 || ListCache),\n    'string': new Hash\n  };\n}\n\n/**\n * Removes `key` and its value from the map.\n *\n * @private\n * @name delete\n * @memberOf MapCache\n * @param {string} key The key of the value to remove.\n * @returns {boolean} Returns `true` if the entry was removed, else `false`.\n */\nfunction mapCacheDelete(key) {\n  return getMapData(this, key)['delete'](key);\n}\n\n/**\n * Gets the map value for `key`.\n *\n * @private\n * @name get\n * @memberOf MapCache\n * @param {string} key The key of the value to get.\n * @returns {*} Returns the entry value.\n */\nfunction mapCacheGet(key) {\n  return getMapData(this, key).get(key);\n}\n\n/**\n * Checks if a map value for `key` exists.\n *\n * @private\n * @name has\n * @memberOf MapCache\n * @param {string} key The key of the entry to check.\n * @returns {boolean} Returns `true` if an entry for `key` exists, else `false`.\n */\nfunction mapCacheHas(key) {\n  return getMapData(this, key).has(key);\n}\n\n/**\n * Sets the map `key` to `value`.\n *\n * @private\n * @name set\n * @memberOf MapCache\n * @param {string} key The key of the value to set.\n * @param {*} value The value to set.\n * @returns {Object} Returns the map cache instance.\n */\nfunction mapCacheSet(key, value) {\n  getMapData(this, key).set(key, value);\n  return this;\n}\n\n// Add methods to `MapCache`.\nMapCache.prototype.clear = mapCacheClear;\nMapCache.prototype['delete'] = mapCacheDelete;\nMapCache.prototype.get = mapCacheGet;\nMapCache.prototype.has = mapCacheHas;\nMapCache.prototype.set = mapCacheSet;\n\n/**\n * Gets the index at which the `key` is found in `array` of key-value pairs.\n *\n * @private\n * @param {Array} array The array to inspect.\n * @param {*} key The key to search for.\n * @returns {number} Returns the index of the matched value, else `-1`.\n */\nfunction assocIndexOf(array, key) {\n  var length = array.length;\n  while (length--) {\n    if (eq(array[length][0], key)) {\n      return length;\n    }\n  }\n  return -1;\n}\n\n/**\n * The base implementation of `_.get` without support for default values.\n *\n * @private\n * @param {Object} object The object to query.\n * @param {Array|string} path The path of the property to get.\n * @returns {*} Returns the resolved value.\n */\nfunction baseGet(object, path) {\n  path = isKey(path, object) ? [path] : castPath(path);\n\n  var index = 0,\n      length = path.length;\n\n  while (object != null && index < length) {\n    object = object[toKey(path[index++])];\n  }\n  return (index && index == length) ? object : undefined;\n}\n\n/**\n * The base implementation of `_.isNative` without bad shim checks.\n *\n * @private\n * @param {*} value The value to check.\n * @returns {boolean} Returns `true` if `value` is a native function,\n *  else `false`.\n */\nfunction baseIsNative(value) {\n  if (!isObject(value) || isMasked(value)) {\n    return false;\n  }\n  var pattern = (isFunction(value) || isHostObject(value)) ? reIsNative : reIsHostCtor;\n  return pattern.test(toSource(value));\n}\n\n/**\n * The base implementation of `_.toString` which doesn't convert nullish\n * values to empty strings.\n *\n * @private\n * @param {*} value The value to process.\n * @returns {string} Returns the string.\n */\nfunction baseToString(value) {\n  // Exit early for strings to avoid a performance hit in some environments.\n  if (typeof value == 'string') {\n    return value;\n  }\n  if (isSymbol(value)) {\n    return symbolToString ? symbolToString.call(value) : '';\n  }\n  var result = (value + '');\n  return (result == '0' && (1 / value) == -INFINITY) ? '-0' : result;\n}\n\n/**\n * Casts `value` to a path array if it's not one.\n *\n * @private\n * @param {*} value The value to inspect.\n * @returns {Array} Returns the cast property path array.\n */\nfunction castPath(value) {\n  return isArray(value) ? value : stringToPath(value);\n}\n\n/**\n * Gets the data for `map`.\n *\n * @private\n * @param {Object} map The map to query.\n * @param {string} key The reference key.\n * @returns {*} Returns the map data.\n */\nfunction getMapData(map, key) {\n  var data = map.__data__;\n  return isKeyable(key)\n    ? data[typeof key == 'string' ? 'string' : 'hash']\n    : data.map;\n}\n\n/**\n * Gets the native function at `key` of `object`.\n *\n * @private\n * @param {Object} object The object to query.\n * @param {string} key The key of the method to get.\n * @returns {*} Returns the function if it's native, else `undefined`.\n */\nfunction getNative(object, key) {\n  var value = getValue(object, key);\n  return baseIsNative(value) ? value : undefined;\n}\n\n/**\n * Checks if `value` is a property name and not a property path.\n *\n * @private\n * @param {*} value The value to check.\n * @param {Object} [object] The object to query keys on.\n * @returns {boolean} Returns `true` if `value` is a property name, else `false`.\n */\nfunction isKey(value, object) {\n  if (isArray(value)) {\n    return false;\n  }\n  var type = typeof value;\n  if (type == 'number' || type == 'symbol' || type == 'boolean' ||\n      value == null || isSymbol(value)) {\n    return true;\n  }\n  return reIsPlainProp.test(value) || !reIsDeepProp.test(value) ||\n    (object != null && value in Object(object));\n}\n\n/**\n * Checks if `value` is suitable for use as unique object key.\n *\n * @private\n * @param {*} value The value to check.\n * @returns {boolean} Returns `true` if `value` is suitable, else `false`.\n */\nfunction isKeyable(value) {\n  var type = typeof value;\n  return (type == 'string' || type == 'number' || type == 'symbol' || type == 'boolean')\n    ? (value !== '__proto__')\n    : (value === null);\n}\n\n/**\n * Checks if `func` has its source masked.\n *\n * @private\n * @param {Function} func The function to check.\n * @returns {boolean} Returns `true` if `func` is masked, else `false`.\n */\nfunction isMasked(func) {\n  return !!maskSrcKey && (maskSrcKey in func);\n}\n\n/**\n * Converts `string` to a property path array.\n *\n * @private\n * @param {string} string The string to convert.\n * @returns {Array} Returns the property path array.\n */\nvar stringToPath = memoize(function(string) {\n  string = toString(string);\n\n  var result = [];\n  if (reLeadingDot.test(string)) {\n    result.push('');\n  }\n  string.replace(rePropName, function(match, number, quote, string) {\n    result.push(quote ? string.replace(reEscapeChar, '$1') : (number || match));\n  });\n  return result;\n});\n\n/**\n * Converts `value` to a string key if it's not a string or symbol.\n *\n * @private\n * @param {*} value The value to inspect.\n * @returns {string|symbol} Returns the key.\n */\nfunction toKey(value) {\n  if (typeof value == 'string' || isSymbol(value)) {\n    return value;\n  }\n  var result = (value + '');\n  return (result == '0' && (1 / value) == -INFINITY) ? '-0' : result;\n}\n\n/**\n * Converts `func` to its source code.\n *\n * @private\n * @param {Function} func The function to process.\n * @returns {string} Returns the source code.\n */\nfunction toSource(func) {\n  if (func != null) {\n    try {\n      return funcToString.call(func);\n    } catch (e) {}\n    try {\n      return (func + '');\n    } catch (e) {}\n  }\n  return '';\n}\n\n/**\n * Creates a function that memoizes the result of `func`. If `resolver` is\n * provided, it determines the cache key for storing the result based on the\n * arguments provided to the memoized function. By default, the first argument\n * provided to the memoized function is used as the map cache key. The `func`\n * is invoked with the `this` binding of the memoized function.\n *\n * **Note:** The cache is exposed as the `cache` property on the memoized\n * function. Its creation may be customized by replacing the `_.memoize.Cache`\n * constructor with one whose instances implement the\n * [`Map`](http://ecma-international.org/ecma-262/7.0/#sec-properties-of-the-map-prototype-object)\n * method interface of `delete`, `get`, `has`, and `set`.\n *\n * @static\n * @memberOf _\n * @since 0.1.0\n * @category Function\n * @param {Function} func The function to have its output memoized.\n * @param {Function} [resolver] The function to resolve the cache key.\n * @returns {Function} Returns the new memoized function.\n * @example\n *\n * var object = { 'a': 1, 'b': 2 };\n * var other = { 'c': 3, 'd': 4 };\n *\n * var values = _.memoize(_.values);\n * values(object);\n * // => [1, 2]\n *\n * values(other);\n * // => [3, 4]\n *\n * object.a = 2;\n * values(object);\n * // => [1, 2]\n *\n * // Modify the result cache.\n * values.cache.set(object, ['a', 'b']);\n * values(object);\n * // => ['a', 'b']\n *\n * // Replace `_.memoize.Cache`.\n * _.memoize.Cache = WeakMap;\n */\nfunction memoize(func, resolver) {\n  if (typeof func != 'function' || (resolver && typeof resolver != 'function')) {\n    throw new TypeError(FUNC_ERROR_TEXT);\n  }\n  var memoized = function() {\n    var args = arguments,\n        key = resolver ? resolver.apply(this, args) : args[0],\n        cache = memoized.cache;\n\n    if (cache.has(key)) {\n      return cache.get(key);\n    }\n    var result = func.apply(this, args);\n    memoized.cache = cache.set(key, result);\n    return result;\n  };\n  memoized.cache = new (memoize.Cache || MapCache);\n  return memoized;\n}\n\n// Assign cache to `_.memoize`.\nmemoize.Cache = MapCache;\n\n/**\n * Performs a\n * [`SameValueZero`](http://ecma-international.org/ecma-262/7.0/#sec-samevaluezero)\n * comparison between two values to determine if they are equivalent.\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @category Lang\n * @param {*} value The value to compare.\n * @param {*} other The other value to compare.\n * @returns {boolean} Returns `true` if the values are equivalent, else `false`.\n * @example\n *\n * var object = { 'a': 1 };\n * var other = { 'a': 1 };\n *\n * _.eq(object, object);\n * // => true\n *\n * _.eq(object, other);\n * // => false\n *\n * _.eq('a', 'a');\n * // => true\n *\n * _.eq('a', Object('a'));\n * // => false\n *\n * _.eq(NaN, NaN);\n * // => true\n */\nfunction eq(value, other) {\n  return value === other || (value !== value && other !== other);\n}\n\n/**\n * Checks if `value` is classified as an `Array` object.\n *\n * @static\n * @memberOf _\n * @since 0.1.0\n * @category Lang\n * @param {*} value The value to check.\n * @returns {boolean} Returns `true` if `value` is an array, else `false`.\n * @example\n *\n * _.isArray([1, 2, 3]);\n * // => true\n *\n * _.isArray(document.body.children);\n * // => false\n *\n * _.isArray('abc');\n * // => false\n *\n * _.isArray(_.noop);\n * // => false\n */\nvar isArray = Array.isArray;\n\n/**\n * Checks if `value` is classified as a `Function` object.\n *\n * @static\n * @memberOf _\n * @since 0.1.0\n * @category Lang\n * @param {*} value The value to check.\n * @returns {boolean} Returns `true` if `value` is a function, else `false`.\n * @example\n *\n * _.isFunction(_);\n * // => true\n *\n * _.isFunction(/abc/);\n * // => false\n */\nfunction isFunction(value) {\n  // The use of `Object#toString` avoids issues with the `typeof` operator\n  // in Safari 8-9 which returns 'object' for typed array and other constructors.\n  var tag = isObject(value) ? objectToString.call(value) : '';\n  return tag == funcTag || tag == genTag;\n}\n\n/**\n * Checks if `value` is the\n * [language type](http://www.ecma-international.org/ecma-262/7.0/#sec-ecmascript-language-types)\n * of `Object`. (e.g. arrays, functions, objects, regexes, `new Number(0)`, and `new String('')`)\n *\n * @static\n * @memberOf _\n * @since 0.1.0\n * @category Lang\n * @param {*} value The value to check.\n * @returns {boolean} Returns `true` if `value` is an object, else `false`.\n * @example\n *\n * _.isObject({});\n * // => true\n *\n * _.isObject([1, 2, 3]);\n * // => true\n *\n * _.isObject(_.noop);\n * // => true\n *\n * _.isObject(null);\n * // => false\n */\nfunction isObject(value) {\n  var type = typeof value;\n  return !!value && (type == 'object' || type == 'function');\n}\n\n/**\n * Checks if `value` is object-like. A value is object-like if it's not `null`\n * and has a `typeof` result of \"object\".\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @category Lang\n * @param {*} value The value to check.\n * @returns {boolean} Returns `true` if `value` is object-like, else `false`.\n * @example\n *\n * _.isObjectLike({});\n * // => true\n *\n * _.isObjectLike([1, 2, 3]);\n * // => true\n *\n * _.isObjectLike(_.noop);\n * // => false\n *\n * _.isObjectLike(null);\n * // => false\n */\nfunction isObjectLike(value) {\n  return !!value && typeof value == 'object';\n}\n\n/**\n * Checks if `value` is classified as a `Symbol` primitive or object.\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @category Lang\n * @param {*} value The value to check.\n * @returns {boolean} Returns `true` if `value` is a symbol, else `false`.\n * @example\n *\n * _.isSymbol(Symbol.iterator);\n * // => true\n *\n * _.isSymbol('abc');\n * // => false\n */\nfunction isSymbol(value) {\n  return typeof value == 'symbol' ||\n    (isObjectLike(value) && objectToString.call(value) == symbolTag);\n}\n\n/**\n * Converts `value` to a string. An empty string is returned for `null`\n * and `undefined` values. The sign of `-0` is preserved.\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @category Lang\n * @param {*} value The value to process.\n * @returns {string} Returns the string.\n * @example\n *\n * _.toString(null);\n * // => ''\n *\n * _.toString(-0);\n * // => '-0'\n *\n * _.toString([1, 2, 3]);\n * // => '1,2,3'\n */\nfunction toString(value) {\n  return value == null ? '' : baseToString(value);\n}\n\n/**\n * Gets the value at `path` of `object`. If the resolved value is\n * `undefined`, the `defaultValue` is returned in its place.\n *\n * @static\n * @memberOf _\n * @since 3.7.0\n * @category Object\n * @param {Object} object The object to query.\n * @param {Array|string} path The path of the property to get.\n * @param {*} [defaultValue] The value returned for `undefined` resolved values.\n * @returns {*} Returns the resolved value.\n * @example\n *\n * var object = { 'a': [{ 'b': { 'c': 3 } }] };\n *\n * _.get(object, 'a[0].b.c');\n * // => 3\n *\n * _.get(object, ['a', '0', 'b', 'c']);\n * // => 3\n *\n * _.get(object, 'a.b.c', 'default');\n * // => 'default'\n */\nfunction get$1(object, path, defaultValue) {\n  var result = object == null ? undefined : baseGet(object, path);\n  return result === undefined ? defaultValue : result;\n}\n\nvar lodash_get = get$1;\n\nvar lodash_clonedeep = createCommonjsModule(function (module, exports) {\n/**\n * lodash (Custom Build) <https://lodash.com/>\n * Build: `lodash modularize exports=\"npm\" -o ./`\n * Copyright jQuery Foundation and other contributors <https://jquery.org/>\n * Released under MIT license <https://lodash.com/license>\n * Based on Underscore.js 1.8.3 <http://underscorejs.org/LICENSE>\n * Copyright Jeremy Ashkenas, DocumentCloud and Investigative Reporters & Editors\n */\n\n/** Used as the size to enable large array optimizations. */\nvar LARGE_ARRAY_SIZE = 200;\n\n/** Used to stand-in for `undefined` hash values. */\nvar HASH_UNDEFINED = '__lodash_hash_undefined__';\n\n/** Used as references for various `Number` constants. */\nvar MAX_SAFE_INTEGER = 9007199254740991;\n\n/** `Object#toString` result references. */\nvar argsTag = '[object Arguments]',\n    arrayTag = '[object Array]',\n    boolTag = '[object Boolean]',\n    dateTag = '[object Date]',\n    errorTag = '[object Error]',\n    funcTag = '[object Function]',\n    genTag = '[object GeneratorFunction]',\n    mapTag = '[object Map]',\n    numberTag = '[object Number]',\n    objectTag = '[object Object]',\n    promiseTag = '[object Promise]',\n    regexpTag = '[object RegExp]',\n    setTag = '[object Set]',\n    stringTag = '[object String]',\n    symbolTag = '[object Symbol]',\n    weakMapTag = '[object WeakMap]';\n\nvar arrayBufferTag = '[object ArrayBuffer]',\n    dataViewTag = '[object DataView]',\n    float32Tag = '[object Float32Array]',\n    float64Tag = '[object Float64Array]',\n    int8Tag = '[object Int8Array]',\n    int16Tag = '[object Int16Array]',\n    int32Tag = '[object Int32Array]',\n    uint8Tag = '[object Uint8Array]',\n    uint8ClampedTag = '[object Uint8ClampedArray]',\n    uint16Tag = '[object Uint16Array]',\n    uint32Tag = '[object Uint32Array]';\n\n/**\n * Used to match `RegExp`\n * [syntax characters](http://ecma-international.org/ecma-262/7.0/#sec-patterns).\n */\nvar reRegExpChar = /[\\\\^$.*+?()[\\]{}|]/g;\n\n/** Used to match `RegExp` flags from their coerced string values. */\nvar reFlags = /\\w*$/;\n\n/** Used to detect host constructors (Safari). */\nvar reIsHostCtor = /^\\[object .+?Constructor\\]$/;\n\n/** Used to detect unsigned integer values. */\nvar reIsUint = /^(?:0|[1-9]\\d*)$/;\n\n/** Used to identify `toStringTag` values supported by `_.clone`. */\nvar cloneableTags = {};\ncloneableTags[argsTag] = cloneableTags[arrayTag] =\ncloneableTags[arrayBufferTag] = cloneableTags[dataViewTag] =\ncloneableTags[boolTag] = cloneableTags[dateTag] =\ncloneableTags[float32Tag] = cloneableTags[float64Tag] =\ncloneableTags[int8Tag] = cloneableTags[int16Tag] =\ncloneableTags[int32Tag] = cloneableTags[mapTag] =\ncloneableTags[numberTag] = cloneableTags[objectTag] =\ncloneableTags[regexpTag] = cloneableTags[setTag] =\ncloneableTags[stringTag] = cloneableTags[symbolTag] =\ncloneableTags[uint8Tag] = cloneableTags[uint8ClampedTag] =\ncloneableTags[uint16Tag] = cloneableTags[uint32Tag] = true;\ncloneableTags[errorTag] = cloneableTags[funcTag] =\ncloneableTags[weakMapTag] = false;\n\n/** Detect free variable `global` from Node.js. */\nvar freeGlobal = typeof commonjsGlobal == 'object' && commonjsGlobal && commonjsGlobal.Object === Object && commonjsGlobal;\n\n/** Detect free variable `self`. */\nvar freeSelf = typeof self == 'object' && self && self.Object === Object && self;\n\n/** Used as a reference to the global object. */\nvar root = freeGlobal || freeSelf || Function('return this')();\n\n/** Detect free variable `exports`. */\nvar freeExports =  exports && !exports.nodeType && exports;\n\n/** Detect free variable `module`. */\nvar freeModule = freeExports && 'object' == 'object' && module && !module.nodeType && module;\n\n/** Detect the popular CommonJS extension `module.exports`. */\nvar moduleExports = freeModule && freeModule.exports === freeExports;\n\n/**\n * Adds the key-value `pair` to `map`.\n *\n * @private\n * @param {Object} map The map to modify.\n * @param {Array} pair The key-value pair to add.\n * @returns {Object} Returns `map`.\n */\nfunction addMapEntry(map, pair) {\n  // Don't return `map.set` because it's not chainable in IE 11.\n  map.set(pair[0], pair[1]);\n  return map;\n}\n\n/**\n * Adds `value` to `set`.\n *\n * @private\n * @param {Object} set The set to modify.\n * @param {*} value The value to add.\n * @returns {Object} Returns `set`.\n */\nfunction addSetEntry(set, value) {\n  // Don't return `set.add` because it's not chainable in IE 11.\n  set.add(value);\n  return set;\n}\n\n/**\n * A specialized version of `_.forEach` for arrays without support for\n * iteratee shorthands.\n *\n * @private\n * @param {Array} [array] The array to iterate over.\n * @param {Function} iteratee The function invoked per iteration.\n * @returns {Array} Returns `array`.\n */\nfunction arrayEach(array, iteratee) {\n  var index = -1,\n      length = array ? array.length : 0;\n\n  while (++index < length) {\n    if (iteratee(array[index], index, array) === false) {\n      break;\n    }\n  }\n  return array;\n}\n\n/**\n * Appends the elements of `values` to `array`.\n *\n * @private\n * @param {Array} array The array to modify.\n * @param {Array} values The values to append.\n * @returns {Array} Returns `array`.\n */\nfunction arrayPush(array, values) {\n  var index = -1,\n      length = values.length,\n      offset = array.length;\n\n  while (++index < length) {\n    array[offset + index] = values[index];\n  }\n  return array;\n}\n\n/**\n * A specialized version of `_.reduce` for arrays without support for\n * iteratee shorthands.\n *\n * @private\n * @param {Array} [array] The array to iterate over.\n * @param {Function} iteratee The function invoked per iteration.\n * @param {*} [accumulator] The initial value.\n * @param {boolean} [initAccum] Specify using the first element of `array` as\n *  the initial value.\n * @returns {*} Returns the accumulated value.\n */\nfunction arrayReduce(array, iteratee, accumulator, initAccum) {\n  var index = -1,\n      length = array ? array.length : 0;\n\n  if (initAccum && length) {\n    accumulator = array[++index];\n  }\n  while (++index < length) {\n    accumulator = iteratee(accumulator, array[index], index, array);\n  }\n  return accumulator;\n}\n\n/**\n * The base implementation of `_.times` without support for iteratee shorthands\n * or max array length checks.\n *\n * @private\n * @param {number} n The number of times to invoke `iteratee`.\n * @param {Function} iteratee The function invoked per iteration.\n * @returns {Array} Returns the array of results.\n */\nfunction baseTimes(n, iteratee) {\n  var index = -1,\n      result = Array(n);\n\n  while (++index < n) {\n    result[index] = iteratee(index);\n  }\n  return result;\n}\n\n/**\n * Gets the value at `key` of `object`.\n *\n * @private\n * @param {Object} [object] The object to query.\n * @param {string} key The key of the property to get.\n * @returns {*} Returns the property value.\n */\nfunction getValue(object, key) {\n  return object == null ? undefined : object[key];\n}\n\n/**\n * Checks if `value` is a host object in IE < 9.\n *\n * @private\n * @param {*} value The value to check.\n * @returns {boolean} Returns `true` if `value` is a host object, else `false`.\n */\nfunction isHostObject(value) {\n  // Many host objects are `Object` objects that can coerce to strings\n  // despite having improperly defined `toString` methods.\n  var result = false;\n  if (value != null && typeof value.toString != 'function') {\n    try {\n      result = !!(value + '');\n    } catch (e) {}\n  }\n  return result;\n}\n\n/**\n * Converts `map` to its key-value pairs.\n *\n * @private\n * @param {Object} map The map to convert.\n * @returns {Array} Returns the key-value pairs.\n */\nfunction mapToArray(map) {\n  var index = -1,\n      result = Array(map.size);\n\n  map.forEach(function(value, key) {\n    result[++index] = [key, value];\n  });\n  return result;\n}\n\n/**\n * Creates a unary function that invokes `func` with its argument transformed.\n *\n * @private\n * @param {Function} func The function to wrap.\n * @param {Function} transform The argument transform.\n * @returns {Function} Returns the new function.\n */\nfunction overArg(func, transform) {\n  return function(arg) {\n    return func(transform(arg));\n  };\n}\n\n/**\n * Converts `set` to an array of its values.\n *\n * @private\n * @param {Object} set The set to convert.\n * @returns {Array} Returns the values.\n */\nfunction setToArray(set) {\n  var index = -1,\n      result = Array(set.size);\n\n  set.forEach(function(value) {\n    result[++index] = value;\n  });\n  return result;\n}\n\n/** Used for built-in method references. */\nvar arrayProto = Array.prototype,\n    funcProto = Function.prototype,\n    objectProto = Object.prototype;\n\n/** Used to detect overreaching core-js shims. */\nvar coreJsData = root['__core-js_shared__'];\n\n/** Used to detect methods masquerading as native. */\nvar maskSrcKey = (function() {\n  var uid = /[^.]+$/.exec(coreJsData && coreJsData.keys && coreJsData.keys.IE_PROTO || '');\n  return uid ? ('Symbol(src)_1.' + uid) : '';\n}());\n\n/** Used to resolve the decompiled source of functions. */\nvar funcToString = funcProto.toString;\n\n/** Used to check objects for own properties. */\nvar hasOwnProperty = objectProto.hasOwnProperty;\n\n/**\n * Used to resolve the\n * [`toStringTag`](http://ecma-international.org/ecma-262/7.0/#sec-object.prototype.tostring)\n * of values.\n */\nvar objectToString = objectProto.toString;\n\n/** Used to detect if a method is native. */\nvar reIsNative = RegExp('^' +\n  funcToString.call(hasOwnProperty).replace(reRegExpChar, '\\\\$&')\n  .replace(/hasOwnProperty|(function).*?(?=\\\\\\()| for .+?(?=\\\\\\])/g, '$1.*?') + '$'\n);\n\n/** Built-in value references. */\nvar Buffer = moduleExports ? root.Buffer : undefined,\n    Symbol = root.Symbol,\n    Uint8Array = root.Uint8Array,\n    getPrototype = overArg(Object.getPrototypeOf, Object),\n    objectCreate = Object.create,\n    propertyIsEnumerable = objectProto.propertyIsEnumerable,\n    splice = arrayProto.splice;\n\n/* Built-in method references for those with the same name as other `lodash` methods. */\nvar nativeGetSymbols = Object.getOwnPropertySymbols,\n    nativeIsBuffer = Buffer ? Buffer.isBuffer : undefined,\n    nativeKeys = overArg(Object.keys, Object);\n\n/* Built-in method references that are verified to be native. */\nvar DataView = getNative(root, 'DataView'),\n    Map = getNative(root, 'Map'),\n    Promise = getNative(root, 'Promise'),\n    Set = getNative(root, 'Set'),\n    WeakMap = getNative(root, 'WeakMap'),\n    nativeCreate = getNative(Object, 'create');\n\n/** Used to detect maps, sets, and weakmaps. */\nvar dataViewCtorString = toSource(DataView),\n    mapCtorString = toSource(Map),\n    promiseCtorString = toSource(Promise),\n    setCtorString = toSource(Set),\n    weakMapCtorString = toSource(WeakMap);\n\n/** Used to convert symbols to primitives and strings. */\nvar symbolProto = Symbol ? Symbol.prototype : undefined,\n    symbolValueOf = symbolProto ? symbolProto.valueOf : undefined;\n\n/**\n * Creates a hash object.\n *\n * @private\n * @constructor\n * @param {Array} [entries] The key-value pairs to cache.\n */\nfunction Hash(entries) {\n  var index = -1,\n      length = entries ? entries.length : 0;\n\n  this.clear();\n  while (++index < length) {\n    var entry = entries[index];\n    this.set(entry[0], entry[1]);\n  }\n}\n\n/**\n * Removes all key-value entries from the hash.\n *\n * @private\n * @name clear\n * @memberOf Hash\n */\nfunction hashClear() {\n  this.__data__ = nativeCreate ? nativeCreate(null) : {};\n}\n\n/**\n * Removes `key` and its value from the hash.\n *\n * @private\n * @name delete\n * @memberOf Hash\n * @param {Object} hash The hash to modify.\n * @param {string} key The key of the value to remove.\n * @returns {boolean} Returns `true` if the entry was removed, else `false`.\n */\nfunction hashDelete(key) {\n  return this.has(key) && delete this.__data__[key];\n}\n\n/**\n * Gets the hash value for `key`.\n *\n * @private\n * @name get\n * @memberOf Hash\n * @param {string} key The key of the value to get.\n * @returns {*} Returns the entry value.\n */\nfunction hashGet(key) {\n  var data = this.__data__;\n  if (nativeCreate) {\n    var result = data[key];\n    return result === HASH_UNDEFINED ? undefined : result;\n  }\n  return hasOwnProperty.call(data, key) ? data[key] : undefined;\n}\n\n/**\n * Checks if a hash value for `key` exists.\n *\n * @private\n * @name has\n * @memberOf Hash\n * @param {string} key The key of the entry to check.\n * @returns {boolean} Returns `true` if an entry for `key` exists, else `false`.\n */\nfunction hashHas(key) {\n  var data = this.__data__;\n  return nativeCreate ? data[key] !== undefined : hasOwnProperty.call(data, key);\n}\n\n/**\n * Sets the hash `key` to `value`.\n *\n * @private\n * @name set\n * @memberOf Hash\n * @param {string} key The key of the value to set.\n * @param {*} value The value to set.\n * @returns {Object} Returns the hash instance.\n */\nfunction hashSet(key, value) {\n  var data = this.__data__;\n  data[key] = (nativeCreate && value === undefined) ? HASH_UNDEFINED : value;\n  return this;\n}\n\n// Add methods to `Hash`.\nHash.prototype.clear = hashClear;\nHash.prototype['delete'] = hashDelete;\nHash.prototype.get = hashGet;\nHash.prototype.has = hashHas;\nHash.prototype.set = hashSet;\n\n/**\n * Creates an list cache object.\n *\n * @private\n * @constructor\n * @param {Array} [entries] The key-value pairs to cache.\n */\nfunction ListCache(entries) {\n  var index = -1,\n      length = entries ? entries.length : 0;\n\n  this.clear();\n  while (++index < length) {\n    var entry = entries[index];\n    this.set(entry[0], entry[1]);\n  }\n}\n\n/**\n * Removes all key-value entries from the list cache.\n *\n * @private\n * @name clear\n * @memberOf ListCache\n */\nfunction listCacheClear() {\n  this.__data__ = [];\n}\n\n/**\n * Removes `key` and its value from the list cache.\n *\n * @private\n * @name delete\n * @memberOf ListCache\n * @param {string} key The key of the value to remove.\n * @returns {boolean} Returns `true` if the entry was removed, else `false`.\n */\nfunction listCacheDelete(key) {\n  var data = this.__data__,\n      index = assocIndexOf(data, key);\n\n  if (index < 0) {\n    return false;\n  }\n  var lastIndex = data.length - 1;\n  if (index == lastIndex) {\n    data.pop();\n  } else {\n    splice.call(data, index, 1);\n  }\n  return true;\n}\n\n/**\n * Gets the list cache value for `key`.\n *\n * @private\n * @name get\n * @memberOf ListCache\n * @param {string} key The key of the value to get.\n * @returns {*} Returns the entry value.\n */\nfunction listCacheGet(key) {\n  var data = this.__data__,\n      index = assocIndexOf(data, key);\n\n  return index < 0 ? undefined : data[index][1];\n}\n\n/**\n * Checks if a list cache value for `key` exists.\n *\n * @private\n * @name has\n * @memberOf ListCache\n * @param {string} key The key of the entry to check.\n * @returns {boolean} Returns `true` if an entry for `key` exists, else `false`.\n */\nfunction listCacheHas(key) {\n  return assocIndexOf(this.__data__, key) > -1;\n}\n\n/**\n * Sets the list cache `key` to `value`.\n *\n * @private\n * @name set\n * @memberOf ListCache\n * @param {string} key The key of the value to set.\n * @param {*} value The value to set.\n * @returns {Object} Returns the list cache instance.\n */\nfunction listCacheSet(key, value) {\n  var data = this.__data__,\n      index = assocIndexOf(data, key);\n\n  if (index < 0) {\n    data.push([key, value]);\n  } else {\n    data[index][1] = value;\n  }\n  return this;\n}\n\n// Add methods to `ListCache`.\nListCache.prototype.clear = listCacheClear;\nListCache.prototype['delete'] = listCacheDelete;\nListCache.prototype.get = listCacheGet;\nListCache.prototype.has = listCacheHas;\nListCache.prototype.set = listCacheSet;\n\n/**\n * Creates a map cache object to store key-value pairs.\n *\n * @private\n * @constructor\n * @param {Array} [entries] The key-value pairs to cache.\n */\nfunction MapCache(entries) {\n  var index = -1,\n      length = entries ? entries.length : 0;\n\n  this.clear();\n  while (++index < length) {\n    var entry = entries[index];\n    this.set(entry[0], entry[1]);\n  }\n}\n\n/**\n * Removes all key-value entries from the map.\n *\n * @private\n * @name clear\n * @memberOf MapCache\n */\nfunction mapCacheClear() {\n  this.__data__ = {\n    'hash': new Hash,\n    'map': new (Map || ListCache),\n    'string': new Hash\n  };\n}\n\n/**\n * Removes `key` and its value from the map.\n *\n * @private\n * @name delete\n * @memberOf MapCache\n * @param {string} key The key of the value to remove.\n * @returns {boolean} Returns `true` if the entry was removed, else `false`.\n */\nfunction mapCacheDelete(key) {\n  return getMapData(this, key)['delete'](key);\n}\n\n/**\n * Gets the map value for `key`.\n *\n * @private\n * @name get\n * @memberOf MapCache\n * @param {string} key The key of the value to get.\n * @returns {*} Returns the entry value.\n */\nfunction mapCacheGet(key) {\n  return getMapData(this, key).get(key);\n}\n\n/**\n * Checks if a map value for `key` exists.\n *\n * @private\n * @name has\n * @memberOf MapCache\n * @param {string} key The key of the entry to check.\n * @returns {boolean} Returns `true` if an entry for `key` exists, else `false`.\n */\nfunction mapCacheHas(key) {\n  return getMapData(this, key).has(key);\n}\n\n/**\n * Sets the map `key` to `value`.\n *\n * @private\n * @name set\n * @memberOf MapCache\n * @param {string} key The key of the value to set.\n * @param {*} value The value to set.\n * @returns {Object} Returns the map cache instance.\n */\nfunction mapCacheSet(key, value) {\n  getMapData(this, key).set(key, value);\n  return this;\n}\n\n// Add methods to `MapCache`.\nMapCache.prototype.clear = mapCacheClear;\nMapCache.prototype['delete'] = mapCacheDelete;\nMapCache.prototype.get = mapCacheGet;\nMapCache.prototype.has = mapCacheHas;\nMapCache.prototype.set = mapCacheSet;\n\n/**\n * Creates a stack cache object to store key-value pairs.\n *\n * @private\n * @constructor\n * @param {Array} [entries] The key-value pairs to cache.\n */\nfunction Stack(entries) {\n  this.__data__ = new ListCache(entries);\n}\n\n/**\n * Removes all key-value entries from the stack.\n *\n * @private\n * @name clear\n * @memberOf Stack\n */\nfunction stackClear() {\n  this.__data__ = new ListCache;\n}\n\n/**\n * Removes `key` and its value from the stack.\n *\n * @private\n * @name delete\n * @memberOf Stack\n * @param {string} key The key of the value to remove.\n * @returns {boolean} Returns `true` if the entry was removed, else `false`.\n */\nfunction stackDelete(key) {\n  return this.__data__['delete'](key);\n}\n\n/**\n * Gets the stack value for `key`.\n *\n * @private\n * @name get\n * @memberOf Stack\n * @param {string} key The key of the value to get.\n * @returns {*} Returns the entry value.\n */\nfunction stackGet(key) {\n  return this.__data__.get(key);\n}\n\n/**\n * Checks if a stack value for `key` exists.\n *\n * @private\n * @name has\n * @memberOf Stack\n * @param {string} key The key of the entry to check.\n * @returns {boolean} Returns `true` if an entry for `key` exists, else `false`.\n */\nfunction stackHas(key) {\n  return this.__data__.has(key);\n}\n\n/**\n * Sets the stack `key` to `value`.\n *\n * @private\n * @name set\n * @memberOf Stack\n * @param {string} key The key of the value to set.\n * @param {*} value The value to set.\n * @returns {Object} Returns the stack cache instance.\n */\nfunction stackSet(key, value) {\n  var cache = this.__data__;\n  if (cache instanceof ListCache) {\n    var pairs = cache.__data__;\n    if (!Map || (pairs.length < LARGE_ARRAY_SIZE - 1)) {\n      pairs.push([key, value]);\n      return this;\n    }\n    cache = this.__data__ = new MapCache(pairs);\n  }\n  cache.set(key, value);\n  return this;\n}\n\n// Add methods to `Stack`.\nStack.prototype.clear = stackClear;\nStack.prototype['delete'] = stackDelete;\nStack.prototype.get = stackGet;\nStack.prototype.has = stackHas;\nStack.prototype.set = stackSet;\n\n/**\n * Creates an array of the enumerable property names of the array-like `value`.\n *\n * @private\n * @param {*} value The value to query.\n * @param {boolean} inherited Specify returning inherited property names.\n * @returns {Array} Returns the array of property names.\n */\nfunction arrayLikeKeys(value, inherited) {\n  // Safari 8.1 makes `arguments.callee` enumerable in strict mode.\n  // Safari 9 makes `arguments.length` enumerable in strict mode.\n  var result = (isArray(value) || isArguments(value))\n    ? baseTimes(value.length, String)\n    : [];\n\n  var length = result.length,\n      skipIndexes = !!length;\n\n  for (var key in value) {\n    if ((inherited || hasOwnProperty.call(value, key)) &&\n        !(skipIndexes && (key == 'length' || isIndex(key, length)))) {\n      result.push(key);\n    }\n  }\n  return result;\n}\n\n/**\n * Assigns `value` to `key` of `object` if the existing value is not equivalent\n * using [`SameValueZero`](http://ecma-international.org/ecma-262/7.0/#sec-samevaluezero)\n * for equality comparisons.\n *\n * @private\n * @param {Object} object The object to modify.\n * @param {string} key The key of the property to assign.\n * @param {*} value The value to assign.\n */\nfunction assignValue(object, key, value) {\n  var objValue = object[key];\n  if (!(hasOwnProperty.call(object, key) && eq(objValue, value)) ||\n      (value === undefined && !(key in object))) {\n    object[key] = value;\n  }\n}\n\n/**\n * Gets the index at which the `key` is found in `array` of key-value pairs.\n *\n * @private\n * @param {Array} array The array to inspect.\n * @param {*} key The key to search for.\n * @returns {number} Returns the index of the matched value, else `-1`.\n */\nfunction assocIndexOf(array, key) {\n  var length = array.length;\n  while (length--) {\n    if (eq(array[length][0], key)) {\n      return length;\n    }\n  }\n  return -1;\n}\n\n/**\n * The base implementation of `_.assign` without support for multiple sources\n * or `customizer` functions.\n *\n * @private\n * @param {Object} object The destination object.\n * @param {Object} source The source object.\n * @returns {Object} Returns `object`.\n */\nfunction baseAssign(object, source) {\n  return object && copyObject(source, keys(source), object);\n}\n\n/**\n * The base implementation of `_.clone` and `_.cloneDeep` which tracks\n * traversed objects.\n *\n * @private\n * @param {*} value The value to clone.\n * @param {boolean} [isDeep] Specify a deep clone.\n * @param {boolean} [isFull] Specify a clone including symbols.\n * @param {Function} [customizer] The function to customize cloning.\n * @param {string} [key] The key of `value`.\n * @param {Object} [object] The parent object of `value`.\n * @param {Object} [stack] Tracks traversed objects and their clone counterparts.\n * @returns {*} Returns the cloned value.\n */\nfunction baseClone(value, isDeep, isFull, customizer, key, object, stack) {\n  var result;\n  if (customizer) {\n    result = object ? customizer(value, key, object, stack) : customizer(value);\n  }\n  if (result !== undefined) {\n    return result;\n  }\n  if (!isObject(value)) {\n    return value;\n  }\n  var isArr = isArray(value);\n  if (isArr) {\n    result = initCloneArray(value);\n    if (!isDeep) {\n      return copyArray(value, result);\n    }\n  } else {\n    var tag = getTag(value),\n        isFunc = tag == funcTag || tag == genTag;\n\n    if (isBuffer(value)) {\n      return cloneBuffer(value, isDeep);\n    }\n    if (tag == objectTag || tag == argsTag || (isFunc && !object)) {\n      if (isHostObject(value)) {\n        return object ? value : {};\n      }\n      result = initCloneObject(isFunc ? {} : value);\n      if (!isDeep) {\n        return copySymbols(value, baseAssign(result, value));\n      }\n    } else {\n      if (!cloneableTags[tag]) {\n        return object ? value : {};\n      }\n      result = initCloneByTag(value, tag, baseClone, isDeep);\n    }\n  }\n  // Check for circular references and return its corresponding clone.\n  stack || (stack = new Stack);\n  var stacked = stack.get(value);\n  if (stacked) {\n    return stacked;\n  }\n  stack.set(value, result);\n\n  if (!isArr) {\n    var props = isFull ? getAllKeys(value) : keys(value);\n  }\n  arrayEach(props || value, function(subValue, key) {\n    if (props) {\n      key = subValue;\n      subValue = value[key];\n    }\n    // Recursively populate clone (susceptible to call stack limits).\n    assignValue(result, key, baseClone(subValue, isDeep, isFull, customizer, key, value, stack));\n  });\n  return result;\n}\n\n/**\n * The base implementation of `_.create` without support for assigning\n * properties to the created object.\n *\n * @private\n * @param {Object} prototype The object to inherit from.\n * @returns {Object} Returns the new object.\n */\nfunction baseCreate(proto) {\n  return isObject(proto) ? objectCreate(proto) : {};\n}\n\n/**\n * The base implementation of `getAllKeys` and `getAllKeysIn` which uses\n * `keysFunc` and `symbolsFunc` to get the enumerable property names and\n * symbols of `object`.\n *\n * @private\n * @param {Object} object The object to query.\n * @param {Function} keysFunc The function to get the keys of `object`.\n * @param {Function} symbolsFunc The function to get the symbols of `object`.\n * @returns {Array} Returns the array of property names and symbols.\n */\nfunction baseGetAllKeys(object, keysFunc, symbolsFunc) {\n  var result = keysFunc(object);\n  return isArray(object) ? result : arrayPush(result, symbolsFunc(object));\n}\n\n/**\n * The base implementation of `getTag`.\n *\n * @private\n * @param {*} value The value to query.\n * @returns {string} Returns the `toStringTag`.\n */\nfunction baseGetTag(value) {\n  return objectToString.call(value);\n}\n\n/**\n * The base implementation of `_.isNative` without bad shim checks.\n *\n * @private\n * @param {*} value The value to check.\n * @returns {boolean} Returns `true` if `value` is a native function,\n *  else `false`.\n */\nfunction baseIsNative(value) {\n  if (!isObject(value) || isMasked(value)) {\n    return false;\n  }\n  var pattern = (isFunction(value) || isHostObject(value)) ? reIsNative : reIsHostCtor;\n  return pattern.test(toSource(value));\n}\n\n/**\n * The base implementation of `_.keys` which doesn't treat sparse arrays as dense.\n *\n * @private\n * @param {Object} object The object to query.\n * @returns {Array} Returns the array of property names.\n */\nfunction baseKeys(object) {\n  if (!isPrototype(object)) {\n    return nativeKeys(object);\n  }\n  var result = [];\n  for (var key in Object(object)) {\n    if (hasOwnProperty.call(object, key) && key != 'constructor') {\n      result.push(key);\n    }\n  }\n  return result;\n}\n\n/**\n * Creates a clone of  `buffer`.\n *\n * @private\n * @param {Buffer} buffer The buffer to clone.\n * @param {boolean} [isDeep] Specify a deep clone.\n * @returns {Buffer} Returns the cloned buffer.\n */\nfunction cloneBuffer(buffer, isDeep) {\n  if (isDeep) {\n    return buffer.slice();\n  }\n  var result = new buffer.constructor(buffer.length);\n  buffer.copy(result);\n  return result;\n}\n\n/**\n * Creates a clone of `arrayBuffer`.\n *\n * @private\n * @param {ArrayBuffer} arrayBuffer The array buffer to clone.\n * @returns {ArrayBuffer} Returns the cloned array buffer.\n */\nfunction cloneArrayBuffer(arrayBuffer) {\n  var result = new arrayBuffer.constructor(arrayBuffer.byteLength);\n  new Uint8Array(result).set(new Uint8Array(arrayBuffer));\n  return result;\n}\n\n/**\n * Creates a clone of `dataView`.\n *\n * @private\n * @param {Object} dataView The data view to clone.\n * @param {boolean} [isDeep] Specify a deep clone.\n * @returns {Object} Returns the cloned data view.\n */\nfunction cloneDataView(dataView, isDeep) {\n  var buffer = isDeep ? cloneArrayBuffer(dataView.buffer) : dataView.buffer;\n  return new dataView.constructor(buffer, dataView.byteOffset, dataView.byteLength);\n}\n\n/**\n * Creates a clone of `map`.\n *\n * @private\n * @param {Object} map The map to clone.\n * @param {Function} cloneFunc The function to clone values.\n * @param {boolean} [isDeep] Specify a deep clone.\n * @returns {Object} Returns the cloned map.\n */\nfunction cloneMap(map, isDeep, cloneFunc) {\n  var array = isDeep ? cloneFunc(mapToArray(map), true) : mapToArray(map);\n  return arrayReduce(array, addMapEntry, new map.constructor);\n}\n\n/**\n * Creates a clone of `regexp`.\n *\n * @private\n * @param {Object} regexp The regexp to clone.\n * @returns {Object} Returns the cloned regexp.\n */\nfunction cloneRegExp(regexp) {\n  var result = new regexp.constructor(regexp.source, reFlags.exec(regexp));\n  result.lastIndex = regexp.lastIndex;\n  return result;\n}\n\n/**\n * Creates a clone of `set`.\n *\n * @private\n * @param {Object} set The set to clone.\n * @param {Function} cloneFunc The function to clone values.\n * @param {boolean} [isDeep] Specify a deep clone.\n * @returns {Object} Returns the cloned set.\n */\nfunction cloneSet(set, isDeep, cloneFunc) {\n  var array = isDeep ? cloneFunc(setToArray(set), true) : setToArray(set);\n  return arrayReduce(array, addSetEntry, new set.constructor);\n}\n\n/**\n * Creates a clone of the `symbol` object.\n *\n * @private\n * @param {Object} symbol The symbol object to clone.\n * @returns {Object} Returns the cloned symbol object.\n */\nfunction cloneSymbol(symbol) {\n  return symbolValueOf ? Object(symbolValueOf.call(symbol)) : {};\n}\n\n/**\n * Creates a clone of `typedArray`.\n *\n * @private\n * @param {Object} typedArray The typed array to clone.\n * @param {boolean} [isDeep] Specify a deep clone.\n * @returns {Object} Returns the cloned typed array.\n */\nfunction cloneTypedArray(typedArray, isDeep) {\n  var buffer = isDeep ? cloneArrayBuffer(typedArray.buffer) : typedArray.buffer;\n  return new typedArray.constructor(buffer, typedArray.byteOffset, typedArray.length);\n}\n\n/**\n * Copies the values of `source` to `array`.\n *\n * @private\n * @param {Array} source The array to copy values from.\n * @param {Array} [array=[]] The array to copy values to.\n * @returns {Array} Returns `array`.\n */\nfunction copyArray(source, array) {\n  var index = -1,\n      length = source.length;\n\n  array || (array = Array(length));\n  while (++index < length) {\n    array[index] = source[index];\n  }\n  return array;\n}\n\n/**\n * Copies properties of `source` to `object`.\n *\n * @private\n * @param {Object} source The object to copy properties from.\n * @param {Array} props The property identifiers to copy.\n * @param {Object} [object={}] The object to copy properties to.\n * @param {Function} [customizer] The function to customize copied values.\n * @returns {Object} Returns `object`.\n */\nfunction copyObject(source, props, object, customizer) {\n  object || (object = {});\n\n  var index = -1,\n      length = props.length;\n\n  while (++index < length) {\n    var key = props[index];\n\n    var newValue = customizer\n      ? customizer(object[key], source[key], key, object, source)\n      : undefined;\n\n    assignValue(object, key, newValue === undefined ? source[key] : newValue);\n  }\n  return object;\n}\n\n/**\n * Copies own symbol properties of `source` to `object`.\n *\n * @private\n * @param {Object} source The object to copy symbols from.\n * @param {Object} [object={}] The object to copy symbols to.\n * @returns {Object} Returns `object`.\n */\nfunction copySymbols(source, object) {\n  return copyObject(source, getSymbols(source), object);\n}\n\n/**\n * Creates an array of own enumerable property names and symbols of `object`.\n *\n * @private\n * @param {Object} object The object to query.\n * @returns {Array} Returns the array of property names and symbols.\n */\nfunction getAllKeys(object) {\n  return baseGetAllKeys(object, keys, getSymbols);\n}\n\n/**\n * Gets the data for `map`.\n *\n * @private\n * @param {Object} map The map to query.\n * @param {string} key The reference key.\n * @returns {*} Returns the map data.\n */\nfunction getMapData(map, key) {\n  var data = map.__data__;\n  return isKeyable(key)\n    ? data[typeof key == 'string' ? 'string' : 'hash']\n    : data.map;\n}\n\n/**\n * Gets the native function at `key` of `object`.\n *\n * @private\n * @param {Object} object The object to query.\n * @param {string} key The key of the method to get.\n * @returns {*} Returns the function if it's native, else `undefined`.\n */\nfunction getNative(object, key) {\n  var value = getValue(object, key);\n  return baseIsNative(value) ? value : undefined;\n}\n\n/**\n * Creates an array of the own enumerable symbol properties of `object`.\n *\n * @private\n * @param {Object} object The object to query.\n * @returns {Array} Returns the array of symbols.\n */\nvar getSymbols = nativeGetSymbols ? overArg(nativeGetSymbols, Object) : stubArray;\n\n/**\n * Gets the `toStringTag` of `value`.\n *\n * @private\n * @param {*} value The value to query.\n * @returns {string} Returns the `toStringTag`.\n */\nvar getTag = baseGetTag;\n\n// Fallback for data views, maps, sets, and weak maps in IE 11,\n// for data views in Edge < 14, and promises in Node.js.\nif ((DataView && getTag(new DataView(new ArrayBuffer(1))) != dataViewTag) ||\n    (Map && getTag(new Map) != mapTag) ||\n    (Promise && getTag(Promise.resolve()) != promiseTag) ||\n    (Set && getTag(new Set) != setTag) ||\n    (WeakMap && getTag(new WeakMap) != weakMapTag)) {\n  getTag = function(value) {\n    var result = objectToString.call(value),\n        Ctor = result == objectTag ? value.constructor : undefined,\n        ctorString = Ctor ? toSource(Ctor) : undefined;\n\n    if (ctorString) {\n      switch (ctorString) {\n        case dataViewCtorString: return dataViewTag;\n        case mapCtorString: return mapTag;\n        case promiseCtorString: return promiseTag;\n        case setCtorString: return setTag;\n        case weakMapCtorString: return weakMapTag;\n      }\n    }\n    return result;\n  };\n}\n\n/**\n * Initializes an array clone.\n *\n * @private\n * @param {Array} array The array to clone.\n * @returns {Array} Returns the initialized clone.\n */\nfunction initCloneArray(array) {\n  var length = array.length,\n      result = array.constructor(length);\n\n  // Add properties assigned by `RegExp#exec`.\n  if (length && typeof array[0] == 'string' && hasOwnProperty.call(array, 'index')) {\n    result.index = array.index;\n    result.input = array.input;\n  }\n  return result;\n}\n\n/**\n * Initializes an object clone.\n *\n * @private\n * @param {Object} object The object to clone.\n * @returns {Object} Returns the initialized clone.\n */\nfunction initCloneObject(object) {\n  return (typeof object.constructor == 'function' && !isPrototype(object))\n    ? baseCreate(getPrototype(object))\n    : {};\n}\n\n/**\n * Initializes an object clone based on its `toStringTag`.\n *\n * **Note:** This function only supports cloning values with tags of\n * `Boolean`, `Date`, `Error`, `Number`, `RegExp`, or `String`.\n *\n * @private\n * @param {Object} object The object to clone.\n * @param {string} tag The `toStringTag` of the object to clone.\n * @param {Function} cloneFunc The function to clone values.\n * @param {boolean} [isDeep] Specify a deep clone.\n * @returns {Object} Returns the initialized clone.\n */\nfunction initCloneByTag(object, tag, cloneFunc, isDeep) {\n  var Ctor = object.constructor;\n  switch (tag) {\n    case arrayBufferTag:\n      return cloneArrayBuffer(object);\n\n    case boolTag:\n    case dateTag:\n      return new Ctor(+object);\n\n    case dataViewTag:\n      return cloneDataView(object, isDeep);\n\n    case float32Tag: case float64Tag:\n    case int8Tag: case int16Tag: case int32Tag:\n    case uint8Tag: case uint8ClampedTag: case uint16Tag: case uint32Tag:\n      return cloneTypedArray(object, isDeep);\n\n    case mapTag:\n      return cloneMap(object, isDeep, cloneFunc);\n\n    case numberTag:\n    case stringTag:\n      return new Ctor(object);\n\n    case regexpTag:\n      return cloneRegExp(object);\n\n    case setTag:\n      return cloneSet(object, isDeep, cloneFunc);\n\n    case symbolTag:\n      return cloneSymbol(object);\n  }\n}\n\n/**\n * Checks if `value` is a valid array-like index.\n *\n * @private\n * @param {*} value The value to check.\n * @param {number} [length=MAX_SAFE_INTEGER] The upper bounds of a valid index.\n * @returns {boolean} Returns `true` if `value` is a valid index, else `false`.\n */\nfunction isIndex(value, length) {\n  length = length == null ? MAX_SAFE_INTEGER : length;\n  return !!length &&\n    (typeof value == 'number' || reIsUint.test(value)) &&\n    (value > -1 && value % 1 == 0 && value < length);\n}\n\n/**\n * Checks if `value` is suitable for use as unique object key.\n *\n * @private\n * @param {*} value The value to check.\n * @returns {boolean} Returns `true` if `value` is suitable, else `false`.\n */\nfunction isKeyable(value) {\n  var type = typeof value;\n  return (type == 'string' || type == 'number' || type == 'symbol' || type == 'boolean')\n    ? (value !== '__proto__')\n    : (value === null);\n}\n\n/**\n * Checks if `func` has its source masked.\n *\n * @private\n * @param {Function} func The function to check.\n * @returns {boolean} Returns `true` if `func` is masked, else `false`.\n */\nfunction isMasked(func) {\n  return !!maskSrcKey && (maskSrcKey in func);\n}\n\n/**\n * Checks if `value` is likely a prototype object.\n *\n * @private\n * @param {*} value The value to check.\n * @returns {boolean} Returns `true` if `value` is a prototype, else `false`.\n */\nfunction isPrototype(value) {\n  var Ctor = value && value.constructor,\n      proto = (typeof Ctor == 'function' && Ctor.prototype) || objectProto;\n\n  return value === proto;\n}\n\n/**\n * Converts `func` to its source code.\n *\n * @private\n * @param {Function} func The function to process.\n * @returns {string} Returns the source code.\n */\nfunction toSource(func) {\n  if (func != null) {\n    try {\n      return funcToString.call(func);\n    } catch (e) {}\n    try {\n      return (func + '');\n    } catch (e) {}\n  }\n  return '';\n}\n\n/**\n * This method is like `_.clone` except that it recursively clones `value`.\n *\n * @static\n * @memberOf _\n * @since 1.0.0\n * @category Lang\n * @param {*} value The value to recursively clone.\n * @returns {*} Returns the deep cloned value.\n * @see _.clone\n * @example\n *\n * var objects = [{ 'a': 1 }, { 'b': 2 }];\n *\n * var deep = _.cloneDeep(objects);\n * console.log(deep[0] === objects[0]);\n * // => false\n */\nfunction cloneDeep(value) {\n  return baseClone(value, true, true);\n}\n\n/**\n * Performs a\n * [`SameValueZero`](http://ecma-international.org/ecma-262/7.0/#sec-samevaluezero)\n * comparison between two values to determine if they are equivalent.\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @category Lang\n * @param {*} value The value to compare.\n * @param {*} other The other value to compare.\n * @returns {boolean} Returns `true` if the values are equivalent, else `false`.\n * @example\n *\n * var object = { 'a': 1 };\n * var other = { 'a': 1 };\n *\n * _.eq(object, object);\n * // => true\n *\n * _.eq(object, other);\n * // => false\n *\n * _.eq('a', 'a');\n * // => true\n *\n * _.eq('a', Object('a'));\n * // => false\n *\n * _.eq(NaN, NaN);\n * // => true\n */\nfunction eq(value, other) {\n  return value === other || (value !== value && other !== other);\n}\n\n/**\n * Checks if `value` is likely an `arguments` object.\n *\n * @static\n * @memberOf _\n * @since 0.1.0\n * @category Lang\n * @param {*} value The value to check.\n * @returns {boolean} Returns `true` if `value` is an `arguments` object,\n *  else `false`.\n * @example\n *\n * _.isArguments(function() { return arguments; }());\n * // => true\n *\n * _.isArguments([1, 2, 3]);\n * // => false\n */\nfunction isArguments(value) {\n  // Safari 8.1 makes `arguments.callee` enumerable in strict mode.\n  return isArrayLikeObject(value) && hasOwnProperty.call(value, 'callee') &&\n    (!propertyIsEnumerable.call(value, 'callee') || objectToString.call(value) == argsTag);\n}\n\n/**\n * Checks if `value` is classified as an `Array` object.\n *\n * @static\n * @memberOf _\n * @since 0.1.0\n * @category Lang\n * @param {*} value The value to check.\n * @returns {boolean} Returns `true` if `value` is an array, else `false`.\n * @example\n *\n * _.isArray([1, 2, 3]);\n * // => true\n *\n * _.isArray(document.body.children);\n * // => false\n *\n * _.isArray('abc');\n * // => false\n *\n * _.isArray(_.noop);\n * // => false\n */\nvar isArray = Array.isArray;\n\n/**\n * Checks if `value` is array-like. A value is considered array-like if it's\n * not a function and has a `value.length` that's an integer greater than or\n * equal to `0` and less than or equal to `Number.MAX_SAFE_INTEGER`.\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @category Lang\n * @param {*} value The value to check.\n * @returns {boolean} Returns `true` if `value` is array-like, else `false`.\n * @example\n *\n * _.isArrayLike([1, 2, 3]);\n * // => true\n *\n * _.isArrayLike(document.body.children);\n * // => true\n *\n * _.isArrayLike('abc');\n * // => true\n *\n * _.isArrayLike(_.noop);\n * // => false\n */\nfunction isArrayLike(value) {\n  return value != null && isLength(value.length) && !isFunction(value);\n}\n\n/**\n * This method is like `_.isArrayLike` except that it also checks if `value`\n * is an object.\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @category Lang\n * @param {*} value The value to check.\n * @returns {boolean} Returns `true` if `value` is an array-like object,\n *  else `false`.\n * @example\n *\n * _.isArrayLikeObject([1, 2, 3]);\n * // => true\n *\n * _.isArrayLikeObject(document.body.children);\n * // => true\n *\n * _.isArrayLikeObject('abc');\n * // => false\n *\n * _.isArrayLikeObject(_.noop);\n * // => false\n */\nfunction isArrayLikeObject(value) {\n  return isObjectLike(value) && isArrayLike(value);\n}\n\n/**\n * Checks if `value` is a buffer.\n *\n * @static\n * @memberOf _\n * @since 4.3.0\n * @category Lang\n * @param {*} value The value to check.\n * @returns {boolean} Returns `true` if `value` is a buffer, else `false`.\n * @example\n *\n * _.isBuffer(new Buffer(2));\n * // => true\n *\n * _.isBuffer(new Uint8Array(2));\n * // => false\n */\nvar isBuffer = nativeIsBuffer || stubFalse;\n\n/**\n * Checks if `value` is classified as a `Function` object.\n *\n * @static\n * @memberOf _\n * @since 0.1.0\n * @category Lang\n * @param {*} value The value to check.\n * @returns {boolean} Returns `true` if `value` is a function, else `false`.\n * @example\n *\n * _.isFunction(_);\n * // => true\n *\n * _.isFunction(/abc/);\n * // => false\n */\nfunction isFunction(value) {\n  // The use of `Object#toString` avoids issues with the `typeof` operator\n  // in Safari 8-9 which returns 'object' for typed array and other constructors.\n  var tag = isObject(value) ? objectToString.call(value) : '';\n  return tag == funcTag || tag == genTag;\n}\n\n/**\n * Checks if `value` is a valid array-like length.\n *\n * **Note:** This method is loosely based on\n * [`ToLength`](http://ecma-international.org/ecma-262/7.0/#sec-tolength).\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @category Lang\n * @param {*} value The value to check.\n * @returns {boolean} Returns `true` if `value` is a valid length, else `false`.\n * @example\n *\n * _.isLength(3);\n * // => true\n *\n * _.isLength(Number.MIN_VALUE);\n * // => false\n *\n * _.isLength(Infinity);\n * // => false\n *\n * _.isLength('3');\n * // => false\n */\nfunction isLength(value) {\n  return typeof value == 'number' &&\n    value > -1 && value % 1 == 0 && value <= MAX_SAFE_INTEGER;\n}\n\n/**\n * Checks if `value` is the\n * [language type](http://www.ecma-international.org/ecma-262/7.0/#sec-ecmascript-language-types)\n * of `Object`. (e.g. arrays, functions, objects, regexes, `new Number(0)`, and `new String('')`)\n *\n * @static\n * @memberOf _\n * @since 0.1.0\n * @category Lang\n * @param {*} value The value to check.\n * @returns {boolean} Returns `true` if `value` is an object, else `false`.\n * @example\n *\n * _.isObject({});\n * // => true\n *\n * _.isObject([1, 2, 3]);\n * // => true\n *\n * _.isObject(_.noop);\n * // => true\n *\n * _.isObject(null);\n * // => false\n */\nfunction isObject(value) {\n  var type = typeof value;\n  return !!value && (type == 'object' || type == 'function');\n}\n\n/**\n * Checks if `value` is object-like. A value is object-like if it's not `null`\n * and has a `typeof` result of \"object\".\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @category Lang\n * @param {*} value The value to check.\n * @returns {boolean} Returns `true` if `value` is object-like, else `false`.\n * @example\n *\n * _.isObjectLike({});\n * // => true\n *\n * _.isObjectLike([1, 2, 3]);\n * // => true\n *\n * _.isObjectLike(_.noop);\n * // => false\n *\n * _.isObjectLike(null);\n * // => false\n */\nfunction isObjectLike(value) {\n  return !!value && typeof value == 'object';\n}\n\n/**\n * Creates an array of the own enumerable property names of `object`.\n *\n * **Note:** Non-object values are coerced to objects. See the\n * [ES spec](http://ecma-international.org/ecma-262/7.0/#sec-object.keys)\n * for more details.\n *\n * @static\n * @since 0.1.0\n * @memberOf _\n * @category Object\n * @param {Object} object The object to query.\n * @returns {Array} Returns the array of property names.\n * @example\n *\n * function Foo() {\n *   this.a = 1;\n *   this.b = 2;\n * }\n *\n * Foo.prototype.c = 3;\n *\n * _.keys(new Foo);\n * // => ['a', 'b'] (iteration order is not guaranteed)\n *\n * _.keys('hi');\n * // => ['0', '1']\n */\nfunction keys(object) {\n  return isArrayLike(object) ? arrayLikeKeys(object) : baseKeys(object);\n}\n\n/**\n * This method returns a new empty array.\n *\n * @static\n * @memberOf _\n * @since 4.13.0\n * @category Util\n * @returns {Array} Returns the new empty array.\n * @example\n *\n * var arrays = _.times(2, _.stubArray);\n *\n * console.log(arrays);\n * // => [[], []]\n *\n * console.log(arrays[0] === arrays[1]);\n * // => false\n */\nfunction stubArray() {\n  return [];\n}\n\n/**\n * This method returns `false`.\n *\n * @static\n * @memberOf _\n * @since 4.13.0\n * @category Util\n * @returns {boolean} Returns `false`.\n * @example\n *\n * _.times(2, _.stubFalse);\n * // => [false, false]\n */\nfunction stubFalse() {\n  return false;\n}\n\nmodule.exports = cloneDeep;\n});\n\nvar lodash_isequal = createCommonjsModule(function (module, exports) {\n/**\n * Lodash (Custom Build) <https://lodash.com/>\n * Build: `lodash modularize exports=\"npm\" -o ./`\n * Copyright JS Foundation and other contributors <https://js.foundation/>\n * Released under MIT license <https://lodash.com/license>\n * Based on Underscore.js 1.8.3 <http://underscorejs.org/LICENSE>\n * Copyright Jeremy Ashkenas, DocumentCloud and Investigative Reporters & Editors\n */\n\n/** Used as the size to enable large array optimizations. */\nvar LARGE_ARRAY_SIZE = 200;\n\n/** Used to stand-in for `undefined` hash values. */\nvar HASH_UNDEFINED = '__lodash_hash_undefined__';\n\n/** Used to compose bitmasks for value comparisons. */\nvar COMPARE_PARTIAL_FLAG = 1,\n    COMPARE_UNORDERED_FLAG = 2;\n\n/** Used as references for various `Number` constants. */\nvar MAX_SAFE_INTEGER = 9007199254740991;\n\n/** `Object#toString` result references. */\nvar argsTag = '[object Arguments]',\n    arrayTag = '[object Array]',\n    asyncTag = '[object AsyncFunction]',\n    boolTag = '[object Boolean]',\n    dateTag = '[object Date]',\n    errorTag = '[object Error]',\n    funcTag = '[object Function]',\n    genTag = '[object GeneratorFunction]',\n    mapTag = '[object Map]',\n    numberTag = '[object Number]',\n    nullTag = '[object Null]',\n    objectTag = '[object Object]',\n    promiseTag = '[object Promise]',\n    proxyTag = '[object Proxy]',\n    regexpTag = '[object RegExp]',\n    setTag = '[object Set]',\n    stringTag = '[object String]',\n    symbolTag = '[object Symbol]',\n    undefinedTag = '[object Undefined]',\n    weakMapTag = '[object WeakMap]';\n\nvar arrayBufferTag = '[object ArrayBuffer]',\n    dataViewTag = '[object DataView]',\n    float32Tag = '[object Float32Array]',\n    float64Tag = '[object Float64Array]',\n    int8Tag = '[object Int8Array]',\n    int16Tag = '[object Int16Array]',\n    int32Tag = '[object Int32Array]',\n    uint8Tag = '[object Uint8Array]',\n    uint8ClampedTag = '[object Uint8ClampedArray]',\n    uint16Tag = '[object Uint16Array]',\n    uint32Tag = '[object Uint32Array]';\n\n/**\n * Used to match `RegExp`\n * [syntax characters](http://ecma-international.org/ecma-262/7.0/#sec-patterns).\n */\nvar reRegExpChar = /[\\\\^$.*+?()[\\]{}|]/g;\n\n/** Used to detect host constructors (Safari). */\nvar reIsHostCtor = /^\\[object .+?Constructor\\]$/;\n\n/** Used to detect unsigned integer values. */\nvar reIsUint = /^(?:0|[1-9]\\d*)$/;\n\n/** Used to identify `toStringTag` values of typed arrays. */\nvar typedArrayTags = {};\ntypedArrayTags[float32Tag] = typedArrayTags[float64Tag] =\ntypedArrayTags[int8Tag] = typedArrayTags[int16Tag] =\ntypedArrayTags[int32Tag] = typedArrayTags[uint8Tag] =\ntypedArrayTags[uint8ClampedTag] = typedArrayTags[uint16Tag] =\ntypedArrayTags[uint32Tag] = true;\ntypedArrayTags[argsTag] = typedArrayTags[arrayTag] =\ntypedArrayTags[arrayBufferTag] = typedArrayTags[boolTag] =\ntypedArrayTags[dataViewTag] = typedArrayTags[dateTag] =\ntypedArrayTags[errorTag] = typedArrayTags[funcTag] =\ntypedArrayTags[mapTag] = typedArrayTags[numberTag] =\ntypedArrayTags[objectTag] = typedArrayTags[regexpTag] =\ntypedArrayTags[setTag] = typedArrayTags[stringTag] =\ntypedArrayTags[weakMapTag] = false;\n\n/** Detect free variable `global` from Node.js. */\nvar freeGlobal = typeof commonjsGlobal == 'object' && commonjsGlobal && commonjsGlobal.Object === Object && commonjsGlobal;\n\n/** Detect free variable `self`. */\nvar freeSelf = typeof self == 'object' && self && self.Object === Object && self;\n\n/** Used as a reference to the global object. */\nvar root = freeGlobal || freeSelf || Function('return this')();\n\n/** Detect free variable `exports`. */\nvar freeExports =  exports && !exports.nodeType && exports;\n\n/** Detect free variable `module`. */\nvar freeModule = freeExports && 'object' == 'object' && module && !module.nodeType && module;\n\n/** Detect the popular CommonJS extension `module.exports`. */\nvar moduleExports = freeModule && freeModule.exports === freeExports;\n\n/** Detect free variable `process` from Node.js. */\nvar freeProcess = moduleExports && freeGlobal.process;\n\n/** Used to access faster Node.js helpers. */\nvar nodeUtil = (function() {\n  try {\n    return freeProcess && freeProcess.binding && freeProcess.binding('util');\n  } catch (e) {}\n}());\n\n/* Node.js helper references. */\nvar nodeIsTypedArray = nodeUtil && nodeUtil.isTypedArray;\n\n/**\n * A specialized version of `_.filter` for arrays without support for\n * iteratee shorthands.\n *\n * @private\n * @param {Array} [array] The array to iterate over.\n * @param {Function} predicate The function invoked per iteration.\n * @returns {Array} Returns the new filtered array.\n */\nfunction arrayFilter(array, predicate) {\n  var index = -1,\n      length = array == null ? 0 : array.length,\n      resIndex = 0,\n      result = [];\n\n  while (++index < length) {\n    var value = array[index];\n    if (predicate(value, index, array)) {\n      result[resIndex++] = value;\n    }\n  }\n  return result;\n}\n\n/**\n * Appends the elements of `values` to `array`.\n *\n * @private\n * @param {Array} array The array to modify.\n * @param {Array} values The values to append.\n * @returns {Array} Returns `array`.\n */\nfunction arrayPush(array, values) {\n  var index = -1,\n      length = values.length,\n      offset = array.length;\n\n  while (++index < length) {\n    array[offset + index] = values[index];\n  }\n  return array;\n}\n\n/**\n * A specialized version of `_.some` for arrays without support for iteratee\n * shorthands.\n *\n * @private\n * @param {Array} [array] The array to iterate over.\n * @param {Function} predicate The function invoked per iteration.\n * @returns {boolean} Returns `true` if any element passes the predicate check,\n *  else `false`.\n */\nfunction arraySome(array, predicate) {\n  var index = -1,\n      length = array == null ? 0 : array.length;\n\n  while (++index < length) {\n    if (predicate(array[index], index, array)) {\n      return true;\n    }\n  }\n  return false;\n}\n\n/**\n * The base implementation of `_.times` without support for iteratee shorthands\n * or max array length checks.\n *\n * @private\n * @param {number} n The number of times to invoke `iteratee`.\n * @param {Function} iteratee The function invoked per iteration.\n * @returns {Array} Returns the array of results.\n */\nfunction baseTimes(n, iteratee) {\n  var index = -1,\n      result = Array(n);\n\n  while (++index < n) {\n    result[index] = iteratee(index);\n  }\n  return result;\n}\n\n/**\n * The base implementation of `_.unary` without support for storing metadata.\n *\n * @private\n * @param {Function} func The function to cap arguments for.\n * @returns {Function} Returns the new capped function.\n */\nfunction baseUnary(func) {\n  return function(value) {\n    return func(value);\n  };\n}\n\n/**\n * Checks if a `cache` value for `key` exists.\n *\n * @private\n * @param {Object} cache The cache to query.\n * @param {string} key The key of the entry to check.\n * @returns {boolean} Returns `true` if an entry for `key` exists, else `false`.\n */\nfunction cacheHas(cache, key) {\n  return cache.has(key);\n}\n\n/**\n * Gets the value at `key` of `object`.\n *\n * @private\n * @param {Object} [object] The object to query.\n * @param {string} key The key of the property to get.\n * @returns {*} Returns the property value.\n */\nfunction getValue(object, key) {\n  return object == null ? undefined : object[key];\n}\n\n/**\n * Converts `map` to its key-value pairs.\n *\n * @private\n * @param {Object} map The map to convert.\n * @returns {Array} Returns the key-value pairs.\n */\nfunction mapToArray(map) {\n  var index = -1,\n      result = Array(map.size);\n\n  map.forEach(function(value, key) {\n    result[++index] = [key, value];\n  });\n  return result;\n}\n\n/**\n * Creates a unary function that invokes `func` with its argument transformed.\n *\n * @private\n * @param {Function} func The function to wrap.\n * @param {Function} transform The argument transform.\n * @returns {Function} Returns the new function.\n */\nfunction overArg(func, transform) {\n  return function(arg) {\n    return func(transform(arg));\n  };\n}\n\n/**\n * Converts `set` to an array of its values.\n *\n * @private\n * @param {Object} set The set to convert.\n * @returns {Array} Returns the values.\n */\nfunction setToArray(set) {\n  var index = -1,\n      result = Array(set.size);\n\n  set.forEach(function(value) {\n    result[++index] = value;\n  });\n  return result;\n}\n\n/** Used for built-in method references. */\nvar arrayProto = Array.prototype,\n    funcProto = Function.prototype,\n    objectProto = Object.prototype;\n\n/** Used to detect overreaching core-js shims. */\nvar coreJsData = root['__core-js_shared__'];\n\n/** Used to resolve the decompiled source of functions. */\nvar funcToString = funcProto.toString;\n\n/** Used to check objects for own properties. */\nvar hasOwnProperty = objectProto.hasOwnProperty;\n\n/** Used to detect methods masquerading as native. */\nvar maskSrcKey = (function() {\n  var uid = /[^.]+$/.exec(coreJsData && coreJsData.keys && coreJsData.keys.IE_PROTO || '');\n  return uid ? ('Symbol(src)_1.' + uid) : '';\n}());\n\n/**\n * Used to resolve the\n * [`toStringTag`](http://ecma-international.org/ecma-262/7.0/#sec-object.prototype.tostring)\n * of values.\n */\nvar nativeObjectToString = objectProto.toString;\n\n/** Used to detect if a method is native. */\nvar reIsNative = RegExp('^' +\n  funcToString.call(hasOwnProperty).replace(reRegExpChar, '\\\\$&')\n  .replace(/hasOwnProperty|(function).*?(?=\\\\\\()| for .+?(?=\\\\\\])/g, '$1.*?') + '$'\n);\n\n/** Built-in value references. */\nvar Buffer = moduleExports ? root.Buffer : undefined,\n    Symbol = root.Symbol,\n    Uint8Array = root.Uint8Array,\n    propertyIsEnumerable = objectProto.propertyIsEnumerable,\n    splice = arrayProto.splice,\n    symToStringTag = Symbol ? Symbol.toStringTag : undefined;\n\n/* Built-in method references for those with the same name as other `lodash` methods. */\nvar nativeGetSymbols = Object.getOwnPropertySymbols,\n    nativeIsBuffer = Buffer ? Buffer.isBuffer : undefined,\n    nativeKeys = overArg(Object.keys, Object);\n\n/* Built-in method references that are verified to be native. */\nvar DataView = getNative(root, 'DataView'),\n    Map = getNative(root, 'Map'),\n    Promise = getNative(root, 'Promise'),\n    Set = getNative(root, 'Set'),\n    WeakMap = getNative(root, 'WeakMap'),\n    nativeCreate = getNative(Object, 'create');\n\n/** Used to detect maps, sets, and weakmaps. */\nvar dataViewCtorString = toSource(DataView),\n    mapCtorString = toSource(Map),\n    promiseCtorString = toSource(Promise),\n    setCtorString = toSource(Set),\n    weakMapCtorString = toSource(WeakMap);\n\n/** Used to convert symbols to primitives and strings. */\nvar symbolProto = Symbol ? Symbol.prototype : undefined,\n    symbolValueOf = symbolProto ? symbolProto.valueOf : undefined;\n\n/**\n * Creates a hash object.\n *\n * @private\n * @constructor\n * @param {Array} [entries] The key-value pairs to cache.\n */\nfunction Hash(entries) {\n  var index = -1,\n      length = entries == null ? 0 : entries.length;\n\n  this.clear();\n  while (++index < length) {\n    var entry = entries[index];\n    this.set(entry[0], entry[1]);\n  }\n}\n\n/**\n * Removes all key-value entries from the hash.\n *\n * @private\n * @name clear\n * @memberOf Hash\n */\nfunction hashClear() {\n  this.__data__ = nativeCreate ? nativeCreate(null) : {};\n  this.size = 0;\n}\n\n/**\n * Removes `key` and its value from the hash.\n *\n * @private\n * @name delete\n * @memberOf Hash\n * @param {Object} hash The hash to modify.\n * @param {string} key The key of the value to remove.\n * @returns {boolean} Returns `true` if the entry was removed, else `false`.\n */\nfunction hashDelete(key) {\n  var result = this.has(key) && delete this.__data__[key];\n  this.size -= result ? 1 : 0;\n  return result;\n}\n\n/**\n * Gets the hash value for `key`.\n *\n * @private\n * @name get\n * @memberOf Hash\n * @param {string} key The key of the value to get.\n * @returns {*} Returns the entry value.\n */\nfunction hashGet(key) {\n  var data = this.__data__;\n  if (nativeCreate) {\n    var result = data[key];\n    return result === HASH_UNDEFINED ? undefined : result;\n  }\n  return hasOwnProperty.call(data, key) ? data[key] : undefined;\n}\n\n/**\n * Checks if a hash value for `key` exists.\n *\n * @private\n * @name has\n * @memberOf Hash\n * @param {string} key The key of the entry to check.\n * @returns {boolean} Returns `true` if an entry for `key` exists, else `false`.\n */\nfunction hashHas(key) {\n  var data = this.__data__;\n  return nativeCreate ? (data[key] !== undefined) : hasOwnProperty.call(data, key);\n}\n\n/**\n * Sets the hash `key` to `value`.\n *\n * @private\n * @name set\n * @memberOf Hash\n * @param {string} key The key of the value to set.\n * @param {*} value The value to set.\n * @returns {Object} Returns the hash instance.\n */\nfunction hashSet(key, value) {\n  var data = this.__data__;\n  this.size += this.has(key) ? 0 : 1;\n  data[key] = (nativeCreate && value === undefined) ? HASH_UNDEFINED : value;\n  return this;\n}\n\n// Add methods to `Hash`.\nHash.prototype.clear = hashClear;\nHash.prototype['delete'] = hashDelete;\nHash.prototype.get = hashGet;\nHash.prototype.has = hashHas;\nHash.prototype.set = hashSet;\n\n/**\n * Creates an list cache object.\n *\n * @private\n * @constructor\n * @param {Array} [entries] The key-value pairs to cache.\n */\nfunction ListCache(entries) {\n  var index = -1,\n      length = entries == null ? 0 : entries.length;\n\n  this.clear();\n  while (++index < length) {\n    var entry = entries[index];\n    this.set(entry[0], entry[1]);\n  }\n}\n\n/**\n * Removes all key-value entries from the list cache.\n *\n * @private\n * @name clear\n * @memberOf ListCache\n */\nfunction listCacheClear() {\n  this.__data__ = [];\n  this.size = 0;\n}\n\n/**\n * Removes `key` and its value from the list cache.\n *\n * @private\n * @name delete\n * @memberOf ListCache\n * @param {string} key The key of the value to remove.\n * @returns {boolean} Returns `true` if the entry was removed, else `false`.\n */\nfunction listCacheDelete(key) {\n  var data = this.__data__,\n      index = assocIndexOf(data, key);\n\n  if (index < 0) {\n    return false;\n  }\n  var lastIndex = data.length - 1;\n  if (index == lastIndex) {\n    data.pop();\n  } else {\n    splice.call(data, index, 1);\n  }\n  --this.size;\n  return true;\n}\n\n/**\n * Gets the list cache value for `key`.\n *\n * @private\n * @name get\n * @memberOf ListCache\n * @param {string} key The key of the value to get.\n * @returns {*} Returns the entry value.\n */\nfunction listCacheGet(key) {\n  var data = this.__data__,\n      index = assocIndexOf(data, key);\n\n  return index < 0 ? undefined : data[index][1];\n}\n\n/**\n * Checks if a list cache value for `key` exists.\n *\n * @private\n * @name has\n * @memberOf ListCache\n * @param {string} key The key of the entry to check.\n * @returns {boolean} Returns `true` if an entry for `key` exists, else `false`.\n */\nfunction listCacheHas(key) {\n  return assocIndexOf(this.__data__, key) > -1;\n}\n\n/**\n * Sets the list cache `key` to `value`.\n *\n * @private\n * @name set\n * @memberOf ListCache\n * @param {string} key The key of the value to set.\n * @param {*} value The value to set.\n * @returns {Object} Returns the list cache instance.\n */\nfunction listCacheSet(key, value) {\n  var data = this.__data__,\n      index = assocIndexOf(data, key);\n\n  if (index < 0) {\n    ++this.size;\n    data.push([key, value]);\n  } else {\n    data[index][1] = value;\n  }\n  return this;\n}\n\n// Add methods to `ListCache`.\nListCache.prototype.clear = listCacheClear;\nListCache.prototype['delete'] = listCacheDelete;\nListCache.prototype.get = listCacheGet;\nListCache.prototype.has = listCacheHas;\nListCache.prototype.set = listCacheSet;\n\n/**\n * Creates a map cache object to store key-value pairs.\n *\n * @private\n * @constructor\n * @param {Array} [entries] The key-value pairs to cache.\n */\nfunction MapCache(entries) {\n  var index = -1,\n      length = entries == null ? 0 : entries.length;\n\n  this.clear();\n  while (++index < length) {\n    var entry = entries[index];\n    this.set(entry[0], entry[1]);\n  }\n}\n\n/**\n * Removes all key-value entries from the map.\n *\n * @private\n * @name clear\n * @memberOf MapCache\n */\nfunction mapCacheClear() {\n  this.size = 0;\n  this.__data__ = {\n    'hash': new Hash,\n    'map': new (Map || ListCache),\n    'string': new Hash\n  };\n}\n\n/**\n * Removes `key` and its value from the map.\n *\n * @private\n * @name delete\n * @memberOf MapCache\n * @param {string} key The key of the value to remove.\n * @returns {boolean} Returns `true` if the entry was removed, else `false`.\n */\nfunction mapCacheDelete(key) {\n  var result = getMapData(this, key)['delete'](key);\n  this.size -= result ? 1 : 0;\n  return result;\n}\n\n/**\n * Gets the map value for `key`.\n *\n * @private\n * @name get\n * @memberOf MapCache\n * @param {string} key The key of the value to get.\n * @returns {*} Returns the entry value.\n */\nfunction mapCacheGet(key) {\n  return getMapData(this, key).get(key);\n}\n\n/**\n * Checks if a map value for `key` exists.\n *\n * @private\n * @name has\n * @memberOf MapCache\n * @param {string} key The key of the entry to check.\n * @returns {boolean} Returns `true` if an entry for `key` exists, else `false`.\n */\nfunction mapCacheHas(key) {\n  return getMapData(this, key).has(key);\n}\n\n/**\n * Sets the map `key` to `value`.\n *\n * @private\n * @name set\n * @memberOf MapCache\n * @param {string} key The key of the value to set.\n * @param {*} value The value to set.\n * @returns {Object} Returns the map cache instance.\n */\nfunction mapCacheSet(key, value) {\n  var data = getMapData(this, key),\n      size = data.size;\n\n  data.set(key, value);\n  this.size += data.size == size ? 0 : 1;\n  return this;\n}\n\n// Add methods to `MapCache`.\nMapCache.prototype.clear = mapCacheClear;\nMapCache.prototype['delete'] = mapCacheDelete;\nMapCache.prototype.get = mapCacheGet;\nMapCache.prototype.has = mapCacheHas;\nMapCache.prototype.set = mapCacheSet;\n\n/**\n *\n * Creates an array cache object to store unique values.\n *\n * @private\n * @constructor\n * @param {Array} [values] The values to cache.\n */\nfunction SetCache(values) {\n  var index = -1,\n      length = values == null ? 0 : values.length;\n\n  this.__data__ = new MapCache;\n  while (++index < length) {\n    this.add(values[index]);\n  }\n}\n\n/**\n * Adds `value` to the array cache.\n *\n * @private\n * @name add\n * @memberOf SetCache\n * @alias push\n * @param {*} value The value to cache.\n * @returns {Object} Returns the cache instance.\n */\nfunction setCacheAdd(value) {\n  this.__data__.set(value, HASH_UNDEFINED);\n  return this;\n}\n\n/**\n * Checks if `value` is in the array cache.\n *\n * @private\n * @name has\n * @memberOf SetCache\n * @param {*} value The value to search for.\n * @returns {number} Returns `true` if `value` is found, else `false`.\n */\nfunction setCacheHas(value) {\n  return this.__data__.has(value);\n}\n\n// Add methods to `SetCache`.\nSetCache.prototype.add = SetCache.prototype.push = setCacheAdd;\nSetCache.prototype.has = setCacheHas;\n\n/**\n * Creates a stack cache object to store key-value pairs.\n *\n * @private\n * @constructor\n * @param {Array} [entries] The key-value pairs to cache.\n */\nfunction Stack(entries) {\n  var data = this.__data__ = new ListCache(entries);\n  this.size = data.size;\n}\n\n/**\n * Removes all key-value entries from the stack.\n *\n * @private\n * @name clear\n * @memberOf Stack\n */\nfunction stackClear() {\n  this.__data__ = new ListCache;\n  this.size = 0;\n}\n\n/**\n * Removes `key` and its value from the stack.\n *\n * @private\n * @name delete\n * @memberOf Stack\n * @param {string} key The key of the value to remove.\n * @returns {boolean} Returns `true` if the entry was removed, else `false`.\n */\nfunction stackDelete(key) {\n  var data = this.__data__,\n      result = data['delete'](key);\n\n  this.size = data.size;\n  return result;\n}\n\n/**\n * Gets the stack value for `key`.\n *\n * @private\n * @name get\n * @memberOf Stack\n * @param {string} key The key of the value to get.\n * @returns {*} Returns the entry value.\n */\nfunction stackGet(key) {\n  return this.__data__.get(key);\n}\n\n/**\n * Checks if a stack value for `key` exists.\n *\n * @private\n * @name has\n * @memberOf Stack\n * @param {string} key The key of the entry to check.\n * @returns {boolean} Returns `true` if an entry for `key` exists, else `false`.\n */\nfunction stackHas(key) {\n  return this.__data__.has(key);\n}\n\n/**\n * Sets the stack `key` to `value`.\n *\n * @private\n * @name set\n * @memberOf Stack\n * @param {string} key The key of the value to set.\n * @param {*} value The value to set.\n * @returns {Object} Returns the stack cache instance.\n */\nfunction stackSet(key, value) {\n  var data = this.__data__;\n  if (data instanceof ListCache) {\n    var pairs = data.__data__;\n    if (!Map || (pairs.length < LARGE_ARRAY_SIZE - 1)) {\n      pairs.push([key, value]);\n      this.size = ++data.size;\n      return this;\n    }\n    data = this.__data__ = new MapCache(pairs);\n  }\n  data.set(key, value);\n  this.size = data.size;\n  return this;\n}\n\n// Add methods to `Stack`.\nStack.prototype.clear = stackClear;\nStack.prototype['delete'] = stackDelete;\nStack.prototype.get = stackGet;\nStack.prototype.has = stackHas;\nStack.prototype.set = stackSet;\n\n/**\n * Creates an array of the enumerable property names of the array-like `value`.\n *\n * @private\n * @param {*} value The value to query.\n * @param {boolean} inherited Specify returning inherited property names.\n * @returns {Array} Returns the array of property names.\n */\nfunction arrayLikeKeys(value, inherited) {\n  var isArr = isArray(value),\n      isArg = !isArr && isArguments(value),\n      isBuff = !isArr && !isArg && isBuffer(value),\n      isType = !isArr && !isArg && !isBuff && isTypedArray(value),\n      skipIndexes = isArr || isArg || isBuff || isType,\n      result = skipIndexes ? baseTimes(value.length, String) : [],\n      length = result.length;\n\n  for (var key in value) {\n    if ((inherited || hasOwnProperty.call(value, key)) &&\n        !(skipIndexes && (\n           // Safari 9 has enumerable `arguments.length` in strict mode.\n           key == 'length' ||\n           // Node.js 0.10 has enumerable non-index properties on buffers.\n           (isBuff && (key == 'offset' || key == 'parent')) ||\n           // PhantomJS 2 has enumerable non-index properties on typed arrays.\n           (isType && (key == 'buffer' || key == 'byteLength' || key == 'byteOffset')) ||\n           // Skip index properties.\n           isIndex(key, length)\n        ))) {\n      result.push(key);\n    }\n  }\n  return result;\n}\n\n/**\n * Gets the index at which the `key` is found in `array` of key-value pairs.\n *\n * @private\n * @param {Array} array The array to inspect.\n * @param {*} key The key to search for.\n * @returns {number} Returns the index of the matched value, else `-1`.\n */\nfunction assocIndexOf(array, key) {\n  var length = array.length;\n  while (length--) {\n    if (eq(array[length][0], key)) {\n      return length;\n    }\n  }\n  return -1;\n}\n\n/**\n * The base implementation of `getAllKeys` and `getAllKeysIn` which uses\n * `keysFunc` and `symbolsFunc` to get the enumerable property names and\n * symbols of `object`.\n *\n * @private\n * @param {Object} object The object to query.\n * @param {Function} keysFunc The function to get the keys of `object`.\n * @param {Function} symbolsFunc The function to get the symbols of `object`.\n * @returns {Array} Returns the array of property names and symbols.\n */\nfunction baseGetAllKeys(object, keysFunc, symbolsFunc) {\n  var result = keysFunc(object);\n  return isArray(object) ? result : arrayPush(result, symbolsFunc(object));\n}\n\n/**\n * The base implementation of `getTag` without fallbacks for buggy environments.\n *\n * @private\n * @param {*} value The value to query.\n * @returns {string} Returns the `toStringTag`.\n */\nfunction baseGetTag(value) {\n  if (value == null) {\n    return value === undefined ? undefinedTag : nullTag;\n  }\n  return (symToStringTag && symToStringTag in Object(value))\n    ? getRawTag(value)\n    : objectToString(value);\n}\n\n/**\n * The base implementation of `_.isArguments`.\n *\n * @private\n * @param {*} value The value to check.\n * @returns {boolean} Returns `true` if `value` is an `arguments` object,\n */\nfunction baseIsArguments(value) {\n  return isObjectLike(value) && baseGetTag(value) == argsTag;\n}\n\n/**\n * The base implementation of `_.isEqual` which supports partial comparisons\n * and tracks traversed objects.\n *\n * @private\n * @param {*} value The value to compare.\n * @param {*} other The other value to compare.\n * @param {boolean} bitmask The bitmask flags.\n *  1 - Unordered comparison\n *  2 - Partial comparison\n * @param {Function} [customizer] The function to customize comparisons.\n * @param {Object} [stack] Tracks traversed `value` and `other` objects.\n * @returns {boolean} Returns `true` if the values are equivalent, else `false`.\n */\nfunction baseIsEqual(value, other, bitmask, customizer, stack) {\n  if (value === other) {\n    return true;\n  }\n  if (value == null || other == null || (!isObjectLike(value) && !isObjectLike(other))) {\n    return value !== value && other !== other;\n  }\n  return baseIsEqualDeep(value, other, bitmask, customizer, baseIsEqual, stack);\n}\n\n/**\n * A specialized version of `baseIsEqual` for arrays and objects which performs\n * deep comparisons and tracks traversed objects enabling objects with circular\n * references to be compared.\n *\n * @private\n * @param {Object} object The object to compare.\n * @param {Object} other The other object to compare.\n * @param {number} bitmask The bitmask flags. See `baseIsEqual` for more details.\n * @param {Function} customizer The function to customize comparisons.\n * @param {Function} equalFunc The function to determine equivalents of values.\n * @param {Object} [stack] Tracks traversed `object` and `other` objects.\n * @returns {boolean} Returns `true` if the objects are equivalent, else `false`.\n */\nfunction baseIsEqualDeep(object, other, bitmask, customizer, equalFunc, stack) {\n  var objIsArr = isArray(object),\n      othIsArr = isArray(other),\n      objTag = objIsArr ? arrayTag : getTag(object),\n      othTag = othIsArr ? arrayTag : getTag(other);\n\n  objTag = objTag == argsTag ? objectTag : objTag;\n  othTag = othTag == argsTag ? objectTag : othTag;\n\n  var objIsObj = objTag == objectTag,\n      othIsObj = othTag == objectTag,\n      isSameTag = objTag == othTag;\n\n  if (isSameTag && isBuffer(object)) {\n    if (!isBuffer(other)) {\n      return false;\n    }\n    objIsArr = true;\n    objIsObj = false;\n  }\n  if (isSameTag && !objIsObj) {\n    stack || (stack = new Stack);\n    return (objIsArr || isTypedArray(object))\n      ? equalArrays(object, other, bitmask, customizer, equalFunc, stack)\n      : equalByTag(object, other, objTag, bitmask, customizer, equalFunc, stack);\n  }\n  if (!(bitmask & COMPARE_PARTIAL_FLAG)) {\n    var objIsWrapped = objIsObj && hasOwnProperty.call(object, '__wrapped__'),\n        othIsWrapped = othIsObj && hasOwnProperty.call(other, '__wrapped__');\n\n    if (objIsWrapped || othIsWrapped) {\n      var objUnwrapped = objIsWrapped ? object.value() : object,\n          othUnwrapped = othIsWrapped ? other.value() : other;\n\n      stack || (stack = new Stack);\n      return equalFunc(objUnwrapped, othUnwrapped, bitmask, customizer, stack);\n    }\n  }\n  if (!isSameTag) {\n    return false;\n  }\n  stack || (stack = new Stack);\n  return equalObjects(object, other, bitmask, customizer, equalFunc, stack);\n}\n\n/**\n * The base implementation of `_.isNative` without bad shim checks.\n *\n * @private\n * @param {*} value The value to check.\n * @returns {boolean} Returns `true` if `value` is a native function,\n *  else `false`.\n */\nfunction baseIsNative(value) {\n  if (!isObject(value) || isMasked(value)) {\n    return false;\n  }\n  var pattern = isFunction(value) ? reIsNative : reIsHostCtor;\n  return pattern.test(toSource(value));\n}\n\n/**\n * The base implementation of `_.isTypedArray` without Node.js optimizations.\n *\n * @private\n * @param {*} value The value to check.\n * @returns {boolean} Returns `true` if `value` is a typed array, else `false`.\n */\nfunction baseIsTypedArray(value) {\n  return isObjectLike(value) &&\n    isLength(value.length) && !!typedArrayTags[baseGetTag(value)];\n}\n\n/**\n * The base implementation of `_.keys` which doesn't treat sparse arrays as dense.\n *\n * @private\n * @param {Object} object The object to query.\n * @returns {Array} Returns the array of property names.\n */\nfunction baseKeys(object) {\n  if (!isPrototype(object)) {\n    return nativeKeys(object);\n  }\n  var result = [];\n  for (var key in Object(object)) {\n    if (hasOwnProperty.call(object, key) && key != 'constructor') {\n      result.push(key);\n    }\n  }\n  return result;\n}\n\n/**\n * A specialized version of `baseIsEqualDeep` for arrays with support for\n * partial deep comparisons.\n *\n * @private\n * @param {Array} array The array to compare.\n * @param {Array} other The other array to compare.\n * @param {number} bitmask The bitmask flags. See `baseIsEqual` for more details.\n * @param {Function} customizer The function to customize comparisons.\n * @param {Function} equalFunc The function to determine equivalents of values.\n * @param {Object} stack Tracks traversed `array` and `other` objects.\n * @returns {boolean} Returns `true` if the arrays are equivalent, else `false`.\n */\nfunction equalArrays(array, other, bitmask, customizer, equalFunc, stack) {\n  var isPartial = bitmask & COMPARE_PARTIAL_FLAG,\n      arrLength = array.length,\n      othLength = other.length;\n\n  if (arrLength != othLength && !(isPartial && othLength > arrLength)) {\n    return false;\n  }\n  // Assume cyclic values are equal.\n  var stacked = stack.get(array);\n  if (stacked && stack.get(other)) {\n    return stacked == other;\n  }\n  var index = -1,\n      result = true,\n      seen = (bitmask & COMPARE_UNORDERED_FLAG) ? new SetCache : undefined;\n\n  stack.set(array, other);\n  stack.set(other, array);\n\n  // Ignore non-index properties.\n  while (++index < arrLength) {\n    var arrValue = array[index],\n        othValue = other[index];\n\n    if (customizer) {\n      var compared = isPartial\n        ? customizer(othValue, arrValue, index, other, array, stack)\n        : customizer(arrValue, othValue, index, array, other, stack);\n    }\n    if (compared !== undefined) {\n      if (compared) {\n        continue;\n      }\n      result = false;\n      break;\n    }\n    // Recursively compare arrays (susceptible to call stack limits).\n    if (seen) {\n      if (!arraySome(other, function(othValue, othIndex) {\n            if (!cacheHas(seen, othIndex) &&\n                (arrValue === othValue || equalFunc(arrValue, othValue, bitmask, customizer, stack))) {\n              return seen.push(othIndex);\n            }\n          })) {\n        result = false;\n        break;\n      }\n    } else if (!(\n          arrValue === othValue ||\n            equalFunc(arrValue, othValue, bitmask, customizer, stack)\n        )) {\n      result = false;\n      break;\n    }\n  }\n  stack['delete'](array);\n  stack['delete'](other);\n  return result;\n}\n\n/**\n * A specialized version of `baseIsEqualDeep` for comparing objects of\n * the same `toStringTag`.\n *\n * **Note:** This function only supports comparing values with tags of\n * `Boolean`, `Date`, `Error`, `Number`, `RegExp`, or `String`.\n *\n * @private\n * @param {Object} object The object to compare.\n * @param {Object} other The other object to compare.\n * @param {string} tag The `toStringTag` of the objects to compare.\n * @param {number} bitmask The bitmask flags. See `baseIsEqual` for more details.\n * @param {Function} customizer The function to customize comparisons.\n * @param {Function} equalFunc The function to determine equivalents of values.\n * @param {Object} stack Tracks traversed `object` and `other` objects.\n * @returns {boolean} Returns `true` if the objects are equivalent, else `false`.\n */\nfunction equalByTag(object, other, tag, bitmask, customizer, equalFunc, stack) {\n  switch (tag) {\n    case dataViewTag:\n      if ((object.byteLength != other.byteLength) ||\n          (object.byteOffset != other.byteOffset)) {\n        return false;\n      }\n      object = object.buffer;\n      other = other.buffer;\n\n    case arrayBufferTag:\n      if ((object.byteLength != other.byteLength) ||\n          !equalFunc(new Uint8Array(object), new Uint8Array(other))) {\n        return false;\n      }\n      return true;\n\n    case boolTag:\n    case dateTag:\n    case numberTag:\n      // Coerce booleans to `1` or `0` and dates to milliseconds.\n      // Invalid dates are coerced to `NaN`.\n      return eq(+object, +other);\n\n    case errorTag:\n      return object.name == other.name && object.message == other.message;\n\n    case regexpTag:\n    case stringTag:\n      // Coerce regexes to strings and treat strings, primitives and objects,\n      // as equal. See http://www.ecma-international.org/ecma-262/7.0/#sec-regexp.prototype.tostring\n      // for more details.\n      return object == (other + '');\n\n    case mapTag:\n      var convert = mapToArray;\n\n    case setTag:\n      var isPartial = bitmask & COMPARE_PARTIAL_FLAG;\n      convert || (convert = setToArray);\n\n      if (object.size != other.size && !isPartial) {\n        return false;\n      }\n      // Assume cyclic values are equal.\n      var stacked = stack.get(object);\n      if (stacked) {\n        return stacked == other;\n      }\n      bitmask |= COMPARE_UNORDERED_FLAG;\n\n      // Recursively compare objects (susceptible to call stack limits).\n      stack.set(object, other);\n      var result = equalArrays(convert(object), convert(other), bitmask, customizer, equalFunc, stack);\n      stack['delete'](object);\n      return result;\n\n    case symbolTag:\n      if (symbolValueOf) {\n        return symbolValueOf.call(object) == symbolValueOf.call(other);\n      }\n  }\n  return false;\n}\n\n/**\n * A specialized version of `baseIsEqualDeep` for objects with support for\n * partial deep comparisons.\n *\n * @private\n * @param {Object} object The object to compare.\n * @param {Object} other The other object to compare.\n * @param {number} bitmask The bitmask flags. See `baseIsEqual` for more details.\n * @param {Function} customizer The function to customize comparisons.\n * @param {Function} equalFunc The function to determine equivalents of values.\n * @param {Object} stack Tracks traversed `object` and `other` objects.\n * @returns {boolean} Returns `true` if the objects are equivalent, else `false`.\n */\nfunction equalObjects(object, other, bitmask, customizer, equalFunc, stack) {\n  var isPartial = bitmask & COMPARE_PARTIAL_FLAG,\n      objProps = getAllKeys(object),\n      objLength = objProps.length,\n      othProps = getAllKeys(other),\n      othLength = othProps.length;\n\n  if (objLength != othLength && !isPartial) {\n    return false;\n  }\n  var index = objLength;\n  while (index--) {\n    var key = objProps[index];\n    if (!(isPartial ? key in other : hasOwnProperty.call(other, key))) {\n      return false;\n    }\n  }\n  // Assume cyclic values are equal.\n  var stacked = stack.get(object);\n  if (stacked && stack.get(other)) {\n    return stacked == other;\n  }\n  var result = true;\n  stack.set(object, other);\n  stack.set(other, object);\n\n  var skipCtor = isPartial;\n  while (++index < objLength) {\n    key = objProps[index];\n    var objValue = object[key],\n        othValue = other[key];\n\n    if (customizer) {\n      var compared = isPartial\n        ? customizer(othValue, objValue, key, other, object, stack)\n        : customizer(objValue, othValue, key, object, other, stack);\n    }\n    // Recursively compare objects (susceptible to call stack limits).\n    if (!(compared === undefined\n          ? (objValue === othValue || equalFunc(objValue, othValue, bitmask, customizer, stack))\n          : compared\n        )) {\n      result = false;\n      break;\n    }\n    skipCtor || (skipCtor = key == 'constructor');\n  }\n  if (result && !skipCtor) {\n    var objCtor = object.constructor,\n        othCtor = other.constructor;\n\n    // Non `Object` object instances with different constructors are not equal.\n    if (objCtor != othCtor &&\n        ('constructor' in object && 'constructor' in other) &&\n        !(typeof objCtor == 'function' && objCtor instanceof objCtor &&\n          typeof othCtor == 'function' && othCtor instanceof othCtor)) {\n      result = false;\n    }\n  }\n  stack['delete'](object);\n  stack['delete'](other);\n  return result;\n}\n\n/**\n * Creates an array of own enumerable property names and symbols of `object`.\n *\n * @private\n * @param {Object} object The object to query.\n * @returns {Array} Returns the array of property names and symbols.\n */\nfunction getAllKeys(object) {\n  return baseGetAllKeys(object, keys, getSymbols);\n}\n\n/**\n * Gets the data for `map`.\n *\n * @private\n * @param {Object} map The map to query.\n * @param {string} key The reference key.\n * @returns {*} Returns the map data.\n */\nfunction getMapData(map, key) {\n  var data = map.__data__;\n  return isKeyable(key)\n    ? data[typeof key == 'string' ? 'string' : 'hash']\n    : data.map;\n}\n\n/**\n * Gets the native function at `key` of `object`.\n *\n * @private\n * @param {Object} object The object to query.\n * @param {string} key The key of the method to get.\n * @returns {*} Returns the function if it's native, else `undefined`.\n */\nfunction getNative(object, key) {\n  var value = getValue(object, key);\n  return baseIsNative(value) ? value : undefined;\n}\n\n/**\n * A specialized version of `baseGetTag` which ignores `Symbol.toStringTag` values.\n *\n * @private\n * @param {*} value The value to query.\n * @returns {string} Returns the raw `toStringTag`.\n */\nfunction getRawTag(value) {\n  var isOwn = hasOwnProperty.call(value, symToStringTag),\n      tag = value[symToStringTag];\n\n  try {\n    value[symToStringTag] = undefined;\n    var unmasked = true;\n  } catch (e) {}\n\n  var result = nativeObjectToString.call(value);\n  if (unmasked) {\n    if (isOwn) {\n      value[symToStringTag] = tag;\n    } else {\n      delete value[symToStringTag];\n    }\n  }\n  return result;\n}\n\n/**\n * Creates an array of the own enumerable symbols of `object`.\n *\n * @private\n * @param {Object} object The object to query.\n * @returns {Array} Returns the array of symbols.\n */\nvar getSymbols = !nativeGetSymbols ? stubArray : function(object) {\n  if (object == null) {\n    return [];\n  }\n  object = Object(object);\n  return arrayFilter(nativeGetSymbols(object), function(symbol) {\n    return propertyIsEnumerable.call(object, symbol);\n  });\n};\n\n/**\n * Gets the `toStringTag` of `value`.\n *\n * @private\n * @param {*} value The value to query.\n * @returns {string} Returns the `toStringTag`.\n */\nvar getTag = baseGetTag;\n\n// Fallback for data views, maps, sets, and weak maps in IE 11 and promises in Node.js < 6.\nif ((DataView && getTag(new DataView(new ArrayBuffer(1))) != dataViewTag) ||\n    (Map && getTag(new Map) != mapTag) ||\n    (Promise && getTag(Promise.resolve()) != promiseTag) ||\n    (Set && getTag(new Set) != setTag) ||\n    (WeakMap && getTag(new WeakMap) != weakMapTag)) {\n  getTag = function(value) {\n    var result = baseGetTag(value),\n        Ctor = result == objectTag ? value.constructor : undefined,\n        ctorString = Ctor ? toSource(Ctor) : '';\n\n    if (ctorString) {\n      switch (ctorString) {\n        case dataViewCtorString: return dataViewTag;\n        case mapCtorString: return mapTag;\n        case promiseCtorString: return promiseTag;\n        case setCtorString: return setTag;\n        case weakMapCtorString: return weakMapTag;\n      }\n    }\n    return result;\n  };\n}\n\n/**\n * Checks if `value` is a valid array-like index.\n *\n * @private\n * @param {*} value The value to check.\n * @param {number} [length=MAX_SAFE_INTEGER] The upper bounds of a valid index.\n * @returns {boolean} Returns `true` if `value` is a valid index, else `false`.\n */\nfunction isIndex(value, length) {\n  length = length == null ? MAX_SAFE_INTEGER : length;\n  return !!length &&\n    (typeof value == 'number' || reIsUint.test(value)) &&\n    (value > -1 && value % 1 == 0 && value < length);\n}\n\n/**\n * Checks if `value` is suitable for use as unique object key.\n *\n * @private\n * @param {*} value The value to check.\n * @returns {boolean} Returns `true` if `value` is suitable, else `false`.\n */\nfunction isKeyable(value) {\n  var type = typeof value;\n  return (type == 'string' || type == 'number' || type == 'symbol' || type == 'boolean')\n    ? (value !== '__proto__')\n    : (value === null);\n}\n\n/**\n * Checks if `func` has its source masked.\n *\n * @private\n * @param {Function} func The function to check.\n * @returns {boolean} Returns `true` if `func` is masked, else `false`.\n */\nfunction isMasked(func) {\n  return !!maskSrcKey && (maskSrcKey in func);\n}\n\n/**\n * Checks if `value` is likely a prototype object.\n *\n * @private\n * @param {*} value The value to check.\n * @returns {boolean} Returns `true` if `value` is a prototype, else `false`.\n */\nfunction isPrototype(value) {\n  var Ctor = value && value.constructor,\n      proto = (typeof Ctor == 'function' && Ctor.prototype) || objectProto;\n\n  return value === proto;\n}\n\n/**\n * Converts `value` to a string using `Object.prototype.toString`.\n *\n * @private\n * @param {*} value The value to convert.\n * @returns {string} Returns the converted string.\n */\nfunction objectToString(value) {\n  return nativeObjectToString.call(value);\n}\n\n/**\n * Converts `func` to its source code.\n *\n * @private\n * @param {Function} func The function to convert.\n * @returns {string} Returns the source code.\n */\nfunction toSource(func) {\n  if (func != null) {\n    try {\n      return funcToString.call(func);\n    } catch (e) {}\n    try {\n      return (func + '');\n    } catch (e) {}\n  }\n  return '';\n}\n\n/**\n * Performs a\n * [`SameValueZero`](http://ecma-international.org/ecma-262/7.0/#sec-samevaluezero)\n * comparison between two values to determine if they are equivalent.\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @category Lang\n * @param {*} value The value to compare.\n * @param {*} other The other value to compare.\n * @returns {boolean} Returns `true` if the values are equivalent, else `false`.\n * @example\n *\n * var object = { 'a': 1 };\n * var other = { 'a': 1 };\n *\n * _.eq(object, object);\n * // => true\n *\n * _.eq(object, other);\n * // => false\n *\n * _.eq('a', 'a');\n * // => true\n *\n * _.eq('a', Object('a'));\n * // => false\n *\n * _.eq(NaN, NaN);\n * // => true\n */\nfunction eq(value, other) {\n  return value === other || (value !== value && other !== other);\n}\n\n/**\n * Checks if `value` is likely an `arguments` object.\n *\n * @static\n * @memberOf _\n * @since 0.1.0\n * @category Lang\n * @param {*} value The value to check.\n * @returns {boolean} Returns `true` if `value` is an `arguments` object,\n *  else `false`.\n * @example\n *\n * _.isArguments(function() { return arguments; }());\n * // => true\n *\n * _.isArguments([1, 2, 3]);\n * // => false\n */\nvar isArguments = baseIsArguments(function() { return arguments; }()) ? baseIsArguments : function(value) {\n  return isObjectLike(value) && hasOwnProperty.call(value, 'callee') &&\n    !propertyIsEnumerable.call(value, 'callee');\n};\n\n/**\n * Checks if `value` is classified as an `Array` object.\n *\n * @static\n * @memberOf _\n * @since 0.1.0\n * @category Lang\n * @param {*} value The value to check.\n * @returns {boolean} Returns `true` if `value` is an array, else `false`.\n * @example\n *\n * _.isArray([1, 2, 3]);\n * // => true\n *\n * _.isArray(document.body.children);\n * // => false\n *\n * _.isArray('abc');\n * // => false\n *\n * _.isArray(_.noop);\n * // => false\n */\nvar isArray = Array.isArray;\n\n/**\n * Checks if `value` is array-like. A value is considered array-like if it's\n * not a function and has a `value.length` that's an integer greater than or\n * equal to `0` and less than or equal to `Number.MAX_SAFE_INTEGER`.\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @category Lang\n * @param {*} value The value to check.\n * @returns {boolean} Returns `true` if `value` is array-like, else `false`.\n * @example\n *\n * _.isArrayLike([1, 2, 3]);\n * // => true\n *\n * _.isArrayLike(document.body.children);\n * // => true\n *\n * _.isArrayLike('abc');\n * // => true\n *\n * _.isArrayLike(_.noop);\n * // => false\n */\nfunction isArrayLike(value) {\n  return value != null && isLength(value.length) && !isFunction(value);\n}\n\n/**\n * Checks if `value` is a buffer.\n *\n * @static\n * @memberOf _\n * @since 4.3.0\n * @category Lang\n * @param {*} value The value to check.\n * @returns {boolean} Returns `true` if `value` is a buffer, else `false`.\n * @example\n *\n * _.isBuffer(new Buffer(2));\n * // => true\n *\n * _.isBuffer(new Uint8Array(2));\n * // => false\n */\nvar isBuffer = nativeIsBuffer || stubFalse;\n\n/**\n * Performs a deep comparison between two values to determine if they are\n * equivalent.\n *\n * **Note:** This method supports comparing arrays, array buffers, booleans,\n * date objects, error objects, maps, numbers, `Object` objects, regexes,\n * sets, strings, symbols, and typed arrays. `Object` objects are compared\n * by their own, not inherited, enumerable properties. Functions and DOM\n * nodes are compared by strict equality, i.e. `===`.\n *\n * @static\n * @memberOf _\n * @since 0.1.0\n * @category Lang\n * @param {*} value The value to compare.\n * @param {*} other The other value to compare.\n * @returns {boolean} Returns `true` if the values are equivalent, else `false`.\n * @example\n *\n * var object = { 'a': 1 };\n * var other = { 'a': 1 };\n *\n * _.isEqual(object, other);\n * // => true\n *\n * object === other;\n * // => false\n */\nfunction isEqual(value, other) {\n  return baseIsEqual(value, other);\n}\n\n/**\n * Checks if `value` is classified as a `Function` object.\n *\n * @static\n * @memberOf _\n * @since 0.1.0\n * @category Lang\n * @param {*} value The value to check.\n * @returns {boolean} Returns `true` if `value` is a function, else `false`.\n * @example\n *\n * _.isFunction(_);\n * // => true\n *\n * _.isFunction(/abc/);\n * // => false\n */\nfunction isFunction(value) {\n  if (!isObject(value)) {\n    return false;\n  }\n  // The use of `Object#toString` avoids issues with the `typeof` operator\n  // in Safari 9 which returns 'object' for typed arrays and other constructors.\n  var tag = baseGetTag(value);\n  return tag == funcTag || tag == genTag || tag == asyncTag || tag == proxyTag;\n}\n\n/**\n * Checks if `value` is a valid array-like length.\n *\n * **Note:** This method is loosely based on\n * [`ToLength`](http://ecma-international.org/ecma-262/7.0/#sec-tolength).\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @category Lang\n * @param {*} value The value to check.\n * @returns {boolean} Returns `true` if `value` is a valid length, else `false`.\n * @example\n *\n * _.isLength(3);\n * // => true\n *\n * _.isLength(Number.MIN_VALUE);\n * // => false\n *\n * _.isLength(Infinity);\n * // => false\n *\n * _.isLength('3');\n * // => false\n */\nfunction isLength(value) {\n  return typeof value == 'number' &&\n    value > -1 && value % 1 == 0 && value <= MAX_SAFE_INTEGER;\n}\n\n/**\n * Checks if `value` is the\n * [language type](http://www.ecma-international.org/ecma-262/7.0/#sec-ecmascript-language-types)\n * of `Object`. (e.g. arrays, functions, objects, regexes, `new Number(0)`, and `new String('')`)\n *\n * @static\n * @memberOf _\n * @since 0.1.0\n * @category Lang\n * @param {*} value The value to check.\n * @returns {boolean} Returns `true` if `value` is an object, else `false`.\n * @example\n *\n * _.isObject({});\n * // => true\n *\n * _.isObject([1, 2, 3]);\n * // => true\n *\n * _.isObject(_.noop);\n * // => true\n *\n * _.isObject(null);\n * // => false\n */\nfunction isObject(value) {\n  var type = typeof value;\n  return value != null && (type == 'object' || type == 'function');\n}\n\n/**\n * Checks if `value` is object-like. A value is object-like if it's not `null`\n * and has a `typeof` result of \"object\".\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @category Lang\n * @param {*} value The value to check.\n * @returns {boolean} Returns `true` if `value` is object-like, else `false`.\n * @example\n *\n * _.isObjectLike({});\n * // => true\n *\n * _.isObjectLike([1, 2, 3]);\n * // => true\n *\n * _.isObjectLike(_.noop);\n * // => false\n *\n * _.isObjectLike(null);\n * // => false\n */\nfunction isObjectLike(value) {\n  return value != null && typeof value == 'object';\n}\n\n/**\n * Checks if `value` is classified as a typed array.\n *\n * @static\n * @memberOf _\n * @since 3.0.0\n * @category Lang\n * @param {*} value The value to check.\n * @returns {boolean} Returns `true` if `value` is a typed array, else `false`.\n * @example\n *\n * _.isTypedArray(new Uint8Array);\n * // => true\n *\n * _.isTypedArray([]);\n * // => false\n */\nvar isTypedArray = nodeIsTypedArray ? baseUnary(nodeIsTypedArray) : baseIsTypedArray;\n\n/**\n * Creates an array of the own enumerable property names of `object`.\n *\n * **Note:** Non-object values are coerced to objects. See the\n * [ES spec](http://ecma-international.org/ecma-262/7.0/#sec-object.keys)\n * for more details.\n *\n * @static\n * @since 0.1.0\n * @memberOf _\n * @category Object\n * @param {Object} object The object to query.\n * @returns {Array} Returns the array of property names.\n * @example\n *\n * function Foo() {\n *   this.a = 1;\n *   this.b = 2;\n * }\n *\n * Foo.prototype.c = 3;\n *\n * _.keys(new Foo);\n * // => ['a', 'b'] (iteration order is not guaranteed)\n *\n * _.keys('hi');\n * // => ['0', '1']\n */\nfunction keys(object) {\n  return isArrayLike(object) ? arrayLikeKeys(object) : baseKeys(object);\n}\n\n/**\n * This method returns a new empty array.\n *\n * @static\n * @memberOf _\n * @since 4.13.0\n * @category Util\n * @returns {Array} Returns the new empty array.\n * @example\n *\n * var arrays = _.times(2, _.stubArray);\n *\n * console.log(arrays);\n * // => [[], []]\n *\n * console.log(arrays[0] === arrays[1]);\n * // => false\n */\nfunction stubArray() {\n  return [];\n}\n\n/**\n * This method returns `false`.\n *\n * @static\n * @memberOf _\n * @since 4.13.0\n * @category Util\n * @returns {boolean} Returns `false`.\n * @example\n *\n * _.times(2, _.stubFalse);\n * // => [false, false]\n */\nfunction stubFalse() {\n  return false;\n}\n\nmodule.exports = isEqual;\n});\n\nconst depsAreEqual = (deps1, deps2) => {\r\n  return lodash_isequal(deps1, deps2)\r\n};\r\n\r\nconst getDepNames = (deps) => {\r\n  return Object.keys(deps || {})\r\n};\r\n\r\nconst getUpdatedDeps = (depNames, currentData) => {\r\n  const updatedDeps = {};\r\n  depNames.forEach((depName) => {\r\n    updatedDeps[depName] = currentData[depName];\r\n  });\r\n  return updatedDeps\r\n};\n\nconst createSubscription = () => {\r\n  const subscribers = {};\r\n\r\n  const memoDependency = (target, dep) => {\r\n    const { watcherName, fn } = target;\r\n    const { prop, value } = dep;\r\n\r\n    if (!subscribers[watcherName]) {\r\n      subscribers[watcherName] = {\r\n        deps: {},\r\n        fn,\r\n      };\r\n    }\r\n    subscribers[watcherName].deps[prop] = value;\r\n  };\r\n\r\n  return {\r\n    subscribers,\r\n    subscribe(target, dep) {\r\n      if (target) {\r\n        memoDependency(target, dep);\r\n      }\r\n    },\r\n    notify(data, prop) {\r\n      Object.entries(subscribers).forEach(([watchName, { deps, fn }]) => {\r\n        const depNames = getDepNames(deps);\r\n\r\n        if (depNames.includes(prop)) {\r\n          const updatedDeps = getUpdatedDeps(depNames, data);\r\n          if (!depsAreEqual(deps, updatedDeps)) {\r\n            subscribers[watchName].deps = updatedDeps;\r\n            fn();\r\n          }\r\n        }\r\n      });\r\n    },\r\n  }\r\n};\n\nconst createTargetWatcher = () => {\r\n  let target = null;\r\n\r\n  return {\r\n    targetWatcher(watcherName, fn) {\r\n      target = {\r\n        watcherName,\r\n        fn,\r\n      };\r\n      target.fn();\r\n      target = null;\r\n    },\r\n    getTarget() {\r\n      return target\r\n    },\r\n  }\r\n};\n\nfunction simplyReactive(entities, options) {\r\n  const data = lodash_get(entities, 'data', {});\r\n  const watch = lodash_get(entities, 'watch', {});\r\n  const methods = lodash_get(entities, 'methods', {});\r\n  const onChange = lodash_get(options, 'onChange', () => {});\r\n\r\n  const { subscribe, notify, subscribers } = createSubscription();\r\n  const { targetWatcher, getTarget } = createTargetWatcher();\r\n\r\n  let _data;\r\n  const _methods = {};\r\n  const getContext = () => ({\r\n    data: _data,\r\n    methods: _methods,\r\n  });\r\n\r\n  let callingMethod = false;\r\n  const methodWithFlags = (fn) => (...args) => {\r\n    callingMethod = true;\r\n    const result = fn(...args);\r\n    callingMethod = false;\r\n    return result\r\n  };\r\n\r\n  // init methods before data, as methods may be used in data\r\n  Object.entries(methods).forEach(([methodName, methodItem]) => {\r\n    _methods[methodName] = methodWithFlags((...args) =>\r\n      methodItem(getContext(), ...args)\r\n    );\r\n    Object.defineProperty(_methods[methodName], 'name', { value: methodName });\r\n  });\r\n\r\n  _data = new Proxy(lodash_clonedeep(data), {\r\n    get(target, prop) {\r\n      if (getTarget() && !callingMethod) {\r\n        subscribe(getTarget(), { prop, value: target[prop] });\r\n      }\r\n      return Reflect.get(...arguments)\r\n    },\r\n    set(target, prop, value) {\r\n      // if value is the same, do nothing\r\n      if (target[prop] === value) {\r\n        return true\r\n      }\r\n\r\n      Reflect.set(...arguments);\r\n\r\n      if (!getTarget()) {\r\n        onChange && onChange(prop, value);\r\n        notify(_data, prop);\r\n      }\r\n\r\n      return true\r\n    },\r\n  });\r\n\r\n  Object.entries(watch).forEach(([watchName, watchItem]) => {\r\n    targetWatcher(watchName, () => {\r\n      watchItem(getContext());\r\n    });\r\n  });\r\n\r\n  const output = [_data, _methods];\r\n  output._internal = {\r\n    _getSubscribers() {\r\n      return subscribers\r\n    },\r\n  };\r\n\r\n  return output\r\n}\n\nfunction getIndexesOfParticlesWithoutClonesInPage({\r\n  pageIndex,\r\n  particlesToShow,\r\n  particlesToScroll,\r\n  particlesCount,\r\n}) {\r\n  const overlap = pageIndex === 0 ? 0 : particlesToShow - particlesToScroll;\r\n  const from = pageIndex * particlesToShow - pageIndex * overlap;\r\n  const to = from + Math.max(particlesToShow, particlesToScroll) - 1;\r\n  const indexes = [];\r\n  for (let i=from; i<=Math.min(particlesCount - 1, to); i++) {\r\n    indexes.push(i);\r\n  }\r\n  return indexes\r\n}\r\n\r\nfunction getAdjacentIndexes({\r\n  infinite,\r\n  pageIndex,\r\n  pagesCount,\r\n  particlesCount,\r\n  particlesToShow,\r\n  particlesToScroll,\r\n}) {\r\n  const _pageIndex = getValueInRange(0, pageIndex, pagesCount - 1);\r\n\r\n  let rangeStart = _pageIndex - 1;\r\n  let rangeEnd = _pageIndex + 1;\r\n\r\n  rangeStart = infinite\r\n    ? rangeStart < 0 ? pagesCount - 1 : rangeStart\r\n    : Math.max(0, rangeStart);\r\n\r\n  rangeEnd = infinite\r\n    ? rangeEnd > pagesCount - 1 ? 0 : rangeEnd\r\n    : Math.min(pagesCount - 1, rangeEnd);\r\n\r\n  const pageIndexes = [...new Set([\r\n    rangeStart,\r\n    _pageIndex,\r\n    rangeEnd,\r\n\r\n    // because of these values outputs for infinite/non-infinites are the same\r\n    0, // needed to clone first page particles\r\n    pagesCount - 1, // needed to clone last page particles\r\n  ])].sort((a, b) => a - b);\r\n  const particleIndexes = pageIndexes.flatMap(\r\n    pageIndex => getIndexesOfParticlesWithoutClonesInPage({\r\n      pageIndex,\r\n      particlesToShow,\r\n      particlesToScroll,\r\n      particlesCount,\r\n    })\r\n  );\r\n  return {\r\n    pageIndexes,\r\n    particleIndexes: [...new Set(particleIndexes)].sort((a, b) => a - b),\r\n  }\r\n}\n\nconst setIntervalImmediate = (fn, ms) => {\r\n  fn();\r\n  return setInterval(fn, ms);\r\n};\n\nconst STEP_MS = 35;\r\nconst MAX_VALUE = 1;\r\n\r\nclass ProgressManager {\r\n  constructor({ onProgressValueChange }) {\r\n    this._onProgressValueChange = onProgressValueChange;\r\n\r\n    this._autoplayDuration;\r\n    this._onProgressValueChange;\r\n  \r\n    this._interval;\r\n    this._paused = false;\r\n  }\r\n\r\n  setAutoplayDuration(autoplayDuration) {\r\n    this._autoplayDuration = autoplayDuration;\r\n  }\r\n\r\n  start(onFinish) {\r\n    return new Promise((resolve) => {\r\n      this.reset();\r\n\r\n      const stepMs = Math.min(STEP_MS, Math.max(this._autoplayDuration, 1));\r\n      let progress = -stepMs;\r\n  \r\n      this._interval = setIntervalImmediate(async () => {\r\n        if (this._paused) {\r\n          return\r\n        }\r\n        progress += stepMs;\r\n  \r\n        const value = progress / this._autoplayDuration;\r\n        this._onProgressValueChange(value);\r\n  \r\n        if (value > MAX_VALUE) {\r\n          this.reset();\r\n          await onFinish();\r\n          resolve();\r\n        }\r\n      }, stepMs);\r\n    })\r\n  }\r\n\r\n  pause() {\r\n    this._paused = true;\r\n  }\r\n\r\n  resume() {\r\n    this._paused = false;\r\n  }\r\n\r\n  reset() {\r\n    clearInterval(this._interval);\r\n    this._onProgressValueChange(MAX_VALUE);\r\n  }\r\n}\n\nfunction createCarousel(onChange) {\r\n  const progressManager = new ProgressManager({\r\n    onProgressValueChange: (value) => {\r\n      onChange('progressValue', 1 - value);\r\n    },\r\n  });\r\n\r\n  const reactive = simplyReactive(\r\n    {\r\n      data: {\r\n        particlesCountWithoutClones: 0,\r\n        particlesToShow: 1, // normalized\r\n        particlesToShowInit: 1, // initial value\r\n        particlesToScroll: 1, // normalized\r\n        particlesToScrollInit: 1, // initial value\r\n        particlesCount: 1,\r\n        currentParticleIndex: 1,\r\n        infinite: false,\r\n        autoplayDuration: 1000,\r\n        clonesCountHead: 0,\r\n        clonesCountTail: 0,\r\n        clonesCountTotal: 0,\r\n        partialPageSize: 1,\r\n        currentPageIndex: 1,\r\n        pagesCount: 1,\r\n        pauseOnFocus: false,\r\n        focused: false,\r\n        autoplay: false,\r\n        autoplayDirection: 'next',\r\n        disabled: false, // disable page change while animation is in progress\r\n        durationMsInit: 1000,\r\n        durationMs: 1000,\r\n        offset: 0,\r\n        particleWidth: 0,\r\n        loaded: [],\r\n      },\r\n      watch: {\r\n        setLoaded({ data }) {\r\n          data.loaded = getAdjacentIndexes({\r\n            infinite: data.infinite,\r\n            pageIndex: data.currentPageIndex,\r\n            pagesCount: data.pagesCount,\r\n            particlesCount: data.particlesCountWithoutClones,\r\n            particlesToShow: data.particlesToShow,\r\n            particlesToScroll: data.particlesToScroll,\r\n          }).particleIndexes;\r\n        },\r\n        setCurrentPageIndex({ data }) {\r\n          data.currentPageIndex = getCurrentPageIndexByCurrentParticleIndex({\r\n            currentParticleIndex: data.currentParticleIndex,\r\n            particlesCount: data.particlesCount,\r\n            clonesCountHead: data.clonesCountHead,\r\n            clonesCountTotal: data.clonesCountTotal,\r\n            infinite: data.infinite,\r\n            particlesToScroll: data.particlesToScroll,\r\n          });\r\n        },\r\n        setPartialPageSize({ data }) {\r\n          data.partialPageSize = getPartialPageSize({\r\n            particlesToScroll: data.particlesToScroll,\r\n            particlesToShow: data.particlesToShow,\r\n            particlesCountWithoutClones: data.particlesCountWithoutClones,\r\n          });\r\n        },\r\n        setClonesCount({ data }) {\r\n          const { head, tail } = getClonesCount({\r\n            infinite: data.infinite,\r\n            particlesToShow: data.particlesToShow,\r\n            partialPageSize: data.partialPageSize,\r\n          });\r\n          data.clonesCountHead = head;\r\n          data.clonesCountTail = tail;\r\n          data.clonesCountTotal = head + tail;\r\n        },\r\n        setProgressManagerAutoplayDuration({ data }) {\r\n          progressManager.setAutoplayDuration(data.autoplayDuration);\r\n        },\r\n        toggleProgressManager({ data: { pauseOnFocus, focused } }) {\r\n          // as focused is in if block, it will not be put to deps, read them in data: {}\r\n          if (pauseOnFocus) {\r\n            if (focused) {\r\n              progressManager.pause();\r\n            } else {\r\n              progressManager.resume();\r\n            }\r\n          }\r\n        },\r\n        initDuration({ data }) {\r\n          data.durationMs = data.durationMsInit;\r\n        },\r\n        applyAutoplay({ data, methods: { _applyAutoplayIfNeeded } }) {\r\n          // prevent _applyAutoplayIfNeeded to be called with watcher\r\n          // to prevent its data added to deps\r\n          data.autoplay && _applyAutoplayIfNeeded(data.autoplay);\r\n        },\r\n        setPagesCount({ data }) {\r\n          data.pagesCount = getPagesCountByParticlesCount({\r\n            infinite: data.infinite,\r\n            particlesCountWithoutClones: data.particlesCountWithoutClones,\r\n            particlesToScroll: data.particlesToScroll,\r\n            particlesToShow: data.particlesToShow,\r\n          });\r\n        },\r\n        setParticlesToShow({ data }) {\r\n          data.particlesToShow = getValueInRange(\r\n            1,\r\n            data.particlesToShowInit,\r\n            data.particlesCountWithoutClones\r\n          );\r\n        },\r\n        setParticlesToScroll({ data }) {\r\n          data.particlesToScroll = getValueInRange(\r\n            1,\r\n            data.particlesToScrollInit,\r\n            data.particlesCountWithoutClones\r\n          );\r\n        },\r\n      },\r\n      methods: {\r\n        _prev({ data }) {\r\n          data.currentParticleIndex = getParticleIndexByPageIndex({\r\n            infinite: data.infinite,\r\n            pageIndex: data.currentPageIndex - 1,\r\n            clonesCountHead: data.clonesCountHead,\r\n            clonesCountTail: data.clonesCountTail,\r\n            particlesToScroll: data.particlesToScroll,\r\n            particlesCount: data.particlesCount,\r\n            particlesToShow: data.particlesToShow,\r\n          });\r\n        },\r\n        _next({ data }) {\r\n          data.currentParticleIndex = getParticleIndexByPageIndex({\r\n            infinite: data.infinite,\r\n            pageIndex: data.currentPageIndex + 1,\r\n            clonesCountHead: data.clonesCountHead,\r\n            clonesCountTail: data.clonesCountTail,\r\n            particlesToScroll: data.particlesToScroll,\r\n            particlesCount: data.particlesCount,\r\n            particlesToShow: data.particlesToShow,\r\n          });\r\n        },\r\n        _moveToParticle({ data }, particleIndex) {\r\n          data.currentParticleIndex = getValueInRange(\r\n            0,\r\n            particleIndex,\r\n            data.particlesCount - 1\r\n          );\r\n        },\r\n        toggleFocused({ data }) {\r\n          data.focused = !data.focused;\r\n        },\r\n        async _applyAutoplayIfNeeded({ data, methods }) {\r\n          // prevent progress change if not infinite for first and last page\r\n          if (\r\n            !data.infinite &&\r\n            ((data.autoplayDirection === NEXT &&\r\n              data.currentParticleIndex === data.particlesCount - 1) ||\r\n              (data.autoplayDirection === PREV &&\r\n                data.currentParticleIndex === 0))\r\n          ) {\r\n            progressManager.reset();\r\n            return\r\n          }\r\n\r\n          if (data.autoplay) {\r\n            const onFinish = () =>\r\n              switcher({\r\n                [NEXT]: async () => methods.showNextPage(),\r\n                [PREV]: async () => methods.showPrevPage(),\r\n              })(data.autoplayDirection);\r\n\r\n            await progressManager.start(onFinish);\r\n          }\r\n        },\r\n        // makes delayed jump to 1st or last element\r\n        async _jumpIfNeeded({ data, methods }) {\r\n          let jumped = false;\r\n          if (data.infinite) {\r\n            if (data.currentParticleIndex === 0) {\r\n              await methods.showParticle(\r\n                data.particlesCount - data.clonesCountTotal,\r\n                {\r\n                  animated: false,\r\n                }\r\n              );\r\n              jumped = true;\r\n            } else if (\r\n              data.currentParticleIndex ===\r\n              data.particlesCount - data.clonesCountTail\r\n            ) {\r\n              await methods.showParticle(data.clonesCountHead, {\r\n                animated: false,\r\n              });\r\n              jumped = true;\r\n            }\r\n          }\r\n          return jumped\r\n        },\r\n        async changePage({ data, methods }, updateStoreFn, options) {\r\n          progressManager.reset();\r\n          if (data.disabled) return\r\n          data.disabled = true;\r\n\r\n          updateStoreFn();\r\n          await methods.offsetPage({ animated: get(options, 'animated', true) });\r\n          data.disabled = false;\r\n\r\n          const jumped = await methods._jumpIfNeeded();\r\n          !jumped && methods._applyAutoplayIfNeeded(); // no need to wait it finishes\r\n        },\r\n        async showNextPage({ data, methods }, options) {\r\n          if (data.disabled) return\r\n          await methods.changePage(methods._next, options);\r\n        },\r\n        async showPrevPage({ data, methods }, options) {\r\n          if (data.disabled) return\r\n          await methods.changePage(methods._prev, options);\r\n        },\r\n        async showParticle({ methods }, particleIndex, options) {\r\n          await methods.changePage(\r\n            () => methods._moveToParticle(particleIndex),\r\n            options\r\n          );\r\n        },\r\n        _getParticleIndexByPageIndex({ data }, pageIndex) {\r\n          return getParticleIndexByPageIndex({\r\n            infinite: data.infinite,\r\n            pageIndex,\r\n            clonesCountHead: data.clonesCountHead,\r\n            clonesCountTail: data.clonesCountTail,\r\n            particlesToScroll: data.particlesToScroll,\r\n            particlesCount: data.particlesCount,\r\n            particlesToShow: data.particlesToShow,\r\n          })\r\n        },\r\n        async showPage({ methods }, pageIndex, options) {\r\n          const particleIndex = methods._getParticleIndexByPageIndex(pageIndex);\r\n          await methods.showParticle(particleIndex, options);\r\n        },\r\n        offsetPage({ data }, options) {\r\n          const animated = get(options, 'animated', true);\r\n          return new Promise((resolve) => {\r\n            // durationMs is an offset animation time\r\n            data.durationMs = animated ? data.durationMsInit : 0;\r\n            data.offset = -data.currentParticleIndex * data.particleWidth;\r\n            setTimeout(() => {\r\n              resolve();\r\n            }, data.durationMs);\r\n          })\r\n        },\r\n      },\r\n    },\r\n    {\r\n      onChange,\r\n    }\r\n  );\r\n  const [data, methods] = reactive;\r\n\r\n  return [{ data, progressManager }, methods, reactive._internal]\r\n}\n\n/* node_modules/svelte-carousel/src/components/Carousel/Carousel.svelte generated by Svelte v3.59.2 */\n\nfunction add_css$4(target) {\n\tappend_styles(target, \"svelte-uwo0yk\", \":root{--sc-color-rgb-light-50p:rgba(93, 93, 93, 0.5);--sc-color-rgb-light:#5d5d5d;--sc-color-hex-dark-50p:rgba(30, 30, 30, 0.5);--sc-color-hex-dark:#1e1e1e}.sc-carousel__carousel-container.svelte-uwo0yk{display:flex;width:100%;flex-direction:column;align-items:center}.sc-carousel__content-container.svelte-uwo0yk{position:relative;display:flex;width:100%}.sc-carousel__pages-window.svelte-uwo0yk{flex:1;display:flex;overflow:hidden;box-sizing:border-box;position:relative}.sc-carousel__pages-container.svelte-uwo0yk{width:100%;display:flex;transition-property:transform}.sc-carousel__arrow-container.svelte-uwo0yk{padding:5px;box-sizing:border-box;display:flex;align-items:center;justify-content:center}.sc-carousel-progress__container.svelte-uwo0yk{width:100%;height:5px;background-color:var(--sc-color-rgb-light-50p);position:absolute;bottom:0}.sc-carousel-button{all:unset;cursor:pointer}.sc-carousel-button:focus{outline:5px auto}\");\n}\n\nconst get_dots_slot_changes = dirty => ({\n\tcurrentPageIndex: dirty[0] & /*currentPageIndex*/ 32,\n\tpagesCount: dirty[0] & /*pagesCount*/ 1024,\n\tloaded: dirty[0] & /*loaded*/ 64\n});\n\nconst get_dots_slot_context = ctx => ({\n\tcurrentPageIndex: /*currentPageIndex*/ ctx[5],\n\tpagesCount: /*pagesCount*/ ctx[10],\n\tshowPage: /*handlePageChange*/ ctx[15],\n\tloaded: /*loaded*/ ctx[6]\n});\n\nconst get_next_slot_changes = dirty => ({\n\tloaded: dirty[0] & /*loaded*/ 64,\n\tcurrentPageIndex: dirty[0] & /*currentPageIndex*/ 32\n});\n\nconst get_next_slot_context = ctx => ({\n\tshowNextPage: /*methods*/ ctx[14].showNextPage,\n\tloaded: /*loaded*/ ctx[6],\n\tcurrentPageIndex: /*currentPageIndex*/ ctx[5]\n});\n\nconst get_default_slot_changes = dirty => ({\n\tloaded: dirty[0] & /*loaded*/ 64,\n\tcurrentPageIndex: dirty[0] & /*currentPageIndex*/ 32\n});\n\nconst get_default_slot_context = ctx => ({\n\tloaded: /*loaded*/ ctx[6],\n\tcurrentPageIndex: /*currentPageIndex*/ ctx[5]\n});\n\nconst get_prev_slot_changes = dirty => ({\n\tloaded: dirty[0] & /*loaded*/ 64,\n\tcurrentPageIndex: dirty[0] & /*currentPageIndex*/ 32\n});\n\nconst get_prev_slot_context = ctx => ({\n\tshowPrevPage: /*methods*/ ctx[14].showPrevPage,\n\tloaded: /*loaded*/ ctx[6],\n\tcurrentPageIndex: /*currentPageIndex*/ ctx[5]\n});\n\n// (259:4) {#if arrows}\nfunction create_if_block_3(ctx) {\n\tlet current;\n\tconst prev_slot_template = /*#slots*/ ctx[37].prev;\n\tconst prev_slot = create_slot(prev_slot_template, ctx, /*$$scope*/ ctx[36], get_prev_slot_context);\n\tconst prev_slot_or_fallback = prev_slot || fallback_block_2(ctx);\n\n\treturn {\n\t\tc() {\n\t\t\tif (prev_slot_or_fallback) prev_slot_or_fallback.c();\n\t\t},\n\t\tm(target, anchor) {\n\t\t\tif (prev_slot_or_fallback) {\n\t\t\t\tprev_slot_or_fallback.m(target, anchor);\n\t\t\t}\n\n\t\t\tcurrent = true;\n\t\t},\n\t\tp(ctx, dirty) {\n\t\t\tif (prev_slot) {\n\t\t\t\tif (prev_slot.p && (!current || dirty[0] & /*loaded, currentPageIndex*/ 96 | dirty[1] & /*$$scope*/ 32)) {\n\t\t\t\t\tupdate_slot_base(\n\t\t\t\t\t\tprev_slot,\n\t\t\t\t\t\tprev_slot_template,\n\t\t\t\t\t\tctx,\n\t\t\t\t\t\t/*$$scope*/ ctx[36],\n\t\t\t\t\t\t!current\n\t\t\t\t\t\t? get_all_dirty_from_scope(/*$$scope*/ ctx[36])\n\t\t\t\t\t\t: get_slot_changes(prev_slot_template, /*$$scope*/ ctx[36], dirty, get_prev_slot_changes),\n\t\t\t\t\t\tget_prev_slot_context\n\t\t\t\t\t);\n\t\t\t\t}\n\t\t\t} else {\n\t\t\t\tif (prev_slot_or_fallback && prev_slot_or_fallback.p && (!current || dirty[0] & /*infinite, currentPageIndex*/ 36)) {\n\t\t\t\t\tprev_slot_or_fallback.p(ctx, !current ? [-1, -1] : dirty);\n\t\t\t\t}\n\t\t\t}\n\t\t},\n\t\ti(local) {\n\t\t\tif (current) return;\n\t\t\ttransition_in(prev_slot_or_fallback, local);\n\t\t\tcurrent = true;\n\t\t},\n\t\to(local) {\n\t\t\ttransition_out(prev_slot_or_fallback, local);\n\t\t\tcurrent = false;\n\t\t},\n\t\td(detaching) {\n\t\t\tif (prev_slot_or_fallback) prev_slot_or_fallback.d(detaching);\n\t\t}\n\t};\n}\n\n// (260:60)           \nfunction fallback_block_2(ctx) {\n\tlet div;\n\tlet arrow;\n\tlet current;\n\n\tarrow = new Arrow({\n\t\t\tprops: {\n\t\t\t\tdirection: \"prev\",\n\t\t\t\tdisabled: !/*infinite*/ ctx[2] && /*currentPageIndex*/ ctx[5] === 0\n\t\t\t}\n\t\t});\n\n\tarrow.$on(\"click\", /*showPrevPage*/ ctx[23]);\n\n\treturn {\n\t\tc() {\n\t\t\tdiv = element(\"div\");\n\t\t\tcreate_component(arrow.$$.fragment);\n\t\t\tattr(div, \"class\", \"sc-carousel__arrow-container svelte-uwo0yk\");\n\t\t},\n\t\tm(target, anchor) {\n\t\t\tinsert(target, div, anchor);\n\t\t\tmount_component(arrow, div, null);\n\t\t\tcurrent = true;\n\t\t},\n\t\tp(ctx, dirty) {\n\t\t\tconst arrow_changes = {};\n\t\t\tif (dirty[0] & /*infinite, currentPageIndex*/ 36) arrow_changes.disabled = !/*infinite*/ ctx[2] && /*currentPageIndex*/ ctx[5] === 0;\n\t\t\tarrow.$set(arrow_changes);\n\t\t},\n\t\ti(local) {\n\t\t\tif (current) return;\n\t\t\ttransition_in(arrow.$$.fragment, local);\n\t\t\tcurrent = true;\n\t\t},\n\t\to(local) {\n\t\t\ttransition_out(arrow.$$.fragment, local);\n\t\t\tcurrent = false;\n\t\t},\n\t\td(detaching) {\n\t\t\tif (detaching) detach(div);\n\t\t\tdestroy_component(arrow);\n\t\t}\n\t};\n}\n\n// (297:6) {#if autoplayProgressVisible}\nfunction create_if_block_2(ctx) {\n\tlet div;\n\tlet progress;\n\tlet current;\n\n\tprogress = new Progress({\n\t\t\tprops: { value: /*progressValue*/ ctx[7] }\n\t\t});\n\n\treturn {\n\t\tc() {\n\t\t\tdiv = element(\"div\");\n\t\t\tcreate_component(progress.$$.fragment);\n\t\t\tattr(div, \"class\", \"sc-carousel-progress__container svelte-uwo0yk\");\n\t\t},\n\t\tm(target, anchor) {\n\t\t\tinsert(target, div, anchor);\n\t\t\tmount_component(progress, div, null);\n\t\t\tcurrent = true;\n\t\t},\n\t\tp(ctx, dirty) {\n\t\t\tconst progress_changes = {};\n\t\t\tif (dirty[0] & /*progressValue*/ 128) progress_changes.value = /*progressValue*/ ctx[7];\n\t\t\tprogress.$set(progress_changes);\n\t\t},\n\t\ti(local) {\n\t\t\tif (current) return;\n\t\t\ttransition_in(progress.$$.fragment, local);\n\t\t\tcurrent = true;\n\t\t},\n\t\to(local) {\n\t\t\ttransition_out(progress.$$.fragment, local);\n\t\t\tcurrent = false;\n\t\t},\n\t\td(detaching) {\n\t\t\tif (detaching) detach(div);\n\t\t\tdestroy_component(progress);\n\t\t}\n\t};\n}\n\n// (303:4) {#if arrows}\nfunction create_if_block_1(ctx) {\n\tlet current;\n\tconst next_slot_template = /*#slots*/ ctx[37].next;\n\tconst next_slot = create_slot(next_slot_template, ctx, /*$$scope*/ ctx[36], get_next_slot_context);\n\tconst next_slot_or_fallback = next_slot || fallback_block_1(ctx);\n\n\treturn {\n\t\tc() {\n\t\t\tif (next_slot_or_fallback) next_slot_or_fallback.c();\n\t\t},\n\t\tm(target, anchor) {\n\t\t\tif (next_slot_or_fallback) {\n\t\t\t\tnext_slot_or_fallback.m(target, anchor);\n\t\t\t}\n\n\t\t\tcurrent = true;\n\t\t},\n\t\tp(ctx, dirty) {\n\t\t\tif (next_slot) {\n\t\t\t\tif (next_slot.p && (!current || dirty[0] & /*loaded, currentPageIndex*/ 96 | dirty[1] & /*$$scope*/ 32)) {\n\t\t\t\t\tupdate_slot_base(\n\t\t\t\t\t\tnext_slot,\n\t\t\t\t\t\tnext_slot_template,\n\t\t\t\t\t\tctx,\n\t\t\t\t\t\t/*$$scope*/ ctx[36],\n\t\t\t\t\t\t!current\n\t\t\t\t\t\t? get_all_dirty_from_scope(/*$$scope*/ ctx[36])\n\t\t\t\t\t\t: get_slot_changes(next_slot_template, /*$$scope*/ ctx[36], dirty, get_next_slot_changes),\n\t\t\t\t\t\tget_next_slot_context\n\t\t\t\t\t);\n\t\t\t\t}\n\t\t\t} else {\n\t\t\t\tif (next_slot_or_fallback && next_slot_or_fallback.p && (!current || dirty[0] & /*infinite, currentPageIndex, pagesCount*/ 1060)) {\n\t\t\t\t\tnext_slot_or_fallback.p(ctx, !current ? [-1, -1] : dirty);\n\t\t\t\t}\n\t\t\t}\n\t\t},\n\t\ti(local) {\n\t\t\tif (current) return;\n\t\t\ttransition_in(next_slot_or_fallback, local);\n\t\t\tcurrent = true;\n\t\t},\n\t\to(local) {\n\t\t\ttransition_out(next_slot_or_fallback, local);\n\t\t\tcurrent = false;\n\t\t},\n\t\td(detaching) {\n\t\t\tif (next_slot_or_fallback) next_slot_or_fallback.d(detaching);\n\t\t}\n\t};\n}\n\n// (304:60)           \nfunction fallback_block_1(ctx) {\n\tlet div;\n\tlet arrow;\n\tlet current;\n\n\tarrow = new Arrow({\n\t\t\tprops: {\n\t\t\t\tdirection: \"next\",\n\t\t\t\tdisabled: !/*infinite*/ ctx[2] && /*currentPageIndex*/ ctx[5] === /*pagesCount*/ ctx[10] - 1\n\t\t\t}\n\t\t});\n\n\tarrow.$on(\"click\", /*methods*/ ctx[14].showNextPage);\n\n\treturn {\n\t\tc() {\n\t\t\tdiv = element(\"div\");\n\t\t\tcreate_component(arrow.$$.fragment);\n\t\t\tattr(div, \"class\", \"sc-carousel__arrow-container svelte-uwo0yk\");\n\t\t},\n\t\tm(target, anchor) {\n\t\t\tinsert(target, div, anchor);\n\t\t\tmount_component(arrow, div, null);\n\t\t\tcurrent = true;\n\t\t},\n\t\tp(ctx, dirty) {\n\t\t\tconst arrow_changes = {};\n\t\t\tif (dirty[0] & /*infinite, currentPageIndex, pagesCount*/ 1060) arrow_changes.disabled = !/*infinite*/ ctx[2] && /*currentPageIndex*/ ctx[5] === /*pagesCount*/ ctx[10] - 1;\n\t\t\tarrow.$set(arrow_changes);\n\t\t},\n\t\ti(local) {\n\t\t\tif (current) return;\n\t\t\ttransition_in(arrow.$$.fragment, local);\n\t\t\tcurrent = true;\n\t\t},\n\t\to(local) {\n\t\t\ttransition_out(arrow.$$.fragment, local);\n\t\t\tcurrent = false;\n\t\t},\n\t\td(detaching) {\n\t\t\tif (detaching) detach(div);\n\t\t\tdestroy_component(arrow);\n\t\t}\n\t};\n}\n\n// (315:2) {#if dots}\nfunction create_if_block(ctx) {\n\tlet current;\n\tconst dots_slot_template = /*#slots*/ ctx[37].dots;\n\tconst dots_slot = create_slot(dots_slot_template, ctx, /*$$scope*/ ctx[36], get_dots_slot_context);\n\tconst dots_slot_or_fallback = dots_slot || fallback_block(ctx);\n\n\treturn {\n\t\tc() {\n\t\t\tif (dots_slot_or_fallback) dots_slot_or_fallback.c();\n\t\t},\n\t\tm(target, anchor) {\n\t\t\tif (dots_slot_or_fallback) {\n\t\t\t\tdots_slot_or_fallback.m(target, anchor);\n\t\t\t}\n\n\t\t\tcurrent = true;\n\t\t},\n\t\tp(ctx, dirty) {\n\t\t\tif (dots_slot) {\n\t\t\t\tif (dots_slot.p && (!current || dirty[0] & /*currentPageIndex, pagesCount, loaded*/ 1120 | dirty[1] & /*$$scope*/ 32)) {\n\t\t\t\t\tupdate_slot_base(\n\t\t\t\t\t\tdots_slot,\n\t\t\t\t\t\tdots_slot_template,\n\t\t\t\t\t\tctx,\n\t\t\t\t\t\t/*$$scope*/ ctx[36],\n\t\t\t\t\t\t!current\n\t\t\t\t\t\t? get_all_dirty_from_scope(/*$$scope*/ ctx[36])\n\t\t\t\t\t\t: get_slot_changes(dots_slot_template, /*$$scope*/ ctx[36], dirty, get_dots_slot_changes),\n\t\t\t\t\t\tget_dots_slot_context\n\t\t\t\t\t);\n\t\t\t\t}\n\t\t\t} else {\n\t\t\t\tif (dots_slot_or_fallback && dots_slot_or_fallback.p && (!current || dirty[0] & /*pagesCount, currentPageIndex*/ 1056)) {\n\t\t\t\t\tdots_slot_or_fallback.p(ctx, !current ? [-1, -1] : dirty);\n\t\t\t\t}\n\t\t\t}\n\t\t},\n\t\ti(local) {\n\t\t\tif (current) return;\n\t\t\ttransition_in(dots_slot_or_fallback, local);\n\t\t\tcurrent = true;\n\t\t},\n\t\to(local) {\n\t\t\ttransition_out(dots_slot_or_fallback, local);\n\t\t\tcurrent = false;\n\t\t},\n\t\td(detaching) {\n\t\t\tif (dots_slot_or_fallback) dots_slot_or_fallback.d(detaching);\n\t\t}\n\t};\n}\n\n// (321:5)         \nfunction fallback_block(ctx) {\n\tlet dots_1;\n\tlet current;\n\n\tdots_1 = new Dots({\n\t\t\tprops: {\n\t\t\t\tpagesCount: /*pagesCount*/ ctx[10],\n\t\t\t\tcurrentPageIndex: /*currentPageIndex*/ ctx[5]\n\t\t\t}\n\t\t});\n\n\tdots_1.$on(\"pageChange\", /*pageChange_handler*/ ctx[41]);\n\n\treturn {\n\t\tc() {\n\t\t\tcreate_component(dots_1.$$.fragment);\n\t\t},\n\t\tm(target, anchor) {\n\t\t\tmount_component(dots_1, target, anchor);\n\t\t\tcurrent = true;\n\t\t},\n\t\tp(ctx, dirty) {\n\t\t\tconst dots_1_changes = {};\n\t\t\tif (dirty[0] & /*pagesCount*/ 1024) dots_1_changes.pagesCount = /*pagesCount*/ ctx[10];\n\t\t\tif (dirty[0] & /*currentPageIndex*/ 32) dots_1_changes.currentPageIndex = /*currentPageIndex*/ ctx[5];\n\t\t\tdots_1.$set(dots_1_changes);\n\t\t},\n\t\ti(local) {\n\t\t\tif (current) return;\n\t\t\ttransition_in(dots_1.$$.fragment, local);\n\t\t\tcurrent = true;\n\t\t},\n\t\to(local) {\n\t\t\ttransition_out(dots_1.$$.fragment, local);\n\t\t\tcurrent = false;\n\t\t},\n\t\td(detaching) {\n\t\t\tdestroy_component(dots_1, detaching);\n\t\t}\n\t};\n}\n\nfunction create_fragment$4(ctx) {\n\tlet div3;\n\tlet div2;\n\tlet t0;\n\tlet div1;\n\tlet div0;\n\tlet swipeable_action;\n\tlet t1;\n\tlet t2;\n\tlet t3;\n\tlet current;\n\tlet mounted;\n\tlet dispose;\n\tlet if_block0 = /*arrows*/ ctx[1] && create_if_block_3(ctx);\n\tconst default_slot_template = /*#slots*/ ctx[37].default;\n\tconst default_slot = create_slot(default_slot_template, ctx, /*$$scope*/ ctx[36], get_default_slot_context);\n\tlet if_block1 = /*autoplayProgressVisible*/ ctx[3] && create_if_block_2(ctx);\n\tlet if_block2 = /*arrows*/ ctx[1] && create_if_block_1(ctx);\n\tlet if_block3 = /*dots*/ ctx[4] && create_if_block(ctx);\n\n\treturn {\n\t\tc() {\n\t\t\tdiv3 = element(\"div\");\n\t\t\tdiv2 = element(\"div\");\n\t\t\tif (if_block0) if_block0.c();\n\t\t\tt0 = space();\n\t\t\tdiv1 = element(\"div\");\n\t\t\tdiv0 = element(\"div\");\n\t\t\tif (default_slot) default_slot.c();\n\t\t\tt1 = space();\n\t\t\tif (if_block1) if_block1.c();\n\t\t\tt2 = space();\n\t\t\tif (if_block2) if_block2.c();\n\t\t\tt3 = space();\n\t\t\tif (if_block3) if_block3.c();\n\t\t\tattr(div0, \"class\", \"sc-carousel__pages-container svelte-uwo0yk\");\n\t\t\tset_style(div0, \"transform\", \"translateX(\" + /*offset*/ ctx[8] + \"px)\");\n\t\t\tset_style(div0, \"transition-duration\", /*durationMs*/ ctx[9] + \"ms\");\n\t\t\tset_style(div0, \"transition-timing-function\", /*timingFunction*/ ctx[0]);\n\t\t\tattr(div1, \"class\", \"sc-carousel__pages-window svelte-uwo0yk\");\n\t\t\tattr(div2, \"class\", \"sc-carousel__content-container svelte-uwo0yk\");\n\t\t\tattr(div3, \"class\", \"sc-carousel__carousel-container svelte-uwo0yk\");\n\t\t},\n\t\tm(target, anchor) {\n\t\t\tinsert(target, div3, anchor);\n\t\t\tappend(div3, div2);\n\t\t\tif (if_block0) if_block0.m(div2, null);\n\t\t\tappend(div2, t0);\n\t\t\tappend(div2, div1);\n\t\t\tappend(div1, div0);\n\n\t\t\tif (default_slot) {\n\t\t\t\tdefault_slot.m(div0, null);\n\t\t\t}\n\n\t\t\t/*div0_binding*/ ctx[39](div0);\n\t\t\tappend(div1, t1);\n\t\t\tif (if_block1) if_block1.m(div1, null);\n\t\t\t/*div1_binding*/ ctx[40](div1);\n\t\t\tappend(div2, t2);\n\t\t\tif (if_block2) if_block2.m(div2, null);\n\t\t\tappend(div3, t3);\n\t\t\tif (if_block3) if_block3.m(div3, null);\n\t\t\tcurrent = true;\n\n\t\t\tif (!mounted) {\n\t\t\t\tdispose = [\n\t\t\t\t\taction_destroyer(swipeable_action = swipeable.call(null, div0, {\n\t\t\t\t\t\tthresholdProvider: /*swipeable_function*/ ctx[38]\n\t\t\t\t\t})),\n\t\t\t\t\tlisten(div0, \"swipeStart\", /*handleSwipeStart*/ ctx[16]),\n\t\t\t\t\tlisten(div0, \"swipeMove\", /*handleSwipeMove*/ ctx[18]),\n\t\t\t\t\tlisten(div0, \"swipeEnd\", /*handleSwipeEnd*/ ctx[19]),\n\t\t\t\t\tlisten(div0, \"swipeFailed\", /*handleSwipeFailed*/ ctx[20]),\n\t\t\t\t\tlisten(div0, \"swipeThresholdReached\", /*handleSwipeThresholdReached*/ ctx[17]),\n\t\t\t\t\taction_destroyer(hoverable.call(null, div1)),\n\t\t\t\t\tlisten(div1, \"hovered\", /*handleHovered*/ ctx[21]),\n\t\t\t\t\taction_destroyer(tappable.call(null, div1)),\n\t\t\t\t\tlisten(div1, \"tapped\", /*handleTapped*/ ctx[22])\n\t\t\t\t];\n\n\t\t\t\tmounted = true;\n\t\t\t}\n\t\t},\n\t\tp(ctx, dirty) {\n\t\t\tif (/*arrows*/ ctx[1]) {\n\t\t\t\tif (if_block0) {\n\t\t\t\t\tif_block0.p(ctx, dirty);\n\n\t\t\t\t\tif (dirty[0] & /*arrows*/ 2) {\n\t\t\t\t\t\ttransition_in(if_block0, 1);\n\t\t\t\t\t}\n\t\t\t\t} else {\n\t\t\t\t\tif_block0 = create_if_block_3(ctx);\n\t\t\t\t\tif_block0.c();\n\t\t\t\t\ttransition_in(if_block0, 1);\n\t\t\t\t\tif_block0.m(div2, t0);\n\t\t\t\t}\n\t\t\t} else if (if_block0) {\n\t\t\t\tgroup_outros();\n\n\t\t\t\ttransition_out(if_block0, 1, 1, () => {\n\t\t\t\t\tif_block0 = null;\n\t\t\t\t});\n\n\t\t\t\tcheck_outros();\n\t\t\t}\n\n\t\t\tif (default_slot) {\n\t\t\t\tif (default_slot.p && (!current || dirty[0] & /*loaded, currentPageIndex*/ 96 | dirty[1] & /*$$scope*/ 32)) {\n\t\t\t\t\tupdate_slot_base(\n\t\t\t\t\t\tdefault_slot,\n\t\t\t\t\t\tdefault_slot_template,\n\t\t\t\t\t\tctx,\n\t\t\t\t\t\t/*$$scope*/ ctx[36],\n\t\t\t\t\t\t!current\n\t\t\t\t\t\t? get_all_dirty_from_scope(/*$$scope*/ ctx[36])\n\t\t\t\t\t\t: get_slot_changes(default_slot_template, /*$$scope*/ ctx[36], dirty, get_default_slot_changes),\n\t\t\t\t\t\tget_default_slot_context\n\t\t\t\t\t);\n\t\t\t\t}\n\t\t\t}\n\n\t\t\tif (!current || dirty[0] & /*offset*/ 256) {\n\t\t\t\tset_style(div0, \"transform\", \"translateX(\" + /*offset*/ ctx[8] + \"px)\");\n\t\t\t}\n\n\t\t\tif (!current || dirty[0] & /*durationMs*/ 512) {\n\t\t\t\tset_style(div0, \"transition-duration\", /*durationMs*/ ctx[9] + \"ms\");\n\t\t\t}\n\n\t\t\tif (!current || dirty[0] & /*timingFunction*/ 1) {\n\t\t\t\tset_style(div0, \"transition-timing-function\", /*timingFunction*/ ctx[0]);\n\t\t\t}\n\n\t\t\tif (swipeable_action && is_function(swipeable_action.update) && dirty[0] & /*pageWindowWidth*/ 2048) swipeable_action.update.call(null, {\n\t\t\t\tthresholdProvider: /*swipeable_function*/ ctx[38]\n\t\t\t});\n\n\t\t\tif (/*autoplayProgressVisible*/ ctx[3]) {\n\t\t\t\tif (if_block1) {\n\t\t\t\t\tif_block1.p(ctx, dirty);\n\n\t\t\t\t\tif (dirty[0] & /*autoplayProgressVisible*/ 8) {\n\t\t\t\t\t\ttransition_in(if_block1, 1);\n\t\t\t\t\t}\n\t\t\t\t} else {\n\t\t\t\t\tif_block1 = create_if_block_2(ctx);\n\t\t\t\t\tif_block1.c();\n\t\t\t\t\ttransition_in(if_block1, 1);\n\t\t\t\t\tif_block1.m(div1, null);\n\t\t\t\t}\n\t\t\t} else if (if_block1) {\n\t\t\t\tgroup_outros();\n\n\t\t\t\ttransition_out(if_block1, 1, 1, () => {\n\t\t\t\t\tif_block1 = null;\n\t\t\t\t});\n\n\t\t\t\tcheck_outros();\n\t\t\t}\n\n\t\t\tif (/*arrows*/ ctx[1]) {\n\t\t\t\tif (if_block2) {\n\t\t\t\t\tif_block2.p(ctx, dirty);\n\n\t\t\t\t\tif (dirty[0] & /*arrows*/ 2) {\n\t\t\t\t\t\ttransition_in(if_block2, 1);\n\t\t\t\t\t}\n\t\t\t\t} else {\n\t\t\t\t\tif_block2 = create_if_block_1(ctx);\n\t\t\t\t\tif_block2.c();\n\t\t\t\t\ttransition_in(if_block2, 1);\n\t\t\t\t\tif_block2.m(div2, null);\n\t\t\t\t}\n\t\t\t} else if (if_block2) {\n\t\t\t\tgroup_outros();\n\n\t\t\t\ttransition_out(if_block2, 1, 1, () => {\n\t\t\t\t\tif_block2 = null;\n\t\t\t\t});\n\n\t\t\t\tcheck_outros();\n\t\t\t}\n\n\t\t\tif (/*dots*/ ctx[4]) {\n\t\t\t\tif (if_block3) {\n\t\t\t\t\tif_block3.p(ctx, dirty);\n\n\t\t\t\t\tif (dirty[0] & /*dots*/ 16) {\n\t\t\t\t\t\ttransition_in(if_block3, 1);\n\t\t\t\t\t}\n\t\t\t\t} else {\n\t\t\t\t\tif_block3 = create_if_block(ctx);\n\t\t\t\t\tif_block3.c();\n\t\t\t\t\ttransition_in(if_block3, 1);\n\t\t\t\t\tif_block3.m(div3, null);\n\t\t\t\t}\n\t\t\t} else if (if_block3) {\n\t\t\t\tgroup_outros();\n\n\t\t\t\ttransition_out(if_block3, 1, 1, () => {\n\t\t\t\t\tif_block3 = null;\n\t\t\t\t});\n\n\t\t\t\tcheck_outros();\n\t\t\t}\n\t\t},\n\t\ti(local) {\n\t\t\tif (current) return;\n\t\t\ttransition_in(if_block0);\n\t\t\ttransition_in(default_slot, local);\n\t\t\ttransition_in(if_block1);\n\t\t\ttransition_in(if_block2);\n\t\t\ttransition_in(if_block3);\n\t\t\tcurrent = true;\n\t\t},\n\t\to(local) {\n\t\t\ttransition_out(if_block0);\n\t\t\ttransition_out(default_slot, local);\n\t\t\ttransition_out(if_block1);\n\t\t\ttransition_out(if_block2);\n\t\t\ttransition_out(if_block3);\n\t\t\tcurrent = false;\n\t\t},\n\t\td(detaching) {\n\t\t\tif (detaching) detach(div3);\n\t\t\tif (if_block0) if_block0.d();\n\t\t\tif (default_slot) default_slot.d(detaching);\n\t\t\t/*div0_binding*/ ctx[39](null);\n\t\t\tif (if_block1) if_block1.d();\n\t\t\t/*div1_binding*/ ctx[40](null);\n\t\t\tif (if_block2) if_block2.d();\n\t\t\tif (if_block3) if_block3.d();\n\t\t\tmounted = false;\n\t\t\trun_all(dispose);\n\t\t}\n\t};\n}\n\nfunction instance$4($$self, $$props, $$invalidate) {\n\tlet { $$slots: slots = {}, $$scope } = $$props;\n\tlet loaded = [];\n\tlet currentPageIndex;\n\tlet progressValue;\n\tlet offset = 0;\n\tlet durationMs = 0;\n\tlet pagesCount = 1;\n\n\tconst [{ data, progressManager }, methods, service] = createCarousel((key, value) => {\n\t\tswitcher({\n\t\t\t'currentPageIndex': () => $$invalidate(5, currentPageIndex = value),\n\t\t\t'progressValue': () => $$invalidate(7, progressValue = value),\n\t\t\t'offset': () => $$invalidate(8, offset = value),\n\t\t\t'durationMs': () => $$invalidate(9, durationMs = value),\n\t\t\t'pagesCount': () => $$invalidate(10, pagesCount = value),\n\t\t\t'loaded': () => $$invalidate(6, loaded = value)\n\t\t})(key);\n\t});\n\n\tconst dispatch = createEventDispatcher();\n\tlet { timingFunction = 'ease-in-out' } = $$props;\n\tlet { arrows = true } = $$props;\n\tlet { infinite = true } = $$props;\n\tlet { initialPageIndex = 0 } = $$props;\n\tlet { duration = 500 } = $$props;\n\tlet { autoplay = false } = $$props;\n\tlet { autoplayDuration = 3000 } = $$props;\n\tlet { autoplayDirection = NEXT } = $$props;\n\tlet { pauseOnFocus = false } = $$props;\n\tlet { autoplayProgressVisible = false } = $$props;\n\tlet { dots = true } = $$props;\n\tlet { swiping = true } = $$props;\n\tlet { particlesToShow = 1 } = $$props;\n\tlet { particlesToScroll = 1 } = $$props;\n\n\tasync function goTo(pageIndex, options) {\n\t\tconst animated = get(options, 'animated', true);\n\n\t\tif (typeof pageIndex !== 'number') {\n\t\t\tthrow new Error('pageIndex should be a number');\n\t\t}\n\n\t\tawait methods.showPage(pageIndex, { animated });\n\t}\n\n\tasync function goToPrev(options) {\n\t\tconst animated = get(options, 'animated', true);\n\t\tawait methods.showPrevPage({ animated });\n\t}\n\n\tasync function goToNext(options) {\n\t\tconst animated = get(options, 'animated', true);\n\t\tawait methods.showNextPage({ animated });\n\t}\n\n\tlet pageWindowWidth = 0;\n\tlet pageWindowElement;\n\tlet particlesContainer;\n\n\tconst pageWindowElementResizeObserver = createResizeObserver(({ width }) => {\n\t\t$$invalidate(11, pageWindowWidth = width);\n\t\tdata.particleWidth = pageWindowWidth / data.particlesToShow;\n\n\t\tapplyParticleSizes({\n\t\t\tparticlesContainerChildren: particlesContainer.children,\n\t\t\tparticleWidth: data.particleWidth\n\t\t});\n\n\t\tmethods.offsetPage({ animated: false });\n\t});\n\n\tfunction addClones() {\n\t\tconst { clonesToAppend, clonesToPrepend } = getClones({\n\t\t\tclonesCountHead: data.clonesCountHead,\n\t\t\tclonesCountTail: data.clonesCountTail,\n\t\t\tparticlesContainerChildren: particlesContainer.children\n\t\t});\n\n\t\tapplyClones({\n\t\t\tparticlesContainer,\n\t\t\tclonesToAppend,\n\t\t\tclonesToPrepend\n\t\t});\n\t}\n\n\tonMount(() => {\n\t\t(async () => {\n\t\t\tawait tick();\n\n\t\t\tif (particlesContainer && pageWindowElement) {\n\t\t\t\tdata.particlesCountWithoutClones = particlesContainer.children.length;\n\t\t\t\tawait tick();\n\t\t\t\tdata.infinite && addClones();\n\n\t\t\t\t// call after adding clones\n\t\t\t\tdata.particlesCount = particlesContainer.children.length;\n\n\t\t\t\tmethods.showPage(initialPageIndex, { animated: false });\n\t\t\t\tpageWindowElementResizeObserver.observe(pageWindowElement);\n\t\t\t}\n\t\t})();\n\t});\n\n\tonDestroy(() => {\n\t\tpageWindowElementResizeObserver.disconnect();\n\t\tprogressManager.reset();\n\t});\n\n\tasync function handlePageChange(pageIndex) {\n\t\tawait methods.showPage(pageIndex, { animated: true });\n\t}\n\n\t// gestures\n\tfunction handleSwipeStart() {\n\t\tif (!swiping) return;\n\t\tdata.durationMs = 0;\n\t}\n\n\tasync function handleSwipeThresholdReached(event) {\n\t\tif (!swiping) return;\n\n\t\tawait switcher({\n\t\t\t[NEXT]: methods.showNextPage,\n\t\t\t[PREV]: methods.showPrevPage\n\t\t})(event.detail.direction);\n\t}\n\n\tfunction handleSwipeMove(event) {\n\t\tif (!swiping) return;\n\t\tdata.offset += event.detail.dx;\n\t}\n\n\tfunction handleSwipeEnd() {\n\t\tif (!swiping) return;\n\t\tmethods.showParticle(data.currentParticleIndex);\n\t}\n\n\tasync function handleSwipeFailed() {\n\t\tif (!swiping) return;\n\t\tawait methods.offsetPage({ animated: true });\n\t}\n\n\tfunction handleHovered(event) {\n\t\tdata.focused = event.detail.value;\n\t}\n\n\tfunction handleTapped() {\n\t\tmethods.toggleFocused();\n\t}\n\n\tfunction showPrevPage() {\n\t\tmethods.showPrevPage();\n\t}\n\n\tconst swipeable_function = () => pageWindowWidth / 3;\n\n\tfunction div0_binding($$value) {\n\t\tbinding_callbacks[$$value ? 'unshift' : 'push'](() => {\n\t\t\tparticlesContainer = $$value;\n\t\t\t$$invalidate(13, particlesContainer);\n\t\t});\n\t}\n\n\tfunction div1_binding($$value) {\n\t\tbinding_callbacks[$$value ? 'unshift' : 'push'](() => {\n\t\t\tpageWindowElement = $$value;\n\t\t\t$$invalidate(12, pageWindowElement);\n\t\t});\n\t}\n\n\tconst pageChange_handler = event => handlePageChange(event.detail);\n\n\t$$self.$$set = $$props => {\n\t\tif ('timingFunction' in $$props) $$invalidate(0, timingFunction = $$props.timingFunction);\n\t\tif ('arrows' in $$props) $$invalidate(1, arrows = $$props.arrows);\n\t\tif ('infinite' in $$props) $$invalidate(2, infinite = $$props.infinite);\n\t\tif ('initialPageIndex' in $$props) $$invalidate(24, initialPageIndex = $$props.initialPageIndex);\n\t\tif ('duration' in $$props) $$invalidate(25, duration = $$props.duration);\n\t\tif ('autoplay' in $$props) $$invalidate(26, autoplay = $$props.autoplay);\n\t\tif ('autoplayDuration' in $$props) $$invalidate(27, autoplayDuration = $$props.autoplayDuration);\n\t\tif ('autoplayDirection' in $$props) $$invalidate(28, autoplayDirection = $$props.autoplayDirection);\n\t\tif ('pauseOnFocus' in $$props) $$invalidate(29, pauseOnFocus = $$props.pauseOnFocus);\n\t\tif ('autoplayProgressVisible' in $$props) $$invalidate(3, autoplayProgressVisible = $$props.autoplayProgressVisible);\n\t\tif ('dots' in $$props) $$invalidate(4, dots = $$props.dots);\n\t\tif ('swiping' in $$props) $$invalidate(30, swiping = $$props.swiping);\n\t\tif ('particlesToShow' in $$props) $$invalidate(31, particlesToShow = $$props.particlesToShow);\n\t\tif ('particlesToScroll' in $$props) $$invalidate(32, particlesToScroll = $$props.particlesToScroll);\n\t\tif ('$$scope' in $$props) $$invalidate(36, $$scope = $$props.$$scope);\n\t};\n\n\t$$self.$$.update = () => {\n\t\tif ($$self.$$.dirty[0] & /*currentPageIndex*/ 32) {\n\t\t\t {\n\t\t\t\tdispatch('pageChange', currentPageIndex);\n\t\t\t}\n\t\t}\n\n\t\tif ($$self.$$.dirty[0] & /*infinite*/ 4) {\n\t\t\t {\n\t\t\t\tdata.infinite = infinite;\n\t\t\t}\n\t\t}\n\n\t\tif ($$self.$$.dirty[0] & /*duration*/ 33554432) {\n\t\t\t {\n\t\t\t\tdata.durationMsInit = duration;\n\t\t\t}\n\t\t}\n\n\t\tif ($$self.$$.dirty[0] & /*autoplay*/ 67108864) {\n\t\t\t {\n\t\t\t\tdata.autoplay = autoplay;\n\t\t\t}\n\t\t}\n\n\t\tif ($$self.$$.dirty[0] & /*autoplayDuration*/ 134217728) {\n\t\t\t {\n\t\t\t\tdata.autoplayDuration = autoplayDuration;\n\t\t\t}\n\t\t}\n\n\t\tif ($$self.$$.dirty[0] & /*autoplayDirection*/ 268435456) {\n\t\t\t {\n\t\t\t\tdata.autoplayDirection = autoplayDirection;\n\t\t\t}\n\t\t}\n\n\t\tif ($$self.$$.dirty[0] & /*pauseOnFocus*/ 536870912) {\n\t\t\t {\n\t\t\t\tdata.pauseOnFocus = pauseOnFocus;\n\t\t\t}\n\t\t}\n\n\t\tif ($$self.$$.dirty[1] & /*particlesToShow*/ 1) {\n\t\t\t {\n\t\t\t\tdata.particlesToShowInit = particlesToShow;\n\t\t\t}\n\t\t}\n\n\t\tif ($$self.$$.dirty[1] & /*particlesToScroll*/ 2) {\n\t\t\t {\n\t\t\t\tdata.particlesToScrollInit = particlesToScroll;\n\t\t\t}\n\t\t}\n\t};\n\n\treturn [\n\t\ttimingFunction,\n\t\tarrows,\n\t\tinfinite,\n\t\tautoplayProgressVisible,\n\t\tdots,\n\t\tcurrentPageIndex,\n\t\tloaded,\n\t\tprogressValue,\n\t\toffset,\n\t\tdurationMs,\n\t\tpagesCount,\n\t\tpageWindowWidth,\n\t\tpageWindowElement,\n\t\tparticlesContainer,\n\t\tmethods,\n\t\thandlePageChange,\n\t\thandleSwipeStart,\n\t\thandleSwipeThresholdReached,\n\t\thandleSwipeMove,\n\t\thandleSwipeEnd,\n\t\thandleSwipeFailed,\n\t\thandleHovered,\n\t\thandleTapped,\n\t\tshowPrevPage,\n\t\tinitialPageIndex,\n\t\tduration,\n\t\tautoplay,\n\t\tautoplayDuration,\n\t\tautoplayDirection,\n\t\tpauseOnFocus,\n\t\tswiping,\n\t\tparticlesToShow,\n\t\tparticlesToScroll,\n\t\tgoTo,\n\t\tgoToPrev,\n\t\tgoToNext,\n\t\t$$scope,\n\t\tslots,\n\t\tswipeable_function,\n\t\tdiv0_binding,\n\t\tdiv1_binding,\n\t\tpageChange_handler\n\t];\n}\n\nclass Carousel extends SvelteComponent {\n\tconstructor(options) {\n\t\tsuper();\n\n\t\tinit(\n\t\t\tthis,\n\t\t\toptions,\n\t\t\tinstance$4,\n\t\t\tcreate_fragment$4,\n\t\t\tsafe_not_equal,\n\t\t\t{\n\t\t\t\ttimingFunction: 0,\n\t\t\t\tarrows: 1,\n\t\t\t\tinfinite: 2,\n\t\t\t\tinitialPageIndex: 24,\n\t\t\t\tduration: 25,\n\t\t\t\tautoplay: 26,\n\t\t\t\tautoplayDuration: 27,\n\t\t\t\tautoplayDirection: 28,\n\t\t\t\tpauseOnFocus: 29,\n\t\t\t\tautoplayProgressVisible: 3,\n\t\t\t\tdots: 4,\n\t\t\t\tswiping: 30,\n\t\t\t\tparticlesToShow: 31,\n\t\t\t\tparticlesToScroll: 32,\n\t\t\t\tgoTo: 33,\n\t\t\t\tgoToPrev: 34,\n\t\t\t\tgoToNext: 35\n\t\t\t},\n\t\t\tadd_css$4,\n\t\t\t[-1, -1]\n\t\t);\n\t}\n\n\tget goTo() {\n\t\treturn this.$$.ctx[33];\n\t}\n\n\tget goToPrev() {\n\t\treturn this.$$.ctx[34];\n\t}\n\n\tget goToNext() {\n\t\treturn this.$$.ctx[35];\n\t}\n}\n\nexport default Carousel;\n", "import './Testimonial.svelte.css';\n/* src/components/Testimonial.svelte generated by Svelte v3.59.2 */\nimport {\n\tSvelteComponent,\n\tappend,\n\tattr,\n\tdetach,\n\telement,\n\tinit,\n\tinsert,\n\tnoop,\n\tsafe_not_equal,\n\tset_data,\n\tset_style,\n\tspace,\n\tsrc_url_equal,\n\ttext\n} from \"../../_snowpack/pkg/svelte/internal.js\";\n\nfunction create_fragment(ctx) {\n\tlet div5;\n\tlet div4;\n\tlet div2;\n\tlet div0;\n\tlet h1;\n\tlet t1;\n\tlet p0;\n\tlet t2;\n\tlet t3;\n\tlet div1;\n\tlet img0;\n\tlet img0_src_value;\n\tlet t4;\n\tlet div3;\n\tlet h2;\n\tlet t5;\n\tlet t6;\n\tlet p1;\n\tlet a0;\n\tlet img1;\n\tlet img1_src_value;\n\tlet a0_href_value;\n\tlet t7;\n\tlet a1;\n\tlet t8;\n\tlet a1_href_value;\n\n\treturn {\n\t\tc() {\n\t\t\tdiv5 = element(\"div\");\n\t\t\tdiv4 = element(\"div\");\n\t\t\tdiv2 = element(\"div\");\n\t\t\tdiv0 = element(\"div\");\n\t\t\th1 = element(\"h1\");\n\t\t\th1.textContent = \"„\";\n\t\t\tt1 = space();\n\t\t\tp0 = element(\"p\");\n\t\t\tt2 = text(/*copy*/ ctx[0]);\n\t\t\tt3 = space();\n\t\t\tdiv1 = element(\"div\");\n\t\t\timg0 = element(\"img\");\n\t\t\tt4 = space();\n\t\t\tdiv3 = element(\"div\");\n\t\t\th2 = element(\"h2\");\n\t\t\tt5 = text(/*reviewerName*/ ctx[1]);\n\t\t\tt6 = space();\n\t\t\tp1 = element(\"p\");\n\t\t\ta0 = element(\"a\");\n\t\t\timg1 = element(\"img\");\n\t\t\tt7 = space();\n\t\t\ta1 = element(\"a\");\n\t\t\tt8 = text(/*reviewerHandle*/ ctx[2]);\n\t\t\tattr(h1, \"class\", \"quote no-margin svelte-13kivrl\");\n\t\t\tattr(p0, \"class\", \"review-text\");\n\t\t\tattr(div0, \"class\", \"review flex-container flex-dir-col flex-center-items svelte-13kivrl\");\n\t\t\tif (!src_url_equal(img0.src, img0_src_value = /*testimonialPhotoUrl*/ ctx[3])) attr(img0, \"src\", img0_src_value);\n\t\t\tattr(img0, \"alt\", \"Reviewer\");\n\t\t\tattr(div1, \"class\", \"small-circle svelte-13kivrl\");\n\t\t\tattr(div2, \"class\", \"big-circle flex-container flex-dir-col flex-center-items svelte-13kivrl\");\n\t\t\tattr(h2, \"class\", \"no-margin svelte-13kivrl\");\n\t\t\tif (!src_url_equal(img1.src, img1_src_value = \"/img/ig.png\")) attr(img1, \"src\", img1_src_value);\n\t\t\tattr(img1, \"height\", \"25\");\n\t\t\tattr(img1, \"width\", \"25\");\n\t\t\tattr(img1, \"alt\", \"Instagram\");\n\t\t\tattr(a0, \"href\", a0_href_value = \"https://www.instagram.com/\" + /*reviewerHandle*/ ctx[2]);\n\t\t\tset_style(a0, \"vertical-align\", \"top\");\n\t\t\tattr(a0, \"target\", \"_blank\");\n\t\t\tattr(a0, \"class\", \"svelte-13kivrl\");\n\t\t\tattr(a1, \"href\", a1_href_value = \"https://www.instagram.com/\" + /*reviewerHandle*/ ctx[2]);\n\t\t\tattr(a1, \"class\", \"instagram-handle svelte-13kivrl\");\n\t\t\tattr(p1, \"class\", \"no-margin svelte-13kivrl\");\n\t\t\tattr(div3, \"class\", \"reviewer-info-container flex-container flex-dir-col flex-center-items svelte-13kivrl\");\n\t\t\tattr(div4, \"class\", \"review-container flex-container flex-dir-col flex-center-items svelte-13kivrl\");\n\t\t\tattr(div5, \"class\", \"testimonial flex-container flex-dir-col flex-center-items svelte-13kivrl\");\n\t\t},\n\t\tm(target, anchor) {\n\t\t\tinsert(target, div5, anchor);\n\t\t\tappend(div5, div4);\n\t\t\tappend(div4, div2);\n\t\t\tappend(div2, div0);\n\t\t\tappend(div0, h1);\n\t\t\tappend(div0, t1);\n\t\t\tappend(div0, p0);\n\t\t\tappend(p0, t2);\n\t\t\tappend(div2, t3);\n\t\t\tappend(div2, div1);\n\t\t\tappend(div1, img0);\n\t\t\tappend(div4, t4);\n\t\t\tappend(div4, div3);\n\t\t\tappend(div3, h2);\n\t\t\tappend(h2, t5);\n\t\t\tappend(div3, t6);\n\t\t\tappend(div3, p1);\n\t\t\tappend(p1, a0);\n\t\t\tappend(a0, img1);\n\t\t\tappend(p1, t7);\n\t\t\tappend(p1, a1);\n\t\t\tappend(a1, t8);\n\t\t},\n\t\tp(ctx, [dirty]) {\n\t\t\tif (dirty & /*copy*/ 1) set_data(t2, /*copy*/ ctx[0]);\n\n\t\t\tif (dirty & /*testimonialPhotoUrl*/ 8 && !src_url_equal(img0.src, img0_src_value = /*testimonialPhotoUrl*/ ctx[3])) {\n\t\t\t\tattr(img0, \"src\", img0_src_value);\n\t\t\t}\n\n\t\t\tif (dirty & /*reviewerName*/ 2) set_data(t5, /*reviewerName*/ ctx[1]);\n\n\t\t\tif (dirty & /*reviewerHandle*/ 4 && a0_href_value !== (a0_href_value = \"https://www.instagram.com/\" + /*reviewerHandle*/ ctx[2])) {\n\t\t\t\tattr(a0, \"href\", a0_href_value);\n\t\t\t}\n\n\t\t\tif (dirty & /*reviewerHandle*/ 4) set_data(t8, /*reviewerHandle*/ ctx[2]);\n\n\t\t\tif (dirty & /*reviewerHandle*/ 4 && a1_href_value !== (a1_href_value = \"https://www.instagram.com/\" + /*reviewerHandle*/ ctx[2])) {\n\t\t\t\tattr(a1, \"href\", a1_href_value);\n\t\t\t}\n\t\t},\n\t\ti: noop,\n\t\to: noop,\n\t\td(detaching) {\n\t\t\tif (detaching) detach(div5);\n\t\t}\n\t};\n}\n\nfunction instance($$self, $$props, $$invalidate) {\n\tlet { copy } = $$props;\n\tlet { reviewerName } = $$props;\n\tlet { reviewerHandle } = $$props;\n\tlet { testimonialPhotoUrl } = $$props;\n\n\t$$self.$$set = $$props => {\n\t\tif ('copy' in $$props) $$invalidate(0, copy = $$props.copy);\n\t\tif ('reviewerName' in $$props) $$invalidate(1, reviewerName = $$props.reviewerName);\n\t\tif ('reviewerHandle' in $$props) $$invalidate(2, reviewerHandle = $$props.reviewerHandle);\n\t\tif ('testimonialPhotoUrl' in $$props) $$invalidate(3, testimonialPhotoUrl = $$props.testimonialPhotoUrl);\n\t};\n\n\treturn [copy, reviewerName, reviewerHandle, testimonialPhotoUrl];\n}\n\nclass Testimonial extends SvelteComponent {\n\tconstructor(options) {\n\t\tsuper();\n\n\t\tinit(this, options, instance, create_fragment, safe_not_equal, {\n\t\t\tcopy: 0,\n\t\t\treviewerName: 1,\n\t\t\treviewerHandle: 2,\n\t\t\ttestimonialPhotoUrl: 3\n\t\t});\n\t}\n}\n\nexport default Testimonial;", "import './TestimonialCarousel.svelte.css';\n/* src/components/TestimonialCarousel.svelte generated by Svelte v3.59.2 */\nimport {\n\tSvelteComponent,\n\tappend,\n\tattr,\n\tcreate_component,\n\tdestroy_component,\n\tdetach,\n\telement,\n\tinit,\n\tinsert,\n\tmount_component,\n\tnoop,\n\tsafe_not_equal,\n\tspace,\n\ttransition_in,\n\ttransition_out\n} from \"../../_snowpack/pkg/svelte/internal.js\";\n\nimport Carousel from '../../_snowpack/pkg/svelte-carousel.js';\nimport Testimonial from './Testimonial.svelte.js';\n\nfunction create_default_slot(ctx) {\n\tlet testimonial0;\n\tlet t0;\n\tlet testimonial1;\n\tlet t1;\n\tlet testimonial2;\n\tlet t2;\n\tlet testimonial3;\n\tlet t3;\n\tlet testimonial4;\n\tlet t4;\n\tlet testimonial5;\n\tlet t5;\n\tlet testimonial6;\n\tlet t6;\n\tlet testimonial7;\n\tlet t7;\n\tlet testimonial8;\n\tlet current;\n\n\ttestimonial0 = new Testimonial({\n\t\t\tprops: {\n\t\t\t\tcopy: \"So happy with this cool #augmentedreality gift I got from mypetar.com. Dexter comes to life and we have great #memories of our #vacation with our #pet.\",\n\t\t\t\treviewerName: \"Dexter\",\n\t\t\t\treviewerHandle: \"thedexfiles\",\n\t\t\t\ttestimonialPhotoUrl: \"../img/reviews/DEXTER1.png\"\n\t\t\t}\n\t\t});\n\n\ttestimonial1 = new Testimonial({\n\t\t\tprops: {\n\t\t\t\tcopy: \"It’s fantastic!\",\n\t\t\t\treviewerName: \"Winky Bear\",\n\t\t\t\treviewerHandle: \"winkybear_the_rottie\",\n\t\t\t\ttestimonialPhotoUrl: \"../img/reviews/WINKY_BEAR1.png\"\n\t\t\t}\n\t\t});\n\n\ttestimonial2 = new Testimonial({\n\t\t\tprops: {\n\t\t\t\tcopy: \"It came out so cute! It is not just any ordinary picture. They use augmented reality to make the artwork come to life on your phone.\",\n\t\t\t\treviewerName: \"Chester\",\n\t\t\t\treviewerHandle: \"chesterthedutchie\",\n\t\t\t\ttestimonialPhotoUrl: \"../img/reviews/CHESTER1.png\"\n\t\t\t}\n\t\t});\n\n\ttestimonial3 = new Testimonial({\n\t\t\tprops: {\n\t\t\t\tcopy: \"Thank you @mypetar!! A little AR action that is - loving this!! Still need to get a frame, but smoking pro quality!\",\n\t\t\t\treviewerName: \"Reggie\",\n\t\t\t\treviewerHandle: \"reggiecataka\",\n\t\t\t\ttestimonialPhotoUrl: \"../img/reviews/REGGIE1.png\"\n\t\t\t}\n\t\t});\n\n\ttestimonial4 = new Testimonial({\n\t\t\tprops: {\n\t\t\t\tcopy: \"We just received an amazing art work! Sooo in love. Thanks so much @mypetar. Can’t wait to put it on my wall and show you guys.\",\n\t\t\t\treviewerName: \"Angel & Ava\",\n\t\t\t\treviewerHandle: \"the.pink.princesses\",\n\t\t\t\ttestimonialPhotoUrl: \"../img/reviews/THEPINK_PRINCESSES1.png\"\n\t\t\t}\n\t\t});\n\n\ttestimonial5 = new Testimonial({\n\t\t\tprops: {\n\t\t\t\tcopy: \"I love it! My husband and kiddos love it too! Thank you MyPetAR!\",\n\t\t\t\treviewerName: \"Munchie\",\n\t\t\t\treviewerHandle: \"mydear.munchie\",\n\t\t\t\ttestimonialPhotoUrl: \"../img/reviews/MUNCHIE1.png\"\n\t\t\t}\n\t\t});\n\n\ttestimonial6 = new Testimonial({\n\t\t\tprops: {\n\t\t\t\tcopy: \"Beautiful artwork! Make sure you check out their page!\",\n\t\t\t\treviewerName: \"Paris & Wish\",\n\t\t\t\treviewerHandle: \"sassycatparis\",\n\t\t\t\ttestimonialPhotoUrl: \"../img/reviews/PARIS&WISH1.png\"\n\t\t\t}\n\t\t});\n\n\ttestimonial7 = new Testimonial({\n\t\t\tprops: {\n\t\t\t\tcopy: \"It’s really cute! Very cool!\",\n\t\t\t\treviewerName: \"Stewie Bear\",\n\t\t\t\treviewerHandle: \"stewiethechewy\",\n\t\t\t\ttestimonialPhotoUrl: \"../img/reviews/STEWIE_BEAR1.png\"\n\t\t\t}\n\t\t});\n\n\ttestimonial8 = new Testimonial({\n\t\t\tprops: {\n\t\t\t\tcopy: \"Awesome artwork from MyPetAR! We love it! It’s a photo that comes to life with an augmented reality using your phone! We love our new photo!\",\n\t\t\t\treviewerName: \"Maple & Juniper\",\n\t\t\t\treviewerHandle: \"lop_and_retriever\",\n\t\t\t\ttestimonialPhotoUrl: \"../img/reviews/MAPLE_JUNIPER1.png\"\n\t\t\t}\n\t\t});\n\n\treturn {\n\t\tc() {\n\t\t\tcreate_component(testimonial0.$$.fragment);\n\t\t\tt0 = space();\n\t\t\tcreate_component(testimonial1.$$.fragment);\n\t\t\tt1 = space();\n\t\t\tcreate_component(testimonial2.$$.fragment);\n\t\t\tt2 = space();\n\t\t\tcreate_component(testimonial3.$$.fragment);\n\t\t\tt3 = space();\n\t\t\tcreate_component(testimonial4.$$.fragment);\n\t\t\tt4 = space();\n\t\t\tcreate_component(testimonial5.$$.fragment);\n\t\t\tt5 = space();\n\t\t\tcreate_component(testimonial6.$$.fragment);\n\t\t\tt6 = space();\n\t\t\tcreate_component(testimonial7.$$.fragment);\n\t\t\tt7 = space();\n\t\t\tcreate_component(testimonial8.$$.fragment);\n\t\t},\n\t\tm(target, anchor) {\n\t\t\tmount_component(testimonial0, target, anchor);\n\t\t\tinsert(target, t0, anchor);\n\t\t\tmount_component(testimonial1, target, anchor);\n\t\t\tinsert(target, t1, anchor);\n\t\t\tmount_component(testimonial2, target, anchor);\n\t\t\tinsert(target, t2, anchor);\n\t\t\tmount_component(testimonial3, target, anchor);\n\t\t\tinsert(target, t3, anchor);\n\t\t\tmount_component(testimonial4, target, anchor);\n\t\t\tinsert(target, t4, anchor);\n\t\t\tmount_component(testimonial5, target, anchor);\n\t\t\tinsert(target, t5, anchor);\n\t\t\tmount_component(testimonial6, target, anchor);\n\t\t\tinsert(target, t6, anchor);\n\t\t\tmount_component(testimonial7, target, anchor);\n\t\t\tinsert(target, t7, anchor);\n\t\t\tmount_component(testimonial8, target, anchor);\n\t\t\tcurrent = true;\n\t\t},\n\t\tp: noop,\n\t\ti(local) {\n\t\t\tif (current) return;\n\t\t\ttransition_in(testimonial0.$$.fragment, local);\n\t\t\ttransition_in(testimonial1.$$.fragment, local);\n\t\t\ttransition_in(testimonial2.$$.fragment, local);\n\t\t\ttransition_in(testimonial3.$$.fragment, local);\n\t\t\ttransition_in(testimonial4.$$.fragment, local);\n\t\t\ttransition_in(testimonial5.$$.fragment, local);\n\t\t\ttransition_in(testimonial6.$$.fragment, local);\n\t\t\ttransition_in(testimonial7.$$.fragment, local);\n\t\t\ttransition_in(testimonial8.$$.fragment, local);\n\t\t\tcurrent = true;\n\t\t},\n\t\to(local) {\n\t\t\ttransition_out(testimonial0.$$.fragment, local);\n\t\t\ttransition_out(testimonial1.$$.fragment, local);\n\t\t\ttransition_out(testimonial2.$$.fragment, local);\n\t\t\ttransition_out(testimonial3.$$.fragment, local);\n\t\t\ttransition_out(testimonial4.$$.fragment, local);\n\t\t\ttransition_out(testimonial5.$$.fragment, local);\n\t\t\ttransition_out(testimonial6.$$.fragment, local);\n\t\t\ttransition_out(testimonial7.$$.fragment, local);\n\t\t\ttransition_out(testimonial8.$$.fragment, local);\n\t\t\tcurrent = false;\n\t\t},\n\t\td(detaching) {\n\t\t\tdestroy_component(testimonial0, detaching);\n\t\t\tif (detaching) detach(t0);\n\t\t\tdestroy_component(testimonial1, detaching);\n\t\t\tif (detaching) detach(t1);\n\t\t\tdestroy_component(testimonial2, detaching);\n\t\t\tif (detaching) detach(t2);\n\t\t\tdestroy_component(testimonial3, detaching);\n\t\t\tif (detaching) detach(t3);\n\t\t\tdestroy_component(testimonial4, detaching);\n\t\t\tif (detaching) detach(t4);\n\t\t\tdestroy_component(testimonial5, detaching);\n\t\t\tif (detaching) detach(t5);\n\t\t\tdestroy_component(testimonial6, detaching);\n\t\t\tif (detaching) detach(t6);\n\t\t\tdestroy_component(testimonial7, detaching);\n\t\t\tif (detaching) detach(t7);\n\t\t\tdestroy_component(testimonial8, detaching);\n\t\t}\n\t};\n}\n\nfunction create_fragment(ctx) {\n\tlet div1;\n\tlet div0;\n\tlet carousel;\n\tlet current;\n\n\tcarousel = new Carousel({\n\t\t\tprops: {\n\t\t\t\t$$slots: { default: [create_default_slot] },\n\t\t\t\t$$scope: { ctx }\n\t\t\t}\n\t\t});\n\n\treturn {\n\t\tc() {\n\t\t\tdiv1 = element(\"div\");\n\t\t\tdiv0 = element(\"div\");\n\t\t\tcreate_component(carousel.$$.fragment);\n\t\t\tattr(div0, \"class\", \"carousel-container svelte-1oz0ru1\");\n\t\t\tattr(div1, \"class\", \"testimonial-carousel svelte-1oz0ru1\");\n\t\t},\n\t\tm(target, anchor) {\n\t\t\tinsert(target, div1, anchor);\n\t\t\tappend(div1, div0);\n\t\t\tmount_component(carousel, div0, null);\n\t\t\tcurrent = true;\n\t\t},\n\t\tp(ctx, [dirty]) {\n\t\t\tconst carousel_changes = {};\n\n\t\t\tif (dirty & /*$$scope*/ 1) {\n\t\t\t\tcarousel_changes.$$scope = { dirty, ctx };\n\t\t\t}\n\n\t\t\tcarousel.$set(carousel_changes);\n\t\t},\n\t\ti(local) {\n\t\t\tif (current) return;\n\t\t\ttransition_in(carousel.$$.fragment, local);\n\t\t\tcurrent = true;\n\t\t},\n\t\to(local) {\n\t\t\ttransition_out(carousel.$$.fragment, local);\n\t\t\tcurrent = false;\n\t\t},\n\t\td(detaching) {\n\t\t\tif (detaching) detach(div1);\n\t\t\tdestroy_component(carousel);\n\t\t}\n\t};\n}\n\nclass TestimonialCarousel extends SvelteComponent {\n\tconstructor(options) {\n\t\tsuper();\n\t\tinit(this, options, null, create_fragment, safe_not_equal, {});\n\t}\n}\n\nexport default TestimonialCarousel;", "import './Front.svelte.css';\n/* src/screens/Front.svelte generated by Svelte v3.59.2 */\nimport {\n\tSvelteComponent,\n\tcreate_component,\n\tdestroy_component,\n\tdetach,\n\tinit,\n\tinsert,\n\tmount_component,\n\tnoop,\n\tsafe_not_equal,\n\tspace,\n\ttransition_in,\n\ttransition_out\n} from \"../../_snowpack/pkg/svelte/internal.js\";\n\nimport Hero from \"../components/Hero.svelte.js\";\nimport NavBar from \"../components/NavBar.svelte.js\";\nimport Products from \"../components/Products.svelte.js\";\nimport About from \"../components/About.svelte.js\";\nimport Infomercial from \"../components/Infomercial.svelte.js\";\nimport FAQ from \"../components/FAQ.svelte.js\";\nimport Banner from \"../components/Banner.svelte.js\";\nimport BuyNow from \"../components/BuyNow.svelte.js\";\nimport ContactUs from \"../components/ContactUs.svelte.js\";\nimport Footer from \"../components/Footer.svelte.js\";\nimport TestimonialCarousel from \"../components/TestimonialCarousel.svelte.js\";\n\nfunction create_fragment(ctx) {\n\tlet navbar;\n\tlet t0;\n\tlet hero;\n\tlet t1;\n\tlet products;\n\tlet t2;\n\tlet about;\n\tlet t3;\n\tlet infomercial;\n\tlet t4;\n\tlet banner;\n\tlet t5;\n\tlet buynow;\n\tlet t6;\n\tlet testimonialcarousel;\n\tlet t7;\n\tlet faq;\n\tlet t8;\n\tlet contactus;\n\tlet t9;\n\tlet footer;\n\tlet current;\n\tnavbar = new NavBar({});\n\thero = new Hero({});\n\tproducts = new Products({});\n\tabout = new About({});\n\tinfomercial = new Infomercial({});\n\tbanner = new Banner({});\n\tbuynow = new BuyNow({});\n\ttestimonialcarousel = new TestimonialCarousel({});\n\tfaq = new FAQ({});\n\tcontactus = new ContactUs({});\n\tfooter = new Footer({});\n\n\treturn {\n\t\tc() {\n\t\t\tcreate_component(navbar.$$.fragment);\n\t\t\tt0 = space();\n\t\t\tcreate_component(hero.$$.fragment);\n\t\t\tt1 = space();\n\t\t\tcreate_component(products.$$.fragment);\n\t\t\tt2 = space();\n\t\t\tcreate_component(about.$$.fragment);\n\t\t\tt3 = space();\n\t\t\tcreate_component(infomercial.$$.fragment);\n\t\t\tt4 = space();\n\t\t\tcreate_component(banner.$$.fragment);\n\t\t\tt5 = space();\n\t\t\tcreate_component(buynow.$$.fragment);\n\t\t\tt6 = space();\n\t\t\tcreate_component(testimonialcarousel.$$.fragment);\n\t\t\tt7 = space();\n\t\t\tcreate_component(faq.$$.fragment);\n\t\t\tt8 = space();\n\t\t\tcreate_component(contactus.$$.fragment);\n\t\t\tt9 = space();\n\t\t\tcreate_component(footer.$$.fragment);\n\t\t},\n\t\tm(target, anchor) {\n\t\t\tmount_component(navbar, target, anchor);\n\t\t\tinsert(target, t0, anchor);\n\t\t\tmount_component(hero, target, anchor);\n\t\t\tinsert(target, t1, anchor);\n\t\t\tmount_component(products, target, anchor);\n\t\t\tinsert(target, t2, anchor);\n\t\t\tmount_component(about, target, anchor);\n\t\t\tinsert(target, t3, anchor);\n\t\t\tmount_component(infomercial, target, anchor);\n\t\t\tinsert(target, t4, anchor);\n\t\t\tmount_component(banner, target, anchor);\n\t\t\tinsert(target, t5, anchor);\n\t\t\tmount_component(buynow, target, anchor);\n\t\t\tinsert(target, t6, anchor);\n\t\t\tmount_component(testimonialcarousel, target, anchor);\n\t\t\tinsert(target, t7, anchor);\n\t\t\tmount_component(faq, target, anchor);\n\t\t\tinsert(target, t8, anchor);\n\t\t\tmount_component(contactus, target, anchor);\n\t\t\tinsert(target, t9, anchor);\n\t\t\tmount_component(footer, target, anchor);\n\t\t\tcurrent = true;\n\t\t},\n\t\tp: noop,\n\t\ti(local) {\n\t\t\tif (current) return;\n\t\t\ttransition_in(navbar.$$.fragment, local);\n\t\t\ttransition_in(hero.$$.fragment, local);\n\t\t\ttransition_in(products.$$.fragment, local);\n\t\t\ttransition_in(about.$$.fragment, local);\n\t\t\ttransition_in(infomercial.$$.fragment, local);\n\t\t\ttransition_in(banner.$$.fragment, local);\n\t\t\ttransition_in(buynow.$$.fragment, local);\n\t\t\ttransition_in(testimonialcarousel.$$.fragment, local);\n\t\t\ttransition_in(faq.$$.fragment, local);\n\t\t\ttransition_in(contactus.$$.fragment, local);\n\t\t\ttransition_in(footer.$$.fragment, local);\n\t\t\tcurrent = true;\n\t\t},\n\t\to(local) {\n\t\t\ttransition_out(navbar.$$.fragment, local);\n\t\t\ttransition_out(hero.$$.fragment, local);\n\t\t\ttransition_out(products.$$.fragment, local);\n\t\t\ttransition_out(about.$$.fragment, local);\n\t\t\ttransition_out(infomercial.$$.fragment, local);\n\t\t\ttransition_out(banner.$$.fragment, local);\n\t\t\ttransition_out(buynow.$$.fragment, local);\n\t\t\ttransition_out(testimonialcarousel.$$.fragment, local);\n\t\t\ttransition_out(faq.$$.fragment, local);\n\t\t\ttransition_out(contactus.$$.fragment, local);\n\t\t\ttransition_out(footer.$$.fragment, local);\n\t\t\tcurrent = false;\n\t\t},\n\t\td(detaching) {\n\t\t\tdestroy_component(navbar, detaching);\n\t\t\tif (detaching) detach(t0);\n\t\t\tdestroy_component(hero, detaching);\n\t\t\tif (detaching) detach(t1);\n\t\t\tdestroy_component(products, detaching);\n\t\t\tif (detaching) detach(t2);\n\t\t\tdestroy_component(about, detaching);\n\t\t\tif (detaching) detach(t3);\n\t\t\tdestroy_component(infomercial, detaching);\n\t\t\tif (detaching) detach(t4);\n\t\t\tdestroy_component(banner, detaching);\n\t\t\tif (detaching) detach(t5);\n\t\t\tdestroy_component(buynow, detaching);\n\t\t\tif (detaching) detach(t6);\n\t\t\tdestroy_component(testimonialcarousel, detaching);\n\t\t\tif (detaching) detach(t7);\n\t\t\tdestroy_component(faq, detaching);\n\t\t\tif (detaching) detach(t8);\n\t\t\tdestroy_component(contactus, detaching);\n\t\t\tif (detaching) detach(t9);\n\t\t\tdestroy_component(footer, detaching);\n\t\t}\n\t};\n}\n\nclass Front extends SvelteComponent {\n\tconstructor(options) {\n\t\tsuper();\n\t\tinit(this, options, null, create_fragment, safe_not_equal, {});\n\t}\n}\n\nexport default Front;", "var HttpAuthLocation;\n(function (HttpAuthLocation) {\n    HttpAuthLocation[\"HEADER\"] = \"header\";\n    HttpAuthLocation[\"QUERY\"] = \"query\";\n})(HttpAuthLocation || (HttpAuthLocation = {}));\n\nvar EndpointURLScheme;\n(function (EndpointURLScheme) {\n    EndpointURLScheme[\"HTTP\"] = \"http\";\n    EndpointURLScheme[\"HTTPS\"] = \"https\";\n})(EndpointURLScheme || (EndpointURLScheme = {}));\n\nvar FieldPosition;\n(function (FieldPosition) {\n    FieldPosition[FieldPosition[\"HEADER\"] = 0] = \"HEADER\";\n    FieldPosition[FieldPosition[\"TRAILER\"] = 1] = \"TRAILER\";\n})(FieldPosition || (FieldPosition = {}));\n\nvar RequestHandlerProtocol;\n(function (RequestHandlerProtocol) {\n    RequestHandlerProtocol[\"HTTP_0_9\"] = \"http/0.9\";\n    RequestHandlerProtocol[\"HTTP_1_0\"] = \"http/1.0\";\n    RequestHandlerProtocol[\"TDS_8_0\"] = \"tds/8.0\";\n})(RequestHandlerProtocol || (RequestHandlerProtocol = {}));\n\nclass HttpRequest {\n    constructor(options) {\n        this.method = options.method || \"GET\";\n        this.hostname = options.hostname || \"localhost\";\n        this.port = options.port;\n        this.query = options.query || {};\n        this.headers = options.headers || {};\n        this.body = options.body;\n        this.protocol = options.protocol\n            ? options.protocol.slice(-1) !== \":\"\n                ? `${options.protocol}:`\n                : options.protocol\n            : \"https:\";\n        this.path = options.path ? (options.path.charAt(0) !== \"/\" ? `/${options.path}` : options.path) : \"/\";\n        this.username = options.username;\n        this.password = options.password;\n        this.fragment = options.fragment;\n    }\n    static isInstance(request) {\n        if (!request)\n            return false;\n        const req = request;\n        return (\"method\" in req &&\n            \"protocol\" in req &&\n            \"hostname\" in req &&\n            \"path\" in req &&\n            typeof req[\"query\"] === \"object\" &&\n            typeof req[\"headers\"] === \"object\");\n    }\n    clone() {\n        const cloned = new HttpRequest({\n            ...this,\n            headers: { ...this.headers },\n        });\n        if (cloned.query)\n            cloned.query = cloneQuery(cloned.query);\n        return cloned;\n    }\n}\nfunction cloneQuery(query) {\n    return Object.keys(query).reduce((carry, paramName) => {\n        const param = query[paramName];\n        return {\n            ...carry,\n            [paramName]: Array.isArray(param) ? [...param] : param,\n        };\n    }, {});\n}\n\nconst SHORT_TO_HEX = {};\nconst HEX_TO_SHORT = {};\nfor (let i = 0; i < 256; i++) {\n    let encodedByte = i.toString(16).toLowerCase();\n    if (encodedByte.length === 1) {\n        encodedByte = `0${encodedByte}`;\n    }\n    SHORT_TO_HEX[i] = encodedByte;\n    HEX_TO_SHORT[encodedByte] = i;\n}\nfunction fromHex(encoded) {\n    if (encoded.length % 2 !== 0) {\n        throw new Error(\"Hex encoded strings must have an even number length\");\n    }\n    const out = new Uint8Array(encoded.length / 2);\n    for (let i = 0; i < encoded.length; i += 2) {\n        const encodedByte = encoded.slice(i, i + 2).toLowerCase();\n        if (encodedByte in HEX_TO_SHORT) {\n            out[i / 2] = HEX_TO_SHORT[encodedByte];\n        }\n        else {\n            throw new Error(`Cannot decode unrecognized sequence ${encodedByte} as hexadecimal`);\n        }\n    }\n    return out;\n}\nfunction toHex(bytes) {\n    let out = \"\";\n    for (let i = 0; i < bytes.byteLength; i++) {\n        out += SHORT_TO_HEX[bytes[i]];\n    }\n    return out;\n}\n\nconst fromUtf8 = (input) => new TextEncoder().encode(input);\n\nconst toUtf8 = (input) => new TextDecoder(\"utf-8\").decode(input);\n\nconst constructStack = () => {\n    let absoluteEntries = [];\n    let relativeEntries = [];\n    const entriesNameSet = new Set();\n    const sort = (entries) => entries.sort((a, b) => stepWeights[b.step] - stepWeights[a.step] ||\n        priorityWeights[b.priority || \"normal\"] - priorityWeights[a.priority || \"normal\"]);\n    const removeByName = (toRemove) => {\n        let isRemoved = false;\n        const filterCb = (entry) => {\n            if (entry.name && entry.name === toRemove) {\n                isRemoved = true;\n                entriesNameSet.delete(toRemove);\n                return false;\n            }\n            return true;\n        };\n        absoluteEntries = absoluteEntries.filter(filterCb);\n        relativeEntries = relativeEntries.filter(filterCb);\n        return isRemoved;\n    };\n    const removeByReference = (toRemove) => {\n        let isRemoved = false;\n        const filterCb = (entry) => {\n            if (entry.middleware === toRemove) {\n                isRemoved = true;\n                if (entry.name)\n                    entriesNameSet.delete(entry.name);\n                return false;\n            }\n            return true;\n        };\n        absoluteEntries = absoluteEntries.filter(filterCb);\n        relativeEntries = relativeEntries.filter(filterCb);\n        return isRemoved;\n    };\n    const cloneTo = (toStack) => {\n        absoluteEntries.forEach((entry) => {\n            toStack.add(entry.middleware, { ...entry });\n        });\n        relativeEntries.forEach((entry) => {\n            toStack.addRelativeTo(entry.middleware, { ...entry });\n        });\n        return toStack;\n    };\n    const expandRelativeMiddlewareList = (from) => {\n        const expandedMiddlewareList = [];\n        from.before.forEach((entry) => {\n            if (entry.before.length === 0 && entry.after.length === 0) {\n                expandedMiddlewareList.push(entry);\n            }\n            else {\n                expandedMiddlewareList.push(...expandRelativeMiddlewareList(entry));\n            }\n        });\n        expandedMiddlewareList.push(from);\n        from.after.reverse().forEach((entry) => {\n            if (entry.before.length === 0 && entry.after.length === 0) {\n                expandedMiddlewareList.push(entry);\n            }\n            else {\n                expandedMiddlewareList.push(...expandRelativeMiddlewareList(entry));\n            }\n        });\n        return expandedMiddlewareList;\n    };\n    const getMiddlewareList = (debug = false) => {\n        const normalizedAbsoluteEntries = [];\n        const normalizedRelativeEntries = [];\n        const normalizedEntriesNameMap = {};\n        absoluteEntries.forEach((entry) => {\n            const normalizedEntry = {\n                ...entry,\n                before: [],\n                after: [],\n            };\n            if (normalizedEntry.name)\n                normalizedEntriesNameMap[normalizedEntry.name] = normalizedEntry;\n            normalizedAbsoluteEntries.push(normalizedEntry);\n        });\n        relativeEntries.forEach((entry) => {\n            const normalizedEntry = {\n                ...entry,\n                before: [],\n                after: [],\n            };\n            if (normalizedEntry.name)\n                normalizedEntriesNameMap[normalizedEntry.name] = normalizedEntry;\n            normalizedRelativeEntries.push(normalizedEntry);\n        });\n        normalizedRelativeEntries.forEach((entry) => {\n            if (entry.toMiddleware) {\n                const toMiddleware = normalizedEntriesNameMap[entry.toMiddleware];\n                if (toMiddleware === undefined) {\n                    if (debug) {\n                        return;\n                    }\n                    throw new Error(`${entry.toMiddleware} is not found when adding ${entry.name || \"anonymous\"} middleware ${entry.relation} ${entry.toMiddleware}`);\n                }\n                if (entry.relation === \"after\") {\n                    toMiddleware.after.push(entry);\n                }\n                if (entry.relation === \"before\") {\n                    toMiddleware.before.push(entry);\n                }\n            }\n        });\n        const mainChain = sort(normalizedAbsoluteEntries)\n            .map(expandRelativeMiddlewareList)\n            .reduce((wholeList, expandedMiddlewareList) => {\n            wholeList.push(...expandedMiddlewareList);\n            return wholeList;\n        }, []);\n        return mainChain;\n    };\n    const stack = {\n        add: (middleware, options = {}) => {\n            const { name, override } = options;\n            const entry = {\n                step: \"initialize\",\n                priority: \"normal\",\n                middleware,\n                ...options,\n            };\n            if (name) {\n                if (entriesNameSet.has(name)) {\n                    if (!override)\n                        throw new Error(`Duplicate middleware name '${name}'`);\n                    const toOverrideIndex = absoluteEntries.findIndex((entry) => entry.name === name);\n                    const toOverride = absoluteEntries[toOverrideIndex];\n                    if (toOverride.step !== entry.step || toOverride.priority !== entry.priority) {\n                        throw new Error(`\"${name}\" middleware with ${toOverride.priority} priority in ${toOverride.step} step cannot be ` +\n                            `overridden by same-name middleware with ${entry.priority} priority in ${entry.step} step.`);\n                    }\n                    absoluteEntries.splice(toOverrideIndex, 1);\n                }\n                entriesNameSet.add(name);\n            }\n            absoluteEntries.push(entry);\n        },\n        addRelativeTo: (middleware, options) => {\n            const { name, override } = options;\n            const entry = {\n                middleware,\n                ...options,\n            };\n            if (name) {\n                if (entriesNameSet.has(name)) {\n                    if (!override)\n                        throw new Error(`Duplicate middleware name '${name}'`);\n                    const toOverrideIndex = relativeEntries.findIndex((entry) => entry.name === name);\n                    const toOverride = relativeEntries[toOverrideIndex];\n                    if (toOverride.toMiddleware !== entry.toMiddleware || toOverride.relation !== entry.relation) {\n                        throw new Error(`\"${name}\" middleware ${toOverride.relation} \"${toOverride.toMiddleware}\" middleware cannot be overridden ` +\n                            `by same-name middleware ${entry.relation} \"${entry.toMiddleware}\" middleware.`);\n                    }\n                    relativeEntries.splice(toOverrideIndex, 1);\n                }\n                entriesNameSet.add(name);\n            }\n            relativeEntries.push(entry);\n        },\n        clone: () => cloneTo(constructStack()),\n        use: (plugin) => {\n            plugin.applyToStack(stack);\n        },\n        remove: (toRemove) => {\n            if (typeof toRemove === \"string\")\n                return removeByName(toRemove);\n            else\n                return removeByReference(toRemove);\n        },\n        removeByTag: (toRemove) => {\n            let isRemoved = false;\n            const filterCb = (entry) => {\n                const { tags, name } = entry;\n                if (tags && tags.includes(toRemove)) {\n                    if (name)\n                        entriesNameSet.delete(name);\n                    isRemoved = true;\n                    return false;\n                }\n                return true;\n            };\n            absoluteEntries = absoluteEntries.filter(filterCb);\n            relativeEntries = relativeEntries.filter(filterCb);\n            return isRemoved;\n        },\n        concat: (from) => {\n            const cloned = cloneTo(constructStack());\n            cloned.use(from);\n            return cloned;\n        },\n        applyToStack: cloneTo,\n        identify: () => {\n            return getMiddlewareList(true).map((mw) => {\n                return mw.name + \": \" + (mw.tags || []).join(\",\");\n            });\n        },\n        resolve: (handler, context) => {\n            for (const middleware of getMiddlewareList()\n                .map((entry) => entry.middleware)\n                .reverse()) {\n                handler = middleware(handler, context);\n            }\n            return handler;\n        },\n    };\n    return stack;\n};\nconst stepWeights = {\n    initialize: 5,\n    serialize: 4,\n    build: 3,\n    finalizeRequest: 2,\n    deserialize: 1,\n};\nconst priorityWeights = {\n    high: 3,\n    normal: 2,\n    low: 1,\n};\n\nconst alphabetByEncoding = {};\nconst alphabetByValue = new Array(64);\nfor (let i = 0, start = \"A\".charCodeAt(0), limit = \"Z\".charCodeAt(0); i + start <= limit; i++) {\n    const char = String.fromCharCode(i + start);\n    alphabetByEncoding[char] = i;\n    alphabetByValue[i] = char;\n}\nfor (let i = 0, start = \"a\".charCodeAt(0), limit = \"z\".charCodeAt(0); i + start <= limit; i++) {\n    const char = String.fromCharCode(i + start);\n    const index = i + 26;\n    alphabetByEncoding[char] = index;\n    alphabetByValue[index] = char;\n}\nfor (let i = 0; i < 10; i++) {\n    alphabetByEncoding[i.toString(10)] = i + 52;\n    const char = i.toString(10);\n    const index = i + 52;\n    alphabetByEncoding[char] = index;\n    alphabetByValue[index] = char;\n}\nalphabetByEncoding[\"+\"] = 62;\nalphabetByValue[62] = \"+\";\nalphabetByEncoding[\"/\"] = 63;\nalphabetByValue[63] = \"/\";\nconst bitsPerLetter = 6;\nconst bitsPerByte = 8;\nconst maxLetterValue = 0b111111;\n\nconst fromBase64 = (input) => {\n    let totalByteLength = (input.length / 4) * 3;\n    if (input.slice(-2) === \"==\") {\n        totalByteLength -= 2;\n    }\n    else if (input.slice(-1) === \"=\") {\n        totalByteLength--;\n    }\n    const out = new ArrayBuffer(totalByteLength);\n    const dataView = new DataView(out);\n    for (let i = 0; i < input.length; i += 4) {\n        let bits = 0;\n        let bitLength = 0;\n        for (let j = i, limit = i + 3; j <= limit; j++) {\n            if (input[j] !== \"=\") {\n                if (!(input[j] in alphabetByEncoding)) {\n                    throw new TypeError(`Invalid character ${input[j]} in base64 string.`);\n                }\n                bits |= alphabetByEncoding[input[j]] << ((limit - j) * bitsPerLetter);\n                bitLength += bitsPerLetter;\n            }\n            else {\n                bits >>= bitsPerLetter;\n            }\n        }\n        const chunkOffset = (i / 4) * 3;\n        bits >>= bitLength % bitsPerByte;\n        const byteLength = Math.floor(bitLength / bitsPerByte);\n        for (let k = 0; k < byteLength; k++) {\n            const offset = (byteLength - k - 1) * bitsPerByte;\n            dataView.setUint8(chunkOffset + k, (bits & (255 << offset)) >> offset);\n        }\n    }\n    return new Uint8Array(out);\n};\n\nfunction toBase64(input) {\n    let str = \"\";\n    for (let i = 0; i < input.length; i += 3) {\n        let bits = 0;\n        let bitLength = 0;\n        for (let j = i, limit = Math.min(i + 3, input.length); j < limit; j++) {\n            bits |= input[j] << ((limit - j - 1) * bitsPerByte);\n            bitLength += bitsPerByte;\n        }\n        const bitClusterCount = Math.ceil(bitLength / bitsPerLetter);\n        bits <<= bitClusterCount * bitsPerLetter - bitLength;\n        for (let k = 1; k <= bitClusterCount; k++) {\n            const offset = (bitClusterCount - k) * bitsPerLetter;\n            str += alphabetByValue[(bits & (maxLetterValue << offset)) >> offset];\n        }\n        str += \"==\".slice(0, 4 - bitClusterCount);\n    }\n    return str;\n}\n\nconst StringWrapper = function () {\n    const Class = Object.getPrototypeOf(this).constructor;\n    const Constructor = Function.bind.apply(String, [null, ...arguments]);\n    const instance = new Constructor();\n    Object.setPrototypeOf(instance, Class.prototype);\n    return instance;\n};\nStringWrapper.prototype = Object.create(String.prototype, {\n    constructor: {\n        value: StringWrapper,\n        enumerable: false,\n        writable: true,\n        configurable: true,\n    },\n});\nObject.setPrototypeOf(StringWrapper, String);\n\nexport { EndpointURLScheme as E, HttpRequest as H, fromUtf8 as a, toUtf8 as b, toHex as c, fromHex as d, constructStack as e, fromBase64 as f, toBase64 as t };\n", "// Unique ID creation requires a high quality random # generator. In the browser we therefore\n// require the crypto API and do not support built-in fallback to lower quality random number\n// generators (like Math.random()).\nvar getRandomValues;\nvar rnds8 = new Uint8Array(16);\nfunction rng() {\n  // lazy load so that environments that need to polyfill have a chance to do so\n  if (!getRandomValues) {\n    // getRandomValues needs to be invoked in a context where \"this\" is a Crypto implementation. Also,\n    // find the complete implementation of crypto (msCrypto) on IE11.\n    getRandomValues = typeof crypto !== 'undefined' && crypto.getRandomValues && crypto.getRandomValues.bind(crypto) || typeof msCrypto !== 'undefined' && typeof msCrypto.getRandomValues === 'function' && msCrypto.getRandomValues.bind(msCrypto);\n\n    if (!getRandomValues) {\n      throw new Error('crypto.getRandomValues() not supported. See https://github.com/uuidjs/uuid#getrandomvalues-not-supported');\n    }\n  }\n\n  return getRandomValues(rnds8);\n}\n\nvar REGEX = /^(?:[0-9a-f]{8}-[0-9a-f]{4}-[1-5][0-9a-f]{3}-[89ab][0-9a-f]{3}-[0-9a-f]{12}|00000000-0000-0000-0000-000000000000)$/i;\n\nfunction validate(uuid) {\n  return typeof uuid === 'string' && REGEX.test(uuid);\n}\n\n/**\n * Convert array of 16 byte values to UUID string format of the form:\n * XXXXXXXX-XXXX-XXXX-XXXX-XXXXXXXXXXXX\n */\n\nvar byteToHex = [];\n\nfor (var i = 0; i < 256; ++i) {\n  byteToHex.push((i + 0x100).toString(16).substr(1));\n}\n\nfunction stringify(arr) {\n  var offset = arguments.length > 1 && arguments[1] !== undefined ? arguments[1] : 0;\n  // Note: Be careful editing this code!  It's been tuned for performance\n  // and works in ways you may not expect. See https://github.com/uuidjs/uuid/pull/434\n  var uuid = (byteToHex[arr[offset + 0]] + byteToHex[arr[offset + 1]] + byteToHex[arr[offset + 2]] + byteToHex[arr[offset + 3]] + '-' + byteToHex[arr[offset + 4]] + byteToHex[arr[offset + 5]] + '-' + byteToHex[arr[offset + 6]] + byteToHex[arr[offset + 7]] + '-' + byteToHex[arr[offset + 8]] + byteToHex[arr[offset + 9]] + '-' + byteToHex[arr[offset + 10]] + byteToHex[arr[offset + 11]] + byteToHex[arr[offset + 12]] + byteToHex[arr[offset + 13]] + byteToHex[arr[offset + 14]] + byteToHex[arr[offset + 15]]).toLowerCase(); // Consistency check for valid UUID.  If this throws, it's likely due to one\n  // of the following:\n  // - One or more input array values don't map to a hex octet (leading to\n  // \"undefined\" in the uuid)\n  // - Invalid input values for the RFC `version` or `variant` fields\n\n  if (!validate(uuid)) {\n    throw TypeError('Stringified UUID is invalid');\n  }\n\n  return uuid;\n}\n\nfunction v4(options, buf, offset) {\n  options = options || {};\n  var rnds = options.random || (options.rng || rng)(); // Per 4.4, set bits for version and `clock_seq_hi_and_reserved`\n\n  rnds[6] = rnds[6] & 0x0f | 0x40;\n  rnds[8] = rnds[8] & 0x3f | 0x80; // Copy bytes to buffer, if provided\n\n  if (buf) {\n    offset = offset || 0;\n\n    for (var i = 0; i < 16; ++i) {\n      buf[offset + i] = rnds[i];\n    }\n\n    return buf;\n  }\n\n  return stringify(rnds);\n}\n\nexport { v4 as v };\n", "import { H as HttpRequest, c as toHex, d as fromHex, a as fromUtf8$3, b as toUtf8$3, E as EndpointURLScheme, e as constructStack, f as fromBase64 } from './lazy-json-f4438c0b.js';\nimport { c as createCommonjsModule } from './_commonjsHelpers-eb5a497e.js';\nimport { v as v4 } from './v4-c5ee5148.js';\n\nclass HttpResponse {\n    constructor(options) {\n        this.statusCode = options.statusCode;\n        this.reason = options.reason;\n        this.headers = options.headers || {};\n        this.body = options.body;\n    }\n    static isInstance(response) {\n        if (!response)\n            return false;\n        const resp = response;\n        return typeof resp.statusCode === \"number\" && typeof resp.headers === \"object\";\n    }\n}\n\nfunction resolveHostHeaderConfig(input) {\n    return input;\n}\nconst hostHeaderMiddleware = (options) => (next) => async (args) => {\n    if (!HttpRequest.isInstance(args.request))\n        return next(args);\n    const { request } = args;\n    const { handlerProtocol = \"\" } = options.requestHandler.metadata || {};\n    if (handlerProtocol.indexOf(\"h2\") >= 0 && !request.headers[\":authority\"]) {\n        delete request.headers[\"host\"];\n        request.headers[\":authority\"] = \"\";\n    }\n    else if (!request.headers[\"host\"]) {\n        let host = request.hostname;\n        if (request.port != null)\n            host += `:${request.port}`;\n        request.headers[\"host\"] = host;\n    }\n    return next(args);\n};\nconst hostHeaderMiddlewareOptions = {\n    name: \"hostHeaderMiddleware\",\n    step: \"build\",\n    priority: \"low\",\n    tags: [\"HOST\"],\n    override: true,\n};\nconst getHostHeaderPlugin = (options) => ({\n    applyToStack: (clientStack) => {\n        clientStack.add(hostHeaderMiddleware(options), hostHeaderMiddlewareOptions);\n    },\n});\n\nconst loggerMiddleware = () => (next, context) => async (args) => {\n    try {\n        const response = await next(args);\n        const { clientName, commandName, logger, dynamoDbDocumentClientOptions = {} } = context;\n        const { overrideInputFilterSensitiveLog, overrideOutputFilterSensitiveLog } = dynamoDbDocumentClientOptions;\n        const inputFilterSensitiveLog = overrideInputFilterSensitiveLog ?? context.inputFilterSensitiveLog;\n        const outputFilterSensitiveLog = overrideOutputFilterSensitiveLog ?? context.outputFilterSensitiveLog;\n        const { $metadata, ...outputWithoutMetadata } = response.output;\n        logger?.info?.({\n            clientName,\n            commandName,\n            input: inputFilterSensitiveLog(args.input),\n            output: outputFilterSensitiveLog(outputWithoutMetadata),\n            metadata: $metadata,\n        });\n        return response;\n    }\n    catch (error) {\n        const { clientName, commandName, logger, dynamoDbDocumentClientOptions = {} } = context;\n        const { overrideInputFilterSensitiveLog } = dynamoDbDocumentClientOptions;\n        const inputFilterSensitiveLog = overrideInputFilterSensitiveLog ?? context.inputFilterSensitiveLog;\n        logger?.error?.({\n            clientName,\n            commandName,\n            input: inputFilterSensitiveLog(args.input),\n            error,\n            metadata: error.$metadata,\n        });\n        throw error;\n    }\n};\nconst loggerMiddlewareOptions = {\n    name: \"loggerMiddleware\",\n    tags: [\"LOGGER\"],\n    step: \"initialize\",\n    override: true,\n};\nconst getLoggerPlugin = (options) => ({\n    applyToStack: (clientStack) => {\n        clientStack.add(loggerMiddleware(), loggerMiddlewareOptions);\n    },\n});\n\n/* SNOWPACK PROCESS POLYFILL (based on https://github.com/calvinmetcalf/node-process-es6) */\nfunction defaultSetTimout() {\n    throw new Error('setTimeout has not been defined');\n}\nfunction defaultClearTimeout () {\n    throw new Error('clearTimeout has not been defined');\n}\nvar cachedSetTimeout = defaultSetTimout;\nvar cachedClearTimeout = defaultClearTimeout;\nvar globalContext;\nif (typeof window !== 'undefined') {\n    globalContext = window;\n} else if (typeof self !== 'undefined') {\n    globalContext = self;\n} else {\n    globalContext = {};\n}\nif (typeof globalContext.setTimeout === 'function') {\n    cachedSetTimeout = setTimeout;\n}\nif (typeof globalContext.clearTimeout === 'function') {\n    cachedClearTimeout = clearTimeout;\n}\n\nfunction runTimeout(fun) {\n    if (cachedSetTimeout === setTimeout) {\n        //normal enviroments in sane situations\n        return setTimeout(fun, 0);\n    }\n    // if setTimeout wasn't available but was latter defined\n    if ((cachedSetTimeout === defaultSetTimout || !cachedSetTimeout) && setTimeout) {\n        cachedSetTimeout = setTimeout;\n        return setTimeout(fun, 0);\n    }\n    try {\n        // when when somebody has screwed with setTimeout but no I.E. maddness\n        return cachedSetTimeout(fun, 0);\n    } catch(e){\n        try {\n            // When we are in I.E. but the script has been evaled so I.E. doesn't trust the global object when called normally\n            return cachedSetTimeout.call(null, fun, 0);\n        } catch(e){\n            // same as above but when it's a version of I.E. that must have the global object for 'this', hopfully our context correct otherwise it will throw a global error\n            return cachedSetTimeout.call(this, fun, 0);\n        }\n    }\n\n\n}\nfunction runClearTimeout(marker) {\n    if (cachedClearTimeout === clearTimeout) {\n        //normal enviroments in sane situations\n        return clearTimeout(marker);\n    }\n    // if clearTimeout wasn't available but was latter defined\n    if ((cachedClearTimeout === defaultClearTimeout || !cachedClearTimeout) && clearTimeout) {\n        cachedClearTimeout = clearTimeout;\n        return clearTimeout(marker);\n    }\n    try {\n        // when when somebody has screwed with setTimeout but no I.E. maddness\n        return cachedClearTimeout(marker);\n    } catch (e){\n        try {\n            // When we are in I.E. but the script has been evaled so I.E. doesn't  trust the global object when called normally\n            return cachedClearTimeout.call(null, marker);\n        } catch (e){\n            // same as above but when it's a version of I.E. that must have the global object for 'this', hopfully our context correct otherwise it will throw a global error.\n            // Some versions of I.E. have different rules for clearTimeout vs setTimeout\n            return cachedClearTimeout.call(this, marker);\n        }\n    }\n\n\n\n}\nvar queue = [];\nvar draining = false;\nvar currentQueue;\nvar queueIndex = -1;\n\nfunction cleanUpNextTick() {\n    if (!draining || !currentQueue) {\n        return;\n    }\n    draining = false;\n    if (currentQueue.length) {\n        queue = currentQueue.concat(queue);\n    } else {\n        queueIndex = -1;\n    }\n    if (queue.length) {\n        drainQueue();\n    }\n}\n\nfunction drainQueue() {\n    if (draining) {\n        return;\n    }\n    var timeout = runTimeout(cleanUpNextTick);\n    draining = true;\n\n    var len = queue.length;\n    while(len) {\n        currentQueue = queue;\n        queue = [];\n        while (++queueIndex < len) {\n            if (currentQueue) {\n                currentQueue[queueIndex].run();\n            }\n        }\n        queueIndex = -1;\n        len = queue.length;\n    }\n    currentQueue = null;\n    draining = false;\n    runClearTimeout(timeout);\n}\nfunction nextTick(fun) {\n    var args = new Array(arguments.length - 1);\n    if (arguments.length > 1) {\n        for (var i = 1; i < arguments.length; i++) {\n            args[i - 1] = arguments[i];\n        }\n    }\n    queue.push(new Item(fun, args));\n    if (queue.length === 1 && !draining) {\n        runTimeout(drainQueue);\n    }\n}\n// v8 likes predictible objects\nfunction Item(fun, array) {\n    this.fun = fun;\n    this.array = array;\n}\nItem.prototype.run = function () {\n    this.fun.apply(null, this.array);\n};\nvar title = 'browser';\nvar platform = 'browser';\nvar browser = true;\nvar argv = [];\nvar version = ''; // empty string to avoid regexp issues\nvar versions = {};\nvar release = {};\nvar config = {};\n\nfunction noop() {}\n\nvar on = noop;\nvar addListener = noop;\nvar once = noop;\nvar off = noop;\nvar removeListener = noop;\nvar removeAllListeners = noop;\nvar emit = noop;\n\nfunction binding(name) {\n    throw new Error('process.binding is not supported');\n}\n\nfunction cwd () { return '/' }\nfunction chdir (dir) {\n    throw new Error('process.chdir is not supported');\n}function umask() { return 0; }\n\n// from https://github.com/kumavis/browser-process-hrtime/blob/master/index.js\nvar performance = globalContext.performance || {};\nvar performanceNow =\n  performance.now        ||\n  performance.mozNow     ||\n  performance.msNow      ||\n  performance.oNow       ||\n  performance.webkitNow  ||\n  function(){ return (new Date()).getTime() };\n\n// generate timestamp or delta\n// see http://nodejs.org/api/process.html#process_process_hrtime\nfunction hrtime(previousTimestamp){\n  var clocktime = performanceNow.call(performance)*1e-3;\n  var seconds = Math.floor(clocktime);\n  var nanoseconds = Math.floor((clocktime%1)*1e9);\n  if (previousTimestamp) {\n    seconds = seconds - previousTimestamp[0];\n    nanoseconds = nanoseconds - previousTimestamp[1];\n    if (nanoseconds<0) {\n      seconds--;\n      nanoseconds += 1e9;\n    }\n  }\n  return [seconds,nanoseconds]\n}\n\nvar startTime = new Date();\nfunction uptime() {\n  var currentTime = new Date();\n  var dif = currentTime - startTime;\n  return dif / 1000;\n}\n\nvar process = {\n  nextTick: nextTick,\n  title: title,\n  browser: browser,\n  env: {\"NODE_ENV\":\"production\"},\n  argv: argv,\n  version: version,\n  versions: versions,\n  on: on,\n  addListener: addListener,\n  once: once,\n  off: off,\n  removeListener: removeListener,\n  removeAllListeners: removeAllListeners,\n  emit: emit,\n  binding: binding,\n  cwd: cwd,\n  chdir: chdir,\n  umask: umask,\n  hrtime: hrtime,\n  platform: platform,\n  release: release,\n  config: config,\n  uptime: uptime\n};\n\nconst TRACE_ID_HEADER_NAME = \"X-Amzn-Trace-Id\";\nconst ENV_LAMBDA_FUNCTION_NAME = \"AWS_LAMBDA_FUNCTION_NAME\";\nconst ENV_TRACE_ID = \"_X_AMZN_TRACE_ID\";\nconst recursionDetectionMiddleware = (options) => (next) => async (args) => {\n    const { request } = args;\n    if (!HttpRequest.isInstance(request) ||\n        options.runtime !== \"node\" ||\n        request.headers.hasOwnProperty(TRACE_ID_HEADER_NAME)) {\n        return next(args);\n    }\n    const functionName = process.env[ENV_LAMBDA_FUNCTION_NAME];\n    const traceId = process.env[ENV_TRACE_ID];\n    const nonEmptyString = (str) => typeof str === \"string\" && str.length > 0;\n    if (nonEmptyString(functionName) && nonEmptyString(traceId)) {\n        request.headers[TRACE_ID_HEADER_NAME] = traceId;\n    }\n    return next({\n        ...args,\n        request,\n    });\n};\nconst addRecursionDetectionMiddlewareOptions = {\n    step: \"build\",\n    tags: [\"RECURSION_DETECTION\"],\n    name: \"recursionDetectionMiddleware\",\n    override: true,\n    priority: \"low\",\n};\nconst getRecursionDetectionPlugin = (options) => ({\n    applyToStack: (clientStack) => {\n        clientStack.add(recursionDetectionMiddleware(options), addRecursionDetectionMiddlewareOptions);\n    },\n});\n\nconst memoize = (provider, isExpired, requiresRefresh) => {\n    let resolved;\n    let pending;\n    let hasResult;\n    let isConstant = false;\n    const coalesceProvider = async () => {\n        if (!pending) {\n            pending = provider();\n        }\n        try {\n            resolved = await pending;\n            hasResult = true;\n            isConstant = false;\n        }\n        finally {\n            pending = undefined;\n        }\n        return resolved;\n    };\n    if (isExpired === undefined) {\n        return async (options) => {\n            if (!hasResult || options?.forceRefresh) {\n                resolved = await coalesceProvider();\n            }\n            return resolved;\n        };\n    }\n    return async (options) => {\n        if (!hasResult || options?.forceRefresh) {\n            resolved = await coalesceProvider();\n        }\n        if (isConstant) {\n            return resolved;\n        }\n        if (requiresRefresh && !requiresRefresh(resolved)) {\n            isConstant = true;\n            return resolved;\n        }\n        if (isExpired(resolved)) {\n            await coalesceProvider();\n            return resolved;\n        }\n        return resolved;\n    };\n};\n\n/*! *****************************************************************************\r\nCopyright (c) Microsoft Corporation.\r\n\r\nPermission to use, copy, modify, and/or distribute this software for any\r\npurpose with or without fee is hereby granted.\r\n\r\nTHE SOFTWARE IS PROVIDED \"AS IS\" AND THE AUTHOR DISCLAIMS ALL WARRANTIES WITH\r\nREGARD TO THIS SOFTWARE INCLUDING ALL IMPLIED WARRANTIES OF MERCHANTABILITY\r\nAND FITNESS. IN NO EVENT SHALL THE AUTHOR BE LIABLE FOR ANY SPECIAL, DIRECT,\r\nINDIRECT, OR CONSEQUENTIAL DAMAGES OR ANY DAMAGES WHATSOEVER RESULTING FROM\r\nLOSS OF USE, DATA OR PROFITS, WHETHER IN AN ACTION OF CONTRACT, NEGLIGENCE OR\r\nOTHER TORTIOUS ACTION, ARISING OUT OF OR IN CONNECTION WITH THE USE OR\r\nPERFORMANCE OF THIS SOFTWARE.\r\n***************************************************************************** */\r\n/* global Reflect, Promise */\r\n\r\nvar extendStatics = function(d, b) {\r\n    extendStatics = Object.setPrototypeOf ||\r\n        ({ __proto__: [] } instanceof Array && function (d, b) { d.__proto__ = b; }) ||\r\n        function (d, b) { for (var p in b) if (b.hasOwnProperty(p)) d[p] = b[p]; };\r\n    return extendStatics(d, b);\r\n};\r\n\r\nfunction __extends(d, b) {\r\n    extendStatics(d, b);\r\n    function __() { this.constructor = d; }\r\n    d.prototype = b === null ? Object.create(b) : (__.prototype = b.prototype, new __());\r\n}\r\n\r\nvar __assign = function() {\r\n    __assign = Object.assign || function __assign(t) {\r\n        for (var s, i = 1, n = arguments.length; i < n; i++) {\r\n            s = arguments[i];\r\n            for (var p in s) if (Object.prototype.hasOwnProperty.call(s, p)) t[p] = s[p];\r\n        }\r\n        return t;\r\n    };\r\n    return __assign.apply(this, arguments);\r\n};\r\n\r\nfunction __rest(s, e) {\r\n    var t = {};\r\n    for (var p in s) if (Object.prototype.hasOwnProperty.call(s, p) && e.indexOf(p) < 0)\r\n        t[p] = s[p];\r\n    if (s != null && typeof Object.getOwnPropertySymbols === \"function\")\r\n        for (var i = 0, p = Object.getOwnPropertySymbols(s); i < p.length; i++) {\r\n            if (e.indexOf(p[i]) < 0 && Object.prototype.propertyIsEnumerable.call(s, p[i]))\r\n                t[p[i]] = s[p[i]];\r\n        }\r\n    return t;\r\n}\r\n\r\nfunction __decorate(decorators, target, key, desc) {\r\n    var c = arguments.length, r = c < 3 ? target : desc === null ? desc = Object.getOwnPropertyDescriptor(target, key) : desc, d;\r\n    if (typeof Reflect === \"object\" && typeof Reflect.decorate === \"function\") r = Reflect.decorate(decorators, target, key, desc);\r\n    else for (var i = decorators.length - 1; i >= 0; i--) if (d = decorators[i]) r = (c < 3 ? d(r) : c > 3 ? d(target, key, r) : d(target, key)) || r;\r\n    return c > 3 && r && Object.defineProperty(target, key, r), r;\r\n}\r\n\r\nfunction __param(paramIndex, decorator) {\r\n    return function (target, key) { decorator(target, key, paramIndex); }\r\n}\r\n\r\nfunction __metadata(metadataKey, metadataValue) {\r\n    if (typeof Reflect === \"object\" && typeof Reflect.metadata === \"function\") return Reflect.metadata(metadataKey, metadataValue);\r\n}\r\n\r\nfunction __awaiter(thisArg, _arguments, P, generator) {\r\n    function adopt(value) { return value instanceof P ? value : new P(function (resolve) { resolve(value); }); }\r\n    return new (P || (P = Promise))(function (resolve, reject) {\r\n        function fulfilled(value) { try { step(generator.next(value)); } catch (e) { reject(e); } }\r\n        function rejected(value) { try { step(generator[\"throw\"](value)); } catch (e) { reject(e); } }\r\n        function step(result) { result.done ? resolve(result.value) : adopt(result.value).then(fulfilled, rejected); }\r\n        step((generator = generator.apply(thisArg, _arguments || [])).next());\r\n    });\r\n}\r\n\r\nfunction __generator(thisArg, body) {\r\n    var _ = { label: 0, sent: function() { if (t[0] & 1) throw t[1]; return t[1]; }, trys: [], ops: [] }, f, y, t, g;\r\n    return g = { next: verb(0), \"throw\": verb(1), \"return\": verb(2) }, typeof Symbol === \"function\" && (g[Symbol.iterator] = function() { return this; }), g;\r\n    function verb(n) { return function (v) { return step([n, v]); }; }\r\n    function step(op) {\r\n        if (f) throw new TypeError(\"Generator is already executing.\");\r\n        while (_) try {\r\n            if (f = 1, y && (t = op[0] & 2 ? y[\"return\"] : op[0] ? y[\"throw\"] || ((t = y[\"return\"]) && t.call(y), 0) : y.next) && !(t = t.call(y, op[1])).done) return t;\r\n            if (y = 0, t) op = [op[0] & 2, t.value];\r\n            switch (op[0]) {\r\n                case 0: case 1: t = op; break;\r\n                case 4: _.label++; return { value: op[1], done: false };\r\n                case 5: _.label++; y = op[1]; op = [0]; continue;\r\n                case 7: op = _.ops.pop(); _.trys.pop(); continue;\r\n                default:\r\n                    if (!(t = _.trys, t = t.length > 0 && t[t.length - 1]) && (op[0] === 6 || op[0] === 2)) { _ = 0; continue; }\r\n                    if (op[0] === 3 && (!t || (op[1] > t[0] && op[1] < t[3]))) { _.label = op[1]; break; }\r\n                    if (op[0] === 6 && _.label < t[1]) { _.label = t[1]; t = op; break; }\r\n                    if (t && _.label < t[2]) { _.label = t[2]; _.ops.push(op); break; }\r\n                    if (t[2]) _.ops.pop();\r\n                    _.trys.pop(); continue;\r\n            }\r\n            op = body.call(thisArg, _);\r\n        } catch (e) { op = [6, e]; y = 0; } finally { f = t = 0; }\r\n        if (op[0] & 5) throw op[1]; return { value: op[0] ? op[1] : void 0, done: true };\r\n    }\r\n}\r\n\r\nfunction __createBinding(o, m, k, k2) {\r\n    if (k2 === undefined) k2 = k;\r\n    o[k2] = m[k];\r\n}\r\n\r\nfunction __exportStar(m, exports) {\r\n    for (var p in m) if (p !== \"default\" && !exports.hasOwnProperty(p)) exports[p] = m[p];\r\n}\r\n\r\nfunction __values(o) {\r\n    var s = typeof Symbol === \"function\" && Symbol.iterator, m = s && o[s], i = 0;\r\n    if (m) return m.call(o);\r\n    if (o && typeof o.length === \"number\") return {\r\n        next: function () {\r\n            if (o && i >= o.length) o = void 0;\r\n            return { value: o && o[i++], done: !o };\r\n        }\r\n    };\r\n    throw new TypeError(s ? \"Object is not iterable.\" : \"Symbol.iterator is not defined.\");\r\n}\r\n\r\nfunction __read(o, n) {\r\n    var m = typeof Symbol === \"function\" && o[Symbol.iterator];\r\n    if (!m) return o;\r\n    var i = m.call(o), r, ar = [], e;\r\n    try {\r\n        while ((n === void 0 || n-- > 0) && !(r = i.next()).done) ar.push(r.value);\r\n    }\r\n    catch (error) { e = { error: error }; }\r\n    finally {\r\n        try {\r\n            if (r && !r.done && (m = i[\"return\"])) m.call(i);\r\n        }\r\n        finally { if (e) throw e.error; }\r\n    }\r\n    return ar;\r\n}\r\n\r\nfunction __spread() {\r\n    for (var ar = [], i = 0; i < arguments.length; i++)\r\n        ar = ar.concat(__read(arguments[i]));\r\n    return ar;\r\n}\r\n\r\nfunction __spreadArrays() {\r\n    for (var s = 0, i = 0, il = arguments.length; i < il; i++) s += arguments[i].length;\r\n    for (var r = Array(s), k = 0, i = 0; i < il; i++)\r\n        for (var a = arguments[i], j = 0, jl = a.length; j < jl; j++, k++)\r\n            r[k] = a[j];\r\n    return r;\r\n}\r\nfunction __await(v) {\r\n    return this instanceof __await ? (this.v = v, this) : new __await(v);\r\n}\r\n\r\nfunction __asyncGenerator(thisArg, _arguments, generator) {\r\n    if (!Symbol.asyncIterator) throw new TypeError(\"Symbol.asyncIterator is not defined.\");\r\n    var g = generator.apply(thisArg, _arguments || []), i, q = [];\r\n    return i = {}, verb(\"next\"), verb(\"throw\"), verb(\"return\"), i[Symbol.asyncIterator] = function () { return this; }, i;\r\n    function verb(n) { if (g[n]) i[n] = function (v) { return new Promise(function (a, b) { q.push([n, v, a, b]) > 1 || resume(n, v); }); }; }\r\n    function resume(n, v) { try { step(g[n](v)); } catch (e) { settle(q[0][3], e); } }\r\n    function step(r) { r.value instanceof __await ? Promise.resolve(r.value.v).then(fulfill, reject) : settle(q[0][2], r); }\r\n    function fulfill(value) { resume(\"next\", value); }\r\n    function reject(value) { resume(\"throw\", value); }\r\n    function settle(f, v) { if (f(v), q.shift(), q.length) resume(q[0][0], q[0][1]); }\r\n}\r\n\r\nfunction __asyncDelegator(o) {\r\n    var i, p;\r\n    return i = {}, verb(\"next\"), verb(\"throw\", function (e) { throw e; }), verb(\"return\"), i[Symbol.iterator] = function () { return this; }, i;\r\n    function verb(n, f) { i[n] = o[n] ? function (v) { return (p = !p) ? { value: __await(o[n](v)), done: n === \"return\" } : f ? f(v) : v; } : f; }\r\n}\r\n\r\nfunction __asyncValues(o) {\r\n    if (!Symbol.asyncIterator) throw new TypeError(\"Symbol.asyncIterator is not defined.\");\r\n    var m = o[Symbol.asyncIterator], i;\r\n    return m ? m.call(o) : (o = typeof __values === \"function\" ? __values(o) : o[Symbol.iterator](), i = {}, verb(\"next\"), verb(\"throw\"), verb(\"return\"), i[Symbol.asyncIterator] = function () { return this; }, i);\r\n    function verb(n) { i[n] = o[n] && function (v) { return new Promise(function (resolve, reject) { v = o[n](v), settle(resolve, reject, v.done, v.value); }); }; }\r\n    function settle(resolve, reject, d, v) { Promise.resolve(v).then(function(v) { resolve({ value: v, done: d }); }, reject); }\r\n}\r\n\r\nfunction __makeTemplateObject(cooked, raw) {\r\n    if (Object.defineProperty) { Object.defineProperty(cooked, \"raw\", { value: raw }); } else { cooked.raw = raw; }\r\n    return cooked;\r\n}\r\nfunction __importStar(mod) {\r\n    if (mod && mod.__esModule) return mod;\r\n    var result = {};\r\n    if (mod != null) for (var k in mod) if (Object.hasOwnProperty.call(mod, k)) result[k] = mod[k];\r\n    result.default = mod;\r\n    return result;\r\n}\r\n\r\nfunction __importDefault(mod) {\r\n    return (mod && mod.__esModule) ? mod : { default: mod };\r\n}\r\n\r\nfunction __classPrivateFieldGet(receiver, privateMap) {\r\n    if (!privateMap.has(receiver)) {\r\n        throw new TypeError(\"attempted to get private field on non-instance\");\r\n    }\r\n    return privateMap.get(receiver);\r\n}\r\n\r\nfunction __classPrivateFieldSet(receiver, privateMap, value) {\r\n    if (!privateMap.has(receiver)) {\r\n        throw new TypeError(\"attempted to set private field on non-instance\");\r\n    }\r\n    privateMap.set(receiver, value);\r\n    return value;\r\n}\n\nvar tslib_es6 = /*#__PURE__*/Object.freeze({\n    __proto__: null,\n    __extends: __extends,\n    get __assign () { return __assign; },\n    __rest: __rest,\n    __decorate: __decorate,\n    __param: __param,\n    __metadata: __metadata,\n    __awaiter: __awaiter,\n    __generator: __generator,\n    __createBinding: __createBinding,\n    __exportStar: __exportStar,\n    __values: __values,\n    __read: __read,\n    __spread: __spread,\n    __spreadArrays: __spreadArrays,\n    __await: __await,\n    __asyncGenerator: __asyncGenerator,\n    __asyncDelegator: __asyncDelegator,\n    __asyncValues: __asyncValues,\n    __makeTemplateObject: __makeTemplateObject,\n    __importStar: __importStar,\n    __importDefault: __importDefault,\n    __classPrivateFieldGet: __classPrivateFieldGet,\n    __classPrivateFieldSet: __classPrivateFieldSet\n});\n\nconst fromUtf8 = (input) => {\n    const bytes = [];\n    for (let i = 0, len = input.length; i < len; i++) {\n        const value = input.charCodeAt(i);\n        if (value < 0x80) {\n            bytes.push(value);\n        }\n        else if (value < 0x800) {\n            bytes.push((value >> 6) | 0b11000000, (value & 0b111111) | 0b10000000);\n        }\n        else if (i + 1 < input.length && (value & 0xfc00) === 0xd800 && (input.charCodeAt(i + 1) & 0xfc00) === 0xdc00) {\n            const surrogatePair = 0x10000 + ((value & 0b1111111111) << 10) + (input.charCodeAt(++i) & 0b1111111111);\n            bytes.push((surrogatePair >> 18) | 0b11110000, ((surrogatePair >> 12) & 0b111111) | 0b10000000, ((surrogatePair >> 6) & 0b111111) | 0b10000000, (surrogatePair & 0b111111) | 0b10000000);\n        }\n        else {\n            bytes.push((value >> 12) | 0b11100000, ((value >> 6) & 0b111111) | 0b10000000, (value & 0b111111) | 0b10000000);\n        }\n    }\n    return Uint8Array.from(bytes);\n};\nconst toUtf8 = (input) => {\n    let decoded = \"\";\n    for (let i = 0, len = input.length; i < len; i++) {\n        const byte = input[i];\n        if (byte < 0x80) {\n            decoded += String.fromCharCode(byte);\n        }\n        else if (0b11000000 <= byte && byte < 0b11100000) {\n            const nextByte = input[++i];\n            decoded += String.fromCharCode(((byte & 0b11111) << 6) | (nextByte & 0b111111));\n        }\n        else if (0b11110000 <= byte && byte < 0b101101101) {\n            const surrogatePair = [byte, input[++i], input[++i], input[++i]];\n            const encoded = \"%\" + surrogatePair.map((byteValue) => byteValue.toString(16)).join(\"%\");\n            decoded += decodeURIComponent(encoded);\n        }\n        else {\n            decoded += String.fromCharCode(((byte & 0b1111) << 12) | ((input[++i] & 0b111111) << 6) | (input[++i] & 0b111111));\n        }\n    }\n    return decoded;\n};\n\nfunction fromUtf8$1(input) {\n    return new TextEncoder().encode(input);\n}\nfunction toUtf8$1(input) {\n    return new TextDecoder(\"utf-8\").decode(input);\n}\n\nconst fromUtf8$2 = (input) => typeof TextEncoder === \"function\" ? fromUtf8$1(input) : fromUtf8(input);\nconst toUtf8$2 = (input) => typeof TextDecoder === \"function\" ? toUtf8$1(input) : toUtf8(input);\n\nvar distEs = /*#__PURE__*/Object.freeze({\n    __proto__: null,\n    fromUtf8: fromUtf8$2,\n    toUtf8: toUtf8$2\n});\n\nvar convertToBuffer_1 = createCommonjsModule(function (module, exports) {\n// Copyright Amazon.com Inc. or its affiliates. All Rights Reserved.\n// SPDX-License-Identifier: Apache-2.0\nObject.defineProperty(exports, \"__esModule\", { value: true });\nexports.convertToBuffer = void 0;\n\n// Quick polyfill\nvar fromUtf8 = typeof Buffer !== \"undefined\" && Buffer.from\n    ? function (input) { return Buffer.from(input, \"utf8\"); }\n    : distEs.fromUtf8;\nfunction convertToBuffer(data) {\n    // Already a Uint8, do nothing\n    if (data instanceof Uint8Array)\n        return data;\n    if (typeof data === \"string\") {\n        return fromUtf8(data);\n    }\n    if (ArrayBuffer.isView(data)) {\n        return new Uint8Array(data.buffer, data.byteOffset, data.byteLength / Uint8Array.BYTES_PER_ELEMENT);\n    }\n    return new Uint8Array(data);\n}\nexports.convertToBuffer = convertToBuffer;\n\n});\n\nvar isEmptyData_1 = createCommonjsModule(function (module, exports) {\n// Copyright Amazon.com Inc. or its affiliates. All Rights Reserved.\n// SPDX-License-Identifier: Apache-2.0\nObject.defineProperty(exports, \"__esModule\", { value: true });\nexports.isEmptyData = void 0;\nfunction isEmptyData(data) {\n    if (typeof data === \"string\") {\n        return data.length === 0;\n    }\n    return data.byteLength === 0;\n}\nexports.isEmptyData = isEmptyData;\n\n});\n\nvar numToUint8_1 = createCommonjsModule(function (module, exports) {\n// Copyright Amazon.com Inc. or its affiliates. All Rights Reserved.\n// SPDX-License-Identifier: Apache-2.0\nObject.defineProperty(exports, \"__esModule\", { value: true });\nexports.numToUint8 = void 0;\nfunction numToUint8(num) {\n    return new Uint8Array([\n        (num & 0xff000000) >> 24,\n        (num & 0x00ff0000) >> 16,\n        (num & 0x0000ff00) >> 8,\n        num & 0x000000ff,\n    ]);\n}\nexports.numToUint8 = numToUint8;\n\n});\n\nvar uint32ArrayFrom_1 = createCommonjsModule(function (module, exports) {\n// Copyright Amazon.com Inc. or its affiliates. All Rights Reserved.\n// SPDX-License-Identifier: Apache-2.0\nObject.defineProperty(exports, \"__esModule\", { value: true });\nexports.uint32ArrayFrom = void 0;\n// IE 11 does not support Array.from, so we do it manually\nfunction uint32ArrayFrom(a_lookUpTable) {\n    if (!Uint32Array.from) {\n        var return_array = new Uint32Array(a_lookUpTable.length);\n        var a_index = 0;\n        while (a_index < a_lookUpTable.length) {\n            return_array[a_index] = a_lookUpTable[a_index];\n            a_index += 1;\n        }\n        return return_array;\n    }\n    return Uint32Array.from(a_lookUpTable);\n}\nexports.uint32ArrayFrom = uint32ArrayFrom;\n\n});\n\nvar build = createCommonjsModule(function (module, exports) {\n// Copyright Amazon.com Inc. or its affiliates. All Rights Reserved.\n// SPDX-License-Identifier: Apache-2.0\nObject.defineProperty(exports, \"__esModule\", { value: true });\nexports.uint32ArrayFrom = exports.numToUint8 = exports.isEmptyData = exports.convertToBuffer = void 0;\n\nObject.defineProperty(exports, \"convertToBuffer\", { enumerable: true, get: function () { return convertToBuffer_1.convertToBuffer; } });\n\nObject.defineProperty(exports, \"isEmptyData\", { enumerable: true, get: function () { return isEmptyData_1.isEmptyData; } });\n\nObject.defineProperty(exports, \"numToUint8\", { enumerable: true, get: function () { return numToUint8_1.numToUint8; } });\n\nObject.defineProperty(exports, \"uint32ArrayFrom\", { enumerable: true, get: function () { return uint32ArrayFrom_1.uint32ArrayFrom; } });\n\n});\n\nvar aws_crc32 = createCommonjsModule(function (module, exports) {\n// Copyright Amazon.com Inc. or its affiliates. All Rights Reserved.\n// SPDX-License-Identifier: Apache-2.0\nObject.defineProperty(exports, \"__esModule\", { value: true });\nexports.AwsCrc32 = void 0;\n\n\n\nvar AwsCrc32 = /** @class */ (function () {\n    function AwsCrc32() {\n        this.crc32 = new build$1.Crc32();\n    }\n    AwsCrc32.prototype.update = function (toHash) {\n        if ((0, build.isEmptyData)(toHash))\n            return;\n        this.crc32.update((0, build.convertToBuffer)(toHash));\n    };\n    AwsCrc32.prototype.digest = function () {\n        return tslib_es6.__awaiter(this, void 0, void 0, function () {\n            return tslib_es6.__generator(this, function (_a) {\n                return [2 /*return*/, (0, build.numToUint8)(this.crc32.digest())];\n            });\n        });\n    };\n    AwsCrc32.prototype.reset = function () {\n        this.crc32 = new build$1.Crc32();\n    };\n    return AwsCrc32;\n}());\nexports.AwsCrc32 = AwsCrc32;\n\n});\n\nvar build$1 = createCommonjsModule(function (module, exports) {\nObject.defineProperty(exports, \"__esModule\", { value: true });\nexports.AwsCrc32 = exports.Crc32 = exports.crc32 = void 0;\n\n\nfunction crc32(data) {\n    return new Crc32().update(data).digest();\n}\nexports.crc32 = crc32;\nvar Crc32 = /** @class */ (function () {\n    function Crc32() {\n        this.checksum = 0xffffffff;\n    }\n    Crc32.prototype.update = function (data) {\n        var e_1, _a;\n        try {\n            for (var data_1 = tslib_es6.__values(data), data_1_1 = data_1.next(); !data_1_1.done; data_1_1 = data_1.next()) {\n                var byte = data_1_1.value;\n                this.checksum =\n                    (this.checksum >>> 8) ^ lookupTable[(this.checksum ^ byte) & 0xff];\n            }\n        }\n        catch (e_1_1) { e_1 = { error: e_1_1 }; }\n        finally {\n            try {\n                if (data_1_1 && !data_1_1.done && (_a = data_1.return)) _a.call(data_1);\n            }\n            finally { if (e_1) throw e_1.error; }\n        }\n        return this;\n    };\n    Crc32.prototype.digest = function () {\n        return (this.checksum ^ 0xffffffff) >>> 0;\n    };\n    return Crc32;\n}());\nexports.Crc32 = Crc32;\n// prettier-ignore\nvar a_lookUpTable = [\n    0x00000000, 0x77073096, 0xEE0E612C, 0x990951BA,\n    0x076DC419, 0x706AF48F, 0xE963A535, 0x9E6495A3,\n    0x0EDB8832, 0x79DCB8A4, 0xE0D5E91E, 0x97D2D988,\n    0x09B64C2B, 0x7EB17CBD, 0xE7B82D07, 0x90BF1D91,\n    0x1DB71064, 0x6AB020F2, 0xF3B97148, 0x84BE41DE,\n    0x1ADAD47D, 0x6DDDE4EB, 0xF4D4B551, 0x83D385C7,\n    0x136C9856, 0x646BA8C0, 0xFD62F97A, 0x8A65C9EC,\n    0x14015C4F, 0x63066CD9, 0xFA0F3D63, 0x8D080DF5,\n    0x3B6E20C8, 0x4C69105E, 0xD56041E4, 0xA2677172,\n    0x3C03E4D1, 0x4B04D447, 0xD20D85FD, 0xA50AB56B,\n    0x35B5A8FA, 0x42B2986C, 0xDBBBC9D6, 0xACBCF940,\n    0x32D86CE3, 0x45DF5C75, 0xDCD60DCF, 0xABD13D59,\n    0x26D930AC, 0x51DE003A, 0xC8D75180, 0xBFD06116,\n    0x21B4F4B5, 0x56B3C423, 0xCFBA9599, 0xB8BDA50F,\n    0x2802B89E, 0x5F058808, 0xC60CD9B2, 0xB10BE924,\n    0x2F6F7C87, 0x58684C11, 0xC1611DAB, 0xB6662D3D,\n    0x76DC4190, 0x01DB7106, 0x98D220BC, 0xEFD5102A,\n    0x71B18589, 0x06B6B51F, 0x9FBFE4A5, 0xE8B8D433,\n    0x7807C9A2, 0x0F00F934, 0x9609A88E, 0xE10E9818,\n    0x7F6A0DBB, 0x086D3D2D, 0x91646C97, 0xE6635C01,\n    0x6B6B51F4, 0x1C6C6162, 0x856530D8, 0xF262004E,\n    0x6C0695ED, 0x1B01A57B, 0x8208F4C1, 0xF50FC457,\n    0x65B0D9C6, 0x12B7E950, 0x8BBEB8EA, 0xFCB9887C,\n    0x62DD1DDF, 0x15DA2D49, 0x8CD37CF3, 0xFBD44C65,\n    0x4DB26158, 0x3AB551CE, 0xA3BC0074, 0xD4BB30E2,\n    0x4ADFA541, 0x3DD895D7, 0xA4D1C46D, 0xD3D6F4FB,\n    0x4369E96A, 0x346ED9FC, 0xAD678846, 0xDA60B8D0,\n    0x44042D73, 0x33031DE5, 0xAA0A4C5F, 0xDD0D7CC9,\n    0x5005713C, 0x270241AA, 0xBE0B1010, 0xC90C2086,\n    0x5768B525, 0x206F85B3, 0xB966D409, 0xCE61E49F,\n    0x5EDEF90E, 0x29D9C998, 0xB0D09822, 0xC7D7A8B4,\n    0x59B33D17, 0x2EB40D81, 0xB7BD5C3B, 0xC0BA6CAD,\n    0xEDB88320, 0x9ABFB3B6, 0x03B6E20C, 0x74B1D29A,\n    0xEAD54739, 0x9DD277AF, 0x04DB2615, 0x73DC1683,\n    0xE3630B12, 0x94643B84, 0x0D6D6A3E, 0x7A6A5AA8,\n    0xE40ECF0B, 0x9309FF9D, 0x0A00AE27, 0x7D079EB1,\n    0xF00F9344, 0x8708A3D2, 0x1E01F268, 0x6906C2FE,\n    0xF762575D, 0x806567CB, 0x196C3671, 0x6E6B06E7,\n    0xFED41B76, 0x89D32BE0, 0x10DA7A5A, 0x67DD4ACC,\n    0xF9B9DF6F, 0x8EBEEFF9, 0x17B7BE43, 0x60B08ED5,\n    0xD6D6A3E8, 0xA1D1937E, 0x38D8C2C4, 0x4FDFF252,\n    0xD1BB67F1, 0xA6BC5767, 0x3FB506DD, 0x48B2364B,\n    0xD80D2BDA, 0xAF0A1B4C, 0x36034AF6, 0x41047A60,\n    0xDF60EFC3, 0xA867DF55, 0x316E8EEF, 0x4669BE79,\n    0xCB61B38C, 0xBC66831A, 0x256FD2A0, 0x5268E236,\n    0xCC0C7795, 0xBB0B4703, 0x220216B9, 0x5505262F,\n    0xC5BA3BBE, 0xB2BD0B28, 0x2BB45A92, 0x5CB36A04,\n    0xC2D7FFA7, 0xB5D0CF31, 0x2CD99E8B, 0x5BDEAE1D,\n    0x9B64C2B0, 0xEC63F226, 0x756AA39C, 0x026D930A,\n    0x9C0906A9, 0xEB0E363F, 0x72076785, 0x05005713,\n    0x95BF4A82, 0xE2B87A14, 0x7BB12BAE, 0x0CB61B38,\n    0x92D28E9B, 0xE5D5BE0D, 0x7CDCEFB7, 0x0BDBDF21,\n    0x86D3D2D4, 0xF1D4E242, 0x68DDB3F8, 0x1FDA836E,\n    0x81BE16CD, 0xF6B9265B, 0x6FB077E1, 0x18B74777,\n    0x88085AE6, 0xFF0F6A70, 0x66063BCA, 0x11010B5C,\n    0x8F659EFF, 0xF862AE69, 0x616BFFD3, 0x166CCF45,\n    0xA00AE278, 0xD70DD2EE, 0x4E048354, 0x3903B3C2,\n    0xA7672661, 0xD06016F7, 0x4969474D, 0x3E6E77DB,\n    0xAED16A4A, 0xD9D65ADC, 0x40DF0B66, 0x37D83BF0,\n    0xA9BCAE53, 0xDEBB9EC5, 0x47B2CF7F, 0x30B5FFE9,\n    0xBDBDF21C, 0xCABAC28A, 0x53B39330, 0x24B4A3A6,\n    0xBAD03605, 0xCDD70693, 0x54DE5729, 0x23D967BF,\n    0xB3667A2E, 0xC4614AB8, 0x5D681B02, 0x2A6F2B94,\n    0xB40BBE37, 0xC30C8EA1, 0x5A05DF1B, 0x2D02EF8D,\n];\nvar lookupTable = (0, build.uint32ArrayFrom)(a_lookUpTable);\n\nObject.defineProperty(exports, \"AwsCrc32\", { enumerable: true, get: function () { return aws_crc32.AwsCrc32; } });\n\n});\n\nclass Int64 {\n    constructor(bytes) {\n        this.bytes = bytes;\n        if (bytes.byteLength !== 8) {\n            throw new Error(\"Int64 buffers must be exactly 8 bytes\");\n        }\n    }\n    static fromNumber(number) {\n        if (number > 9223372036854776000 || number < -9223372036854776000) {\n            throw new Error(`${number} is too large (or, if negative, too small) to represent as an Int64`);\n        }\n        const bytes = new Uint8Array(8);\n        for (let i = 7, remaining = Math.abs(Math.round(number)); i > -1 && remaining > 0; i--, remaining /= 256) {\n            bytes[i] = remaining;\n        }\n        if (number < 0) {\n            negate(bytes);\n        }\n        return new Int64(bytes);\n    }\n    valueOf() {\n        const bytes = this.bytes.slice(0);\n        const negative = bytes[0] & 0b10000000;\n        if (negative) {\n            negate(bytes);\n        }\n        return parseInt(toHex(bytes), 16) * (negative ? -1 : 1);\n    }\n    toString() {\n        return String(this.valueOf());\n    }\n}\nfunction negate(bytes) {\n    for (let i = 0; i < 8; i++) {\n        bytes[i] ^= 0xff;\n    }\n    for (let i = 7; i > -1; i--) {\n        bytes[i]++;\n        if (bytes[i] !== 0)\n            break;\n    }\n}\n\nclass HeaderMarshaller {\n    constructor(toUtf8, fromUtf8) {\n        this.toUtf8 = toUtf8;\n        this.fromUtf8 = fromUtf8;\n    }\n    format(headers) {\n        const chunks = [];\n        for (const headerName of Object.keys(headers)) {\n            const bytes = this.fromUtf8(headerName);\n            chunks.push(Uint8Array.from([bytes.byteLength]), bytes, this.formatHeaderValue(headers[headerName]));\n        }\n        const out = new Uint8Array(chunks.reduce((carry, bytes) => carry + bytes.byteLength, 0));\n        let position = 0;\n        for (const chunk of chunks) {\n            out.set(chunk, position);\n            position += chunk.byteLength;\n        }\n        return out;\n    }\n    formatHeaderValue(header) {\n        switch (header.type) {\n            case \"boolean\":\n                return Uint8Array.from([header.value ? 0 : 1]);\n            case \"byte\":\n                return Uint8Array.from([2, header.value]);\n            case \"short\":\n                const shortView = new DataView(new ArrayBuffer(3));\n                shortView.setUint8(0, 3);\n                shortView.setInt16(1, header.value, false);\n                return new Uint8Array(shortView.buffer);\n            case \"integer\":\n                const intView = new DataView(new ArrayBuffer(5));\n                intView.setUint8(0, 4);\n                intView.setInt32(1, header.value, false);\n                return new Uint8Array(intView.buffer);\n            case \"long\":\n                const longBytes = new Uint8Array(9);\n                longBytes[0] = 5;\n                longBytes.set(header.value.bytes, 1);\n                return longBytes;\n            case \"binary\":\n                const binView = new DataView(new ArrayBuffer(3 + header.value.byteLength));\n                binView.setUint8(0, 6);\n                binView.setUint16(1, header.value.byteLength, false);\n                const binBytes = new Uint8Array(binView.buffer);\n                binBytes.set(header.value, 3);\n                return binBytes;\n            case \"string\":\n                const utf8Bytes = this.fromUtf8(header.value);\n                const strView = new DataView(new ArrayBuffer(3 + utf8Bytes.byteLength));\n                strView.setUint8(0, 7);\n                strView.setUint16(1, utf8Bytes.byteLength, false);\n                const strBytes = new Uint8Array(strView.buffer);\n                strBytes.set(utf8Bytes, 3);\n                return strBytes;\n            case \"timestamp\":\n                const tsBytes = new Uint8Array(9);\n                tsBytes[0] = 8;\n                tsBytes.set(Int64.fromNumber(header.value.valueOf()).bytes, 1);\n                return tsBytes;\n            case \"uuid\":\n                if (!UUID_PATTERN.test(header.value)) {\n                    throw new Error(`Invalid UUID received: ${header.value}`);\n                }\n                const uuidBytes = new Uint8Array(17);\n                uuidBytes[0] = 9;\n                uuidBytes.set(fromHex(header.value.replace(/\\-/g, \"\")), 1);\n                return uuidBytes;\n        }\n    }\n    parse(headers) {\n        const out = {};\n        let position = 0;\n        while (position < headers.byteLength) {\n            const nameLength = headers.getUint8(position++);\n            const name = this.toUtf8(new Uint8Array(headers.buffer, headers.byteOffset + position, nameLength));\n            position += nameLength;\n            switch (headers.getUint8(position++)) {\n                case 0:\n                    out[name] = {\n                        type: BOOLEAN_TAG,\n                        value: true,\n                    };\n                    break;\n                case 1:\n                    out[name] = {\n                        type: BOOLEAN_TAG,\n                        value: false,\n                    };\n                    break;\n                case 2:\n                    out[name] = {\n                        type: BYTE_TAG,\n                        value: headers.getInt8(position++),\n                    };\n                    break;\n                case 3:\n                    out[name] = {\n                        type: SHORT_TAG,\n                        value: headers.getInt16(position, false),\n                    };\n                    position += 2;\n                    break;\n                case 4:\n                    out[name] = {\n                        type: INT_TAG,\n                        value: headers.getInt32(position, false),\n                    };\n                    position += 4;\n                    break;\n                case 5:\n                    out[name] = {\n                        type: LONG_TAG,\n                        value: new Int64(new Uint8Array(headers.buffer, headers.byteOffset + position, 8)),\n                    };\n                    position += 8;\n                    break;\n                case 6:\n                    const binaryLength = headers.getUint16(position, false);\n                    position += 2;\n                    out[name] = {\n                        type: BINARY_TAG,\n                        value: new Uint8Array(headers.buffer, headers.byteOffset + position, binaryLength),\n                    };\n                    position += binaryLength;\n                    break;\n                case 7:\n                    const stringLength = headers.getUint16(position, false);\n                    position += 2;\n                    out[name] = {\n                        type: STRING_TAG,\n                        value: this.toUtf8(new Uint8Array(headers.buffer, headers.byteOffset + position, stringLength)),\n                    };\n                    position += stringLength;\n                    break;\n                case 8:\n                    out[name] = {\n                        type: TIMESTAMP_TAG,\n                        value: new Date(new Int64(new Uint8Array(headers.buffer, headers.byteOffset + position, 8)).valueOf()),\n                    };\n                    position += 8;\n                    break;\n                case 9:\n                    const uuidBytes = new Uint8Array(headers.buffer, headers.byteOffset + position, 16);\n                    position += 16;\n                    out[name] = {\n                        type: UUID_TAG,\n                        value: `${toHex(uuidBytes.subarray(0, 4))}-${toHex(uuidBytes.subarray(4, 6))}-${toHex(uuidBytes.subarray(6, 8))}-${toHex(uuidBytes.subarray(8, 10))}-${toHex(uuidBytes.subarray(10))}`,\n                    };\n                    break;\n                default:\n                    throw new Error(`Unrecognized header type tag`);\n            }\n        }\n        return out;\n    }\n}\nvar HEADER_VALUE_TYPE;\n(function (HEADER_VALUE_TYPE) {\n    HEADER_VALUE_TYPE[HEADER_VALUE_TYPE[\"boolTrue\"] = 0] = \"boolTrue\";\n    HEADER_VALUE_TYPE[HEADER_VALUE_TYPE[\"boolFalse\"] = 1] = \"boolFalse\";\n    HEADER_VALUE_TYPE[HEADER_VALUE_TYPE[\"byte\"] = 2] = \"byte\";\n    HEADER_VALUE_TYPE[HEADER_VALUE_TYPE[\"short\"] = 3] = \"short\";\n    HEADER_VALUE_TYPE[HEADER_VALUE_TYPE[\"integer\"] = 4] = \"integer\";\n    HEADER_VALUE_TYPE[HEADER_VALUE_TYPE[\"long\"] = 5] = \"long\";\n    HEADER_VALUE_TYPE[HEADER_VALUE_TYPE[\"byteArray\"] = 6] = \"byteArray\";\n    HEADER_VALUE_TYPE[HEADER_VALUE_TYPE[\"string\"] = 7] = \"string\";\n    HEADER_VALUE_TYPE[HEADER_VALUE_TYPE[\"timestamp\"] = 8] = \"timestamp\";\n    HEADER_VALUE_TYPE[HEADER_VALUE_TYPE[\"uuid\"] = 9] = \"uuid\";\n})(HEADER_VALUE_TYPE || (HEADER_VALUE_TYPE = {}));\nconst BOOLEAN_TAG = \"boolean\";\nconst BYTE_TAG = \"byte\";\nconst SHORT_TAG = \"short\";\nconst INT_TAG = \"integer\";\nconst LONG_TAG = \"long\";\nconst BINARY_TAG = \"binary\";\nconst STRING_TAG = \"string\";\nconst TIMESTAMP_TAG = \"timestamp\";\nconst UUID_TAG = \"uuid\";\nconst UUID_PATTERN = /^[a-f0-9]{8}-[a-f0-9]{4}-[a-f0-9]{4}-[a-f0-9]{4}-[a-f0-9]{12}$/;\n\nconst normalizeProvider = (input) => {\n    if (typeof input === \"function\")\n        return input;\n    const promisified = Promise.resolve(input);\n    return () => promisified;\n};\n\nconst toUint8Array = (data) => {\n    if (typeof data === \"string\") {\n        return fromUtf8$3(data);\n    }\n    if (ArrayBuffer.isView(data)) {\n        return new Uint8Array(data.buffer, data.byteOffset, data.byteLength / Uint8Array.BYTES_PER_ELEMENT);\n    }\n    return new Uint8Array(data);\n};\n\nconst ALGORITHM_QUERY_PARAM = \"X-Amz-Algorithm\";\nconst CREDENTIAL_QUERY_PARAM = \"X-Amz-Credential\";\nconst AMZ_DATE_QUERY_PARAM = \"X-Amz-Date\";\nconst SIGNED_HEADERS_QUERY_PARAM = \"X-Amz-SignedHeaders\";\nconst EXPIRES_QUERY_PARAM = \"X-Amz-Expires\";\nconst SIGNATURE_QUERY_PARAM = \"X-Amz-Signature\";\nconst TOKEN_QUERY_PARAM = \"X-Amz-Security-Token\";\nconst AUTH_HEADER = \"authorization\";\nconst AMZ_DATE_HEADER = AMZ_DATE_QUERY_PARAM.toLowerCase();\nconst DATE_HEADER = \"date\";\nconst GENERATED_HEADERS = [AUTH_HEADER, AMZ_DATE_HEADER, DATE_HEADER];\nconst SIGNATURE_HEADER = SIGNATURE_QUERY_PARAM.toLowerCase();\nconst SHA256_HEADER = \"x-amz-content-sha256\";\nconst TOKEN_HEADER = TOKEN_QUERY_PARAM.toLowerCase();\nconst ALWAYS_UNSIGNABLE_HEADERS = {\n    authorization: true,\n    \"cache-control\": true,\n    connection: true,\n    expect: true,\n    from: true,\n    \"keep-alive\": true,\n    \"max-forwards\": true,\n    pragma: true,\n    referer: true,\n    te: true,\n    trailer: true,\n    \"transfer-encoding\": true,\n    upgrade: true,\n    \"user-agent\": true,\n    \"x-amzn-trace-id\": true,\n};\nconst PROXY_HEADER_PATTERN = /^proxy-/;\nconst SEC_HEADER_PATTERN = /^sec-/;\nconst ALGORITHM_IDENTIFIER = \"AWS4-HMAC-SHA256\";\nconst EVENT_ALGORITHM_IDENTIFIER = \"AWS4-HMAC-SHA256-PAYLOAD\";\nconst UNSIGNED_PAYLOAD = \"UNSIGNED-PAYLOAD\";\nconst MAX_CACHE_SIZE = 50;\nconst KEY_TYPE_IDENTIFIER = \"aws4_request\";\nconst MAX_PRESIGNED_TTL = 60 * 60 * 24 * 7;\n\nconst signingKeyCache = {};\nconst cacheQueue = [];\nconst createScope = (shortDate, region, service) => `${shortDate}/${region}/${service}/${KEY_TYPE_IDENTIFIER}`;\nconst getSigningKey = async (sha256Constructor, credentials, shortDate, region, service) => {\n    const credsHash = await hmac(sha256Constructor, credentials.secretAccessKey, credentials.accessKeyId);\n    const cacheKey = `${shortDate}:${region}:${service}:${toHex(credsHash)}:${credentials.sessionToken}`;\n    if (cacheKey in signingKeyCache) {\n        return signingKeyCache[cacheKey];\n    }\n    cacheQueue.push(cacheKey);\n    while (cacheQueue.length > MAX_CACHE_SIZE) {\n        delete signingKeyCache[cacheQueue.shift()];\n    }\n    let key = `AWS4${credentials.secretAccessKey}`;\n    for (const signable of [shortDate, region, service, KEY_TYPE_IDENTIFIER]) {\n        key = await hmac(sha256Constructor, key, signable);\n    }\n    return (signingKeyCache[cacheKey] = key);\n};\nconst hmac = (ctor, secret, data) => {\n    const hash = new ctor(secret);\n    hash.update(toUint8Array(data));\n    return hash.digest();\n};\n\nconst getCanonicalHeaders = ({ headers }, unsignableHeaders, signableHeaders) => {\n    const canonical = {};\n    for (const headerName of Object.keys(headers).sort()) {\n        if (headers[headerName] == undefined) {\n            continue;\n        }\n        const canonicalHeaderName = headerName.toLowerCase();\n        if (canonicalHeaderName in ALWAYS_UNSIGNABLE_HEADERS ||\n            unsignableHeaders?.has(canonicalHeaderName) ||\n            PROXY_HEADER_PATTERN.test(canonicalHeaderName) ||\n            SEC_HEADER_PATTERN.test(canonicalHeaderName)) {\n            if (!signableHeaders || (signableHeaders && !signableHeaders.has(canonicalHeaderName))) {\n                continue;\n            }\n        }\n        canonical[canonicalHeaderName] = headers[headerName].trim().replace(/\\s+/g, \" \");\n    }\n    return canonical;\n};\n\nconst escapeUri = (uri) => encodeURIComponent(uri).replace(/[!'()*]/g, hexEncode);\nconst hexEncode = (c) => `%${c.charCodeAt(0).toString(16).toUpperCase()}`;\n\nconst getCanonicalQuery = ({ query = {} }) => {\n    const keys = [];\n    const serialized = {};\n    for (const key of Object.keys(query).sort()) {\n        if (key.toLowerCase() === SIGNATURE_HEADER) {\n            continue;\n        }\n        keys.push(key);\n        const value = query[key];\n        if (typeof value === \"string\") {\n            serialized[key] = `${escapeUri(key)}=${escapeUri(value)}`;\n        }\n        else if (Array.isArray(value)) {\n            serialized[key] = value\n                .slice(0)\n                .sort()\n                .reduce((encoded, value) => encoded.concat([`${escapeUri(key)}=${escapeUri(value)}`]), [])\n                .join(\"&\");\n        }\n    }\n    return keys\n        .map((key) => serialized[key])\n        .filter((serialized) => serialized)\n        .join(\"&\");\n};\n\nconst isArrayBuffer = (arg) => (typeof ArrayBuffer === \"function\" && arg instanceof ArrayBuffer) ||\n    Object.prototype.toString.call(arg) === \"[object ArrayBuffer]\";\n\nconst getPayloadHash = async ({ headers, body }, hashConstructor) => {\n    for (const headerName of Object.keys(headers)) {\n        if (headerName.toLowerCase() === SHA256_HEADER) {\n            return headers[headerName];\n        }\n    }\n    if (body == undefined) {\n        return \"e3b0c44298fc1c149afbf4c8996fb92427ae41e4649b934ca495991b7852b855\";\n    }\n    else if (typeof body === \"string\" || ArrayBuffer.isView(body) || isArrayBuffer(body)) {\n        const hashCtor = new hashConstructor();\n        hashCtor.update(toUint8Array(body));\n        return toHex(await hashCtor.digest());\n    }\n    return UNSIGNED_PAYLOAD;\n};\n\nconst hasHeader = (soughtHeader, headers) => {\n    soughtHeader = soughtHeader.toLowerCase();\n    for (const headerName of Object.keys(headers)) {\n        if (soughtHeader === headerName.toLowerCase()) {\n            return true;\n        }\n    }\n    return false;\n};\n\nconst cloneRequest = ({ headers, query, ...rest }) => ({\n    ...rest,\n    headers: { ...headers },\n    query: query ? cloneQuery(query) : undefined,\n});\nconst cloneQuery = (query) => Object.keys(query).reduce((carry, paramName) => {\n    const param = query[paramName];\n    return {\n        ...carry,\n        [paramName]: Array.isArray(param) ? [...param] : param,\n    };\n}, {});\n\nconst moveHeadersToQuery = (request, options = {}) => {\n    const { headers, query = {} } = typeof request.clone === \"function\" ? request.clone() : cloneRequest(request);\n    for (const name of Object.keys(headers)) {\n        const lname = name.toLowerCase();\n        if (lname.slice(0, 6) === \"x-amz-\" && !options.unhoistableHeaders?.has(lname)) {\n            query[name] = headers[name];\n            delete headers[name];\n        }\n    }\n    return {\n        ...request,\n        headers,\n        query,\n    };\n};\n\nconst prepareRequest = (request) => {\n    request = typeof request.clone === \"function\" ? request.clone() : cloneRequest(request);\n    for (const headerName of Object.keys(request.headers)) {\n        if (GENERATED_HEADERS.indexOf(headerName.toLowerCase()) > -1) {\n            delete request.headers[headerName];\n        }\n    }\n    return request;\n};\n\nconst iso8601 = (time) => toDate(time)\n    .toISOString()\n    .replace(/\\.\\d{3}Z$/, \"Z\");\nconst toDate = (time) => {\n    if (typeof time === \"number\") {\n        return new Date(time * 1000);\n    }\n    if (typeof time === \"string\") {\n        if (Number(time)) {\n            return new Date(Number(time) * 1000);\n        }\n        return new Date(time);\n    }\n    return time;\n};\n\nclass SignatureV4 {\n    constructor({ applyChecksum, credentials, region, service, sha256, uriEscapePath = true, }) {\n        this.headerMarshaller = new HeaderMarshaller(toUtf8$3, fromUtf8$3);\n        this.service = service;\n        this.sha256 = sha256;\n        this.uriEscapePath = uriEscapePath;\n        this.applyChecksum = typeof applyChecksum === \"boolean\" ? applyChecksum : true;\n        this.regionProvider = normalizeProvider(region);\n        this.credentialProvider = normalizeProvider(credentials);\n    }\n    async presign(originalRequest, options = {}) {\n        const { signingDate = new Date(), expiresIn = 3600, unsignableHeaders, unhoistableHeaders, signableHeaders, signingRegion, signingService, } = options;\n        const credentials = await this.credentialProvider();\n        this.validateResolvedCredentials(credentials);\n        const region = signingRegion ?? (await this.regionProvider());\n        const { longDate, shortDate } = formatDate(signingDate);\n        if (expiresIn > MAX_PRESIGNED_TTL) {\n            return Promise.reject(\"Signature version 4 presigned URLs\" + \" must have an expiration date less than one week in\" + \" the future\");\n        }\n        const scope = createScope(shortDate, region, signingService ?? this.service);\n        const request = moveHeadersToQuery(prepareRequest(originalRequest), { unhoistableHeaders });\n        if (credentials.sessionToken) {\n            request.query[TOKEN_QUERY_PARAM] = credentials.sessionToken;\n        }\n        request.query[ALGORITHM_QUERY_PARAM] = ALGORITHM_IDENTIFIER;\n        request.query[CREDENTIAL_QUERY_PARAM] = `${credentials.accessKeyId}/${scope}`;\n        request.query[AMZ_DATE_QUERY_PARAM] = longDate;\n        request.query[EXPIRES_QUERY_PARAM] = expiresIn.toString(10);\n        const canonicalHeaders = getCanonicalHeaders(request, unsignableHeaders, signableHeaders);\n        request.query[SIGNED_HEADERS_QUERY_PARAM] = getCanonicalHeaderList(canonicalHeaders);\n        request.query[SIGNATURE_QUERY_PARAM] = await this.getSignature(longDate, scope, this.getSigningKey(credentials, region, shortDate, signingService), this.createCanonicalRequest(request, canonicalHeaders, await getPayloadHash(originalRequest, this.sha256)));\n        return request;\n    }\n    async sign(toSign, options) {\n        if (typeof toSign === \"string\") {\n            return this.signString(toSign, options);\n        }\n        else if (toSign.headers && toSign.payload) {\n            return this.signEvent(toSign, options);\n        }\n        else if (toSign.message) {\n            return this.signMessage(toSign, options);\n        }\n        else {\n            return this.signRequest(toSign, options);\n        }\n    }\n    async signEvent({ headers, payload }, { signingDate = new Date(), priorSignature, signingRegion, signingService }) {\n        const region = signingRegion ?? (await this.regionProvider());\n        const { shortDate, longDate } = formatDate(signingDate);\n        const scope = createScope(shortDate, region, signingService ?? this.service);\n        const hashedPayload = await getPayloadHash({ headers: {}, body: payload }, this.sha256);\n        const hash = new this.sha256();\n        hash.update(headers);\n        const hashedHeaders = toHex(await hash.digest());\n        const stringToSign = [\n            EVENT_ALGORITHM_IDENTIFIER,\n            longDate,\n            scope,\n            priorSignature,\n            hashedHeaders,\n            hashedPayload,\n        ].join(\"\\n\");\n        return this.signString(stringToSign, { signingDate, signingRegion: region, signingService });\n    }\n    async signMessage(signableMessage, { signingDate = new Date(), signingRegion, signingService }) {\n        const promise = this.signEvent({\n            headers: this.headerMarshaller.format(signableMessage.message.headers),\n            payload: signableMessage.message.body,\n        }, {\n            signingDate,\n            signingRegion,\n            signingService,\n            priorSignature: signableMessage.priorSignature,\n        });\n        return promise.then((signature) => {\n            return { message: signableMessage.message, signature };\n        });\n    }\n    async signString(stringToSign, { signingDate = new Date(), signingRegion, signingService } = {}) {\n        const credentials = await this.credentialProvider();\n        this.validateResolvedCredentials(credentials);\n        const region = signingRegion ?? (await this.regionProvider());\n        const { shortDate } = formatDate(signingDate);\n        const hash = new this.sha256(await this.getSigningKey(credentials, region, shortDate, signingService));\n        hash.update(toUint8Array(stringToSign));\n        return toHex(await hash.digest());\n    }\n    async signRequest(requestToSign, { signingDate = new Date(), signableHeaders, unsignableHeaders, signingRegion, signingService, } = {}) {\n        const credentials = await this.credentialProvider();\n        this.validateResolvedCredentials(credentials);\n        const region = signingRegion ?? (await this.regionProvider());\n        const request = prepareRequest(requestToSign);\n        const { longDate, shortDate } = formatDate(signingDate);\n        const scope = createScope(shortDate, region, signingService ?? this.service);\n        request.headers[AMZ_DATE_HEADER] = longDate;\n        if (credentials.sessionToken) {\n            request.headers[TOKEN_HEADER] = credentials.sessionToken;\n        }\n        const payloadHash = await getPayloadHash(request, this.sha256);\n        if (!hasHeader(SHA256_HEADER, request.headers) && this.applyChecksum) {\n            request.headers[SHA256_HEADER] = payloadHash;\n        }\n        const canonicalHeaders = getCanonicalHeaders(request, unsignableHeaders, signableHeaders);\n        const signature = await this.getSignature(longDate, scope, this.getSigningKey(credentials, region, shortDate, signingService), this.createCanonicalRequest(request, canonicalHeaders, payloadHash));\n        request.headers[AUTH_HEADER] =\n            `${ALGORITHM_IDENTIFIER} ` +\n                `Credential=${credentials.accessKeyId}/${scope}, ` +\n                `SignedHeaders=${getCanonicalHeaderList(canonicalHeaders)}, ` +\n                `Signature=${signature}`;\n        return request;\n    }\n    createCanonicalRequest(request, canonicalHeaders, payloadHash) {\n        const sortedHeaders = Object.keys(canonicalHeaders).sort();\n        return `${request.method}\n${this.getCanonicalPath(request)}\n${getCanonicalQuery(request)}\n${sortedHeaders.map((name) => `${name}:${canonicalHeaders[name]}`).join(\"\\n\")}\n\n${sortedHeaders.join(\";\")}\n${payloadHash}`;\n    }\n    async createStringToSign(longDate, credentialScope, canonicalRequest) {\n        const hash = new this.sha256();\n        hash.update(toUint8Array(canonicalRequest));\n        const hashedRequest = await hash.digest();\n        return `${ALGORITHM_IDENTIFIER}\n${longDate}\n${credentialScope}\n${toHex(hashedRequest)}`;\n    }\n    getCanonicalPath({ path }) {\n        if (this.uriEscapePath) {\n            const normalizedPathSegments = [];\n            for (const pathSegment of path.split(\"/\")) {\n                if (pathSegment?.length === 0)\n                    continue;\n                if (pathSegment === \".\")\n                    continue;\n                if (pathSegment === \"..\") {\n                    normalizedPathSegments.pop();\n                }\n                else {\n                    normalizedPathSegments.push(pathSegment);\n                }\n            }\n            const normalizedPath = `${path?.startsWith(\"/\") ? \"/\" : \"\"}${normalizedPathSegments.join(\"/\")}${normalizedPathSegments.length > 0 && path?.endsWith(\"/\") ? \"/\" : \"\"}`;\n            const doubleEncoded = encodeURIComponent(normalizedPath);\n            return doubleEncoded.replace(/%2F/g, \"/\");\n        }\n        return path;\n    }\n    async getSignature(longDate, credentialScope, keyPromise, canonicalRequest) {\n        const stringToSign = await this.createStringToSign(longDate, credentialScope, canonicalRequest);\n        const hash = new this.sha256(await keyPromise);\n        hash.update(toUint8Array(stringToSign));\n        return toHex(await hash.digest());\n    }\n    getSigningKey(credentials, region, shortDate, service) {\n        return getSigningKey(this.sha256, credentials, shortDate, region, service || this.service);\n    }\n    validateResolvedCredentials(credentials) {\n        if (typeof credentials !== \"object\" ||\n            typeof credentials.accessKeyId !== \"string\" ||\n            typeof credentials.secretAccessKey !== \"string\") {\n            throw new Error(\"Resolved credential object is not valid\");\n        }\n    }\n}\nconst formatDate = (now) => {\n    const longDate = iso8601(now).replace(/[\\-:]/g, \"\");\n    return {\n        longDate,\n        shortDate: longDate.slice(0, 8),\n    };\n};\nconst getCanonicalHeaderList = (headers) => Object.keys(headers).sort().join(\";\");\n\nconst CREDENTIAL_EXPIRE_WINDOW = 300000;\nconst resolveAwsAuthConfig = (input) => {\n    const normalizedCreds = input.credentials\n        ? normalizeCredentialProvider(input.credentials)\n        : input.credentialDefaultProvider(input);\n    const { signingEscapePath = true, systemClockOffset = input.systemClockOffset || 0, sha256 } = input;\n    let signer;\n    if (input.signer) {\n        signer = normalizeProvider(input.signer);\n    }\n    else if (input.regionInfoProvider) {\n        signer = () => normalizeProvider(input.region)()\n            .then(async (region) => [\n            (await input.regionInfoProvider(region, {\n                useFipsEndpoint: await input.useFipsEndpoint(),\n                useDualstackEndpoint: await input.useDualstackEndpoint(),\n            })) || {},\n            region,\n        ])\n            .then(([regionInfo, region]) => {\n            const { signingRegion, signingService } = regionInfo;\n            input.signingRegion = input.signingRegion || signingRegion || region;\n            input.signingName = input.signingName || signingService || input.serviceId;\n            const params = {\n                ...input,\n                credentials: normalizedCreds,\n                region: input.signingRegion,\n                service: input.signingName,\n                sha256,\n                uriEscapePath: signingEscapePath,\n            };\n            const SignerCtor = input.signerConstructor || SignatureV4;\n            return new SignerCtor(params);\n        });\n    }\n    else {\n        signer = async (authScheme) => {\n            authScheme = Object.assign({}, {\n                name: \"sigv4\",\n                signingName: input.signingName || input.defaultSigningName,\n                signingRegion: await normalizeProvider(input.region)(),\n                properties: {},\n            }, authScheme);\n            const signingRegion = authScheme.signingRegion;\n            const signingService = authScheme.signingName;\n            input.signingRegion = input.signingRegion || signingRegion;\n            input.signingName = input.signingName || signingService || input.serviceId;\n            const params = {\n                ...input,\n                credentials: normalizedCreds,\n                region: input.signingRegion,\n                service: input.signingName,\n                sha256,\n                uriEscapePath: signingEscapePath,\n            };\n            const SignerCtor = input.signerConstructor || SignatureV4;\n            return new SignerCtor(params);\n        };\n    }\n    return {\n        ...input,\n        systemClockOffset,\n        signingEscapePath,\n        credentials: normalizedCreds,\n        signer,\n    };\n};\nconst normalizeCredentialProvider = (credentials) => {\n    if (typeof credentials === \"function\") {\n        return memoize(credentials, (credentials) => credentials.expiration !== undefined &&\n            credentials.expiration.getTime() - Date.now() < CREDENTIAL_EXPIRE_WINDOW, (credentials) => credentials.expiration !== undefined);\n    }\n    return normalizeProvider(credentials);\n};\n\nfunction resolveUserAgentConfig(input) {\n    return {\n        ...input,\n        customUserAgent: typeof input.customUserAgent === \"string\" ? [[input.customUserAgent]] : input.customUserAgent,\n    };\n}\n\nconst partitions = [\n  {\n    id: \"aws\",\n    outputs: {\n      dnsSuffix: \"amazonaws.com\",\n      dualStackDnsSuffix: \"api.aws\",\n      name: \"aws\",\n      supportsDualStack: true,\n      supportsFIPS: true\n    },\n    regionRegex: \"^(us|eu|ap|sa|ca|me|af)\\\\-\\\\w+\\\\-\\\\d+$\",\n    regions: {\n      \"af-south-1\": {\n        description: \"Africa (Cape Town)\"\n      },\n      \"ap-east-1\": {\n        description: \"Asia Pacific (Hong Kong)\"\n      },\n      \"ap-northeast-1\": {\n        description: \"Asia Pacific (Tokyo)\"\n      },\n      \"ap-northeast-2\": {\n        description: \"Asia Pacific (Seoul)\"\n      },\n      \"ap-northeast-3\": {\n        description: \"Asia Pacific (Osaka)\"\n      },\n      \"ap-south-1\": {\n        description: \"Asia Pacific (Mumbai)\"\n      },\n      \"ap-south-2\": {\n        description: \"Asia Pacific (Hyderabad)\"\n      },\n      \"ap-southeast-1\": {\n        description: \"Asia Pacific (Singapore)\"\n      },\n      \"ap-southeast-2\": {\n        description: \"Asia Pacific (Sydney)\"\n      },\n      \"ap-southeast-3\": {\n        description: \"Asia Pacific (Jakarta)\"\n      },\n      \"ap-southeast-4\": {\n        description: \"Asia Pacific (Melbourne)\"\n      },\n      \"aws-global\": {\n        description: \"AWS Standard global region\"\n      },\n      \"ca-central-1\": {\n        description: \"Canada (Central)\"\n      },\n      \"eu-central-1\": {\n        description: \"Europe (Frankfurt)\"\n      },\n      \"eu-central-2\": {\n        description: \"Europe (Zurich)\"\n      },\n      \"eu-north-1\": {\n        description: \"Europe (Stockholm)\"\n      },\n      \"eu-south-1\": {\n        description: \"Europe (Milan)\"\n      },\n      \"eu-south-2\": {\n        description: \"Europe (Spain)\"\n      },\n      \"eu-west-1\": {\n        description: \"Europe (Ireland)\"\n      },\n      \"eu-west-2\": {\n        description: \"Europe (London)\"\n      },\n      \"eu-west-3\": {\n        description: \"Europe (Paris)\"\n      },\n      \"me-central-1\": {\n        description: \"Middle East (UAE)\"\n      },\n      \"me-south-1\": {\n        description: \"Middle East (Bahrain)\"\n      },\n      \"sa-east-1\": {\n        description: \"South America (Sao Paulo)\"\n      },\n      \"us-east-1\": {\n        description: \"US East (N. Virginia)\"\n      },\n      \"us-east-2\": {\n        description: \"US East (Ohio)\"\n      },\n      \"us-west-1\": {\n        description: \"US West (N. California)\"\n      },\n      \"us-west-2\": {\n        description: \"US West (Oregon)\"\n      }\n    }\n  },\n  {\n    id: \"aws-cn\",\n    outputs: {\n      dnsSuffix: \"amazonaws.com.cn\",\n      dualStackDnsSuffix: \"api.amazonwebservices.com.cn\",\n      name: \"aws-cn\",\n      supportsDualStack: true,\n      supportsFIPS: true\n    },\n    regionRegex: \"^cn\\\\-\\\\w+\\\\-\\\\d+$\",\n    regions: {\n      \"aws-cn-global\": {\n        description: \"AWS China global region\"\n      },\n      \"cn-north-1\": {\n        description: \"China (Beijing)\"\n      },\n      \"cn-northwest-1\": {\n        description: \"China (Ningxia)\"\n      }\n    }\n  },\n  {\n    id: \"aws-us-gov\",\n    outputs: {\n      dnsSuffix: \"amazonaws.com\",\n      dualStackDnsSuffix: \"api.aws\",\n      name: \"aws-us-gov\",\n      supportsDualStack: true,\n      supportsFIPS: true\n    },\n    regionRegex: \"^us\\\\-gov\\\\-\\\\w+\\\\-\\\\d+$\",\n    regions: {\n      \"aws-us-gov-global\": {\n        description: \"AWS GovCloud (US) global region\"\n      },\n      \"us-gov-east-1\": {\n        description: \"AWS GovCloud (US-East)\"\n      },\n      \"us-gov-west-1\": {\n        description: \"AWS GovCloud (US-West)\"\n      }\n    }\n  },\n  {\n    id: \"aws-iso\",\n    outputs: {\n      dnsSuffix: \"c2s.ic.gov\",\n      dualStackDnsSuffix: \"c2s.ic.gov\",\n      name: \"aws-iso\",\n      supportsDualStack: false,\n      supportsFIPS: true\n    },\n    regionRegex: \"^us\\\\-iso\\\\-\\\\w+\\\\-\\\\d+$\",\n    regions: {\n      \"aws-iso-global\": {\n        description: \"AWS ISO (US) global region\"\n      },\n      \"us-iso-east-1\": {\n        description: \"US ISO East\"\n      },\n      \"us-iso-west-1\": {\n        description: \"US ISO WEST\"\n      }\n    }\n  },\n  {\n    id: \"aws-iso-b\",\n    outputs: {\n      dnsSuffix: \"sc2s.sgov.gov\",\n      dualStackDnsSuffix: \"sc2s.sgov.gov\",\n      name: \"aws-iso-b\",\n      supportsDualStack: false,\n      supportsFIPS: true\n    },\n    regionRegex: \"^us\\\\-isob\\\\-\\\\w+\\\\-\\\\d+$\",\n    regions: {\n      \"aws-iso-b-global\": {\n        description: \"AWS ISOB (US) global region\"\n      },\n      \"us-isob-east-1\": {\n        description: \"US ISOB East (Ohio)\"\n      }\n    }\n  },\n  {\n    id: \"aws-iso-e\",\n    outputs: {\n      dnsSuffix: \"cloud.adc-e.uk\",\n      dualStackDnsSuffix: \"cloud.adc-e.uk\",\n      name: \"aws-iso-e\",\n      supportsDualStack: false,\n      supportsFIPS: true\n    },\n    regionRegex: \"^eu\\\\-isoe\\\\-\\\\w+\\\\-\\\\d+$\",\n    regions: {\n    }\n  },\n  {\n    id: \"aws-iso-f\",\n    outputs: {\n      dnsSuffix: \"csp.hci.ic.gov\",\n      dualStackDnsSuffix: \"csp.hci.ic.gov\",\n      name: \"aws-iso-f\",\n      supportsDualStack: false,\n      supportsFIPS: true\n    },\n    regionRegex: \"^us\\\\-isof\\\\-\\\\w+\\\\-\\\\d+$\",\n    regions: {\n    }\n  }\n];\nconst version$1 = \"1.1\";\nvar partitionsInfo = {\n  partitions: partitions,\n  version: version$1\n};\n\nlet selectedPartitionsInfo = partitionsInfo;\nlet selectedUserAgentPrefix = \"\";\nconst partition = (value) => {\n    const { partitions } = selectedPartitionsInfo;\n    for (const partition of partitions) {\n        const { regions, outputs } = partition;\n        for (const [region, regionData] of Object.entries(regions)) {\n            if (region === value) {\n                return {\n                    ...outputs,\n                    ...regionData,\n                };\n            }\n        }\n    }\n    for (const partition of partitions) {\n        const { regionRegex, outputs } = partition;\n        if (new RegExp(regionRegex).test(value)) {\n            return {\n                ...outputs,\n            };\n        }\n    }\n    const DEFAULT_PARTITION = partitions.find((partition) => partition.id === \"aws\");\n    if (!DEFAULT_PARTITION) {\n        throw new Error(\"Provided region was not found in the partition array or regex,\" +\n            \" and default partition with id 'aws' doesn't exist.\");\n    }\n    return {\n        ...DEFAULT_PARTITION.outputs,\n    };\n};\nconst setPartitionInfo = (partitionsInfo, userAgentPrefix = \"\") => {\n    selectedPartitionsInfo = partitionsInfo;\n    selectedUserAgentPrefix = userAgentPrefix;\n};\nconst useDefaultPartitionInfo = () => {\n    setPartitionInfo(partitionsInfo, \"\");\n};\nconst getUserAgentPrefix = () => selectedUserAgentPrefix;\n\nconst IP_V4_REGEX = new RegExp(`^(?:25[0-5]|2[0-4]\\\\d|1\\\\d\\\\d|[1-9]\\\\d|\\\\d)(?:\\\\.(?:25[0-5]|2[0-4]\\\\d|1\\\\d\\\\d|[1-9]\\\\d|\\\\d)){3}$`);\nconst isIpAddress = (value) => IP_V4_REGEX.test(value) || (value.startsWith(\"[\") && value.endsWith(\"]\"));\n\nconst debugId = \"endpoints\";\n\nfunction toDebugString(input) {\n    if (typeof input !== \"object\" || input == null) {\n        return input;\n    }\n    if (\"ref\" in input) {\n        return `$${toDebugString(input.ref)}`;\n    }\n    if (\"fn\" in input) {\n        return `${input.fn}(${(input.argv || []).map(toDebugString).join(\", \")})`;\n    }\n    return JSON.stringify(input, null, 2);\n}\n\nclass EndpointError extends Error {\n    constructor(message) {\n        super(message);\n        this.name = \"EndpointError\";\n    }\n}\n\nconst VALID_HOST_LABEL_REGEX = new RegExp(`^(?!.*-$)(?!-)[a-zA-Z0-9-]{1,63}$`);\nconst isValidHostLabel = (value, allowSubDomains = false) => {\n    if (!allowSubDomains) {\n        return VALID_HOST_LABEL_REGEX.test(value);\n    }\n    const labels = value.split(\".\");\n    for (const label of labels) {\n        if (!isValidHostLabel(label)) {\n            return false;\n        }\n    }\n    return true;\n};\n\nconst isVirtualHostableS3Bucket = (value, allowSubDomains = false) => {\n    if (allowSubDomains) {\n        for (const label of value.split(\".\")) {\n            if (!isVirtualHostableS3Bucket(label)) {\n                return false;\n            }\n        }\n        return true;\n    }\n    if (!isValidHostLabel(value)) {\n        return false;\n    }\n    if (value.length < 3 || value.length > 63) {\n        return false;\n    }\n    if (value !== value.toLowerCase()) {\n        return false;\n    }\n    if (isIpAddress(value)) {\n        return false;\n    }\n    return true;\n};\n\nconst parseArn = (value) => {\n    const segments = value.split(\":\");\n    if (segments.length < 6)\n        return null;\n    const [arn, partition, service, region, accountId, ...resourceId] = segments;\n    if (arn !== \"arn\" || partition === \"\" || service === \"\" || resourceId[0] === \"\")\n        return null;\n    return {\n        partition,\n        service,\n        region,\n        accountId,\n        resourceId: resourceId[0].includes(\"/\") ? resourceId[0].split(\"/\") : resourceId,\n    };\n};\n\nvar index = /*#__PURE__*/Object.freeze({\n    __proto__: null,\n    isVirtualHostableS3Bucket: isVirtualHostableS3Bucket,\n    parseArn: parseArn,\n    partition: partition,\n    setPartitionInfo: setPartitionInfo,\n    useDefaultPartitionInfo: useDefaultPartitionInfo,\n    getUserAgentPrefix: getUserAgentPrefix\n});\n\nconst booleanEquals = (value1, value2) => value1 === value2;\n\nconst getAttrPathList = (path) => {\n    const parts = path.split(\".\");\n    const pathList = [];\n    for (const part of parts) {\n        const squareBracketIndex = part.indexOf(\"[\");\n        if (squareBracketIndex !== -1) {\n            if (part.indexOf(\"]\") !== part.length - 1) {\n                throw new EndpointError(`Path: '${path}' does not end with ']'`);\n            }\n            const arrayIndex = part.slice(squareBracketIndex + 1, -1);\n            if (Number.isNaN(parseInt(arrayIndex))) {\n                throw new EndpointError(`Invalid array index: '${arrayIndex}' in path: '${path}'`);\n            }\n            if (squareBracketIndex !== 0) {\n                pathList.push(part.slice(0, squareBracketIndex));\n            }\n            pathList.push(arrayIndex);\n        }\n        else {\n            pathList.push(part);\n        }\n    }\n    return pathList;\n};\n\nconst getAttr = (value, path) => getAttrPathList(path).reduce((acc, index) => {\n    if (typeof acc !== \"object\") {\n        throw new EndpointError(`Index '${index}' in '${path}' not found in '${JSON.stringify(value)}'`);\n    }\n    else if (Array.isArray(acc)) {\n        return acc[parseInt(index)];\n    }\n    return acc[index];\n}, value);\n\nconst isSet = (value) => value != null;\n\nconst not = (value) => !value;\n\nvar HostAddressType;\n(function (HostAddressType) {\n    HostAddressType[\"AAAA\"] = \"AAAA\";\n    HostAddressType[\"A\"] = \"A\";\n})(HostAddressType || (HostAddressType = {}));\n\nconst DEFAULT_PORTS = {\n    [EndpointURLScheme.HTTP]: 80,\n    [EndpointURLScheme.HTTPS]: 443,\n};\nconst parseURL = (value) => {\n    const whatwgURL = (() => {\n        try {\n            if (value instanceof URL) {\n                return value;\n            }\n            if (typeof value === \"object\" && \"hostname\" in value) {\n                const { hostname, port, protocol = \"\", path = \"\", query = {} } = value;\n                const url = new URL(`${protocol}//${hostname}${port ? `:${port}` : \"\"}${path}`);\n                url.search = Object.entries(query)\n                    .map(([k, v]) => `${k}=${v}`)\n                    .join(\"&\");\n                return url;\n            }\n            return new URL(value);\n        }\n        catch (error) {\n            return null;\n        }\n    })();\n    if (!whatwgURL) {\n        console.error(`Unable to parse ${JSON.stringify(value)} as a whatwg URL.`);\n        return null;\n    }\n    const urlString = whatwgURL.href;\n    const { host, hostname, pathname, protocol, search } = whatwgURL;\n    if (search) {\n        return null;\n    }\n    const scheme = protocol.slice(0, -1);\n    if (!Object.values(EndpointURLScheme).includes(scheme)) {\n        return null;\n    }\n    const isIp = isIpAddress(hostname);\n    const inputContainsDefaultPort = urlString.includes(`${host}:${DEFAULT_PORTS[scheme]}`) ||\n        (typeof value === \"string\" && value.includes(`${host}:${DEFAULT_PORTS[scheme]}`));\n    const authority = `${host}${inputContainsDefaultPort ? `:${DEFAULT_PORTS[scheme]}` : ``}`;\n    return {\n        scheme,\n        authority,\n        path: pathname,\n        normalizedPath: pathname.endsWith(\"/\") ? pathname : `${pathname}/`,\n        isIp,\n    };\n};\n\nconst stringEquals = (value1, value2) => value1 === value2;\n\nconst substring = (input, start, stop, reverse) => {\n    if (start >= stop || input.length < stop) {\n        return null;\n    }\n    if (!reverse) {\n        return input.substring(start, stop);\n    }\n    return input.substring(input.length - stop, input.length - start);\n};\n\nconst uriEncode = (value) => encodeURIComponent(value).replace(/[!*'()]/g, (c) => `%${c.charCodeAt(0).toString(16).toUpperCase()}`);\n\nvar lib = /*#__PURE__*/Object.freeze({\n    __proto__: null,\n    aws: index,\n    booleanEquals: booleanEquals,\n    getAttr: getAttr,\n    isSet: isSet,\n    isValidHostLabel: isValidHostLabel,\n    not: not,\n    parseURL: parseURL,\n    stringEquals: stringEquals,\n    substring: substring,\n    uriEncode: uriEncode\n});\n\nconst evaluateTemplate = (template, options) => {\n    const evaluatedTemplateArr = [];\n    const templateContext = {\n        ...options.endpointParams,\n        ...options.referenceRecord,\n    };\n    let currentIndex = 0;\n    while (currentIndex < template.length) {\n        const openingBraceIndex = template.indexOf(\"{\", currentIndex);\n        if (openingBraceIndex === -1) {\n            evaluatedTemplateArr.push(template.slice(currentIndex));\n            break;\n        }\n        evaluatedTemplateArr.push(template.slice(currentIndex, openingBraceIndex));\n        const closingBraceIndex = template.indexOf(\"}\", openingBraceIndex);\n        if (closingBraceIndex === -1) {\n            evaluatedTemplateArr.push(template.slice(openingBraceIndex));\n            break;\n        }\n        if (template[openingBraceIndex + 1] === \"{\" && template[closingBraceIndex + 1] === \"}\") {\n            evaluatedTemplateArr.push(template.slice(openingBraceIndex + 1, closingBraceIndex));\n            currentIndex = closingBraceIndex + 2;\n        }\n        const parameterName = template.substring(openingBraceIndex + 1, closingBraceIndex);\n        if (parameterName.includes(\"#\")) {\n            const [refName, attrName] = parameterName.split(\"#\");\n            evaluatedTemplateArr.push(getAttr(templateContext[refName], attrName));\n        }\n        else {\n            evaluatedTemplateArr.push(templateContext[parameterName]);\n        }\n        currentIndex = closingBraceIndex + 1;\n    }\n    return evaluatedTemplateArr.join(\"\");\n};\n\nconst getReferenceValue = ({ ref }, options) => {\n    const referenceRecord = {\n        ...options.endpointParams,\n        ...options.referenceRecord,\n    };\n    return referenceRecord[ref];\n};\n\nconst evaluateExpression = (obj, keyName, options) => {\n    if (typeof obj === \"string\") {\n        return evaluateTemplate(obj, options);\n    }\n    else if (obj[\"fn\"]) {\n        return callFunction(obj, options);\n    }\n    else if (obj[\"ref\"]) {\n        return getReferenceValue(obj, options);\n    }\n    throw new EndpointError(`'${keyName}': ${String(obj)} is not a string, function or reference.`);\n};\n\nconst callFunction = ({ fn, argv }, options) => {\n    const evaluatedArgs = argv.map((arg) => [\"boolean\", \"number\"].includes(typeof arg) ? arg : evaluateExpression(arg, \"arg\", options));\n    return fn.split(\".\").reduce((acc, key) => acc[key], lib)(...evaluatedArgs);\n};\n\nconst evaluateCondition = ({ assign, ...fnArgs }, options) => {\n    if (assign && assign in options.referenceRecord) {\n        throw new EndpointError(`'${assign}' is already defined in Reference Record.`);\n    }\n    const value = callFunction(fnArgs, options);\n    options.logger?.debug?.(debugId, `evaluateCondition: ${toDebugString(fnArgs)} = ${toDebugString(value)}`);\n    return {\n        result: value === \"\" ? true : !!value,\n        ...(assign != null && { toAssign: { name: assign, value } }),\n    };\n};\n\nconst evaluateConditions = (conditions = [], options) => {\n    const conditionsReferenceRecord = {};\n    for (const condition of conditions) {\n        const { result, toAssign } = evaluateCondition(condition, {\n            ...options,\n            referenceRecord: {\n                ...options.referenceRecord,\n                ...conditionsReferenceRecord,\n            },\n        });\n        if (!result) {\n            return { result };\n        }\n        if (toAssign) {\n            conditionsReferenceRecord[toAssign.name] = toAssign.value;\n            options.logger?.debug?.(debugId, `assign: ${toAssign.name} := ${toDebugString(toAssign.value)}`);\n        }\n    }\n    return { result: true, referenceRecord: conditionsReferenceRecord };\n};\n\nconst getEndpointHeaders = (headers, options) => Object.entries(headers).reduce((acc, [headerKey, headerVal]) => ({\n    ...acc,\n    [headerKey]: headerVal.map((headerValEntry) => {\n        const processedExpr = evaluateExpression(headerValEntry, \"Header value entry\", options);\n        if (typeof processedExpr !== \"string\") {\n            throw new EndpointError(`Header '${headerKey}' value '${processedExpr}' is not a string`);\n        }\n        return processedExpr;\n    }),\n}), {});\n\nconst getEndpointProperty = (property, options) => {\n    if (Array.isArray(property)) {\n        return property.map((propertyEntry) => getEndpointProperty(propertyEntry, options));\n    }\n    switch (typeof property) {\n        case \"string\":\n            return evaluateTemplate(property, options);\n        case \"object\":\n            if (property === null) {\n                throw new EndpointError(`Unexpected endpoint property: ${property}`);\n            }\n            return getEndpointProperties(property, options);\n        case \"boolean\":\n            return property;\n        default:\n            throw new EndpointError(`Unexpected endpoint property type: ${typeof property}`);\n    }\n};\n\nconst getEndpointProperties = (properties, options) => Object.entries(properties).reduce((acc, [propertyKey, propertyVal]) => ({\n    ...acc,\n    [propertyKey]: getEndpointProperty(propertyVal, options),\n}), {});\n\nconst getEndpointUrl = (endpointUrl, options) => {\n    const expression = evaluateExpression(endpointUrl, \"Endpoint URL\", options);\n    if (typeof expression === \"string\") {\n        try {\n            return new URL(expression);\n        }\n        catch (error) {\n            console.error(`Failed to construct URL with ${expression}`, error);\n            throw error;\n        }\n    }\n    throw new EndpointError(`Endpoint URL must be a string, got ${typeof expression}`);\n};\n\nconst evaluateEndpointRule = (endpointRule, options) => {\n    const { conditions, endpoint } = endpointRule;\n    const { result, referenceRecord } = evaluateConditions(conditions, options);\n    if (!result) {\n        return;\n    }\n    const endpointRuleOptions = {\n        ...options,\n        referenceRecord: { ...options.referenceRecord, ...referenceRecord },\n    };\n    const { url, properties, headers } = endpoint;\n    options.logger?.debug?.(debugId, `Resolving endpoint from template: ${toDebugString(endpoint)}`);\n    return {\n        ...(headers != undefined && {\n            headers: getEndpointHeaders(headers, endpointRuleOptions),\n        }),\n        ...(properties != undefined && {\n            properties: getEndpointProperties(properties, endpointRuleOptions),\n        }),\n        url: getEndpointUrl(url, endpointRuleOptions),\n    };\n};\n\nconst evaluateErrorRule = (errorRule, options) => {\n    const { conditions, error } = errorRule;\n    const { result, referenceRecord } = evaluateConditions(conditions, options);\n    if (!result) {\n        return;\n    }\n    throw new EndpointError(evaluateExpression(error, \"Error\", {\n        ...options,\n        referenceRecord: { ...options.referenceRecord, ...referenceRecord },\n    }));\n};\n\nconst evaluateTreeRule = (treeRule, options) => {\n    const { conditions, rules } = treeRule;\n    const { result, referenceRecord } = evaluateConditions(conditions, options);\n    if (!result) {\n        return;\n    }\n    return evaluateRules(rules, {\n        ...options,\n        referenceRecord: { ...options.referenceRecord, ...referenceRecord },\n    });\n};\n\nconst evaluateRules = (rules, options) => {\n    for (const rule of rules) {\n        if (rule.type === \"endpoint\") {\n            const endpointOrUndefined = evaluateEndpointRule(rule, options);\n            if (endpointOrUndefined) {\n                return endpointOrUndefined;\n            }\n        }\n        else if (rule.type === \"error\") {\n            evaluateErrorRule(rule, options);\n        }\n        else if (rule.type === \"tree\") {\n            const endpointOrUndefined = evaluateTreeRule(rule, options);\n            if (endpointOrUndefined) {\n                return endpointOrUndefined;\n            }\n        }\n        else {\n            throw new EndpointError(`Unknown endpoint rule: ${rule}`);\n        }\n    }\n    throw new EndpointError(`Rules evaluation failed`);\n};\n\nconst resolveEndpoint = (ruleSetObject, options) => {\n    const { endpointParams, logger } = options;\n    const { parameters, rules } = ruleSetObject;\n    options.logger?.debug?.(`${debugId} Initial EndpointParams: ${toDebugString(endpointParams)}`);\n    const paramsWithDefault = Object.entries(parameters)\n        .filter(([, v]) => v.default != null)\n        .map(([k, v]) => [k, v.default]);\n    if (paramsWithDefault.length > 0) {\n        for (const [paramKey, paramDefaultValue] of paramsWithDefault) {\n            endpointParams[paramKey] = endpointParams[paramKey] ?? paramDefaultValue;\n        }\n    }\n    const requiredParams = Object.entries(parameters)\n        .filter(([, v]) => v.required)\n        .map(([k]) => k);\n    for (const requiredParam of requiredParams) {\n        if (endpointParams[requiredParam] == null) {\n            throw new EndpointError(`Missing required parameter: '${requiredParam}'`);\n        }\n    }\n    const endpoint = evaluateRules(rules, { endpointParams, logger, referenceRecord: {} });\n    if (options.endpointParams?.Endpoint) {\n        try {\n            const givenEndpoint = new URL(options.endpointParams.Endpoint);\n            const { protocol, port } = givenEndpoint;\n            endpoint.url.protocol = protocol;\n            endpoint.url.port = port;\n        }\n        catch (e) {\n        }\n    }\n    options.logger?.debug?.(`${debugId} Resolved endpoint: ${toDebugString(endpoint)}`);\n    return endpoint;\n};\n\nconst USER_AGENT = \"user-agent\";\nconst X_AMZ_USER_AGENT = \"x-amz-user-agent\";\nconst SPACE = \" \";\nconst UA_NAME_SEPARATOR = \"/\";\nconst UA_NAME_ESCAPE_REGEX = /[^\\!\\$\\%\\&\\'\\*\\+\\-\\.\\^\\_\\`\\|\\~\\d\\w]/g;\nconst UA_VALUE_ESCAPE_REGEX = /[^\\!\\$\\%\\&\\'\\*\\+\\-\\.\\^\\_\\`\\|\\~\\d\\w\\#]/g;\nconst UA_ESCAPE_CHAR = \"-\";\n\nconst userAgentMiddleware = (options) => (next, context) => async (args) => {\n    const { request } = args;\n    if (!HttpRequest.isInstance(request))\n        return next(args);\n    const { headers } = request;\n    const userAgent = context?.userAgent?.map(escapeUserAgent) || [];\n    const defaultUserAgent = (await options.defaultUserAgentProvider()).map(escapeUserAgent);\n    const customUserAgent = options?.customUserAgent?.map(escapeUserAgent) || [];\n    const prefix = getUserAgentPrefix();\n    const sdkUserAgentValue = (prefix ? [prefix] : [])\n        .concat([...defaultUserAgent, ...userAgent, ...customUserAgent])\n        .join(SPACE);\n    const normalUAValue = [\n        ...defaultUserAgent.filter((section) => section.startsWith(\"aws-sdk-\")),\n        ...customUserAgent,\n    ].join(SPACE);\n    if (options.runtime !== \"browser\") {\n        if (normalUAValue) {\n            headers[X_AMZ_USER_AGENT] = headers[X_AMZ_USER_AGENT]\n                ? `${headers[USER_AGENT]} ${normalUAValue}`\n                : normalUAValue;\n        }\n        headers[USER_AGENT] = sdkUserAgentValue;\n    }\n    else {\n        headers[X_AMZ_USER_AGENT] = sdkUserAgentValue;\n    }\n    return next({\n        ...args,\n        request,\n    });\n};\nconst escapeUserAgent = (userAgentPair) => {\n    const name = userAgentPair[0]\n        .split(UA_NAME_SEPARATOR)\n        .map((part) => part.replace(UA_NAME_ESCAPE_REGEX, UA_ESCAPE_CHAR))\n        .join(UA_NAME_SEPARATOR);\n    const version = userAgentPair[1]?.replace(UA_VALUE_ESCAPE_REGEX, UA_ESCAPE_CHAR);\n    const prefixSeparatorIndex = name.indexOf(UA_NAME_SEPARATOR);\n    const prefix = name.substring(0, prefixSeparatorIndex);\n    let uaName = name.substring(prefixSeparatorIndex + 1);\n    if (prefix === \"api\") {\n        uaName = uaName.toLowerCase();\n    }\n    return [prefix, uaName, version]\n        .filter((item) => item && item.length > 0)\n        .reduce((acc, item, index) => {\n        switch (index) {\n            case 0:\n                return item;\n            case 1:\n                return `${acc}/${item}`;\n            default:\n                return `${acc}#${item}`;\n        }\n    }, \"\");\n};\nconst getUserAgentMiddlewareOptions = {\n    name: \"getUserAgentMiddleware\",\n    step: \"build\",\n    priority: \"low\",\n    tags: [\"SET_USER_AGENT\", \"USER_AGENT\"],\n    override: true,\n};\nconst getUserAgentPlugin = (config) => ({\n    applyToStack: (clientStack) => {\n        clientStack.add(userAgentMiddleware(config), getUserAgentMiddlewareOptions);\n    },\n});\n\nvar SelectorType;\n(function (SelectorType) {\n    SelectorType[\"ENV\"] = \"env\";\n    SelectorType[\"CONFIG\"] = \"shared config entry\";\n})(SelectorType || (SelectorType = {}));\n\nconst DEFAULT_USE_DUALSTACK_ENDPOINT = false;\n\nconst DEFAULT_USE_FIPS_ENDPOINT = false;\n\nconst isFipsRegion = (region) => typeof region === \"string\" && (region.startsWith(\"fips-\") || region.endsWith(\"-fips\"));\n\nconst getRealRegion = (region) => isFipsRegion(region)\n    ? [\"fips-aws-global\", \"aws-fips\"].includes(region)\n        ? \"us-east-1\"\n        : region.replace(/fips-(dkr-|prod-)?|-fips/, \"\")\n    : region;\n\nconst resolveRegionConfig = (input) => {\n    const { region, useFipsEndpoint } = input;\n    if (!region) {\n        throw new Error(\"Region is missing\");\n    }\n    return {\n        ...input,\n        region: async () => {\n            if (typeof region === \"string\") {\n                return getRealRegion(region);\n            }\n            const providedRegion = await region();\n            return getRealRegion(providedRegion);\n        },\n        useFipsEndpoint: async () => {\n            const providedRegion = typeof region === \"string\" ? region : await region();\n            if (isFipsRegion(providedRegion)) {\n                return true;\n            }\n            return typeof useFipsEndpoint !== \"function\" ? Promise.resolve(!!useFipsEndpoint) : useFipsEndpoint();\n        },\n    };\n};\n\nconst CONTENT_LENGTH_HEADER = \"content-length\";\nfunction contentLengthMiddleware(bodyLengthChecker) {\n    return (next) => async (args) => {\n        const request = args.request;\n        if (HttpRequest.isInstance(request)) {\n            const { body, headers } = request;\n            if (body &&\n                Object.keys(headers)\n                    .map((str) => str.toLowerCase())\n                    .indexOf(CONTENT_LENGTH_HEADER) === -1) {\n                try {\n                    const length = bodyLengthChecker(body);\n                    request.headers = {\n                        ...request.headers,\n                        [CONTENT_LENGTH_HEADER]: String(length),\n                    };\n                }\n                catch (error) {\n                }\n            }\n        }\n        return next({\n            ...args,\n            request,\n        });\n    };\n}\nconst contentLengthMiddlewareOptions = {\n    step: \"build\",\n    tags: [\"SET_CONTENT_LENGTH\", \"CONTENT_LENGTH\"],\n    name: \"contentLengthMiddleware\",\n    override: true,\n};\nconst getContentLengthPlugin = (options) => ({\n    applyToStack: (clientStack) => {\n        clientStack.add(contentLengthMiddleware(options.bodyLengthChecker), contentLengthMiddlewareOptions);\n    },\n});\n\nfunction parseQueryString(querystring) {\n    const query = {};\n    querystring = querystring.replace(/^\\?/, \"\");\n    if (querystring) {\n        for (const pair of querystring.split(\"&\")) {\n            let [key, value = null] = pair.split(\"=\");\n            key = decodeURIComponent(key);\n            if (value) {\n                value = decodeURIComponent(value);\n            }\n            if (!(key in query)) {\n                query[key] = value;\n            }\n            else if (Array.isArray(query[key])) {\n                query[key].push(value);\n            }\n            else {\n                query[key] = [query[key], value];\n            }\n        }\n    }\n    return query;\n}\n\nconst parseUrl = (url) => {\n    if (typeof url === \"string\") {\n        return parseUrl(new URL(url));\n    }\n    const { hostname, pathname, port, protocol, search } = url;\n    let query;\n    if (search) {\n        query = parseQueryString(search);\n    }\n    return {\n        hostname,\n        port: port ? parseInt(port) : undefined,\n        protocol,\n        path: pathname,\n        query,\n    };\n};\n\nconst toEndpointV1 = (endpoint) => {\n    if (typeof endpoint === \"object\") {\n        if (\"url\" in endpoint) {\n            return parseUrl(endpoint.url);\n        }\n        return endpoint;\n    }\n    return parseUrl(endpoint);\n};\n\nconst resolveEndpointConfig = (input) => {\n    const tls = input.tls ?? true;\n    const { endpoint } = input;\n    const customEndpointProvider = endpoint != null ? async () => toEndpointV1(await normalizeProvider(endpoint)()) : undefined;\n    const isCustomEndpoint = !!endpoint;\n    return {\n        ...input,\n        endpoint: customEndpointProvider,\n        tls,\n        isCustomEndpoint,\n        useDualstackEndpoint: normalizeProvider(input.useDualstackEndpoint ?? false),\n        useFipsEndpoint: normalizeProvider(input.useFipsEndpoint ?? false),\n    };\n};\n\nvar RETRY_MODES;\n(function (RETRY_MODES) {\n    RETRY_MODES[\"STANDARD\"] = \"standard\";\n    RETRY_MODES[\"ADAPTIVE\"] = \"adaptive\";\n})(RETRY_MODES || (RETRY_MODES = {}));\nconst DEFAULT_MAX_ATTEMPTS = 3;\nconst DEFAULT_RETRY_MODE = RETRY_MODES.STANDARD;\n\nconst THROTTLING_ERROR_CODES = [\n    \"BandwidthLimitExceeded\",\n    \"EC2ThrottledException\",\n    \"LimitExceededException\",\n    \"PriorRequestNotComplete\",\n    \"ProvisionedThroughputExceededException\",\n    \"RequestLimitExceeded\",\n    \"RequestThrottled\",\n    \"RequestThrottledException\",\n    \"SlowDown\",\n    \"ThrottledException\",\n    \"Throttling\",\n    \"ThrottlingException\",\n    \"TooManyRequestsException\",\n    \"TransactionInProgressException\",\n];\nconst TRANSIENT_ERROR_CODES = [\"TimeoutError\", \"RequestTimeout\", \"RequestTimeoutException\"];\nconst TRANSIENT_ERROR_STATUS_CODES = [500, 502, 503, 504];\nconst NODEJS_TIMEOUT_ERROR_CODES = [\"ECONNRESET\", \"ECONNREFUSED\", \"EPIPE\", \"ETIMEDOUT\"];\n\nconst isThrottlingError = (error) => error.$metadata?.httpStatusCode === 429 ||\n    THROTTLING_ERROR_CODES.includes(error.name) ||\n    error.$retryable?.throttling == true;\nconst isTransientError = (error) => TRANSIENT_ERROR_CODES.includes(error.name) ||\n    NODEJS_TIMEOUT_ERROR_CODES.includes(error?.code || \"\") ||\n    TRANSIENT_ERROR_STATUS_CODES.includes(error.$metadata?.httpStatusCode || 0);\nconst isServerError = (error) => {\n    if (error.$metadata?.httpStatusCode !== undefined) {\n        const statusCode = error.$metadata.httpStatusCode;\n        if (500 <= statusCode && statusCode <= 599 && !isTransientError(error)) {\n            return true;\n        }\n        return false;\n    }\n    return false;\n};\n\nclass DefaultRateLimiter {\n    constructor(options) {\n        this.currentCapacity = 0;\n        this.enabled = false;\n        this.lastMaxRate = 0;\n        this.measuredTxRate = 0;\n        this.requestCount = 0;\n        this.lastTimestamp = 0;\n        this.timeWindow = 0;\n        this.beta = options?.beta ?? 0.7;\n        this.minCapacity = options?.minCapacity ?? 1;\n        this.minFillRate = options?.minFillRate ?? 0.5;\n        this.scaleConstant = options?.scaleConstant ?? 0.4;\n        this.smooth = options?.smooth ?? 0.8;\n        const currentTimeInSeconds = this.getCurrentTimeInSeconds();\n        this.lastThrottleTime = currentTimeInSeconds;\n        this.lastTxRateBucket = Math.floor(this.getCurrentTimeInSeconds());\n        this.fillRate = this.minFillRate;\n        this.maxCapacity = this.minCapacity;\n    }\n    getCurrentTimeInSeconds() {\n        return Date.now() / 1000;\n    }\n    async getSendToken() {\n        return this.acquireTokenBucket(1);\n    }\n    async acquireTokenBucket(amount) {\n        if (!this.enabled) {\n            return;\n        }\n        this.refillTokenBucket();\n        if (amount > this.currentCapacity) {\n            const delay = ((amount - this.currentCapacity) / this.fillRate) * 1000;\n            await new Promise((resolve) => setTimeout(resolve, delay));\n        }\n        this.currentCapacity = this.currentCapacity - amount;\n    }\n    refillTokenBucket() {\n        const timestamp = this.getCurrentTimeInSeconds();\n        if (!this.lastTimestamp) {\n            this.lastTimestamp = timestamp;\n            return;\n        }\n        const fillAmount = (timestamp - this.lastTimestamp) * this.fillRate;\n        this.currentCapacity = Math.min(this.maxCapacity, this.currentCapacity + fillAmount);\n        this.lastTimestamp = timestamp;\n    }\n    updateClientSendingRate(response) {\n        let calculatedRate;\n        this.updateMeasuredRate();\n        if (isThrottlingError(response)) {\n            const rateToUse = !this.enabled ? this.measuredTxRate : Math.min(this.measuredTxRate, this.fillRate);\n            this.lastMaxRate = rateToUse;\n            this.calculateTimeWindow();\n            this.lastThrottleTime = this.getCurrentTimeInSeconds();\n            calculatedRate = this.cubicThrottle(rateToUse);\n            this.enableTokenBucket();\n        }\n        else {\n            this.calculateTimeWindow();\n            calculatedRate = this.cubicSuccess(this.getCurrentTimeInSeconds());\n        }\n        const newRate = Math.min(calculatedRate, 2 * this.measuredTxRate);\n        this.updateTokenBucketRate(newRate);\n    }\n    calculateTimeWindow() {\n        this.timeWindow = this.getPrecise(Math.pow((this.lastMaxRate * (1 - this.beta)) / this.scaleConstant, 1 / 3));\n    }\n    cubicThrottle(rateToUse) {\n        return this.getPrecise(rateToUse * this.beta);\n    }\n    cubicSuccess(timestamp) {\n        return this.getPrecise(this.scaleConstant * Math.pow(timestamp - this.lastThrottleTime - this.timeWindow, 3) + this.lastMaxRate);\n    }\n    enableTokenBucket() {\n        this.enabled = true;\n    }\n    updateTokenBucketRate(newRate) {\n        this.refillTokenBucket();\n        this.fillRate = Math.max(newRate, this.minFillRate);\n        this.maxCapacity = Math.max(newRate, this.minCapacity);\n        this.currentCapacity = Math.min(this.currentCapacity, this.maxCapacity);\n    }\n    updateMeasuredRate() {\n        const t = this.getCurrentTimeInSeconds();\n        const timeBucket = Math.floor(t * 2) / 2;\n        this.requestCount++;\n        if (timeBucket > this.lastTxRateBucket) {\n            const currentRate = this.requestCount / (timeBucket - this.lastTxRateBucket);\n            this.measuredTxRate = this.getPrecise(currentRate * this.smooth + this.measuredTxRate * (1 - this.smooth));\n            this.requestCount = 0;\n            this.lastTxRateBucket = timeBucket;\n        }\n    }\n    getPrecise(num) {\n        return parseFloat(num.toFixed(8));\n    }\n}\n\nconst DEFAULT_RETRY_DELAY_BASE = 100;\nconst MAXIMUM_RETRY_DELAY = 20 * 1000;\nconst THROTTLING_RETRY_DELAY_BASE = 500;\nconst INITIAL_RETRY_TOKENS = 500;\nconst RETRY_COST = 5;\nconst TIMEOUT_RETRY_COST = 10;\nconst NO_RETRY_INCREMENT = 1;\nconst INVOCATION_ID_HEADER = \"amz-sdk-invocation-id\";\nconst REQUEST_HEADER = \"amz-sdk-request\";\n\nconst getDefaultRetryBackoffStrategy = () => {\n    let delayBase = DEFAULT_RETRY_DELAY_BASE;\n    const computeNextBackoffDelay = (attempts) => {\n        return Math.floor(Math.min(MAXIMUM_RETRY_DELAY, Math.random() * 2 ** attempts * delayBase));\n    };\n    const setDelayBase = (delay) => {\n        delayBase = delay;\n    };\n    return {\n        computeNextBackoffDelay,\n        setDelayBase,\n    };\n};\n\nconst createDefaultRetryToken = ({ retryDelay, retryCount, retryCost, }) => {\n    const getRetryCount = () => retryCount;\n    const getRetryDelay = () => Math.min(MAXIMUM_RETRY_DELAY, retryDelay);\n    const getRetryCost = () => retryCost;\n    return {\n        getRetryCount,\n        getRetryDelay,\n        getRetryCost,\n    };\n};\n\nclass StandardRetryStrategy {\n    constructor(maxAttempts) {\n        this.maxAttempts = maxAttempts;\n        this.mode = RETRY_MODES.STANDARD;\n        this.capacity = INITIAL_RETRY_TOKENS;\n        this.retryBackoffStrategy = getDefaultRetryBackoffStrategy();\n        this.maxAttemptsProvider = typeof maxAttempts === \"function\" ? maxAttempts : async () => maxAttempts;\n    }\n    async acquireInitialRetryToken(retryTokenScope) {\n        return createDefaultRetryToken({\n            retryDelay: DEFAULT_RETRY_DELAY_BASE,\n            retryCount: 0,\n        });\n    }\n    async refreshRetryTokenForRetry(token, errorInfo) {\n        const maxAttempts = await this.getMaxAttempts();\n        if (this.shouldRetry(token, errorInfo, maxAttempts)) {\n            const errorType = errorInfo.errorType;\n            this.retryBackoffStrategy.setDelayBase(errorType === \"THROTTLING\" ? THROTTLING_RETRY_DELAY_BASE : DEFAULT_RETRY_DELAY_BASE);\n            const delayFromErrorType = this.retryBackoffStrategy.computeNextBackoffDelay(token.getRetryCount());\n            const retryDelay = errorInfo.retryAfterHint\n                ? Math.max(errorInfo.retryAfterHint.getTime() - Date.now() || 0, delayFromErrorType)\n                : delayFromErrorType;\n            const capacityCost = this.getCapacityCost(errorType);\n            this.capacity -= capacityCost;\n            return createDefaultRetryToken({\n                retryDelay,\n                retryCount: token.getRetryCount() + 1,\n                retryCost: capacityCost,\n            });\n        }\n        throw new Error(\"No retry token available\");\n    }\n    recordSuccess(token) {\n        this.capacity = Math.max(INITIAL_RETRY_TOKENS, this.capacity + (token.getRetryCost() ?? NO_RETRY_INCREMENT));\n    }\n    getCapacity() {\n        return this.capacity;\n    }\n    async getMaxAttempts() {\n        try {\n            return await this.maxAttemptsProvider();\n        }\n        catch (error) {\n            console.warn(`Max attempts provider could not resolve. Using default of ${DEFAULT_MAX_ATTEMPTS}`);\n            return DEFAULT_MAX_ATTEMPTS;\n        }\n    }\n    shouldRetry(tokenToRenew, errorInfo, maxAttempts) {\n        const attempts = tokenToRenew.getRetryCount() + 1;\n        return (attempts < maxAttempts &&\n            this.capacity >= this.getCapacityCost(errorInfo.errorType) &&\n            this.isRetryableError(errorInfo.errorType));\n    }\n    getCapacityCost(errorType) {\n        return errorType === \"TRANSIENT\" ? TIMEOUT_RETRY_COST : RETRY_COST;\n    }\n    isRetryableError(errorType) {\n        return errorType === \"THROTTLING\" || errorType === \"TRANSIENT\";\n    }\n}\n\nclass AdaptiveRetryStrategy {\n    constructor(maxAttemptsProvider, options) {\n        this.maxAttemptsProvider = maxAttemptsProvider;\n        this.mode = RETRY_MODES.ADAPTIVE;\n        const { rateLimiter } = options ?? {};\n        this.rateLimiter = rateLimiter ?? new DefaultRateLimiter();\n        this.standardRetryStrategy = new StandardRetryStrategy(maxAttemptsProvider);\n    }\n    async acquireInitialRetryToken(retryTokenScope) {\n        await this.rateLimiter.getSendToken();\n        return this.standardRetryStrategy.acquireInitialRetryToken(retryTokenScope);\n    }\n    async refreshRetryTokenForRetry(tokenToRenew, errorInfo) {\n        this.rateLimiter.updateClientSendingRate(errorInfo);\n        return this.standardRetryStrategy.refreshRetryTokenForRetry(tokenToRenew, errorInfo);\n    }\n    recordSuccess(token) {\n        this.rateLimiter.updateClientSendingRate({});\n        this.standardRetryStrategy.recordSuccess(token);\n    }\n}\n\nconst asSdkError = (error) => {\n    if (error instanceof Error)\n        return error;\n    if (error instanceof Object)\n        return Object.assign(new Error(), error);\n    if (typeof error === \"string\")\n        return new Error(error);\n    return new Error(`AWS SDK error wrapper for ${error}`);\n};\n\nconst resolveRetryConfig = (input) => {\n    const { retryStrategy } = input;\n    const maxAttempts = normalizeProvider(input.maxAttempts ?? DEFAULT_MAX_ATTEMPTS);\n    return {\n        ...input,\n        maxAttempts,\n        retryStrategy: async () => {\n            if (retryStrategy) {\n                return retryStrategy;\n            }\n            const retryMode = await normalizeProvider(input.retryMode)();\n            if (retryMode === RETRY_MODES.ADAPTIVE) {\n                return new AdaptiveRetryStrategy(maxAttempts);\n            }\n            return new StandardRetryStrategy(maxAttempts);\n        },\n    };\n};\n\nconst retryMiddleware = (options) => (next, context) => async (args) => {\n    let retryStrategy = await options.retryStrategy();\n    const maxAttempts = await options.maxAttempts();\n    if (isRetryStrategyV2(retryStrategy)) {\n        retryStrategy = retryStrategy;\n        let retryToken = await retryStrategy.acquireInitialRetryToken(context[\"partition_id\"]);\n        let lastError = new Error();\n        let attempts = 0;\n        let totalRetryDelay = 0;\n        const { request } = args;\n        if (HttpRequest.isInstance(request)) {\n            request.headers[INVOCATION_ID_HEADER] = v4();\n        }\n        while (true) {\n            try {\n                if (HttpRequest.isInstance(request)) {\n                    request.headers[REQUEST_HEADER] = `attempt=${attempts + 1}; max=${maxAttempts}`;\n                }\n                const { response, output } = await next(args);\n                retryStrategy.recordSuccess(retryToken);\n                output.$metadata.attempts = attempts + 1;\n                output.$metadata.totalRetryDelay = totalRetryDelay;\n                return { response, output };\n            }\n            catch (e) {\n                const retryErrorInfo = getRetryErrorInfo(e);\n                lastError = asSdkError(e);\n                try {\n                    retryToken = await retryStrategy.refreshRetryTokenForRetry(retryToken, retryErrorInfo);\n                }\n                catch (refreshError) {\n                    if (!lastError.$metadata) {\n                        lastError.$metadata = {};\n                    }\n                    lastError.$metadata.attempts = attempts + 1;\n                    lastError.$metadata.totalRetryDelay = totalRetryDelay;\n                    throw lastError;\n                }\n                attempts = retryToken.getRetryCount();\n                const delay = retryToken.getRetryDelay();\n                totalRetryDelay += delay;\n                await new Promise((resolve) => setTimeout(resolve, delay));\n            }\n        }\n    }\n    else {\n        retryStrategy = retryStrategy;\n        if (retryStrategy?.mode)\n            context.userAgent = [...(context.userAgent || []), [\"cfg/retry-mode\", retryStrategy.mode]];\n        return retryStrategy.retry(next, args);\n    }\n};\nconst isRetryStrategyV2 = (retryStrategy) => typeof retryStrategy.acquireInitialRetryToken !== \"undefined\" &&\n    typeof retryStrategy.refreshRetryTokenForRetry !== \"undefined\" &&\n    typeof retryStrategy.recordSuccess !== \"undefined\";\nconst getRetryErrorInfo = (error) => {\n    const errorInfo = {\n        errorType: getRetryErrorType(error),\n    };\n    const retryAfterHint = getRetryAfterHint(error.$response);\n    if (retryAfterHint) {\n        errorInfo.retryAfterHint = retryAfterHint;\n    }\n    return errorInfo;\n};\nconst getRetryErrorType = (error) => {\n    if (isThrottlingError(error))\n        return \"THROTTLING\";\n    if (isTransientError(error))\n        return \"TRANSIENT\";\n    if (isServerError(error))\n        return \"SERVER_ERROR\";\n    return \"CLIENT_ERROR\";\n};\nconst retryMiddlewareOptions = {\n    name: \"retryMiddleware\",\n    tags: [\"RETRY\"],\n    step: \"finalizeRequest\",\n    priority: \"high\",\n    override: true,\n};\nconst getRetryPlugin = (options) => ({\n    applyToStack: (clientStack) => {\n        clientStack.add(retryMiddleware(options), retryMiddlewareOptions);\n    },\n});\nconst getRetryAfterHint = (response) => {\n    if (!HttpResponse.isInstance(response))\n        return;\n    const retryAfterHeaderName = Object.keys(response.headers).find((key) => key.toLowerCase() === \"retry-after\");\n    if (!retryAfterHeaderName)\n        return;\n    const retryAfter = response.headers[retryAfterHeaderName];\n    const retryAfterSeconds = Number(retryAfter);\n    if (!Number.isNaN(retryAfterSeconds))\n        return new Date(retryAfterSeconds * 1000);\n    const retryAfterDate = new Date(retryAfter);\n    return retryAfterDate;\n};\n\nclass NoOpLogger {\n    trace() { }\n    debug() { }\n    info() { }\n    warn() { }\n    error() { }\n}\n\nclass Client {\n    constructor(config) {\n        this.middlewareStack = constructStack();\n        this.config = config;\n    }\n    send(command, optionsOrCb, cb) {\n        const options = typeof optionsOrCb !== \"function\" ? optionsOrCb : undefined;\n        const callback = typeof optionsOrCb === \"function\" ? optionsOrCb : cb;\n        const handler = command.resolveMiddleware(this.middlewareStack, this.config, options);\n        if (callback) {\n            handler(command)\n                .then((result) => callback(null, result.output), (err) => callback(err))\n                .catch(() => { });\n        }\n        else {\n            return handler(command).then((result) => result.output);\n        }\n    }\n    destroy() {\n        if (this.config.requestHandler.destroy)\n            this.config.requestHandler.destroy();\n    }\n}\n\nfunction buildQueryString(query) {\n    const parts = [];\n    for (let key of Object.keys(query).sort()) {\n        const value = query[key];\n        key = escapeUri(key);\n        if (Array.isArray(value)) {\n            for (let i = 0, iLen = value.length; i < iLen; i++) {\n                parts.push(`${key}=${escapeUri(value[i])}`);\n            }\n        }\n        else {\n            let qsEntry = key;\n            if (value || typeof value === \"string\") {\n                qsEntry += `=${escapeUri(value)}`;\n            }\n            parts.push(qsEntry);\n        }\n    }\n    return parts.join(\"&\");\n}\n\nfunction requestTimeout(timeoutInMs = 0) {\n    return new Promise((resolve, reject) => {\n        if (timeoutInMs) {\n            setTimeout(() => {\n                const timeoutError = new Error(`Request did not complete within ${timeoutInMs} ms`);\n                timeoutError.name = \"TimeoutError\";\n                reject(timeoutError);\n            }, timeoutInMs);\n        }\n    });\n}\n\nclass FetchHttpHandler {\n    constructor(options) {\n        if (typeof options === \"function\") {\n            this.configProvider = options().then((opts) => opts || {});\n        }\n        else {\n            this.config = options ?? {};\n            this.configProvider = Promise.resolve(this.config);\n        }\n    }\n    destroy() {\n    }\n    async handle(request, { abortSignal } = {}) {\n        if (!this.config) {\n            this.config = await this.configProvider;\n        }\n        const requestTimeoutInMs = this.config.requestTimeout;\n        if (abortSignal?.aborted) {\n            const abortError = new Error(\"Request aborted\");\n            abortError.name = \"AbortError\";\n            return Promise.reject(abortError);\n        }\n        let path = request.path;\n        const queryString = buildQueryString(request.query || {});\n        if (queryString) {\n            path += `?${queryString}`;\n        }\n        if (request.fragment) {\n            path += `#${request.fragment}`;\n        }\n        let auth = \"\";\n        if (request.username != null || request.password != null) {\n            const username = request.username ?? \"\";\n            const password = request.password ?? \"\";\n            auth = `${username}:${password}@`;\n        }\n        const { port, method } = request;\n        const url = `${request.protocol}//${auth}${request.hostname}${port ? `:${port}` : \"\"}${path}`;\n        const body = method === \"GET\" || method === \"HEAD\" ? undefined : request.body;\n        const requestOptions = {\n            body,\n            headers: new Headers(request.headers),\n            method: method,\n        };\n        if (typeof AbortController !== \"undefined\") {\n            requestOptions[\"signal\"] = abortSignal;\n        }\n        const fetchRequest = new Request(url, requestOptions);\n        const raceOfPromises = [\n            fetch(fetchRequest).then((response) => {\n                const fetchHeaders = response.headers;\n                const transformedHeaders = {};\n                for (const pair of fetchHeaders.entries()) {\n                    transformedHeaders[pair[0]] = pair[1];\n                }\n                const hasReadableStream = response.body != undefined;\n                if (!hasReadableStream) {\n                    return response.blob().then((body) => ({\n                        response: new HttpResponse({\n                            headers: transformedHeaders,\n                            reason: response.statusText,\n                            statusCode: response.status,\n                            body,\n                        }),\n                    }));\n                }\n                return {\n                    response: new HttpResponse({\n                        headers: transformedHeaders,\n                        reason: response.statusText,\n                        statusCode: response.status,\n                        body: response.body,\n                    }),\n                };\n            }),\n            requestTimeout(requestTimeoutInMs),\n        ];\n        if (abortSignal) {\n            raceOfPromises.push(new Promise((resolve, reject) => {\n                abortSignal.onabort = () => {\n                    const abortError = new Error(\"Request aborted\");\n                    abortError.name = \"AbortError\";\n                    reject(abortError);\n                };\n            }));\n        }\n        return Promise.race(raceOfPromises);\n    }\n}\n\nconst streamCollector = (stream) => {\n    if (typeof Blob === \"function\" && stream instanceof Blob) {\n        return collectBlob(stream);\n    }\n    return collectStream(stream);\n};\nasync function collectBlob(blob) {\n    const base64 = await readToBase64(blob);\n    const arrayBuffer = fromBase64(base64);\n    return new Uint8Array(arrayBuffer);\n}\nasync function collectStream(stream) {\n    let res = new Uint8Array(0);\n    const reader = stream.getReader();\n    let isDone = false;\n    while (!isDone) {\n        const { done, value } = await reader.read();\n        if (value) {\n            const prior = res;\n            res = new Uint8Array(prior.length + value.length);\n            res.set(prior);\n            res.set(value, prior.length);\n        }\n        isDone = done;\n    }\n    return res;\n}\nfunction readToBase64(blob) {\n    return new Promise((resolve, reject) => {\n        const reader = new FileReader();\n        reader.onloadend = () => {\n            if (reader.readyState !== 2) {\n                return reject(new Error(\"Reader aborted too early\"));\n            }\n            const result = (reader.result ?? \"\");\n            const commaIndex = result.indexOf(\",\");\n            const dataOffset = commaIndex > -1 ? commaIndex + 1 : result.length;\n            resolve(result.substring(dataOffset));\n        };\n        reader.onabort = () => reject(new Error(\"Read aborted\"));\n        reader.onerror = () => reject(reader.error);\n        reader.readAsDataURL(blob);\n    });\n}\n\nconst loadConfigsForDefaultMode = (mode) => {\n    switch (mode) {\n        case \"standard\":\n            return {\n                retryMode: \"standard\",\n                connectionTimeout: 3100,\n            };\n        case \"in-region\":\n            return {\n                retryMode: \"standard\",\n                connectionTimeout: 1100,\n            };\n        case \"cross-region\":\n            return {\n                retryMode: \"standard\",\n                connectionTimeout: 3100,\n            };\n        case \"mobile\":\n            return {\n                retryMode: \"standard\",\n                connectionTimeout: 30000,\n            };\n        default:\n            return {};\n    }\n};\n\n/*! *****************************************************************************\r\nCopyright (c) Microsoft Corporation.\r\n\r\nPermission to use, copy, modify, and/or distribute this software for any\r\npurpose with or without fee is hereby granted.\r\n\r\nTHE SOFTWARE IS PROVIDED \"AS IS\" AND THE AUTHOR DISCLAIMS ALL WARRANTIES WITH\r\nREGARD TO THIS SOFTWARE INCLUDING ALL IMPLIED WARRANTIES OF MERCHANTABILITY\r\nAND FITNESS. IN NO EVENT SHALL THE AUTHOR BE LIABLE FOR ANY SPECIAL, DIRECT,\r\nINDIRECT, OR CONSEQUENTIAL DAMAGES OR ANY DAMAGES WHATSOEVER RESULTING FROM\r\nLOSS OF USE, DATA OR PROFITS, WHETHER IN AN ACTION OF CONTRACT, NEGLIGENCE OR\r\nOTHER TORTIOUS ACTION, ARISING OUT OF OR IN CONNECTION WITH THE USE OR\r\nPERFORMANCE OF THIS SOFTWARE.\r\n***************************************************************************** */\r\n/* global Reflect, Promise */\r\n\r\nvar extendStatics$1 = function(d, b) {\r\n    extendStatics$1 = Object.setPrototypeOf ||\r\n        ({ __proto__: [] } instanceof Array && function (d, b) { d.__proto__ = b; }) ||\r\n        function (d, b) { for (var p in b) if (b.hasOwnProperty(p)) d[p] = b[p]; };\r\n    return extendStatics$1(d, b);\r\n};\r\n\r\nfunction __extends$1(d, b) {\r\n    extendStatics$1(d, b);\r\n    function __() { this.constructor = d; }\r\n    d.prototype = b === null ? Object.create(b) : (__.prototype = b.prototype, new __());\r\n}\r\n\r\nvar __assign$1 = function() {\r\n    __assign$1 = Object.assign || function __assign(t) {\r\n        for (var s, i = 1, n = arguments.length; i < n; i++) {\r\n            s = arguments[i];\r\n            for (var p in s) if (Object.prototype.hasOwnProperty.call(s, p)) t[p] = s[p];\r\n        }\r\n        return t;\r\n    };\r\n    return __assign$1.apply(this, arguments);\r\n};\r\n\r\nfunction __rest$1(s, e) {\r\n    var t = {};\r\n    for (var p in s) if (Object.prototype.hasOwnProperty.call(s, p) && e.indexOf(p) < 0)\r\n        t[p] = s[p];\r\n    if (s != null && typeof Object.getOwnPropertySymbols === \"function\")\r\n        for (var i = 0, p = Object.getOwnPropertySymbols(s); i < p.length; i++) {\r\n            if (e.indexOf(p[i]) < 0 && Object.prototype.propertyIsEnumerable.call(s, p[i]))\r\n                t[p[i]] = s[p[i]];\r\n        }\r\n    return t;\r\n}\r\n\r\nfunction __decorate$1(decorators, target, key, desc) {\r\n    var c = arguments.length, r = c < 3 ? target : desc === null ? desc = Object.getOwnPropertyDescriptor(target, key) : desc, d;\r\n    if (typeof Reflect === \"object\" && typeof Reflect.decorate === \"function\") r = Reflect.decorate(decorators, target, key, desc);\r\n    else for (var i = decorators.length - 1; i >= 0; i--) if (d = decorators[i]) r = (c < 3 ? d(r) : c > 3 ? d(target, key, r) : d(target, key)) || r;\r\n    return c > 3 && r && Object.defineProperty(target, key, r), r;\r\n}\r\n\r\nfunction __param$1(paramIndex, decorator) {\r\n    return function (target, key) { decorator(target, key, paramIndex); }\r\n}\r\n\r\nfunction __metadata$1(metadataKey, metadataValue) {\r\n    if (typeof Reflect === \"object\" && typeof Reflect.metadata === \"function\") return Reflect.metadata(metadataKey, metadataValue);\r\n}\r\n\r\nfunction __awaiter$1(thisArg, _arguments, P, generator) {\r\n    function adopt(value) { return value instanceof P ? value : new P(function (resolve) { resolve(value); }); }\r\n    return new (P || (P = Promise))(function (resolve, reject) {\r\n        function fulfilled(value) { try { step(generator.next(value)); } catch (e) { reject(e); } }\r\n        function rejected(value) { try { step(generator[\"throw\"](value)); } catch (e) { reject(e); } }\r\n        function step(result) { result.done ? resolve(result.value) : adopt(result.value).then(fulfilled, rejected); }\r\n        step((generator = generator.apply(thisArg, _arguments || [])).next());\r\n    });\r\n}\r\n\r\nfunction __generator$1(thisArg, body) {\r\n    var _ = { label: 0, sent: function() { if (t[0] & 1) throw t[1]; return t[1]; }, trys: [], ops: [] }, f, y, t, g;\r\n    return g = { next: verb(0), \"throw\": verb(1), \"return\": verb(2) }, typeof Symbol === \"function\" && (g[Symbol.iterator] = function() { return this; }), g;\r\n    function verb(n) { return function (v) { return step([n, v]); }; }\r\n    function step(op) {\r\n        if (f) throw new TypeError(\"Generator is already executing.\");\r\n        while (_) try {\r\n            if (f = 1, y && (t = op[0] & 2 ? y[\"return\"] : op[0] ? y[\"throw\"] || ((t = y[\"return\"]) && t.call(y), 0) : y.next) && !(t = t.call(y, op[1])).done) return t;\r\n            if (y = 0, t) op = [op[0] & 2, t.value];\r\n            switch (op[0]) {\r\n                case 0: case 1: t = op; break;\r\n                case 4: _.label++; return { value: op[1], done: false };\r\n                case 5: _.label++; y = op[1]; op = [0]; continue;\r\n                case 7: op = _.ops.pop(); _.trys.pop(); continue;\r\n                default:\r\n                    if (!(t = _.trys, t = t.length > 0 && t[t.length - 1]) && (op[0] === 6 || op[0] === 2)) { _ = 0; continue; }\r\n                    if (op[0] === 3 && (!t || (op[1] > t[0] && op[1] < t[3]))) { _.label = op[1]; break; }\r\n                    if (op[0] === 6 && _.label < t[1]) { _.label = t[1]; t = op; break; }\r\n                    if (t && _.label < t[2]) { _.label = t[2]; _.ops.push(op); break; }\r\n                    if (t[2]) _.ops.pop();\r\n                    _.trys.pop(); continue;\r\n            }\r\n            op = body.call(thisArg, _);\r\n        } catch (e) { op = [6, e]; y = 0; } finally { f = t = 0; }\r\n        if (op[0] & 5) throw op[1]; return { value: op[0] ? op[1] : void 0, done: true };\r\n    }\r\n}\r\n\r\nfunction __createBinding$1(o, m, k, k2) {\r\n    if (k2 === undefined) k2 = k;\r\n    o[k2] = m[k];\r\n}\r\n\r\nfunction __exportStar$1(m, exports) {\r\n    for (var p in m) if (p !== \"default\" && !exports.hasOwnProperty(p)) exports[p] = m[p];\r\n}\r\n\r\nfunction __values$1(o) {\r\n    var s = typeof Symbol === \"function\" && Symbol.iterator, m = s && o[s], i = 0;\r\n    if (m) return m.call(o);\r\n    if (o && typeof o.length === \"number\") return {\r\n        next: function () {\r\n            if (o && i >= o.length) o = void 0;\r\n            return { value: o && o[i++], done: !o };\r\n        }\r\n    };\r\n    throw new TypeError(s ? \"Object is not iterable.\" : \"Symbol.iterator is not defined.\");\r\n}\r\n\r\nfunction __read$1(o, n) {\r\n    var m = typeof Symbol === \"function\" && o[Symbol.iterator];\r\n    if (!m) return o;\r\n    var i = m.call(o), r, ar = [], e;\r\n    try {\r\n        while ((n === void 0 || n-- > 0) && !(r = i.next()).done) ar.push(r.value);\r\n    }\r\n    catch (error) { e = { error: error }; }\r\n    finally {\r\n        try {\r\n            if (r && !r.done && (m = i[\"return\"])) m.call(i);\r\n        }\r\n        finally { if (e) throw e.error; }\r\n    }\r\n    return ar;\r\n}\r\n\r\nfunction __spread$1() {\r\n    for (var ar = [], i = 0; i < arguments.length; i++)\r\n        ar = ar.concat(__read$1(arguments[i]));\r\n    return ar;\r\n}\r\n\r\nfunction __spreadArrays$1() {\r\n    for (var s = 0, i = 0, il = arguments.length; i < il; i++) s += arguments[i].length;\r\n    for (var r = Array(s), k = 0, i = 0; i < il; i++)\r\n        for (var a = arguments[i], j = 0, jl = a.length; j < jl; j++, k++)\r\n            r[k] = a[j];\r\n    return r;\r\n}\r\nfunction __await$1(v) {\r\n    return this instanceof __await$1 ? (this.v = v, this) : new __await$1(v);\r\n}\r\n\r\nfunction __asyncGenerator$1(thisArg, _arguments, generator) {\r\n    if (!Symbol.asyncIterator) throw new TypeError(\"Symbol.asyncIterator is not defined.\");\r\n    var g = generator.apply(thisArg, _arguments || []), i, q = [];\r\n    return i = {}, verb(\"next\"), verb(\"throw\"), verb(\"return\"), i[Symbol.asyncIterator] = function () { return this; }, i;\r\n    function verb(n) { if (g[n]) i[n] = function (v) { return new Promise(function (a, b) { q.push([n, v, a, b]) > 1 || resume(n, v); }); }; }\r\n    function resume(n, v) { try { step(g[n](v)); } catch (e) { settle(q[0][3], e); } }\r\n    function step(r) { r.value instanceof __await$1 ? Promise.resolve(r.value.v).then(fulfill, reject) : settle(q[0][2], r); }\r\n    function fulfill(value) { resume(\"next\", value); }\r\n    function reject(value) { resume(\"throw\", value); }\r\n    function settle(f, v) { if (f(v), q.shift(), q.length) resume(q[0][0], q[0][1]); }\r\n}\r\n\r\nfunction __asyncDelegator$1(o) {\r\n    var i, p;\r\n    return i = {}, verb(\"next\"), verb(\"throw\", function (e) { throw e; }), verb(\"return\"), i[Symbol.iterator] = function () { return this; }, i;\r\n    function verb(n, f) { i[n] = o[n] ? function (v) { return (p = !p) ? { value: __await$1(o[n](v)), done: n === \"return\" } : f ? f(v) : v; } : f; }\r\n}\r\n\r\nfunction __asyncValues$1(o) {\r\n    if (!Symbol.asyncIterator) throw new TypeError(\"Symbol.asyncIterator is not defined.\");\r\n    var m = o[Symbol.asyncIterator], i;\r\n    return m ? m.call(o) : (o = typeof __values$1 === \"function\" ? __values$1(o) : o[Symbol.iterator](), i = {}, verb(\"next\"), verb(\"throw\"), verb(\"return\"), i[Symbol.asyncIterator] = function () { return this; }, i);\r\n    function verb(n) { i[n] = o[n] && function (v) { return new Promise(function (resolve, reject) { v = o[n](v), settle(resolve, reject, v.done, v.value); }); }; }\r\n    function settle(resolve, reject, d, v) { Promise.resolve(v).then(function(v) { resolve({ value: v, done: d }); }, reject); }\r\n}\r\n\r\nfunction __makeTemplateObject$1(cooked, raw) {\r\n    if (Object.defineProperty) { Object.defineProperty(cooked, \"raw\", { value: raw }); } else { cooked.raw = raw; }\r\n    return cooked;\r\n}\r\nfunction __importStar$1(mod) {\r\n    if (mod && mod.__esModule) return mod;\r\n    var result = {};\r\n    if (mod != null) for (var k in mod) if (Object.hasOwnProperty.call(mod, k)) result[k] = mod[k];\r\n    result.default = mod;\r\n    return result;\r\n}\r\n\r\nfunction __importDefault$1(mod) {\r\n    return (mod && mod.__esModule) ? mod : { default: mod };\r\n}\r\n\r\nfunction __classPrivateFieldGet$1(receiver, privateMap) {\r\n    if (!privateMap.has(receiver)) {\r\n        throw new TypeError(\"attempted to get private field on non-instance\");\r\n    }\r\n    return privateMap.get(receiver);\r\n}\r\n\r\nfunction __classPrivateFieldSet$1(receiver, privateMap, value) {\r\n    if (!privateMap.has(receiver)) {\r\n        throw new TypeError(\"attempted to set private field on non-instance\");\r\n    }\r\n    privateMap.set(receiver, value);\r\n    return value;\r\n}\n\nvar tslib_es6$1 = /*#__PURE__*/Object.freeze({\n    __proto__: null,\n    __extends: __extends$1,\n    get __assign () { return __assign$1; },\n    __rest: __rest$1,\n    __decorate: __decorate$1,\n    __param: __param$1,\n    __metadata: __metadata$1,\n    __awaiter: __awaiter$1,\n    __generator: __generator$1,\n    __createBinding: __createBinding$1,\n    __exportStar: __exportStar$1,\n    __values: __values$1,\n    __read: __read$1,\n    __spread: __spread$1,\n    __spreadArrays: __spreadArrays$1,\n    __await: __await$1,\n    __asyncGenerator: __asyncGenerator$1,\n    __asyncDelegator: __asyncDelegator$1,\n    __asyncValues: __asyncValues$1,\n    __makeTemplateObject: __makeTemplateObject$1,\n    __importStar: __importStar$1,\n    __importDefault: __importDefault$1,\n    __classPrivateFieldGet: __classPrivateFieldGet$1,\n    __classPrivateFieldSet: __classPrivateFieldSet$1\n});\n\nvar isEmptyData_1$1 = createCommonjsModule(function (module, exports) {\nObject.defineProperty(exports, \"__esModule\", { value: true });\nexports.isEmptyData = void 0;\nfunction isEmptyData(data) {\n    if (typeof data === \"string\") {\n        return data.length === 0;\n    }\n    return data.byteLength === 0;\n}\nexports.isEmptyData = isEmptyData;\n\n});\n\nvar constants = createCommonjsModule(function (module, exports) {\nObject.defineProperty(exports, \"__esModule\", { value: true });\nexports.EMPTY_DATA_SHA_256 = exports.SHA_256_HMAC_ALGO = exports.SHA_256_HASH = void 0;\nexports.SHA_256_HASH = { name: \"SHA-256\" };\nexports.SHA_256_HMAC_ALGO = {\n    name: \"HMAC\",\n    hash: exports.SHA_256_HASH\n};\nexports.EMPTY_DATA_SHA_256 = new Uint8Array([\n    227,\n    176,\n    196,\n    66,\n    152,\n    252,\n    28,\n    20,\n    154,\n    251,\n    244,\n    200,\n    153,\n    111,\n    185,\n    36,\n    39,\n    174,\n    65,\n    228,\n    100,\n    155,\n    147,\n    76,\n    164,\n    149,\n    153,\n    27,\n    120,\n    82,\n    184,\n    85\n]);\n\n});\n\nconst fallbackWindow = {};\nfunction locateWindow() {\n    if (typeof window !== \"undefined\") {\n        return window;\n    }\n    else if (typeof self !== \"undefined\") {\n        return self;\n    }\n    return fallbackWindow;\n}\n\nvar distEs$1 = /*#__PURE__*/Object.freeze({\n    __proto__: null,\n    locateWindow: locateWindow\n});\n\nvar ie11Sha256 = createCommonjsModule(function (module, exports) {\nObject.defineProperty(exports, \"__esModule\", { value: true });\nexports.Sha256 = void 0;\n\n\n\n\nvar Sha256 = /** @class */ (function () {\n    function Sha256(secret) {\n        this.secret = secret;\n        this.reset();\n    }\n    Sha256.prototype.update = function (toHash) {\n        var _this = this;\n        if ((0, isEmptyData_1$1.isEmptyData)(toHash)) {\n            return;\n        }\n        this.operation = this.operation.then(function (operation) {\n            operation.onerror = function () {\n                _this.operation = Promise.reject(new Error(\"Error encountered updating hash\"));\n            };\n            operation.process(toArrayBufferView(toHash));\n            return operation;\n        });\n        this.operation.catch(function () { });\n    };\n    Sha256.prototype.digest = function () {\n        return this.operation.then(function (operation) {\n            return new Promise(function (resolve, reject) {\n                operation.onerror = function () {\n                    reject(new Error(\"Error encountered finalizing hash\"));\n                };\n                operation.oncomplete = function () {\n                    if (operation.result) {\n                        resolve(new Uint8Array(operation.result));\n                    }\n                    reject(new Error(\"Error encountered finalizing hash\"));\n                };\n                operation.finish();\n            });\n        });\n    };\n    Sha256.prototype.reset = function () {\n        if (this.secret) {\n            this.operation = getKeyPromise(this.secret).then(function (keyData) {\n                return (0, distEs$1.locateWindow)().msCrypto.subtle.sign(constants.SHA_256_HMAC_ALGO, keyData);\n            });\n            this.operation.catch(function () { });\n        }\n        else {\n            this.operation = Promise.resolve((0, distEs$1.locateWindow)().msCrypto.subtle.digest(\"SHA-256\"));\n        }\n    };\n    return Sha256;\n}());\nexports.Sha256 = Sha256;\nfunction getKeyPromise(secret) {\n    return new Promise(function (resolve, reject) {\n        var keyOperation = (0, distEs$1.locateWindow)().msCrypto.subtle.importKey(\"raw\", toArrayBufferView(secret), constants.SHA_256_HMAC_ALGO, false, [\"sign\"]);\n        keyOperation.oncomplete = function () {\n            if (keyOperation.result) {\n                resolve(keyOperation.result);\n            }\n            reject(new Error(\"ImportKey completed without importing key.\"));\n        };\n        keyOperation.onerror = function () {\n            reject(new Error(\"ImportKey failed to import key.\"));\n        };\n    });\n}\nfunction toArrayBufferView(data) {\n    if (typeof data === \"string\") {\n        return (0, distEs.fromUtf8)(data);\n    }\n    if (ArrayBuffer.isView(data)) {\n        return new Uint8Array(data.buffer, data.byteOffset, data.byteLength / Uint8Array.BYTES_PER_ELEMENT);\n    }\n    return new Uint8Array(data);\n}\n\n});\n\nvar webCryptoSha256 = createCommonjsModule(function (module, exports) {\nObject.defineProperty(exports, \"__esModule\", { value: true });\nexports.Sha256 = void 0;\n\n\n\nvar Sha256 = /** @class */ (function () {\n    function Sha256(secret) {\n        this.toHash = new Uint8Array(0);\n        this.secret = secret;\n        this.reset();\n    }\n    Sha256.prototype.update = function (data) {\n        if ((0, build.isEmptyData)(data)) {\n            return;\n        }\n        var update = (0, build.convertToBuffer)(data);\n        var typedArray = new Uint8Array(this.toHash.byteLength + update.byteLength);\n        typedArray.set(this.toHash, 0);\n        typedArray.set(update, this.toHash.byteLength);\n        this.toHash = typedArray;\n    };\n    Sha256.prototype.digest = function () {\n        var _this = this;\n        if (this.key) {\n            return this.key.then(function (key) {\n                return (0, distEs$1.locateWindow)()\n                    .crypto.subtle.sign(constants.SHA_256_HMAC_ALGO, key, _this.toHash)\n                    .then(function (data) { return new Uint8Array(data); });\n            });\n        }\n        if ((0, build.isEmptyData)(this.toHash)) {\n            return Promise.resolve(constants.EMPTY_DATA_SHA_256);\n        }\n        return Promise.resolve()\n            .then(function () {\n            return (0, distEs$1.locateWindow)().crypto.subtle.digest(constants.SHA_256_HASH, _this.toHash);\n        })\n            .then(function (data) { return Promise.resolve(new Uint8Array(data)); });\n    };\n    Sha256.prototype.reset = function () {\n        var _this = this;\n        this.toHash = new Uint8Array(0);\n        if (this.secret && this.secret !== void 0) {\n            this.key = new Promise(function (resolve, reject) {\n                (0, distEs$1.locateWindow)()\n                    .crypto.subtle.importKey(\"raw\", (0, build.convertToBuffer)(_this.secret), constants.SHA_256_HMAC_ALGO, false, [\"sign\"])\n                    .then(resolve, reject);\n            });\n            this.key.catch(function () { });\n        }\n    };\n    return Sha256;\n}());\nexports.Sha256 = Sha256;\n\n});\n\n/*! *****************************************************************************\r\nCopyright (c) Microsoft Corporation.\r\n\r\nPermission to use, copy, modify, and/or distribute this software for any\r\npurpose with or without fee is hereby granted.\r\n\r\nTHE SOFTWARE IS PROVIDED \"AS IS\" AND THE AUTHOR DISCLAIMS ALL WARRANTIES WITH\r\nREGARD TO THIS SOFTWARE INCLUDING ALL IMPLIED WARRANTIES OF MERCHANTABILITY\r\nAND FITNESS. IN NO EVENT SHALL THE AUTHOR BE LIABLE FOR ANY SPECIAL, DIRECT,\r\nINDIRECT, OR CONSEQUENTIAL DAMAGES OR ANY DAMAGES WHATSOEVER RESULTING FROM\r\nLOSS OF USE, DATA OR PROFITS, WHETHER IN AN ACTION OF CONTRACT, NEGLIGENCE OR\r\nOTHER TORTIOUS ACTION, ARISING OUT OF OR IN CONNECTION WITH THE USE OR\r\nPERFORMANCE OF THIS SOFTWARE.\r\n***************************************************************************** */\r\n/* global Reflect, Promise */\r\n\r\nvar extendStatics$2 = function(d, b) {\r\n    extendStatics$2 = Object.setPrototypeOf ||\r\n        ({ __proto__: [] } instanceof Array && function (d, b) { d.__proto__ = b; }) ||\r\n        function (d, b) { for (var p in b) if (b.hasOwnProperty(p)) d[p] = b[p]; };\r\n    return extendStatics$2(d, b);\r\n};\r\n\r\nfunction __extends$2(d, b) {\r\n    extendStatics$2(d, b);\r\n    function __() { this.constructor = d; }\r\n    d.prototype = b === null ? Object.create(b) : (__.prototype = b.prototype, new __());\r\n}\r\n\r\nvar __assign$2 = function() {\r\n    __assign$2 = Object.assign || function __assign(t) {\r\n        for (var s, i = 1, n = arguments.length; i < n; i++) {\r\n            s = arguments[i];\r\n            for (var p in s) if (Object.prototype.hasOwnProperty.call(s, p)) t[p] = s[p];\r\n        }\r\n        return t;\r\n    };\r\n    return __assign$2.apply(this, arguments);\r\n};\r\n\r\nfunction __rest$2(s, e) {\r\n    var t = {};\r\n    for (var p in s) if (Object.prototype.hasOwnProperty.call(s, p) && e.indexOf(p) < 0)\r\n        t[p] = s[p];\r\n    if (s != null && typeof Object.getOwnPropertySymbols === \"function\")\r\n        for (var i = 0, p = Object.getOwnPropertySymbols(s); i < p.length; i++) {\r\n            if (e.indexOf(p[i]) < 0 && Object.prototype.propertyIsEnumerable.call(s, p[i]))\r\n                t[p[i]] = s[p[i]];\r\n        }\r\n    return t;\r\n}\r\n\r\nfunction __decorate$2(decorators, target, key, desc) {\r\n    var c = arguments.length, r = c < 3 ? target : desc === null ? desc = Object.getOwnPropertyDescriptor(target, key) : desc, d;\r\n    if (typeof Reflect === \"object\" && typeof Reflect.decorate === \"function\") r = Reflect.decorate(decorators, target, key, desc);\r\n    else for (var i = decorators.length - 1; i >= 0; i--) if (d = decorators[i]) r = (c < 3 ? d(r) : c > 3 ? d(target, key, r) : d(target, key)) || r;\r\n    return c > 3 && r && Object.defineProperty(target, key, r), r;\r\n}\r\n\r\nfunction __param$2(paramIndex, decorator) {\r\n    return function (target, key) { decorator(target, key, paramIndex); }\r\n}\r\n\r\nfunction __metadata$2(metadataKey, metadataValue) {\r\n    if (typeof Reflect === \"object\" && typeof Reflect.metadata === \"function\") return Reflect.metadata(metadataKey, metadataValue);\r\n}\r\n\r\nfunction __awaiter$2(thisArg, _arguments, P, generator) {\r\n    function adopt(value) { return value instanceof P ? value : new P(function (resolve) { resolve(value); }); }\r\n    return new (P || (P = Promise))(function (resolve, reject) {\r\n        function fulfilled(value) { try { step(generator.next(value)); } catch (e) { reject(e); } }\r\n        function rejected(value) { try { step(generator[\"throw\"](value)); } catch (e) { reject(e); } }\r\n        function step(result) { result.done ? resolve(result.value) : adopt(result.value).then(fulfilled, rejected); }\r\n        step((generator = generator.apply(thisArg, _arguments || [])).next());\r\n    });\r\n}\r\n\r\nfunction __generator$2(thisArg, body) {\r\n    var _ = { label: 0, sent: function() { if (t[0] & 1) throw t[1]; return t[1]; }, trys: [], ops: [] }, f, y, t, g;\r\n    return g = { next: verb(0), \"throw\": verb(1), \"return\": verb(2) }, typeof Symbol === \"function\" && (g[Symbol.iterator] = function() { return this; }), g;\r\n    function verb(n) { return function (v) { return step([n, v]); }; }\r\n    function step(op) {\r\n        if (f) throw new TypeError(\"Generator is already executing.\");\r\n        while (_) try {\r\n            if (f = 1, y && (t = op[0] & 2 ? y[\"return\"] : op[0] ? y[\"throw\"] || ((t = y[\"return\"]) && t.call(y), 0) : y.next) && !(t = t.call(y, op[1])).done) return t;\r\n            if (y = 0, t) op = [op[0] & 2, t.value];\r\n            switch (op[0]) {\r\n                case 0: case 1: t = op; break;\r\n                case 4: _.label++; return { value: op[1], done: false };\r\n                case 5: _.label++; y = op[1]; op = [0]; continue;\r\n                case 7: op = _.ops.pop(); _.trys.pop(); continue;\r\n                default:\r\n                    if (!(t = _.trys, t = t.length > 0 && t[t.length - 1]) && (op[0] === 6 || op[0] === 2)) { _ = 0; continue; }\r\n                    if (op[0] === 3 && (!t || (op[1] > t[0] && op[1] < t[3]))) { _.label = op[1]; break; }\r\n                    if (op[0] === 6 && _.label < t[1]) { _.label = t[1]; t = op; break; }\r\n                    if (t && _.label < t[2]) { _.label = t[2]; _.ops.push(op); break; }\r\n                    if (t[2]) _.ops.pop();\r\n                    _.trys.pop(); continue;\r\n            }\r\n            op = body.call(thisArg, _);\r\n        } catch (e) { op = [6, e]; y = 0; } finally { f = t = 0; }\r\n        if (op[0] & 5) throw op[1]; return { value: op[0] ? op[1] : void 0, done: true };\r\n    }\r\n}\r\n\r\nfunction __createBinding$2(o, m, k, k2) {\r\n    if (k2 === undefined) k2 = k;\r\n    o[k2] = m[k];\r\n}\r\n\r\nfunction __exportStar$2(m, exports) {\r\n    for (var p in m) if (p !== \"default\" && !exports.hasOwnProperty(p)) exports[p] = m[p];\r\n}\r\n\r\nfunction __values$2(o) {\r\n    var s = typeof Symbol === \"function\" && Symbol.iterator, m = s && o[s], i = 0;\r\n    if (m) return m.call(o);\r\n    if (o && typeof o.length === \"number\") return {\r\n        next: function () {\r\n            if (o && i >= o.length) o = void 0;\r\n            return { value: o && o[i++], done: !o };\r\n        }\r\n    };\r\n    throw new TypeError(s ? \"Object is not iterable.\" : \"Symbol.iterator is not defined.\");\r\n}\r\n\r\nfunction __read$2(o, n) {\r\n    var m = typeof Symbol === \"function\" && o[Symbol.iterator];\r\n    if (!m) return o;\r\n    var i = m.call(o), r, ar = [], e;\r\n    try {\r\n        while ((n === void 0 || n-- > 0) && !(r = i.next()).done) ar.push(r.value);\r\n    }\r\n    catch (error) { e = { error: error }; }\r\n    finally {\r\n        try {\r\n            if (r && !r.done && (m = i[\"return\"])) m.call(i);\r\n        }\r\n        finally { if (e) throw e.error; }\r\n    }\r\n    return ar;\r\n}\r\n\r\nfunction __spread$2() {\r\n    for (var ar = [], i = 0; i < arguments.length; i++)\r\n        ar = ar.concat(__read$2(arguments[i]));\r\n    return ar;\r\n}\r\n\r\nfunction __spreadArrays$2() {\r\n    for (var s = 0, i = 0, il = arguments.length; i < il; i++) s += arguments[i].length;\r\n    for (var r = Array(s), k = 0, i = 0; i < il; i++)\r\n        for (var a = arguments[i], j = 0, jl = a.length; j < jl; j++, k++)\r\n            r[k] = a[j];\r\n    return r;\r\n}\r\nfunction __await$2(v) {\r\n    return this instanceof __await$2 ? (this.v = v, this) : new __await$2(v);\r\n}\r\n\r\nfunction __asyncGenerator$2(thisArg, _arguments, generator) {\r\n    if (!Symbol.asyncIterator) throw new TypeError(\"Symbol.asyncIterator is not defined.\");\r\n    var g = generator.apply(thisArg, _arguments || []), i, q = [];\r\n    return i = {}, verb(\"next\"), verb(\"throw\"), verb(\"return\"), i[Symbol.asyncIterator] = function () { return this; }, i;\r\n    function verb(n) { if (g[n]) i[n] = function (v) { return new Promise(function (a, b) { q.push([n, v, a, b]) > 1 || resume(n, v); }); }; }\r\n    function resume(n, v) { try { step(g[n](v)); } catch (e) { settle(q[0][3], e); } }\r\n    function step(r) { r.value instanceof __await$2 ? Promise.resolve(r.value.v).then(fulfill, reject) : settle(q[0][2], r); }\r\n    function fulfill(value) { resume(\"next\", value); }\r\n    function reject(value) { resume(\"throw\", value); }\r\n    function settle(f, v) { if (f(v), q.shift(), q.length) resume(q[0][0], q[0][1]); }\r\n}\r\n\r\nfunction __asyncDelegator$2(o) {\r\n    var i, p;\r\n    return i = {}, verb(\"next\"), verb(\"throw\", function (e) { throw e; }), verb(\"return\"), i[Symbol.iterator] = function () { return this; }, i;\r\n    function verb(n, f) { i[n] = o[n] ? function (v) { return (p = !p) ? { value: __await$2(o[n](v)), done: n === \"return\" } : f ? f(v) : v; } : f; }\r\n}\r\n\r\nfunction __asyncValues$2(o) {\r\n    if (!Symbol.asyncIterator) throw new TypeError(\"Symbol.asyncIterator is not defined.\");\r\n    var m = o[Symbol.asyncIterator], i;\r\n    return m ? m.call(o) : (o = typeof __values$2 === \"function\" ? __values$2(o) : o[Symbol.iterator](), i = {}, verb(\"next\"), verb(\"throw\"), verb(\"return\"), i[Symbol.asyncIterator] = function () { return this; }, i);\r\n    function verb(n) { i[n] = o[n] && function (v) { return new Promise(function (resolve, reject) { v = o[n](v), settle(resolve, reject, v.done, v.value); }); }; }\r\n    function settle(resolve, reject, d, v) { Promise.resolve(v).then(function(v) { resolve({ value: v, done: d }); }, reject); }\r\n}\r\n\r\nfunction __makeTemplateObject$2(cooked, raw) {\r\n    if (Object.defineProperty) { Object.defineProperty(cooked, \"raw\", { value: raw }); } else { cooked.raw = raw; }\r\n    return cooked;\r\n}\r\nfunction __importStar$2(mod) {\r\n    if (mod && mod.__esModule) return mod;\r\n    var result = {};\r\n    if (mod != null) for (var k in mod) if (Object.hasOwnProperty.call(mod, k)) result[k] = mod[k];\r\n    result.default = mod;\r\n    return result;\r\n}\r\n\r\nfunction __importDefault$2(mod) {\r\n    return (mod && mod.__esModule) ? mod : { default: mod };\r\n}\r\n\r\nfunction __classPrivateFieldGet$2(receiver, privateMap) {\r\n    if (!privateMap.has(receiver)) {\r\n        throw new TypeError(\"attempted to get private field on non-instance\");\r\n    }\r\n    return privateMap.get(receiver);\r\n}\r\n\r\nfunction __classPrivateFieldSet$2(receiver, privateMap, value) {\r\n    if (!privateMap.has(receiver)) {\r\n        throw new TypeError(\"attempted to set private field on non-instance\");\r\n    }\r\n    privateMap.set(receiver, value);\r\n    return value;\r\n}\n\nvar tslib_es6$2 = /*#__PURE__*/Object.freeze({\n    __proto__: null,\n    __extends: __extends$2,\n    get __assign () { return __assign$2; },\n    __rest: __rest$2,\n    __decorate: __decorate$2,\n    __param: __param$2,\n    __metadata: __metadata$2,\n    __awaiter: __awaiter$2,\n    __generator: __generator$2,\n    __createBinding: __createBinding$2,\n    __exportStar: __exportStar$2,\n    __values: __values$2,\n    __read: __read$2,\n    __spread: __spread$2,\n    __spreadArrays: __spreadArrays$2,\n    __await: __await$2,\n    __asyncGenerator: __asyncGenerator$2,\n    __asyncDelegator: __asyncDelegator$2,\n    __asyncValues: __asyncValues$2,\n    __makeTemplateObject: __makeTemplateObject$2,\n    __importStar: __importStar$2,\n    __importDefault: __importDefault$2,\n    __classPrivateFieldGet: __classPrivateFieldGet$2,\n    __classPrivateFieldSet: __classPrivateFieldSet$2\n});\n\nvar constants$1 = createCommonjsModule(function (module, exports) {\nObject.defineProperty(exports, \"__esModule\", { value: true });\nexports.MAX_HASHABLE_LENGTH = exports.INIT = exports.KEY = exports.DIGEST_LENGTH = exports.BLOCK_SIZE = void 0;\n/**\n * @internal\n */\nexports.BLOCK_SIZE = 64;\n/**\n * @internal\n */\nexports.DIGEST_LENGTH = 32;\n/**\n * @internal\n */\nexports.KEY = new Uint32Array([\n    0x428a2f98,\n    0x71374491,\n    0xb5c0fbcf,\n    0xe9b5dba5,\n    0x3956c25b,\n    0x59f111f1,\n    0x923f82a4,\n    0xab1c5ed5,\n    0xd807aa98,\n    0x12835b01,\n    0x243185be,\n    0x550c7dc3,\n    0x72be5d74,\n    0x80deb1fe,\n    0x9bdc06a7,\n    0xc19bf174,\n    0xe49b69c1,\n    0xefbe4786,\n    0x0fc19dc6,\n    0x240ca1cc,\n    0x2de92c6f,\n    0x4a7484aa,\n    0x5cb0a9dc,\n    0x76f988da,\n    0x983e5152,\n    0xa831c66d,\n    0xb00327c8,\n    0xbf597fc7,\n    0xc6e00bf3,\n    0xd5a79147,\n    0x06ca6351,\n    0x14292967,\n    0x27b70a85,\n    0x2e1b2138,\n    0x4d2c6dfc,\n    0x53380d13,\n    0x650a7354,\n    0x766a0abb,\n    0x81c2c92e,\n    0x92722c85,\n    0xa2bfe8a1,\n    0xa81a664b,\n    0xc24b8b70,\n    0xc76c51a3,\n    0xd192e819,\n    0xd6990624,\n    0xf40e3585,\n    0x106aa070,\n    0x19a4c116,\n    0x1e376c08,\n    0x2748774c,\n    0x34b0bcb5,\n    0x391c0cb3,\n    0x4ed8aa4a,\n    0x5b9cca4f,\n    0x682e6ff3,\n    0x748f82ee,\n    0x78a5636f,\n    0x84c87814,\n    0x8cc70208,\n    0x90befffa,\n    0xa4506ceb,\n    0xbef9a3f7,\n    0xc67178f2\n]);\n/**\n * @internal\n */\nexports.INIT = [\n    0x6a09e667,\n    0xbb67ae85,\n    0x3c6ef372,\n    0xa54ff53a,\n    0x510e527f,\n    0x9b05688c,\n    0x1f83d9ab,\n    0x5be0cd19\n];\n/**\n * @internal\n */\nexports.MAX_HASHABLE_LENGTH = Math.pow(2, 53) - 1;\n\n});\n\nvar RawSha256_1 = createCommonjsModule(function (module, exports) {\nObject.defineProperty(exports, \"__esModule\", { value: true });\nexports.RawSha256 = void 0;\n\n/**\n * @internal\n */\nvar RawSha256 = /** @class */ (function () {\n    function RawSha256() {\n        this.state = Int32Array.from(constants$1.INIT);\n        this.temp = new Int32Array(64);\n        this.buffer = new Uint8Array(64);\n        this.bufferLength = 0;\n        this.bytesHashed = 0;\n        /**\n         * @internal\n         */\n        this.finished = false;\n    }\n    RawSha256.prototype.update = function (data) {\n        if (this.finished) {\n            throw new Error(\"Attempted to update an already finished hash.\");\n        }\n        var position = 0;\n        var byteLength = data.byteLength;\n        this.bytesHashed += byteLength;\n        if (this.bytesHashed * 8 > constants$1.MAX_HASHABLE_LENGTH) {\n            throw new Error(\"Cannot hash more than 2^53 - 1 bits\");\n        }\n        while (byteLength > 0) {\n            this.buffer[this.bufferLength++] = data[position++];\n            byteLength--;\n            if (this.bufferLength === constants$1.BLOCK_SIZE) {\n                this.hashBuffer();\n                this.bufferLength = 0;\n            }\n        }\n    };\n    RawSha256.prototype.digest = function () {\n        if (!this.finished) {\n            var bitsHashed = this.bytesHashed * 8;\n            var bufferView = new DataView(this.buffer.buffer, this.buffer.byteOffset, this.buffer.byteLength);\n            var undecoratedLength = this.bufferLength;\n            bufferView.setUint8(this.bufferLength++, 0x80);\n            // Ensure the final block has enough room for the hashed length\n            if (undecoratedLength % constants$1.BLOCK_SIZE >= constants$1.BLOCK_SIZE - 8) {\n                for (var i = this.bufferLength; i < constants$1.BLOCK_SIZE; i++) {\n                    bufferView.setUint8(i, 0);\n                }\n                this.hashBuffer();\n                this.bufferLength = 0;\n            }\n            for (var i = this.bufferLength; i < constants$1.BLOCK_SIZE - 8; i++) {\n                bufferView.setUint8(i, 0);\n            }\n            bufferView.setUint32(constants$1.BLOCK_SIZE - 8, Math.floor(bitsHashed / 0x100000000), true);\n            bufferView.setUint32(constants$1.BLOCK_SIZE - 4, bitsHashed);\n            this.hashBuffer();\n            this.finished = true;\n        }\n        // The value in state is little-endian rather than big-endian, so flip\n        // each word into a new Uint8Array\n        var out = new Uint8Array(constants$1.DIGEST_LENGTH);\n        for (var i = 0; i < 8; i++) {\n            out[i * 4] = (this.state[i] >>> 24) & 0xff;\n            out[i * 4 + 1] = (this.state[i] >>> 16) & 0xff;\n            out[i * 4 + 2] = (this.state[i] >>> 8) & 0xff;\n            out[i * 4 + 3] = (this.state[i] >>> 0) & 0xff;\n        }\n        return out;\n    };\n    RawSha256.prototype.hashBuffer = function () {\n        var _a = this, buffer = _a.buffer, state = _a.state;\n        var state0 = state[0], state1 = state[1], state2 = state[2], state3 = state[3], state4 = state[4], state5 = state[5], state6 = state[6], state7 = state[7];\n        for (var i = 0; i < constants$1.BLOCK_SIZE; i++) {\n            if (i < 16) {\n                this.temp[i] =\n                    ((buffer[i * 4] & 0xff) << 24) |\n                        ((buffer[i * 4 + 1] & 0xff) << 16) |\n                        ((buffer[i * 4 + 2] & 0xff) << 8) |\n                        (buffer[i * 4 + 3] & 0xff);\n            }\n            else {\n                var u = this.temp[i - 2];\n                var t1_1 = ((u >>> 17) | (u << 15)) ^ ((u >>> 19) | (u << 13)) ^ (u >>> 10);\n                u = this.temp[i - 15];\n                var t2_1 = ((u >>> 7) | (u << 25)) ^ ((u >>> 18) | (u << 14)) ^ (u >>> 3);\n                this.temp[i] =\n                    ((t1_1 + this.temp[i - 7]) | 0) + ((t2_1 + this.temp[i - 16]) | 0);\n            }\n            var t1 = ((((((state4 >>> 6) | (state4 << 26)) ^\n                ((state4 >>> 11) | (state4 << 21)) ^\n                ((state4 >>> 25) | (state4 << 7))) +\n                ((state4 & state5) ^ (~state4 & state6))) |\n                0) +\n                ((state7 + ((constants$1.KEY[i] + this.temp[i]) | 0)) | 0)) |\n                0;\n            var t2 = ((((state0 >>> 2) | (state0 << 30)) ^\n                ((state0 >>> 13) | (state0 << 19)) ^\n                ((state0 >>> 22) | (state0 << 10))) +\n                ((state0 & state1) ^ (state0 & state2) ^ (state1 & state2))) |\n                0;\n            state7 = state6;\n            state6 = state5;\n            state5 = state4;\n            state4 = (state3 + t1) | 0;\n            state3 = state2;\n            state2 = state1;\n            state1 = state0;\n            state0 = (t1 + t2) | 0;\n        }\n        state[0] += state0;\n        state[1] += state1;\n        state[2] += state2;\n        state[3] += state3;\n        state[4] += state4;\n        state[5] += state5;\n        state[6] += state6;\n        state[7] += state7;\n    };\n    return RawSha256;\n}());\nexports.RawSha256 = RawSha256;\n\n});\n\nvar jsSha256 = createCommonjsModule(function (module, exports) {\nObject.defineProperty(exports, \"__esModule\", { value: true });\nexports.Sha256 = void 0;\n\n\n\n\nvar Sha256 = /** @class */ (function () {\n    function Sha256(secret) {\n        this.secret = secret;\n        this.hash = new RawSha256_1.RawSha256();\n        this.reset();\n    }\n    Sha256.prototype.update = function (toHash) {\n        if ((0, build.isEmptyData)(toHash) || this.error) {\n            return;\n        }\n        try {\n            this.hash.update((0, build.convertToBuffer)(toHash));\n        }\n        catch (e) {\n            this.error = e;\n        }\n    };\n    /* This synchronous method keeps compatibility\n     * with the v2 aws-sdk.\n     */\n    Sha256.prototype.digestSync = function () {\n        if (this.error) {\n            throw this.error;\n        }\n        if (this.outer) {\n            if (!this.outer.finished) {\n                this.outer.update(this.hash.digest());\n            }\n            return this.outer.digest();\n        }\n        return this.hash.digest();\n    };\n    /* The underlying digest method here is synchronous.\n     * To keep the same interface with the other hash functions\n     * the default is to expose this as an async method.\n     * However, it can sometimes be useful to have a sync method.\n     */\n    Sha256.prototype.digest = function () {\n        return tslib_es6$2.__awaiter(this, void 0, void 0, function () {\n            return tslib_es6$2.__generator(this, function (_a) {\n                return [2 /*return*/, this.digestSync()];\n            });\n        });\n    };\n    Sha256.prototype.reset = function () {\n        this.hash = new RawSha256_1.RawSha256();\n        if (this.secret) {\n            this.outer = new RawSha256_1.RawSha256();\n            var inner = bufferFromSecret(this.secret);\n            var outer = new Uint8Array(constants$1.BLOCK_SIZE);\n            outer.set(inner);\n            for (var i = 0; i < constants$1.BLOCK_SIZE; i++) {\n                inner[i] ^= 0x36;\n                outer[i] ^= 0x5c;\n            }\n            this.hash.update(inner);\n            this.outer.update(outer);\n            // overwrite the copied key in memory\n            for (var i = 0; i < inner.byteLength; i++) {\n                inner[i] = 0;\n            }\n        }\n    };\n    return Sha256;\n}());\nexports.Sha256 = Sha256;\nfunction bufferFromSecret(secret) {\n    var input = (0, build.convertToBuffer)(secret);\n    if (input.byteLength > constants$1.BLOCK_SIZE) {\n        var bufferHash = new RawSha256_1.RawSha256();\n        bufferHash.update(input);\n        input = bufferHash.digest();\n    }\n    var buffer = new Uint8Array(constants$1.BLOCK_SIZE);\n    buffer.set(input);\n    return buffer;\n}\n\n});\n\nvar build$2 = createCommonjsModule(function (module, exports) {\nObject.defineProperty(exports, \"__esModule\", { value: true });\n\ntslib_es6$2.__exportStar(jsSha256, exports);\n\n});\n\n/*! *****************************************************************************\r\nCopyright (c) Microsoft Corporation.\r\n\r\nPermission to use, copy, modify, and/or distribute this software for any\r\npurpose with or without fee is hereby granted.\r\n\r\nTHE SOFTWARE IS PROVIDED \"AS IS\" AND THE AUTHOR DISCLAIMS ALL WARRANTIES WITH\r\nREGARD TO THIS SOFTWARE INCLUDING ALL IMPLIED WARRANTIES OF MERCHANTABILITY\r\nAND FITNESS. IN NO EVENT SHALL THE AUTHOR BE LIABLE FOR ANY SPECIAL, DIRECT,\r\nINDIRECT, OR CONSEQUENTIAL DAMAGES OR ANY DAMAGES WHATSOEVER RESULTING FROM\r\nLOSS OF USE, DATA OR PROFITS, WHETHER IN AN ACTION OF CONTRACT, NEGLIGENCE OR\r\nOTHER TORTIOUS ACTION, ARISING OUT OF OR IN CONNECTION WITH THE USE OR\r\nPERFORMANCE OF THIS SOFTWARE.\r\n***************************************************************************** */\r\n/* global Reflect, Promise */\r\n\r\nvar extendStatics$3 = function(d, b) {\r\n    extendStatics$3 = Object.setPrototypeOf ||\r\n        ({ __proto__: [] } instanceof Array && function (d, b) { d.__proto__ = b; }) ||\r\n        function (d, b) { for (var p in b) if (b.hasOwnProperty(p)) d[p] = b[p]; };\r\n    return extendStatics$3(d, b);\r\n};\r\n\r\nfunction __extends$3(d, b) {\r\n    extendStatics$3(d, b);\r\n    function __() { this.constructor = d; }\r\n    d.prototype = b === null ? Object.create(b) : (__.prototype = b.prototype, new __());\r\n}\r\n\r\nvar __assign$3 = function() {\r\n    __assign$3 = Object.assign || function __assign(t) {\r\n        for (var s, i = 1, n = arguments.length; i < n; i++) {\r\n            s = arguments[i];\r\n            for (var p in s) if (Object.prototype.hasOwnProperty.call(s, p)) t[p] = s[p];\r\n        }\r\n        return t;\r\n    };\r\n    return __assign$3.apply(this, arguments);\r\n};\r\n\r\nfunction __rest$3(s, e) {\r\n    var t = {};\r\n    for (var p in s) if (Object.prototype.hasOwnProperty.call(s, p) && e.indexOf(p) < 0)\r\n        t[p] = s[p];\r\n    if (s != null && typeof Object.getOwnPropertySymbols === \"function\")\r\n        for (var i = 0, p = Object.getOwnPropertySymbols(s); i < p.length; i++) {\r\n            if (e.indexOf(p[i]) < 0 && Object.prototype.propertyIsEnumerable.call(s, p[i]))\r\n                t[p[i]] = s[p[i]];\r\n        }\r\n    return t;\r\n}\r\n\r\nfunction __decorate$3(decorators, target, key, desc) {\r\n    var c = arguments.length, r = c < 3 ? target : desc === null ? desc = Object.getOwnPropertyDescriptor(target, key) : desc, d;\r\n    if (typeof Reflect === \"object\" && typeof Reflect.decorate === \"function\") r = Reflect.decorate(decorators, target, key, desc);\r\n    else for (var i = decorators.length - 1; i >= 0; i--) if (d = decorators[i]) r = (c < 3 ? d(r) : c > 3 ? d(target, key, r) : d(target, key)) || r;\r\n    return c > 3 && r && Object.defineProperty(target, key, r), r;\r\n}\r\n\r\nfunction __param$3(paramIndex, decorator) {\r\n    return function (target, key) { decorator(target, key, paramIndex); }\r\n}\r\n\r\nfunction __metadata$3(metadataKey, metadataValue) {\r\n    if (typeof Reflect === \"object\" && typeof Reflect.metadata === \"function\") return Reflect.metadata(metadataKey, metadataValue);\r\n}\r\n\r\nfunction __awaiter$3(thisArg, _arguments, P, generator) {\r\n    function adopt(value) { return value instanceof P ? value : new P(function (resolve) { resolve(value); }); }\r\n    return new (P || (P = Promise))(function (resolve, reject) {\r\n        function fulfilled(value) { try { step(generator.next(value)); } catch (e) { reject(e); } }\r\n        function rejected(value) { try { step(generator[\"throw\"](value)); } catch (e) { reject(e); } }\r\n        function step(result) { result.done ? resolve(result.value) : adopt(result.value).then(fulfilled, rejected); }\r\n        step((generator = generator.apply(thisArg, _arguments || [])).next());\r\n    });\r\n}\r\n\r\nfunction __generator$3(thisArg, body) {\r\n    var _ = { label: 0, sent: function() { if (t[0] & 1) throw t[1]; return t[1]; }, trys: [], ops: [] }, f, y, t, g;\r\n    return g = { next: verb(0), \"throw\": verb(1), \"return\": verb(2) }, typeof Symbol === \"function\" && (g[Symbol.iterator] = function() { return this; }), g;\r\n    function verb(n) { return function (v) { return step([n, v]); }; }\r\n    function step(op) {\r\n        if (f) throw new TypeError(\"Generator is already executing.\");\r\n        while (_) try {\r\n            if (f = 1, y && (t = op[0] & 2 ? y[\"return\"] : op[0] ? y[\"throw\"] || ((t = y[\"return\"]) && t.call(y), 0) : y.next) && !(t = t.call(y, op[1])).done) return t;\r\n            if (y = 0, t) op = [op[0] & 2, t.value];\r\n            switch (op[0]) {\r\n                case 0: case 1: t = op; break;\r\n                case 4: _.label++; return { value: op[1], done: false };\r\n                case 5: _.label++; y = op[1]; op = [0]; continue;\r\n                case 7: op = _.ops.pop(); _.trys.pop(); continue;\r\n                default:\r\n                    if (!(t = _.trys, t = t.length > 0 && t[t.length - 1]) && (op[0] === 6 || op[0] === 2)) { _ = 0; continue; }\r\n                    if (op[0] === 3 && (!t || (op[1] > t[0] && op[1] < t[3]))) { _.label = op[1]; break; }\r\n                    if (op[0] === 6 && _.label < t[1]) { _.label = t[1]; t = op; break; }\r\n                    if (t && _.label < t[2]) { _.label = t[2]; _.ops.push(op); break; }\r\n                    if (t[2]) _.ops.pop();\r\n                    _.trys.pop(); continue;\r\n            }\r\n            op = body.call(thisArg, _);\r\n        } catch (e) { op = [6, e]; y = 0; } finally { f = t = 0; }\r\n        if (op[0] & 5) throw op[1]; return { value: op[0] ? op[1] : void 0, done: true };\r\n    }\r\n}\r\n\r\nfunction __createBinding$3(o, m, k, k2) {\r\n    if (k2 === undefined) k2 = k;\r\n    o[k2] = m[k];\r\n}\r\n\r\nfunction __exportStar$3(m, exports) {\r\n    for (var p in m) if (p !== \"default\" && !exports.hasOwnProperty(p)) exports[p] = m[p];\r\n}\r\n\r\nfunction __values$3(o) {\r\n    var s = typeof Symbol === \"function\" && Symbol.iterator, m = s && o[s], i = 0;\r\n    if (m) return m.call(o);\r\n    if (o && typeof o.length === \"number\") return {\r\n        next: function () {\r\n            if (o && i >= o.length) o = void 0;\r\n            return { value: o && o[i++], done: !o };\r\n        }\r\n    };\r\n    throw new TypeError(s ? \"Object is not iterable.\" : \"Symbol.iterator is not defined.\");\r\n}\r\n\r\nfunction __read$3(o, n) {\r\n    var m = typeof Symbol === \"function\" && o[Symbol.iterator];\r\n    if (!m) return o;\r\n    var i = m.call(o), r, ar = [], e;\r\n    try {\r\n        while ((n === void 0 || n-- > 0) && !(r = i.next()).done) ar.push(r.value);\r\n    }\r\n    catch (error) { e = { error: error }; }\r\n    finally {\r\n        try {\r\n            if (r && !r.done && (m = i[\"return\"])) m.call(i);\r\n        }\r\n        finally { if (e) throw e.error; }\r\n    }\r\n    return ar;\r\n}\r\n\r\nfunction __spread$3() {\r\n    for (var ar = [], i = 0; i < arguments.length; i++)\r\n        ar = ar.concat(__read$3(arguments[i]));\r\n    return ar;\r\n}\r\n\r\nfunction __spreadArrays$3() {\r\n    for (var s = 0, i = 0, il = arguments.length; i < il; i++) s += arguments[i].length;\r\n    for (var r = Array(s), k = 0, i = 0; i < il; i++)\r\n        for (var a = arguments[i], j = 0, jl = a.length; j < jl; j++, k++)\r\n            r[k] = a[j];\r\n    return r;\r\n}\r\nfunction __await$3(v) {\r\n    return this instanceof __await$3 ? (this.v = v, this) : new __await$3(v);\r\n}\r\n\r\nfunction __asyncGenerator$3(thisArg, _arguments, generator) {\r\n    if (!Symbol.asyncIterator) throw new TypeError(\"Symbol.asyncIterator is not defined.\");\r\n    var g = generator.apply(thisArg, _arguments || []), i, q = [];\r\n    return i = {}, verb(\"next\"), verb(\"throw\"), verb(\"return\"), i[Symbol.asyncIterator] = function () { return this; }, i;\r\n    function verb(n) { if (g[n]) i[n] = function (v) { return new Promise(function (a, b) { q.push([n, v, a, b]) > 1 || resume(n, v); }); }; }\r\n    function resume(n, v) { try { step(g[n](v)); } catch (e) { settle(q[0][3], e); } }\r\n    function step(r) { r.value instanceof __await$3 ? Promise.resolve(r.value.v).then(fulfill, reject) : settle(q[0][2], r); }\r\n    function fulfill(value) { resume(\"next\", value); }\r\n    function reject(value) { resume(\"throw\", value); }\r\n    function settle(f, v) { if (f(v), q.shift(), q.length) resume(q[0][0], q[0][1]); }\r\n}\r\n\r\nfunction __asyncDelegator$3(o) {\r\n    var i, p;\r\n    return i = {}, verb(\"next\"), verb(\"throw\", function (e) { throw e; }), verb(\"return\"), i[Symbol.iterator] = function () { return this; }, i;\r\n    function verb(n, f) { i[n] = o[n] ? function (v) { return (p = !p) ? { value: __await$3(o[n](v)), done: n === \"return\" } : f ? f(v) : v; } : f; }\r\n}\r\n\r\nfunction __asyncValues$3(o) {\r\n    if (!Symbol.asyncIterator) throw new TypeError(\"Symbol.asyncIterator is not defined.\");\r\n    var m = o[Symbol.asyncIterator], i;\r\n    return m ? m.call(o) : (o = typeof __values$3 === \"function\" ? __values$3(o) : o[Symbol.iterator](), i = {}, verb(\"next\"), verb(\"throw\"), verb(\"return\"), i[Symbol.asyncIterator] = function () { return this; }, i);\r\n    function verb(n) { i[n] = o[n] && function (v) { return new Promise(function (resolve, reject) { v = o[n](v), settle(resolve, reject, v.done, v.value); }); }; }\r\n    function settle(resolve, reject, d, v) { Promise.resolve(v).then(function(v) { resolve({ value: v, done: d }); }, reject); }\r\n}\r\n\r\nfunction __makeTemplateObject$3(cooked, raw) {\r\n    if (Object.defineProperty) { Object.defineProperty(cooked, \"raw\", { value: raw }); } else { cooked.raw = raw; }\r\n    return cooked;\r\n}\r\nfunction __importStar$3(mod) {\r\n    if (mod && mod.__esModule) return mod;\r\n    var result = {};\r\n    if (mod != null) for (var k in mod) if (Object.hasOwnProperty.call(mod, k)) result[k] = mod[k];\r\n    result.default = mod;\r\n    return result;\r\n}\r\n\r\nfunction __importDefault$3(mod) {\r\n    return (mod && mod.__esModule) ? mod : { default: mod };\r\n}\r\n\r\nfunction __classPrivateFieldGet$3(receiver, privateMap) {\r\n    if (!privateMap.has(receiver)) {\r\n        throw new TypeError(\"attempted to get private field on non-instance\");\r\n    }\r\n    return privateMap.get(receiver);\r\n}\r\n\r\nfunction __classPrivateFieldSet$3(receiver, privateMap, value) {\r\n    if (!privateMap.has(receiver)) {\r\n        throw new TypeError(\"attempted to set private field on non-instance\");\r\n    }\r\n    privateMap.set(receiver, value);\r\n    return value;\r\n}\n\nvar tslib_es6$3 = /*#__PURE__*/Object.freeze({\n    __proto__: null,\n    __extends: __extends$3,\n    get __assign () { return __assign$3; },\n    __rest: __rest$3,\n    __decorate: __decorate$3,\n    __param: __param$3,\n    __metadata: __metadata$3,\n    __awaiter: __awaiter$3,\n    __generator: __generator$3,\n    __createBinding: __createBinding$3,\n    __exportStar: __exportStar$3,\n    __values: __values$3,\n    __read: __read$3,\n    __spread: __spread$3,\n    __spreadArrays: __spreadArrays$3,\n    __await: __await$3,\n    __asyncGenerator: __asyncGenerator$3,\n    __asyncDelegator: __asyncDelegator$3,\n    __asyncValues: __asyncValues$3,\n    __makeTemplateObject: __makeTemplateObject$3,\n    __importStar: __importStar$3,\n    __importDefault: __importDefault$3,\n    __classPrivateFieldGet: __classPrivateFieldGet$3,\n    __classPrivateFieldSet: __classPrivateFieldSet$3\n});\n\nvar supportsWebCrypto_1 = createCommonjsModule(function (module, exports) {\nObject.defineProperty(exports, \"__esModule\", { value: true });\nexports.supportsZeroByteGCM = exports.supportsSubtleCrypto = exports.supportsSecureRandom = exports.supportsWebCrypto = void 0;\n\nvar subtleCryptoMethods = [\n    \"decrypt\",\n    \"digest\",\n    \"encrypt\",\n    \"exportKey\",\n    \"generateKey\",\n    \"importKey\",\n    \"sign\",\n    \"verify\"\n];\nfunction supportsWebCrypto(window) {\n    if (supportsSecureRandom(window) &&\n        typeof window.crypto.subtle === \"object\") {\n        var subtle = window.crypto.subtle;\n        return supportsSubtleCrypto(subtle);\n    }\n    return false;\n}\nexports.supportsWebCrypto = supportsWebCrypto;\nfunction supportsSecureRandom(window) {\n    if (typeof window === \"object\" && typeof window.crypto === \"object\") {\n        var getRandomValues = window.crypto.getRandomValues;\n        return typeof getRandomValues === \"function\";\n    }\n    return false;\n}\nexports.supportsSecureRandom = supportsSecureRandom;\nfunction supportsSubtleCrypto(subtle) {\n    return (subtle &&\n        subtleCryptoMethods.every(function (methodName) { return typeof subtle[methodName] === \"function\"; }));\n}\nexports.supportsSubtleCrypto = supportsSubtleCrypto;\nfunction supportsZeroByteGCM(subtle) {\n    return tslib_es6$3.__awaiter(this, void 0, void 0, function () {\n        var key, zeroByteAuthTag;\n        return tslib_es6$3.__generator(this, function (_b) {\n            switch (_b.label) {\n                case 0:\n                    if (!supportsSubtleCrypto(subtle))\n                        return [2 /*return*/, false];\n                    _b.label = 1;\n                case 1:\n                    _b.trys.push([1, 4, , 5]);\n                    return [4 /*yield*/, subtle.generateKey({ name: \"AES-GCM\", length: 128 }, false, [\"encrypt\"])];\n                case 2:\n                    key = _b.sent();\n                    return [4 /*yield*/, subtle.encrypt({\n                            name: \"AES-GCM\",\n                            iv: new Uint8Array(Array(12)),\n                            additionalData: new Uint8Array(Array(16)),\n                            tagLength: 128\n                        }, key, new Uint8Array(0))];\n                case 3:\n                    zeroByteAuthTag = _b.sent();\n                    return [2 /*return*/, zeroByteAuthTag.byteLength === 16];\n                case 4:\n                    _b.sent();\n                    return [2 /*return*/, false];\n                case 5: return [2 /*return*/];\n            }\n        });\n    });\n}\nexports.supportsZeroByteGCM = supportsZeroByteGCM;\n\n});\n\nvar build$3 = createCommonjsModule(function (module, exports) {\nObject.defineProperty(exports, \"__esModule\", { value: true });\n\ntslib_es6$3.__exportStar(supportsWebCrypto_1, exports);\n\n});\n\n/*! *****************************************************************************\r\nCopyright (c) Microsoft Corporation.\r\n\r\nPermission to use, copy, modify, and/or distribute this software for any\r\npurpose with or without fee is hereby granted.\r\n\r\nTHE SOFTWARE IS PROVIDED \"AS IS\" AND THE AUTHOR DISCLAIMS ALL WARRANTIES WITH\r\nREGARD TO THIS SOFTWARE INCLUDING ALL IMPLIED WARRANTIES OF MERCHANTABILITY\r\nAND FITNESS. IN NO EVENT SHALL THE AUTHOR BE LIABLE FOR ANY SPECIAL, DIRECT,\r\nINDIRECT, OR CONSEQUENTIAL DAMAGES OR ANY DAMAGES WHATSOEVER RESULTING FROM\r\nLOSS OF USE, DATA OR PROFITS, WHETHER IN AN ACTION OF CONTRACT, NEGLIGENCE OR\r\nOTHER TORTIOUS ACTION, ARISING OUT OF OR IN CONNECTION WITH THE USE OR\r\nPERFORMANCE OF THIS SOFTWARE.\r\n***************************************************************************** */\r\n/* global Reflect, Promise */\r\n\r\nvar extendStatics$4 = function(d, b) {\r\n    extendStatics$4 = Object.setPrototypeOf ||\r\n        ({ __proto__: [] } instanceof Array && function (d, b) { d.__proto__ = b; }) ||\r\n        function (d, b) { for (var p in b) if (b.hasOwnProperty(p)) d[p] = b[p]; };\r\n    return extendStatics$4(d, b);\r\n};\r\n\r\nfunction __extends$4(d, b) {\r\n    extendStatics$4(d, b);\r\n    function __() { this.constructor = d; }\r\n    d.prototype = b === null ? Object.create(b) : (__.prototype = b.prototype, new __());\r\n}\r\n\r\nvar __assign$4 = function() {\r\n    __assign$4 = Object.assign || function __assign(t) {\r\n        for (var s, i = 1, n = arguments.length; i < n; i++) {\r\n            s = arguments[i];\r\n            for (var p in s) if (Object.prototype.hasOwnProperty.call(s, p)) t[p] = s[p];\r\n        }\r\n        return t;\r\n    };\r\n    return __assign$4.apply(this, arguments);\r\n};\r\n\r\nfunction __rest$4(s, e) {\r\n    var t = {};\r\n    for (var p in s) if (Object.prototype.hasOwnProperty.call(s, p) && e.indexOf(p) < 0)\r\n        t[p] = s[p];\r\n    if (s != null && typeof Object.getOwnPropertySymbols === \"function\")\r\n        for (var i = 0, p = Object.getOwnPropertySymbols(s); i < p.length; i++) {\r\n            if (e.indexOf(p[i]) < 0 && Object.prototype.propertyIsEnumerable.call(s, p[i]))\r\n                t[p[i]] = s[p[i]];\r\n        }\r\n    return t;\r\n}\r\n\r\nfunction __decorate$4(decorators, target, key, desc) {\r\n    var c = arguments.length, r = c < 3 ? target : desc === null ? desc = Object.getOwnPropertyDescriptor(target, key) : desc, d;\r\n    if (typeof Reflect === \"object\" && typeof Reflect.decorate === \"function\") r = Reflect.decorate(decorators, target, key, desc);\r\n    else for (var i = decorators.length - 1; i >= 0; i--) if (d = decorators[i]) r = (c < 3 ? d(r) : c > 3 ? d(target, key, r) : d(target, key)) || r;\r\n    return c > 3 && r && Object.defineProperty(target, key, r), r;\r\n}\r\n\r\nfunction __param$4(paramIndex, decorator) {\r\n    return function (target, key) { decorator(target, key, paramIndex); }\r\n}\r\n\r\nfunction __metadata$4(metadataKey, metadataValue) {\r\n    if (typeof Reflect === \"object\" && typeof Reflect.metadata === \"function\") return Reflect.metadata(metadataKey, metadataValue);\r\n}\r\n\r\nfunction __awaiter$4(thisArg, _arguments, P, generator) {\r\n    function adopt(value) { return value instanceof P ? value : new P(function (resolve) { resolve(value); }); }\r\n    return new (P || (P = Promise))(function (resolve, reject) {\r\n        function fulfilled(value) { try { step(generator.next(value)); } catch (e) { reject(e); } }\r\n        function rejected(value) { try { step(generator[\"throw\"](value)); } catch (e) { reject(e); } }\r\n        function step(result) { result.done ? resolve(result.value) : adopt(result.value).then(fulfilled, rejected); }\r\n        step((generator = generator.apply(thisArg, _arguments || [])).next());\r\n    });\r\n}\r\n\r\nfunction __generator$4(thisArg, body) {\r\n    var _ = { label: 0, sent: function() { if (t[0] & 1) throw t[1]; return t[1]; }, trys: [], ops: [] }, f, y, t, g;\r\n    return g = { next: verb(0), \"throw\": verb(1), \"return\": verb(2) }, typeof Symbol === \"function\" && (g[Symbol.iterator] = function() { return this; }), g;\r\n    function verb(n) { return function (v) { return step([n, v]); }; }\r\n    function step(op) {\r\n        if (f) throw new TypeError(\"Generator is already executing.\");\r\n        while (_) try {\r\n            if (f = 1, y && (t = op[0] & 2 ? y[\"return\"] : op[0] ? y[\"throw\"] || ((t = y[\"return\"]) && t.call(y), 0) : y.next) && !(t = t.call(y, op[1])).done) return t;\r\n            if (y = 0, t) op = [op[0] & 2, t.value];\r\n            switch (op[0]) {\r\n                case 0: case 1: t = op; break;\r\n                case 4: _.label++; return { value: op[1], done: false };\r\n                case 5: _.label++; y = op[1]; op = [0]; continue;\r\n                case 7: op = _.ops.pop(); _.trys.pop(); continue;\r\n                default:\r\n                    if (!(t = _.trys, t = t.length > 0 && t[t.length - 1]) && (op[0] === 6 || op[0] === 2)) { _ = 0; continue; }\r\n                    if (op[0] === 3 && (!t || (op[1] > t[0] && op[1] < t[3]))) { _.label = op[1]; break; }\r\n                    if (op[0] === 6 && _.label < t[1]) { _.label = t[1]; t = op; break; }\r\n                    if (t && _.label < t[2]) { _.label = t[2]; _.ops.push(op); break; }\r\n                    if (t[2]) _.ops.pop();\r\n                    _.trys.pop(); continue;\r\n            }\r\n            op = body.call(thisArg, _);\r\n        } catch (e) { op = [6, e]; y = 0; } finally { f = t = 0; }\r\n        if (op[0] & 5) throw op[1]; return { value: op[0] ? op[1] : void 0, done: true };\r\n    }\r\n}\r\n\r\nfunction __createBinding$4(o, m, k, k2) {\r\n    if (k2 === undefined) k2 = k;\r\n    o[k2] = m[k];\r\n}\r\n\r\nfunction __exportStar$4(m, exports) {\r\n    for (var p in m) if (p !== \"default\" && !exports.hasOwnProperty(p)) exports[p] = m[p];\r\n}\r\n\r\nfunction __values$4(o) {\r\n    var s = typeof Symbol === \"function\" && Symbol.iterator, m = s && o[s], i = 0;\r\n    if (m) return m.call(o);\r\n    if (o && typeof o.length === \"number\") return {\r\n        next: function () {\r\n            if (o && i >= o.length) o = void 0;\r\n            return { value: o && o[i++], done: !o };\r\n        }\r\n    };\r\n    throw new TypeError(s ? \"Object is not iterable.\" : \"Symbol.iterator is not defined.\");\r\n}\r\n\r\nfunction __read$4(o, n) {\r\n    var m = typeof Symbol === \"function\" && o[Symbol.iterator];\r\n    if (!m) return o;\r\n    var i = m.call(o), r, ar = [], e;\r\n    try {\r\n        while ((n === void 0 || n-- > 0) && !(r = i.next()).done) ar.push(r.value);\r\n    }\r\n    catch (error) { e = { error: error }; }\r\n    finally {\r\n        try {\r\n            if (r && !r.done && (m = i[\"return\"])) m.call(i);\r\n        }\r\n        finally { if (e) throw e.error; }\r\n    }\r\n    return ar;\r\n}\r\n\r\nfunction __spread$4() {\r\n    for (var ar = [], i = 0; i < arguments.length; i++)\r\n        ar = ar.concat(__read$4(arguments[i]));\r\n    return ar;\r\n}\r\n\r\nfunction __spreadArrays$4() {\r\n    for (var s = 0, i = 0, il = arguments.length; i < il; i++) s += arguments[i].length;\r\n    for (var r = Array(s), k = 0, i = 0; i < il; i++)\r\n        for (var a = arguments[i], j = 0, jl = a.length; j < jl; j++, k++)\r\n            r[k] = a[j];\r\n    return r;\r\n}\r\nfunction __await$4(v) {\r\n    return this instanceof __await$4 ? (this.v = v, this) : new __await$4(v);\r\n}\r\n\r\nfunction __asyncGenerator$4(thisArg, _arguments, generator) {\r\n    if (!Symbol.asyncIterator) throw new TypeError(\"Symbol.asyncIterator is not defined.\");\r\n    var g = generator.apply(thisArg, _arguments || []), i, q = [];\r\n    return i = {}, verb(\"next\"), verb(\"throw\"), verb(\"return\"), i[Symbol.asyncIterator] = function () { return this; }, i;\r\n    function verb(n) { if (g[n]) i[n] = function (v) { return new Promise(function (a, b) { q.push([n, v, a, b]) > 1 || resume(n, v); }); }; }\r\n    function resume(n, v) { try { step(g[n](v)); } catch (e) { settle(q[0][3], e); } }\r\n    function step(r) { r.value instanceof __await$4 ? Promise.resolve(r.value.v).then(fulfill, reject) : settle(q[0][2], r); }\r\n    function fulfill(value) { resume(\"next\", value); }\r\n    function reject(value) { resume(\"throw\", value); }\r\n    function settle(f, v) { if (f(v), q.shift(), q.length) resume(q[0][0], q[0][1]); }\r\n}\r\n\r\nfunction __asyncDelegator$4(o) {\r\n    var i, p;\r\n    return i = {}, verb(\"next\"), verb(\"throw\", function (e) { throw e; }), verb(\"return\"), i[Symbol.iterator] = function () { return this; }, i;\r\n    function verb(n, f) { i[n] = o[n] ? function (v) { return (p = !p) ? { value: __await$4(o[n](v)), done: n === \"return\" } : f ? f(v) : v; } : f; }\r\n}\r\n\r\nfunction __asyncValues$4(o) {\r\n    if (!Symbol.asyncIterator) throw new TypeError(\"Symbol.asyncIterator is not defined.\");\r\n    var m = o[Symbol.asyncIterator], i;\r\n    return m ? m.call(o) : (o = typeof __values$4 === \"function\" ? __values$4(o) : o[Symbol.iterator](), i = {}, verb(\"next\"), verb(\"throw\"), verb(\"return\"), i[Symbol.asyncIterator] = function () { return this; }, i);\r\n    function verb(n) { i[n] = o[n] && function (v) { return new Promise(function (resolve, reject) { v = o[n](v), settle(resolve, reject, v.done, v.value); }); }; }\r\n    function settle(resolve, reject, d, v) { Promise.resolve(v).then(function(v) { resolve({ value: v, done: d }); }, reject); }\r\n}\r\n\r\nfunction __makeTemplateObject$4(cooked, raw) {\r\n    if (Object.defineProperty) { Object.defineProperty(cooked, \"raw\", { value: raw }); } else { cooked.raw = raw; }\r\n    return cooked;\r\n}\r\nfunction __importStar$4(mod) {\r\n    if (mod && mod.__esModule) return mod;\r\n    var result = {};\r\n    if (mod != null) for (var k in mod) if (Object.hasOwnProperty.call(mod, k)) result[k] = mod[k];\r\n    result.default = mod;\r\n    return result;\r\n}\r\n\r\nfunction __importDefault$4(mod) {\r\n    return (mod && mod.__esModule) ? mod : { default: mod };\r\n}\r\n\r\nfunction __classPrivateFieldGet$4(receiver, privateMap) {\r\n    if (!privateMap.has(receiver)) {\r\n        throw new TypeError(\"attempted to get private field on non-instance\");\r\n    }\r\n    return privateMap.get(receiver);\r\n}\r\n\r\nfunction __classPrivateFieldSet$4(receiver, privateMap, value) {\r\n    if (!privateMap.has(receiver)) {\r\n        throw new TypeError(\"attempted to set private field on non-instance\");\r\n    }\r\n    privateMap.set(receiver, value);\r\n    return value;\r\n}\n\nvar tslib_es6$4 = /*#__PURE__*/Object.freeze({\n    __proto__: null,\n    __extends: __extends$4,\n    get __assign () { return __assign$4; },\n    __rest: __rest$4,\n    __decorate: __decorate$4,\n    __param: __param$4,\n    __metadata: __metadata$4,\n    __awaiter: __awaiter$4,\n    __generator: __generator$4,\n    __createBinding: __createBinding$4,\n    __exportStar: __exportStar$4,\n    __values: __values$4,\n    __read: __read$4,\n    __spread: __spread$4,\n    __spreadArrays: __spreadArrays$4,\n    __await: __await$4,\n    __asyncGenerator: __asyncGenerator$4,\n    __asyncDelegator: __asyncDelegator$4,\n    __asyncValues: __asyncValues$4,\n    __makeTemplateObject: __makeTemplateObject$4,\n    __importStar: __importStar$4,\n    __importDefault: __importDefault$4,\n    __classPrivateFieldGet: __classPrivateFieldGet$4,\n    __classPrivateFieldSet: __classPrivateFieldSet$4\n});\n\nvar CryptoOperation = createCommonjsModule(function (module, exports) {\nObject.defineProperty(exports, \"__esModule\", { value: true });\n\n});\n\nvar Key = createCommonjsModule(function (module, exports) {\nObject.defineProperty(exports, \"__esModule\", { value: true });\n\n});\n\nvar KeyOperation = createCommonjsModule(function (module, exports) {\nObject.defineProperty(exports, \"__esModule\", { value: true });\n\n});\n\nvar MsSubtleCrypto = createCommonjsModule(function (module, exports) {\nObject.defineProperty(exports, \"__esModule\", { value: true });\n\n});\n\nvar MsWindow = createCommonjsModule(function (module, exports) {\nObject.defineProperty(exports, \"__esModule\", { value: true });\nexports.isMsWindow = void 0;\nvar msSubtleCryptoMethods = [\n    \"decrypt\",\n    \"digest\",\n    \"encrypt\",\n    \"exportKey\",\n    \"generateKey\",\n    \"importKey\",\n    \"sign\",\n    \"verify\"\n];\nfunction quacksLikeAnMsWindow(window) {\n    return \"MSInputMethodContext\" in window && \"msCrypto\" in window;\n}\n/**\n * Determines if the provided window is (or is like) the window object one would\n * expect to encounter in Internet Explorer 11.\n */\nfunction isMsWindow(window) {\n    if (quacksLikeAnMsWindow(window) && window.msCrypto.subtle !== undefined) {\n        var _a = window.msCrypto, getRandomValues = _a.getRandomValues, subtle_1 = _a.subtle;\n        return msSubtleCryptoMethods\n            .map(function (methodName) { return subtle_1[methodName]; })\n            .concat(getRandomValues)\n            .every(function (method) { return typeof method === \"function\"; });\n    }\n    return false;\n}\nexports.isMsWindow = isMsWindow;\n\n});\n\nvar build$4 = createCommonjsModule(function (module, exports) {\nObject.defineProperty(exports, \"__esModule\", { value: true });\n\ntslib_es6$4.__exportStar(CryptoOperation, exports);\ntslib_es6$4.__exportStar(Key, exports);\ntslib_es6$4.__exportStar(KeyOperation, exports);\ntslib_es6$4.__exportStar(MsSubtleCrypto, exports);\ntslib_es6$4.__exportStar(MsWindow, exports);\n\n});\n\nvar crossPlatformSha256 = createCommonjsModule(function (module, exports) {\nObject.defineProperty(exports, \"__esModule\", { value: true });\nexports.Sha256 = void 0;\n\n\n\n\n\n\n\nvar Sha256 = /** @class */ (function () {\n    function Sha256(secret) {\n        if ((0, build$3.supportsWebCrypto)((0, distEs$1.locateWindow)())) {\n            this.hash = new webCryptoSha256.Sha256(secret);\n        }\n        else if ((0, build$4.isMsWindow)((0, distEs$1.locateWindow)())) {\n            this.hash = new ie11Sha256.Sha256(secret);\n        }\n        else {\n            this.hash = new build$2.Sha256(secret);\n        }\n    }\n    Sha256.prototype.update = function (data, encoding) {\n        this.hash.update((0, build.convertToBuffer)(data));\n    };\n    Sha256.prototype.digest = function () {\n        return this.hash.digest();\n    };\n    Sha256.prototype.reset = function () {\n        this.hash.reset();\n    };\n    return Sha256;\n}());\nexports.Sha256 = Sha256;\n\n});\n\nvar build$5 = createCommonjsModule(function (module, exports) {\nObject.defineProperty(exports, \"__esModule\", { value: true });\nexports.WebCryptoSha256 = exports.Ie11Sha256 = void 0;\n\ntslib_es6$1.__exportStar(crossPlatformSha256, exports);\n\nObject.defineProperty(exports, \"Ie11Sha256\", { enumerable: true, get: function () { return ie11Sha256.Sha256; } });\n\nObject.defineProperty(exports, \"WebCryptoSha256\", { enumerable: true, get: function () { return webCryptoSha256.Sha256; } });\n\n});\n\n// NOTE: this list must be up-to-date with browsers listed in\n// test/acceptance/useragentstrings.yml\nconst BROWSER_ALIASES_MAP = {\n  'Amazon Silk': 'amazon_silk',\n  'Android Browser': 'android',\n  Bada: 'bada',\n  BlackBerry: 'blackberry',\n  Chrome: 'chrome',\n  Chromium: 'chromium',\n  Electron: 'electron',\n  Epiphany: 'epiphany',\n  Firefox: 'firefox',\n  Focus: 'focus',\n  Generic: 'generic',\n  'Google Search': 'google_search',\n  Googlebot: 'googlebot',\n  'Internet Explorer': 'ie',\n  'K-Meleon': 'k_meleon',\n  Maxthon: 'maxthon',\n  'Microsoft Edge': 'edge',\n  'MZ Browser': 'mz',\n  'NAVER Whale Browser': 'naver',\n  Opera: 'opera',\n  'Opera Coast': 'opera_coast',\n  PhantomJS: 'phantomjs',\n  Puffin: 'puffin',\n  QupZilla: 'qupzilla',\n  QQ: 'qq',\n  QQLite: 'qqlite',\n  Safari: 'safari',\n  Sailfish: 'sailfish',\n  'Samsung Internet for Android': 'samsung_internet',\n  SeaMonkey: 'seamonkey',\n  Sleipnir: 'sleipnir',\n  Swing: 'swing',\n  Tizen: 'tizen',\n  'UC Browser': 'uc',\n  Vivaldi: 'vivaldi',\n  'WebOS Browser': 'webos',\n  WeChat: 'wechat',\n  'Yandex Browser': 'yandex',\n  Roku: 'roku',\n};\n\nconst BROWSER_MAP = {\n  amazon_silk: 'Amazon Silk',\n  android: 'Android Browser',\n  bada: 'Bada',\n  blackberry: 'BlackBerry',\n  chrome: 'Chrome',\n  chromium: 'Chromium',\n  electron: 'Electron',\n  epiphany: 'Epiphany',\n  firefox: 'Firefox',\n  focus: 'Focus',\n  generic: 'Generic',\n  googlebot: 'Googlebot',\n  google_search: 'Google Search',\n  ie: 'Internet Explorer',\n  k_meleon: 'K-Meleon',\n  maxthon: 'Maxthon',\n  edge: 'Microsoft Edge',\n  mz: 'MZ Browser',\n  naver: 'NAVER Whale Browser',\n  opera: 'Opera',\n  opera_coast: 'Opera Coast',\n  phantomjs: 'PhantomJS',\n  puffin: 'Puffin',\n  qupzilla: 'QupZilla',\n  qq: 'QQ Browser',\n  qqlite: 'QQ Browser Lite',\n  safari: 'Safari',\n  sailfish: 'Sailfish',\n  samsung_internet: 'Samsung Internet for Android',\n  seamonkey: 'SeaMonkey',\n  sleipnir: 'Sleipnir',\n  swing: 'Swing',\n  tizen: 'Tizen',\n  uc: 'UC Browser',\n  vivaldi: 'Vivaldi',\n  webos: 'WebOS Browser',\n  wechat: 'WeChat',\n  yandex: 'Yandex Browser',\n};\n\nconst PLATFORMS_MAP = {\n  tablet: 'tablet',\n  mobile: 'mobile',\n  desktop: 'desktop',\n  tv: 'tv',\n};\n\nconst OS_MAP = {\n  WindowsPhone: 'Windows Phone',\n  Windows: 'Windows',\n  MacOS: 'macOS',\n  iOS: 'iOS',\n  Android: 'Android',\n  WebOS: 'WebOS',\n  BlackBerry: 'BlackBerry',\n  Bada: 'Bada',\n  Tizen: 'Tizen',\n  Linux: 'Linux',\n  ChromeOS: 'Chrome OS',\n  PlayStation4: 'PlayStation 4',\n  Roku: 'Roku',\n};\n\nconst ENGINE_MAP = {\n  EdgeHTML: 'EdgeHTML',\n  Blink: 'Blink',\n  Trident: 'Trident',\n  Presto: 'Presto',\n  Gecko: 'Gecko',\n  WebKit: 'WebKit',\n};\n\nclass Utils {\n  /**\n   * Get first matched item for a string\n   * @param {RegExp} regexp\n   * @param {String} ua\n   * @return {Array|{index: number, input: string}|*|boolean|string}\n   */\n  static getFirstMatch(regexp, ua) {\n    const match = ua.match(regexp);\n    return (match && match.length > 0 && match[1]) || '';\n  }\n\n  /**\n   * Get second matched item for a string\n   * @param regexp\n   * @param {String} ua\n   * @return {Array|{index: number, input: string}|*|boolean|string}\n   */\n  static getSecondMatch(regexp, ua) {\n    const match = ua.match(regexp);\n    return (match && match.length > 1 && match[2]) || '';\n  }\n\n  /**\n   * Match a regexp and return a constant or undefined\n   * @param {RegExp} regexp\n   * @param {String} ua\n   * @param {*} _const Any const that will be returned if regexp matches the string\n   * @return {*}\n   */\n  static matchAndReturnConst(regexp, ua, _const) {\n    if (regexp.test(ua)) {\n      return _const;\n    }\n    return void (0);\n  }\n\n  static getWindowsVersionName(version) {\n    switch (version) {\n      case 'NT': return 'NT';\n      case 'XP': return 'XP';\n      case 'NT 5.0': return '2000';\n      case 'NT 5.1': return 'XP';\n      case 'NT 5.2': return '2003';\n      case 'NT 6.0': return 'Vista';\n      case 'NT 6.1': return '7';\n      case 'NT 6.2': return '8';\n      case 'NT 6.3': return '8.1';\n      case 'NT 10.0': return '10';\n      default: return undefined;\n    }\n  }\n\n  /**\n   * Get macOS version name\n   *    10.5 - Leopard\n   *    10.6 - Snow Leopard\n   *    10.7 - Lion\n   *    10.8 - Mountain Lion\n   *    10.9 - Mavericks\n   *    10.10 - Yosemite\n   *    10.11 - El Capitan\n   *    10.12 - Sierra\n   *    10.13 - High Sierra\n   *    10.14 - Mojave\n   *    10.15 - Catalina\n   *\n   * @example\n   *   getMacOSVersionName(\"10.14\") // 'Mojave'\n   *\n   * @param  {string} version\n   * @return {string} versionName\n   */\n  static getMacOSVersionName(version) {\n    const v = version.split('.').splice(0, 2).map(s => parseInt(s, 10) || 0);\n    v.push(0);\n    if (v[0] !== 10) return undefined;\n    switch (v[1]) {\n      case 5: return 'Leopard';\n      case 6: return 'Snow Leopard';\n      case 7: return 'Lion';\n      case 8: return 'Mountain Lion';\n      case 9: return 'Mavericks';\n      case 10: return 'Yosemite';\n      case 11: return 'El Capitan';\n      case 12: return 'Sierra';\n      case 13: return 'High Sierra';\n      case 14: return 'Mojave';\n      case 15: return 'Catalina';\n      default: return undefined;\n    }\n  }\n\n  /**\n   * Get Android version name\n   *    1.5 - Cupcake\n   *    1.6 - Donut\n   *    2.0 - Eclair\n   *    2.1 - Eclair\n   *    2.2 - Froyo\n   *    2.x - Gingerbread\n   *    3.x - Honeycomb\n   *    4.0 - Ice Cream Sandwich\n   *    4.1 - Jelly Bean\n   *    4.4 - KitKat\n   *    5.x - Lollipop\n   *    6.x - Marshmallow\n   *    7.x - Nougat\n   *    8.x - Oreo\n   *    9.x - Pie\n   *\n   * @example\n   *   getAndroidVersionName(\"7.0\") // 'Nougat'\n   *\n   * @param  {string} version\n   * @return {string} versionName\n   */\n  static getAndroidVersionName(version) {\n    const v = version.split('.').splice(0, 2).map(s => parseInt(s, 10) || 0);\n    v.push(0);\n    if (v[0] === 1 && v[1] < 5) return undefined;\n    if (v[0] === 1 && v[1] < 6) return 'Cupcake';\n    if (v[0] === 1 && v[1] >= 6) return 'Donut';\n    if (v[0] === 2 && v[1] < 2) return 'Eclair';\n    if (v[0] === 2 && v[1] === 2) return 'Froyo';\n    if (v[0] === 2 && v[1] > 2) return 'Gingerbread';\n    if (v[0] === 3) return 'Honeycomb';\n    if (v[0] === 4 && v[1] < 1) return 'Ice Cream Sandwich';\n    if (v[0] === 4 && v[1] < 4) return 'Jelly Bean';\n    if (v[0] === 4 && v[1] >= 4) return 'KitKat';\n    if (v[0] === 5) return 'Lollipop';\n    if (v[0] === 6) return 'Marshmallow';\n    if (v[0] === 7) return 'Nougat';\n    if (v[0] === 8) return 'Oreo';\n    if (v[0] === 9) return 'Pie';\n    return undefined;\n  }\n\n  /**\n   * Get version precisions count\n   *\n   * @example\n   *   getVersionPrecision(\"1.10.3\") // 3\n   *\n   * @param  {string} version\n   * @return {number}\n   */\n  static getVersionPrecision(version) {\n    return version.split('.').length;\n  }\n\n  /**\n   * Calculate browser version weight\n   *\n   * @example\n   *   compareVersions('1.10.2.1',  '1.8.2.1.90')    // 1\n   *   compareVersions('1.010.2.1', '1.09.2.1.90');  // 1\n   *   compareVersions('1.10.2.1',  '1.10.2.1');     // 0\n   *   compareVersions('1.10.2.1',  '1.0800.2');     // -1\n   *   compareVersions('1.10.2.1',  '1.10',  true);  // 0\n   *\n   * @param {String} versionA versions versions to compare\n   * @param {String} versionB versions versions to compare\n   * @param {boolean} [isLoose] enable loose comparison\n   * @return {Number} comparison result: -1 when versionA is lower,\n   * 1 when versionA is bigger, 0 when both equal\n   */\n  /* eslint consistent-return: 1 */\n  static compareVersions(versionA, versionB, isLoose = false) {\n    // 1) get common precision for both versions, for example for \"10.0\" and \"9\" it should be 2\n    const versionAPrecision = Utils.getVersionPrecision(versionA);\n    const versionBPrecision = Utils.getVersionPrecision(versionB);\n\n    let precision = Math.max(versionAPrecision, versionBPrecision);\n    let lastPrecision = 0;\n\n    const chunks = Utils.map([versionA, versionB], (version) => {\n      const delta = precision - Utils.getVersionPrecision(version);\n\n      // 2) \"9\" -> \"9.0\" (for precision = 2)\n      const _version = version + new Array(delta + 1).join('.0');\n\n      // 3) \"9.0\" -> [\"000000000\"\", \"000000009\"]\n      return Utils.map(_version.split('.'), chunk => new Array(20 - chunk.length).join('0') + chunk).reverse();\n    });\n\n    // adjust precision for loose comparison\n    if (isLoose) {\n      lastPrecision = precision - Math.min(versionAPrecision, versionBPrecision);\n    }\n\n    // iterate in reverse order by reversed chunks array\n    precision -= 1;\n    while (precision >= lastPrecision) {\n      // 4) compare: \"000000009\" > \"000000010\" = false (but \"9\" > \"10\" = true)\n      if (chunks[0][precision] > chunks[1][precision]) {\n        return 1;\n      }\n\n      if (chunks[0][precision] === chunks[1][precision]) {\n        if (precision === lastPrecision) {\n          // all version chunks are same\n          return 0;\n        }\n\n        precision -= 1;\n      } else if (chunks[0][precision] < chunks[1][precision]) {\n        return -1;\n      }\n    }\n\n    return undefined;\n  }\n\n  /**\n   * Array::map polyfill\n   *\n   * @param  {Array} arr\n   * @param  {Function} iterator\n   * @return {Array}\n   */\n  static map(arr, iterator) {\n    const result = [];\n    let i;\n    if (Array.prototype.map) {\n      return Array.prototype.map.call(arr, iterator);\n    }\n    for (i = 0; i < arr.length; i += 1) {\n      result.push(iterator(arr[i]));\n    }\n    return result;\n  }\n\n  /**\n   * Array::find polyfill\n   *\n   * @param  {Array} arr\n   * @param  {Function} predicate\n   * @return {Array}\n   */\n  static find(arr, predicate) {\n    let i;\n    let l;\n    if (Array.prototype.find) {\n      return Array.prototype.find.call(arr, predicate);\n    }\n    for (i = 0, l = arr.length; i < l; i += 1) {\n      const value = arr[i];\n      if (predicate(value, i)) {\n        return value;\n      }\n    }\n    return undefined;\n  }\n\n  /**\n   * Object::assign polyfill\n   *\n   * @param  {Object} obj\n   * @param  {Object} ...objs\n   * @return {Object}\n   */\n  static assign(obj, ...assigners) {\n    const result = obj;\n    let i;\n    let l;\n    if (Object.assign) {\n      return Object.assign(obj, ...assigners);\n    }\n    for (i = 0, l = assigners.length; i < l; i += 1) {\n      const assigner = assigners[i];\n      if (typeof assigner === 'object' && assigner !== null) {\n        const keys = Object.keys(assigner);\n        keys.forEach((key) => {\n          result[key] = assigner[key];\n        });\n      }\n    }\n    return obj;\n  }\n\n  /**\n   * Get short version/alias for a browser name\n   *\n   * @example\n   *   getBrowserAlias('Microsoft Edge') // edge\n   *\n   * @param  {string} browserName\n   * @return {string}\n   */\n  static getBrowserAlias(browserName) {\n    return BROWSER_ALIASES_MAP[browserName];\n  }\n\n  /**\n   * Get short version/alias for a browser name\n   *\n   * @example\n   *   getBrowserAlias('edge') // Microsoft Edge\n   *\n   * @param  {string} browserAlias\n   * @return {string}\n   */\n  static getBrowserTypeByAlias(browserAlias) {\n    return BROWSER_MAP[browserAlias] || '';\n  }\n}\n\n/**\n * Browsers' descriptors\n *\n * The idea of descriptors is simple. You should know about them two simple things:\n * 1. Every descriptor has a method or property called `test` and a `describe` method.\n * 2. Order of descriptors is important.\n *\n * More details:\n * 1. Method or property `test` serves as a way to detect whether the UA string\n * matches some certain browser or not. The `describe` method helps to make a result\n * object with params that show some browser-specific things: name, version, etc.\n * 2. Order of descriptors is important because a Parser goes through them one by one\n * in course. For example, if you insert Chrome's descriptor as the first one,\n * more then a half of browsers will be described as Chrome, because they will pass\n * the Chrome descriptor's test.\n *\n * Descriptor's `test` could be a property with an array of RegExps, where every RegExp\n * will be applied to a UA string to test it whether it matches or not.\n * If a descriptor has two or more regexps in the `test` array it tests them one by one\n * with a logical sum operation. Parser stops if it has found any RegExp that matches the UA.\n *\n * Or `test` could be a method. In that case it gets a Parser instance and should\n * return true/false to get the Parser know if this browser descriptor matches the UA or not.\n */\n\nconst commonVersionIdentifier = /version\\/(\\d+(\\.?_?\\d+)+)/i;\n\nconst browsersList = [\n  /* Googlebot */\n  {\n    test: [/googlebot/i],\n    describe(ua) {\n      const browser = {\n        name: 'Googlebot',\n      };\n      const version = Utils.getFirstMatch(/googlebot\\/(\\d+(\\.\\d+))/i, ua) || Utils.getFirstMatch(commonVersionIdentifier, ua);\n\n      if (version) {\n        browser.version = version;\n      }\n\n      return browser;\n    },\n  },\n\n  /* Opera < 13.0 */\n  {\n    test: [/opera/i],\n    describe(ua) {\n      const browser = {\n        name: 'Opera',\n      };\n      const version = Utils.getFirstMatch(commonVersionIdentifier, ua) || Utils.getFirstMatch(/(?:opera)[\\s/](\\d+(\\.?_?\\d+)+)/i, ua);\n\n      if (version) {\n        browser.version = version;\n      }\n\n      return browser;\n    },\n  },\n\n  /* Opera > 13.0 */\n  {\n    test: [/opr\\/|opios/i],\n    describe(ua) {\n      const browser = {\n        name: 'Opera',\n      };\n      const version = Utils.getFirstMatch(/(?:opr|opios)[\\s/](\\S+)/i, ua) || Utils.getFirstMatch(commonVersionIdentifier, ua);\n\n      if (version) {\n        browser.version = version;\n      }\n\n      return browser;\n    },\n  },\n  {\n    test: [/SamsungBrowser/i],\n    describe(ua) {\n      const browser = {\n        name: 'Samsung Internet for Android',\n      };\n      const version = Utils.getFirstMatch(commonVersionIdentifier, ua) || Utils.getFirstMatch(/(?:SamsungBrowser)[\\s/](\\d+(\\.?_?\\d+)+)/i, ua);\n\n      if (version) {\n        browser.version = version;\n      }\n\n      return browser;\n    },\n  },\n  {\n    test: [/Whale/i],\n    describe(ua) {\n      const browser = {\n        name: 'NAVER Whale Browser',\n      };\n      const version = Utils.getFirstMatch(commonVersionIdentifier, ua) || Utils.getFirstMatch(/(?:whale)[\\s/](\\d+(?:\\.\\d+)+)/i, ua);\n\n      if (version) {\n        browser.version = version;\n      }\n\n      return browser;\n    },\n  },\n  {\n    test: [/MZBrowser/i],\n    describe(ua) {\n      const browser = {\n        name: 'MZ Browser',\n      };\n      const version = Utils.getFirstMatch(/(?:MZBrowser)[\\s/](\\d+(?:\\.\\d+)+)/i, ua) || Utils.getFirstMatch(commonVersionIdentifier, ua);\n\n      if (version) {\n        browser.version = version;\n      }\n\n      return browser;\n    },\n  },\n  {\n    test: [/focus/i],\n    describe(ua) {\n      const browser = {\n        name: 'Focus',\n      };\n      const version = Utils.getFirstMatch(/(?:focus)[\\s/](\\d+(?:\\.\\d+)+)/i, ua) || Utils.getFirstMatch(commonVersionIdentifier, ua);\n\n      if (version) {\n        browser.version = version;\n      }\n\n      return browser;\n    },\n  },\n  {\n    test: [/swing/i],\n    describe(ua) {\n      const browser = {\n        name: 'Swing',\n      };\n      const version = Utils.getFirstMatch(/(?:swing)[\\s/](\\d+(?:\\.\\d+)+)/i, ua) || Utils.getFirstMatch(commonVersionIdentifier, ua);\n\n      if (version) {\n        browser.version = version;\n      }\n\n      return browser;\n    },\n  },\n  {\n    test: [/coast/i],\n    describe(ua) {\n      const browser = {\n        name: 'Opera Coast',\n      };\n      const version = Utils.getFirstMatch(commonVersionIdentifier, ua) || Utils.getFirstMatch(/(?:coast)[\\s/](\\d+(\\.?_?\\d+)+)/i, ua);\n\n      if (version) {\n        browser.version = version;\n      }\n\n      return browser;\n    },\n  },\n  {\n    test: [/opt\\/\\d+(?:.?_?\\d+)+/i],\n    describe(ua) {\n      const browser = {\n        name: 'Opera Touch',\n      };\n      const version = Utils.getFirstMatch(/(?:opt)[\\s/](\\d+(\\.?_?\\d+)+)/i, ua) || Utils.getFirstMatch(commonVersionIdentifier, ua);\n\n      if (version) {\n        browser.version = version;\n      }\n\n      return browser;\n    },\n  },\n  {\n    test: [/yabrowser/i],\n    describe(ua) {\n      const browser = {\n        name: 'Yandex Browser',\n      };\n      const version = Utils.getFirstMatch(/(?:yabrowser)[\\s/](\\d+(\\.?_?\\d+)+)/i, ua) || Utils.getFirstMatch(commonVersionIdentifier, ua);\n\n      if (version) {\n        browser.version = version;\n      }\n\n      return browser;\n    },\n  },\n  {\n    test: [/ucbrowser/i],\n    describe(ua) {\n      const browser = {\n        name: 'UC Browser',\n      };\n      const version = Utils.getFirstMatch(commonVersionIdentifier, ua) || Utils.getFirstMatch(/(?:ucbrowser)[\\s/](\\d+(\\.?_?\\d+)+)/i, ua);\n\n      if (version) {\n        browser.version = version;\n      }\n\n      return browser;\n    },\n  },\n  {\n    test: [/Maxthon|mxios/i],\n    describe(ua) {\n      const browser = {\n        name: 'Maxthon',\n      };\n      const version = Utils.getFirstMatch(commonVersionIdentifier, ua) || Utils.getFirstMatch(/(?:Maxthon|mxios)[\\s/](\\d+(\\.?_?\\d+)+)/i, ua);\n\n      if (version) {\n        browser.version = version;\n      }\n\n      return browser;\n    },\n  },\n  {\n    test: [/epiphany/i],\n    describe(ua) {\n      const browser = {\n        name: 'Epiphany',\n      };\n      const version = Utils.getFirstMatch(commonVersionIdentifier, ua) || Utils.getFirstMatch(/(?:epiphany)[\\s/](\\d+(\\.?_?\\d+)+)/i, ua);\n\n      if (version) {\n        browser.version = version;\n      }\n\n      return browser;\n    },\n  },\n  {\n    test: [/puffin/i],\n    describe(ua) {\n      const browser = {\n        name: 'Puffin',\n      };\n      const version = Utils.getFirstMatch(commonVersionIdentifier, ua) || Utils.getFirstMatch(/(?:puffin)[\\s/](\\d+(\\.?_?\\d+)+)/i, ua);\n\n      if (version) {\n        browser.version = version;\n      }\n\n      return browser;\n    },\n  },\n  {\n    test: [/sleipnir/i],\n    describe(ua) {\n      const browser = {\n        name: 'Sleipnir',\n      };\n      const version = Utils.getFirstMatch(commonVersionIdentifier, ua) || Utils.getFirstMatch(/(?:sleipnir)[\\s/](\\d+(\\.?_?\\d+)+)/i, ua);\n\n      if (version) {\n        browser.version = version;\n      }\n\n      return browser;\n    },\n  },\n  {\n    test: [/k-meleon/i],\n    describe(ua) {\n      const browser = {\n        name: 'K-Meleon',\n      };\n      const version = Utils.getFirstMatch(commonVersionIdentifier, ua) || Utils.getFirstMatch(/(?:k-meleon)[\\s/](\\d+(\\.?_?\\d+)+)/i, ua);\n\n      if (version) {\n        browser.version = version;\n      }\n\n      return browser;\n    },\n  },\n  {\n    test: [/micromessenger/i],\n    describe(ua) {\n      const browser = {\n        name: 'WeChat',\n      };\n      const version = Utils.getFirstMatch(/(?:micromessenger)[\\s/](\\d+(\\.?_?\\d+)+)/i, ua) || Utils.getFirstMatch(commonVersionIdentifier, ua);\n\n      if (version) {\n        browser.version = version;\n      }\n\n      return browser;\n    },\n  },\n  {\n    test: [/qqbrowser/i],\n    describe(ua) {\n      const browser = {\n        name: (/qqbrowserlite/i).test(ua) ? 'QQ Browser Lite' : 'QQ Browser',\n      };\n      const version = Utils.getFirstMatch(/(?:qqbrowserlite|qqbrowser)[/](\\d+(\\.?_?\\d+)+)/i, ua) || Utils.getFirstMatch(commonVersionIdentifier, ua);\n\n      if (version) {\n        browser.version = version;\n      }\n\n      return browser;\n    },\n  },\n  {\n    test: [/msie|trident/i],\n    describe(ua) {\n      const browser = {\n        name: 'Internet Explorer',\n      };\n      const version = Utils.getFirstMatch(/(?:msie |rv:)(\\d+(\\.?_?\\d+)+)/i, ua);\n\n      if (version) {\n        browser.version = version;\n      }\n\n      return browser;\n    },\n  },\n  {\n    test: [/\\sedg\\//i],\n    describe(ua) {\n      const browser = {\n        name: 'Microsoft Edge',\n      };\n\n      const version = Utils.getFirstMatch(/\\sedg\\/(\\d+(\\.?_?\\d+)+)/i, ua);\n\n      if (version) {\n        browser.version = version;\n      }\n\n      return browser;\n    },\n  },\n  {\n    test: [/edg([ea]|ios)/i],\n    describe(ua) {\n      const browser = {\n        name: 'Microsoft Edge',\n      };\n\n      const version = Utils.getSecondMatch(/edg([ea]|ios)\\/(\\d+(\\.?_?\\d+)+)/i, ua);\n\n      if (version) {\n        browser.version = version;\n      }\n\n      return browser;\n    },\n  },\n  {\n    test: [/vivaldi/i],\n    describe(ua) {\n      const browser = {\n        name: 'Vivaldi',\n      };\n      const version = Utils.getFirstMatch(/vivaldi\\/(\\d+(\\.?_?\\d+)+)/i, ua);\n\n      if (version) {\n        browser.version = version;\n      }\n\n      return browser;\n    },\n  },\n  {\n    test: [/seamonkey/i],\n    describe(ua) {\n      const browser = {\n        name: 'SeaMonkey',\n      };\n      const version = Utils.getFirstMatch(/seamonkey\\/(\\d+(\\.?_?\\d+)+)/i, ua);\n\n      if (version) {\n        browser.version = version;\n      }\n\n      return browser;\n    },\n  },\n  {\n    test: [/sailfish/i],\n    describe(ua) {\n      const browser = {\n        name: 'Sailfish',\n      };\n\n      const version = Utils.getFirstMatch(/sailfish\\s?browser\\/(\\d+(\\.\\d+)?)/i, ua);\n\n      if (version) {\n        browser.version = version;\n      }\n\n      return browser;\n    },\n  },\n  {\n    test: [/silk/i],\n    describe(ua) {\n      const browser = {\n        name: 'Amazon Silk',\n      };\n      const version = Utils.getFirstMatch(/silk\\/(\\d+(\\.?_?\\d+)+)/i, ua);\n\n      if (version) {\n        browser.version = version;\n      }\n\n      return browser;\n    },\n  },\n  {\n    test: [/phantom/i],\n    describe(ua) {\n      const browser = {\n        name: 'PhantomJS',\n      };\n      const version = Utils.getFirstMatch(/phantomjs\\/(\\d+(\\.?_?\\d+)+)/i, ua);\n\n      if (version) {\n        browser.version = version;\n      }\n\n      return browser;\n    },\n  },\n  {\n    test: [/slimerjs/i],\n    describe(ua) {\n      const browser = {\n        name: 'SlimerJS',\n      };\n      const version = Utils.getFirstMatch(/slimerjs\\/(\\d+(\\.?_?\\d+)+)/i, ua);\n\n      if (version) {\n        browser.version = version;\n      }\n\n      return browser;\n    },\n  },\n  {\n    test: [/blackberry|\\bbb\\d+/i, /rim\\stablet/i],\n    describe(ua) {\n      const browser = {\n        name: 'BlackBerry',\n      };\n      const version = Utils.getFirstMatch(commonVersionIdentifier, ua) || Utils.getFirstMatch(/blackberry[\\d]+\\/(\\d+(\\.?_?\\d+)+)/i, ua);\n\n      if (version) {\n        browser.version = version;\n      }\n\n      return browser;\n    },\n  },\n  {\n    test: [/(web|hpw)[o0]s/i],\n    describe(ua) {\n      const browser = {\n        name: 'WebOS Browser',\n      };\n      const version = Utils.getFirstMatch(commonVersionIdentifier, ua) || Utils.getFirstMatch(/w(?:eb)?[o0]sbrowser\\/(\\d+(\\.?_?\\d+)+)/i, ua);\n\n      if (version) {\n        browser.version = version;\n      }\n\n      return browser;\n    },\n  },\n  {\n    test: [/bada/i],\n    describe(ua) {\n      const browser = {\n        name: 'Bada',\n      };\n      const version = Utils.getFirstMatch(/dolfin\\/(\\d+(\\.?_?\\d+)+)/i, ua);\n\n      if (version) {\n        browser.version = version;\n      }\n\n      return browser;\n    },\n  },\n  {\n    test: [/tizen/i],\n    describe(ua) {\n      const browser = {\n        name: 'Tizen',\n      };\n      const version = Utils.getFirstMatch(/(?:tizen\\s?)?browser\\/(\\d+(\\.?_?\\d+)+)/i, ua) || Utils.getFirstMatch(commonVersionIdentifier, ua);\n\n      if (version) {\n        browser.version = version;\n      }\n\n      return browser;\n    },\n  },\n  {\n    test: [/qupzilla/i],\n    describe(ua) {\n      const browser = {\n        name: 'QupZilla',\n      };\n      const version = Utils.getFirstMatch(/(?:qupzilla)[\\s/](\\d+(\\.?_?\\d+)+)/i, ua) || Utils.getFirstMatch(commonVersionIdentifier, ua);\n\n      if (version) {\n        browser.version = version;\n      }\n\n      return browser;\n    },\n  },\n  {\n    test: [/firefox|iceweasel|fxios/i],\n    describe(ua) {\n      const browser = {\n        name: 'Firefox',\n      };\n      const version = Utils.getFirstMatch(/(?:firefox|iceweasel|fxios)[\\s/](\\d+(\\.?_?\\d+)+)/i, ua);\n\n      if (version) {\n        browser.version = version;\n      }\n\n      return browser;\n    },\n  },\n  {\n    test: [/electron/i],\n    describe(ua) {\n      const browser = {\n        name: 'Electron',\n      };\n      const version = Utils.getFirstMatch(/(?:electron)\\/(\\d+(\\.?_?\\d+)+)/i, ua);\n\n      if (version) {\n        browser.version = version;\n      }\n\n      return browser;\n    },\n  },\n  {\n    test: [/MiuiBrowser/i],\n    describe(ua) {\n      const browser = {\n        name: 'Miui',\n      };\n      const version = Utils.getFirstMatch(/(?:MiuiBrowser)[\\s/](\\d+(\\.?_?\\d+)+)/i, ua);\n\n      if (version) {\n        browser.version = version;\n      }\n\n      return browser;\n    },\n  },\n  {\n    test: [/chromium/i],\n    describe(ua) {\n      const browser = {\n        name: 'Chromium',\n      };\n      const version = Utils.getFirstMatch(/(?:chromium)[\\s/](\\d+(\\.?_?\\d+)+)/i, ua) || Utils.getFirstMatch(commonVersionIdentifier, ua);\n\n      if (version) {\n        browser.version = version;\n      }\n\n      return browser;\n    },\n  },\n  {\n    test: [/chrome|crios|crmo/i],\n    describe(ua) {\n      const browser = {\n        name: 'Chrome',\n      };\n      const version = Utils.getFirstMatch(/(?:chrome|crios|crmo)\\/(\\d+(\\.?_?\\d+)+)/i, ua);\n\n      if (version) {\n        browser.version = version;\n      }\n\n      return browser;\n    },\n  },\n  {\n    test: [/GSA/i],\n    describe(ua) {\n      const browser = {\n        name: 'Google Search',\n      };\n      const version = Utils.getFirstMatch(/(?:GSA)\\/(\\d+(\\.?_?\\d+)+)/i, ua);\n\n      if (version) {\n        browser.version = version;\n      }\n\n      return browser;\n    },\n  },\n\n  /* Android Browser */\n  {\n    test(parser) {\n      const notLikeAndroid = !parser.test(/like android/i);\n      const butAndroid = parser.test(/android/i);\n      return notLikeAndroid && butAndroid;\n    },\n    describe(ua) {\n      const browser = {\n        name: 'Android Browser',\n      };\n      const version = Utils.getFirstMatch(commonVersionIdentifier, ua);\n\n      if (version) {\n        browser.version = version;\n      }\n\n      return browser;\n    },\n  },\n\n  /* PlayStation 4 */\n  {\n    test: [/playstation 4/i],\n    describe(ua) {\n      const browser = {\n        name: 'PlayStation 4',\n      };\n      const version = Utils.getFirstMatch(commonVersionIdentifier, ua);\n\n      if (version) {\n        browser.version = version;\n      }\n\n      return browser;\n    },\n  },\n\n  /* Safari */\n  {\n    test: [/safari|applewebkit/i],\n    describe(ua) {\n      const browser = {\n        name: 'Safari',\n      };\n      const version = Utils.getFirstMatch(commonVersionIdentifier, ua);\n\n      if (version) {\n        browser.version = version;\n      }\n\n      return browser;\n    },\n  },\n\n  /* Something else */\n  {\n    test: [/.*/i],\n    describe(ua) {\n      /* Here we try to make sure that there are explicit details about the device\n       * in order to decide what regexp exactly we want to apply\n       * (as there is a specific decision based on that conclusion)\n       */\n      const regexpWithoutDeviceSpec = /^(.*)\\/(.*) /;\n      const regexpWithDeviceSpec = /^(.*)\\/(.*)[ \\t]\\((.*)/;\n      const hasDeviceSpec = ua.search('\\\\(') !== -1;\n      const regexp = hasDeviceSpec ? regexpWithDeviceSpec : regexpWithoutDeviceSpec;\n      return {\n        name: Utils.getFirstMatch(regexp, ua),\n        version: Utils.getSecondMatch(regexp, ua),\n      };\n    },\n  },\n];\n\nvar osParsersList = [\n  /* Roku */\n  {\n    test: [/Roku\\/DVP/],\n    describe(ua) {\n      const version = Utils.getFirstMatch(/Roku\\/DVP-(\\d+\\.\\d+)/i, ua);\n      return {\n        name: OS_MAP.Roku,\n        version,\n      };\n    },\n  },\n\n  /* Windows Phone */\n  {\n    test: [/windows phone/i],\n    describe(ua) {\n      const version = Utils.getFirstMatch(/windows phone (?:os)?\\s?(\\d+(\\.\\d+)*)/i, ua);\n      return {\n        name: OS_MAP.WindowsPhone,\n        version,\n      };\n    },\n  },\n\n  /* Windows */\n  {\n    test: [/windows /i],\n    describe(ua) {\n      const version = Utils.getFirstMatch(/Windows ((NT|XP)( \\d\\d?.\\d)?)/i, ua);\n      const versionName = Utils.getWindowsVersionName(version);\n\n      return {\n        name: OS_MAP.Windows,\n        version,\n        versionName,\n      };\n    },\n  },\n\n  /* Firefox on iPad */\n  {\n    test: [/Macintosh(.*?) FxiOS(.*?)\\//],\n    describe(ua) {\n      const result = {\n        name: OS_MAP.iOS,\n      };\n      const version = Utils.getSecondMatch(/(Version\\/)(\\d[\\d.]+)/, ua);\n      if (version) {\n        result.version = version;\n      }\n      return result;\n    },\n  },\n\n  /* macOS */\n  {\n    test: [/macintosh/i],\n    describe(ua) {\n      const version = Utils.getFirstMatch(/mac os x (\\d+(\\.?_?\\d+)+)/i, ua).replace(/[_\\s]/g, '.');\n      const versionName = Utils.getMacOSVersionName(version);\n\n      const os = {\n        name: OS_MAP.MacOS,\n        version,\n      };\n      if (versionName) {\n        os.versionName = versionName;\n      }\n      return os;\n    },\n  },\n\n  /* iOS */\n  {\n    test: [/(ipod|iphone|ipad)/i],\n    describe(ua) {\n      const version = Utils.getFirstMatch(/os (\\d+([_\\s]\\d+)*) like mac os x/i, ua).replace(/[_\\s]/g, '.');\n\n      return {\n        name: OS_MAP.iOS,\n        version,\n      };\n    },\n  },\n\n  /* Android */\n  {\n    test(parser) {\n      const notLikeAndroid = !parser.test(/like android/i);\n      const butAndroid = parser.test(/android/i);\n      return notLikeAndroid && butAndroid;\n    },\n    describe(ua) {\n      const version = Utils.getFirstMatch(/android[\\s/-](\\d+(\\.\\d+)*)/i, ua);\n      const versionName = Utils.getAndroidVersionName(version);\n      const os = {\n        name: OS_MAP.Android,\n        version,\n      };\n      if (versionName) {\n        os.versionName = versionName;\n      }\n      return os;\n    },\n  },\n\n  /* WebOS */\n  {\n    test: [/(web|hpw)[o0]s/i],\n    describe(ua) {\n      const version = Utils.getFirstMatch(/(?:web|hpw)[o0]s\\/(\\d+(\\.\\d+)*)/i, ua);\n      const os = {\n        name: OS_MAP.WebOS,\n      };\n\n      if (version && version.length) {\n        os.version = version;\n      }\n      return os;\n    },\n  },\n\n  /* BlackBerry */\n  {\n    test: [/blackberry|\\bbb\\d+/i, /rim\\stablet/i],\n    describe(ua) {\n      const version = Utils.getFirstMatch(/rim\\stablet\\sos\\s(\\d+(\\.\\d+)*)/i, ua)\n        || Utils.getFirstMatch(/blackberry\\d+\\/(\\d+([_\\s]\\d+)*)/i, ua)\n        || Utils.getFirstMatch(/\\bbb(\\d+)/i, ua);\n\n      return {\n        name: OS_MAP.BlackBerry,\n        version,\n      };\n    },\n  },\n\n  /* Bada */\n  {\n    test: [/bada/i],\n    describe(ua) {\n      const version = Utils.getFirstMatch(/bada\\/(\\d+(\\.\\d+)*)/i, ua);\n\n      return {\n        name: OS_MAP.Bada,\n        version,\n      };\n    },\n  },\n\n  /* Tizen */\n  {\n    test: [/tizen/i],\n    describe(ua) {\n      const version = Utils.getFirstMatch(/tizen[/\\s](\\d+(\\.\\d+)*)/i, ua);\n\n      return {\n        name: OS_MAP.Tizen,\n        version,\n      };\n    },\n  },\n\n  /* Linux */\n  {\n    test: [/linux/i],\n    describe() {\n      return {\n        name: OS_MAP.Linux,\n      };\n    },\n  },\n\n  /* Chrome OS */\n  {\n    test: [/CrOS/],\n    describe() {\n      return {\n        name: OS_MAP.ChromeOS,\n      };\n    },\n  },\n\n  /* Playstation 4 */\n  {\n    test: [/PlayStation 4/],\n    describe(ua) {\n      const version = Utils.getFirstMatch(/PlayStation 4[/\\s](\\d+(\\.\\d+)*)/i, ua);\n      return {\n        name: OS_MAP.PlayStation4,\n        version,\n      };\n    },\n  },\n];\n\n/*\n * Tablets go first since usually they have more specific\n * signs to detect.\n */\n\nvar platformParsersList = [\n  /* Googlebot */\n  {\n    test: [/googlebot/i],\n    describe() {\n      return {\n        type: 'bot',\n        vendor: 'Google',\n      };\n    },\n  },\n\n  /* Huawei */\n  {\n    test: [/huawei/i],\n    describe(ua) {\n      const model = Utils.getFirstMatch(/(can-l01)/i, ua) && 'Nova';\n      const platform = {\n        type: PLATFORMS_MAP.mobile,\n        vendor: 'Huawei',\n      };\n      if (model) {\n        platform.model = model;\n      }\n      return platform;\n    },\n  },\n\n  /* Nexus Tablet */\n  {\n    test: [/nexus\\s*(?:7|8|9|10).*/i],\n    describe() {\n      return {\n        type: PLATFORMS_MAP.tablet,\n        vendor: 'Nexus',\n      };\n    },\n  },\n\n  /* iPad */\n  {\n    test: [/ipad/i],\n    describe() {\n      return {\n        type: PLATFORMS_MAP.tablet,\n        vendor: 'Apple',\n        model: 'iPad',\n      };\n    },\n  },\n\n  /* Firefox on iPad */\n  {\n    test: [/Macintosh(.*?) FxiOS(.*?)\\//],\n    describe() {\n      return {\n        type: PLATFORMS_MAP.tablet,\n        vendor: 'Apple',\n        model: 'iPad',\n      };\n    },\n  },\n\n  /* Amazon Kindle Fire */\n  {\n    test: [/kftt build/i],\n    describe() {\n      return {\n        type: PLATFORMS_MAP.tablet,\n        vendor: 'Amazon',\n        model: 'Kindle Fire HD 7',\n      };\n    },\n  },\n\n  /* Another Amazon Tablet with Silk */\n  {\n    test: [/silk/i],\n    describe() {\n      return {\n        type: PLATFORMS_MAP.tablet,\n        vendor: 'Amazon',\n      };\n    },\n  },\n\n  /* Tablet */\n  {\n    test: [/tablet(?! pc)/i],\n    describe() {\n      return {\n        type: PLATFORMS_MAP.tablet,\n      };\n    },\n  },\n\n  /* iPod/iPhone */\n  {\n    test(parser) {\n      const iDevice = parser.test(/ipod|iphone/i);\n      const likeIDevice = parser.test(/like (ipod|iphone)/i);\n      return iDevice && !likeIDevice;\n    },\n    describe(ua) {\n      const model = Utils.getFirstMatch(/(ipod|iphone)/i, ua);\n      return {\n        type: PLATFORMS_MAP.mobile,\n        vendor: 'Apple',\n        model,\n      };\n    },\n  },\n\n  /* Nexus Mobile */\n  {\n    test: [/nexus\\s*[0-6].*/i, /galaxy nexus/i],\n    describe() {\n      return {\n        type: PLATFORMS_MAP.mobile,\n        vendor: 'Nexus',\n      };\n    },\n  },\n\n  /* Mobile */\n  {\n    test: [/[^-]mobi/i],\n    describe() {\n      return {\n        type: PLATFORMS_MAP.mobile,\n      };\n    },\n  },\n\n  /* BlackBerry */\n  {\n    test(parser) {\n      return parser.getBrowserName(true) === 'blackberry';\n    },\n    describe() {\n      return {\n        type: PLATFORMS_MAP.mobile,\n        vendor: 'BlackBerry',\n      };\n    },\n  },\n\n  /* Bada */\n  {\n    test(parser) {\n      return parser.getBrowserName(true) === 'bada';\n    },\n    describe() {\n      return {\n        type: PLATFORMS_MAP.mobile,\n      };\n    },\n  },\n\n  /* Windows Phone */\n  {\n    test(parser) {\n      return parser.getBrowserName() === 'windows phone';\n    },\n    describe() {\n      return {\n        type: PLATFORMS_MAP.mobile,\n        vendor: 'Microsoft',\n      };\n    },\n  },\n\n  /* Android Tablet */\n  {\n    test(parser) {\n      const osMajorVersion = Number(String(parser.getOSVersion()).split('.')[0]);\n      return parser.getOSName(true) === 'android' && (osMajorVersion >= 3);\n    },\n    describe() {\n      return {\n        type: PLATFORMS_MAP.tablet,\n      };\n    },\n  },\n\n  /* Android Mobile */\n  {\n    test(parser) {\n      return parser.getOSName(true) === 'android';\n    },\n    describe() {\n      return {\n        type: PLATFORMS_MAP.mobile,\n      };\n    },\n  },\n\n  /* desktop */\n  {\n    test(parser) {\n      return parser.getOSName(true) === 'macos';\n    },\n    describe() {\n      return {\n        type: PLATFORMS_MAP.desktop,\n        vendor: 'Apple',\n      };\n    },\n  },\n\n  /* Windows */\n  {\n    test(parser) {\n      return parser.getOSName(true) === 'windows';\n    },\n    describe() {\n      return {\n        type: PLATFORMS_MAP.desktop,\n      };\n    },\n  },\n\n  /* Linux */\n  {\n    test(parser) {\n      return parser.getOSName(true) === 'linux';\n    },\n    describe() {\n      return {\n        type: PLATFORMS_MAP.desktop,\n      };\n    },\n  },\n\n  /* PlayStation 4 */\n  {\n    test(parser) {\n      return parser.getOSName(true) === 'playstation 4';\n    },\n    describe() {\n      return {\n        type: PLATFORMS_MAP.tv,\n      };\n    },\n  },\n\n  /* Roku */\n  {\n    test(parser) {\n      return parser.getOSName(true) === 'roku';\n    },\n    describe() {\n      return {\n        type: PLATFORMS_MAP.tv,\n      };\n    },\n  },\n];\n\n/*\n * More specific goes first\n */\nvar enginesParsersList = [\n  /* EdgeHTML */\n  {\n    test(parser) {\n      return parser.getBrowserName(true) === 'microsoft edge';\n    },\n    describe(ua) {\n      const isBlinkBased = /\\sedg\\//i.test(ua);\n\n      // return blink if it's blink-based one\n      if (isBlinkBased) {\n        return {\n          name: ENGINE_MAP.Blink,\n        };\n      }\n\n      // otherwise match the version and return EdgeHTML\n      const version = Utils.getFirstMatch(/edge\\/(\\d+(\\.?_?\\d+)+)/i, ua);\n\n      return {\n        name: ENGINE_MAP.EdgeHTML,\n        version,\n      };\n    },\n  },\n\n  /* Trident */\n  {\n    test: [/trident/i],\n    describe(ua) {\n      const engine = {\n        name: ENGINE_MAP.Trident,\n      };\n\n      const version = Utils.getFirstMatch(/trident\\/(\\d+(\\.?_?\\d+)+)/i, ua);\n\n      if (version) {\n        engine.version = version;\n      }\n\n      return engine;\n    },\n  },\n\n  /* Presto */\n  {\n    test(parser) {\n      return parser.test(/presto/i);\n    },\n    describe(ua) {\n      const engine = {\n        name: ENGINE_MAP.Presto,\n      };\n\n      const version = Utils.getFirstMatch(/presto\\/(\\d+(\\.?_?\\d+)+)/i, ua);\n\n      if (version) {\n        engine.version = version;\n      }\n\n      return engine;\n    },\n  },\n\n  /* Gecko */\n  {\n    test(parser) {\n      const isGecko = parser.test(/gecko/i);\n      const likeGecko = parser.test(/like gecko/i);\n      return isGecko && !likeGecko;\n    },\n    describe(ua) {\n      const engine = {\n        name: ENGINE_MAP.Gecko,\n      };\n\n      const version = Utils.getFirstMatch(/gecko\\/(\\d+(\\.?_?\\d+)+)/i, ua);\n\n      if (version) {\n        engine.version = version;\n      }\n\n      return engine;\n    },\n  },\n\n  /* Blink */\n  {\n    test: [/(apple)?webkit\\/537\\.36/i],\n    describe() {\n      return {\n        name: ENGINE_MAP.Blink,\n      };\n    },\n  },\n\n  /* WebKit */\n  {\n    test: [/(apple)?webkit/i],\n    describe(ua) {\n      const engine = {\n        name: ENGINE_MAP.WebKit,\n      };\n\n      const version = Utils.getFirstMatch(/webkit\\/(\\d+(\\.?_?\\d+)+)/i, ua);\n\n      if (version) {\n        engine.version = version;\n      }\n\n      return engine;\n    },\n  },\n];\n\n/**\n * The main class that arranges the whole parsing process.\n */\nclass Parser {\n  /**\n   * Create instance of Parser\n   *\n   * @param {String} UA User-Agent string\n   * @param {Boolean} [skipParsing=false] parser can skip parsing in purpose of performance\n   * improvements if you need to make a more particular parsing\n   * like {@link Parser#parseBrowser} or {@link Parser#parsePlatform}\n   *\n   * @throw {Error} in case of empty UA String\n   *\n   * @constructor\n   */\n  constructor(UA, skipParsing = false) {\n    if (UA === void (0) || UA === null || UA === '') {\n      throw new Error(\"UserAgent parameter can't be empty\");\n    }\n\n    this._ua = UA;\n\n    /**\n     * @typedef ParsedResult\n     * @property {Object} browser\n     * @property {String|undefined} [browser.name]\n     * Browser name, like `\"Chrome\"` or `\"Internet Explorer\"`\n     * @property {String|undefined} [browser.version] Browser version as a String `\"12.01.45334.10\"`\n     * @property {Object} os\n     * @property {String|undefined} [os.name] OS name, like `\"Windows\"` or `\"macOS\"`\n     * @property {String|undefined} [os.version] OS version, like `\"NT 5.1\"` or `\"10.11.1\"`\n     * @property {String|undefined} [os.versionName] OS name, like `\"XP\"` or `\"High Sierra\"`\n     * @property {Object} platform\n     * @property {String|undefined} [platform.type]\n     * platform type, can be either `\"desktop\"`, `\"tablet\"` or `\"mobile\"`\n     * @property {String|undefined} [platform.vendor] Vendor of the device,\n     * like `\"Apple\"` or `\"Samsung\"`\n     * @property {String|undefined} [platform.model] Device model,\n     * like `\"iPhone\"` or `\"Kindle Fire HD 7\"`\n     * @property {Object} engine\n     * @property {String|undefined} [engine.name]\n     * Can be any of this: `WebKit`, `Blink`, `Gecko`, `Trident`, `Presto`, `EdgeHTML`\n     * @property {String|undefined} [engine.version] String version of the engine\n     */\n    this.parsedResult = {};\n\n    if (skipParsing !== true) {\n      this.parse();\n    }\n  }\n\n  /**\n   * Get UserAgent string of current Parser instance\n   * @return {String} User-Agent String of the current <Parser> object\n   *\n   * @public\n   */\n  getUA() {\n    return this._ua;\n  }\n\n  /**\n   * Test a UA string for a regexp\n   * @param {RegExp} regex\n   * @return {Boolean}\n   */\n  test(regex) {\n    return regex.test(this._ua);\n  }\n\n  /**\n   * Get parsed browser object\n   * @return {Object}\n   */\n  parseBrowser() {\n    this.parsedResult.browser = {};\n\n    const browserDescriptor = Utils.find(browsersList, (_browser) => {\n      if (typeof _browser.test === 'function') {\n        return _browser.test(this);\n      }\n\n      if (_browser.test instanceof Array) {\n        return _browser.test.some(condition => this.test(condition));\n      }\n\n      throw new Error(\"Browser's test function is not valid\");\n    });\n\n    if (browserDescriptor) {\n      this.parsedResult.browser = browserDescriptor.describe(this.getUA());\n    }\n\n    return this.parsedResult.browser;\n  }\n\n  /**\n   * Get parsed browser object\n   * @return {Object}\n   *\n   * @public\n   */\n  getBrowser() {\n    if (this.parsedResult.browser) {\n      return this.parsedResult.browser;\n    }\n\n    return this.parseBrowser();\n  }\n\n  /**\n   * Get browser's name\n   * @return {String} Browser's name or an empty string\n   *\n   * @public\n   */\n  getBrowserName(toLowerCase) {\n    if (toLowerCase) {\n      return String(this.getBrowser().name).toLowerCase() || '';\n    }\n    return this.getBrowser().name || '';\n  }\n\n\n  /**\n   * Get browser's version\n   * @return {String} version of browser\n   *\n   * @public\n   */\n  getBrowserVersion() {\n    return this.getBrowser().version;\n  }\n\n  /**\n   * Get OS\n   * @return {Object}\n   *\n   * @example\n   * this.getOS();\n   * {\n   *   name: 'macOS',\n   *   version: '10.11.12'\n   * }\n   */\n  getOS() {\n    if (this.parsedResult.os) {\n      return this.parsedResult.os;\n    }\n\n    return this.parseOS();\n  }\n\n  /**\n   * Parse OS and save it to this.parsedResult.os\n   * @return {*|{}}\n   */\n  parseOS() {\n    this.parsedResult.os = {};\n\n    const os = Utils.find(osParsersList, (_os) => {\n      if (typeof _os.test === 'function') {\n        return _os.test(this);\n      }\n\n      if (_os.test instanceof Array) {\n        return _os.test.some(condition => this.test(condition));\n      }\n\n      throw new Error(\"Browser's test function is not valid\");\n    });\n\n    if (os) {\n      this.parsedResult.os = os.describe(this.getUA());\n    }\n\n    return this.parsedResult.os;\n  }\n\n  /**\n   * Get OS name\n   * @param {Boolean} [toLowerCase] return lower-cased value\n   * @return {String} name of the OS — macOS, Windows, Linux, etc.\n   */\n  getOSName(toLowerCase) {\n    const { name } = this.getOS();\n\n    if (toLowerCase) {\n      return String(name).toLowerCase() || '';\n    }\n\n    return name || '';\n  }\n\n  /**\n   * Get OS version\n   * @return {String} full version with dots ('10.11.12', '5.6', etc)\n   */\n  getOSVersion() {\n    return this.getOS().version;\n  }\n\n  /**\n   * Get parsed platform\n   * @return {{}}\n   */\n  getPlatform() {\n    if (this.parsedResult.platform) {\n      return this.parsedResult.platform;\n    }\n\n    return this.parsePlatform();\n  }\n\n  /**\n   * Get platform name\n   * @param {Boolean} [toLowerCase=false]\n   * @return {*}\n   */\n  getPlatformType(toLowerCase = false) {\n    const { type } = this.getPlatform();\n\n    if (toLowerCase) {\n      return String(type).toLowerCase() || '';\n    }\n\n    return type || '';\n  }\n\n  /**\n   * Get parsed platform\n   * @return {{}}\n   */\n  parsePlatform() {\n    this.parsedResult.platform = {};\n\n    const platform = Utils.find(platformParsersList, (_platform) => {\n      if (typeof _platform.test === 'function') {\n        return _platform.test(this);\n      }\n\n      if (_platform.test instanceof Array) {\n        return _platform.test.some(condition => this.test(condition));\n      }\n\n      throw new Error(\"Browser's test function is not valid\");\n    });\n\n    if (platform) {\n      this.parsedResult.platform = platform.describe(this.getUA());\n    }\n\n    return this.parsedResult.platform;\n  }\n\n  /**\n   * Get parsed engine\n   * @return {{}}\n   */\n  getEngine() {\n    if (this.parsedResult.engine) {\n      return this.parsedResult.engine;\n    }\n\n    return this.parseEngine();\n  }\n\n  /**\n   * Get engines's name\n   * @return {String} Engines's name or an empty string\n   *\n   * @public\n   */\n  getEngineName(toLowerCase) {\n    if (toLowerCase) {\n      return String(this.getEngine().name).toLowerCase() || '';\n    }\n    return this.getEngine().name || '';\n  }\n\n  /**\n   * Get parsed platform\n   * @return {{}}\n   */\n  parseEngine() {\n    this.parsedResult.engine = {};\n\n    const engine = Utils.find(enginesParsersList, (_engine) => {\n      if (typeof _engine.test === 'function') {\n        return _engine.test(this);\n      }\n\n      if (_engine.test instanceof Array) {\n        return _engine.test.some(condition => this.test(condition));\n      }\n\n      throw new Error(\"Browser's test function is not valid\");\n    });\n\n    if (engine) {\n      this.parsedResult.engine = engine.describe(this.getUA());\n    }\n\n    return this.parsedResult.engine;\n  }\n\n  /**\n   * Parse full information about the browser\n   * @returns {Parser}\n   */\n  parse() {\n    this.parseBrowser();\n    this.parseOS();\n    this.parsePlatform();\n    this.parseEngine();\n\n    return this;\n  }\n\n  /**\n   * Get parsed result\n   * @return {ParsedResult}\n   */\n  getResult() {\n    return Utils.assign({}, this.parsedResult);\n  }\n\n  /**\n   * Check if parsed browser matches certain conditions\n   *\n   * @param {Object} checkTree It's one or two layered object,\n   * which can include a platform or an OS on the first layer\n   * and should have browsers specs on the bottom-laying layer\n   *\n   * @returns {Boolean|undefined} Whether the browser satisfies the set conditions or not.\n   * Returns `undefined` when the browser is no described in the checkTree object.\n   *\n   * @example\n   * const browser = Bowser.getParser(window.navigator.userAgent);\n   * if (browser.satisfies({chrome: '>118.01.1322' }))\n   * // or with os\n   * if (browser.satisfies({windows: { chrome: '>118.01.1322' } }))\n   * // or with platforms\n   * if (browser.satisfies({desktop: { chrome: '>118.01.1322' } }))\n   */\n  satisfies(checkTree) {\n    const platformsAndOSes = {};\n    let platformsAndOSCounter = 0;\n    const browsers = {};\n    let browsersCounter = 0;\n\n    const allDefinitions = Object.keys(checkTree);\n\n    allDefinitions.forEach((key) => {\n      const currentDefinition = checkTree[key];\n      if (typeof currentDefinition === 'string') {\n        browsers[key] = currentDefinition;\n        browsersCounter += 1;\n      } else if (typeof currentDefinition === 'object') {\n        platformsAndOSes[key] = currentDefinition;\n        platformsAndOSCounter += 1;\n      }\n    });\n\n    if (platformsAndOSCounter > 0) {\n      const platformsAndOSNames = Object.keys(platformsAndOSes);\n      const OSMatchingDefinition = Utils.find(platformsAndOSNames, name => (this.isOS(name)));\n\n      if (OSMatchingDefinition) {\n        const osResult = this.satisfies(platformsAndOSes[OSMatchingDefinition]);\n\n        if (osResult !== void 0) {\n          return osResult;\n        }\n      }\n\n      const platformMatchingDefinition = Utils.find(\n        platformsAndOSNames,\n        name => (this.isPlatform(name)),\n      );\n      if (platformMatchingDefinition) {\n        const platformResult = this.satisfies(platformsAndOSes[platformMatchingDefinition]);\n\n        if (platformResult !== void 0) {\n          return platformResult;\n        }\n      }\n    }\n\n    if (browsersCounter > 0) {\n      const browserNames = Object.keys(browsers);\n      const matchingDefinition = Utils.find(browserNames, name => (this.isBrowser(name, true)));\n\n      if (matchingDefinition !== void 0) {\n        return this.compareVersion(browsers[matchingDefinition]);\n      }\n    }\n\n    return undefined;\n  }\n\n  /**\n   * Check if the browser name equals the passed string\n   * @param browserName The string to compare with the browser name\n   * @param [includingAlias=false] The flag showing whether alias will be included into comparison\n   * @returns {boolean}\n   */\n  isBrowser(browserName, includingAlias = false) {\n    const defaultBrowserName = this.getBrowserName().toLowerCase();\n    let browserNameLower = browserName.toLowerCase();\n    const alias = Utils.getBrowserTypeByAlias(browserNameLower);\n\n    if (includingAlias && alias) {\n      browserNameLower = alias.toLowerCase();\n    }\n    return browserNameLower === defaultBrowserName;\n  }\n\n  compareVersion(version) {\n    let expectedResults = [0];\n    let comparableVersion = version;\n    let isLoose = false;\n\n    const currentBrowserVersion = this.getBrowserVersion();\n\n    if (typeof currentBrowserVersion !== 'string') {\n      return void 0;\n    }\n\n    if (version[0] === '>' || version[0] === '<') {\n      comparableVersion = version.substr(1);\n      if (version[1] === '=') {\n        isLoose = true;\n        comparableVersion = version.substr(2);\n      } else {\n        expectedResults = [];\n      }\n      if (version[0] === '>') {\n        expectedResults.push(1);\n      } else {\n        expectedResults.push(-1);\n      }\n    } else if (version[0] === '=') {\n      comparableVersion = version.substr(1);\n    } else if (version[0] === '~') {\n      isLoose = true;\n      comparableVersion = version.substr(1);\n    }\n\n    return expectedResults.indexOf(\n      Utils.compareVersions(currentBrowserVersion, comparableVersion, isLoose),\n    ) > -1;\n  }\n\n  isOS(osName) {\n    return this.getOSName(true) === String(osName).toLowerCase();\n  }\n\n  isPlatform(platformType) {\n    return this.getPlatformType(true) === String(platformType).toLowerCase();\n  }\n\n  isEngine(engineName) {\n    return this.getEngineName(true) === String(engineName).toLowerCase();\n  }\n\n  /**\n   * Is anything? Check if the browser is called \"anything\",\n   * the OS called \"anything\" or the platform called \"anything\"\n   * @param {String} anything\n   * @param [includingAlias=false] The flag showing whether alias will be included into comparison\n   * @returns {Boolean}\n   */\n  is(anything, includingAlias = false) {\n    return this.isBrowser(anything, includingAlias) || this.isOS(anything)\n      || this.isPlatform(anything);\n  }\n\n  /**\n   * Check if any of the given values satisfies this.is(anything)\n   * @param {String[]} anythings\n   * @returns {Boolean}\n   */\n  some(anythings = []) {\n    return anythings.some(anything => this.is(anything));\n  }\n}\n\n/*!\n * Bowser - a browser detector\n * https://github.com/lancedikson/bowser\n * MIT License | (c) Dustin Diaz 2012-2015\n * MIT License | (c) Denis Demchenko 2015-2019\n */\n\n/**\n * Bowser class.\n * Keep it simple as much as it can be.\n * It's supposed to work with collections of {@link Parser} instances\n * rather then solve one-instance problems.\n * All the one-instance stuff is located in Parser class.\n *\n * @class\n * @classdesc Bowser is a static object, that provides an API to the Parsers\n * @hideconstructor\n */\nclass Bowser {\n  /**\n   * Creates a {@link Parser} instance\n   *\n   * @param {String} UA UserAgent string\n   * @param {Boolean} [skipParsing=false] Will make the Parser postpone parsing until you ask it\n   * explicitly. Same as `skipParsing` for {@link Parser}.\n   * @returns {Parser}\n   * @throws {Error} when UA is not a String\n   *\n   * @example\n   * const parser = Bowser.getParser(window.navigator.userAgent);\n   * const result = parser.getResult();\n   */\n  static getParser(UA, skipParsing = false) {\n    if (typeof UA !== 'string') {\n      throw new Error('UserAgent should be a string');\n    }\n    return new Parser(UA, skipParsing);\n  }\n\n  /**\n   * Creates a {@link Parser} instance and runs {@link Parser.getResult} immediately\n   *\n   * @param UA\n   * @return {ParsedResult}\n   *\n   * @example\n   * const result = Bowser.parse(window.navigator.userAgent);\n   */\n  static parse(UA) {\n    return (new Parser(UA)).getResult();\n  }\n\n  static get BROWSER_MAP() {\n    return BROWSER_MAP;\n  }\n\n  static get ENGINE_MAP() {\n    return ENGINE_MAP;\n  }\n\n  static get OS_MAP() {\n    return OS_MAP;\n  }\n\n  static get PLATFORMS_MAP() {\n    return PLATFORMS_MAP;\n  }\n}\n\nconst defaultUserAgent = ({ serviceId, clientVersion }) => async () => {\n    const parsedUA = typeof window !== \"undefined\" && window?.navigator?.userAgent\n        ? Bowser.parse(window.navigator.userAgent)\n        : undefined;\n    const sections = [\n        [\"aws-sdk-js\", clientVersion],\n        [\"ua\", \"2.0\"],\n        [`os/${parsedUA?.os?.name || \"other\"}`, parsedUA?.os?.version],\n        [\"lang/js\"],\n        [\"md/browser\", `${parsedUA?.browser?.name ?? \"unknown\"}_${parsedUA?.browser?.version ?? \"unknown\"}`],\n    ];\n    if (serviceId) {\n        sections.push([`api/${serviceId}`, clientVersion]);\n    }\n    return sections;\n};\n\nconst invalidProvider = (message) => () => Promise.reject(message);\n\nconst calculateBodyLength = (body) => {\n    if (typeof body === \"string\") {\n        let len = body.length;\n        for (let i = len - 1; i >= 0; i--) {\n            const code = body.charCodeAt(i);\n            if (code > 0x7f && code <= 0x7ff)\n                len++;\n            else if (code > 0x7ff && code <= 0xffff)\n                len += 2;\n            if (code >= 0xdc00 && code <= 0xdfff)\n                i--;\n        }\n        return len;\n    }\n    else if (typeof body.byteLength === \"number\") {\n        return body.byteLength;\n    }\n    else if (typeof body.size === \"number\") {\n        return body.size;\n    }\n    throw new Error(`Body Length computation failed for ${body}`);\n};\n\nconst DEFAULTS_MODE_OPTIONS = [\"in-region\", \"cross-region\", \"mobile\", \"standard\", \"legacy\"];\n\nconst resolveDefaultsModeConfig = ({ defaultsMode, } = {}) => memoize(async () => {\n    const mode = typeof defaultsMode === \"function\" ? await defaultsMode() : defaultsMode;\n    switch (mode?.toLowerCase()) {\n        case \"auto\":\n            return Promise.resolve(isMobileBrowser() ? \"mobile\" : \"standard\");\n        case \"mobile\":\n        case \"in-region\":\n        case \"cross-region\":\n        case \"standard\":\n        case \"legacy\":\n            return Promise.resolve(mode?.toLocaleLowerCase());\n        case undefined:\n            return Promise.resolve(\"legacy\");\n        default:\n            throw new Error(`Invalid parameter for \"defaultsMode\", expect ${DEFAULTS_MODE_OPTIONS.join(\", \")}, got ${mode}`);\n    }\n});\nconst isMobileBrowser = () => {\n    const parsedUA = typeof window !== \"undefined\" && window?.navigator?.userAgent\n        ? Bowser.parse(window.navigator.userAgent)\n        : undefined;\n    const platform = parsedUA?.platform?.type;\n    return platform === \"tablet\" || platform === \"mobile\";\n};\n\nexport { distEs$1 as A, distEs as B, Client as C, DEFAULT_MAX_ATTEMPTS as D, build as E, FetchHttpHandler as F, build$3 as G, HeaderMarshaller as H, build$4 as I, isArrayBuffer as J, toUint8Array as K, NoOpLogger as N, SignatureV4 as S, DEFAULT_RETRY_MODE as a, build$5 as b, calculateBodyLength as c, defaultUserAgent as d, DEFAULT_USE_DUALSTACK_ENDPOINT as e, DEFAULT_USE_FIPS_ENDPOINT as f, resolveDefaultsModeConfig as g, resolveRegionConfig as h, invalidProvider as i, resolveEndpointConfig as j, resolveRetryConfig as k, loadConfigsForDefaultMode as l, resolveAwsAuthConfig as m, resolveUserAgentConfig as n, getRetryPlugin as o, parseUrl as p, getContentLengthPlugin as q, resolveEndpoint as r, streamCollector as s, getHostHeaderPlugin as t, getLoggerPlugin as u, getRecursionDetectionPlugin as v, getUserAgentPlugin as w, resolveHostHeaderConfig as x, build$1 as y, HttpResponse as z };\n", "import { t as toBase64, b as toUtf8, f as fromBase64, a as fromUtf8, e as constructStack } from './lazy-json-f4438c0b.js';\n\nconst resolveParamsForS3 = async (endpointParams) => {\n    const bucket = endpointParams?.Bucket || \"\";\n    if (typeof endpointParams.Bucket === \"string\") {\n        endpointParams.Bucket = bucket.replace(/#/g, encodeURIComponent(\"#\")).replace(/\\?/g, encodeURIComponent(\"?\"));\n    }\n    if (isArnBucketName(bucket)) {\n        if (endpointParams.ForcePathStyle === true) {\n            throw new Error(\"Path-style addressing cannot be used with ARN buckets\");\n        }\n    }\n    else if (!isDnsCompatibleBucketName(bucket) ||\n        (bucket.indexOf(\".\") !== -1 && !String(endpointParams.Endpoint).startsWith(\"http:\")) ||\n        bucket.toLowerCase() !== bucket ||\n        bucket.length < 3) {\n        endpointParams.ForcePathStyle = true;\n    }\n    if (endpointParams.DisableMultiRegionAccessPoints) {\n        endpointParams.disableMultiRegionAccessPoints = true;\n        endpointParams.DisableMRAP = true;\n    }\n    return endpointParams;\n};\nconst DOMAIN_PATTERN = /^[a-z0-9][a-z0-9\\.\\-]{1,61}[a-z0-9]$/;\nconst IP_ADDRESS_PATTERN = /(\\d+\\.){3}\\d+/;\nconst DOTS_PATTERN = /\\.\\./;\nconst isDnsCompatibleBucketName = (bucketName) => DOMAIN_PATTERN.test(bucketName) && !IP_ADDRESS_PATTERN.test(bucketName) && !DOTS_PATTERN.test(bucketName);\nconst isArnBucketName = (bucketName) => {\n    const [arn, partition, service, region, account, typeOrId] = bucketName.split(\":\");\n    const isArn = arn === \"arn\" && bucketName.split(\":\").length >= 6;\n    const isValidArn = [arn, partition, service, account, typeOrId].filter(Boolean).length === 5;\n    if (isArn && !isValidArn) {\n        throw new Error(`Invalid ARN: ${bucketName} was an invalid ARN.`);\n    }\n    return arn === \"arn\" && !!partition && !!service && !!account && !!typeOrId;\n};\n\nconst createConfigValueProvider = (configKey, canonicalEndpointParamKey, config) => {\n    const configProvider = async () => {\n        const configValue = config[configKey] ?? config[canonicalEndpointParamKey];\n        if (typeof configValue === \"function\") {\n            return configValue();\n        }\n        return configValue;\n    };\n    if (configKey === \"endpoint\" || canonicalEndpointParamKey === \"endpoint\") {\n        return async () => {\n            const endpoint = await configProvider();\n            if (endpoint && typeof endpoint === \"object\") {\n                if (\"url\" in endpoint) {\n                    return endpoint.url.href;\n                }\n                if (\"hostname\" in endpoint) {\n                    const { protocol, hostname, port, path } = endpoint;\n                    return `${protocol}//${hostname}${port ? \":\" + port : \"\"}${path}`;\n                }\n            }\n            return endpoint;\n        };\n    }\n    return configProvider;\n};\n\nconst getEndpointFromInstructions = async (commandInput, instructionsSupplier, clientConfig, context) => {\n    const endpointParams = await resolveParams(commandInput, instructionsSupplier, clientConfig);\n    if (typeof clientConfig.endpointProvider !== \"function\") {\n        throw new Error(\"config.endpointProvider is not set.\");\n    }\n    const endpoint = clientConfig.endpointProvider(endpointParams, context);\n    return endpoint;\n};\nconst resolveParams = async (commandInput, instructionsSupplier, clientConfig) => {\n    const endpointParams = {};\n    const instructions = instructionsSupplier?.getEndpointParameterInstructions?.() || {};\n    for (const [name, instruction] of Object.entries(instructions)) {\n        switch (instruction.type) {\n            case \"staticContextParams\":\n                endpointParams[name] = instruction.value;\n                break;\n            case \"contextParams\":\n                endpointParams[name] = commandInput[instruction.name];\n                break;\n            case \"clientContextParams\":\n            case \"builtInParams\":\n                endpointParams[name] = await createConfigValueProvider(instruction.name, name, clientConfig)();\n                break;\n            default:\n                throw new Error(\"Unrecognized endpoint parameter instruction: \" + JSON.stringify(instruction));\n        }\n    }\n    if (Object.keys(instructions).length === 0) {\n        Object.assign(endpointParams, clientConfig);\n    }\n    if (String(clientConfig.serviceId).toLowerCase() === \"s3\") {\n        await resolveParamsForS3(endpointParams);\n    }\n    return endpointParams;\n};\n\nconst endpointMiddleware = ({ config, instructions, }) => {\n    return (next, context) => async (args) => {\n        const endpoint = await getEndpointFromInstructions(args.input, {\n            getEndpointParameterInstructions() {\n                return instructions;\n            },\n        }, { ...config }, context);\n        context.endpointV2 = endpoint;\n        context.authSchemes = endpoint.properties?.authSchemes;\n        const authScheme = context.authSchemes?.[0];\n        if (authScheme) {\n            context[\"signing_region\"] = authScheme.signingRegion;\n            context[\"signing_service\"] = authScheme.signingName;\n        }\n        return next({\n            ...args,\n        });\n    };\n};\n\nconst deserializerMiddleware = (options, deserializer) => (next, context) => async (args) => {\n    const { response } = await next(args);\n    try {\n        const parsed = await deserializer(response, options);\n        return {\n            response,\n            output: parsed,\n        };\n    }\n    catch (error) {\n        Object.defineProperty(error, \"$response\", {\n            value: response,\n        });\n        if (!(\"$metadata\" in error)) {\n            const hint = `Deserialization error: to see the raw response, inspect the hidden field {error}.$response on this object.`;\n            error.message += \"\\n  \" + hint;\n        }\n        throw error;\n    }\n};\n\nconst serializerMiddleware = (options, serializer) => (next, context) => async (args) => {\n    const endpoint = context.endpointV2?.url && options.urlParser\n        ? async () => options.urlParser(context.endpointV2.url)\n        : options.endpoint;\n    if (!endpoint) {\n        throw new Error(\"No valid endpoint provider available.\");\n    }\n    const request = await serializer(args.input, { ...options, endpoint });\n    return next({\n        ...args,\n        request,\n    });\n};\n\nconst deserializerMiddlewareOption = {\n    name: \"deserializerMiddleware\",\n    step: \"deserialize\",\n    tags: [\"DESERIALIZER\"],\n    override: true,\n};\nconst serializerMiddlewareOption = {\n    name: \"serializerMiddleware\",\n    step: \"serialize\",\n    tags: [\"SERIALIZER\"],\n    override: true,\n};\nfunction getSerdePlugin(config, serializer, deserializer) {\n    return {\n        applyToStack: (commandStack) => {\n            commandStack.add(deserializerMiddleware(config, deserializer), deserializerMiddlewareOption);\n            commandStack.add(serializerMiddleware(config, serializer), serializerMiddlewareOption);\n        },\n    };\n}\n\nconst endpointMiddlewareOptions = {\n    step: \"serialize\",\n    tags: [\"ENDPOINT_PARAMETERS\", \"ENDPOINT_V2\", \"ENDPOINT\"],\n    name: \"endpointV2Middleware\",\n    override: true,\n    relation: \"before\",\n    toMiddleware: serializerMiddlewareOption.name,\n};\nconst getEndpointPlugin = (config, instructions) => ({\n    applyToStack: (clientStack) => {\n        clientStack.addRelativeTo(endpointMiddleware({\n            config,\n            instructions,\n        }), endpointMiddlewareOptions);\n    },\n});\n\nfunction transformToString(payload, encoding = \"utf-8\") {\n    if (encoding === \"base64\") {\n        return toBase64(payload);\n    }\n    return toUtf8(payload);\n}\nfunction transformFromString(str, encoding) {\n    if (encoding === \"base64\") {\n        return Uint8ArrayBlobAdapter.mutate(fromBase64(str));\n    }\n    return Uint8ArrayBlobAdapter.mutate(fromUtf8(str));\n}\n\nclass Uint8ArrayBlobAdapter extends Uint8Array {\n    static fromString(source, encoding = \"utf-8\") {\n        switch (typeof source) {\n            case \"string\":\n                return transformFromString(source, encoding);\n            default:\n                throw new Error(`Unsupported conversion from ${typeof source} to Uint8ArrayBlobAdapter.`);\n        }\n    }\n    static mutate(source) {\n        Object.setPrototypeOf(source, Uint8ArrayBlobAdapter.prototype);\n        return source;\n    }\n    transformToString(encoding = \"utf-8\") {\n        return transformToString(this, encoding);\n    }\n}\n\nconst collectBody = async (streamBody = new Uint8Array(), context) => {\n    if (streamBody instanceof Uint8Array) {\n        return Uint8ArrayBlobAdapter.mutate(streamBody);\n    }\n    if (!streamBody) {\n        return Uint8ArrayBlobAdapter.mutate(new Uint8Array());\n    }\n    const fromContext = context.streamCollector(streamBody);\n    return Uint8ArrayBlobAdapter.mutate(await fromContext);\n};\n\nclass Command {\n    constructor() {\n        this.middlewareStack = constructStack();\n    }\n}\n\nconst parseBoolean = (value) => {\n    switch (value) {\n        case \"true\":\n            return true;\n        case \"false\":\n            return false;\n        default:\n            throw new Error(`Unable to parse boolean value \"${value}\"`);\n    }\n};\nconst expectNumber = (value) => {\n    if (value === null || value === undefined) {\n        return undefined;\n    }\n    if (typeof value === \"string\") {\n        const parsed = parseFloat(value);\n        if (!Number.isNaN(parsed)) {\n            if (String(parsed) !== String(value)) {\n                logger.warn(stackTraceWarning(`Expected number but observed string: ${value}`));\n            }\n            return parsed;\n        }\n    }\n    if (typeof value === \"number\") {\n        return value;\n    }\n    throw new TypeError(`Expected number, got ${typeof value}: ${value}`);\n};\nconst MAX_FLOAT = Math.ceil(2 ** 127 * (2 - 2 ** -23));\nconst expectFloat32 = (value) => {\n    const expected = expectNumber(value);\n    if (expected !== undefined && !Number.isNaN(expected) && expected !== Infinity && expected !== -Infinity) {\n        if (Math.abs(expected) > MAX_FLOAT) {\n            throw new TypeError(`Expected 32-bit float, got ${value}`);\n        }\n    }\n    return expected;\n};\nconst expectLong = (value) => {\n    if (value === null || value === undefined) {\n        return undefined;\n    }\n    if (Number.isInteger(value) && !Number.isNaN(value)) {\n        return value;\n    }\n    throw new TypeError(`Expected integer, got ${typeof value}: ${value}`);\n};\nconst expectInt32 = (value) => expectSizedInt(value, 32);\nconst expectShort = (value) => expectSizedInt(value, 16);\nconst expectByte = (value) => expectSizedInt(value, 8);\nconst expectSizedInt = (value, size) => {\n    const expected = expectLong(value);\n    if (expected !== undefined && castInt(expected, size) !== expected) {\n        throw new TypeError(`Expected ${size}-bit integer, got ${value}`);\n    }\n    return expected;\n};\nconst castInt = (value, size) => {\n    switch (size) {\n        case 32:\n            return Int32Array.of(value)[0];\n        case 16:\n            return Int16Array.of(value)[0];\n        case 8:\n            return Int8Array.of(value)[0];\n    }\n};\nconst expectNonNull = (value, location) => {\n    if (value === null || value === undefined) {\n        if (location) {\n            throw new TypeError(`Expected a non-null value for ${location}`);\n        }\n        throw new TypeError(\"Expected a non-null value\");\n    }\n    return value;\n};\nconst expectObject = (value) => {\n    if (value === null || value === undefined) {\n        return undefined;\n    }\n    if (typeof value === \"object\" && !Array.isArray(value)) {\n        return value;\n    }\n    const receivedType = Array.isArray(value) ? \"array\" : typeof value;\n    throw new TypeError(`Expected object, got ${receivedType}: ${value}`);\n};\nconst expectString = (value) => {\n    if (value === null || value === undefined) {\n        return undefined;\n    }\n    if (typeof value === \"string\") {\n        return value;\n    }\n    if ([\"boolean\", \"number\", \"bigint\"].includes(typeof value)) {\n        logger.warn(stackTraceWarning(`Expected string, got ${typeof value}: ${value}`));\n        return String(value);\n    }\n    throw new TypeError(`Expected string, got ${typeof value}: ${value}`);\n};\nconst strictParseDouble = (value) => {\n    if (typeof value == \"string\") {\n        return expectNumber(parseNumber(value));\n    }\n    return expectNumber(value);\n};\nconst strictParseFloat32 = (value) => {\n    if (typeof value == \"string\") {\n        return expectFloat32(parseNumber(value));\n    }\n    return expectFloat32(value);\n};\nconst NUMBER_REGEX = /(-?(?:0|[1-9]\\d*)(?:\\.\\d+)?(?:[eE][+-]?\\d+)?)|(-?Infinity)|(NaN)/g;\nconst parseNumber = (value) => {\n    const matches = value.match(NUMBER_REGEX);\n    if (matches === null || matches[0].length !== value.length) {\n        throw new TypeError(`Expected real number, got implicit NaN`);\n    }\n    return parseFloat(value);\n};\nconst strictParseLong = (value) => {\n    if (typeof value === \"string\") {\n        return expectLong(parseNumber(value));\n    }\n    return expectLong(value);\n};\nconst strictParseInt32 = (value) => {\n    if (typeof value === \"string\") {\n        return expectInt32(parseNumber(value));\n    }\n    return expectInt32(value);\n};\nconst strictParseShort = (value) => {\n    if (typeof value === \"string\") {\n        return expectShort(parseNumber(value));\n    }\n    return expectShort(value);\n};\nconst strictParseByte = (value) => {\n    if (typeof value === \"string\") {\n        return expectByte(parseNumber(value));\n    }\n    return expectByte(value);\n};\nconst stackTraceWarning = (message) => {\n    return String(new TypeError(message).stack || message)\n        .split(\"\\n\")\n        .slice(0, 5)\n        .filter((s) => !s.includes(\"stackTraceWarning\"))\n        .join(\"\\n\");\n};\nconst logger = {\n    warn: console.warn,\n};\n\nconst DAYS = [\"Sun\", \"Mon\", \"Tue\", \"Wed\", \"Thu\", \"Fri\", \"Sat\"];\nconst MONTHS = [\"Jan\", \"Feb\", \"Mar\", \"Apr\", \"May\", \"Jun\", \"Jul\", \"Aug\", \"Sep\", \"Oct\", \"Nov\", \"Dec\"];\nfunction dateToUtcString(date) {\n    const year = date.getUTCFullYear();\n    const month = date.getUTCMonth();\n    const dayOfWeek = date.getUTCDay();\n    const dayOfMonthInt = date.getUTCDate();\n    const hoursInt = date.getUTCHours();\n    const minutesInt = date.getUTCMinutes();\n    const secondsInt = date.getUTCSeconds();\n    const dayOfMonthString = dayOfMonthInt < 10 ? `0${dayOfMonthInt}` : `${dayOfMonthInt}`;\n    const hoursString = hoursInt < 10 ? `0${hoursInt}` : `${hoursInt}`;\n    const minutesString = minutesInt < 10 ? `0${minutesInt}` : `${minutesInt}`;\n    const secondsString = secondsInt < 10 ? `0${secondsInt}` : `${secondsInt}`;\n    return `${DAYS[dayOfWeek]}, ${dayOfMonthString} ${MONTHS[month]} ${year} ${hoursString}:${minutesString}:${secondsString} GMT`;\n}\nconst RFC3339_WITH_OFFSET = new RegExp(/^(\\d{4})-(\\d{2})-(\\d{2})[tT](\\d{2}):(\\d{2}):(\\d{2})(?:\\.(\\d+))?(([-+]\\d{2}\\:\\d{2})|[zZ])$/);\nconst parseRfc3339DateTimeWithOffset = (value) => {\n    if (value === null || value === undefined) {\n        return undefined;\n    }\n    if (typeof value !== \"string\") {\n        throw new TypeError(\"RFC-3339 date-times must be expressed as strings\");\n    }\n    const match = RFC3339_WITH_OFFSET.exec(value);\n    if (!match) {\n        throw new TypeError(\"Invalid RFC-3339 date-time value\");\n    }\n    const [_, yearStr, monthStr, dayStr, hours, minutes, seconds, fractionalMilliseconds, offsetStr] = match;\n    const year = strictParseShort(stripLeadingZeroes(yearStr));\n    const month = parseDateValue(monthStr, \"month\", 1, 12);\n    const day = parseDateValue(dayStr, \"day\", 1, 31);\n    const date = buildDate(year, month, day, { hours, minutes, seconds, fractionalMilliseconds });\n    if (offsetStr.toUpperCase() != \"Z\") {\n        date.setTime(date.getTime() - parseOffsetToMilliseconds(offsetStr));\n    }\n    return date;\n};\nconst parseEpochTimestamp = (value) => {\n    if (value === null || value === undefined) {\n        return undefined;\n    }\n    let valueAsDouble;\n    if (typeof value === \"number\") {\n        valueAsDouble = value;\n    }\n    else if (typeof value === \"string\") {\n        valueAsDouble = strictParseDouble(value);\n    }\n    else {\n        throw new TypeError(\"Epoch timestamps must be expressed as floating point numbers or their string representation\");\n    }\n    if (Number.isNaN(valueAsDouble) || valueAsDouble === Infinity || valueAsDouble === -Infinity) {\n        throw new TypeError(\"Epoch timestamps must be valid, non-Infinite, non-NaN numerics\");\n    }\n    return new Date(Math.round(valueAsDouble * 1000));\n};\nconst buildDate = (year, month, day, time) => {\n    const adjustedMonth = month - 1;\n    validateDayOfMonth(year, adjustedMonth, day);\n    return new Date(Date.UTC(year, adjustedMonth, day, parseDateValue(time.hours, \"hour\", 0, 23), parseDateValue(time.minutes, \"minute\", 0, 59), parseDateValue(time.seconds, \"seconds\", 0, 60), parseMilliseconds(time.fractionalMilliseconds)));\n};\nconst DAYS_IN_MONTH = [31, 28, 31, 30, 31, 30, 31, 31, 30, 31, 30, 31];\nconst validateDayOfMonth = (year, month, day) => {\n    let maxDays = DAYS_IN_MONTH[month];\n    if (month === 1 && isLeapYear(year)) {\n        maxDays = 29;\n    }\n    if (day > maxDays) {\n        throw new TypeError(`Invalid day for ${MONTHS[month]} in ${year}: ${day}`);\n    }\n};\nconst isLeapYear = (year) => {\n    return year % 4 === 0 && (year % 100 !== 0 || year % 400 === 0);\n};\nconst parseDateValue = (value, type, lower, upper) => {\n    const dateVal = strictParseByte(stripLeadingZeroes(value));\n    if (dateVal < lower || dateVal > upper) {\n        throw new TypeError(`${type} must be between ${lower} and ${upper}, inclusive`);\n    }\n    return dateVal;\n};\nconst parseMilliseconds = (value) => {\n    if (value === null || value === undefined) {\n        return 0;\n    }\n    return strictParseFloat32(\"0.\" + value) * 1000;\n};\nconst parseOffsetToMilliseconds = (value) => {\n    const directionStr = value[0];\n    let direction = 1;\n    if (directionStr == \"+\") {\n        direction = 1;\n    }\n    else if (directionStr == \"-\") {\n        direction = -1;\n    }\n    else {\n        throw new TypeError(`Offset direction, ${directionStr}, must be \"+\" or \"-\"`);\n    }\n    const hour = Number(value.substring(1, 3));\n    const minute = Number(value.substring(4, 6));\n    return direction * (hour * 60 + minute) * 60 * 1000;\n};\nconst stripLeadingZeroes = (value) => {\n    let idx = 0;\n    while (idx < value.length - 1 && value.charAt(idx) === \"0\") {\n        idx++;\n    }\n    if (idx === 0) {\n        return value;\n    }\n    return value.slice(idx);\n};\n\nclass ServiceException extends Error {\n    constructor(options) {\n        super(options.message);\n        Object.setPrototypeOf(this, ServiceException.prototype);\n        this.name = options.name;\n        this.$fault = options.$fault;\n        this.$metadata = options.$metadata;\n    }\n}\nconst decorateServiceException = (exception, additions = {}) => {\n    Object.entries(additions)\n        .filter(([, v]) => v !== undefined)\n        .forEach(([k, v]) => {\n        if (exception[k] == undefined || exception[k] === \"\") {\n            exception[k] = v;\n        }\n    });\n    const message = exception.message || exception.Message || \"UnknownError\";\n    exception.message = message;\n    delete exception.Message;\n    return exception;\n};\n\nconst throwDefaultError = ({ output, parsedBody, exceptionCtor, errorCode }) => {\n    const $metadata = deserializeMetadata(output);\n    const statusCode = $metadata.httpStatusCode ? $metadata.httpStatusCode + \"\" : undefined;\n    const response = new exceptionCtor({\n        name: parsedBody?.code || parsedBody?.Code || errorCode || statusCode || \"UnknownError\",\n        $fault: \"client\",\n        $metadata,\n    });\n    throw decorateServiceException(response, parsedBody);\n};\nconst withBaseException = (ExceptionCtor) => {\n    return ({ output, parsedBody, errorCode }) => {\n        throwDefaultError({ output, parsedBody, exceptionCtor: ExceptionCtor, errorCode });\n    };\n};\nconst deserializeMetadata = (output) => ({\n    httpStatusCode: output.statusCode,\n    requestId: output.headers[\"x-amzn-requestid\"] ?? output.headers[\"x-amzn-request-id\"] ?? output.headers[\"x-amz-request-id\"],\n    extendedRequestId: output.headers[\"x-amz-id-2\"],\n    cfId: output.headers[\"x-amz-cf-id\"],\n});\n\nfunction map(arg0, arg1, arg2) {\n    let target;\n    let filter;\n    let instructions;\n    if (typeof arg1 === \"undefined\" && typeof arg2 === \"undefined\") {\n        target = {};\n        instructions = arg0;\n    }\n    else {\n        target = arg0;\n        if (typeof arg1 === \"function\") {\n            filter = arg1;\n            instructions = arg2;\n            return mapWithFilter(target, filter, instructions);\n        }\n        else {\n            instructions = arg1;\n        }\n    }\n    for (const key of Object.keys(instructions)) {\n        if (!Array.isArray(instructions[key])) {\n            target[key] = instructions[key];\n            continue;\n        }\n        applyInstruction(target, null, instructions, key);\n    }\n    return target;\n}\nconst take = (source, instructions) => {\n    const out = {};\n    for (const key in instructions) {\n        applyInstruction(out, source, instructions, key);\n    }\n    return out;\n};\nconst mapWithFilter = (target, filter, instructions) => {\n    return map(target, Object.entries(instructions).reduce((_instructions, [key, value]) => {\n        if (Array.isArray(value)) {\n            _instructions[key] = value;\n        }\n        else {\n            if (typeof value === \"function\") {\n                _instructions[key] = [filter, value()];\n            }\n            else {\n                _instructions[key] = [filter, value];\n            }\n        }\n        return _instructions;\n    }, {}));\n};\nconst applyInstruction = (target, source, instructions, targetKey) => {\n    if (source !== null) {\n        let instruction = instructions[targetKey];\n        if (typeof instruction === \"function\") {\n            instruction = [, instruction];\n        }\n        const [filter = nonNullish, valueFn = pass, sourceKey = targetKey] = instruction;\n        if ((typeof filter === \"function\" && filter(source[sourceKey])) || (typeof filter !== \"function\" && !!filter)) {\n            target[targetKey] = valueFn(source[sourceKey]);\n        }\n        return;\n    }\n    let [filter, value] = instructions[targetKey];\n    if (typeof value === \"function\") {\n        let _value;\n        const defaultFilterPassed = filter === undefined && (_value = value()) != null;\n        const customFilterPassed = (typeof filter === \"function\" && !!filter(void 0)) || (typeof filter !== \"function\" && !!filter);\n        if (defaultFilterPassed) {\n            target[targetKey] = _value;\n        }\n        else if (customFilterPassed) {\n            target[targetKey] = value();\n        }\n    }\n    else {\n        const defaultFilterPassed = filter === undefined && value != null;\n        const customFilterPassed = (typeof filter === \"function\" && !!filter(value)) || (typeof filter !== \"function\" && !!filter);\n        if (defaultFilterPassed || customFilterPassed) {\n            target[targetKey] = value;\n        }\n    }\n};\nconst nonNullish = (_) => _ != null;\nconst pass = (_) => _;\n\nexport { Command as C, ServiceException as S, expectObject as a, expectString as b, collectBody as c, dateToUtcString as d, expectNonNull as e, decorateServiceException as f, parseRfc3339DateTimeWithOffset as g, strictParseLong as h, getSerdePlugin as i, getEndpointPlugin as j, parseEpochTimestamp as k, expectNumber as l, map as m, parseBoolean as p, strictParseInt32 as s, take as t, withBaseException as w };\n", "import { H as HttpRequest, t as toBase64, c as toHex, b as toUtf8, a as fromUtf8, f as fromBase64 } from '../common/lazy-json-f4438c0b.js';\nimport { y as build$2, H as HeaderMarshaller, z as HttpResponse, s as streamCollector, A as distEs, B as distEs$1, E as build$3, G as build$4, I as build$5, S as SignatureV4, r as resolveEndpoint, N as NoOpLogger, p as parseUrl, c as calculateBodyLength, d as defaultUserAgent, D as DEFAULT_MAX_ATTEMPTS, i as invalidProvider, F as FetchHttpHandler, l as loadConfigsForDefaultMode, a as DEFAULT_RETRY_MODE, b as build$6, e as DEFAULT_USE_DUALSTACK_ENDPOINT, f as DEFAULT_USE_FIPS_ENDPOINT, g as resolveDefaultsModeConfig, C as Client, h as resolveRegionConfig, j as resolveEndpointConfig, k as resolveRetryConfig, m as resolveAwsAuthConfig, n as resolveUserAgentConfig, o as getRetryPlugin, q as getContentLengthPlugin, t as getHostHeaderPlugin, u as getLoggerPlugin, v as getRecursionDetectionPlugin, w as getUserAgentPlugin, x as resolveHostHeaderConfig, J as isArrayBuffer, K as toUint8Array } from '../common/resolveDefaultsModeConfig-3d61721d.js';\nimport { c as createCommonjsModule } from '../common/_commonjsHelpers-eb5a497e.js';\nimport { S as ServiceException, m as map, d as dateToUtcString, e as expectNonNull, a as expectObject, c as collectBody, b as expectString, p as parseBoolean, s as strictParseInt32, f as decorateServiceException, w as withBaseException, g as parseRfc3339DateTimeWithOffset, h as strictParseLong, C as Command, i as getSerdePlugin, j as getEndpointPlugin } from '../common/object-mapping-ce2960b7.js';\nimport '../common/v4-c5ee5148.js';\n\nconst PRELUDE_MEMBER_LENGTH = 4;\nconst PRELUDE_LENGTH = PRELUDE_MEMBER_LENGTH * 2;\nconst CHECKSUM_LENGTH = 4;\nconst MINIMUM_MESSAGE_LENGTH = PRELUDE_LENGTH + CHECKSUM_LENGTH * 2;\nfunction splitMessage({ byteLength, byteOffset, buffer }) {\n    if (byteLength < MINIMUM_MESSAGE_LENGTH) {\n        throw new Error(\"Provided message too short to accommodate event stream message overhead\");\n    }\n    const view = new DataView(buffer, byteOffset, byteLength);\n    const messageLength = view.getUint32(0, false);\n    if (byteLength !== messageLength) {\n        throw new Error(\"Reported message length does not match received message length\");\n    }\n    const headerLength = view.getUint32(PRELUDE_MEMBER_LENGTH, false);\n    const expectedPreludeChecksum = view.getUint32(PRELUDE_LENGTH, false);\n    const expectedMessageChecksum = view.getUint32(byteLength - CHECKSUM_LENGTH, false);\n    const checksummer = new build$2.Crc32().update(new Uint8Array(buffer, byteOffset, PRELUDE_LENGTH));\n    if (expectedPreludeChecksum !== checksummer.digest()) {\n        throw new Error(`The prelude checksum specified in the message (${expectedPreludeChecksum}) does not match the calculated CRC32 checksum (${checksummer.digest()})`);\n    }\n    checksummer.update(new Uint8Array(buffer, byteOffset + PRELUDE_LENGTH, byteLength - (PRELUDE_LENGTH + CHECKSUM_LENGTH)));\n    if (expectedMessageChecksum !== checksummer.digest()) {\n        throw new Error(`The message checksum (${checksummer.digest()}) did not match the expected value of ${expectedMessageChecksum}`);\n    }\n    return {\n        headers: new DataView(buffer, byteOffset + PRELUDE_LENGTH + CHECKSUM_LENGTH, headerLength),\n        body: new Uint8Array(buffer, byteOffset + PRELUDE_LENGTH + CHECKSUM_LENGTH + headerLength, messageLength - headerLength - (PRELUDE_LENGTH + CHECKSUM_LENGTH + CHECKSUM_LENGTH)),\n    };\n}\n\nclass EventStreamCodec {\n    constructor(toUtf8, fromUtf8) {\n        this.headerMarshaller = new HeaderMarshaller(toUtf8, fromUtf8);\n        this.messageBuffer = [];\n        this.isEndOfStream = false;\n    }\n    feed(message) {\n        this.messageBuffer.push(this.decode(message));\n    }\n    endOfStream() {\n        this.isEndOfStream = true;\n    }\n    getMessage() {\n        const message = this.messageBuffer.pop();\n        const isEndOfStream = this.isEndOfStream;\n        return {\n            getMessage() {\n                return message;\n            },\n            isEndOfStream() {\n                return isEndOfStream;\n            },\n        };\n    }\n    getAvailableMessages() {\n        const messages = this.messageBuffer;\n        this.messageBuffer = [];\n        const isEndOfStream = this.isEndOfStream;\n        return {\n            getMessages() {\n                return messages;\n            },\n            isEndOfStream() {\n                return isEndOfStream;\n            },\n        };\n    }\n    encode({ headers: rawHeaders, body }) {\n        const headers = this.headerMarshaller.format(rawHeaders);\n        const length = headers.byteLength + body.byteLength + 16;\n        const out = new Uint8Array(length);\n        const view = new DataView(out.buffer, out.byteOffset, out.byteLength);\n        const checksum = new build$2.Crc32();\n        view.setUint32(0, length, false);\n        view.setUint32(4, headers.byteLength, false);\n        view.setUint32(8, checksum.update(out.subarray(0, 8)).digest(), false);\n        out.set(headers, 12);\n        out.set(body, headers.byteLength + 12);\n        view.setUint32(length - 4, checksum.update(out.subarray(8, length - 4)).digest(), false);\n        return out;\n    }\n    decode(message) {\n        const { headers, body } = splitMessage(message);\n        return { headers: this.headerMarshaller.parse(headers), body };\n    }\n    formatHeaders(rawHeaders) {\n        return this.headerMarshaller.format(rawHeaders);\n    }\n}\n\nclass MessageDecoderStream {\n    constructor(options) {\n        this.options = options;\n    }\n    [Symbol.asyncIterator]() {\n        return this.asyncIterator();\n    }\n    async *asyncIterator() {\n        for await (const bytes of this.options.inputStream) {\n            const decoded = this.options.decoder.decode(bytes);\n            yield decoded;\n        }\n    }\n}\n\nclass MessageEncoderStream {\n    constructor(options) {\n        this.options = options;\n    }\n    [Symbol.asyncIterator]() {\n        return this.asyncIterator();\n    }\n    async *asyncIterator() {\n        for await (const msg of this.options.messageStream) {\n            const encoded = this.options.encoder.encode(msg);\n            yield encoded;\n        }\n        if (this.options.includeEndFrame) {\n            yield new Uint8Array(0);\n        }\n    }\n}\n\nclass SmithyMessageDecoderStream {\n    constructor(options) {\n        this.options = options;\n    }\n    [Symbol.asyncIterator]() {\n        return this.asyncIterator();\n    }\n    async *asyncIterator() {\n        for await (const message of this.options.messageStream) {\n            const deserialized = await this.options.deserializer(message);\n            if (deserialized === undefined)\n                continue;\n            yield deserialized;\n        }\n    }\n}\n\nclass SmithyMessageEncoderStream {\n    constructor(options) {\n        this.options = options;\n    }\n    [Symbol.asyncIterator]() {\n        return this.asyncIterator();\n    }\n    async *asyncIterator() {\n        for await (const chunk of this.options.inputStream) {\n            const payloadBuf = this.options.serializer(chunk);\n            yield payloadBuf;\n        }\n    }\n}\n\nconst getSkewCorrectedDate = (systemClockOffset) => new Date(Date.now() + systemClockOffset);\n\nconst isClockSkewed = (clockTime, systemClockOffset) => Math.abs(getSkewCorrectedDate(systemClockOffset).getTime() - clockTime) >= 300000;\n\nconst getUpdatedSystemClockOffset = (clockTime, currentSystemClockOffset) => {\n    const clockTimeInMs = Date.parse(clockTime);\n    if (isClockSkewed(clockTimeInMs, currentSystemClockOffset)) {\n        return clockTimeInMs - Date.now();\n    }\n    return currentSystemClockOffset;\n};\n\nconst awsAuthMiddleware = (options) => (next, context) => async function (args) {\n    if (!HttpRequest.isInstance(args.request))\n        return next(args);\n    const authScheme = context.endpointV2?.properties?.authSchemes?.[0];\n    const multiRegionOverride = authScheme?.name === \"sigv4a\" ? authScheme?.signingRegionSet?.join(\",\") : undefined;\n    const signer = await options.signer(authScheme);\n    const output = await next({\n        ...args,\n        request: await signer.sign(args.request, {\n            signingDate: getSkewCorrectedDate(options.systemClockOffset),\n            signingRegion: multiRegionOverride || context[\"signing_region\"],\n            signingService: context[\"signing_service\"],\n        }),\n    }).catch((error) => {\n        const serverTime = error.ServerTime ?? getDateHeader(error.$response);\n        if (serverTime) {\n            options.systemClockOffset = getUpdatedSystemClockOffset(serverTime, options.systemClockOffset);\n        }\n        throw error;\n    });\n    const dateHeader = getDateHeader(output.response);\n    if (dateHeader) {\n        options.systemClockOffset = getUpdatedSystemClockOffset(dateHeader, options.systemClockOffset);\n    }\n    return output;\n};\nconst getDateHeader = (response) => HttpResponse.isInstance(response) ? response.headers?.date ?? response.headers?.Date : undefined;\nconst awsAuthMiddlewareOptions = {\n    name: \"awsAuthMiddleware\",\n    tags: [\"SIGNATURE\", \"AWSAUTH\"],\n    relation: \"after\",\n    toMiddleware: \"retryMiddleware\",\n    override: true,\n};\nconst getAwsAuthPlugin = (options) => ({\n    applyToStack: (clientStack) => {\n        clientStack.addRelativeTo(awsAuthMiddleware(options), awsAuthMiddlewareOptions);\n    },\n});\n\nconst getAwsChunkedEncodingStream = (readableStream, options) => {\n    const { base64Encoder, bodyLengthChecker, checksumAlgorithmFn, checksumLocationName, streamHasher } = options;\n    const checksumRequired = base64Encoder !== undefined &&\n        bodyLengthChecker !== undefined &&\n        checksumAlgorithmFn !== undefined &&\n        checksumLocationName !== undefined &&\n        streamHasher !== undefined;\n    const digest = checksumRequired ? streamHasher(checksumAlgorithmFn, readableStream) : undefined;\n    const reader = readableStream.getReader();\n    return new ReadableStream({\n        async pull(controller) {\n            const { value, done } = await reader.read();\n            if (done) {\n                controller.enqueue(`0\\r\\n`);\n                if (checksumRequired) {\n                    const checksum = base64Encoder(await digest);\n                    controller.enqueue(`${checksumLocationName}:${checksum}\\r\\n`);\n                    controller.enqueue(`\\r\\n`);\n                }\n                controller.close();\n            }\n            else {\n                controller.enqueue(`${(bodyLengthChecker(value) || 0).toString(16)}\\r\\n${value}\\r\\n`);\n            }\n        },\n    });\n};\n\nconst ERR_MSG_STREAM_HAS_BEEN_TRANSFORMED = \"The stream has already been transformed.\";\nconst sdkStreamMixin = (stream) => {\n    if (!isBlobInstance(stream) && !isReadableStreamInstance(stream)) {\n        const name = stream?.__proto__?.constructor?.name || stream;\n        throw new Error(`Unexpected stream implementation, expect Blob or ReadableStream, got ${name}`);\n    }\n    let transformed = false;\n    const transformToByteArray = async () => {\n        if (transformed) {\n            throw new Error(ERR_MSG_STREAM_HAS_BEEN_TRANSFORMED);\n        }\n        transformed = true;\n        return await streamCollector(stream);\n    };\n    const blobToWebStream = (blob) => {\n        if (typeof blob.stream !== \"function\") {\n            throw new Error(\"Cannot transform payload Blob to web stream. Please make sure the Blob.stream() is polyfilled.\\n\" +\n                \"If you are using React Native, this API is not yet supported, see: https://react-native.canny.io/feature-requests/p/fetch-streaming-body\");\n        }\n        return blob.stream();\n    };\n    return Object.assign(stream, {\n        transformToByteArray: transformToByteArray,\n        transformToString: async (encoding) => {\n            const buf = await transformToByteArray();\n            if (encoding === \"base64\") {\n                return toBase64(buf);\n            }\n            else if (encoding === \"hex\") {\n                return toHex(buf);\n            }\n            else if (encoding === undefined || encoding === \"utf8\" || encoding === \"utf-8\") {\n                return toUtf8(buf);\n            }\n            else if (typeof TextDecoder === \"function\") {\n                return new TextDecoder(encoding).decode(buf);\n            }\n            else {\n                throw new Error(\"TextDecoder is not available, please make sure polyfill is provided.\");\n            }\n        },\n        transformToWebStream: () => {\n            if (transformed) {\n                throw new Error(ERR_MSG_STREAM_HAS_BEEN_TRANSFORMED);\n            }\n            transformed = true;\n            if (isBlobInstance(stream)) {\n                return blobToWebStream(stream);\n            }\n            else if (isReadableStreamInstance(stream)) {\n                return stream;\n            }\n            else {\n                throw new Error(`Cannot transform payload to web stream, got ${stream}`);\n            }\n        },\n    });\n};\nconst isBlobInstance = (stream) => typeof Blob === \"function\" && stream instanceof Blob;\nconst isReadableStreamInstance = (stream) => typeof ReadableStream === \"function\" && stream instanceof ReadableStream;\n\nconst SENSITIVE_STRING = \"***SensitiveInformation***\";\n\nfunction extendedEncodeURIComponent(str) {\n    return encodeURIComponent(str).replace(/[!'()*]/g, function (c) {\n        return \"%\" + c.charCodeAt(0).toString(16).toUpperCase();\n    });\n}\n\nconst getArrayIfSingleItem = (mayBeArray) => Array.isArray(mayBeArray) ? mayBeArray : [mayBeArray];\n\nconst getValueFromTextNode = (obj) => {\n    const textNodeName = \"#text\";\n    for (const key in obj) {\n        if (obj.hasOwnProperty(key) && obj[key][textNodeName] !== undefined) {\n            obj[key] = obj[key][textNodeName];\n        }\n        else if (typeof obj[key] === \"object\" && obj[key] !== null) {\n            obj[key] = getValueFromTextNode(obj[key]);\n        }\n    }\n    return obj;\n};\n\nconst resolvedPath = (resolvedPath, input, memberName, labelValueProvider, uriLabel, isGreedyLabel) => {\n    if (input != null && input[memberName] !== undefined) {\n        const labelValue = labelValueProvider();\n        if (labelValue.length <= 0) {\n            throw new Error(\"Empty value provided for input HTTP label: \" + memberName + \".\");\n        }\n        resolvedPath = resolvedPath.replace(uriLabel, isGreedyLabel\n            ? labelValue\n                .split(\"/\")\n                .map((segment) => extendedEncodeURIComponent(segment))\n                .join(\"/\")\n            : extendedEncodeURIComponent(labelValue));\n    }\n    else {\n        throw new Error(\"No value provided for input HTTP label: \" + memberName + \".\");\n    }\n    return resolvedPath;\n};\n\nfunction addExpectContinueMiddleware(options) {\n    return (next) => async (args) => {\n        const { request } = args;\n        if (HttpRequest.isInstance(request) && request.body && options.runtime === \"node\") {\n            request.headers = {\n                ...request.headers,\n                Expect: \"100-continue\",\n            };\n        }\n        return next({\n            ...args,\n            request,\n        });\n    };\n}\nconst addExpectContinueMiddlewareOptions = {\n    step: \"build\",\n    tags: [\"SET_EXPECT_HEADER\", \"EXPECT_HEADER\"],\n    name: \"addExpectContinueMiddleware\",\n    override: true,\n};\nconst getAddExpectContinuePlugin = (options) => ({\n    applyToStack: (clientStack) => {\n        clientStack.add(addExpectContinueMiddleware(options), addExpectContinueMiddlewareOptions);\n    },\n});\n\nconst CONTENT_LENGTH_HEADER = \"content-length\";\nfunction checkContentLengthHeader() {\n    return (next, context) => async (args) => {\n        const { request } = args;\n        if (HttpRequest.isInstance(request)) {\n            if (!request.headers[CONTENT_LENGTH_HEADER]) {\n                const message = `Are you using a Stream of unknown length as the Body of a PutObject request? Consider using Upload instead from @aws-sdk/lib-storage.`;\n                if (typeof context?.logger?.warn === \"function\") {\n                    context.logger.warn(message);\n                }\n                else {\n                    console.warn(message);\n                }\n            }\n        }\n        return next({ ...args });\n    };\n}\nconst checkContentLengthHeaderMiddlewareOptions = {\n    step: \"finalizeRequest\",\n    tags: [\"CHECK_CONTENT_LENGTH_HEADER\"],\n    name: \"getCheckContentLengthHeaderPlugin\",\n    override: true,\n};\nconst getCheckContentLengthHeaderPlugin = (unused) => ({\n    applyToStack: (clientStack) => {\n        clientStack.add(checkContentLengthHeader(), checkContentLengthHeaderMiddlewareOptions);\n    },\n});\n\nconst resolveS3Config = (input) => ({\n    ...input,\n    forcePathStyle: input.forcePathStyle ?? false,\n    useAccelerateEndpoint: input.useAccelerateEndpoint ?? false,\n    disableMultiregionAccessPoints: input.disableMultiregionAccessPoints ?? false,\n});\n\nconst validate = (str) => typeof str === \"string\" && str.indexOf(\"arn:\") === 0 && str.split(\":\").length >= 6;\n\nfunction validateBucketNameMiddleware() {\n    return (next) => async (args) => {\n        const { input: { Bucket }, } = args;\n        if (typeof Bucket === \"string\" && !validate(Bucket) && Bucket.indexOf(\"/\") >= 0) {\n            const err = new Error(`Bucket name shouldn't contain '/', received '${Bucket}'`);\n            err.name = \"InvalidBucketName\";\n            throw err;\n        }\n        return next({ ...args });\n    };\n}\nconst validateBucketNameMiddlewareOptions = {\n    step: \"initialize\",\n    tags: [\"VALIDATE_BUCKET_NAME\"],\n    name: \"validateBucketNameMiddleware\",\n    override: true,\n};\nconst getValidateBucketNamePlugin = (unused) => ({\n    applyToStack: (clientStack) => {\n        clientStack.add(validateBucketNameMiddleware(), validateBucketNameMiddlewareOptions);\n    },\n});\n\nconst resolveEventStreamSerdeConfig = (input) => ({\n    ...input,\n    eventStreamMarshaller: input.eventStreamSerdeProvider(input),\n});\n\nconst resolveClientEndpointParameters = (options) => {\n    return {\n        ...options,\n        useFipsEndpoint: options.useFipsEndpoint ?? false,\n        useDualstackEndpoint: options.useDualstackEndpoint ?? false,\n        forcePathStyle: options.forcePathStyle ?? false,\n        useAccelerateEndpoint: options.useAccelerateEndpoint ?? false,\n        useGlobalEndpoint: options.useGlobalEndpoint ?? false,\n        disableMultiregionAccessPoints: options.disableMultiregionAccessPoints ?? false,\n        defaultSigningName: \"s3\",\n    };\n};\n\nconst name = \"@aws-sdk/client-s3\";\nconst description = \"AWS SDK for JavaScript S3 Client for Node.js, Browser and React Native\";\nconst version = \"3.378.0\";\nconst scripts = {\n  build: \"concurrently 'yarn:build:cjs' 'yarn:build:es' 'yarn:build:types'\",\n  \"build:cjs\": \"tsc -p tsconfig.cjs.json\",\n  \"build:docs\": \"typedoc\",\n  \"build:es\": \"tsc -p tsconfig.es.json\",\n  \"build:include:deps\": \"lerna run --scope $npm_package_name --include-dependencies build\",\n  \"build:types\": \"tsc -p tsconfig.types.json\",\n  \"build:types:downlevel\": \"downlevel-dts dist-types dist-types/ts3.4\",\n  clean: \"rimraf ./dist-* && rimraf *.tsbuildinfo\",\n  \"extract:docs\": \"api-extractor run --local\",\n  \"generate:client\": \"node ../../scripts/generate-clients/single-service --solo s3\",\n  test: \"yarn test:unit\",\n  \"test:e2e\": \"ts-mocha test/**/*.ispec.ts && karma start karma.conf.js\",\n  \"test:unit\": \"ts-mocha test/**/*.spec.ts\"\n};\nconst main = \"./dist-cjs/index.js\";\nconst types = \"./dist-types/index.d.ts\";\nconst module = \"./dist-es/index.js\";\nconst sideEffects = false;\nconst dependencies = {\n  \"@aws-crypto/sha1-browser\": \"3.0.0\",\n  \"@aws-crypto/sha256-browser\": \"3.0.0\",\n  \"@aws-crypto/sha256-js\": \"3.0.0\",\n  \"@aws-sdk/client-sts\": \"3.378.0\",\n  \"@aws-sdk/credential-provider-node\": \"3.378.0\",\n  \"@aws-sdk/middleware-bucket-endpoint\": \"3.378.0\",\n  \"@aws-sdk/middleware-expect-continue\": \"3.378.0\",\n  \"@aws-sdk/middleware-flexible-checksums\": \"3.378.0\",\n  \"@aws-sdk/middleware-host-header\": \"3.378.0\",\n  \"@aws-sdk/middleware-location-constraint\": \"3.378.0\",\n  \"@aws-sdk/middleware-logger\": \"3.378.0\",\n  \"@aws-sdk/middleware-recursion-detection\": \"3.378.0\",\n  \"@aws-sdk/middleware-sdk-s3\": \"3.378.0\",\n  \"@aws-sdk/middleware-signing\": \"3.378.0\",\n  \"@aws-sdk/middleware-ssec\": \"3.378.0\",\n  \"@aws-sdk/middleware-user-agent\": \"3.378.0\",\n  \"@aws-sdk/signature-v4-multi-region\": \"3.378.0\",\n  \"@aws-sdk/types\": \"3.378.0\",\n  \"@aws-sdk/util-endpoints\": \"3.378.0\",\n  \"@aws-sdk/util-user-agent-browser\": \"3.378.0\",\n  \"@aws-sdk/util-user-agent-node\": \"3.378.0\",\n  \"@aws-sdk/xml-builder\": \"3.310.0\",\n  \"@smithy/config-resolver\": \"^2.0.1\",\n  \"@smithy/eventstream-serde-browser\": \"^2.0.1\",\n  \"@smithy/eventstream-serde-config-resolver\": \"^2.0.1\",\n  \"@smithy/eventstream-serde-node\": \"^2.0.1\",\n  \"@smithy/fetch-http-handler\": \"^2.0.1\",\n  \"@smithy/hash-blob-browser\": \"^2.0.1\",\n  \"@smithy/hash-node\": \"^2.0.1\",\n  \"@smithy/hash-stream-node\": \"^2.0.1\",\n  \"@smithy/invalid-dependency\": \"^2.0.1\",\n  \"@smithy/md5-js\": \"^2.0.1\",\n  \"@smithy/middleware-content-length\": \"^2.0.1\",\n  \"@smithy/middleware-endpoint\": \"^2.0.1\",\n  \"@smithy/middleware-retry\": \"^2.0.1\",\n  \"@smithy/middleware-serde\": \"^2.0.1\",\n  \"@smithy/middleware-stack\": \"^2.0.0\",\n  \"@smithy/node-config-provider\": \"^2.0.1\",\n  \"@smithy/node-http-handler\": \"^2.0.1\",\n  \"@smithy/protocol-http\": \"^2.0.1\",\n  \"@smithy/smithy-client\": \"^2.0.1\",\n  \"@smithy/types\": \"^2.0.2\",\n  \"@smithy/url-parser\": \"^2.0.1\",\n  \"@smithy/util-base64\": \"^2.0.0\",\n  \"@smithy/util-body-length-browser\": \"^2.0.0\",\n  \"@smithy/util-body-length-node\": \"^2.0.0\",\n  \"@smithy/util-defaults-mode-browser\": \"^2.0.1\",\n  \"@smithy/util-defaults-mode-node\": \"^2.0.1\",\n  \"@smithy/util-retry\": \"^2.0.0\",\n  \"@smithy/util-stream\": \"^2.0.1\",\n  \"@smithy/util-utf8\": \"^2.0.0\",\n  \"@smithy/util-waiter\": \"^2.0.1\",\n  \"fast-xml-parser\": \"4.2.5\",\n  tslib: \"^2.5.0\"\n};\nconst devDependencies = {\n  \"@smithy/service-client-documentation-generator\": \"^2.0.0\",\n  \"@tsconfig/node14\": \"1.0.3\",\n  \"@types/chai\": \"^4.2.11\",\n  \"@types/mocha\": \"^8.0.4\",\n  \"@types/node\": \"^14.14.31\",\n  concurrently: \"7.0.0\",\n  \"downlevel-dts\": \"0.10.1\",\n  rimraf: \"3.0.2\",\n  typedoc: \"0.23.23\",\n  typescript: \"~4.9.5\"\n};\nconst engines = {\n  node: \">=14.0.0\"\n};\nconst typesVersions = {\n  \"<4.0\": {\n    \"dist-types/*\": [\n      \"dist-types/ts3.4/*\"\n    ]\n  }\n};\nconst files = [\n  \"dist-*/**\"\n];\nconst author = {\n  name: \"AWS SDK for JavaScript Team\",\n  url: \"https://aws.amazon.com/javascript/\"\n};\nconst license = \"Apache-2.0\";\nconst browser = {\n  \"./dist-es/runtimeConfig\": \"./dist-es/runtimeConfig.browser\"\n};\nconst homepage = \"https://github.com/aws/aws-sdk-js-v3/tree/main/clients/client-s3\";\nconst repository = {\n  type: \"git\",\n  url: \"https://github.com/aws/aws-sdk-js-v3.git\",\n  directory: \"clients/client-s3\"\n};\nvar packageInfo = {\n  name: name,\n  description: description,\n  version: version,\n  scripts: scripts,\n  main: main,\n  types: types,\n  module: module,\n  sideEffects: sideEffects,\n  dependencies: dependencies,\n  devDependencies: devDependencies,\n  engines: engines,\n  typesVersions: typesVersions,\n  files: files,\n  author: author,\n  license: license,\n  browser: browser,\n  \"react-native\": {\n  \"./dist-es/runtimeConfig\": \"./dist-es/runtimeConfig.native\"\n},\n  homepage: homepage,\n  repository: repository\n};\n\n/*! *****************************************************************************\r\nCopyright (c) Microsoft Corporation.\r\n\r\nPermission to use, copy, modify, and/or distribute this software for any\r\npurpose with or without fee is hereby granted.\r\n\r\nTHE SOFTWARE IS PROVIDED \"AS IS\" AND THE AUTHOR DISCLAIMS ALL WARRANTIES WITH\r\nREGARD TO THIS SOFTWARE INCLUDING ALL IMPLIED WARRANTIES OF MERCHANTABILITY\r\nAND FITNESS. IN NO EVENT SHALL THE AUTHOR BE LIABLE FOR ANY SPECIAL, DIRECT,\r\nINDIRECT, OR CONSEQUENTIAL DAMAGES OR ANY DAMAGES WHATSOEVER RESULTING FROM\r\nLOSS OF USE, DATA OR PROFITS, WHETHER IN AN ACTION OF CONTRACT, NEGLIGENCE OR\r\nOTHER TORTIOUS ACTION, ARISING OUT OF OR IN CONNECTION WITH THE USE OR\r\nPERFORMANCE OF THIS SOFTWARE.\r\n***************************************************************************** */\r\n/* global Reflect, Promise */\r\n\r\nvar extendStatics = function(d, b) {\r\n    extendStatics = Object.setPrototypeOf ||\r\n        ({ __proto__: [] } instanceof Array && function (d, b) { d.__proto__ = b; }) ||\r\n        function (d, b) { for (var p in b) if (b.hasOwnProperty(p)) d[p] = b[p]; };\r\n    return extendStatics(d, b);\r\n};\r\n\r\nfunction __extends(d, b) {\r\n    extendStatics(d, b);\r\n    function __() { this.constructor = d; }\r\n    d.prototype = b === null ? Object.create(b) : (__.prototype = b.prototype, new __());\r\n}\r\n\r\nvar __assign = function() {\r\n    __assign = Object.assign || function __assign(t) {\r\n        for (var s, i = 1, n = arguments.length; i < n; i++) {\r\n            s = arguments[i];\r\n            for (var p in s) if (Object.prototype.hasOwnProperty.call(s, p)) t[p] = s[p];\r\n        }\r\n        return t;\r\n    };\r\n    return __assign.apply(this, arguments);\r\n};\r\n\r\nfunction __rest(s, e) {\r\n    var t = {};\r\n    for (var p in s) if (Object.prototype.hasOwnProperty.call(s, p) && e.indexOf(p) < 0)\r\n        t[p] = s[p];\r\n    if (s != null && typeof Object.getOwnPropertySymbols === \"function\")\r\n        for (var i = 0, p = Object.getOwnPropertySymbols(s); i < p.length; i++) {\r\n            if (e.indexOf(p[i]) < 0 && Object.prototype.propertyIsEnumerable.call(s, p[i]))\r\n                t[p[i]] = s[p[i]];\r\n        }\r\n    return t;\r\n}\r\n\r\nfunction __decorate(decorators, target, key, desc) {\r\n    var c = arguments.length, r = c < 3 ? target : desc === null ? desc = Object.getOwnPropertyDescriptor(target, key) : desc, d;\r\n    if (typeof Reflect === \"object\" && typeof Reflect.decorate === \"function\") r = Reflect.decorate(decorators, target, key, desc);\r\n    else for (var i = decorators.length - 1; i >= 0; i--) if (d = decorators[i]) r = (c < 3 ? d(r) : c > 3 ? d(target, key, r) : d(target, key)) || r;\r\n    return c > 3 && r && Object.defineProperty(target, key, r), r;\r\n}\r\n\r\nfunction __param(paramIndex, decorator) {\r\n    return function (target, key) { decorator(target, key, paramIndex); }\r\n}\r\n\r\nfunction __metadata(metadataKey, metadataValue) {\r\n    if (typeof Reflect === \"object\" && typeof Reflect.metadata === \"function\") return Reflect.metadata(metadataKey, metadataValue);\r\n}\r\n\r\nfunction __awaiter(thisArg, _arguments, P, generator) {\r\n    function adopt(value) { return value instanceof P ? value : new P(function (resolve) { resolve(value); }); }\r\n    return new (P || (P = Promise))(function (resolve, reject) {\r\n        function fulfilled(value) { try { step(generator.next(value)); } catch (e) { reject(e); } }\r\n        function rejected(value) { try { step(generator[\"throw\"](value)); } catch (e) { reject(e); } }\r\n        function step(result) { result.done ? resolve(result.value) : adopt(result.value).then(fulfilled, rejected); }\r\n        step((generator = generator.apply(thisArg, _arguments || [])).next());\r\n    });\r\n}\r\n\r\nfunction __generator(thisArg, body) {\r\n    var _ = { label: 0, sent: function() { if (t[0] & 1) throw t[1]; return t[1]; }, trys: [], ops: [] }, f, y, t, g;\r\n    return g = { next: verb(0), \"throw\": verb(1), \"return\": verb(2) }, typeof Symbol === \"function\" && (g[Symbol.iterator] = function() { return this; }), g;\r\n    function verb(n) { return function (v) { return step([n, v]); }; }\r\n    function step(op) {\r\n        if (f) throw new TypeError(\"Generator is already executing.\");\r\n        while (_) try {\r\n            if (f = 1, y && (t = op[0] & 2 ? y[\"return\"] : op[0] ? y[\"throw\"] || ((t = y[\"return\"]) && t.call(y), 0) : y.next) && !(t = t.call(y, op[1])).done) return t;\r\n            if (y = 0, t) op = [op[0] & 2, t.value];\r\n            switch (op[0]) {\r\n                case 0: case 1: t = op; break;\r\n                case 4: _.label++; return { value: op[1], done: false };\r\n                case 5: _.label++; y = op[1]; op = [0]; continue;\r\n                case 7: op = _.ops.pop(); _.trys.pop(); continue;\r\n                default:\r\n                    if (!(t = _.trys, t = t.length > 0 && t[t.length - 1]) && (op[0] === 6 || op[0] === 2)) { _ = 0; continue; }\r\n                    if (op[0] === 3 && (!t || (op[1] > t[0] && op[1] < t[3]))) { _.label = op[1]; break; }\r\n                    if (op[0] === 6 && _.label < t[1]) { _.label = t[1]; t = op; break; }\r\n                    if (t && _.label < t[2]) { _.label = t[2]; _.ops.push(op); break; }\r\n                    if (t[2]) _.ops.pop();\r\n                    _.trys.pop(); continue;\r\n            }\r\n            op = body.call(thisArg, _);\r\n        } catch (e) { op = [6, e]; y = 0; } finally { f = t = 0; }\r\n        if (op[0] & 5) throw op[1]; return { value: op[0] ? op[1] : void 0, done: true };\r\n    }\r\n}\r\n\r\nfunction __createBinding(o, m, k, k2) {\r\n    if (k2 === undefined) k2 = k;\r\n    o[k2] = m[k];\r\n}\r\n\r\nfunction __exportStar(m, exports) {\r\n    for (var p in m) if (p !== \"default\" && !exports.hasOwnProperty(p)) exports[p] = m[p];\r\n}\r\n\r\nfunction __values(o) {\r\n    var s = typeof Symbol === \"function\" && Symbol.iterator, m = s && o[s], i = 0;\r\n    if (m) return m.call(o);\r\n    if (o && typeof o.length === \"number\") return {\r\n        next: function () {\r\n            if (o && i >= o.length) o = void 0;\r\n            return { value: o && o[i++], done: !o };\r\n        }\r\n    };\r\n    throw new TypeError(s ? \"Object is not iterable.\" : \"Symbol.iterator is not defined.\");\r\n}\r\n\r\nfunction __read(o, n) {\r\n    var m = typeof Symbol === \"function\" && o[Symbol.iterator];\r\n    if (!m) return o;\r\n    var i = m.call(o), r, ar = [], e;\r\n    try {\r\n        while ((n === void 0 || n-- > 0) && !(r = i.next()).done) ar.push(r.value);\r\n    }\r\n    catch (error) { e = { error: error }; }\r\n    finally {\r\n        try {\r\n            if (r && !r.done && (m = i[\"return\"])) m.call(i);\r\n        }\r\n        finally { if (e) throw e.error; }\r\n    }\r\n    return ar;\r\n}\r\n\r\nfunction __spread() {\r\n    for (var ar = [], i = 0; i < arguments.length; i++)\r\n        ar = ar.concat(__read(arguments[i]));\r\n    return ar;\r\n}\r\n\r\nfunction __spreadArrays() {\r\n    for (var s = 0, i = 0, il = arguments.length; i < il; i++) s += arguments[i].length;\r\n    for (var r = Array(s), k = 0, i = 0; i < il; i++)\r\n        for (var a = arguments[i], j = 0, jl = a.length; j < jl; j++, k++)\r\n            r[k] = a[j];\r\n    return r;\r\n}\r\nfunction __await(v) {\r\n    return this instanceof __await ? (this.v = v, this) : new __await(v);\r\n}\r\n\r\nfunction __asyncGenerator(thisArg, _arguments, generator) {\r\n    if (!Symbol.asyncIterator) throw new TypeError(\"Symbol.asyncIterator is not defined.\");\r\n    var g = generator.apply(thisArg, _arguments || []), i, q = [];\r\n    return i = {}, verb(\"next\"), verb(\"throw\"), verb(\"return\"), i[Symbol.asyncIterator] = function () { return this; }, i;\r\n    function verb(n) { if (g[n]) i[n] = function (v) { return new Promise(function (a, b) { q.push([n, v, a, b]) > 1 || resume(n, v); }); }; }\r\n    function resume(n, v) { try { step(g[n](v)); } catch (e) { settle(q[0][3], e); } }\r\n    function step(r) { r.value instanceof __await ? Promise.resolve(r.value.v).then(fulfill, reject) : settle(q[0][2], r); }\r\n    function fulfill(value) { resume(\"next\", value); }\r\n    function reject(value) { resume(\"throw\", value); }\r\n    function settle(f, v) { if (f(v), q.shift(), q.length) resume(q[0][0], q[0][1]); }\r\n}\r\n\r\nfunction __asyncDelegator(o) {\r\n    var i, p;\r\n    return i = {}, verb(\"next\"), verb(\"throw\", function (e) { throw e; }), verb(\"return\"), i[Symbol.iterator] = function () { return this; }, i;\r\n    function verb(n, f) { i[n] = o[n] ? function (v) { return (p = !p) ? { value: __await(o[n](v)), done: n === \"return\" } : f ? f(v) : v; } : f; }\r\n}\r\n\r\nfunction __asyncValues(o) {\r\n    if (!Symbol.asyncIterator) throw new TypeError(\"Symbol.asyncIterator is not defined.\");\r\n    var m = o[Symbol.asyncIterator], i;\r\n    return m ? m.call(o) : (o = typeof __values === \"function\" ? __values(o) : o[Symbol.iterator](), i = {}, verb(\"next\"), verb(\"throw\"), verb(\"return\"), i[Symbol.asyncIterator] = function () { return this; }, i);\r\n    function verb(n) { i[n] = o[n] && function (v) { return new Promise(function (resolve, reject) { v = o[n](v), settle(resolve, reject, v.done, v.value); }); }; }\r\n    function settle(resolve, reject, d, v) { Promise.resolve(v).then(function(v) { resolve({ value: v, done: d }); }, reject); }\r\n}\r\n\r\nfunction __makeTemplateObject(cooked, raw) {\r\n    if (Object.defineProperty) { Object.defineProperty(cooked, \"raw\", { value: raw }); } else { cooked.raw = raw; }\r\n    return cooked;\r\n}\r\nfunction __importStar(mod) {\r\n    if (mod && mod.__esModule) return mod;\r\n    var result = {};\r\n    if (mod != null) for (var k in mod) if (Object.hasOwnProperty.call(mod, k)) result[k] = mod[k];\r\n    result.default = mod;\r\n    return result;\r\n}\r\n\r\nfunction __importDefault(mod) {\r\n    return (mod && mod.__esModule) ? mod : { default: mod };\r\n}\r\n\r\nfunction __classPrivateFieldGet(receiver, privateMap) {\r\n    if (!privateMap.has(receiver)) {\r\n        throw new TypeError(\"attempted to get private field on non-instance\");\r\n    }\r\n    return privateMap.get(receiver);\r\n}\r\n\r\nfunction __classPrivateFieldSet(receiver, privateMap, value) {\r\n    if (!privateMap.has(receiver)) {\r\n        throw new TypeError(\"attempted to set private field on non-instance\");\r\n    }\r\n    privateMap.set(receiver, value);\r\n    return value;\r\n}\n\nvar tslib_es6 = /*#__PURE__*/Object.freeze({\n    __proto__: null,\n    __extends: __extends,\n    get __assign () { return __assign; },\n    __rest: __rest,\n    __decorate: __decorate,\n    __param: __param,\n    __metadata: __metadata,\n    __awaiter: __awaiter,\n    __generator: __generator,\n    __createBinding: __createBinding,\n    __exportStar: __exportStar,\n    __values: __values,\n    __read: __read,\n    __spread: __spread,\n    __spreadArrays: __spreadArrays,\n    __await: __await,\n    __asyncGenerator: __asyncGenerator,\n    __asyncDelegator: __asyncDelegator,\n    __asyncValues: __asyncValues,\n    __makeTemplateObject: __makeTemplateObject,\n    __importStar: __importStar,\n    __importDefault: __importDefault,\n    __classPrivateFieldGet: __classPrivateFieldGet,\n    __classPrivateFieldSet: __classPrivateFieldSet\n});\n\nvar isEmptyData_1 = createCommonjsModule(function (module, exports) {\nObject.defineProperty(exports, \"__esModule\", { value: true });\nexports.isEmptyData = void 0;\nfunction isEmptyData(data) {\n    if (typeof data === \"string\") {\n        return data.length === 0;\n    }\n    return data.byteLength === 0;\n}\nexports.isEmptyData = isEmptyData;\n\n});\n\nvar constants = createCommonjsModule(function (module, exports) {\nObject.defineProperty(exports, \"__esModule\", { value: true });\nexports.EMPTY_DATA_SHA_1 = exports.SHA_1_HMAC_ALGO = exports.SHA_1_HASH = void 0;\nexports.SHA_1_HASH = { name: \"SHA-1\" };\nexports.SHA_1_HMAC_ALGO = {\n    name: \"HMAC\",\n    hash: exports.SHA_1_HASH,\n};\nexports.EMPTY_DATA_SHA_1 = new Uint8Array([\n    218,\n    57,\n    163,\n    238,\n    94,\n    107,\n    75,\n    13,\n    50,\n    85,\n    191,\n    239,\n    149,\n    96,\n    24,\n    144,\n    175,\n    216,\n    7,\n    9,\n]);\n\n});\n\nvar ie11Sha1 = createCommonjsModule(function (module, exports) {\nObject.defineProperty(exports, \"__esModule\", { value: true });\nexports.Sha1 = void 0;\n\n\n\n\nvar Sha1 = /** @class */ (function () {\n    function Sha1(secret) {\n        this.secret = secret;\n        this.reset();\n    }\n    Sha1.prototype.update = function (toHash) {\n        var _this = this;\n        if ((0, isEmptyData_1.isEmptyData)(toHash)) {\n            return;\n        }\n        this.operation = this.operation.then(function (operation) {\n            operation.onerror = function () {\n                _this.operation = Promise.reject(new Error(\"Error encountered updating hash\"));\n            };\n            operation.process(toArrayBufferView(toHash));\n            return operation;\n        });\n        this.operation.catch(function () { });\n    };\n    Sha1.prototype.digest = function () {\n        return this.operation.then(function (operation) {\n            return new Promise(function (resolve, reject) {\n                operation.onerror = function () {\n                    reject(new Error(\"Error encountered finalizing hash\"));\n                };\n                operation.oncomplete = function () {\n                    if (operation.result) {\n                        resolve(new Uint8Array(operation.result));\n                    }\n                    reject(new Error(\"Error encountered finalizing hash\"));\n                };\n                operation.finish();\n            });\n        });\n    };\n    Sha1.prototype.reset = function () {\n        if (this.secret) {\n            this.operation = getKeyPromise(this.secret).then(function (keyData) {\n                return (0, distEs.locateWindow)().msCrypto.subtle.sign(constants.SHA_1_HMAC_ALGO, keyData);\n            });\n            this.operation.catch(function () { });\n        }\n        else {\n            this.operation = Promise.resolve((0, distEs.locateWindow)().msCrypto.subtle.digest(\"SHA-1\"));\n        }\n    };\n    return Sha1;\n}());\nexports.Sha1 = Sha1;\nfunction getKeyPromise(secret) {\n    return new Promise(function (resolve, reject) {\n        var keyOperation = (0, distEs.locateWindow)().msCrypto.subtle.importKey(\"raw\", toArrayBufferView(secret), constants.SHA_1_HMAC_ALGO, false, [\"sign\"]);\n        keyOperation.oncomplete = function () {\n            if (keyOperation.result) {\n                resolve(keyOperation.result);\n            }\n            reject(new Error(\"ImportKey completed without importing key.\"));\n        };\n        keyOperation.onerror = function () {\n            reject(new Error(\"ImportKey failed to import key.\"));\n        };\n    });\n}\nfunction toArrayBufferView(data) {\n    if (typeof data === \"string\") {\n        return (0, distEs$1.fromUtf8)(data);\n    }\n    if (ArrayBuffer.isView(data)) {\n        return new Uint8Array(data.buffer, data.byteOffset, data.byteLength / Uint8Array.BYTES_PER_ELEMENT);\n    }\n    return new Uint8Array(data);\n}\n\n});\n\nvar webCryptoSha1 = createCommonjsModule(function (module, exports) {\nObject.defineProperty(exports, \"__esModule\", { value: true });\nexports.Sha1 = void 0;\n\n\n\n\nvar Sha1 = /** @class */ (function () {\n    function Sha1(secret) {\n        this.toHash = new Uint8Array(0);\n        if (secret !== void 0) {\n            this.key = new Promise(function (resolve, reject) {\n                (0, distEs.locateWindow)()\n                    .crypto.subtle.importKey(\"raw\", convertToBuffer(secret), constants.SHA_1_HMAC_ALGO, false, [\"sign\"])\n                    .then(resolve, reject);\n            });\n            this.key.catch(function () { });\n        }\n    }\n    Sha1.prototype.update = function (data) {\n        if ((0, isEmptyData_1.isEmptyData)(data)) {\n            return;\n        }\n        var update = convertToBuffer(data);\n        var typedArray = new Uint8Array(this.toHash.byteLength + update.byteLength);\n        typedArray.set(this.toHash, 0);\n        typedArray.set(update, this.toHash.byteLength);\n        this.toHash = typedArray;\n    };\n    Sha1.prototype.digest = function () {\n        var _this = this;\n        if (this.key) {\n            return this.key.then(function (key) {\n                return (0, distEs.locateWindow)()\n                    .crypto.subtle.sign(constants.SHA_1_HMAC_ALGO, key, _this.toHash)\n                    .then(function (data) { return new Uint8Array(data); });\n            });\n        }\n        if ((0, isEmptyData_1.isEmptyData)(this.toHash)) {\n            return Promise.resolve(constants.EMPTY_DATA_SHA_1);\n        }\n        return Promise.resolve()\n            .then(function () { return (0, distEs.locateWindow)().crypto.subtle.digest(constants.SHA_1_HASH, _this.toHash); })\n            .then(function (data) { return Promise.resolve(new Uint8Array(data)); });\n    };\n    Sha1.prototype.reset = function () {\n        this.toHash = new Uint8Array(0);\n    };\n    return Sha1;\n}());\nexports.Sha1 = Sha1;\nfunction convertToBuffer(data) {\n    if (typeof data === \"string\") {\n        return (0, distEs$1.fromUtf8)(data);\n    }\n    if (ArrayBuffer.isView(data)) {\n        return new Uint8Array(data.buffer, data.byteOffset, data.byteLength / Uint8Array.BYTES_PER_ELEMENT);\n    }\n    return new Uint8Array(data);\n}\n\n});\n\nvar crossPlatformSha1 = createCommonjsModule(function (module, exports) {\nObject.defineProperty(exports, \"__esModule\", { value: true });\nexports.Sha1 = void 0;\n\n\n\n\n\n\nvar Sha1 = /** @class */ (function () {\n    function Sha1(secret) {\n        if ((0, build$4.supportsWebCrypto)((0, distEs.locateWindow)())) {\n            this.hash = new webCryptoSha1.Sha1(secret);\n        }\n        else if ((0, build$5.isMsWindow)((0, distEs.locateWindow)())) {\n            this.hash = new ie11Sha1.Sha1(secret);\n        }\n        else {\n            throw new Error(\"SHA1 not supported\");\n        }\n    }\n    Sha1.prototype.update = function (data, encoding) {\n        this.hash.update((0, build$3.convertToBuffer)(data));\n    };\n    Sha1.prototype.digest = function () {\n        return this.hash.digest();\n    };\n    Sha1.prototype.reset = function () {\n        this.hash.reset();\n    };\n    return Sha1;\n}());\nexports.Sha1 = Sha1;\n\n});\n\nvar build = createCommonjsModule(function (module, exports) {\nObject.defineProperty(exports, \"__esModule\", { value: true });\nexports.WebCryptoSha1 = exports.Ie11Sha1 = void 0;\n\ntslib_es6.__exportStar(crossPlatformSha1, exports);\n\nObject.defineProperty(exports, \"Ie11Sha1\", { enumerable: true, get: function () { return ie11Sha1.Sha1; } });\n\nObject.defineProperty(exports, \"WebCryptoSha1\", { enumerable: true, get: function () { return webCryptoSha1.Sha1; } });\n\n});\n\nfunction getChunkedStream(source) {\n    let currentMessageTotalLength = 0;\n    let currentMessagePendingLength = 0;\n    let currentMessage = null;\n    let messageLengthBuffer = null;\n    const allocateMessage = (size) => {\n        if (typeof size !== \"number\") {\n            throw new Error(\"Attempted to allocate an event message where size was not a number: \" + size);\n        }\n        currentMessageTotalLength = size;\n        currentMessagePendingLength = 4;\n        currentMessage = new Uint8Array(size);\n        const currentMessageView = new DataView(currentMessage.buffer);\n        currentMessageView.setUint32(0, size, false);\n    };\n    const iterator = async function* () {\n        const sourceIterator = source[Symbol.asyncIterator]();\n        while (true) {\n            const { value, done } = await sourceIterator.next();\n            if (done) {\n                if (!currentMessageTotalLength) {\n                    return;\n                }\n                else if (currentMessageTotalLength === currentMessagePendingLength) {\n                    yield currentMessage;\n                }\n                else {\n                    throw new Error(\"Truncated event message received.\");\n                }\n                return;\n            }\n            const chunkLength = value.length;\n            let currentOffset = 0;\n            while (currentOffset < chunkLength) {\n                if (!currentMessage) {\n                    const bytesRemaining = chunkLength - currentOffset;\n                    if (!messageLengthBuffer) {\n                        messageLengthBuffer = new Uint8Array(4);\n                    }\n                    const numBytesForTotal = Math.min(4 - currentMessagePendingLength, bytesRemaining);\n                    messageLengthBuffer.set(value.slice(currentOffset, currentOffset + numBytesForTotal), currentMessagePendingLength);\n                    currentMessagePendingLength += numBytesForTotal;\n                    currentOffset += numBytesForTotal;\n                    if (currentMessagePendingLength < 4) {\n                        break;\n                    }\n                    allocateMessage(new DataView(messageLengthBuffer.buffer).getUint32(0, false));\n                    messageLengthBuffer = null;\n                }\n                const numBytesToWrite = Math.min(currentMessageTotalLength - currentMessagePendingLength, chunkLength - currentOffset);\n                currentMessage.set(value.slice(currentOffset, currentOffset + numBytesToWrite), currentMessagePendingLength);\n                currentMessagePendingLength += numBytesToWrite;\n                currentOffset += numBytesToWrite;\n                if (currentMessageTotalLength && currentMessageTotalLength === currentMessagePendingLength) {\n                    yield currentMessage;\n                    currentMessage = null;\n                    currentMessageTotalLength = 0;\n                    currentMessagePendingLength = 0;\n                }\n            }\n        }\n    };\n    return {\n        [Symbol.asyncIterator]: iterator,\n    };\n}\n\nfunction getMessageUnmarshaller(deserializer, toUtf8) {\n    return async function (message) {\n        const { value: messageType } = message.headers[\":message-type\"];\n        if (messageType === \"error\") {\n            const unmodeledError = new Error(message.headers[\":error-message\"].value || \"UnknownError\");\n            unmodeledError.name = message.headers[\":error-code\"].value;\n            throw unmodeledError;\n        }\n        else if (messageType === \"exception\") {\n            const code = message.headers[\":exception-type\"].value;\n            const exception = { [code]: message };\n            const deserializedException = await deserializer(exception);\n            if (deserializedException.$unknown) {\n                const error = new Error(toUtf8(message.body));\n                error.name = code;\n                throw error;\n            }\n            throw deserializedException[code];\n        }\n        else if (messageType === \"event\") {\n            const event = {\n                [message.headers[\":event-type\"].value]: message,\n            };\n            const deserialized = await deserializer(event);\n            if (deserialized.$unknown)\n                return;\n            return deserialized;\n        }\n        else {\n            throw Error(`Unrecognizable event type: ${message.headers[\":event-type\"].value}`);\n        }\n    };\n}\n\nclass EventStreamMarshaller {\n    constructor({ utf8Encoder, utf8Decoder }) {\n        this.eventStreamCodec = new EventStreamCodec(utf8Encoder, utf8Decoder);\n        this.utfEncoder = utf8Encoder;\n    }\n    deserialize(body, deserializer) {\n        const inputStream = getChunkedStream(body);\n        return new SmithyMessageDecoderStream({\n            messageStream: new MessageDecoderStream({ inputStream, decoder: this.eventStreamCodec }),\n            deserializer: getMessageUnmarshaller(deserializer, this.utfEncoder),\n        });\n    }\n    serialize(inputStream, serializer) {\n        return new MessageEncoderStream({\n            messageStream: new SmithyMessageEncoderStream({ inputStream, serializer }),\n            encoder: this.eventStreamCodec,\n            includeEndFrame: true,\n        });\n    }\n}\n\nconst readableStreamtoIterable = (readableStream) => ({\n    [Symbol.asyncIterator]: async function* () {\n        const reader = readableStream.getReader();\n        try {\n            while (true) {\n                const { done, value } = await reader.read();\n                if (done)\n                    return;\n                yield value;\n            }\n        }\n        finally {\n            reader.releaseLock();\n        }\n    },\n});\nconst iterableToReadableStream = (asyncIterable) => {\n    const iterator = asyncIterable[Symbol.asyncIterator]();\n    return new ReadableStream({\n        async pull(controller) {\n            const { done, value } = await iterator.next();\n            if (done) {\n                return controller.close();\n            }\n            controller.enqueue(value);\n        },\n    });\n};\n\nclass EventStreamMarshaller$1 {\n    constructor({ utf8Encoder, utf8Decoder }) {\n        this.universalMarshaller = new EventStreamMarshaller({\n            utf8Decoder,\n            utf8Encoder,\n        });\n    }\n    deserialize(body, deserializer) {\n        const bodyIterable = isReadableStream(body) ? readableStreamtoIterable(body) : body;\n        return this.universalMarshaller.deserialize(bodyIterable, deserializer);\n    }\n    serialize(input, serializer) {\n        const serialziedIterable = this.universalMarshaller.serialize(input, serializer);\n        return typeof ReadableStream === \"function\" ? iterableToReadableStream(serialziedIterable) : serialziedIterable;\n    }\n}\nconst isReadableStream = (body) => typeof ReadableStream === \"function\" && body instanceof ReadableStream;\n\nconst eventStreamSerdeProvider = (options) => new EventStreamMarshaller$1(options);\n\nfunction blobReader(blob, onChunk, chunkSize = 1024 * 1024) {\n    return new Promise((resolve, reject) => {\n        const fileReader = new FileReader();\n        fileReader.addEventListener(\"error\", reject);\n        fileReader.addEventListener(\"abort\", reject);\n        const size = blob.size;\n        let totalBytesRead = 0;\n        function read() {\n            if (totalBytesRead >= size) {\n                resolve();\n                return;\n            }\n            fileReader.readAsArrayBuffer(blob.slice(totalBytesRead, Math.min(size, totalBytesRead + chunkSize)));\n        }\n        fileReader.addEventListener(\"load\", (event) => {\n            const result = event.target.result;\n            onChunk(new Uint8Array(result));\n            totalBytesRead += result.byteLength;\n            read();\n        });\n        read();\n    });\n}\n\nconst blobHasher = async function blobHasher(hashCtor, blob) {\n    const hash = new hashCtor();\n    await blobReader(blob, (chunk) => {\n        hash.update(chunk);\n    });\n    return hash.digest();\n};\n\nconst BLOCK_SIZE = 64;\nconst DIGEST_LENGTH = 16;\nconst INIT = [0x67452301, 0xefcdab89, 0x98badcfe, 0x10325476];\n\nclass Md5 {\n    constructor() {\n        this.reset();\n    }\n    update(sourceData) {\n        if (isEmptyData(sourceData)) {\n            return;\n        }\n        else if (this.finished) {\n            throw new Error(\"Attempted to update an already finished hash.\");\n        }\n        const data = convertToBuffer(sourceData);\n        let position = 0;\n        let { byteLength } = data;\n        this.bytesHashed += byteLength;\n        while (byteLength > 0) {\n            this.buffer.setUint8(this.bufferLength++, data[position++]);\n            byteLength--;\n            if (this.bufferLength === BLOCK_SIZE) {\n                this.hashBuffer();\n                this.bufferLength = 0;\n            }\n        }\n    }\n    async digest() {\n        if (!this.finished) {\n            const { buffer, bufferLength: undecoratedLength, bytesHashed } = this;\n            const bitsHashed = bytesHashed * 8;\n            buffer.setUint8(this.bufferLength++, 0b10000000);\n            if (undecoratedLength % BLOCK_SIZE >= BLOCK_SIZE - 8) {\n                for (let i = this.bufferLength; i < BLOCK_SIZE; i++) {\n                    buffer.setUint8(i, 0);\n                }\n                this.hashBuffer();\n                this.bufferLength = 0;\n            }\n            for (let i = this.bufferLength; i < BLOCK_SIZE - 8; i++) {\n                buffer.setUint8(i, 0);\n            }\n            buffer.setUint32(BLOCK_SIZE - 8, bitsHashed >>> 0, true);\n            buffer.setUint32(BLOCK_SIZE - 4, Math.floor(bitsHashed / 0x100000000), true);\n            this.hashBuffer();\n            this.finished = true;\n        }\n        const out = new DataView(new ArrayBuffer(DIGEST_LENGTH));\n        for (let i = 0; i < 4; i++) {\n            out.setUint32(i * 4, this.state[i], true);\n        }\n        return new Uint8Array(out.buffer, out.byteOffset, out.byteLength);\n    }\n    hashBuffer() {\n        const { buffer, state } = this;\n        let a = state[0], b = state[1], c = state[2], d = state[3];\n        a = ff(a, b, c, d, buffer.getUint32(0, true), 7, 0xd76aa478);\n        d = ff(d, a, b, c, buffer.getUint32(4, true), 12, 0xe8c7b756);\n        c = ff(c, d, a, b, buffer.getUint32(8, true), 17, 0x242070db);\n        b = ff(b, c, d, a, buffer.getUint32(12, true), 22, 0xc1bdceee);\n        a = ff(a, b, c, d, buffer.getUint32(16, true), 7, 0xf57c0faf);\n        d = ff(d, a, b, c, buffer.getUint32(20, true), 12, 0x4787c62a);\n        c = ff(c, d, a, b, buffer.getUint32(24, true), 17, 0xa8304613);\n        b = ff(b, c, d, a, buffer.getUint32(28, true), 22, 0xfd469501);\n        a = ff(a, b, c, d, buffer.getUint32(32, true), 7, 0x698098d8);\n        d = ff(d, a, b, c, buffer.getUint32(36, true), 12, 0x8b44f7af);\n        c = ff(c, d, a, b, buffer.getUint32(40, true), 17, 0xffff5bb1);\n        b = ff(b, c, d, a, buffer.getUint32(44, true), 22, 0x895cd7be);\n        a = ff(a, b, c, d, buffer.getUint32(48, true), 7, 0x6b901122);\n        d = ff(d, a, b, c, buffer.getUint32(52, true), 12, 0xfd987193);\n        c = ff(c, d, a, b, buffer.getUint32(56, true), 17, 0xa679438e);\n        b = ff(b, c, d, a, buffer.getUint32(60, true), 22, 0x49b40821);\n        a = gg(a, b, c, d, buffer.getUint32(4, true), 5, 0xf61e2562);\n        d = gg(d, a, b, c, buffer.getUint32(24, true), 9, 0xc040b340);\n        c = gg(c, d, a, b, buffer.getUint32(44, true), 14, 0x265e5a51);\n        b = gg(b, c, d, a, buffer.getUint32(0, true), 20, 0xe9b6c7aa);\n        a = gg(a, b, c, d, buffer.getUint32(20, true), 5, 0xd62f105d);\n        d = gg(d, a, b, c, buffer.getUint32(40, true), 9, 0x02441453);\n        c = gg(c, d, a, b, buffer.getUint32(60, true), 14, 0xd8a1e681);\n        b = gg(b, c, d, a, buffer.getUint32(16, true), 20, 0xe7d3fbc8);\n        a = gg(a, b, c, d, buffer.getUint32(36, true), 5, 0x21e1cde6);\n        d = gg(d, a, b, c, buffer.getUint32(56, true), 9, 0xc33707d6);\n        c = gg(c, d, a, b, buffer.getUint32(12, true), 14, 0xf4d50d87);\n        b = gg(b, c, d, a, buffer.getUint32(32, true), 20, 0x455a14ed);\n        a = gg(a, b, c, d, buffer.getUint32(52, true), 5, 0xa9e3e905);\n        d = gg(d, a, b, c, buffer.getUint32(8, true), 9, 0xfcefa3f8);\n        c = gg(c, d, a, b, buffer.getUint32(28, true), 14, 0x676f02d9);\n        b = gg(b, c, d, a, buffer.getUint32(48, true), 20, 0x8d2a4c8a);\n        a = hh(a, b, c, d, buffer.getUint32(20, true), 4, 0xfffa3942);\n        d = hh(d, a, b, c, buffer.getUint32(32, true), 11, 0x8771f681);\n        c = hh(c, d, a, b, buffer.getUint32(44, true), 16, 0x6d9d6122);\n        b = hh(b, c, d, a, buffer.getUint32(56, true), 23, 0xfde5380c);\n        a = hh(a, b, c, d, buffer.getUint32(4, true), 4, 0xa4beea44);\n        d = hh(d, a, b, c, buffer.getUint32(16, true), 11, 0x4bdecfa9);\n        c = hh(c, d, a, b, buffer.getUint32(28, true), 16, 0xf6bb4b60);\n        b = hh(b, c, d, a, buffer.getUint32(40, true), 23, 0xbebfbc70);\n        a = hh(a, b, c, d, buffer.getUint32(52, true), 4, 0x289b7ec6);\n        d = hh(d, a, b, c, buffer.getUint32(0, true), 11, 0xeaa127fa);\n        c = hh(c, d, a, b, buffer.getUint32(12, true), 16, 0xd4ef3085);\n        b = hh(b, c, d, a, buffer.getUint32(24, true), 23, 0x04881d05);\n        a = hh(a, b, c, d, buffer.getUint32(36, true), 4, 0xd9d4d039);\n        d = hh(d, a, b, c, buffer.getUint32(48, true), 11, 0xe6db99e5);\n        c = hh(c, d, a, b, buffer.getUint32(60, true), 16, 0x1fa27cf8);\n        b = hh(b, c, d, a, buffer.getUint32(8, true), 23, 0xc4ac5665);\n        a = ii(a, b, c, d, buffer.getUint32(0, true), 6, 0xf4292244);\n        d = ii(d, a, b, c, buffer.getUint32(28, true), 10, 0x432aff97);\n        c = ii(c, d, a, b, buffer.getUint32(56, true), 15, 0xab9423a7);\n        b = ii(b, c, d, a, buffer.getUint32(20, true), 21, 0xfc93a039);\n        a = ii(a, b, c, d, buffer.getUint32(48, true), 6, 0x655b59c3);\n        d = ii(d, a, b, c, buffer.getUint32(12, true), 10, 0x8f0ccc92);\n        c = ii(c, d, a, b, buffer.getUint32(40, true), 15, 0xffeff47d);\n        b = ii(b, c, d, a, buffer.getUint32(4, true), 21, 0x85845dd1);\n        a = ii(a, b, c, d, buffer.getUint32(32, true), 6, 0x6fa87e4f);\n        d = ii(d, a, b, c, buffer.getUint32(60, true), 10, 0xfe2ce6e0);\n        c = ii(c, d, a, b, buffer.getUint32(24, true), 15, 0xa3014314);\n        b = ii(b, c, d, a, buffer.getUint32(52, true), 21, 0x4e0811a1);\n        a = ii(a, b, c, d, buffer.getUint32(16, true), 6, 0xf7537e82);\n        d = ii(d, a, b, c, buffer.getUint32(44, true), 10, 0xbd3af235);\n        c = ii(c, d, a, b, buffer.getUint32(8, true), 15, 0x2ad7d2bb);\n        b = ii(b, c, d, a, buffer.getUint32(36, true), 21, 0xeb86d391);\n        state[0] = (a + state[0]) & 0xffffffff;\n        state[1] = (b + state[1]) & 0xffffffff;\n        state[2] = (c + state[2]) & 0xffffffff;\n        state[3] = (d + state[3]) & 0xffffffff;\n    }\n    reset() {\n        this.state = Uint32Array.from(INIT);\n        this.buffer = new DataView(new ArrayBuffer(BLOCK_SIZE));\n        this.bufferLength = 0;\n        this.bytesHashed = 0;\n        this.finished = false;\n    }\n}\nfunction cmn(q, a, b, x, s, t) {\n    a = (((a + q) & 0xffffffff) + ((x + t) & 0xffffffff)) & 0xffffffff;\n    return (((a << s) | (a >>> (32 - s))) + b) & 0xffffffff;\n}\nfunction ff(a, b, c, d, x, s, t) {\n    return cmn((b & c) | (~b & d), a, b, x, s, t);\n}\nfunction gg(a, b, c, d, x, s, t) {\n    return cmn((b & d) | (c & ~d), a, b, x, s, t);\n}\nfunction hh(a, b, c, d, x, s, t) {\n    return cmn(b ^ c ^ d, a, b, x, s, t);\n}\nfunction ii(a, b, c, d, x, s, t) {\n    return cmn(c ^ (b | ~d), a, b, x, s, t);\n}\nfunction isEmptyData(data) {\n    if (typeof data === \"string\") {\n        return data.length === 0;\n    }\n    return data.byteLength === 0;\n}\nfunction convertToBuffer(data) {\n    if (typeof data === \"string\") {\n        return fromUtf8(data);\n    }\n    if (ArrayBuffer.isView(data)) {\n        return new Uint8Array(data.buffer, data.byteOffset, data.byteLength / Uint8Array.BYTES_PER_ELEMENT);\n    }\n    return new Uint8Array(data);\n}\n\nclass SignatureV4MultiRegion {\n    constructor(options) {\n        this.sigv4Signer = new SignatureV4(options);\n        this.signerOptions = options;\n    }\n    async sign(requestToSign, options = {}) {\n        if (options.signingRegion === \"*\") {\n            if (this.signerOptions.runtime !== \"node\")\n                throw new Error(\"This request requires signing with SigV4Asymmetric algorithm. It's only available in Node.js\");\n            return this.getSigv4aSigner().sign(requestToSign, options);\n        }\n        return this.sigv4Signer.sign(requestToSign, options);\n    }\n    async presign(originalRequest, options = {}) {\n        if (options.signingRegion === \"*\") {\n            if (this.signerOptions.runtime !== \"node\")\n                throw new Error(\"This request requires signing with SigV4Asymmetric algorithm. It's only available in Node.js\");\n            return this.getSigv4aSigner().presign(originalRequest, options);\n        }\n        return this.sigv4Signer.presign(originalRequest, options);\n    }\n    getSigv4aSigner() {\n        if (!this.sigv4aSigner) {\n            let CrtSignerV4;\n            try {\n                CrtSignerV4 = typeof require === \"function\" && require(\"@aws-sdk/signature-v4-crt\").CrtSignerV4;\n                if (typeof CrtSignerV4 !== \"function\")\n                    throw new Error();\n            }\n            catch (e) {\n                e.message =\n                    `${e.message}\\nPlease check if you have installed \"@aws-sdk/signature-v4-crt\" package explicitly. \\n` +\n                        \"For more information please go to \" +\n                        \"https://github.com/aws/aws-sdk-js-v3#functionality-requiring-aws-common-runtime-crt\";\n                throw e;\n            }\n            this.sigv4aSigner = new CrtSignerV4({\n                ...this.signerOptions,\n                signingAlgorithm: 1,\n            });\n        }\n        return this.sigv4aSigner;\n    }\n}\n\nconst bJ = \"required\", bK = \"type\", bL = \"conditions\", bM = \"fn\", bN = \"argv\", bO = \"ref\", bP = \"assign\", bQ = \"url\", bR = \"properties\", bS = \"authSchemes\", bT = \"disableDoubleEncoding\", bU = \"signingName\", bV = \"signingRegion\", bW = \"headers\";\nconst a = false, b = true, c = \"isSet\", d = \"tree\", e = \"booleanEquals\", f = \"error\", g = \"aws.partition\", h = \"stringEquals\", i = \"getAttr\", j = \"name\", k = \"substring\", l = \"hardwareType\", m = \"regionPrefix\", n = \"bucketAliasSuffix\", o = \"outpostId\", p = \"isValidHostLabel\", q = \"not\", r = \"parseURL\", s = \"s3-outposts\", t = \"endpoint\", u = \"aws.isVirtualHostableS3Bucket\", v = \"s3\", w = \"{url#scheme}://{url#authority}{url#normalizedPath}{Bucket}\", x = \"{url#scheme}://{Bucket}.{url#authority}{url#path}\", y = \"https://{Bucket}.s3-accelerate.{partitionResult#dnsSuffix}\", z = \"https://{Bucket}.s3.{partitionResult#dnsSuffix}\", A = \"aws.parseArn\", B = \"bucketArn\", C = \"arnType\", D = \"\", E = \"s3-object-lambda\", F = \"accesspoint\", G = \"accessPointName\", H = \"{url#scheme}://{accessPointName}-{bucketArn#accountId}.{url#authority}{url#path}\", I = \"mrapPartition\", J = \"outpostType\", K = \"arnPrefix\", L = \"{url#scheme}://{url#authority}{url#normalizedPath}{uri_encoded_bucket}\", M = \"https://s3.{partitionResult#dnsSuffix}/{uri_encoded_bucket}\", N = \"{url#scheme}://{url#authority}{url#path}\", O = \"https://s3.{partitionResult#dnsSuffix}\", P = { [bJ]: false, [bK]: \"String\" }, Q = { [bJ]: true, \"default\": false, [bK]: \"Boolean\" }, R = { [bJ]: false, [bK]: \"Boolean\" }, S = { [bM]: e, [bN]: [{ [bO]: \"Accelerate\" }, true] }, T = { [bM]: e, [bN]: [{ [bO]: \"UseFIPS\" }, true] }, U = { [bM]: e, [bN]: [{ [bO]: \"UseDualStack\" }, true] }, V = { [bM]: c, [bN]: [{ [bO]: \"Endpoint\" }] }, W = { [bM]: g, [bN]: [{ [bO]: \"Region\" }], [bP]: \"partitionResult\" }, X = { [bM]: h, [bN]: [{ [bM]: i, [bN]: [{ [bO]: \"partitionResult\" }, j] }, \"aws-cn\"] }, Y = { [bM]: c, [bN]: [{ [bO]: \"Bucket\" }] }, Z = { [bO]: \"Bucket\" }, aa = { [bO]: l }, ab = { [bL]: [{ [bM]: q, [bN]: [V] }], [f]: \"Expected a endpoint to be specified but no endpoint was found\", [bK]: f }, ac = { [bM]: q, [bN]: [V] }, ad = { [bM]: r, [bN]: [{ [bO]: \"Endpoint\" }], [bP]: \"url\" }, ae = { [bS]: [{ [bT]: true, [j]: \"sigv4\", [bU]: s, [bV]: \"{Region}\" }] }, af = {}, ag = { [bM]: e, [bN]: [{ [bO]: \"ForcePathStyle\" }, false] }, ah = { [bO]: \"ForcePathStyle\" }, ai = { [bM]: e, [bN]: [{ [bO]: \"Accelerate\" }, false] }, aj = { [bM]: h, [bN]: [{ [bO]: \"Region\" }, \"aws-global\"] }, ak = { [bS]: [{ [bT]: true, [j]: \"sigv4\", [bU]: v, [bV]: \"us-east-1\" }] }, al = { [bM]: q, [bN]: [aj] }, am = { [bM]: e, [bN]: [{ [bO]: \"UseGlobalEndpoint\" }, true] }, an = { [bQ]: \"https://{Bucket}.s3-fips.dualstack.{Region}.{partitionResult#dnsSuffix}\", [bR]: { [bS]: [{ [bT]: true, [j]: \"sigv4\", [bU]: v, [bV]: \"{Region}\" }] }, [bW]: {} }, ao = { [bS]: [{ [bT]: true, [j]: \"sigv4\", [bU]: v, [bV]: \"{Region}\" }] }, ap = { [bM]: e, [bN]: [{ [bO]: \"UseGlobalEndpoint\" }, false] }, aq = { [bM]: e, [bN]: [{ [bO]: \"UseDualStack\" }, false] }, ar = { [bQ]: \"https://{Bucket}.s3-fips.{Region}.{partitionResult#dnsSuffix}\", [bR]: ao, [bW]: {} }, as = { [bM]: e, [bN]: [{ [bO]: \"UseFIPS\" }, false] }, at = { [bQ]: \"https://{Bucket}.s3-accelerate.dualstack.{partitionResult#dnsSuffix}\", [bR]: ao, [bW]: {} }, au = { [bQ]: \"https://{Bucket}.s3.dualstack.{Region}.{partitionResult#dnsSuffix}\", [bR]: ao, [bW]: {} }, av = { [bM]: e, [bN]: [{ [bM]: i, [bN]: [{ [bO]: \"url\" }, \"isIp\"] }, true] }, aw = { [bO]: \"url\" }, ax = { [bM]: e, [bN]: [{ [bM]: i, [bN]: [aw, \"isIp\"] }, false] }, ay = { [bQ]: w, [bR]: ao, [bW]: {} }, az = { [bQ]: x, [bR]: ao, [bW]: {} }, aA = { [t]: az, [bK]: t }, aB = { [bQ]: y, [bR]: ao, [bW]: {} }, aC = { [bQ]: \"https://{Bucket}.s3.{Region}.{partitionResult#dnsSuffix}\", [bR]: ao, [bW]: {} }, aD = { [f]: \"Invalid region: region was not a valid DNS name.\", [bK]: f }, aE = { [bO]: B }, aF = { [bO]: C }, aG = { [bM]: i, [bN]: [aE, \"service\"] }, aH = { [bO]: G }, aI = { [bL]: [U], [f]: \"S3 Object Lambda does not support Dual-stack\", [bK]: f }, aJ = { [bL]: [S], [f]: \"S3 Object Lambda does not support S3 Accelerate\", [bK]: f }, aK = { [bL]: [{ [bM]: c, [bN]: [{ [bO]: \"DisableAccessPoints\" }] }, { [bM]: e, [bN]: [{ [bO]: \"DisableAccessPoints\" }, true] }], [f]: \"Access points are not supported for this operation\", [bK]: f }, aL = { [bL]: [{ [bM]: c, [bN]: [{ [bO]: \"UseArnRegion\" }] }, { [bM]: e, [bN]: [{ [bO]: \"UseArnRegion\" }, false] }, { [bM]: q, [bN]: [{ [bM]: h, [bN]: [{ [bM]: i, [bN]: [aE, \"region\"] }, \"{Region}\"] }] }], [f]: \"Invalid configuration: region from ARN `{bucketArn#region}` does not match client region `{Region}` and UseArnRegion is `false`\", [bK]: f }, aM = { [bM]: i, [bN]: [{ [bO]: \"bucketPartition\" }, j] }, aN = { [bM]: i, [bN]: [aE, \"accountId\"] }, aO = { [bS]: [{ [bT]: true, [j]: \"sigv4\", [bU]: E, [bV]: \"{bucketArn#region}\" }] }, aP = { [f]: \"Invalid ARN: The access point name may only contain a-z, A-Z, 0-9 and `-`. Found: `{accessPointName}`\", [bK]: f }, aQ = { [f]: \"Invalid ARN: The account id may only contain a-z, A-Z, 0-9 and `-`. Found: `{bucketArn#accountId}`\", [bK]: f }, aR = { [f]: \"Invalid region in ARN: `{bucketArn#region}` (invalid DNS name)\", [bK]: f }, aS = { [f]: \"Client was configured for partition `{partitionResult#name}` but ARN (`{Bucket}`) has `{bucketPartition#name}`\", [bK]: f }, aT = { [f]: \"Invalid ARN: The ARN may only contain a single resource component after `accesspoint`.\", [bK]: f }, aU = { [f]: \"Invalid ARN: Expected a resource of the format `accesspoint:<accesspoint name>` but no name was provided\", [bK]: f }, aV = { [bS]: [{ [bT]: true, [j]: \"sigv4\", [bU]: v, [bV]: \"{bucketArn#region}\" }] }, aW = { [bS]: [{ [bT]: true, [j]: \"sigv4\", [bU]: s, [bV]: \"{bucketArn#region}\" }] }, aX = { [bM]: A, [bN]: [Z] }, aY = { [bQ]: \"https://s3-fips.dualstack.{Region}.{partitionResult#dnsSuffix}/{uri_encoded_bucket}\", [bR]: ao, [bW]: {} }, aZ = { [bQ]: \"https://s3-fips.{Region}.{partitionResult#dnsSuffix}/{uri_encoded_bucket}\", [bR]: ao, [bW]: {} }, ba = { [bQ]: \"https://s3.dualstack.{Region}.{partitionResult#dnsSuffix}/{uri_encoded_bucket}\", [bR]: ao, [bW]: {} }, bb = { [bQ]: L, [bR]: ao, [bW]: {} }, bc = { [bQ]: \"https://s3.{Region}.{partitionResult#dnsSuffix}/{uri_encoded_bucket}\", [bR]: ao, [bW]: {} }, bd = { [bO]: \"UseObjectLambdaEndpoint\" }, be = { [bS]: [{ [bT]: true, [j]: \"sigv4\", [bU]: E, [bV]: \"{Region}\" }] }, bf = { [bQ]: \"https://s3-fips.dualstack.{Region}.{partitionResult#dnsSuffix}\", [bR]: ao, [bW]: {} }, bg = { [bQ]: \"https://s3-fips.{Region}.{partitionResult#dnsSuffix}\", [bR]: ao, [bW]: {} }, bh = { [bQ]: \"https://s3.dualstack.{Region}.{partitionResult#dnsSuffix}\", [bR]: ao, [bW]: {} }, bi = { [bQ]: N, [bR]: ao, [bW]: {} }, bj = { [bQ]: \"https://s3.{Region}.{partitionResult#dnsSuffix}\", [bR]: ao, [bW]: {} }, bk = [{ [bO]: \"Region\" }], bl = [{ [bO]: \"Endpoint\" }], bm = [Z], bn = [{ [bM]: p, [bN]: [{ [bO]: o }, false] }], bo = [{ [bM]: h, [bN]: [{ [bO]: m }, \"beta\"] }], bp = [V, ad], bq = [Y], br = [W], bs = [{ [bM]: p, [bN]: [{ [bO]: \"Region\" }, false] }], bt = [{ [bM]: h, [bN]: [{ [bO]: \"Region\" }, \"us-east-1\"] }], bu = [{ [bM]: h, [bN]: [aF, F] }], bv = [{ [bM]: i, [bN]: [aE, \"resourceId[1]\"], [bP]: G }, { [bM]: q, [bN]: [{ [bM]: h, [bN]: [aH, D] }] }], bw = [aE, \"resourceId[1]\"], bx = [U], by = [S], bz = [{ [bM]: q, [bN]: [{ [bM]: h, [bN]: [{ [bM]: i, [bN]: [aE, \"region\"] }, D] }] }], bA = [{ [bM]: q, [bN]: [{ [bM]: c, [bN]: [{ [bM]: i, [bN]: [aE, \"resourceId[2]\"] }] }] }], bB = [aE, \"resourceId[2]\"], bC = [{ [bM]: g, [bN]: [{ [bM]: i, [bN]: [aE, \"region\"] }], [bP]: \"bucketPartition\" }], bD = [{ [bM]: h, [bN]: [aM, { [bM]: i, [bN]: [{ [bO]: \"partitionResult\" }, j] }] }], bE = [{ [bM]: p, [bN]: [{ [bM]: i, [bN]: [aE, \"region\"] }, true] }], bF = [{ [bM]: p, [bN]: [aN, false] }], bG = [{ [bM]: p, [bN]: [aH, false] }], bH = [T], bI = [{ [bM]: p, [bN]: [{ [bO]: \"Region\" }, true] }];\nconst _data = { version: \"1.0\", parameters: { Bucket: P, Region: P, UseFIPS: Q, UseDualStack: Q, Endpoint: P, ForcePathStyle: Q, Accelerate: Q, UseGlobalEndpoint: Q, UseObjectLambdaEndpoint: R, DisableAccessPoints: R, DisableMultiRegionAccessPoints: Q, UseArnRegion: R }, rules: [{ [bL]: [{ [bM]: c, [bN]: bk }], [bK]: d, rules: [{ [bL]: [S, T], error: \"Accelerate cannot be used with FIPS\", [bK]: f }, { [bL]: [U, V], error: \"Cannot set dual-stack in combination with a custom endpoint.\", [bK]: f }, { [bL]: [V, T], error: \"A custom endpoint cannot be combined with FIPS\", [bK]: f }, { [bL]: [V, S], error: \"A custom endpoint cannot be combined with S3 Accelerate\", [bK]: f }, { [bL]: [T, W, X], error: \"Partition does not support FIPS\", [bK]: f }, { [bL]: [Y, { [bM]: k, [bN]: [Z, 49, 50, b], [bP]: l }, { [bM]: k, [bN]: [Z, 8, 12, b], [bP]: m }, { [bM]: k, [bN]: [Z, 0, 7, b], [bP]: n }, { [bM]: k, [bN]: [Z, 32, 49, b], [bP]: o }, { [bM]: g, [bN]: bk, [bP]: \"regionPartition\" }, { [bM]: h, [bN]: [{ [bO]: n }, \"--op-s3\"] }], [bK]: d, rules: [{ [bL]: bn, [bK]: d, rules: [{ [bL]: [{ [bM]: h, [bN]: [aa, \"e\"] }], [bK]: d, rules: [{ [bL]: bo, [bK]: d, rules: [ab, { [bL]: bp, endpoint: { [bQ]: \"https://{Bucket}.ec2.{url#authority}\", [bR]: ae, [bW]: af }, [bK]: t }] }, { endpoint: { [bQ]: \"https://{Bucket}.ec2.s3-outposts.{Region}.{regionPartition#dnsSuffix}\", [bR]: ae, [bW]: af }, [bK]: t }] }, { [bL]: [{ [bM]: h, [bN]: [aa, \"o\"] }], [bK]: d, rules: [{ [bL]: bo, [bK]: d, rules: [ab, { [bL]: bp, endpoint: { [bQ]: \"https://{Bucket}.op-{outpostId}.{url#authority}\", [bR]: ae, [bW]: af }, [bK]: t }] }, { endpoint: { [bQ]: \"https://{Bucket}.op-{outpostId}.s3-outposts.{Region}.{regionPartition#dnsSuffix}\", [bR]: ae, [bW]: af }, [bK]: t }] }, { error: \"Unrecognized hardware type: \\\"Expected hardware type o or e but got {hardwareType}\\\"\", [bK]: f }] }, { error: \"Invalid ARN: The outpost Id must only contain a-z, A-Z, 0-9 and `-`.\", [bK]: f }] }, { [bL]: bq, [bK]: d, rules: [{ [bL]: [V, { [bM]: q, [bN]: [{ [bM]: c, [bN]: [{ [bM]: r, [bN]: bl }] }] }], error: \"Custom endpoint `{Endpoint}` was not a valid URI\", [bK]: f }, { [bL]: [ag, { [bM]: u, [bN]: [Z, a] }], [bK]: d, rules: [{ [bL]: br, [bK]: d, rules: [{ [bL]: bs, [bK]: d, rules: [{ [bL]: [S, X], error: \"S3 Accelerate cannot be used in this region\", [bK]: f }, { [bL]: [U, T, ai, ac, aj], endpoint: { [bQ]: \"https://{Bucket}.s3-fips.dualstack.us-east-1.{partitionResult#dnsSuffix}\", [bR]: ak, [bW]: af }, [bK]: t }, { [bL]: [U, T, ai, ac, al, am], [bK]: d, rules: [{ endpoint: an, [bK]: t }] }, { [bL]: [U, T, ai, ac, al, ap], endpoint: an, [bK]: t }, { [bL]: [aq, T, ai, ac, aj], endpoint: { [bQ]: \"https://{Bucket}.s3-fips.us-east-1.{partitionResult#dnsSuffix}\", [bR]: ak, [bW]: af }, [bK]: t }, { [bL]: [aq, T, ai, ac, al, am], [bK]: d, rules: [{ endpoint: ar, [bK]: t }] }, { [bL]: [aq, T, ai, ac, al, ap], endpoint: ar, [bK]: t }, { [bL]: [U, as, S, ac, aj], endpoint: { [bQ]: \"https://{Bucket}.s3-accelerate.dualstack.us-east-1.{partitionResult#dnsSuffix}\", [bR]: ak, [bW]: af }, [bK]: t }, { [bL]: [U, as, S, ac, al, am], [bK]: d, rules: [{ endpoint: at, [bK]: t }] }, { [bL]: [U, as, S, ac, al, ap], endpoint: at, [bK]: t }, { [bL]: [U, as, ai, ac, aj], endpoint: { [bQ]: \"https://{Bucket}.s3.dualstack.us-east-1.{partitionResult#dnsSuffix}\", [bR]: ak, [bW]: af }, [bK]: t }, { [bL]: [U, as, ai, ac, al, am], [bK]: d, rules: [{ endpoint: au, [bK]: t }] }, { [bL]: [U, as, ai, ac, al, ap], endpoint: au, [bK]: t }, { [bL]: [aq, as, ai, V, ad, av, aj], endpoint: { [bQ]: w, [bR]: ak, [bW]: af }, [bK]: t }, { [bL]: [aq, as, ai, V, ad, ax, aj], endpoint: { [bQ]: x, [bR]: ak, [bW]: af }, [bK]: t }, { [bL]: [aq, as, ai, V, ad, av, al, am], [bK]: d, rules: [{ [bL]: bt, endpoint: ay, [bK]: t }, { endpoint: ay, [bK]: t }] }, { [bL]: [aq, as, ai, V, ad, ax, al, am], [bK]: d, rules: [{ [bL]: bt, endpoint: az, [bK]: t }, aA] }, { [bL]: [aq, as, ai, V, ad, av, al, ap], endpoint: ay, [bK]: t }, { [bL]: [aq, as, ai, V, ad, ax, al, ap], endpoint: az, [bK]: t }, { [bL]: [aq, as, S, ac, aj], endpoint: { [bQ]: y, [bR]: ak, [bW]: af }, [bK]: t }, { [bL]: [aq, as, S, ac, al, am], [bK]: d, rules: [{ [bL]: bt, endpoint: aB, [bK]: t }, { endpoint: aB, [bK]: t }] }, { [bL]: [aq, as, S, ac, al, ap], endpoint: aB, [bK]: t }, { [bL]: [aq, as, ai, ac, aj], endpoint: { [bQ]: z, [bR]: ak, [bW]: af }, [bK]: t }, { [bL]: [aq, as, ai, ac, al, am], [bK]: d, rules: [{ [bL]: bt, endpoint: { [bQ]: z, [bR]: ao, [bW]: af }, [bK]: t }, { endpoint: aC, [bK]: t }] }, { [bL]: [aq, as, ai, ac, al, ap], endpoint: aC, [bK]: t }] }, aD] }] }, { [bL]: [V, ad, { [bM]: h, [bN]: [{ [bM]: i, [bN]: [aw, \"scheme\"] }, \"http\"] }, { [bM]: u, [bN]: [Z, b] }, ag, as, aq, ai], [bK]: d, rules: [{ [bL]: br, [bK]: d, rules: [{ [bL]: bs, [bK]: d, rules: [aA] }, aD] }] }, { [bL]: [ag, { [bM]: A, [bN]: bm, [bP]: B }], [bK]: d, rules: [{ [bL]: [{ [bM]: i, [bN]: [aE, \"resourceId[0]\"], [bP]: C }, { [bM]: q, [bN]: [{ [bM]: h, [bN]: [aF, D] }] }], [bK]: d, rules: [{ [bL]: [{ [bM]: h, [bN]: [aG, E] }], [bK]: d, rules: [{ [bL]: bu, [bK]: d, rules: [{ [bL]: bv, [bK]: d, rules: [aI, aJ, { [bL]: bz, [bK]: d, rules: [aK, { [bL]: bA, [bK]: d, rules: [aL, { [bL]: bC, [bK]: d, rules: [{ [bL]: br, [bK]: d, rules: [{ [bL]: bD, [bK]: d, rules: [{ [bL]: bE, [bK]: d, rules: [{ [bL]: [{ [bM]: h, [bN]: [aN, D] }], error: \"Invalid ARN: Missing account id\", [bK]: f }, { [bL]: bF, [bK]: d, rules: [{ [bL]: bG, [bK]: d, rules: [{ [bL]: bp, endpoint: { [bQ]: H, [bR]: aO, [bW]: af }, [bK]: t }, { [bL]: bH, endpoint: { [bQ]: \"https://{accessPointName}-{bucketArn#accountId}.s3-object-lambda-fips.{bucketArn#region}.{bucketPartition#dnsSuffix}\", [bR]: aO, [bW]: af }, [bK]: t }, { endpoint: { [bQ]: \"https://{accessPointName}-{bucketArn#accountId}.s3-object-lambda.{bucketArn#region}.{bucketPartition#dnsSuffix}\", [bR]: aO, [bW]: af }, [bK]: t }] }, aP] }, aQ] }, aR] }, aS] }] }] }, aT] }, { error: \"Invalid ARN: bucket ARN is missing a region\", [bK]: f }] }, aU] }, { error: \"Invalid ARN: Object Lambda ARNs only support `accesspoint` arn types, but found: `{arnType}`\", [bK]: f }] }, { [bL]: bu, [bK]: d, rules: [{ [bL]: bv, [bK]: d, rules: [{ [bL]: bz, [bK]: d, rules: [{ [bL]: bu, [bK]: d, rules: [{ [bL]: bz, [bK]: d, rules: [aK, { [bL]: bA, [bK]: d, rules: [aL, { [bL]: bC, [bK]: d, rules: [{ [bL]: br, [bK]: d, rules: [{ [bL]: [{ [bM]: h, [bN]: [aM, \"{partitionResult#name}\"] }], [bK]: d, rules: [{ [bL]: bE, [bK]: d, rules: [{ [bL]: [{ [bM]: h, [bN]: [aG, v] }], [bK]: d, rules: [{ [bL]: bF, [bK]: d, rules: [{ [bL]: bG, [bK]: d, rules: [{ [bL]: by, error: \"Access Points do not support S3 Accelerate\", [bK]: f }, { [bL]: [T, U], endpoint: { [bQ]: \"https://{accessPointName}-{bucketArn#accountId}.s3-accesspoint-fips.dualstack.{bucketArn#region}.{bucketPartition#dnsSuffix}\", [bR]: aV, [bW]: af }, [bK]: t }, { [bL]: [T, aq], endpoint: { [bQ]: \"https://{accessPointName}-{bucketArn#accountId}.s3-accesspoint-fips.{bucketArn#region}.{bucketPartition#dnsSuffix}\", [bR]: aV, [bW]: af }, [bK]: t }, { [bL]: [as, U], endpoint: { [bQ]: \"https://{accessPointName}-{bucketArn#accountId}.s3-accesspoint.dualstack.{bucketArn#region}.{bucketPartition#dnsSuffix}\", [bR]: aV, [bW]: af }, [bK]: t }, { [bL]: [as, aq, V, ad], endpoint: { [bQ]: H, [bR]: aV, [bW]: af }, [bK]: t }, { [bL]: [as, aq], endpoint: { [bQ]: \"https://{accessPointName}-{bucketArn#accountId}.s3-accesspoint.{bucketArn#region}.{bucketPartition#dnsSuffix}\", [bR]: aV, [bW]: af }, [bK]: t }] }, aP] }, aQ] }, { error: \"Invalid ARN: The ARN was not for the S3 service, found: {bucketArn#service}\", [bK]: f }] }, aR] }, aS] }] }] }, aT] }] }] }, { [bL]: [{ [bM]: p, [bN]: [aH, b] }], [bK]: d, rules: [{ [bL]: bx, error: \"S3 MRAP does not support dual-stack\", [bK]: f }, { [bL]: bH, error: \"S3 MRAP does not support FIPS\", [bK]: f }, { [bL]: by, error: \"S3 MRAP does not support S3 Accelerate\", [bK]: f }, { [bL]: [{ [bM]: e, [bN]: [{ [bO]: \"DisableMultiRegionAccessPoints\" }, b] }], error: \"Invalid configuration: Multi-Region Access Point ARNs are disabled.\", [bK]: f }, { [bL]: [{ [bM]: g, [bN]: bk, [bP]: I }], [bK]: d, rules: [{ [bL]: [{ [bM]: h, [bN]: [{ [bM]: i, [bN]: [{ [bO]: I }, j] }, { [bM]: i, [bN]: [aE, \"partition\"] }] }], [bK]: d, rules: [{ endpoint: { [bQ]: \"https://{accessPointName}.accesspoint.s3-global.{mrapPartition#dnsSuffix}\", [bR]: { [bS]: [{ [bT]: b, name: \"sigv4a\", [bU]: v, signingRegionSet: [\"*\"] }] }, [bW]: af }, [bK]: t }] }, { error: \"Client was configured for partition `{mrapPartition#name}` but bucket referred to partition `{bucketArn#partition}`\", [bK]: f }] }] }, { error: \"Invalid Access Point Name\", [bK]: f }] }, aU] }, { [bL]: [{ [bM]: h, [bN]: [aG, s] }], [bK]: d, rules: [{ [bL]: bx, error: \"S3 Outposts does not support Dual-stack\", [bK]: f }, { [bL]: bH, error: \"S3 Outposts does not support FIPS\", [bK]: f }, { [bL]: by, error: \"S3 Outposts does not support S3 Accelerate\", [bK]: f }, { [bL]: [{ [bM]: c, [bN]: [{ [bM]: i, [bN]: [aE, \"resourceId[4]\"] }] }], error: \"Invalid Arn: Outpost Access Point ARN contains sub resources\", [bK]: f }, { [bL]: [{ [bM]: i, [bN]: bw, [bP]: o }], [bK]: d, rules: [{ [bL]: bn, [bK]: d, rules: [aL, { [bL]: bC, [bK]: d, rules: [{ [bL]: br, [bK]: d, rules: [{ [bL]: bD, [bK]: d, rules: [{ [bL]: bE, [bK]: d, rules: [{ [bL]: bF, [bK]: d, rules: [{ [bL]: [{ [bM]: i, [bN]: bB, [bP]: J }], [bK]: d, rules: [{ [bL]: [{ [bM]: i, [bN]: [aE, \"resourceId[3]\"], [bP]: G }], [bK]: d, rules: [{ [bL]: [{ [bM]: h, [bN]: [{ [bO]: J }, F] }], [bK]: d, rules: [{ [bL]: bp, endpoint: { [bQ]: \"https://{accessPointName}-{bucketArn#accountId}.{outpostId}.{url#authority}\", [bR]: aW, [bW]: af }, [bK]: t }, { endpoint: { [bQ]: \"https://{accessPointName}-{bucketArn#accountId}.{outpostId}.s3-outposts.{bucketArn#region}.{bucketPartition#dnsSuffix}\", [bR]: aW, [bW]: af }, [bK]: t }] }, { error: \"Expected an outpost type `accesspoint`, found {outpostType}\", [bK]: f }] }, { error: \"Invalid ARN: expected an access point name\", [bK]: f }] }, { error: \"Invalid ARN: Expected a 4-component resource\", [bK]: f }] }, aQ] }, aR] }, aS] }] }] }, { error: \"Invalid ARN: The outpost Id may only contain a-z, A-Z, 0-9 and `-`. Found: `{outpostId}`\", [bK]: f }] }, { error: \"Invalid ARN: The Outpost Id was not set\", [bK]: f }] }, { error: \"Invalid ARN: Unrecognized format: {Bucket} (type: {arnType})\", [bK]: f }] }, { error: \"Invalid ARN: No ARN type specified\", [bK]: f }] }, { [bL]: [{ [bM]: k, [bN]: [Z, 0, 4, a], [bP]: K }, { [bM]: h, [bN]: [{ [bO]: K }, \"arn:\"] }, { [bM]: q, [bN]: [{ [bM]: c, [bN]: [aX] }] }], error: \"Invalid ARN: `{Bucket}` was not a valid ARN\", [bK]: f }, { [bL]: [{ [bM]: e, [bN]: [ah, b] }, aX], error: \"Path-style addressing cannot be used with ARN buckets\", [bK]: f }, { [bL]: [{ [bM]: \"uriEncode\", [bN]: bm, [bP]: \"uri_encoded_bucket\" }], [bK]: d, rules: [{ [bL]: br, [bK]: d, rules: [{ [bL]: [ai], [bK]: d, rules: [{ [bL]: [U, ac, T, aj], endpoint: { [bQ]: \"https://s3-fips.dualstack.us-east-1.{partitionResult#dnsSuffix}/{uri_encoded_bucket}\", [bR]: ak, [bW]: af }, [bK]: t }, { [bL]: [U, ac, T, al, am], [bK]: d, rules: [{ endpoint: aY, [bK]: t }] }, { [bL]: [U, ac, T, al, ap], endpoint: aY, [bK]: t }, { [bL]: [aq, ac, T, aj], endpoint: { [bQ]: \"https://s3-fips.us-east-1.{partitionResult#dnsSuffix}/{uri_encoded_bucket}\", [bR]: ak, [bW]: af }, [bK]: t }, { [bL]: [aq, ac, T, al, am], [bK]: d, rules: [{ endpoint: aZ, [bK]: t }] }, { [bL]: [aq, ac, T, al, ap], endpoint: aZ, [bK]: t }, { [bL]: [U, ac, as, aj], endpoint: { [bQ]: \"https://s3.dualstack.us-east-1.{partitionResult#dnsSuffix}/{uri_encoded_bucket}\", [bR]: ak, [bW]: af }, [bK]: t }, { [bL]: [U, ac, as, al, am], [bK]: d, rules: [{ endpoint: ba, [bK]: t }] }, { [bL]: [U, ac, as, al, ap], endpoint: ba, [bK]: t }, { [bL]: [aq, V, ad, as, aj], endpoint: { [bQ]: L, [bR]: ak, [bW]: af }, [bK]: t }, { [bL]: [aq, V, ad, as, al, am], [bK]: d, rules: [{ [bL]: bt, endpoint: bb, [bK]: t }, { endpoint: bb, [bK]: t }] }, { [bL]: [aq, V, ad, as, al, ap], endpoint: bb, [bK]: t }, { [bL]: [aq, ac, as, aj], endpoint: { [bQ]: M, [bR]: ak, [bW]: af }, [bK]: t }, { [bL]: [aq, ac, as, al, am], [bK]: d, rules: [{ [bL]: bt, endpoint: { [bQ]: M, [bR]: ao, [bW]: af }, [bK]: t }, { endpoint: bc, [bK]: t }] }, { [bL]: [aq, ac, as, al, ap], endpoint: bc, [bK]: t }] }, { error: \"Path-style addressing cannot be used with S3 Accelerate\", [bK]: f }] }] }] }, { [bL]: [{ [bM]: c, [bN]: [bd] }, { [bM]: e, [bN]: [bd, b] }], [bK]: d, rules: [{ [bL]: br, [bK]: d, rules: [{ [bL]: bI, [bK]: d, rules: [aI, aJ, { [bL]: bp, endpoint: { [bQ]: N, [bR]: be, [bW]: af }, [bK]: t }, { [bL]: bH, endpoint: { [bQ]: \"https://s3-object-lambda-fips.{Region}.{partitionResult#dnsSuffix}\", [bR]: be, [bW]: af }, [bK]: t }, { endpoint: { [bQ]: \"https://s3-object-lambda.{Region}.{partitionResult#dnsSuffix}\", [bR]: be, [bW]: af }, [bK]: t }] }, aD] }] }, { [bL]: [{ [bM]: q, [bN]: bq }], [bK]: d, rules: [{ [bL]: br, [bK]: d, rules: [{ [bL]: bI, [bK]: d, rules: [{ [bL]: [T, U, ac, aj], endpoint: { [bQ]: \"https://s3-fips.dualstack.us-east-1.{partitionResult#dnsSuffix}\", [bR]: ak, [bW]: af }, [bK]: t }, { [bL]: [T, U, ac, al, am], [bK]: d, rules: [{ endpoint: bf, [bK]: t }] }, { [bL]: [T, U, ac, al, ap], endpoint: bf, [bK]: t }, { [bL]: [T, aq, ac, aj], endpoint: { [bQ]: \"https://s3-fips.us-east-1.{partitionResult#dnsSuffix}\", [bR]: ak, [bW]: af }, [bK]: t }, { [bL]: [T, aq, ac, al, am], [bK]: d, rules: [{ endpoint: bg, [bK]: t }] }, { [bL]: [T, aq, ac, al, ap], endpoint: bg, [bK]: t }, { [bL]: [as, U, ac, aj], endpoint: { [bQ]: \"https://s3.dualstack.us-east-1.{partitionResult#dnsSuffix}\", [bR]: ak, [bW]: af }, [bK]: t }, { [bL]: [as, U, ac, al, am], [bK]: d, rules: [{ endpoint: bh, [bK]: t }] }, { [bL]: [as, U, ac, al, ap], endpoint: bh, [bK]: t }, { [bL]: [as, aq, V, ad, aj], endpoint: { [bQ]: N, [bR]: ak, [bW]: af }, [bK]: t }, { [bL]: [as, aq, V, ad, al, am], [bK]: d, rules: [{ [bL]: bt, endpoint: bi, [bK]: t }, { endpoint: bi, [bK]: t }] }, { [bL]: [as, aq, V, ad, al, ap], endpoint: bi, [bK]: t }, { [bL]: [as, aq, ac, aj], endpoint: { [bQ]: O, [bR]: ak, [bW]: af }, [bK]: t }, { [bL]: [as, aq, ac, al, am], [bK]: d, rules: [{ [bL]: bt, endpoint: { [bQ]: O, [bR]: ao, [bW]: af }, [bK]: t }, { endpoint: bj, [bK]: t }] }, { [bL]: [as, aq, ac, al, ap], endpoint: bj, [bK]: t }] }, aD] }] }] }, { error: \"A region must be set when sending requests to S3.\", [bK]: f }] };\nconst ruleSet = _data;\n\nconst defaultEndpointResolver = (endpointParams, context = {}) => {\n    return resolveEndpoint(ruleSet, {\n        endpointParams: endpointParams,\n        logger: context.logger,\n    });\n};\n\nconst getRuntimeConfig = (config) => ({\n    apiVersion: \"2006-03-01\",\n    base64Decoder: config?.base64Decoder ?? fromBase64,\n    base64Encoder: config?.base64Encoder ?? toBase64,\n    disableHostPrefix: config?.disableHostPrefix ?? false,\n    endpointProvider: config?.endpointProvider ?? defaultEndpointResolver,\n    getAwsChunkedEncodingStream: config?.getAwsChunkedEncodingStream ?? getAwsChunkedEncodingStream,\n    logger: config?.logger ?? new NoOpLogger(),\n    sdkStreamMixin: config?.sdkStreamMixin ?? sdkStreamMixin,\n    serviceId: config?.serviceId ?? \"S3\",\n    signerConstructor: config?.signerConstructor ?? SignatureV4MultiRegion,\n    signingEscapePath: config?.signingEscapePath ?? false,\n    urlParser: config?.urlParser ?? parseUrl,\n    useArnRegion: config?.useArnRegion ?? false,\n    utf8Decoder: config?.utf8Decoder ?? fromUtf8,\n    utf8Encoder: config?.utf8Encoder ?? toUtf8,\n});\n\nconst getRuntimeConfig$1 = (config) => {\n    const defaultsMode = resolveDefaultsModeConfig(config);\n    const defaultConfigProvider = () => defaultsMode().then(loadConfigsForDefaultMode);\n    const clientSharedValues = getRuntimeConfig(config);\n    return {\n        ...clientSharedValues,\n        ...config,\n        runtime: \"browser\",\n        defaultsMode,\n        bodyLengthChecker: config?.bodyLengthChecker ?? calculateBodyLength,\n        credentialDefaultProvider: config?.credentialDefaultProvider ?? ((_) => () => Promise.reject(new Error(\"Credential is missing\"))),\n        defaultUserAgentProvider: config?.defaultUserAgentProvider ??\n            defaultUserAgent({ serviceId: clientSharedValues.serviceId, clientVersion: packageInfo.version }),\n        eventStreamSerdeProvider: config?.eventStreamSerdeProvider ?? eventStreamSerdeProvider,\n        maxAttempts: config?.maxAttempts ?? DEFAULT_MAX_ATTEMPTS,\n        md5: config?.md5 ?? Md5,\n        region: config?.region ?? invalidProvider(\"Region is missing\"),\n        requestHandler: config?.requestHandler ?? new FetchHttpHandler(defaultConfigProvider),\n        retryMode: config?.retryMode ?? (async () => (await defaultConfigProvider()).retryMode || DEFAULT_RETRY_MODE),\n        sha1: config?.sha1 ?? build.Sha1,\n        sha256: config?.sha256 ?? build$6.Sha256,\n        streamCollector: config?.streamCollector ?? streamCollector,\n        streamHasher: config?.streamHasher ?? blobHasher,\n        useDualstackEndpoint: config?.useDualstackEndpoint ?? (() => Promise.resolve(DEFAULT_USE_DUALSTACK_ENDPOINT)),\n        useFipsEndpoint: config?.useFipsEndpoint ?? (() => Promise.resolve(DEFAULT_USE_FIPS_ENDPOINT)),\n    };\n};\n\nclass S3Client extends Client {\n    constructor(configuration) {\n        const _config_0 = getRuntimeConfig$1(configuration);\n        const _config_1 = resolveClientEndpointParameters(_config_0);\n        const _config_2 = resolveRegionConfig(_config_1);\n        const _config_3 = resolveEndpointConfig(_config_2);\n        const _config_4 = resolveRetryConfig(_config_3);\n        const _config_5 = resolveHostHeaderConfig(_config_4);\n        const _config_6 = resolveAwsAuthConfig(_config_5);\n        const _config_7 = resolveS3Config(_config_6);\n        const _config_8 = resolveUserAgentConfig(_config_7);\n        const _config_9 = resolveEventStreamSerdeConfig(_config_8);\n        super(_config_9);\n        this.config = _config_9;\n        this.middlewareStack.use(getRetryPlugin(this.config));\n        this.middlewareStack.use(getContentLengthPlugin(this.config));\n        this.middlewareStack.use(getHostHeaderPlugin(this.config));\n        this.middlewareStack.use(getLoggerPlugin(this.config));\n        this.middlewareStack.use(getRecursionDetectionPlugin(this.config));\n        this.middlewareStack.use(getAwsAuthPlugin(this.config));\n        this.middlewareStack.use(getValidateBucketNamePlugin(this.config));\n        this.middlewareStack.use(getAddExpectContinuePlugin(this.config));\n        this.middlewareStack.use(getUserAgentPlugin(this.config));\n    }\n    destroy() {\n        super.destroy();\n    }\n}\n\nvar util = createCommonjsModule(function (module, exports) {\n\nconst nameStartChar = ':A-Za-z_\\\\u00C0-\\\\u00D6\\\\u00D8-\\\\u00F6\\\\u00F8-\\\\u02FF\\\\u0370-\\\\u037D\\\\u037F-\\\\u1FFF\\\\u200C-\\\\u200D\\\\u2070-\\\\u218F\\\\u2C00-\\\\u2FEF\\\\u3001-\\\\uD7FF\\\\uF900-\\\\uFDCF\\\\uFDF0-\\\\uFFFD';\nconst nameChar = nameStartChar + '\\\\-.\\\\d\\\\u00B7\\\\u0300-\\\\u036F\\\\u203F-\\\\u2040';\nconst nameRegexp = '[' + nameStartChar + '][' + nameChar + ']*';\nconst regexName = new RegExp('^' + nameRegexp + '$');\n\nconst getAllMatches = function(string, regex) {\n  const matches = [];\n  let match = regex.exec(string);\n  while (match) {\n    const allmatches = [];\n    allmatches.startIndex = regex.lastIndex - match[0].length;\n    const len = match.length;\n    for (let index = 0; index < len; index++) {\n      allmatches.push(match[index]);\n    }\n    matches.push(allmatches);\n    match = regex.exec(string);\n  }\n  return matches;\n};\n\nconst isName = function(string) {\n  const match = regexName.exec(string);\n  return !(match === null || typeof match === 'undefined');\n};\n\nexports.isExist = function(v) {\n  return typeof v !== 'undefined';\n};\n\nexports.isEmptyObject = function(obj) {\n  return Object.keys(obj).length === 0;\n};\n\n/**\n * Copy all the properties of a into b.\n * @param {*} target\n * @param {*} a\n */\nexports.merge = function(target, a, arrayMode) {\n  if (a) {\n    const keys = Object.keys(a); // will return an array of own properties\n    const len = keys.length; //don't make it inline\n    for (let i = 0; i < len; i++) {\n      if (arrayMode === 'strict') {\n        target[keys[i]] = [ a[keys[i]] ];\n      } else {\n        target[keys[i]] = a[keys[i]];\n      }\n    }\n  }\n};\n/* exports.merge =function (b,a){\n  return Object.assign(b,a);\n} */\n\nexports.getValue = function(v) {\n  if (exports.isExist(v)) {\n    return v;\n  } else {\n    return '';\n  }\n};\n\n// const fakeCall = function(a) {return a;};\n// const fakeCallNoReturn = function() {};\n\nexports.isName = isName;\nexports.getAllMatches = getAllMatches;\nexports.nameRegexp = nameRegexp;\n});\n\nconst defaultOptions = {\n  allowBooleanAttributes: false, //A tag can have attributes without any value\n  unpairedTags: []\n};\n\n//const tagsPattern = new RegExp(\"<\\\\/?([\\\\w:\\\\-_\\.]+)\\\\s*\\/?>\",\"g\");\nvar validate$1 = function (xmlData, options) {\n  options = Object.assign({}, defaultOptions, options);\n\n  //xmlData = xmlData.replace(/(\\r\\n|\\n|\\r)/gm,\"\");//make it single line\n  //xmlData = xmlData.replace(/(^\\s*<\\?xml.*?\\?>)/g,\"\");//Remove XML starting tag\n  //xmlData = xmlData.replace(/(<!DOCTYPE[\\s\\w\\\"\\.\\/\\-\\:]+(\\[.*\\])*\\s*>)/g,\"\");//Remove DOCTYPE\n  const tags = [];\n  let tagFound = false;\n\n  //indicates that the root tag has been closed (aka. depth 0 has been reached)\n  let reachedRoot = false;\n\n  if (xmlData[0] === '\\ufeff') {\n    // check for byte order mark (BOM)\n    xmlData = xmlData.substr(1);\n  }\n  \n  for (let i = 0; i < xmlData.length; i++) {\n\n    if (xmlData[i] === '<' && xmlData[i+1] === '?') {\n      i+=2;\n      i = readPI(xmlData,i);\n      if (i.err) return i;\n    }else if (xmlData[i] === '<') {\n      //starting of tag\n      //read until you reach to '>' avoiding any '>' in attribute value\n      let tagStartPos = i;\n      i++;\n      \n      if (xmlData[i] === '!') {\n        i = readCommentAndCDATA(xmlData, i);\n        continue;\n      } else {\n        let closingTag = false;\n        if (xmlData[i] === '/') {\n          //closing tag\n          closingTag = true;\n          i++;\n        }\n        //read tagname\n        let tagName = '';\n        for (; i < xmlData.length &&\n          xmlData[i] !== '>' &&\n          xmlData[i] !== ' ' &&\n          xmlData[i] !== '\\t' &&\n          xmlData[i] !== '\\n' &&\n          xmlData[i] !== '\\r'; i++\n        ) {\n          tagName += xmlData[i];\n        }\n        tagName = tagName.trim();\n        //console.log(tagName);\n\n        if (tagName[tagName.length - 1] === '/') {\n          //self closing tag without attributes\n          tagName = tagName.substring(0, tagName.length - 1);\n          //continue;\n          i--;\n        }\n        if (!validateTagName(tagName)) {\n          let msg;\n          if (tagName.trim().length === 0) {\n            msg = \"Invalid space after '<'.\";\n          } else {\n            msg = \"Tag '\"+tagName+\"' is an invalid name.\";\n          }\n          return getErrorObject('InvalidTag', msg, getLineNumberForPosition(xmlData, i));\n        }\n\n        const result = readAttributeStr(xmlData, i);\n        if (result === false) {\n          return getErrorObject('InvalidAttr', \"Attributes for '\"+tagName+\"' have open quote.\", getLineNumberForPosition(xmlData, i));\n        }\n        let attrStr = result.value;\n        i = result.index;\n\n        if (attrStr[attrStr.length - 1] === '/') {\n          //self closing tag\n          const attrStrStart = i - attrStr.length;\n          attrStr = attrStr.substring(0, attrStr.length - 1);\n          const isValid = validateAttributeString(attrStr, options);\n          if (isValid === true) {\n            tagFound = true;\n            //continue; //text may presents after self closing tag\n          } else {\n            //the result from the nested function returns the position of the error within the attribute\n            //in order to get the 'true' error line, we need to calculate the position where the attribute begins (i - attrStr.length) and then add the position within the attribute\n            //this gives us the absolute index in the entire xml, which we can use to find the line at last\n            return getErrorObject(isValid.err.code, isValid.err.msg, getLineNumberForPosition(xmlData, attrStrStart + isValid.err.line));\n          }\n        } else if (closingTag) {\n          if (!result.tagClosed) {\n            return getErrorObject('InvalidTag', \"Closing tag '\"+tagName+\"' doesn't have proper closing.\", getLineNumberForPosition(xmlData, i));\n          } else if (attrStr.trim().length > 0) {\n            return getErrorObject('InvalidTag', \"Closing tag '\"+tagName+\"' can't have attributes or invalid starting.\", getLineNumberForPosition(xmlData, tagStartPos));\n          } else {\n            const otg = tags.pop();\n            if (tagName !== otg.tagName) {\n              let openPos = getLineNumberForPosition(xmlData, otg.tagStartPos);\n              return getErrorObject('InvalidTag',\n                \"Expected closing tag '\"+otg.tagName+\"' (opened in line \"+openPos.line+\", col \"+openPos.col+\") instead of closing tag '\"+tagName+\"'.\",\n                getLineNumberForPosition(xmlData, tagStartPos));\n            }\n\n            //when there are no more tags, we reached the root level.\n            if (tags.length == 0) {\n              reachedRoot = true;\n            }\n          }\n        } else {\n          const isValid = validateAttributeString(attrStr, options);\n          if (isValid !== true) {\n            //the result from the nested function returns the position of the error within the attribute\n            //in order to get the 'true' error line, we need to calculate the position where the attribute begins (i - attrStr.length) and then add the position within the attribute\n            //this gives us the absolute index in the entire xml, which we can use to find the line at last\n            return getErrorObject(isValid.err.code, isValid.err.msg, getLineNumberForPosition(xmlData, i - attrStr.length + isValid.err.line));\n          }\n\n          //if the root level has been reached before ...\n          if (reachedRoot === true) {\n            return getErrorObject('InvalidXml', 'Multiple possible root nodes found.', getLineNumberForPosition(xmlData, i));\n          } else if(options.unpairedTags.indexOf(tagName) !== -1); else {\n            tags.push({tagName, tagStartPos});\n          }\n          tagFound = true;\n        }\n\n        //skip tag text value\n        //It may include comments and CDATA value\n        for (i++; i < xmlData.length; i++) {\n          if (xmlData[i] === '<') {\n            if (xmlData[i + 1] === '!') {\n              //comment or CADATA\n              i++;\n              i = readCommentAndCDATA(xmlData, i);\n              continue;\n            } else if (xmlData[i+1] === '?') {\n              i = readPI(xmlData, ++i);\n              if (i.err) return i;\n            } else {\n              break;\n            }\n          } else if (xmlData[i] === '&') {\n            const afterAmp = validateAmpersand(xmlData, i);\n            if (afterAmp == -1)\n              return getErrorObject('InvalidChar', \"char '&' is not expected.\", getLineNumberForPosition(xmlData, i));\n            i = afterAmp;\n          }else {\n            if (reachedRoot === true && !isWhiteSpace(xmlData[i])) {\n              return getErrorObject('InvalidXml', \"Extra text at the end\", getLineNumberForPosition(xmlData, i));\n            }\n          }\n        } //end of reading tag text value\n        if (xmlData[i] === '<') {\n          i--;\n        }\n      }\n    } else {\n      if ( isWhiteSpace(xmlData[i])) {\n        continue;\n      }\n      return getErrorObject('InvalidChar', \"char '\"+xmlData[i]+\"' is not expected.\", getLineNumberForPosition(xmlData, i));\n    }\n  }\n\n  if (!tagFound) {\n    return getErrorObject('InvalidXml', 'Start tag expected.', 1);\n  }else if (tags.length == 1) {\n      return getErrorObject('InvalidTag', \"Unclosed tag '\"+tags[0].tagName+\"'.\", getLineNumberForPosition(xmlData, tags[0].tagStartPos));\n  }else if (tags.length > 0) {\n      return getErrorObject('InvalidXml', \"Invalid '\"+\n          JSON.stringify(tags.map(t => t.tagName), null, 4).replace(/\\r?\\n/g, '')+\n          \"' found.\", {line: 1, col: 1});\n  }\n\n  return true;\n};\n\nfunction isWhiteSpace(char){\n  return char === ' ' || char === '\\t' || char === '\\n'  || char === '\\r';\n}\n/**\n * Read Processing insstructions and skip\n * @param {*} xmlData\n * @param {*} i\n */\nfunction readPI(xmlData, i) {\n  const start = i;\n  for (; i < xmlData.length; i++) {\n    if (xmlData[i] == '?' || xmlData[i] == ' ') {\n      //tagname\n      const tagname = xmlData.substr(start, i - start);\n      if (i > 5 && tagname === 'xml') {\n        return getErrorObject('InvalidXml', 'XML declaration allowed only at the start of the document.', getLineNumberForPosition(xmlData, i));\n      } else if (xmlData[i] == '?' && xmlData[i + 1] == '>') {\n        //check if valid attribut string\n        i++;\n        break;\n      } else {\n        continue;\n      }\n    }\n  }\n  return i;\n}\n\nfunction readCommentAndCDATA(xmlData, i) {\n  if (xmlData.length > i + 5 && xmlData[i + 1] === '-' && xmlData[i + 2] === '-') {\n    //comment\n    for (i += 3; i < xmlData.length; i++) {\n      if (xmlData[i] === '-' && xmlData[i + 1] === '-' && xmlData[i + 2] === '>') {\n        i += 2;\n        break;\n      }\n    }\n  } else if (\n    xmlData.length > i + 8 &&\n    xmlData[i + 1] === 'D' &&\n    xmlData[i + 2] === 'O' &&\n    xmlData[i + 3] === 'C' &&\n    xmlData[i + 4] === 'T' &&\n    xmlData[i + 5] === 'Y' &&\n    xmlData[i + 6] === 'P' &&\n    xmlData[i + 7] === 'E'\n  ) {\n    let angleBracketsCount = 1;\n    for (i += 8; i < xmlData.length; i++) {\n      if (xmlData[i] === '<') {\n        angleBracketsCount++;\n      } else if (xmlData[i] === '>') {\n        angleBracketsCount--;\n        if (angleBracketsCount === 0) {\n          break;\n        }\n      }\n    }\n  } else if (\n    xmlData.length > i + 9 &&\n    xmlData[i + 1] === '[' &&\n    xmlData[i + 2] === 'C' &&\n    xmlData[i + 3] === 'D' &&\n    xmlData[i + 4] === 'A' &&\n    xmlData[i + 5] === 'T' &&\n    xmlData[i + 6] === 'A' &&\n    xmlData[i + 7] === '['\n  ) {\n    for (i += 8; i < xmlData.length; i++) {\n      if (xmlData[i] === ']' && xmlData[i + 1] === ']' && xmlData[i + 2] === '>') {\n        i += 2;\n        break;\n      }\n    }\n  }\n\n  return i;\n}\n\nconst doubleQuote = '\"';\nconst singleQuote = \"'\";\n\n/**\n * Keep reading xmlData until '<' is found outside the attribute value.\n * @param {string} xmlData\n * @param {number} i\n */\nfunction readAttributeStr(xmlData, i) {\n  let attrStr = '';\n  let startChar = '';\n  let tagClosed = false;\n  for (; i < xmlData.length; i++) {\n    if (xmlData[i] === doubleQuote || xmlData[i] === singleQuote) {\n      if (startChar === '') {\n        startChar = xmlData[i];\n      } else if (startChar !== xmlData[i]) ; else {\n        startChar = '';\n      }\n    } else if (xmlData[i] === '>') {\n      if (startChar === '') {\n        tagClosed = true;\n        break;\n      }\n    }\n    attrStr += xmlData[i];\n  }\n  if (startChar !== '') {\n    return false;\n  }\n\n  return {\n    value: attrStr,\n    index: i,\n    tagClosed: tagClosed\n  };\n}\n\n/**\n * Select all the attributes whether valid or invalid.\n */\nconst validAttrStrRegxp = new RegExp('(\\\\s*)([^\\\\s=]+)(\\\\s*=)?(\\\\s*([\\'\"])(([\\\\s\\\\S])*?)\\\\5)?', 'g');\n\n//attr, =\"sd\", a=\"amit's\", a=\"sd\"b=\"saf\", ab  cd=\"\"\n\nfunction validateAttributeString(attrStr, options) {\n  //console.log(\"start:\"+attrStr+\":end\");\n\n  //if(attrStr.trim().length === 0) return true; //empty string\n\n  const matches = util.getAllMatches(attrStr, validAttrStrRegxp);\n  const attrNames = {};\n\n  for (let i = 0; i < matches.length; i++) {\n    if (matches[i][1].length === 0) {\n      //nospace before attribute name: a=\"sd\"b=\"saf\"\n      return getErrorObject('InvalidAttr', \"Attribute '\"+matches[i][2]+\"' has no space in starting.\", getPositionFromMatch(matches[i]))\n    } else if (matches[i][3] !== undefined && matches[i][4] === undefined) {\n      return getErrorObject('InvalidAttr', \"Attribute '\"+matches[i][2]+\"' is without value.\", getPositionFromMatch(matches[i]));\n    } else if (matches[i][3] === undefined && !options.allowBooleanAttributes) {\n      //independent attribute: ab\n      return getErrorObject('InvalidAttr', \"boolean attribute '\"+matches[i][2]+\"' is not allowed.\", getPositionFromMatch(matches[i]));\n    }\n    /* else if(matches[i][6] === undefined){//attribute without value: ab=\n                    return { err: { code:\"InvalidAttr\",msg:\"attribute \" + matches[i][2] + \" has no value assigned.\"}};\n                } */\n    const attrName = matches[i][2];\n    if (!validateAttrName(attrName)) {\n      return getErrorObject('InvalidAttr', \"Attribute '\"+attrName+\"' is an invalid name.\", getPositionFromMatch(matches[i]));\n    }\n    if (!attrNames.hasOwnProperty(attrName)) {\n      //check for duplicate attribute.\n      attrNames[attrName] = 1;\n    } else {\n      return getErrorObject('InvalidAttr', \"Attribute '\"+attrName+\"' is repeated.\", getPositionFromMatch(matches[i]));\n    }\n  }\n\n  return true;\n}\n\nfunction validateNumberAmpersand(xmlData, i) {\n  let re = /\\d/;\n  if (xmlData[i] === 'x') {\n    i++;\n    re = /[\\da-fA-F]/;\n  }\n  for (; i < xmlData.length; i++) {\n    if (xmlData[i] === ';')\n      return i;\n    if (!xmlData[i].match(re))\n      break;\n  }\n  return -1;\n}\n\nfunction validateAmpersand(xmlData, i) {\n  // https://www.w3.org/TR/xml/#dt-charref\n  i++;\n  if (xmlData[i] === ';')\n    return -1;\n  if (xmlData[i] === '#') {\n    i++;\n    return validateNumberAmpersand(xmlData, i);\n  }\n  let count = 0;\n  for (; i < xmlData.length; i++, count++) {\n    if (xmlData[i].match(/\\w/) && count < 20)\n      continue;\n    if (xmlData[i] === ';')\n      break;\n    return -1;\n  }\n  return i;\n}\n\nfunction getErrorObject(code, message, lineNumber) {\n  return {\n    err: {\n      code: code,\n      msg: message,\n      line: lineNumber.line || lineNumber,\n      col: lineNumber.col,\n    },\n  };\n}\n\nfunction validateAttrName(attrName) {\n  return util.isName(attrName);\n}\n\n// const startsWithXML = /^xml/i;\n\nfunction validateTagName(tagname) {\n  return util.isName(tagname) /* && !tagname.match(startsWithXML) */;\n}\n\n//this function returns the line number for the character at the given index\nfunction getLineNumberForPosition(xmlData, index) {\n  const lines = xmlData.substring(0, index).split(/\\r?\\n/);\n  return {\n    line: lines.length,\n\n    // column number is last line's length + 1, because column numbering starts at 1:\n    col: lines[lines.length - 1].length + 1\n  };\n}\n\n//this function returns the position of the first character of match within attrStr\nfunction getPositionFromMatch(match) {\n  return match.startIndex + match[1].length;\n}\n\nvar validator = {\n\tvalidate: validate$1\n};\n\nconst defaultOptions$1 = {\n    preserveOrder: false,\n    attributeNamePrefix: '@_',\n    attributesGroupName: false,\n    textNodeName: '#text',\n    ignoreAttributes: true,\n    removeNSPrefix: false, // remove NS from tag name or attribute name if true\n    allowBooleanAttributes: false, //a tag can have attributes without any value\n    //ignoreRootElement : false,\n    parseTagValue: true,\n    parseAttributeValue: false,\n    trimValues: true, //Trim string values of tag and attributes\n    cdataPropName: false,\n    numberParseOptions: {\n      hex: true,\n      leadingZeros: true,\n      eNotation: true\n    },\n    tagValueProcessor: function(tagName, val) {\n      return val;\n    },\n    attributeValueProcessor: function(attrName, val) {\n      return val;\n    },\n    stopNodes: [], //nested tags will not be parsed even for errors\n    alwaysCreateTextNode: false,\n    isArray: () => false,\n    commentPropName: false,\n    unpairedTags: [],\n    processEntities: true,\n    htmlEntities: false,\n    ignoreDeclaration: false,\n    ignorePiTags: false,\n    transformTagName: false,\n    transformAttributeName: false,\n    updateTag: function(tagName, jPath, attrs){\n      return tagName\n    },\n    // skipEmptyListItem: false\n};\n   \nconst buildOptions = function(options) {\n    return Object.assign({}, defaultOptions$1, options);\n};\n\nvar buildOptions_1 = buildOptions;\nvar defaultOptions_1 = defaultOptions$1;\n\nvar OptionsBuilder = {\n\tbuildOptions: buildOptions_1,\n\tdefaultOptions: defaultOptions_1\n};\n\nclass XmlNode{\n  constructor(tagname) {\n    this.tagname = tagname;\n    this.child = []; //nested tags, text, cdata, comments in order\n    this[\":@\"] = {}; //attributes map\n  }\n  add(key,val){\n    // this.child.push( {name : key, val: val, isCdata: isCdata });\n    if(key === \"__proto__\") key = \"#__proto__\";\n    this.child.push( {[key]: val });\n  }\n  addChild(node) {\n    if(node.tagname === \"__proto__\") node.tagname = \"#__proto__\";\n    if(node[\":@\"] && Object.keys(node[\":@\"]).length > 0){\n      this.child.push( { [node.tagname]: node.child, [\":@\"]: node[\":@\"] });\n    }else {\n      this.child.push( { [node.tagname]: node.child });\n    }\n  };\n}\n\nvar xmlNode = XmlNode;\n\n//TODO: handle comments\nfunction readDocType(xmlData, i){\n    \n    const entities = {};\n    if( xmlData[i + 3] === 'O' &&\n         xmlData[i + 4] === 'C' &&\n         xmlData[i + 5] === 'T' &&\n         xmlData[i + 6] === 'Y' &&\n         xmlData[i + 7] === 'P' &&\n         xmlData[i + 8] === 'E')\n    {    \n        i = i+9;\n        let angleBracketsCount = 1;\n        let hasBody = false, comment = false;\n        let exp = \"\";\n        for(;i<xmlData.length;i++){\n            if (xmlData[i] === '<' && !comment) { //Determine the tag type\n                if( hasBody && isEntity(xmlData, i)){\n                    i += 7; \n                    [entityName, val,i] = readEntityExp(xmlData,i+1);\n                    if(val.indexOf(\"&\") === -1) //Parameter entities are not supported\n                        entities[ validateEntityName(entityName) ] = {\n                            regx : RegExp( `&${entityName};`,\"g\"),\n                            val: val\n                        };\n                }\n                else if( hasBody && isElement(xmlData, i))  i += 8;//Not supported\n                else if( hasBody && isAttlist(xmlData, i))  i += 8;//Not supported\n                else if( hasBody && isNotation(xmlData, i)) i += 9;//Not supported\n                else if( isComment)                         comment = true;\n                else                                        throw new Error(\"Invalid DOCTYPE\");\n\n                angleBracketsCount++;\n                exp = \"\";\n            } else if (xmlData[i] === '>') { //Read tag content\n                if(comment){\n                    if( xmlData[i - 1] === \"-\" && xmlData[i - 2] === \"-\"){\n                        comment = false;\n                        angleBracketsCount--;\n                    }\n                }else {\n                    angleBracketsCount--;\n                }\n                if (angleBracketsCount === 0) {\n                  break;\n                }\n            }else if( xmlData[i] === '['){\n                hasBody = true;\n            }else {\n                exp += xmlData[i];\n            }\n        }\n        if(angleBracketsCount !== 0){\n            throw new Error(`Unclosed DOCTYPE`);\n        }\n    }else {\n        throw new Error(`Invalid Tag instead of DOCTYPE`);\n    }\n    return {entities, i};\n}\n\nfunction readEntityExp(xmlData,i){\n    //External entities are not supported\n    //    <!ENTITY ext SYSTEM \"http://normal-website.com\" >\n\n    //Parameter entities are not supported\n    //    <!ENTITY entityname \"&anotherElement;\">\n\n    //Internal entities are supported\n    //    <!ENTITY entityname \"replacement text\">\n    \n    //read EntityName\n    let entityName = \"\";\n    for (; i < xmlData.length && (xmlData[i] !== \"'\" && xmlData[i] !== '\"' ); i++) {\n        // if(xmlData[i] === \" \") continue;\n        // else \n        entityName += xmlData[i];\n    }\n    entityName = entityName.trim();\n    if(entityName.indexOf(\" \") !== -1) throw new Error(\"External entites are not supported\");\n\n    //read Entity Value\n    const startChar = xmlData[i++];\n    let val = \"\";\n    for (; i < xmlData.length && xmlData[i] !== startChar ; i++) {\n        val += xmlData[i];\n    }\n    return [entityName, val, i];\n}\n\nfunction isComment(xmlData, i){\n    if(xmlData[i+1] === '!' &&\n    xmlData[i+2] === '-' &&\n    xmlData[i+3] === '-') return true\n    return false\n}\nfunction isEntity(xmlData, i){\n    if(xmlData[i+1] === '!' &&\n    xmlData[i+2] === 'E' &&\n    xmlData[i+3] === 'N' &&\n    xmlData[i+4] === 'T' &&\n    xmlData[i+5] === 'I' &&\n    xmlData[i+6] === 'T' &&\n    xmlData[i+7] === 'Y') return true\n    return false\n}\nfunction isElement(xmlData, i){\n    if(xmlData[i+1] === '!' &&\n    xmlData[i+2] === 'E' &&\n    xmlData[i+3] === 'L' &&\n    xmlData[i+4] === 'E' &&\n    xmlData[i+5] === 'M' &&\n    xmlData[i+6] === 'E' &&\n    xmlData[i+7] === 'N' &&\n    xmlData[i+8] === 'T') return true\n    return false\n}\n\nfunction isAttlist(xmlData, i){\n    if(xmlData[i+1] === '!' &&\n    xmlData[i+2] === 'A' &&\n    xmlData[i+3] === 'T' &&\n    xmlData[i+4] === 'T' &&\n    xmlData[i+5] === 'L' &&\n    xmlData[i+6] === 'I' &&\n    xmlData[i+7] === 'S' &&\n    xmlData[i+8] === 'T') return true\n    return false\n}\nfunction isNotation(xmlData, i){\n    if(xmlData[i+1] === '!' &&\n    xmlData[i+2] === 'N' &&\n    xmlData[i+3] === 'O' &&\n    xmlData[i+4] === 'T' &&\n    xmlData[i+5] === 'A' &&\n    xmlData[i+6] === 'T' &&\n    xmlData[i+7] === 'I' &&\n    xmlData[i+8] === 'O' &&\n    xmlData[i+9] === 'N') return true\n    return false\n}\n\nfunction validateEntityName(name){\n    if (util.isName(name))\n\treturn name;\n    else\n        throw new Error(`Invalid entity name ${name}`);\n}\n\nvar DocTypeReader = readDocType;\n\nconst hexRegex = /^[-+]?0x[a-fA-F0-9]+$/;\nconst numRegex = /^([\\-\\+])?(0*)(\\.[0-9]+([eE]\\-?[0-9]+)?|[0-9]+(\\.[0-9]+([eE]\\-?[0-9]+)?)?)$/;\n// const octRegex = /0x[a-z0-9]+/;\n// const binRegex = /0x[a-z0-9]+/;\n\n\n//polyfill\nif (!Number.parseInt && window.parseInt) {\n    Number.parseInt = window.parseInt;\n}\nif (!Number.parseFloat && window.parseFloat) {\n    Number.parseFloat = window.parseFloat;\n}\n\n  \nconst consider = {\n    hex :  true,\n    leadingZeros: true,\n    decimalPoint: \"\\.\",\n    eNotation: true\n    //skipLike: /regex/\n};\n\nfunction toNumber(str, options = {}){\n    // const options = Object.assign({}, consider);\n    // if(opt.leadingZeros === false){\n    //     options.leadingZeros = false;\n    // }else if(opt.hex === false){\n    //     options.hex = false;\n    // }\n\n    options = Object.assign({}, consider, options );\n    if(!str || typeof str !== \"string\" ) return str;\n    \n    let trimmedStr  = str.trim();\n    // if(trimmedStr === \"0.0\") return 0;\n    // else if(trimmedStr === \"+0.0\") return 0;\n    // else if(trimmedStr === \"-0.0\") return -0;\n\n    if(options.skipLike !== undefined && options.skipLike.test(trimmedStr)) return str;\n    else if (options.hex && hexRegex.test(trimmedStr)) {\n        return Number.parseInt(trimmedStr, 16);\n    // } else if (options.parseOct && octRegex.test(str)) {\n    //     return Number.parseInt(val, 8);\n    // }else if (options.parseBin && binRegex.test(str)) {\n    //     return Number.parseInt(val, 2);\n    }else {\n        //separate negative sign, leading zeros, and rest number\n        const match = numRegex.exec(trimmedStr);\n        if(match){\n            const sign = match[1];\n            const leadingZeros = match[2];\n            let numTrimmedByZeros = trimZeros(match[3]); //complete num without leading zeros\n            //trim ending zeros for floating number\n            \n            const eNotation = match[4] || match[6];\n            if(!options.leadingZeros && leadingZeros.length > 0 && sign && trimmedStr[2] !== \".\") return str; //-0123\n            else if(!options.leadingZeros && leadingZeros.length > 0 && !sign && trimmedStr[1] !== \".\") return str; //0123\n            else {//no leading zeros or leading zeros are allowed\n                const num = Number(trimmedStr);\n                const numStr = \"\" + num;\n                if(numStr.search(/[eE]/) !== -1){ //given number is long and parsed to eNotation\n                    if(options.eNotation) return num;\n                    else return str;\n                }else if(eNotation){ //given number has enotation\n                    if(options.eNotation) return num;\n                    else return str;\n                }else if(trimmedStr.indexOf(\".\") !== -1){ //floating number\n                    // const decimalPart = match[5].substr(1);\n                    // const intPart = trimmedStr.substr(0,trimmedStr.indexOf(\".\"));\n\n                    \n                    // const p = numStr.indexOf(\".\");\n                    // const givenIntPart = numStr.substr(0,p);\n                    // const givenDecPart = numStr.substr(p+1);\n                    if(numStr === \"0\" && (numTrimmedByZeros === \"\") ) return num; //0.0\n                    else if(numStr === numTrimmedByZeros) return num; //0.456. 0.79000\n                    else if( sign && numStr === \"-\"+numTrimmedByZeros) return num;\n                    else return str;\n                }\n                \n                if(leadingZeros){\n                    // if(numTrimmedByZeros === numStr){\n                    //     if(options.leadingZeros) return num;\n                    //     else return str;\n                    // }else return str;\n                    if(numTrimmedByZeros === numStr) return num;\n                    else if(sign+numTrimmedByZeros === numStr) return num;\n                    else return str;\n                }\n\n                if(trimmedStr === numStr) return num;\n                else if(trimmedStr === sign+numStr) return num;\n                // else{\n                //     //number with +/- sign\n                //     trimmedStr.test(/[-+][0-9]);\n\n                // }\n                return str;\n            }\n            // else if(!eNotation && trimmedStr && trimmedStr !== Number(trimmedStr) ) return str;\n            \n        }else { //non-numeric string\n            return str;\n        }\n    }\n}\n\n/**\n * \n * @param {string} numStr without leading zeros\n * @returns \n */\nfunction trimZeros(numStr){\n    if(numStr && numStr.indexOf(\".\") !== -1){//float\n        numStr = numStr.replace(/0+$/, \"\"); //remove ending zeros\n        if(numStr === \".\")  numStr = \"0\";\n        else if(numStr[0] === \".\")  numStr = \"0\"+numStr;\n        else if(numStr[numStr.length-1] === \".\")  numStr = numStr.substr(0,numStr.length-1);\n        return numStr;\n    }\n    return numStr;\n}\nvar strnum = toNumber;\n\n///@ts-check\n\n\n\n\n\n\nconst regx =\n  '<((!\\\\[CDATA\\\\[([\\\\s\\\\S]*?)(]]>))|((NAME:)?(NAME))([^>]*)>|((\\\\/)(NAME)\\\\s*>))([^<]*)'\n  .replace(/NAME/g, util.nameRegexp);\n\n//const tagsRegx = new RegExp(\"<(\\\\/?[\\\\w:\\\\-\\._]+)([^>]*)>(\\\\s*\"+cdataRegx+\")*([^<]+)?\",\"g\");\n//const tagsRegx = new RegExp(\"<(\\\\/?)((\\\\w*:)?([\\\\w:\\\\-\\._]+))([^>]*)>([^<]*)(\"+cdataRegx+\"([^<]*))*([^<]+)?\",\"g\");\n\nclass OrderedObjParser{\n  constructor(options){\n    this.options = options;\n    this.currentNode = null;\n    this.tagsNodeStack = [];\n    this.docTypeEntities = {};\n    this.lastEntities = {\n      \"apos\" : { regex: /&(apos|#39|#x27);/g, val : \"'\"},\n      \"gt\" : { regex: /&(gt|#62|#x3E);/g, val : \">\"},\n      \"lt\" : { regex: /&(lt|#60|#x3C);/g, val : \"<\"},\n      \"quot\" : { regex: /&(quot|#34|#x22);/g, val : \"\\\"\"},\n    };\n    this.ampEntity = { regex: /&(amp|#38|#x26);/g, val : \"&\"};\n    this.htmlEntities = {\n      \"space\": { regex: /&(nbsp|#160);/g, val: \" \" },\n      // \"lt\" : { regex: /&(lt|#60);/g, val: \"<\" },\n      // \"gt\" : { regex: /&(gt|#62);/g, val: \">\" },\n      // \"amp\" : { regex: /&(amp|#38);/g, val: \"&\" },\n      // \"quot\" : { regex: /&(quot|#34);/g, val: \"\\\"\" },\n      // \"apos\" : { regex: /&(apos|#39);/g, val: \"'\" },\n      \"cent\" : { regex: /&(cent|#162);/g, val: \"¢\" },\n      \"pound\" : { regex: /&(pound|#163);/g, val: \"£\" },\n      \"yen\" : { regex: /&(yen|#165);/g, val: \"¥\" },\n      \"euro\" : { regex: /&(euro|#8364);/g, val: \"€\" },\n      \"copyright\" : { regex: /&(copy|#169);/g, val: \"©\" },\n      \"reg\" : { regex: /&(reg|#174);/g, val: \"®\" },\n      \"inr\" : { regex: /&(inr|#8377);/g, val: \"₹\" },\n    };\n    this.addExternalEntities = addExternalEntities;\n    this.parseXml = parseXml;\n    this.parseTextData = parseTextData;\n    this.resolveNameSpace = resolveNameSpace;\n    this.buildAttributesMap = buildAttributesMap;\n    this.isItStopNode = isItStopNode;\n    this.replaceEntitiesValue = replaceEntitiesValue;\n    this.readStopNodeData = readStopNodeData;\n    this.saveTextToParentTag = saveTextToParentTag;\n    this.addChild = addChild;\n  }\n\n}\n\nfunction addExternalEntities(externalEntities){\n  const entKeys = Object.keys(externalEntities);\n  for (let i = 0; i < entKeys.length; i++) {\n    const ent = entKeys[i];\n    this.lastEntities[ent] = {\n       regex: new RegExp(\"&\"+ent+\";\",\"g\"),\n       val : externalEntities[ent]\n    };\n  }\n}\n\n/**\n * @param {string} val\n * @param {string} tagName\n * @param {string} jPath\n * @param {boolean} dontTrim\n * @param {boolean} hasAttributes\n * @param {boolean} isLeafNode\n * @param {boolean} escapeEntities\n */\nfunction parseTextData(val, tagName, jPath, dontTrim, hasAttributes, isLeafNode, escapeEntities) {\n  if (val !== undefined) {\n    if (this.options.trimValues && !dontTrim) {\n      val = val.trim();\n    }\n    if(val.length > 0){\n      if(!escapeEntities) val = this.replaceEntitiesValue(val);\n      \n      const newval = this.options.tagValueProcessor(tagName, val, jPath, hasAttributes, isLeafNode);\n      if(newval === null || newval === undefined){\n        //don't parse\n        return val;\n      }else if(typeof newval !== typeof val || newval !== val){\n        //overwrite\n        return newval;\n      }else if(this.options.trimValues){\n        return parseValue(val, this.options.parseTagValue, this.options.numberParseOptions);\n      }else {\n        const trimmedVal = val.trim();\n        if(trimmedVal === val){\n          return parseValue(val, this.options.parseTagValue, this.options.numberParseOptions);\n        }else {\n          return val;\n        }\n      }\n    }\n  }\n}\n\nfunction resolveNameSpace(tagname) {\n  if (this.options.removeNSPrefix) {\n    const tags = tagname.split(':');\n    const prefix = tagname.charAt(0) === '/' ? '/' : '';\n    if (tags[0] === 'xmlns') {\n      return '';\n    }\n    if (tags.length === 2) {\n      tagname = prefix + tags[1];\n    }\n  }\n  return tagname;\n}\n\n//TODO: change regex to capture NS\n//const attrsRegx = new RegExp(\"([\\\\w\\\\-\\\\.\\\\:]+)\\\\s*=\\\\s*(['\\\"])((.|\\n)*?)\\\\2\",\"gm\");\nconst attrsRegx = new RegExp('([^\\\\s=]+)\\\\s*(=\\\\s*([\\'\"])([\\\\s\\\\S]*?)\\\\3)?', 'gm');\n\nfunction buildAttributesMap(attrStr, jPath, tagName) {\n  if (!this.options.ignoreAttributes && typeof attrStr === 'string') {\n    // attrStr = attrStr.replace(/\\r?\\n/g, ' ');\n    //attrStr = attrStr || attrStr.trim();\n\n    const matches = util.getAllMatches(attrStr, attrsRegx);\n    const len = matches.length; //don't make it inline\n    const attrs = {};\n    for (let i = 0; i < len; i++) {\n      const attrName = this.resolveNameSpace(matches[i][1]);\n      let oldVal = matches[i][4];\n      let aName = this.options.attributeNamePrefix + attrName;\n      if (attrName.length) {\n        if (this.options.transformAttributeName) {\n          aName = this.options.transformAttributeName(aName);\n        }\n        if(aName === \"__proto__\") aName  = \"#__proto__\";\n        if (oldVal !== undefined) {\n          if (this.options.trimValues) {\n            oldVal = oldVal.trim();\n          }\n          oldVal = this.replaceEntitiesValue(oldVal);\n          const newVal = this.options.attributeValueProcessor(attrName, oldVal, jPath);\n          if(newVal === null || newVal === undefined){\n            //don't parse\n            attrs[aName] = oldVal;\n          }else if(typeof newVal !== typeof oldVal || newVal !== oldVal){\n            //overwrite\n            attrs[aName] = newVal;\n          }else {\n            //parse\n            attrs[aName] = parseValue(\n              oldVal,\n              this.options.parseAttributeValue,\n              this.options.numberParseOptions\n            );\n          }\n        } else if (this.options.allowBooleanAttributes) {\n          attrs[aName] = true;\n        }\n      }\n    }\n    if (!Object.keys(attrs).length) {\n      return;\n    }\n    if (this.options.attributesGroupName) {\n      const attrCollection = {};\n      attrCollection[this.options.attributesGroupName] = attrs;\n      return attrCollection;\n    }\n    return attrs\n  }\n}\n\nconst parseXml = function(xmlData) {\n  xmlData = xmlData.replace(/\\r\\n?/g, \"\\n\"); //TODO: remove this line\n  const xmlObj = new xmlNode('!xml');\n  let currentNode = xmlObj;\n  let textData = \"\";\n  let jPath = \"\";\n  for(let i=0; i< xmlData.length; i++){//for each char in XML data\n    const ch = xmlData[i];\n    if(ch === '<'){\n      // const nextIndex = i+1;\n      // const _2ndChar = xmlData[nextIndex];\n      if( xmlData[i+1] === '/') {//Closing Tag\n        const closeIndex = findClosingIndex(xmlData, \">\", i, \"Closing Tag is not closed.\");\n        let tagName = xmlData.substring(i+2,closeIndex).trim();\n\n        if(this.options.removeNSPrefix){\n          const colonIndex = tagName.indexOf(\":\");\n          if(colonIndex !== -1){\n            tagName = tagName.substr(colonIndex+1);\n          }\n        }\n\n        if(this.options.transformTagName) {\n          tagName = this.options.transformTagName(tagName);\n        }\n\n        if(currentNode){\n          textData = this.saveTextToParentTag(textData, currentNode, jPath);\n        }\n\n        //check if last tag of nested tag was unpaired tag\n        const lastTagName = jPath.substring(jPath.lastIndexOf(\".\")+1);\n        if(tagName && this.options.unpairedTags.indexOf(tagName) !== -1 ){\n          throw new Error(`Unpaired tag can not be used as closing tag: </${tagName}>`);\n        }\n        let propIndex = 0;\n        if(lastTagName && this.options.unpairedTags.indexOf(lastTagName) !== -1 ){\n          propIndex = jPath.lastIndexOf('.', jPath.lastIndexOf('.')-1);\n          this.tagsNodeStack.pop();\n        }else {\n          propIndex = jPath.lastIndexOf(\".\");\n        }\n        jPath = jPath.substring(0, propIndex);\n\n        currentNode = this.tagsNodeStack.pop();//avoid recursion, set the parent tag scope\n        textData = \"\";\n        i = closeIndex;\n      } else if( xmlData[i+1] === '?') {\n\n        let tagData = readTagExp(xmlData,i, false, \"?>\");\n        if(!tagData) throw new Error(\"Pi Tag is not closed.\");\n\n        textData = this.saveTextToParentTag(textData, currentNode, jPath);\n        if( (this.options.ignoreDeclaration && tagData.tagName === \"?xml\") || this.options.ignorePiTags);else {\n  \n          const childNode = new xmlNode(tagData.tagName);\n          childNode.add(this.options.textNodeName, \"\");\n          \n          if(tagData.tagName !== tagData.tagExp && tagData.attrExpPresent){\n            childNode[\":@\"] = this.buildAttributesMap(tagData.tagExp, jPath, tagData.tagName);\n          }\n          this.addChild(currentNode, childNode, jPath);\n\n        }\n\n\n        i = tagData.closeIndex + 1;\n      } else if(xmlData.substr(i + 1, 3) === '!--') {\n        const endIndex = findClosingIndex(xmlData, \"-->\", i+4, \"Comment is not closed.\");\n        if(this.options.commentPropName){\n          const comment = xmlData.substring(i + 4, endIndex - 2);\n\n          textData = this.saveTextToParentTag(textData, currentNode, jPath);\n\n          currentNode.add(this.options.commentPropName, [ { [this.options.textNodeName] : comment } ]);\n        }\n        i = endIndex;\n      } else if( xmlData.substr(i + 1, 2) === '!D') {\n        const result = DocTypeReader(xmlData, i);\n        this.docTypeEntities = result.entities;\n        i = result.i;\n      }else if(xmlData.substr(i + 1, 2) === '![') {\n        const closeIndex = findClosingIndex(xmlData, \"]]>\", i, \"CDATA is not closed.\") - 2;\n        const tagExp = xmlData.substring(i + 9,closeIndex);\n\n        textData = this.saveTextToParentTag(textData, currentNode, jPath);\n\n        //cdata should be set even if it is 0 length string\n        if(this.options.cdataPropName){\n          // let val = this.parseTextData(tagExp, this.options.cdataPropName, jPath + \".\" + this.options.cdataPropName, true, false, true);\n          // if(!val) val = \"\";\n          currentNode.add(this.options.cdataPropName, [ { [this.options.textNodeName] : tagExp } ]);\n        }else {\n          let val = this.parseTextData(tagExp, currentNode.tagname, jPath, true, false, true);\n          if(val == undefined) val = \"\";\n          currentNode.add(this.options.textNodeName, val);\n        }\n        \n        i = closeIndex + 2;\n      }else {//Opening tag\n        let result = readTagExp(xmlData,i, this.options.removeNSPrefix);\n        let tagName= result.tagName;\n        let tagExp = result.tagExp;\n        let attrExpPresent = result.attrExpPresent;\n        let closeIndex = result.closeIndex;\n\n        if (this.options.transformTagName) {\n          tagName = this.options.transformTagName(tagName);\n        }\n        \n        //save text as child node\n        if (currentNode && textData) {\n          if(currentNode.tagname !== '!xml'){\n            //when nested tag is found\n            textData = this.saveTextToParentTag(textData, currentNode, jPath, false);\n          }\n        }\n\n        //check if last tag was unpaired tag\n        const lastTag = currentNode;\n        if(lastTag && this.options.unpairedTags.indexOf(lastTag.tagname) !== -1 ){\n          currentNode = this.tagsNodeStack.pop();\n          jPath = jPath.substring(0, jPath.lastIndexOf(\".\"));\n        }\n        if(tagName !== xmlObj.tagname){\n          jPath += jPath ? \".\" + tagName : tagName;\n        }\n        if (this.isItStopNode(this.options.stopNodes, jPath, tagName)) { //TODO: namespace\n          let tagContent = \"\";\n          //self-closing tag\n          if(tagExp.length > 0 && tagExp.lastIndexOf(\"/\") === tagExp.length - 1){\n            i = result.closeIndex;\n          }\n          //unpaired tag\n          else if(this.options.unpairedTags.indexOf(tagName) !== -1){\n            i = result.closeIndex;\n          }\n          //normal tag\n          else {\n            //read until closing tag is found\n            const result = this.readStopNodeData(xmlData, tagName, closeIndex + 1);\n            if(!result) throw new Error(`Unexpected end of ${tagName}`);\n            i = result.i;\n            tagContent = result.tagContent;\n          }\n\n          const childNode = new xmlNode(tagName);\n          if(tagName !== tagExp && attrExpPresent){\n            childNode[\":@\"] = this.buildAttributesMap(tagExp, jPath, tagName);\n          }\n          if(tagContent) {\n            tagContent = this.parseTextData(tagContent, tagName, jPath, true, attrExpPresent, true, true);\n          }\n          \n          jPath = jPath.substr(0, jPath.lastIndexOf(\".\"));\n          childNode.add(this.options.textNodeName, tagContent);\n          \n          this.addChild(currentNode, childNode, jPath);\n        }else {\n  //selfClosing tag\n          if(tagExp.length > 0 && tagExp.lastIndexOf(\"/\") === tagExp.length - 1){\n            if(tagName[tagName.length - 1] === \"/\"){ //remove trailing '/'\n              tagName = tagName.substr(0, tagName.length - 1);\n              tagExp = tagName;\n            }else {\n              tagExp = tagExp.substr(0, tagExp.length - 1);\n            }\n            \n            if(this.options.transformTagName) {\n              tagName = this.options.transformTagName(tagName);\n            }\n\n            const childNode = new xmlNode(tagName);\n            if(tagName !== tagExp && attrExpPresent){\n              childNode[\":@\"] = this.buildAttributesMap(tagExp, jPath, tagName);\n            }\n            this.addChild(currentNode, childNode, jPath);\n            jPath = jPath.substr(0, jPath.lastIndexOf(\".\"));\n          }\n    //opening tag\n          else {\n            const childNode = new xmlNode( tagName);\n            this.tagsNodeStack.push(currentNode);\n            \n            if(tagName !== tagExp && attrExpPresent){\n              childNode[\":@\"] = this.buildAttributesMap(tagExp, jPath, tagName);\n            }\n            this.addChild(currentNode, childNode, jPath);\n            currentNode = childNode;\n          }\n          textData = \"\";\n          i = closeIndex;\n        }\n      }\n    }else {\n      textData += xmlData[i];\n    }\n  }\n  return xmlObj.child;\n};\n\nfunction addChild(currentNode, childNode, jPath){\n  const result = this.options.updateTag(childNode.tagname, jPath, childNode[\":@\"]);\n  if(result === false);else if(typeof result === \"string\"){\n    childNode.tagname = result;\n    currentNode.addChild(childNode);\n  }else {\n    currentNode.addChild(childNode);\n  }\n}\n\nconst replaceEntitiesValue = function(val){\n\n  if(this.options.processEntities){\n    for(let entityName in this.docTypeEntities){\n      const entity = this.docTypeEntities[entityName];\n      val = val.replace( entity.regx, entity.val);\n    }\n    for(let entityName in this.lastEntities){\n      const entity = this.lastEntities[entityName];\n      val = val.replace( entity.regex, entity.val);\n    }\n    if(this.options.htmlEntities){\n      for(let entityName in this.htmlEntities){\n        const entity = this.htmlEntities[entityName];\n        val = val.replace( entity.regex, entity.val);\n      }\n    }\n    val = val.replace( this.ampEntity.regex, this.ampEntity.val);\n  }\n  return val;\n};\nfunction saveTextToParentTag(textData, currentNode, jPath, isLeafNode) {\n  if (textData) { //store previously collected data as textNode\n    if(isLeafNode === undefined) isLeafNode = Object.keys(currentNode.child).length === 0;\n    \n    textData = this.parseTextData(textData,\n      currentNode.tagname,\n      jPath,\n      false,\n      currentNode[\":@\"] ? Object.keys(currentNode[\":@\"]).length !== 0 : false,\n      isLeafNode);\n\n    if (textData !== undefined && textData !== \"\")\n      currentNode.add(this.options.textNodeName, textData);\n    textData = \"\";\n  }\n  return textData;\n}\n\n//TODO: use jPath to simplify the logic\n/**\n * \n * @param {string[]} stopNodes \n * @param {string} jPath\n * @param {string} currentTagName \n */\nfunction isItStopNode(stopNodes, jPath, currentTagName){\n  const allNodesExp = \"*.\" + currentTagName;\n  for (const stopNodePath in stopNodes) {\n    const stopNodeExp = stopNodes[stopNodePath];\n    if( allNodesExp === stopNodeExp || jPath === stopNodeExp  ) return true;\n  }\n  return false;\n}\n\n/**\n * Returns the tag Expression and where it is ending handling single-double quotes situation\n * @param {string} xmlData \n * @param {number} i starting index\n * @returns \n */\nfunction tagExpWithClosingIndex(xmlData, i, closingChar = \">\"){\n  let attrBoundary;\n  let tagExp = \"\";\n  for (let index = i; index < xmlData.length; index++) {\n    let ch = xmlData[index];\n    if (attrBoundary) {\n        if (ch === attrBoundary) attrBoundary = \"\";//reset\n    } else if (ch === '\"' || ch === \"'\") {\n        attrBoundary = ch;\n    } else if (ch === closingChar[0]) {\n      if(closingChar[1]){\n        if(xmlData[index + 1] === closingChar[1]){\n          return {\n            data: tagExp,\n            index: index\n          }\n        }\n      }else {\n        return {\n          data: tagExp,\n          index: index\n        }\n      }\n    } else if (ch === '\\t') {\n      ch = \" \";\n    }\n    tagExp += ch;\n  }\n}\n\nfunction findClosingIndex(xmlData, str, i, errMsg){\n  const closingIndex = xmlData.indexOf(str, i);\n  if(closingIndex === -1){\n    throw new Error(errMsg)\n  }else {\n    return closingIndex + str.length - 1;\n  }\n}\n\nfunction readTagExp(xmlData,i, removeNSPrefix, closingChar = \">\"){\n  const result = tagExpWithClosingIndex(xmlData, i+1, closingChar);\n  if(!result) return;\n  let tagExp = result.data;\n  const closeIndex = result.index;\n  const separatorIndex = tagExp.search(/\\s/);\n  let tagName = tagExp;\n  let attrExpPresent = true;\n  if(separatorIndex !== -1){//separate tag name and attributes expression\n    tagName = tagExp.substr(0, separatorIndex).replace(/\\s\\s*$/, '');\n    tagExp = tagExp.substr(separatorIndex + 1);\n  }\n\n  if(removeNSPrefix){\n    const colonIndex = tagName.indexOf(\":\");\n    if(colonIndex !== -1){\n      tagName = tagName.substr(colonIndex+1);\n      attrExpPresent = tagName !== result.data.substr(colonIndex + 1);\n    }\n  }\n\n  return {\n    tagName: tagName,\n    tagExp: tagExp,\n    closeIndex: closeIndex,\n    attrExpPresent: attrExpPresent,\n  }\n}\n/**\n * find paired tag for a stop node\n * @param {string} xmlData \n * @param {string} tagName \n * @param {number} i \n */\nfunction readStopNodeData(xmlData, tagName, i){\n  const startIndex = i;\n  // Starting at 1 since we already have an open tag\n  let openTagCount = 1;\n\n  for (; i < xmlData.length; i++) {\n    if( xmlData[i] === \"<\"){ \n      if (xmlData[i+1] === \"/\") {//close tag\n          const closeIndex = findClosingIndex(xmlData, \">\", i, `${tagName} is not closed`);\n          let closeTagName = xmlData.substring(i+2,closeIndex).trim();\n          if(closeTagName === tagName){\n            openTagCount--;\n            if (openTagCount === 0) {\n              return {\n                tagContent: xmlData.substring(startIndex, i),\n                i : closeIndex\n              }\n            }\n          }\n          i=closeIndex;\n        } else if(xmlData[i+1] === '?') { \n          const closeIndex = findClosingIndex(xmlData, \"?>\", i+1, \"StopNode is not closed.\");\n          i=closeIndex;\n        } else if(xmlData.substr(i + 1, 3) === '!--') { \n          const closeIndex = findClosingIndex(xmlData, \"-->\", i+3, \"StopNode is not closed.\");\n          i=closeIndex;\n        } else if(xmlData.substr(i + 1, 2) === '![') { \n          const closeIndex = findClosingIndex(xmlData, \"]]>\", i, \"StopNode is not closed.\") - 2;\n          i=closeIndex;\n        } else {\n          const tagData = readTagExp(xmlData, i, '>');\n\n          if (tagData) {\n            const openTagName = tagData && tagData.tagName;\n            if (openTagName === tagName && tagData.tagExp[tagData.tagExp.length-1] !== \"/\") {\n              openTagCount++;\n            }\n            i=tagData.closeIndex;\n          }\n        }\n      }\n  }//end for loop\n}\n\nfunction parseValue(val, shouldParse, options) {\n  if (shouldParse && typeof val === 'string') {\n    //console.log(options)\n    const newval = val.trim();\n    if(newval === 'true' ) return true;\n    else if(newval === 'false' ) return false;\n    else return strnum(val, options);\n  } else {\n    if (util.isExist(val)) {\n      return val;\n    } else {\n      return '';\n    }\n  }\n}\n\n\nvar OrderedObjParser_1 = OrderedObjParser;\n\n/**\n * \n * @param {array} node \n * @param {any} options \n * @returns \n */\nfunction prettify(node, options){\n  return compress( node, options);\n}\n\n/**\n * \n * @param {array} arr \n * @param {object} options \n * @param {string} jPath \n * @returns object\n */\nfunction compress(arr, options, jPath){\n  let text;\n  const compressedObj = {};\n  for (let i = 0; i < arr.length; i++) {\n    const tagObj = arr[i];\n    const property = propName(tagObj);\n    let newJpath = \"\";\n    if(jPath === undefined) newJpath = property;\n    else newJpath = jPath + \".\" + property;\n\n    if(property === options.textNodeName){\n      if(text === undefined) text = tagObj[property];\n      else text += \"\" + tagObj[property];\n    }else if(property === undefined){\n      continue;\n    }else if(tagObj[property]){\n      \n      let val = compress(tagObj[property], options, newJpath);\n      const isLeaf = isLeafTag(val, options);\n\n      if(tagObj[\":@\"]){\n        assignAttributes( val, tagObj[\":@\"], newJpath, options);\n      }else if(Object.keys(val).length === 1 && val[options.textNodeName] !== undefined && !options.alwaysCreateTextNode){\n        val = val[options.textNodeName];\n      }else if(Object.keys(val).length === 0){\n        if(options.alwaysCreateTextNode) val[options.textNodeName] = \"\";\n        else val = \"\";\n      }\n\n      if(compressedObj[property] !== undefined && compressedObj.hasOwnProperty(property)) {\n        if(!Array.isArray(compressedObj[property])) {\n            compressedObj[property] = [ compressedObj[property] ];\n        }\n        compressedObj[property].push(val);\n      }else {\n        //TODO: if a node is not an array, then check if it should be an array\n        //also determine if it is a leaf node\n        if (options.isArray(property, newJpath, isLeaf )) {\n          compressedObj[property] = [val];\n        }else {\n          compressedObj[property] = val;\n        }\n      }\n    }\n    \n  }\n  // if(text && text.length > 0) compressedObj[options.textNodeName] = text;\n  if(typeof text === \"string\"){\n    if(text.length > 0) compressedObj[options.textNodeName] = text;\n  }else if(text !== undefined) compressedObj[options.textNodeName] = text;\n  return compressedObj;\n}\n\nfunction propName(obj){\n  const keys = Object.keys(obj);\n  for (let i = 0; i < keys.length; i++) {\n    const key = keys[i];\n    if(key !== \":@\") return key;\n  }\n}\n\nfunction assignAttributes(obj, attrMap, jpath, options){\n  if (attrMap) {\n    const keys = Object.keys(attrMap);\n    const len = keys.length; //don't make it inline\n    for (let i = 0; i < len; i++) {\n      const atrrName = keys[i];\n      if (options.isArray(atrrName, jpath + \".\" + atrrName, true, true)) {\n        obj[atrrName] = [ attrMap[atrrName] ];\n      } else {\n        obj[atrrName] = attrMap[atrrName];\n      }\n    }\n  }\n}\n\nfunction isLeafTag(obj, options){\n  const { textNodeName } = options;\n  const propCount = Object.keys(obj).length;\n  \n  if (propCount === 0) {\n    return true;\n  }\n\n  if (\n    propCount === 1 &&\n    (obj[textNodeName] || typeof obj[textNodeName] === \"boolean\" || obj[textNodeName] === 0)\n  ) {\n    return true;\n  }\n\n  return false;\n}\nvar prettify_1 = prettify;\n\nvar node2json = {\n\tprettify: prettify_1\n};\n\nconst { buildOptions: buildOptions$1} = OptionsBuilder;\n\nconst { prettify: prettify$1} = node2json;\n\n\nclass XMLParser{\n    \n    constructor(options){\n        this.externalEntities = {};\n        this.options = buildOptions$1(options);\n        \n    }\n    /**\n     * Parse XML dats to JS object \n     * @param {string|Buffer} xmlData \n     * @param {boolean|Object} validationOption \n     */\n    parse(xmlData,validationOption){\n        if(typeof xmlData === \"string\");else if( xmlData.toString){\n            xmlData = xmlData.toString();\n        }else {\n            throw new Error(\"XML data is accepted in String or Bytes[] form.\")\n        }\n        if( validationOption){\n            if(validationOption === true) validationOption = {}; //validate with default options\n            \n            const result = validator.validate(xmlData, validationOption);\n            if (result !== true) {\n              throw Error( `${result.err.msg}:${result.err.line}:${result.err.col}` )\n            }\n          }\n        const orderedObjParser = new OrderedObjParser_1(this.options);\n        orderedObjParser.addExternalEntities(this.externalEntities);\n        const orderedResult = orderedObjParser.parseXml(xmlData);\n        if(this.options.preserveOrder || orderedResult === undefined) return orderedResult;\n        else return prettify$1(orderedResult, this.options);\n    }\n\n    /**\n     * Add Entity which is not by default supported by this library\n     * @param {string} key \n     * @param {string} value \n     */\n    addEntity(key, value){\n        if(value.indexOf(\"&\") !== -1){\n            throw new Error(\"Entity value can't have '&'\")\n        }else if(key.indexOf(\"&\") !== -1 || key.indexOf(\";\") !== -1){\n            throw new Error(\"An entity must be set without '&' and ';'. Eg. use '#xD' for '&#xD;'\")\n        }else if(value === \"&\"){\n            throw new Error(\"An entity with value '&' is not permitted\");\n        }else {\n            this.externalEntities[key] = value;\n        }\n    }\n}\n\nvar XMLParser_1 = XMLParser;\n\nconst EOL = \"\\n\";\n\n/**\n * \n * @param {array} jArray \n * @param {any} options \n * @returns \n */\nfunction toXml(jArray, options) {\n    let indentation = \"\";\n    if (options.format && options.indentBy.length > 0) {\n        indentation = EOL;\n    }\n    return arrToStr(jArray, options, \"\", indentation);\n}\n\nfunction arrToStr(arr, options, jPath, indentation) {\n    let xmlStr = \"\";\n    let isPreviousElementTag = false;\n\n    for (let i = 0; i < arr.length; i++) {\n        const tagObj = arr[i];\n        const tagName = propName$1(tagObj);\n        let newJPath = \"\";\n        if (jPath.length === 0) newJPath = tagName;\n        else newJPath = `${jPath}.${tagName}`;\n\n        if (tagName === options.textNodeName) {\n            let tagText = tagObj[tagName];\n            if (!isStopNode(newJPath, options)) {\n                tagText = options.tagValueProcessor(tagName, tagText);\n                tagText = replaceEntitiesValue$1(tagText, options);\n            }\n            if (isPreviousElementTag) {\n                xmlStr += indentation;\n            }\n            xmlStr += tagText;\n            isPreviousElementTag = false;\n            continue;\n        } else if (tagName === options.cdataPropName) {\n            if (isPreviousElementTag) {\n                xmlStr += indentation;\n            }\n            xmlStr += `<![CDATA[${tagObj[tagName][0][options.textNodeName]}]]>`;\n            isPreviousElementTag = false;\n            continue;\n        } else if (tagName === options.commentPropName) {\n            xmlStr += indentation + `<!--${tagObj[tagName][0][options.textNodeName]}-->`;\n            isPreviousElementTag = true;\n            continue;\n        } else if (tagName[0] === \"?\") {\n            const attStr = attr_to_str(tagObj[\":@\"], options);\n            const tempInd = tagName === \"?xml\" ? \"\" : indentation;\n            let piTextNodeName = tagObj[tagName][0][options.textNodeName];\n            piTextNodeName = piTextNodeName.length !== 0 ? \" \" + piTextNodeName : \"\"; //remove extra spacing\n            xmlStr += tempInd + `<${tagName}${piTextNodeName}${attStr}?>`;\n            isPreviousElementTag = true;\n            continue;\n        }\n        let newIdentation = indentation;\n        if (newIdentation !== \"\") {\n            newIdentation += options.indentBy;\n        }\n        const attStr = attr_to_str(tagObj[\":@\"], options);\n        const tagStart = indentation + `<${tagName}${attStr}`;\n        const tagValue = arrToStr(tagObj[tagName], options, newJPath, newIdentation);\n        if (options.unpairedTags.indexOf(tagName) !== -1) {\n            if (options.suppressUnpairedNode) xmlStr += tagStart + \">\";\n            else xmlStr += tagStart + \"/>\";\n        } else if ((!tagValue || tagValue.length === 0) && options.suppressEmptyNode) {\n            xmlStr += tagStart + \"/>\";\n        } else if (tagValue && tagValue.endsWith(\">\")) {\n            xmlStr += tagStart + `>${tagValue}${indentation}</${tagName}>`;\n        } else {\n            xmlStr += tagStart + \">\";\n            if (tagValue && indentation !== \"\" && (tagValue.includes(\"/>\") || tagValue.includes(\"</\"))) {\n                xmlStr += indentation + options.indentBy + tagValue + indentation;\n            } else {\n                xmlStr += tagValue;\n            }\n            xmlStr += `</${tagName}>`;\n        }\n        isPreviousElementTag = true;\n    }\n\n    return xmlStr;\n}\n\nfunction propName$1(obj) {\n    const keys = Object.keys(obj);\n    for (let i = 0; i < keys.length; i++) {\n        const key = keys[i];\n        if (key !== \":@\") return key;\n    }\n}\n\nfunction attr_to_str(attrMap, options) {\n    let attrStr = \"\";\n    if (attrMap && !options.ignoreAttributes) {\n        for (let attr in attrMap) {\n            let attrVal = options.attributeValueProcessor(attr, attrMap[attr]);\n            attrVal = replaceEntitiesValue$1(attrVal, options);\n            if (attrVal === true && options.suppressBooleanAttributes) {\n                attrStr += ` ${attr.substr(options.attributeNamePrefix.length)}`;\n            } else {\n                attrStr += ` ${attr.substr(options.attributeNamePrefix.length)}=\"${attrVal}\"`;\n            }\n        }\n    }\n    return attrStr;\n}\n\nfunction isStopNode(jPath, options) {\n    jPath = jPath.substr(0, jPath.length - options.textNodeName.length - 1);\n    let tagName = jPath.substr(jPath.lastIndexOf(\".\") + 1);\n    for (let index in options.stopNodes) {\n        if (options.stopNodes[index] === jPath || options.stopNodes[index] === \"*.\" + tagName) return true;\n    }\n    return false;\n}\n\nfunction replaceEntitiesValue$1(textValue, options) {\n    if (textValue && textValue.length > 0 && options.processEntities) {\n        for (let i = 0; i < options.entities.length; i++) {\n            const entity = options.entities[i];\n            textValue = textValue.replace(entity.regex, entity.val);\n        }\n    }\n    return textValue;\n}\nvar orderedJs2Xml = toXml;\n\n//parse Empty Node as self closing node\n\n\nconst defaultOptions$2 = {\n  attributeNamePrefix: '@_',\n  attributesGroupName: false,\n  textNodeName: '#text',\n  ignoreAttributes: true,\n  cdataPropName: false,\n  format: false,\n  indentBy: '  ',\n  suppressEmptyNode: false,\n  suppressUnpairedNode: true,\n  suppressBooleanAttributes: true,\n  tagValueProcessor: function(key, a) {\n    return a;\n  },\n  attributeValueProcessor: function(attrName, a) {\n    return a;\n  },\n  preserveOrder: false,\n  commentPropName: false,\n  unpairedTags: [],\n  entities: [\n    { regex: new RegExp(\"&\", \"g\"), val: \"&amp;\" },//it must be on top\n    { regex: new RegExp(\">\", \"g\"), val: \"&gt;\" },\n    { regex: new RegExp(\"<\", \"g\"), val: \"&lt;\" },\n    { regex: new RegExp(\"\\'\", \"g\"), val: \"&apos;\" },\n    { regex: new RegExp(\"\\\"\", \"g\"), val: \"&quot;\" }\n  ],\n  processEntities: true,\n  stopNodes: [],\n  // transformTagName: false,\n  // transformAttributeName: false,\n  oneListGroup: false\n};\n\nfunction Builder(options) {\n  this.options = Object.assign({}, defaultOptions$2, options);\n  if (this.options.ignoreAttributes || this.options.attributesGroupName) {\n    this.isAttribute = function(/*a*/) {\n      return false;\n    };\n  } else {\n    this.attrPrefixLen = this.options.attributeNamePrefix.length;\n    this.isAttribute = isAttribute;\n  }\n\n  this.processTextOrObjNode = processTextOrObjNode;\n\n  if (this.options.format) {\n    this.indentate = indentate;\n    this.tagEndChar = '>\\n';\n    this.newLine = '\\n';\n  } else {\n    this.indentate = function() {\n      return '';\n    };\n    this.tagEndChar = '>';\n    this.newLine = '';\n  }\n}\n\nBuilder.prototype.build = function(jObj) {\n  if(this.options.preserveOrder){\n    return orderedJs2Xml(jObj, this.options);\n  }else {\n    if(Array.isArray(jObj) && this.options.arrayNodeName && this.options.arrayNodeName.length > 1){\n      jObj = {\n        [this.options.arrayNodeName] : jObj\n      };\n    }\n    return this.j2x(jObj, 0).val;\n  }\n};\n\nBuilder.prototype.j2x = function(jObj, level) {\n  let attrStr = '';\n  let val = '';\n  for (let key in jObj) {\n    if (typeof jObj[key] === 'undefined') ; else if (jObj[key] === null) {\n      if(key[0] === \"?\") val += this.indentate(level) + '<' + key + '?' + this.tagEndChar;\n      else val += this.indentate(level) + '<' + key + '/' + this.tagEndChar;\n      // val += this.indentate(level) + '<' + key + '/' + this.tagEndChar;\n    } else if (jObj[key] instanceof Date) {\n      val += this.buildTextValNode(jObj[key], key, '', level);\n    } else if (typeof jObj[key] !== 'object') {\n      //premitive type\n      const attr = this.isAttribute(key);\n      if (attr) {\n        attrStr += this.buildAttrPairStr(attr, '' + jObj[key]);\n      }else {\n        //tag value\n        if (key === this.options.textNodeName) {\n          let newval = this.options.tagValueProcessor(key, '' + jObj[key]);\n          val += this.replaceEntitiesValue(newval);\n        } else {\n          val += this.buildTextValNode(jObj[key], key, '', level);\n        }\n      }\n    } else if (Array.isArray(jObj[key])) {\n      //repeated nodes\n      const arrLen = jObj[key].length;\n      let listTagVal = \"\";\n      for (let j = 0; j < arrLen; j++) {\n        const item = jObj[key][j];\n        if (typeof item === 'undefined') ; else if (item === null) {\n          if(key[0] === \"?\") val += this.indentate(level) + '<' + key + '?' + this.tagEndChar;\n          else val += this.indentate(level) + '<' + key + '/' + this.tagEndChar;\n          // val += this.indentate(level) + '<' + key + '/' + this.tagEndChar;\n        } else if (typeof item === 'object') {\n          if(this.options.oneListGroup ){\n            listTagVal += this.j2x(item, level + 1).val;\n          }else {\n            listTagVal += this.processTextOrObjNode(item, key, level);\n          }\n        } else {\n          listTagVal += this.buildTextValNode(item, key, '', level);\n        }\n      }\n      if(this.options.oneListGroup){\n        listTagVal = this.buildObjectNode(listTagVal, key, '', level);\n      }\n      val += listTagVal;\n    } else {\n      //nested node\n      if (this.options.attributesGroupName && key === this.options.attributesGroupName) {\n        const Ks = Object.keys(jObj[key]);\n        const L = Ks.length;\n        for (let j = 0; j < L; j++) {\n          attrStr += this.buildAttrPairStr(Ks[j], '' + jObj[key][Ks[j]]);\n        }\n      } else {\n        val += this.processTextOrObjNode(jObj[key], key, level);\n      }\n    }\n  }\n  return {attrStr: attrStr, val: val};\n};\n\nBuilder.prototype.buildAttrPairStr = function(attrName, val){\n  val = this.options.attributeValueProcessor(attrName, '' + val);\n  val = this.replaceEntitiesValue(val);\n  if (this.options.suppressBooleanAttributes && val === \"true\") {\n    return ' ' + attrName;\n  } else return ' ' + attrName + '=\"' + val + '\"';\n};\n\nfunction processTextOrObjNode (object, key, level) {\n  const result = this.j2x(object, level + 1);\n  if (object[this.options.textNodeName] !== undefined && Object.keys(object).length === 1) {\n    return this.buildTextValNode(object[this.options.textNodeName], key, result.attrStr, level);\n  } else {\n    return this.buildObjectNode(result.val, key, result.attrStr, level);\n  }\n}\n\nBuilder.prototype.buildObjectNode = function(val, key, attrStr, level) {\n  if(val === \"\"){\n    if(key[0] === \"?\") return  this.indentate(level) + '<' + key + attrStr+ '?' + this.tagEndChar;\n    else {\n      return this.indentate(level) + '<' + key + attrStr + this.closeTag(key) + this.tagEndChar;\n    }\n  }else {\n\n    let tagEndExp = '</' + key + this.tagEndChar;\n    let piClosingChar = \"\";\n    \n    if(key[0] === \"?\") {\n      piClosingChar = \"?\";\n      tagEndExp = \"\";\n    }\n  \n    if (attrStr && val.indexOf('<') === -1) {\n      return ( this.indentate(level) + '<' +  key + attrStr + piClosingChar + '>' + val + tagEndExp );\n    } else if (this.options.commentPropName !== false && key === this.options.commentPropName && piClosingChar.length === 0) {\n      return this.indentate(level) + `<!--${val}-->` + this.newLine;\n    }else {\n      return (\n        this.indentate(level) + '<' + key + attrStr + piClosingChar + this.tagEndChar +\n        val +\n        this.indentate(level) + tagEndExp    );\n    }\n  }\n};\n\nBuilder.prototype.closeTag = function(key){\n  let closeTag = \"\";\n  if(this.options.unpairedTags.indexOf(key) !== -1){ //unpaired\n    if(!this.options.suppressUnpairedNode) closeTag = \"/\";\n  }else if(this.options.suppressEmptyNode){ //empty\n    closeTag = \"/\";\n  }else {\n    closeTag = `></${key}`;\n  }\n  return closeTag;\n};\n\nBuilder.prototype.buildTextValNode = function(val, key, attrStr, level) {\n  if (this.options.cdataPropName !== false && key === this.options.cdataPropName) {\n    return this.indentate(level) + `<![CDATA[${val}]]>` +  this.newLine;\n  }else if (this.options.commentPropName !== false && key === this.options.commentPropName) {\n    return this.indentate(level) + `<!--${val}-->` +  this.newLine;\n  }else if(key[0] === \"?\") {//PI tag\n    return  this.indentate(level) + '<' + key + attrStr+ '?' + this.tagEndChar; \n  }else {\n    let textValue = this.options.tagValueProcessor(key, val);\n    textValue = this.replaceEntitiesValue(textValue);\n  \n    if( textValue === ''){\n      return this.indentate(level) + '<' + key + attrStr + this.closeTag(key) + this.tagEndChar;\n    }else {\n      return this.indentate(level) + '<' + key + attrStr + '>' +\n         textValue +\n        '</' + key + this.tagEndChar;\n    }\n  }\n};\n\nBuilder.prototype.replaceEntitiesValue = function(textValue){\n  if(textValue && textValue.length > 0 && this.options.processEntities){\n    for (let i=0; i<this.options.entities.length; i++) {\n      const entity = this.options.entities[i];\n      textValue = textValue.replace(entity.regex, entity.val);\n    }\n  }\n  return textValue;\n};\n\nfunction indentate(level) {\n  return this.options.indentBy.repeat(level);\n}\n\nfunction isAttribute(name /*, options*/) {\n  if (name.startsWith(this.options.attributeNamePrefix)) {\n    return name.substr(this.attrPrefixLen);\n  } else {\n    return false;\n  }\n}\n\nvar json2xml = Builder;\n\nvar fxp = {\n  XMLParser: XMLParser_1,\n  XMLValidator: validator,\n  XMLBuilder: json2xml\n};\n\nclass S3ServiceException extends ServiceException {\n    constructor(options) {\n        super(options);\n        Object.setPrototypeOf(this, S3ServiceException.prototype);\n    }\n}\n\nvar AnalyticsFilter;\n(function (AnalyticsFilter) {\n    AnalyticsFilter.visit = (value, visitor) => {\n        if (value.Prefix !== undefined)\n            return visitor.Prefix(value.Prefix);\n        if (value.Tag !== undefined)\n            return visitor.Tag(value.Tag);\n        if (value.And !== undefined)\n            return visitor.And(value.And);\n        return visitor._(value.$unknown[0], value.$unknown[1]);\n    };\n})(AnalyticsFilter || (AnalyticsFilter = {}));\nvar LifecycleRuleFilter;\n(function (LifecycleRuleFilter) {\n    LifecycleRuleFilter.visit = (value, visitor) => {\n        if (value.Prefix !== undefined)\n            return visitor.Prefix(value.Prefix);\n        if (value.Tag !== undefined)\n            return visitor.Tag(value.Tag);\n        if (value.ObjectSizeGreaterThan !== undefined)\n            return visitor.ObjectSizeGreaterThan(value.ObjectSizeGreaterThan);\n        if (value.ObjectSizeLessThan !== undefined)\n            return visitor.ObjectSizeLessThan(value.ObjectSizeLessThan);\n        if (value.And !== undefined)\n            return visitor.And(value.And);\n        return visitor._(value.$unknown[0], value.$unknown[1]);\n    };\n})(LifecycleRuleFilter || (LifecycleRuleFilter = {}));\nvar MetricsFilter;\n(function (MetricsFilter) {\n    MetricsFilter.visit = (value, visitor) => {\n        if (value.Prefix !== undefined)\n            return visitor.Prefix(value.Prefix);\n        if (value.Tag !== undefined)\n            return visitor.Tag(value.Tag);\n        if (value.AccessPointArn !== undefined)\n            return visitor.AccessPointArn(value.AccessPointArn);\n        if (value.And !== undefined)\n            return visitor.And(value.And);\n        return visitor._(value.$unknown[0], value.$unknown[1]);\n    };\n})(MetricsFilter || (MetricsFilter = {}));\nvar ReplicationRuleFilter;\n(function (ReplicationRuleFilter) {\n    ReplicationRuleFilter.visit = (value, visitor) => {\n        if (value.Prefix !== undefined)\n            return visitor.Prefix(value.Prefix);\n        if (value.Tag !== undefined)\n            return visitor.Tag(value.Tag);\n        if (value.And !== undefined)\n            return visitor.And(value.And);\n        return visitor._(value.$unknown[0], value.$unknown[1]);\n    };\n})(ReplicationRuleFilter || (ReplicationRuleFilter = {}));\nclass NoSuchBucket extends S3ServiceException {\n    constructor(opts) {\n        super({\n            name: \"NoSuchBucket\",\n            $fault: \"client\",\n            ...opts,\n        });\n        this.name = \"NoSuchBucket\";\n        this.$fault = \"client\";\n        Object.setPrototypeOf(this, NoSuchBucket.prototype);\n    }\n}\nconst PutObjectOutputFilterSensitiveLog = (obj) => ({\n    ...obj,\n    ...(obj.SSEKMSKeyId && { SSEKMSKeyId: SENSITIVE_STRING }),\n    ...(obj.SSEKMSEncryptionContext && { SSEKMSEncryptionContext: SENSITIVE_STRING }),\n});\nconst PutObjectRequestFilterSensitiveLog = (obj) => ({\n    ...obj,\n    ...(obj.SSECustomerKey && { SSECustomerKey: SENSITIVE_STRING }),\n    ...(obj.SSEKMSKeyId && { SSEKMSKeyId: SENSITIVE_STRING }),\n    ...(obj.SSEKMSEncryptionContext && { SSEKMSEncryptionContext: SENSITIVE_STRING }),\n});\n\nconst se_ListObjectsCommand = async (input, context) => {\n    const { hostname, protocol = \"https\", port, path: basePath } = await context.endpoint();\n    const headers = map({}, isSerializableHeaderValue, {\n        \"x-amz-request-payer\": input.RequestPayer,\n        \"x-amz-expected-bucket-owner\": input.ExpectedBucketOwner,\n        \"x-amz-optional-object-attributes\": [\n            () => isSerializableHeaderValue(input.OptionalObjectAttributes),\n            () => (input.OptionalObjectAttributes || []).map((_entry) => _entry).join(\", \"),\n        ],\n    });\n    let resolvedPath$1 = `${basePath?.endsWith(\"/\") ? basePath.slice(0, -1) : basePath || \"\"}` + \"/\";\n    resolvedPath$1 = resolvedPath(resolvedPath$1, input, \"Bucket\", () => input.Bucket, \"{Bucket}\", false);\n    const query = map({\n        delimiter: [, input.Delimiter],\n        \"encoding-type\": [, input.EncodingType],\n        marker: [, input.Marker],\n        \"max-keys\": [() => input.MaxKeys !== void 0, () => input.MaxKeys.toString()],\n        prefix: [, input.Prefix],\n    });\n    let body;\n    return new HttpRequest({\n        protocol,\n        hostname,\n        port,\n        method: \"GET\",\n        headers,\n        path: resolvedPath$1,\n        query,\n        body,\n    });\n};\nconst se_PutObjectCommand = async (input, context) => {\n    const { hostname, protocol = \"https\", port, path: basePath } = await context.endpoint();\n    const headers = map({}, isSerializableHeaderValue, {\n        \"content-type\": input.ContentType || \"application/octet-stream\",\n        \"x-amz-acl\": input.ACL,\n        \"cache-control\": input.CacheControl,\n        \"content-disposition\": input.ContentDisposition,\n        \"content-encoding\": input.ContentEncoding,\n        \"content-language\": input.ContentLanguage,\n        \"content-length\": [() => isSerializableHeaderValue(input.ContentLength), () => input.ContentLength.toString()],\n        \"content-md5\": input.ContentMD5,\n        \"x-amz-sdk-checksum-algorithm\": input.ChecksumAlgorithm,\n        \"x-amz-checksum-crc32\": input.ChecksumCRC32,\n        \"x-amz-checksum-crc32c\": input.ChecksumCRC32C,\n        \"x-amz-checksum-sha1\": input.ChecksumSHA1,\n        \"x-amz-checksum-sha256\": input.ChecksumSHA256,\n        expires: [() => isSerializableHeaderValue(input.Expires), () => dateToUtcString(input.Expires).toString()],\n        \"x-amz-grant-full-control\": input.GrantFullControl,\n        \"x-amz-grant-read\": input.GrantRead,\n        \"x-amz-grant-read-acp\": input.GrantReadACP,\n        \"x-amz-grant-write-acp\": input.GrantWriteACP,\n        \"x-amz-server-side-encryption\": input.ServerSideEncryption,\n        \"x-amz-storage-class\": input.StorageClass,\n        \"x-amz-website-redirect-location\": input.WebsiteRedirectLocation,\n        \"x-amz-server-side-encryption-customer-algorithm\": input.SSECustomerAlgorithm,\n        \"x-amz-server-side-encryption-customer-key\": input.SSECustomerKey,\n        \"x-amz-server-side-encryption-customer-key-md5\": input.SSECustomerKeyMD5,\n        \"x-amz-server-side-encryption-aws-kms-key-id\": input.SSEKMSKeyId,\n        \"x-amz-server-side-encryption-context\": input.SSEKMSEncryptionContext,\n        \"x-amz-server-side-encryption-bucket-key-enabled\": [\n            () => isSerializableHeaderValue(input.BucketKeyEnabled),\n            () => input.BucketKeyEnabled.toString(),\n        ],\n        \"x-amz-request-payer\": input.RequestPayer,\n        \"x-amz-tagging\": input.Tagging,\n        \"x-amz-object-lock-mode\": input.ObjectLockMode,\n        \"x-amz-object-lock-retain-until-date\": [\n            () => isSerializableHeaderValue(input.ObjectLockRetainUntilDate),\n            () => (input.ObjectLockRetainUntilDate.toISOString().split(\".\")[0] + \"Z\").toString(),\n        ],\n        \"x-amz-object-lock-legal-hold\": input.ObjectLockLegalHoldStatus,\n        \"x-amz-expected-bucket-owner\": input.ExpectedBucketOwner,\n        ...(input.Metadata !== undefined &&\n            Object.keys(input.Metadata).reduce((acc, suffix) => {\n                acc[`x-amz-meta-${suffix.toLowerCase()}`] = input.Metadata[suffix];\n                return acc;\n            }, {})),\n    });\n    let resolvedPath$1 = `${basePath?.endsWith(\"/\") ? basePath.slice(0, -1) : basePath || \"\"}` + \"/{Key+}\";\n    resolvedPath$1 = resolvedPath(resolvedPath$1, input, \"Bucket\", () => input.Bucket, \"{Bucket}\", false);\n    resolvedPath$1 = resolvedPath(resolvedPath$1, input, \"Key\", () => input.Key, \"{Key+}\", true);\n    const query = map({\n        \"x-id\": [, \"PutObject\"],\n    });\n    let body;\n    if (input.Body !== undefined) {\n        body = input.Body;\n    }\n    let contents;\n    if (input.Body !== undefined) {\n        contents = input.Body;\n        body = contents;\n    }\n    return new HttpRequest({\n        protocol,\n        hostname,\n        port,\n        method: \"PUT\",\n        headers,\n        path: resolvedPath$1,\n        query,\n        body,\n    });\n};\nconst de_ListObjectsCommand = async (output, context) => {\n    if (output.statusCode !== 200 && output.statusCode >= 300) {\n        return de_ListObjectsCommandError(output, context);\n    }\n    const contents = map({\n        $metadata: deserializeMetadata(output),\n        RequestCharged: [, output.headers[\"x-amz-request-charged\"]],\n    });\n    const data = expectNonNull(expectObject(await parseBody(output.body, context)), \"body\");\n    if (data.CommonPrefixes === \"\") {\n        contents.CommonPrefixes = [];\n    }\n    else if (data[\"CommonPrefixes\"] !== undefined) {\n        contents.CommonPrefixes = de_CommonPrefixList(getArrayIfSingleItem(data[\"CommonPrefixes\"]));\n    }\n    if (data.Contents === \"\") {\n        contents.Contents = [];\n    }\n    else if (data[\"Contents\"] !== undefined) {\n        contents.Contents = de_ObjectList(getArrayIfSingleItem(data[\"Contents\"]));\n    }\n    if (data[\"Delimiter\"] !== undefined) {\n        contents.Delimiter = expectString(data[\"Delimiter\"]);\n    }\n    if (data[\"EncodingType\"] !== undefined) {\n        contents.EncodingType = expectString(data[\"EncodingType\"]);\n    }\n    if (data[\"IsTruncated\"] !== undefined) {\n        contents.IsTruncated = parseBoolean(data[\"IsTruncated\"]);\n    }\n    if (data[\"Marker\"] !== undefined) {\n        contents.Marker = expectString(data[\"Marker\"]);\n    }\n    if (data[\"MaxKeys\"] !== undefined) {\n        contents.MaxKeys = strictParseInt32(data[\"MaxKeys\"]);\n    }\n    if (data[\"Name\"] !== undefined) {\n        contents.Name = expectString(data[\"Name\"]);\n    }\n    if (data[\"NextMarker\"] !== undefined) {\n        contents.NextMarker = expectString(data[\"NextMarker\"]);\n    }\n    if (data[\"Prefix\"] !== undefined) {\n        contents.Prefix = expectString(data[\"Prefix\"]);\n    }\n    return contents;\n};\nconst de_ListObjectsCommandError = async (output, context) => {\n    const parsedOutput = {\n        ...output,\n        body: await parseErrorBody(output.body, context),\n    };\n    const errorCode = loadRestXmlErrorCode(output, parsedOutput.body);\n    switch (errorCode) {\n        case \"NoSuchBucket\":\n        case \"com.amazonaws.s3#NoSuchBucket\":\n            throw await de_NoSuchBucketRes(parsedOutput);\n        default:\n            const parsedBody = parsedOutput.body;\n            return throwDefaultError({\n                output,\n                parsedBody,\n                errorCode,\n            });\n    }\n};\nconst de_PutObjectCommand = async (output, context) => {\n    if (output.statusCode !== 200 && output.statusCode >= 300) {\n        return de_PutObjectCommandError(output, context);\n    }\n    const contents = map({\n        $metadata: deserializeMetadata(output),\n        Expiration: [, output.headers[\"x-amz-expiration\"]],\n        ETag: [, output.headers[\"etag\"]],\n        ChecksumCRC32: [, output.headers[\"x-amz-checksum-crc32\"]],\n        ChecksumCRC32C: [, output.headers[\"x-amz-checksum-crc32c\"]],\n        ChecksumSHA1: [, output.headers[\"x-amz-checksum-sha1\"]],\n        ChecksumSHA256: [, output.headers[\"x-amz-checksum-sha256\"]],\n        ServerSideEncryption: [, output.headers[\"x-amz-server-side-encryption\"]],\n        VersionId: [, output.headers[\"x-amz-version-id\"]],\n        SSECustomerAlgorithm: [, output.headers[\"x-amz-server-side-encryption-customer-algorithm\"]],\n        SSECustomerKeyMD5: [, output.headers[\"x-amz-server-side-encryption-customer-key-md5\"]],\n        SSEKMSKeyId: [, output.headers[\"x-amz-server-side-encryption-aws-kms-key-id\"]],\n        SSEKMSEncryptionContext: [, output.headers[\"x-amz-server-side-encryption-context\"]],\n        BucketKeyEnabled: [\n            () => void 0 !== output.headers[\"x-amz-server-side-encryption-bucket-key-enabled\"],\n            () => parseBoolean(output.headers[\"x-amz-server-side-encryption-bucket-key-enabled\"]),\n        ],\n        RequestCharged: [, output.headers[\"x-amz-request-charged\"]],\n    });\n    await collectBody(output.body, context);\n    return contents;\n};\nconst de_PutObjectCommandError = async (output, context) => {\n    const parsedOutput = {\n        ...output,\n        body: await parseErrorBody(output.body, context),\n    };\n    const errorCode = loadRestXmlErrorCode(output, parsedOutput.body);\n    const parsedBody = parsedOutput.body;\n    return throwDefaultError({\n        output,\n        parsedBody,\n        errorCode,\n    });\n};\nconst throwDefaultError = withBaseException(S3ServiceException);\nconst de_NoSuchBucketRes = async (parsedOutput, context) => {\n    const contents = map({});\n    const data = parsedOutput.body;\n    const exception = new NoSuchBucket({\n        $metadata: deserializeMetadata(parsedOutput),\n        ...contents,\n    });\n    return decorateServiceException(exception, parsedOutput.body);\n};\nconst de_ChecksumAlgorithmList = (output, context) => {\n    return (output || [])\n        .filter((e) => e != null)\n        .map((entry) => {\n        return expectString(entry);\n    });\n};\nconst de_CommonPrefix = (output, context) => {\n    const contents = {};\n    if (output[\"Prefix\"] !== undefined) {\n        contents.Prefix = expectString(output[\"Prefix\"]);\n    }\n    return contents;\n};\nconst de_CommonPrefixList = (output, context) => {\n    return (output || [])\n        .filter((e) => e != null)\n        .map((entry) => {\n        return de_CommonPrefix(entry);\n    });\n};\nconst de__Object = (output, context) => {\n    const contents = {};\n    if (output[\"Key\"] !== undefined) {\n        contents.Key = expectString(output[\"Key\"]);\n    }\n    if (output[\"LastModified\"] !== undefined) {\n        contents.LastModified = expectNonNull(parseRfc3339DateTimeWithOffset(output[\"LastModified\"]));\n    }\n    if (output[\"ETag\"] !== undefined) {\n        contents.ETag = expectString(output[\"ETag\"]);\n    }\n    if (output.ChecksumAlgorithm === \"\") {\n        contents.ChecksumAlgorithm = [];\n    }\n    else if (output[\"ChecksumAlgorithm\"] !== undefined) {\n        contents.ChecksumAlgorithm = de_ChecksumAlgorithmList(getArrayIfSingleItem(output[\"ChecksumAlgorithm\"]));\n    }\n    if (output[\"Size\"] !== undefined) {\n        contents.Size = strictParseLong(output[\"Size\"]);\n    }\n    if (output[\"StorageClass\"] !== undefined) {\n        contents.StorageClass = expectString(output[\"StorageClass\"]);\n    }\n    if (output[\"Owner\"] !== undefined) {\n        contents.Owner = de_Owner(output[\"Owner\"]);\n    }\n    if (output[\"RestoreStatus\"] !== undefined) {\n        contents.RestoreStatus = de_RestoreStatus(output[\"RestoreStatus\"]);\n    }\n    return contents;\n};\nconst de_ObjectList = (output, context) => {\n    return (output || [])\n        .filter((e) => e != null)\n        .map((entry) => {\n        return de__Object(entry);\n    });\n};\nconst de_Owner = (output, context) => {\n    const contents = {};\n    if (output[\"DisplayName\"] !== undefined) {\n        contents.DisplayName = expectString(output[\"DisplayName\"]);\n    }\n    if (output[\"ID\"] !== undefined) {\n        contents.ID = expectString(output[\"ID\"]);\n    }\n    return contents;\n};\nconst de_RestoreStatus = (output, context) => {\n    const contents = {};\n    if (output[\"IsRestoreInProgress\"] !== undefined) {\n        contents.IsRestoreInProgress = parseBoolean(output[\"IsRestoreInProgress\"]);\n    }\n    if (output[\"RestoreExpiryDate\"] !== undefined) {\n        contents.RestoreExpiryDate = expectNonNull(parseRfc3339DateTimeWithOffset(output[\"RestoreExpiryDate\"]));\n    }\n    return contents;\n};\nconst deserializeMetadata = (output) => ({\n    httpStatusCode: output.statusCode,\n    requestId: output.headers[\"x-amzn-requestid\"] ?? output.headers[\"x-amzn-request-id\"] ?? output.headers[\"x-amz-request-id\"],\n    extendedRequestId: output.headers[\"x-amz-id-2\"],\n    cfId: output.headers[\"x-amz-cf-id\"],\n});\nconst collectBodyString = (streamBody, context) => collectBody(streamBody, context).then((body) => context.utf8Encoder(body));\nconst isSerializableHeaderValue = (value) => value !== undefined &&\n    value !== null &&\n    value !== \"\" &&\n    (!Object.getOwnPropertyNames(value).includes(\"length\") || value.length != 0) &&\n    (!Object.getOwnPropertyNames(value).includes(\"size\") || value.size != 0);\nconst parseBody = (streamBody, context) => collectBodyString(streamBody, context).then((encoded) => {\n    if (encoded.length) {\n        const parser = new fxp.XMLParser({\n            attributeNamePrefix: \"\",\n            htmlEntities: true,\n            ignoreAttributes: false,\n            ignoreDeclaration: true,\n            parseTagValue: false,\n            trimValues: false,\n            tagValueProcessor: (_, val) => (val.trim() === \"\" && val.includes(\"\\n\") ? \"\" : undefined),\n        });\n        parser.addEntity(\"#xD\", \"\\r\");\n        parser.addEntity(\"#10\", \"\\n\");\n        const parsedObj = parser.parse(encoded);\n        const textNodeName = \"#text\";\n        const key = Object.keys(parsedObj)[0];\n        const parsedObjToReturn = parsedObj[key];\n        if (parsedObjToReturn[textNodeName]) {\n            parsedObjToReturn[key] = parsedObjToReturn[textNodeName];\n            delete parsedObjToReturn[textNodeName];\n        }\n        return getValueFromTextNode(parsedObjToReturn);\n    }\n    return {};\n});\nconst parseErrorBody = async (errorBody, context) => {\n    const value = await parseBody(errorBody, context);\n    if (value.Error) {\n        value.Error.message = value.Error.message ?? value.Error.Message;\n    }\n    return value;\n};\nconst loadRestXmlErrorCode = (output, data) => {\n    if (data?.Code !== undefined) {\n        return data.Code;\n    }\n    if (output.statusCode == 404) {\n        return \"NotFound\";\n    }\n};\n\nfunction ssecMiddleware(options) {\n    return (next) => async (args) => {\n        let input = { ...args.input };\n        const properties = [\n            {\n                target: \"SSECustomerKey\",\n                hash: \"SSECustomerKeyMD5\",\n            },\n            {\n                target: \"CopySourceSSECustomerKey\",\n                hash: \"CopySourceSSECustomerKeyMD5\",\n            },\n        ];\n        for (const prop of properties) {\n            const value = input[prop.target];\n            if (value) {\n                const valueView = ArrayBuffer.isView(value)\n                    ? new Uint8Array(value.buffer, value.byteOffset, value.byteLength)\n                    : typeof value === \"string\"\n                        ? options.utf8Decoder(value)\n                        : new Uint8Array(value);\n                const encoded = options.base64Encoder(valueView);\n                const hash = new options.md5();\n                hash.update(valueView);\n                input = {\n                    ...input,\n                    [prop.target]: encoded,\n                    [prop.hash]: options.base64Encoder(await hash.digest()),\n                };\n            }\n        }\n        return next({\n            ...args,\n            input,\n        });\n    };\n}\nconst ssecMiddlewareOptions = {\n    name: \"ssecMiddleware\",\n    step: \"initialize\",\n    tags: [\"SSE\"],\n    override: true,\n};\nconst getSsecPlugin = (config) => ({\n    applyToStack: (clientStack) => {\n        clientStack.add(ssecMiddleware(config), ssecMiddlewareOptions);\n    },\n});\n\nvar ChecksumAlgorithm;\n(function (ChecksumAlgorithm) {\n    ChecksumAlgorithm[\"MD5\"] = \"MD5\";\n    ChecksumAlgorithm[\"CRC32\"] = \"CRC32\";\n    ChecksumAlgorithm[\"CRC32C\"] = \"CRC32C\";\n    ChecksumAlgorithm[\"SHA1\"] = \"SHA1\";\n    ChecksumAlgorithm[\"SHA256\"] = \"SHA256\";\n})(ChecksumAlgorithm || (ChecksumAlgorithm = {}));\nvar ChecksumLocation;\n(function (ChecksumLocation) {\n    ChecksumLocation[\"HEADER\"] = \"header\";\n    ChecksumLocation[\"TRAILER\"] = \"trailer\";\n})(ChecksumLocation || (ChecksumLocation = {}));\n\nconst CLIENT_SUPPORTED_ALGORITHMS = [\n    ChecksumAlgorithm.CRC32,\n    ChecksumAlgorithm.CRC32C,\n    ChecksumAlgorithm.SHA1,\n    ChecksumAlgorithm.SHA256,\n];\nconst PRIORITY_ORDER_ALGORITHMS = [\n    ChecksumAlgorithm.CRC32,\n    ChecksumAlgorithm.CRC32C,\n    ChecksumAlgorithm.SHA1,\n    ChecksumAlgorithm.SHA256,\n];\n\nconst getChecksumAlgorithmForRequest = (input, { requestChecksumRequired, requestAlgorithmMember }) => {\n    if (!requestAlgorithmMember || !input[requestAlgorithmMember]) {\n        return requestChecksumRequired ? ChecksumAlgorithm.MD5 : undefined;\n    }\n    const checksumAlgorithm = input[requestAlgorithmMember];\n    if (!CLIENT_SUPPORTED_ALGORITHMS.includes(checksumAlgorithm)) {\n        throw new Error(`The checksum algorithm \"${checksumAlgorithm}\" is not supported by the client.` +\n            ` Select one of ${CLIENT_SUPPORTED_ALGORITHMS}.`);\n    }\n    return checksumAlgorithm;\n};\n\nconst getChecksumLocationName = (algorithm) => algorithm === ChecksumAlgorithm.MD5 ? \"content-md5\" : `x-amz-checksum-${algorithm.toLowerCase()}`;\n\nconst hasHeader = (header, headers) => {\n    const soughtHeader = header.toLowerCase();\n    for (const headerName of Object.keys(headers)) {\n        if (soughtHeader === headerName.toLowerCase()) {\n            return true;\n        }\n    }\n    return false;\n};\n\nconst isStreaming = (body) => body !== undefined && typeof body !== \"string\" && !ArrayBuffer.isView(body) && !isArrayBuffer(body);\n\n/*! *****************************************************************************\r\nCopyright (c) Microsoft Corporation.\r\n\r\nPermission to use, copy, modify, and/or distribute this software for any\r\npurpose with or without fee is hereby granted.\r\n\r\nTHE SOFTWARE IS PROVIDED \"AS IS\" AND THE AUTHOR DISCLAIMS ALL WARRANTIES WITH\r\nREGARD TO THIS SOFTWARE INCLUDING ALL IMPLIED WARRANTIES OF MERCHANTABILITY\r\nAND FITNESS. IN NO EVENT SHALL THE AUTHOR BE LIABLE FOR ANY SPECIAL, DIRECT,\r\nINDIRECT, OR CONSEQUENTIAL DAMAGES OR ANY DAMAGES WHATSOEVER RESULTING FROM\r\nLOSS OF USE, DATA OR PROFITS, WHETHER IN AN ACTION OF CONTRACT, NEGLIGENCE OR\r\nOTHER TORTIOUS ACTION, ARISING OUT OF OR IN CONNECTION WITH THE USE OR\r\nPERFORMANCE OF THIS SOFTWARE.\r\n***************************************************************************** */\r\n/* global Reflect, Promise */\r\n\r\nvar extendStatics$1 = function(d, b) {\r\n    extendStatics$1 = Object.setPrototypeOf ||\r\n        ({ __proto__: [] } instanceof Array && function (d, b) { d.__proto__ = b; }) ||\r\n        function (d, b) { for (var p in b) if (b.hasOwnProperty(p)) d[p] = b[p]; };\r\n    return extendStatics$1(d, b);\r\n};\r\n\r\nfunction __extends$1(d, b) {\r\n    extendStatics$1(d, b);\r\n    function __() { this.constructor = d; }\r\n    d.prototype = b === null ? Object.create(b) : (__.prototype = b.prototype, new __());\r\n}\r\n\r\nvar __assign$1 = function() {\r\n    __assign$1 = Object.assign || function __assign(t) {\r\n        for (var s, i = 1, n = arguments.length; i < n; i++) {\r\n            s = arguments[i];\r\n            for (var p in s) if (Object.prototype.hasOwnProperty.call(s, p)) t[p] = s[p];\r\n        }\r\n        return t;\r\n    };\r\n    return __assign$1.apply(this, arguments);\r\n};\r\n\r\nfunction __rest$1(s, e) {\r\n    var t = {};\r\n    for (var p in s) if (Object.prototype.hasOwnProperty.call(s, p) && e.indexOf(p) < 0)\r\n        t[p] = s[p];\r\n    if (s != null && typeof Object.getOwnPropertySymbols === \"function\")\r\n        for (var i = 0, p = Object.getOwnPropertySymbols(s); i < p.length; i++) {\r\n            if (e.indexOf(p[i]) < 0 && Object.prototype.propertyIsEnumerable.call(s, p[i]))\r\n                t[p[i]] = s[p[i]];\r\n        }\r\n    return t;\r\n}\r\n\r\nfunction __decorate$1(decorators, target, key, desc) {\r\n    var c = arguments.length, r = c < 3 ? target : desc === null ? desc = Object.getOwnPropertyDescriptor(target, key) : desc, d;\r\n    if (typeof Reflect === \"object\" && typeof Reflect.decorate === \"function\") r = Reflect.decorate(decorators, target, key, desc);\r\n    else for (var i = decorators.length - 1; i >= 0; i--) if (d = decorators[i]) r = (c < 3 ? d(r) : c > 3 ? d(target, key, r) : d(target, key)) || r;\r\n    return c > 3 && r && Object.defineProperty(target, key, r), r;\r\n}\r\n\r\nfunction __param$1(paramIndex, decorator) {\r\n    return function (target, key) { decorator(target, key, paramIndex); }\r\n}\r\n\r\nfunction __metadata$1(metadataKey, metadataValue) {\r\n    if (typeof Reflect === \"object\" && typeof Reflect.metadata === \"function\") return Reflect.metadata(metadataKey, metadataValue);\r\n}\r\n\r\nfunction __awaiter$1(thisArg, _arguments, P, generator) {\r\n    function adopt(value) { return value instanceof P ? value : new P(function (resolve) { resolve(value); }); }\r\n    return new (P || (P = Promise))(function (resolve, reject) {\r\n        function fulfilled(value) { try { step(generator.next(value)); } catch (e) { reject(e); } }\r\n        function rejected(value) { try { step(generator[\"throw\"](value)); } catch (e) { reject(e); } }\r\n        function step(result) { result.done ? resolve(result.value) : adopt(result.value).then(fulfilled, rejected); }\r\n        step((generator = generator.apply(thisArg, _arguments || [])).next());\r\n    });\r\n}\r\n\r\nfunction __generator$1(thisArg, body) {\r\n    var _ = { label: 0, sent: function() { if (t[0] & 1) throw t[1]; return t[1]; }, trys: [], ops: [] }, f, y, t, g;\r\n    return g = { next: verb(0), \"throw\": verb(1), \"return\": verb(2) }, typeof Symbol === \"function\" && (g[Symbol.iterator] = function() { return this; }), g;\r\n    function verb(n) { return function (v) { return step([n, v]); }; }\r\n    function step(op) {\r\n        if (f) throw new TypeError(\"Generator is already executing.\");\r\n        while (_) try {\r\n            if (f = 1, y && (t = op[0] & 2 ? y[\"return\"] : op[0] ? y[\"throw\"] || ((t = y[\"return\"]) && t.call(y), 0) : y.next) && !(t = t.call(y, op[1])).done) return t;\r\n            if (y = 0, t) op = [op[0] & 2, t.value];\r\n            switch (op[0]) {\r\n                case 0: case 1: t = op; break;\r\n                case 4: _.label++; return { value: op[1], done: false };\r\n                case 5: _.label++; y = op[1]; op = [0]; continue;\r\n                case 7: op = _.ops.pop(); _.trys.pop(); continue;\r\n                default:\r\n                    if (!(t = _.trys, t = t.length > 0 && t[t.length - 1]) && (op[0] === 6 || op[0] === 2)) { _ = 0; continue; }\r\n                    if (op[0] === 3 && (!t || (op[1] > t[0] && op[1] < t[3]))) { _.label = op[1]; break; }\r\n                    if (op[0] === 6 && _.label < t[1]) { _.label = t[1]; t = op; break; }\r\n                    if (t && _.label < t[2]) { _.label = t[2]; _.ops.push(op); break; }\r\n                    if (t[2]) _.ops.pop();\r\n                    _.trys.pop(); continue;\r\n            }\r\n            op = body.call(thisArg, _);\r\n        } catch (e) { op = [6, e]; y = 0; } finally { f = t = 0; }\r\n        if (op[0] & 5) throw op[1]; return { value: op[0] ? op[1] : void 0, done: true };\r\n    }\r\n}\r\n\r\nfunction __createBinding$1(o, m, k, k2) {\r\n    if (k2 === undefined) k2 = k;\r\n    o[k2] = m[k];\r\n}\r\n\r\nfunction __exportStar$1(m, exports) {\r\n    for (var p in m) if (p !== \"default\" && !exports.hasOwnProperty(p)) exports[p] = m[p];\r\n}\r\n\r\nfunction __values$1(o) {\r\n    var s = typeof Symbol === \"function\" && Symbol.iterator, m = s && o[s], i = 0;\r\n    if (m) return m.call(o);\r\n    if (o && typeof o.length === \"number\") return {\r\n        next: function () {\r\n            if (o && i >= o.length) o = void 0;\r\n            return { value: o && o[i++], done: !o };\r\n        }\r\n    };\r\n    throw new TypeError(s ? \"Object is not iterable.\" : \"Symbol.iterator is not defined.\");\r\n}\r\n\r\nfunction __read$1(o, n) {\r\n    var m = typeof Symbol === \"function\" && o[Symbol.iterator];\r\n    if (!m) return o;\r\n    var i = m.call(o), r, ar = [], e;\r\n    try {\r\n        while ((n === void 0 || n-- > 0) && !(r = i.next()).done) ar.push(r.value);\r\n    }\r\n    catch (error) { e = { error: error }; }\r\n    finally {\r\n        try {\r\n            if (r && !r.done && (m = i[\"return\"])) m.call(i);\r\n        }\r\n        finally { if (e) throw e.error; }\r\n    }\r\n    return ar;\r\n}\r\n\r\nfunction __spread$1() {\r\n    for (var ar = [], i = 0; i < arguments.length; i++)\r\n        ar = ar.concat(__read$1(arguments[i]));\r\n    return ar;\r\n}\r\n\r\nfunction __spreadArrays$1() {\r\n    for (var s = 0, i = 0, il = arguments.length; i < il; i++) s += arguments[i].length;\r\n    for (var r = Array(s), k = 0, i = 0; i < il; i++)\r\n        for (var a = arguments[i], j = 0, jl = a.length; j < jl; j++, k++)\r\n            r[k] = a[j];\r\n    return r;\r\n}\r\nfunction __await$1(v) {\r\n    return this instanceof __await$1 ? (this.v = v, this) : new __await$1(v);\r\n}\r\n\r\nfunction __asyncGenerator$1(thisArg, _arguments, generator) {\r\n    if (!Symbol.asyncIterator) throw new TypeError(\"Symbol.asyncIterator is not defined.\");\r\n    var g = generator.apply(thisArg, _arguments || []), i, q = [];\r\n    return i = {}, verb(\"next\"), verb(\"throw\"), verb(\"return\"), i[Symbol.asyncIterator] = function () { return this; }, i;\r\n    function verb(n) { if (g[n]) i[n] = function (v) { return new Promise(function (a, b) { q.push([n, v, a, b]) > 1 || resume(n, v); }); }; }\r\n    function resume(n, v) { try { step(g[n](v)); } catch (e) { settle(q[0][3], e); } }\r\n    function step(r) { r.value instanceof __await$1 ? Promise.resolve(r.value.v).then(fulfill, reject) : settle(q[0][2], r); }\r\n    function fulfill(value) { resume(\"next\", value); }\r\n    function reject(value) { resume(\"throw\", value); }\r\n    function settle(f, v) { if (f(v), q.shift(), q.length) resume(q[0][0], q[0][1]); }\r\n}\r\n\r\nfunction __asyncDelegator$1(o) {\r\n    var i, p;\r\n    return i = {}, verb(\"next\"), verb(\"throw\", function (e) { throw e; }), verb(\"return\"), i[Symbol.iterator] = function () { return this; }, i;\r\n    function verb(n, f) { i[n] = o[n] ? function (v) { return (p = !p) ? { value: __await$1(o[n](v)), done: n === \"return\" } : f ? f(v) : v; } : f; }\r\n}\r\n\r\nfunction __asyncValues$1(o) {\r\n    if (!Symbol.asyncIterator) throw new TypeError(\"Symbol.asyncIterator is not defined.\");\r\n    var m = o[Symbol.asyncIterator], i;\r\n    return m ? m.call(o) : (o = typeof __values$1 === \"function\" ? __values$1(o) : o[Symbol.iterator](), i = {}, verb(\"next\"), verb(\"throw\"), verb(\"return\"), i[Symbol.asyncIterator] = function () { return this; }, i);\r\n    function verb(n) { i[n] = o[n] && function (v) { return new Promise(function (resolve, reject) { v = o[n](v), settle(resolve, reject, v.done, v.value); }); }; }\r\n    function settle(resolve, reject, d, v) { Promise.resolve(v).then(function(v) { resolve({ value: v, done: d }); }, reject); }\r\n}\r\n\r\nfunction __makeTemplateObject$1(cooked, raw) {\r\n    if (Object.defineProperty) { Object.defineProperty(cooked, \"raw\", { value: raw }); } else { cooked.raw = raw; }\r\n    return cooked;\r\n}\r\nfunction __importStar$1(mod) {\r\n    if (mod && mod.__esModule) return mod;\r\n    var result = {};\r\n    if (mod != null) for (var k in mod) if (Object.hasOwnProperty.call(mod, k)) result[k] = mod[k];\r\n    result.default = mod;\r\n    return result;\r\n}\r\n\r\nfunction __importDefault$1(mod) {\r\n    return (mod && mod.__esModule) ? mod : { default: mod };\r\n}\r\n\r\nfunction __classPrivateFieldGet$1(receiver, privateMap) {\r\n    if (!privateMap.has(receiver)) {\r\n        throw new TypeError(\"attempted to get private field on non-instance\");\r\n    }\r\n    return privateMap.get(receiver);\r\n}\r\n\r\nfunction __classPrivateFieldSet$1(receiver, privateMap, value) {\r\n    if (!privateMap.has(receiver)) {\r\n        throw new TypeError(\"attempted to set private field on non-instance\");\r\n    }\r\n    privateMap.set(receiver, value);\r\n    return value;\r\n}\n\nvar tslib_es6$1 = /*#__PURE__*/Object.freeze({\n    __proto__: null,\n    __extends: __extends$1,\n    get __assign () { return __assign$1; },\n    __rest: __rest$1,\n    __decorate: __decorate$1,\n    __param: __param$1,\n    __metadata: __metadata$1,\n    __awaiter: __awaiter$1,\n    __generator: __generator$1,\n    __createBinding: __createBinding$1,\n    __exportStar: __exportStar$1,\n    __values: __values$1,\n    __read: __read$1,\n    __spread: __spread$1,\n    __spreadArrays: __spreadArrays$1,\n    __await: __await$1,\n    __asyncGenerator: __asyncGenerator$1,\n    __asyncDelegator: __asyncDelegator$1,\n    __asyncValues: __asyncValues$1,\n    __makeTemplateObject: __makeTemplateObject$1,\n    __importStar: __importStar$1,\n    __importDefault: __importDefault$1,\n    __classPrivateFieldGet: __classPrivateFieldGet$1,\n    __classPrivateFieldSet: __classPrivateFieldSet$1\n});\n\nvar aws_crc32c = createCommonjsModule(function (module, exports) {\n// Copyright Amazon.com Inc. or its affiliates. All Rights Reserved.\n// SPDX-License-Identifier: Apache-2.0\nObject.defineProperty(exports, \"__esModule\", { value: true });\nexports.AwsCrc32c = void 0;\n\n\n\nvar AwsCrc32c = /** @class */ (function () {\n    function AwsCrc32c() {\n        this.crc32c = new build$1.Crc32c();\n    }\n    AwsCrc32c.prototype.update = function (toHash) {\n        if ((0, build$3.isEmptyData)(toHash))\n            return;\n        this.crc32c.update((0, build$3.convertToBuffer)(toHash));\n    };\n    AwsCrc32c.prototype.digest = function () {\n        return tslib_es6$1.__awaiter(this, void 0, void 0, function () {\n            return tslib_es6$1.__generator(this, function (_a) {\n                return [2 /*return*/, (0, build$3.numToUint8)(this.crc32c.digest())];\n            });\n        });\n    };\n    AwsCrc32c.prototype.reset = function () {\n        this.crc32c = new build$1.Crc32c();\n    };\n    return AwsCrc32c;\n}());\nexports.AwsCrc32c = AwsCrc32c;\n\n});\n\nvar build$1 = createCommonjsModule(function (module, exports) {\n// Copyright Amazon.com Inc. or its affiliates. All Rights Reserved.\n// SPDX-License-Identifier: Apache-2.0\nObject.defineProperty(exports, \"__esModule\", { value: true });\nexports.AwsCrc32c = exports.Crc32c = exports.crc32c = void 0;\n\n\nfunction crc32c(data) {\n    return new Crc32c().update(data).digest();\n}\nexports.crc32c = crc32c;\nvar Crc32c = /** @class */ (function () {\n    function Crc32c() {\n        this.checksum = 0xffffffff;\n    }\n    Crc32c.prototype.update = function (data) {\n        var e_1, _a;\n        try {\n            for (var data_1 = tslib_es6$1.__values(data), data_1_1 = data_1.next(); !data_1_1.done; data_1_1 = data_1.next()) {\n                var byte = data_1_1.value;\n                this.checksum =\n                    (this.checksum >>> 8) ^ lookupTable[(this.checksum ^ byte) & 0xff];\n            }\n        }\n        catch (e_1_1) { e_1 = { error: e_1_1 }; }\n        finally {\n            try {\n                if (data_1_1 && !data_1_1.done && (_a = data_1.return)) _a.call(data_1);\n            }\n            finally { if (e_1) throw e_1.error; }\n        }\n        return this;\n    };\n    Crc32c.prototype.digest = function () {\n        return (this.checksum ^ 0xffffffff) >>> 0;\n    };\n    return Crc32c;\n}());\nexports.Crc32c = Crc32c;\n// prettier-ignore\nvar a_lookupTable = [\n    0x00000000, 0xF26B8303, 0xE13B70F7, 0x1350F3F4, 0xC79A971F, 0x35F1141C, 0x26A1E7E8, 0xD4CA64EB,\n    0x8AD958CF, 0x78B2DBCC, 0x6BE22838, 0x9989AB3B, 0x4D43CFD0, 0xBF284CD3, 0xAC78BF27, 0x5E133C24,\n    0x105EC76F, 0xE235446C, 0xF165B798, 0x030E349B, 0xD7C45070, 0x25AFD373, 0x36FF2087, 0xC494A384,\n    0x9A879FA0, 0x68EC1CA3, 0x7BBCEF57, 0x89D76C54, 0x5D1D08BF, 0xAF768BBC, 0xBC267848, 0x4E4DFB4B,\n    0x20BD8EDE, 0xD2D60DDD, 0xC186FE29, 0x33ED7D2A, 0xE72719C1, 0x154C9AC2, 0x061C6936, 0xF477EA35,\n    0xAA64D611, 0x580F5512, 0x4B5FA6E6, 0xB93425E5, 0x6DFE410E, 0x9F95C20D, 0x8CC531F9, 0x7EAEB2FA,\n    0x30E349B1, 0xC288CAB2, 0xD1D83946, 0x23B3BA45, 0xF779DEAE, 0x05125DAD, 0x1642AE59, 0xE4292D5A,\n    0xBA3A117E, 0x4851927D, 0x5B016189, 0xA96AE28A, 0x7DA08661, 0x8FCB0562, 0x9C9BF696, 0x6EF07595,\n    0x417B1DBC, 0xB3109EBF, 0xA0406D4B, 0x522BEE48, 0x86E18AA3, 0x748A09A0, 0x67DAFA54, 0x95B17957,\n    0xCBA24573, 0x39C9C670, 0x2A993584, 0xD8F2B687, 0x0C38D26C, 0xFE53516F, 0xED03A29B, 0x1F682198,\n    0x5125DAD3, 0xA34E59D0, 0xB01EAA24, 0x42752927, 0x96BF4DCC, 0x64D4CECF, 0x77843D3B, 0x85EFBE38,\n    0xDBFC821C, 0x2997011F, 0x3AC7F2EB, 0xC8AC71E8, 0x1C661503, 0xEE0D9600, 0xFD5D65F4, 0x0F36E6F7,\n    0x61C69362, 0x93AD1061, 0x80FDE395, 0x72966096, 0xA65C047D, 0x5437877E, 0x4767748A, 0xB50CF789,\n    0xEB1FCBAD, 0x197448AE, 0x0A24BB5A, 0xF84F3859, 0x2C855CB2, 0xDEEEDFB1, 0xCDBE2C45, 0x3FD5AF46,\n    0x7198540D, 0x83F3D70E, 0x90A324FA, 0x62C8A7F9, 0xB602C312, 0x44694011, 0x5739B3E5, 0xA55230E6,\n    0xFB410CC2, 0x092A8FC1, 0x1A7A7C35, 0xE811FF36, 0x3CDB9BDD, 0xCEB018DE, 0xDDE0EB2A, 0x2F8B6829,\n    0x82F63B78, 0x709DB87B, 0x63CD4B8F, 0x91A6C88C, 0x456CAC67, 0xB7072F64, 0xA457DC90, 0x563C5F93,\n    0x082F63B7, 0xFA44E0B4, 0xE9141340, 0x1B7F9043, 0xCFB5F4A8, 0x3DDE77AB, 0x2E8E845F, 0xDCE5075C,\n    0x92A8FC17, 0x60C37F14, 0x73938CE0, 0x81F80FE3, 0x55326B08, 0xA759E80B, 0xB4091BFF, 0x466298FC,\n    0x1871A4D8, 0xEA1A27DB, 0xF94AD42F, 0x0B21572C, 0xDFEB33C7, 0x2D80B0C4, 0x3ED04330, 0xCCBBC033,\n    0xA24BB5A6, 0x502036A5, 0x4370C551, 0xB11B4652, 0x65D122B9, 0x97BAA1BA, 0x84EA524E, 0x7681D14D,\n    0x2892ED69, 0xDAF96E6A, 0xC9A99D9E, 0x3BC21E9D, 0xEF087A76, 0x1D63F975, 0x0E330A81, 0xFC588982,\n    0xB21572C9, 0x407EF1CA, 0x532E023E, 0xA145813D, 0x758FE5D6, 0x87E466D5, 0x94B49521, 0x66DF1622,\n    0x38CC2A06, 0xCAA7A905, 0xD9F75AF1, 0x2B9CD9F2, 0xFF56BD19, 0x0D3D3E1A, 0x1E6DCDEE, 0xEC064EED,\n    0xC38D26C4, 0x31E6A5C7, 0x22B65633, 0xD0DDD530, 0x0417B1DB, 0xF67C32D8, 0xE52CC12C, 0x1747422F,\n    0x49547E0B, 0xBB3FFD08, 0xA86F0EFC, 0x5A048DFF, 0x8ECEE914, 0x7CA56A17, 0x6FF599E3, 0x9D9E1AE0,\n    0xD3D3E1AB, 0x21B862A8, 0x32E8915C, 0xC083125F, 0x144976B4, 0xE622F5B7, 0xF5720643, 0x07198540,\n    0x590AB964, 0xAB613A67, 0xB831C993, 0x4A5A4A90, 0x9E902E7B, 0x6CFBAD78, 0x7FAB5E8C, 0x8DC0DD8F,\n    0xE330A81A, 0x115B2B19, 0x020BD8ED, 0xF0605BEE, 0x24AA3F05, 0xD6C1BC06, 0xC5914FF2, 0x37FACCF1,\n    0x69E9F0D5, 0x9B8273D6, 0x88D28022, 0x7AB90321, 0xAE7367CA, 0x5C18E4C9, 0x4F48173D, 0xBD23943E,\n    0xF36E6F75, 0x0105EC76, 0x12551F82, 0xE03E9C81, 0x34F4F86A, 0xC69F7B69, 0xD5CF889D, 0x27A40B9E,\n    0x79B737BA, 0x8BDCB4B9, 0x988C474D, 0x6AE7C44E, 0xBE2DA0A5, 0x4C4623A6, 0x5F16D052, 0xAD7D5351,\n];\nvar lookupTable = (0, build$3.uint32ArrayFrom)(a_lookupTable);\n\nObject.defineProperty(exports, \"AwsCrc32c\", { enumerable: true, get: function () { return aws_crc32c.AwsCrc32c; } });\n\n});\n\nconst selectChecksumAlgorithmFunction = (checksumAlgorithm, config) => ({\n    [ChecksumAlgorithm.MD5]: config.md5,\n    [ChecksumAlgorithm.CRC32]: build$2.AwsCrc32,\n    [ChecksumAlgorithm.CRC32C]: build$1.AwsCrc32c,\n    [ChecksumAlgorithm.SHA1]: config.sha1,\n    [ChecksumAlgorithm.SHA256]: config.sha256,\n}[checksumAlgorithm]);\n\nconst stringHasher = (checksumAlgorithmFn, body) => {\n    const hash = new checksumAlgorithmFn();\n    hash.update(toUint8Array(body || \"\"));\n    return hash.digest();\n};\n\nconst getChecksum = async (body, { streamHasher, checksumAlgorithmFn, base64Encoder }) => {\n    const digest = isStreaming(body) ? streamHasher(checksumAlgorithmFn, body) : stringHasher(checksumAlgorithmFn, body);\n    return base64Encoder(await digest);\n};\n\nconst getChecksumAlgorithmListForResponse = (responseAlgorithms = []) => {\n    const validChecksumAlgorithms = [];\n    for (const algorithm of PRIORITY_ORDER_ALGORITHMS) {\n        if (!responseAlgorithms.includes(algorithm) || !CLIENT_SUPPORTED_ALGORITHMS.includes(algorithm)) {\n            continue;\n        }\n        validChecksumAlgorithms.push(algorithm);\n    }\n    return validChecksumAlgorithms;\n};\n\nconst validateChecksumFromResponse = async (response, { config, responseAlgorithms }) => {\n    const checksumAlgorithms = getChecksumAlgorithmListForResponse(responseAlgorithms);\n    const { body: responseBody, headers: responseHeaders } = response;\n    for (const algorithm of checksumAlgorithms) {\n        const responseHeader = getChecksumLocationName(algorithm);\n        const checksumFromResponse = responseHeaders[responseHeader];\n        if (checksumFromResponse) {\n            const checksumAlgorithmFn = selectChecksumAlgorithmFunction(algorithm, config);\n            const { streamHasher, base64Encoder } = config;\n            const checksum = await getChecksum(responseBody, { streamHasher, checksumAlgorithmFn, base64Encoder });\n            if (checksum === checksumFromResponse) {\n                break;\n            }\n            throw new Error(`Checksum mismatch: expected \"${checksum}\" but received \"${checksumFromResponse}\"` +\n                ` in response header \"${responseHeader}\".`);\n        }\n    }\n};\n\nconst flexibleChecksumsMiddleware = (config, middlewareConfig) => (next) => async (args) => {\n    if (!HttpRequest.isInstance(args.request)) {\n        return next(args);\n    }\n    const { request } = args;\n    const { body: requestBody, headers } = request;\n    const { base64Encoder, streamHasher } = config;\n    const { input, requestChecksumRequired, requestAlgorithmMember } = middlewareConfig;\n    const checksumAlgorithm = getChecksumAlgorithmForRequest(input, {\n        requestChecksumRequired,\n        requestAlgorithmMember,\n    });\n    let updatedBody = requestBody;\n    let updatedHeaders = headers;\n    if (checksumAlgorithm) {\n        const checksumLocationName = getChecksumLocationName(checksumAlgorithm);\n        const checksumAlgorithmFn = selectChecksumAlgorithmFunction(checksumAlgorithm, config);\n        if (isStreaming(requestBody)) {\n            const { getAwsChunkedEncodingStream, bodyLengthChecker } = config;\n            updatedBody = getAwsChunkedEncodingStream(requestBody, {\n                base64Encoder,\n                bodyLengthChecker,\n                checksumLocationName,\n                checksumAlgorithmFn,\n                streamHasher,\n            });\n            updatedHeaders = {\n                ...headers,\n                \"content-encoding\": headers[\"content-encoding\"]\n                    ? `${headers[\"content-encoding\"]},aws-chunked`\n                    : \"aws-chunked\",\n                \"transfer-encoding\": \"chunked\",\n                \"x-amz-decoded-content-length\": headers[\"content-length\"],\n                \"x-amz-content-sha256\": \"STREAMING-UNSIGNED-PAYLOAD-TRAILER\",\n                \"x-amz-trailer\": checksumLocationName,\n            };\n            delete updatedHeaders[\"content-length\"];\n        }\n        else if (!hasHeader(checksumLocationName, headers)) {\n            const rawChecksum = await stringHasher(checksumAlgorithmFn, requestBody);\n            updatedHeaders = {\n                ...headers,\n                [checksumLocationName]: base64Encoder(rawChecksum),\n            };\n        }\n    }\n    const result = await next({\n        ...args,\n        request: {\n            ...request,\n            headers: updatedHeaders,\n            body: updatedBody,\n        },\n    });\n    const { requestValidationModeMember, responseAlgorithms } = middlewareConfig;\n    if (requestValidationModeMember && input[requestValidationModeMember] === \"ENABLED\") {\n        validateChecksumFromResponse(result.response, {\n            config,\n            responseAlgorithms,\n        });\n    }\n    return result;\n};\n\nconst flexibleChecksumsMiddlewareOptions = {\n    name: \"flexibleChecksumsMiddleware\",\n    step: \"build\",\n    tags: [\"BODY_CHECKSUM\"],\n    override: true,\n};\nconst getFlexibleChecksumsPlugin = (config, middlewareConfig) => ({\n    applyToStack: (clientStack) => {\n        clientStack.add(flexibleChecksumsMiddleware(config, middlewareConfig), flexibleChecksumsMiddlewareOptions);\n    },\n});\n\nclass ListObjectsCommand extends Command {\n    static getEndpointParameterInstructions() {\n        return {\n            Bucket: { type: \"contextParams\", name: \"Bucket\" },\n            ForcePathStyle: { type: \"clientContextParams\", name: \"forcePathStyle\" },\n            UseArnRegion: { type: \"clientContextParams\", name: \"useArnRegion\" },\n            DisableMultiRegionAccessPoints: { type: \"clientContextParams\", name: \"disableMultiregionAccessPoints\" },\n            Accelerate: { type: \"clientContextParams\", name: \"useAccelerateEndpoint\" },\n            UseGlobalEndpoint: { type: \"builtInParams\", name: \"useGlobalEndpoint\" },\n            UseFIPS: { type: \"builtInParams\", name: \"useFipsEndpoint\" },\n            Endpoint: { type: \"builtInParams\", name: \"endpoint\" },\n            Region: { type: \"builtInParams\", name: \"region\" },\n            UseDualStack: { type: \"builtInParams\", name: \"useDualstackEndpoint\" },\n        };\n    }\n    constructor(input) {\n        super();\n        this.input = input;\n    }\n    resolveMiddleware(clientStack, configuration, options) {\n        this.middlewareStack.use(getSerdePlugin(configuration, this.serialize, this.deserialize));\n        this.middlewareStack.use(getEndpointPlugin(configuration, ListObjectsCommand.getEndpointParameterInstructions()));\n        const stack = clientStack.concat(this.middlewareStack);\n        const { logger } = configuration;\n        const clientName = \"S3Client\";\n        const commandName = \"ListObjectsCommand\";\n        const handlerExecutionContext = {\n            logger,\n            clientName,\n            commandName,\n            inputFilterSensitiveLog: (_) => _,\n            outputFilterSensitiveLog: (_) => _,\n        };\n        const { requestHandler } = configuration;\n        return stack.resolve((request) => requestHandler.handle(request.request, options || {}), handlerExecutionContext);\n    }\n    serialize(input, context) {\n        return se_ListObjectsCommand(input, context);\n    }\n    deserialize(output, context) {\n        return de_ListObjectsCommand(output, context);\n    }\n}\n\nclass PutObjectCommand extends Command {\n    static getEndpointParameterInstructions() {\n        return {\n            Bucket: { type: \"contextParams\", name: \"Bucket\" },\n            ForcePathStyle: { type: \"clientContextParams\", name: \"forcePathStyle\" },\n            UseArnRegion: { type: \"clientContextParams\", name: \"useArnRegion\" },\n            DisableMultiRegionAccessPoints: { type: \"clientContextParams\", name: \"disableMultiregionAccessPoints\" },\n            Accelerate: { type: \"clientContextParams\", name: \"useAccelerateEndpoint\" },\n            UseGlobalEndpoint: { type: \"builtInParams\", name: \"useGlobalEndpoint\" },\n            UseFIPS: { type: \"builtInParams\", name: \"useFipsEndpoint\" },\n            Endpoint: { type: \"builtInParams\", name: \"endpoint\" },\n            Region: { type: \"builtInParams\", name: \"region\" },\n            UseDualStack: { type: \"builtInParams\", name: \"useDualstackEndpoint\" },\n        };\n    }\n    constructor(input) {\n        super();\n        this.input = input;\n    }\n    resolveMiddleware(clientStack, configuration, options) {\n        this.middlewareStack.use(getSerdePlugin(configuration, this.serialize, this.deserialize));\n        this.middlewareStack.use(getEndpointPlugin(configuration, PutObjectCommand.getEndpointParameterInstructions()));\n        this.middlewareStack.use(getCheckContentLengthHeaderPlugin());\n        this.middlewareStack.use(getSsecPlugin(configuration));\n        this.middlewareStack.use(getFlexibleChecksumsPlugin(configuration, {\n            input: this.input,\n            requestAlgorithmMember: \"ChecksumAlgorithm\",\n            requestChecksumRequired: false,\n        }));\n        const stack = clientStack.concat(this.middlewareStack);\n        const { logger } = configuration;\n        const clientName = \"S3Client\";\n        const commandName = \"PutObjectCommand\";\n        const handlerExecutionContext = {\n            logger,\n            clientName,\n            commandName,\n            inputFilterSensitiveLog: PutObjectRequestFilterSensitiveLog,\n            outputFilterSensitiveLog: PutObjectOutputFilterSensitiveLog,\n        };\n        const { requestHandler } = configuration;\n        return stack.resolve((request) => requestHandler.handle(request.request, options || {}), handlerExecutionContext);\n    }\n    serialize(input, context) {\n        return se_PutObjectCommand(input, context);\n    }\n    deserialize(output, context) {\n        return de_PutObjectCommand(output, context);\n    }\n}\n\nexport { ListObjectsCommand, PutObjectCommand, S3Client };\n", "import { r as resolveEndpoint, N as NoOpLogger, p as parseUrl, c as calculateBodyLength, d as defaultUserAgent, D as DEFAULT_MAX_ATTEMPTS, i as invalidProvider, F as FetchHttpHandler, l as loadConfigsForDefaultMode, a as DEFAULT_RETRY_MODE, b as build, s as streamCollector, e as DEFAULT_USE_DUALSTACK_ENDPOINT, f as DEFAULT_USE_FIPS_ENDPOINT, g as resolveDefaultsModeConfig, C as Client, h as resolveRegionConfig, j as resolveEndpointConfig, k as resolveRetryConfig, m as resolveAwsAuthConfig, n as resolveUserAgentConfig, o as getRetryPlugin, q as getContentLengthPlugin, t as getHostHeaderPlugin, u as getLoggerPlugin, v as getRecursionDetectionPlugin, w as getUserAgentPlugin, x as resolveHostHeaderConfig } from '../common/resolveDefaultsModeConfig-3d61721d.js';\nimport { f as fromBase64, t as toBase64, a as fromUtf8, b as toUtf8 } from '../common/lazy-json-f4438c0b.js';\nimport '../common/_commonjsHelpers-eb5a497e.js';\nimport '../common/v4-c5ee5148.js';\n\nconst resolveClientEndpointParameters = (options) => {\n    return {\n        ...options,\n        useDualstackEndpoint: options.useDualstackEndpoint ?? false,\n        useFipsEndpoint: options.useFipsEndpoint ?? false,\n        defaultSigningName: \"cognito-identity\",\n    };\n};\n\nconst name = \"@aws-sdk/client-cognito-identity\";\nconst description = \"AWS SDK for JavaScript Cognito Identity Client for Node.js, Browser and React Native\";\nconst version = \"3.378.0\";\nconst scripts = {\n  build: \"concurrently 'yarn:build:cjs' 'yarn:build:es' 'yarn:build:types'\",\n  \"build:cjs\": \"tsc -p tsconfig.cjs.json\",\n  \"build:docs\": \"typedoc\",\n  \"build:es\": \"tsc -p tsconfig.es.json\",\n  \"build:include:deps\": \"lerna run --scope $npm_package_name --include-dependencies build\",\n  \"build:types\": \"tsc -p tsconfig.types.json\",\n  \"build:types:downlevel\": \"downlevel-dts dist-types dist-types/ts3.4\",\n  clean: \"rimraf ./dist-* && rimraf *.tsbuildinfo\",\n  \"extract:docs\": \"api-extractor run --local\",\n  \"generate:client\": \"node ../../scripts/generate-clients/single-service --solo cognito-identity\",\n  \"test:e2e\": \"ts-mocha test/**/*.ispec.ts && karma start karma.conf.js\"\n};\nconst main = \"./dist-cjs/index.js\";\nconst types = \"./dist-types/index.d.ts\";\nconst module = \"./dist-es/index.js\";\nconst sideEffects = false;\nconst dependencies = {\n  \"@aws-crypto/sha256-browser\": \"3.0.0\",\n  \"@aws-crypto/sha256-js\": \"3.0.0\",\n  \"@aws-sdk/client-sts\": \"3.378.0\",\n  \"@aws-sdk/credential-provider-node\": \"3.378.0\",\n  \"@aws-sdk/middleware-host-header\": \"3.378.0\",\n  \"@aws-sdk/middleware-logger\": \"3.378.0\",\n  \"@aws-sdk/middleware-recursion-detection\": \"3.378.0\",\n  \"@aws-sdk/middleware-signing\": \"3.378.0\",\n  \"@aws-sdk/middleware-user-agent\": \"3.378.0\",\n  \"@aws-sdk/types\": \"3.378.0\",\n  \"@aws-sdk/util-endpoints\": \"3.378.0\",\n  \"@aws-sdk/util-user-agent-browser\": \"3.378.0\",\n  \"@aws-sdk/util-user-agent-node\": \"3.378.0\",\n  \"@smithy/config-resolver\": \"^2.0.1\",\n  \"@smithy/fetch-http-handler\": \"^2.0.1\",\n  \"@smithy/hash-node\": \"^2.0.1\",\n  \"@smithy/invalid-dependency\": \"^2.0.1\",\n  \"@smithy/middleware-content-length\": \"^2.0.1\",\n  \"@smithy/middleware-endpoint\": \"^2.0.1\",\n  \"@smithy/middleware-retry\": \"^2.0.1\",\n  \"@smithy/middleware-serde\": \"^2.0.1\",\n  \"@smithy/middleware-stack\": \"^2.0.0\",\n  \"@smithy/node-config-provider\": \"^2.0.1\",\n  \"@smithy/node-http-handler\": \"^2.0.1\",\n  \"@smithy/protocol-http\": \"^2.0.1\",\n  \"@smithy/smithy-client\": \"^2.0.1\",\n  \"@smithy/types\": \"^2.0.2\",\n  \"@smithy/url-parser\": \"^2.0.1\",\n  \"@smithy/util-base64\": \"^2.0.0\",\n  \"@smithy/util-body-length-browser\": \"^2.0.0\",\n  \"@smithy/util-body-length-node\": \"^2.0.0\",\n  \"@smithy/util-defaults-mode-browser\": \"^2.0.1\",\n  \"@smithy/util-defaults-mode-node\": \"^2.0.1\",\n  \"@smithy/util-retry\": \"^2.0.0\",\n  \"@smithy/util-utf8\": \"^2.0.0\",\n  tslib: \"^2.5.0\"\n};\nconst devDependencies = {\n  \"@aws-sdk/client-iam\": \"3.378.0\",\n  \"@smithy/service-client-documentation-generator\": \"^2.0.0\",\n  \"@tsconfig/node14\": \"1.0.3\",\n  \"@types/chai\": \"^4.2.11\",\n  \"@types/mocha\": \"^8.0.4\",\n  \"@types/node\": \"^14.14.31\",\n  concurrently: \"7.0.0\",\n  \"downlevel-dts\": \"0.10.1\",\n  rimraf: \"3.0.2\",\n  typedoc: \"0.23.23\",\n  typescript: \"~4.9.5\"\n};\nconst engines = {\n  node: \">=14.0.0\"\n};\nconst typesVersions = {\n  \"<4.0\": {\n    \"dist-types/*\": [\n      \"dist-types/ts3.4/*\"\n    ]\n  }\n};\nconst files = [\n  \"dist-*/**\"\n];\nconst author = {\n  name: \"AWS SDK for JavaScript Team\",\n  url: \"https://aws.amazon.com/javascript/\"\n};\nconst license = \"Apache-2.0\";\nconst browser = {\n  \"./dist-es/runtimeConfig\": \"./dist-es/runtimeConfig.browser\"\n};\nconst homepage = \"https://github.com/aws/aws-sdk-js-v3/tree/main/clients/client-cognito-identity\";\nconst repository = {\n  type: \"git\",\n  url: \"https://github.com/aws/aws-sdk-js-v3.git\",\n  directory: \"clients/client-cognito-identity\"\n};\nvar packageInfo = {\n  name: name,\n  description: description,\n  version: version,\n  scripts: scripts,\n  main: main,\n  types: types,\n  module: module,\n  sideEffects: sideEffects,\n  dependencies: dependencies,\n  devDependencies: devDependencies,\n  engines: engines,\n  typesVersions: typesVersions,\n  files: files,\n  author: author,\n  license: license,\n  browser: browser,\n  \"react-native\": {\n  \"./dist-es/runtimeConfig\": \"./dist-es/runtimeConfig.native\"\n},\n  homepage: homepage,\n  repository: repository\n};\n\nconst p = \"required\", q = \"fn\", r = \"argv\", s = \"ref\";\nconst a = \"PartitionResult\", b = \"tree\", c = \"error\", d = \"endpoint\", e = { [p]: false, \"type\": \"String\" }, f = { [p]: true, \"default\": false, \"type\": \"Boolean\" }, g = { [s]: \"Endpoint\" }, h = { [q]: \"booleanEquals\", [r]: [{ [s]: \"UseFIPS\" }, true] }, i = { [q]: \"booleanEquals\", [r]: [{ [s]: \"UseDualStack\" }, true] }, j = {}, k = { [q]: \"booleanEquals\", [r]: [true, { [q]: \"getAttr\", [r]: [{ [s]: a }, \"supportsFIPS\"] }] }, l = { [q]: \"booleanEquals\", [r]: [true, { [q]: \"getAttr\", [r]: [{ [s]: a }, \"supportsDualStack\"] }] }, m = [g], n = [h], o = [i];\nconst _data = { version: \"1.0\", parameters: { Region: e, UseDualStack: f, UseFIPS: f, Endpoint: e }, rules: [{ conditions: [{ [q]: \"aws.partition\", [r]: [{ [s]: \"Region\" }], assign: a }], type: b, rules: [{ conditions: [{ [q]: \"isSet\", [r]: m }, { [q]: \"parseURL\", [r]: m, assign: \"url\" }], type: b, rules: [{ conditions: n, error: \"Invalid Configuration: FIPS and custom endpoint are not supported\", type: c }, { type: b, rules: [{ conditions: o, error: \"Invalid Configuration: Dualstack and custom endpoint are not supported\", type: c }, { endpoint: { url: g, properties: j, headers: j }, type: d }] }] }, { conditions: [h, i], type: b, rules: [{ conditions: [k, l], type: b, rules: [{ endpoint: { url: \"https://cognito-identity-fips.{Region}.{PartitionResult#dualStackDnsSuffix}\", properties: j, headers: j }, type: d }] }, { error: \"FIPS and DualStack are enabled, but this partition does not support one or both\", type: c }] }, { conditions: n, type: b, rules: [{ conditions: [k], type: b, rules: [{ type: b, rules: [{ endpoint: { url: \"https://cognito-identity-fips.{Region}.{PartitionResult#dnsSuffix}\", properties: j, headers: j }, type: d }] }] }, { error: \"FIPS is enabled but this partition does not support FIPS\", type: c }] }, { conditions: o, type: b, rules: [{ conditions: [l], type: b, rules: [{ endpoint: { url: \"https://cognito-identity.{Region}.{PartitionResult#dualStackDnsSuffix}\", properties: j, headers: j }, type: d }] }, { error: \"DualStack is enabled but this partition does not support DualStack\", type: c }] }, { endpoint: { url: \"https://cognito-identity.{Region}.{PartitionResult#dnsSuffix}\", properties: j, headers: j }, type: d }] }] };\nconst ruleSet = _data;\n\nconst defaultEndpointResolver = (endpointParams, context = {}) => {\n    return resolveEndpoint(ruleSet, {\n        endpointParams: endpointParams,\n        logger: context.logger,\n    });\n};\n\nconst getRuntimeConfig = (config) => ({\n    apiVersion: \"2014-06-30\",\n    base64Decoder: config?.base64Decoder ?? fromBase64,\n    base64Encoder: config?.base64Encoder ?? toBase64,\n    disableHostPrefix: config?.disableHostPrefix ?? false,\n    endpointProvider: config?.endpointProvider ?? defaultEndpointResolver,\n    logger: config?.logger ?? new NoOpLogger(),\n    serviceId: config?.serviceId ?? \"Cognito Identity\",\n    urlParser: config?.urlParser ?? parseUrl,\n    utf8Decoder: config?.utf8Decoder ?? fromUtf8,\n    utf8Encoder: config?.utf8Encoder ?? toUtf8,\n});\n\nconst getRuntimeConfig$1 = (config) => {\n    const defaultsMode = resolveDefaultsModeConfig(config);\n    const defaultConfigProvider = () => defaultsMode().then(loadConfigsForDefaultMode);\n    const clientSharedValues = getRuntimeConfig(config);\n    return {\n        ...clientSharedValues,\n        ...config,\n        runtime: \"browser\",\n        defaultsMode,\n        bodyLengthChecker: config?.bodyLengthChecker ?? calculateBodyLength,\n        credentialDefaultProvider: config?.credentialDefaultProvider ?? ((_) => () => Promise.reject(new Error(\"Credential is missing\"))),\n        defaultUserAgentProvider: config?.defaultUserAgentProvider ??\n            defaultUserAgent({ serviceId: clientSharedValues.serviceId, clientVersion: packageInfo.version }),\n        maxAttempts: config?.maxAttempts ?? DEFAULT_MAX_ATTEMPTS,\n        region: config?.region ?? invalidProvider(\"Region is missing\"),\n        requestHandler: config?.requestHandler ?? new FetchHttpHandler(defaultConfigProvider),\n        retryMode: config?.retryMode ?? (async () => (await defaultConfigProvider()).retryMode || DEFAULT_RETRY_MODE),\n        sha256: config?.sha256 ?? build.Sha256,\n        streamCollector: config?.streamCollector ?? streamCollector,\n        useDualstackEndpoint: config?.useDualstackEndpoint ?? (() => Promise.resolve(DEFAULT_USE_DUALSTACK_ENDPOINT)),\n        useFipsEndpoint: config?.useFipsEndpoint ?? (() => Promise.resolve(DEFAULT_USE_FIPS_ENDPOINT)),\n    };\n};\n\nclass CognitoIdentityClient extends Client {\n    constructor(configuration) {\n        const _config_0 = getRuntimeConfig$1(configuration);\n        const _config_1 = resolveClientEndpointParameters(_config_0);\n        const _config_2 = resolveRegionConfig(_config_1);\n        const _config_3 = resolveEndpointConfig(_config_2);\n        const _config_4 = resolveRetryConfig(_config_3);\n        const _config_5 = resolveHostHeaderConfig(_config_4);\n        const _config_6 = resolveAwsAuthConfig(_config_5);\n        const _config_7 = resolveUserAgentConfig(_config_6);\n        super(_config_7);\n        this.config = _config_7;\n        this.middlewareStack.use(getRetryPlugin(this.config));\n        this.middlewareStack.use(getContentLengthPlugin(this.config));\n        this.middlewareStack.use(getHostHeaderPlugin(this.config));\n        this.middlewareStack.use(getLoggerPlugin(this.config));\n        this.middlewareStack.use(getRecursionDetectionPlugin(this.config));\n        this.middlewareStack.use(getUserAgentPlugin(this.config));\n    }\n    destroy() {\n        super.destroy();\n    }\n}\n\nexport { CognitoIdentityClient };\n", "import { S as ServiceException, c as collectBody, t as take, f as decorateServiceException, w as withBaseException, b as expectString, e as expectNonNull, k as parseEpochTimestamp, l as expectNumber, C as Command, i as getSerdePlugin, j as getEndpointPlugin } from '../common/object-mapping-ce2960b7.js';\nimport { H as HttpRequest } from '../common/lazy-json-f4438c0b.js';\n\nclass ProviderError extends Error {\n    constructor(message, tryNextLink = true) {\n        super(message);\n        this.tryNextLink = tryNextLink;\n        this.name = \"ProviderError\";\n        Object.setPrototypeOf(this, ProviderError.prototype);\n    }\n    static from(error, tryNextLink = true) {\n        return Object.assign(new this(error.message, tryNextLink), error);\n    }\n}\n\nclass CredentialsProviderError extends ProviderError {\n    constructor(message, tryNextLink = true) {\n        super(message, tryNextLink);\n        this.tryNextLink = tryNextLink;\n        this.name = \"CredentialsProviderError\";\n        Object.setPrototypeOf(this, CredentialsProviderError.prototype);\n    }\n}\n\nconst _json = (obj) => {\n    if (obj == null) {\n        return {};\n    }\n    if (Array.isArray(obj)) {\n        return obj.filter((_) => _ != null);\n    }\n    if (typeof obj === \"object\") {\n        const target = {};\n        for (const key of Object.keys(obj)) {\n            if (obj[key] == null) {\n                continue;\n            }\n            target[key] = _json(obj[key]);\n        }\n        return target;\n    }\n    return obj;\n};\n\nclass CognitoIdentityServiceException extends ServiceException {\n    constructor(options) {\n        super(options);\n        Object.setPrototypeOf(this, CognitoIdentityServiceException.prototype);\n    }\n}\n\nclass InternalErrorException extends CognitoIdentityServiceException {\n    constructor(opts) {\n        super({\n            name: \"InternalErrorException\",\n            $fault: \"server\",\n            ...opts,\n        });\n        this.name = \"InternalErrorException\";\n        this.$fault = \"server\";\n        Object.setPrototypeOf(this, InternalErrorException.prototype);\n    }\n}\nclass InvalidParameterException extends CognitoIdentityServiceException {\n    constructor(opts) {\n        super({\n            name: \"InvalidParameterException\",\n            $fault: \"client\",\n            ...opts,\n        });\n        this.name = \"InvalidParameterException\";\n        this.$fault = \"client\";\n        Object.setPrototypeOf(this, InvalidParameterException.prototype);\n    }\n}\nclass LimitExceededException extends CognitoIdentityServiceException {\n    constructor(opts) {\n        super({\n            name: \"LimitExceededException\",\n            $fault: \"client\",\n            ...opts,\n        });\n        this.name = \"LimitExceededException\";\n        this.$fault = \"client\";\n        Object.setPrototypeOf(this, LimitExceededException.prototype);\n    }\n}\nclass NotAuthorizedException extends CognitoIdentityServiceException {\n    constructor(opts) {\n        super({\n            name: \"NotAuthorizedException\",\n            $fault: \"client\",\n            ...opts,\n        });\n        this.name = \"NotAuthorizedException\";\n        this.$fault = \"client\";\n        Object.setPrototypeOf(this, NotAuthorizedException.prototype);\n    }\n}\nclass ResourceConflictException extends CognitoIdentityServiceException {\n    constructor(opts) {\n        super({\n            name: \"ResourceConflictException\",\n            $fault: \"client\",\n            ...opts,\n        });\n        this.name = \"ResourceConflictException\";\n        this.$fault = \"client\";\n        Object.setPrototypeOf(this, ResourceConflictException.prototype);\n    }\n}\nclass TooManyRequestsException extends CognitoIdentityServiceException {\n    constructor(opts) {\n        super({\n            name: \"TooManyRequestsException\",\n            $fault: \"client\",\n            ...opts,\n        });\n        this.name = \"TooManyRequestsException\";\n        this.$fault = \"client\";\n        Object.setPrototypeOf(this, TooManyRequestsException.prototype);\n    }\n}\nclass ResourceNotFoundException extends CognitoIdentityServiceException {\n    constructor(opts) {\n        super({\n            name: \"ResourceNotFoundException\",\n            $fault: \"client\",\n            ...opts,\n        });\n        this.name = \"ResourceNotFoundException\";\n        this.$fault = \"client\";\n        Object.setPrototypeOf(this, ResourceNotFoundException.prototype);\n    }\n}\nclass ExternalServiceException extends CognitoIdentityServiceException {\n    constructor(opts) {\n        super({\n            name: \"ExternalServiceException\",\n            $fault: \"client\",\n            ...opts,\n        });\n        this.name = \"ExternalServiceException\";\n        this.$fault = \"client\";\n        Object.setPrototypeOf(this, ExternalServiceException.prototype);\n    }\n}\nclass InvalidIdentityPoolConfigurationException extends CognitoIdentityServiceException {\n    constructor(opts) {\n        super({\n            name: \"InvalidIdentityPoolConfigurationException\",\n            $fault: \"client\",\n            ...opts,\n        });\n        this.name = \"InvalidIdentityPoolConfigurationException\";\n        this.$fault = \"client\";\n        Object.setPrototypeOf(this, InvalidIdentityPoolConfigurationException.prototype);\n    }\n}\n\nconst se_GetCredentialsForIdentityCommand = async (input, context) => {\n    const headers = sharedHeaders(\"GetCredentialsForIdentity\");\n    let body;\n    body = JSON.stringify(_json(input));\n    return buildHttpRpcRequest(context, headers, \"/\", undefined, body);\n};\nconst se_GetIdCommand = async (input, context) => {\n    const headers = sharedHeaders(\"GetId\");\n    let body;\n    body = JSON.stringify(_json(input));\n    return buildHttpRpcRequest(context, headers, \"/\", undefined, body);\n};\nconst de_GetCredentialsForIdentityCommand = async (output, context) => {\n    if (output.statusCode >= 300) {\n        return de_GetCredentialsForIdentityCommandError(output, context);\n    }\n    const data = await parseBody(output.body, context);\n    let contents = {};\n    contents = de_GetCredentialsForIdentityResponse(data);\n    const response = {\n        $metadata: deserializeMetadata(output),\n        ...contents,\n    };\n    return response;\n};\nconst de_GetCredentialsForIdentityCommandError = async (output, context) => {\n    const parsedOutput = {\n        ...output,\n        body: await parseErrorBody(output.body, context),\n    };\n    const errorCode = loadRestJsonErrorCode(output, parsedOutput.body);\n    switch (errorCode) {\n        case \"ExternalServiceException\":\n        case \"com.amazonaws.cognitoidentity#ExternalServiceException\":\n            throw await de_ExternalServiceExceptionRes(parsedOutput);\n        case \"InternalErrorException\":\n        case \"com.amazonaws.cognitoidentity#InternalErrorException\":\n            throw await de_InternalErrorExceptionRes(parsedOutput);\n        case \"InvalidIdentityPoolConfigurationException\":\n        case \"com.amazonaws.cognitoidentity#InvalidIdentityPoolConfigurationException\":\n            throw await de_InvalidIdentityPoolConfigurationExceptionRes(parsedOutput);\n        case \"InvalidParameterException\":\n        case \"com.amazonaws.cognitoidentity#InvalidParameterException\":\n            throw await de_InvalidParameterExceptionRes(parsedOutput);\n        case \"NotAuthorizedException\":\n        case \"com.amazonaws.cognitoidentity#NotAuthorizedException\":\n            throw await de_NotAuthorizedExceptionRes(parsedOutput);\n        case \"ResourceConflictException\":\n        case \"com.amazonaws.cognitoidentity#ResourceConflictException\":\n            throw await de_ResourceConflictExceptionRes(parsedOutput);\n        case \"ResourceNotFoundException\":\n        case \"com.amazonaws.cognitoidentity#ResourceNotFoundException\":\n            throw await de_ResourceNotFoundExceptionRes(parsedOutput);\n        case \"TooManyRequestsException\":\n        case \"com.amazonaws.cognitoidentity#TooManyRequestsException\":\n            throw await de_TooManyRequestsExceptionRes(parsedOutput);\n        default:\n            const parsedBody = parsedOutput.body;\n            return throwDefaultError({\n                output,\n                parsedBody,\n                errorCode,\n            });\n    }\n};\nconst de_GetIdCommand = async (output, context) => {\n    if (output.statusCode >= 300) {\n        return de_GetIdCommandError(output, context);\n    }\n    const data = await parseBody(output.body, context);\n    let contents = {};\n    contents = _json(data);\n    const response = {\n        $metadata: deserializeMetadata(output),\n        ...contents,\n    };\n    return response;\n};\nconst de_GetIdCommandError = async (output, context) => {\n    const parsedOutput = {\n        ...output,\n        body: await parseErrorBody(output.body, context),\n    };\n    const errorCode = loadRestJsonErrorCode(output, parsedOutput.body);\n    switch (errorCode) {\n        case \"ExternalServiceException\":\n        case \"com.amazonaws.cognitoidentity#ExternalServiceException\":\n            throw await de_ExternalServiceExceptionRes(parsedOutput);\n        case \"InternalErrorException\":\n        case \"com.amazonaws.cognitoidentity#InternalErrorException\":\n            throw await de_InternalErrorExceptionRes(parsedOutput);\n        case \"InvalidParameterException\":\n        case \"com.amazonaws.cognitoidentity#InvalidParameterException\":\n            throw await de_InvalidParameterExceptionRes(parsedOutput);\n        case \"LimitExceededException\":\n        case \"com.amazonaws.cognitoidentity#LimitExceededException\":\n            throw await de_LimitExceededExceptionRes(parsedOutput);\n        case \"NotAuthorizedException\":\n        case \"com.amazonaws.cognitoidentity#NotAuthorizedException\":\n            throw await de_NotAuthorizedExceptionRes(parsedOutput);\n        case \"ResourceConflictException\":\n        case \"com.amazonaws.cognitoidentity#ResourceConflictException\":\n            throw await de_ResourceConflictExceptionRes(parsedOutput);\n        case \"ResourceNotFoundException\":\n        case \"com.amazonaws.cognitoidentity#ResourceNotFoundException\":\n            throw await de_ResourceNotFoundExceptionRes(parsedOutput);\n        case \"TooManyRequestsException\":\n        case \"com.amazonaws.cognitoidentity#TooManyRequestsException\":\n            throw await de_TooManyRequestsExceptionRes(parsedOutput);\n        default:\n            const parsedBody = parsedOutput.body;\n            return throwDefaultError({\n                output,\n                parsedBody,\n                errorCode,\n            });\n    }\n};\nconst de_ExternalServiceExceptionRes = async (parsedOutput, context) => {\n    const body = parsedOutput.body;\n    const deserialized = _json(body);\n    const exception = new ExternalServiceException({\n        $metadata: deserializeMetadata(parsedOutput),\n        ...deserialized,\n    });\n    return decorateServiceException(exception, body);\n};\nconst de_InternalErrorExceptionRes = async (parsedOutput, context) => {\n    const body = parsedOutput.body;\n    const deserialized = _json(body);\n    const exception = new InternalErrorException({\n        $metadata: deserializeMetadata(parsedOutput),\n        ...deserialized,\n    });\n    return decorateServiceException(exception, body);\n};\nconst de_InvalidIdentityPoolConfigurationExceptionRes = async (parsedOutput, context) => {\n    const body = parsedOutput.body;\n    const deserialized = _json(body);\n    const exception = new InvalidIdentityPoolConfigurationException({\n        $metadata: deserializeMetadata(parsedOutput),\n        ...deserialized,\n    });\n    return decorateServiceException(exception, body);\n};\nconst de_InvalidParameterExceptionRes = async (parsedOutput, context) => {\n    const body = parsedOutput.body;\n    const deserialized = _json(body);\n    const exception = new InvalidParameterException({\n        $metadata: deserializeMetadata(parsedOutput),\n        ...deserialized,\n    });\n    return decorateServiceException(exception, body);\n};\nconst de_LimitExceededExceptionRes = async (parsedOutput, context) => {\n    const body = parsedOutput.body;\n    const deserialized = _json(body);\n    const exception = new LimitExceededException({\n        $metadata: deserializeMetadata(parsedOutput),\n        ...deserialized,\n    });\n    return decorateServiceException(exception, body);\n};\nconst de_NotAuthorizedExceptionRes = async (parsedOutput, context) => {\n    const body = parsedOutput.body;\n    const deserialized = _json(body);\n    const exception = new NotAuthorizedException({\n        $metadata: deserializeMetadata(parsedOutput),\n        ...deserialized,\n    });\n    return decorateServiceException(exception, body);\n};\nconst de_ResourceConflictExceptionRes = async (parsedOutput, context) => {\n    const body = parsedOutput.body;\n    const deserialized = _json(body);\n    const exception = new ResourceConflictException({\n        $metadata: deserializeMetadata(parsedOutput),\n        ...deserialized,\n    });\n    return decorateServiceException(exception, body);\n};\nconst de_ResourceNotFoundExceptionRes = async (parsedOutput, context) => {\n    const body = parsedOutput.body;\n    const deserialized = _json(body);\n    const exception = new ResourceNotFoundException({\n        $metadata: deserializeMetadata(parsedOutput),\n        ...deserialized,\n    });\n    return decorateServiceException(exception, body);\n};\nconst de_TooManyRequestsExceptionRes = async (parsedOutput, context) => {\n    const body = parsedOutput.body;\n    const deserialized = _json(body);\n    const exception = new TooManyRequestsException({\n        $metadata: deserializeMetadata(parsedOutput),\n        ...deserialized,\n    });\n    return decorateServiceException(exception, body);\n};\nconst de_Credentials = (output, context) => {\n    return take(output, {\n        AccessKeyId: expectString,\n        Expiration: (_) => expectNonNull(parseEpochTimestamp(expectNumber(_))),\n        SecretKey: expectString,\n        SessionToken: expectString,\n    });\n};\nconst de_GetCredentialsForIdentityResponse = (output, context) => {\n    return take(output, {\n        Credentials: (_) => de_Credentials(_),\n        IdentityId: expectString,\n    });\n};\nconst deserializeMetadata = (output) => ({\n    httpStatusCode: output.statusCode,\n    requestId: output.headers[\"x-amzn-requestid\"] ?? output.headers[\"x-amzn-request-id\"] ?? output.headers[\"x-amz-request-id\"],\n    extendedRequestId: output.headers[\"x-amz-id-2\"],\n    cfId: output.headers[\"x-amz-cf-id\"],\n});\nconst collectBodyString = (streamBody, context) => collectBody(streamBody, context).then((body) => context.utf8Encoder(body));\nconst throwDefaultError = withBaseException(CognitoIdentityServiceException);\nconst buildHttpRpcRequest = async (context, headers, path, resolvedHostname, body) => {\n    const { hostname, protocol = \"https\", port, path: basePath } = await context.endpoint();\n    const contents = {\n        protocol,\n        hostname,\n        port,\n        method: \"POST\",\n        path: basePath.endsWith(\"/\") ? basePath.slice(0, -1) + path : basePath + path,\n        headers,\n    };\n    if (resolvedHostname !== undefined) {\n        contents.hostname = resolvedHostname;\n    }\n    if (body !== undefined) {\n        contents.body = body;\n    }\n    return new HttpRequest(contents);\n};\nfunction sharedHeaders(operation) {\n    return {\n        \"content-type\": \"application/x-amz-json-1.1\",\n        \"x-amz-target\": `AWSCognitoIdentityService.${operation}`,\n    };\n}\nconst parseBody = (streamBody, context) => collectBodyString(streamBody, context).then((encoded) => {\n    if (encoded.length) {\n        return JSON.parse(encoded);\n    }\n    return {};\n});\nconst parseErrorBody = async (errorBody, context) => {\n    const value = await parseBody(errorBody, context);\n    value.message = value.message ?? value.Message;\n    return value;\n};\nconst loadRestJsonErrorCode = (output, data) => {\n    const findKey = (object, key) => Object.keys(object).find((k) => k.toLowerCase() === key.toLowerCase());\n    const sanitizeErrorCode = (rawValue) => {\n        let cleanValue = rawValue;\n        if (typeof cleanValue === \"number\") {\n            cleanValue = cleanValue.toString();\n        }\n        if (cleanValue.indexOf(\",\") >= 0) {\n            cleanValue = cleanValue.split(\",\")[0];\n        }\n        if (cleanValue.indexOf(\":\") >= 0) {\n            cleanValue = cleanValue.split(\":\")[0];\n        }\n        if (cleanValue.indexOf(\"#\") >= 0) {\n            cleanValue = cleanValue.split(\"#\")[1];\n        }\n        return cleanValue;\n    };\n    const headerKey = findKey(output.headers, \"x-amzn-errortype\");\n    if (headerKey !== undefined) {\n        return sanitizeErrorCode(output.headers[headerKey]);\n    }\n    if (data.code !== undefined) {\n        return sanitizeErrorCode(data.code);\n    }\n    if (data[\"__type\"] !== undefined) {\n        return sanitizeErrorCode(data[\"__type\"]);\n    }\n};\n\nclass GetCredentialsForIdentityCommand extends Command {\n    static getEndpointParameterInstructions() {\n        return {\n            UseFIPS: { type: \"builtInParams\", name: \"useFipsEndpoint\" },\n            Endpoint: { type: \"builtInParams\", name: \"endpoint\" },\n            Region: { type: \"builtInParams\", name: \"region\" },\n            UseDualStack: { type: \"builtInParams\", name: \"useDualstackEndpoint\" },\n        };\n    }\n    constructor(input) {\n        super();\n        this.input = input;\n    }\n    resolveMiddleware(clientStack, configuration, options) {\n        this.middlewareStack.use(getSerdePlugin(configuration, this.serialize, this.deserialize));\n        this.middlewareStack.use(getEndpointPlugin(configuration, GetCredentialsForIdentityCommand.getEndpointParameterInstructions()));\n        const stack = clientStack.concat(this.middlewareStack);\n        const { logger } = configuration;\n        const clientName = \"CognitoIdentityClient\";\n        const commandName = \"GetCredentialsForIdentityCommand\";\n        const handlerExecutionContext = {\n            logger,\n            clientName,\n            commandName,\n            inputFilterSensitiveLog: (_) => _,\n            outputFilterSensitiveLog: (_) => _,\n        };\n        const { requestHandler } = configuration;\n        return stack.resolve((request) => requestHandler.handle(request.request, options || {}), handlerExecutionContext);\n    }\n    serialize(input, context) {\n        return se_GetCredentialsForIdentityCommand(input, context);\n    }\n    deserialize(output, context) {\n        return de_GetCredentialsForIdentityCommand(output, context);\n    }\n}\n\nclass GetIdCommand extends Command {\n    static getEndpointParameterInstructions() {\n        return {\n            UseFIPS: { type: \"builtInParams\", name: \"useFipsEndpoint\" },\n            Endpoint: { type: \"builtInParams\", name: \"endpoint\" },\n            Region: { type: \"builtInParams\", name: \"region\" },\n            UseDualStack: { type: \"builtInParams\", name: \"useDualstackEndpoint\" },\n        };\n    }\n    constructor(input) {\n        super();\n        this.input = input;\n    }\n    resolveMiddleware(clientStack, configuration, options) {\n        this.middlewareStack.use(getSerdePlugin(configuration, this.serialize, this.deserialize));\n        this.middlewareStack.use(getEndpointPlugin(configuration, GetIdCommand.getEndpointParameterInstructions()));\n        const stack = clientStack.concat(this.middlewareStack);\n        const { logger } = configuration;\n        const clientName = \"CognitoIdentityClient\";\n        const commandName = \"GetIdCommand\";\n        const handlerExecutionContext = {\n            logger,\n            clientName,\n            commandName,\n            inputFilterSensitiveLog: (_) => _,\n            outputFilterSensitiveLog: (_) => _,\n        };\n        const { requestHandler } = configuration;\n        return stack.resolve((request) => requestHandler.handle(request.request, options || {}), handlerExecutionContext);\n    }\n    serialize(input, context) {\n        return se_GetIdCommand(input, context);\n    }\n    deserialize(output, context) {\n        return de_GetIdCommand(output, context);\n    }\n}\n\nfunction resolveLogins(logins) {\n    return Promise.all(Object.keys(logins).reduce((arr, name) => {\n        const tokenOrProvider = logins[name];\n        if (typeof tokenOrProvider === \"string\") {\n            arr.push([name, tokenOrProvider]);\n        }\n        else {\n            arr.push(tokenOrProvider().then((token) => [name, token]));\n        }\n        return arr;\n    }, [])).then((resolvedPairs) => resolvedPairs.reduce((logins, [key, value]) => {\n        logins[key] = value;\n        return logins;\n    }, {}));\n}\n\nfunction fromCognitoIdentity(parameters) {\n    return async () => {\n        const { Credentials: { AccessKeyId = throwOnMissingAccessKeyId(), Expiration, SecretKey = throwOnMissingSecretKey(), SessionToken, } = throwOnMissingCredentials(), } = await parameters.client.send(new GetCredentialsForIdentityCommand({\n            CustomRoleArn: parameters.customRoleArn,\n            IdentityId: parameters.identityId,\n            Logins: parameters.logins ? await resolveLogins(parameters.logins) : undefined,\n        }));\n        return {\n            identityId: parameters.identityId,\n            accessKeyId: AccessKeyId,\n            secretAccessKey: SecretKey,\n            sessionToken: SessionToken,\n            expiration: Expiration,\n        };\n    };\n}\nfunction throwOnMissingAccessKeyId() {\n    throw new CredentialsProviderError(\"Response from Amazon Cognito contained no access key ID\");\n}\nfunction throwOnMissingCredentials() {\n    throw new CredentialsProviderError(\"Response from Amazon Cognito contained no credentials\");\n}\nfunction throwOnMissingSecretKey() {\n    throw new CredentialsProviderError(\"Response from Amazon Cognito contained no secret key\");\n}\n\nconst STORE_NAME = \"IdentityIds\";\nclass IndexedDbStorage {\n    constructor(dbName = \"aws:cognito-identity-ids\") {\n        this.dbName = dbName;\n    }\n    getItem(key) {\n        return this.withObjectStore(\"readonly\", (store) => {\n            const req = store.get(key);\n            return new Promise((resolve) => {\n                req.onerror = () => resolve(null);\n                req.onsuccess = () => resolve(req.result ? req.result.value : null);\n            });\n        }).catch(() => null);\n    }\n    removeItem(key) {\n        return this.withObjectStore(\"readwrite\", (store) => {\n            const req = store.delete(key);\n            return new Promise((resolve, reject) => {\n                req.onerror = () => reject(req.error);\n                req.onsuccess = () => resolve();\n            });\n        });\n    }\n    setItem(id, value) {\n        return this.withObjectStore(\"readwrite\", (store) => {\n            const req = store.put({ id, value });\n            return new Promise((resolve, reject) => {\n                req.onerror = () => reject(req.error);\n                req.onsuccess = () => resolve();\n            });\n        });\n    }\n    getDb() {\n        const openDbRequest = self.indexedDB.open(this.dbName, 1);\n        return new Promise((resolve, reject) => {\n            openDbRequest.onsuccess = () => {\n                resolve(openDbRequest.result);\n            };\n            openDbRequest.onerror = () => {\n                reject(openDbRequest.error);\n            };\n            openDbRequest.onblocked = () => {\n                reject(new Error(\"Unable to access DB\"));\n            };\n            openDbRequest.onupgradeneeded = () => {\n                const db = openDbRequest.result;\n                db.onerror = () => {\n                    reject(new Error(\"Failed to create object store\"));\n                };\n                db.createObjectStore(STORE_NAME, { keyPath: \"id\" });\n            };\n        });\n    }\n    withObjectStore(mode, action) {\n        return this.getDb().then((db) => {\n            const tx = db.transaction(STORE_NAME, mode);\n            tx.oncomplete = () => db.close();\n            return new Promise((resolve, reject) => {\n                tx.onerror = () => reject(tx.error);\n                resolve(action(tx.objectStore(STORE_NAME)));\n            }).catch((err) => {\n                db.close();\n                throw err;\n            });\n        });\n    }\n}\n\nclass InMemoryStorage {\n    constructor(store = {}) {\n        this.store = store;\n    }\n    getItem(key) {\n        if (key in this.store) {\n            return this.store[key];\n        }\n        return null;\n    }\n    removeItem(key) {\n        delete this.store[key];\n    }\n    setItem(key, value) {\n        this.store[key] = value;\n    }\n}\n\nconst inMemoryStorage = new InMemoryStorage();\nfunction localStorage() {\n    if (typeof self === \"object\" && self.indexedDB) {\n        return new IndexedDbStorage();\n    }\n    if (typeof window === \"object\" && window.localStorage) {\n        return window.localStorage;\n    }\n    return inMemoryStorage;\n}\n\nfunction fromCognitoIdentityPool({ accountId, cache = localStorage(), client, customRoleArn, identityPoolId, logins, userIdentifier = !logins || Object.keys(logins).length === 0 ? \"ANONYMOUS\" : undefined, }) {\n    const cacheKey = userIdentifier ? `aws:cognito-identity-credentials:${identityPoolId}:${userIdentifier}` : undefined;\n    let provider = async () => {\n        let identityId = cacheKey && (await cache.getItem(cacheKey));\n        if (!identityId) {\n            const { IdentityId = throwOnMissingId() } = await client.send(new GetIdCommand({\n                AccountId: accountId,\n                IdentityPoolId: identityPoolId,\n                Logins: logins ? await resolveLogins(logins) : undefined,\n            }));\n            identityId = IdentityId;\n            if (cacheKey) {\n                Promise.resolve(cache.setItem(cacheKey, identityId)).catch(() => { });\n            }\n        }\n        provider = fromCognitoIdentity({\n            client,\n            customRoleArn,\n            logins,\n            identityId,\n        });\n        return provider();\n    };\n    return () => provider().catch(async (err) => {\n        if (cacheKey) {\n            Promise.resolve(cache.removeItem(cacheKey)).catch(() => { });\n        }\n        throw err;\n    });\n}\nfunction throwOnMissingId() {\n    throw new CredentialsProviderError(\"Response from Amazon Cognito contained no identity ID\");\n}\n\nexport { fromCognitoIdentityPool };\n", "import { S3Client, PutObjectCommand, ListObjectsCommand } from \"../_snowpack/pkg/@aws-sdk/client-s3.js\";\nimport { CognitoIdentityClient } from \"../_snowpack/pkg/@aws-sdk/client-cognito-identity.js\";\nimport { fromCognitoIdentityPool } from \"../_snowpack/pkg/@aws-sdk/credential-provider-cognito-identity.js\";\nimport { v4 as uuidv4 } from '../_snowpack/pkg/uuid.js';\n\n// Initialize the Amazon Cognito credentials provider\nconst REGION = 'us-west-2';\nconst IDENTITY_POOL_ID = 'us-west-2:dfb8b28f-f2c3-4b7d-82eb-9a314d90575e';\n\n// Set up the S3 Client and bucket\nconst s3 = new S3Client({\n  region: REGION,\n  credentials: fromCognitoIdentityPool({\n    client: new CognitoIdentityClient({ region: REGION }),\n    identityPoolId: IDENTITY_POOL_ID,\n  }),\n});\nconst albumBucketName = \"proexp.net-public\";\n\nexport default class UploadClient {\n  // Image Upload\n  static async addPhoto(files) {\n    try {\n      const albumPhotosKey = \"uploads/\";\n      const data = await s3.send(\n          new ListObjectsCommand({\n            Prefix: albumPhotosKey,\n            Bucket: albumBucketName\n          })\n      );\n      const file = files[0];\n      let fileExtension = \".jpg\";\n      switch (file.type) {\n        case 'image/png':\n          fileExtension = \".png\";\n          break;\n        case 'image/jpeg':\n          fileExtension = \".jpg\";\n          break;\n      }\n      const photoKey = albumPhotosKey + uuidv4() + fileExtension; // Construct the new file name\n      const uploadParams = {\n        Bucket: albumBucketName,\n        Key: photoKey,\n        ContentType: file.type,\n        Body: file\n      };\n      try {\n        const data = await s3.send(new PutObjectCommand(uploadParams));\n        return 'https://s3.us-west-2.amazonaws.com/' + albumBucketName + '/' + photoKey;\n      } catch (err) {\n        return alert(\"There was an error uploading your photo.\\n\\nPlease note that only .jpg and .png file are accepted.\");\n      }\n    } catch (err) {\n      if (!files.length) {\n        return alert(\"Choose a file to upload first.\");\n      }\n    }\n  };\n\n  // Video Upload\n  static async addVideo(files) {\n    try {\n      const albumVideosKey = \"uploads/\";\n      const data = await s3.send(\n          new ListObjectsCommand({\n            Prefix: albumVideosKey,\n            Bucket: albumBucketName\n          })\n      );\n      const file = files[0];\n      \n      // Check file size -- in bytes (20 MB max)\n      if (file.size > 20971520) {\n        return alert(\"Your video file is too large.\\n\\nPlease trim your file (approx. 15 seconds or 20 MB max) and try again.\");\n      }\n   \n      // TODO: Check file run time\n      // var vid = document.createElement('video');\n      // var fileURL = URL.createObjectURL(file);\n      // vid.src = fileURL;\n      // vid.ondurationchange = function() {\n      //   if (this.duration > 15) {\n      //     return alert(\"Your video file must be less than 15 seconds.\\n\\nPlease trim your file and try again.\");\n      //   }\n      // };\n\n      let fileExtension = \".mp4\";\n      switch (file.type) {\n        case 'video/mp4':\n          fileExtension = \".mp4\";\n          break;\n        case 'video/quicktime':\n          fileExtension = \".mov\";\n          break;\n      }\n      const videoKey = albumVideosKey + uuidv4() + fileExtension; // Construct the new file name\n      const uploadParams = {\n        Bucket: albumBucketName,\n        Key: videoKey,\n        ContentType: file.type,\n        Body: file\n      };\n      try {\n        const data = await s3.send(new PutObjectCommand(uploadParams));\n        return 'https://s3.us-west-2.amazonaws.com/' + albumBucketName + '/' + videoKey;\n      } catch (err) {\n        console.debug(err);\n        return alert(\"There was an error uploading your video.\\n\\nPlease note that only .mp4 and .mov are accepted.\");\n      }\n    } catch (err) {\n      if (!files.length) {\n        return alert(\"Choose a file to upload first.\");\n      }\n    }\n  };\n}", "import './LoadingAnimation.svelte.css';\n/* src/components/LoadingAnimation.svelte generated by Svelte v3.59.2 */\nimport {\n\tSvelteComponent,\n\tattr,\n\tdetach,\n\telement,\n\tinit,\n\tinsert,\n\tnoop,\n\tsafe_not_equal\n} from \"../../_snowpack/pkg/svelte/internal.js\";\n\nfunction create_fragment(ctx) {\n\tlet div5;\n\n\treturn {\n\t\tc() {\n\t\t\tdiv5 = element(\"div\");\n\n\t\t\tdiv5.innerHTML = `<div class=\"rect1 svelte-1vweht2\"></div> \n  <div class=\"rect2 svelte-1vweht2\"></div> \n  <div class=\"rect3 svelte-1vweht2\"></div> \n  <div class=\"rect4 svelte-1vweht2\"></div> \n  <div class=\"rect5 svelte-1vweht2\"></div>`;\n\n\t\t\tattr(div5, \"class\", \"spinner svelte-1vweht2\");\n\t\t},\n\t\tm(target, anchor) {\n\t\t\tinsert(target, div5, anchor);\n\t\t},\n\t\tp: noop,\n\t\ti: noop,\n\t\to: noop,\n\t\td(detaching) {\n\t\t\tif (detaching) detach(div5);\n\t\t}\n\t};\n}\n\nclass LoadingAnimation extends SvelteComponent {\n\tconstructor(options) {\n\t\tsuper();\n\t\tinit(this, options, null, create_fragment, safe_not_equal, {});\n\t}\n}\n\nexport default LoadingAnimation;", "import './ThemePreview.svelte.css';\n/* src/components/ThemePreview.svelte generated by Svelte v3.59.2 */\nimport {\n\tSvelteComponent,\n\tappend,\n\tattr,\n\tdetach,\n\telement,\n\tinit,\n\tinsert,\n\tnoop,\n\tsafe_not_equal,\n\tsrc_url_equal\n} from \"../../_snowpack/pkg/svelte/internal.js\";\n\nfunction create_fragment(ctx) {\n\tlet div;\n\tlet video;\n\tlet video_src_value;\n\n\treturn {\n\t\tc() {\n\t\t\tdiv = element(\"div\");\n\t\t\tvideo = element(\"video\");\n\t\t\tif (!src_url_equal(video.src, video_src_value = \"/vid/\" + /*theme*/ ctx[0] + \".mp4\")) attr(video, \"src\", video_src_value);\n\t\t\tvideo.autoplay = true;\n\t\t\tvideo.playsInline = true;\n\t\t\tattr(video, \"class\", \"svelte-15f7yeq\");\n\t\t\tattr(div, \"class\", \"container svelte-15f7yeq\");\n\t\t},\n\t\tm(target, anchor) {\n\t\t\tinsert(target, div, anchor);\n\t\t\tappend(div, video);\n\t\t},\n\t\tp(ctx, [dirty]) {\n\t\t\tif (dirty & /*theme*/ 1 && !src_url_equal(video.src, video_src_value = \"/vid/\" + /*theme*/ ctx[0] + \".mp4\")) {\n\t\t\t\tattr(video, \"src\", video_src_value);\n\t\t\t}\n\t\t},\n\t\ti: noop,\n\t\to: noop,\n\t\td(detaching) {\n\t\t\tif (detaching) detach(div);\n\t\t}\n\t};\n}\n\nfunction instance($$self, $$props, $$invalidate) {\n\tlet { theme } = $$props;\n\n\t$$self.$$set = $$props => {\n\t\tif ('theme' in $$props) $$invalidate(0, theme = $$props.theme);\n\t};\n\n\treturn [theme];\n}\n\nclass ThemePreview extends SvelteComponent {\n\tconstructor(options) {\n\t\tsuper();\n\t\tinit(this, options, instance, create_fragment, safe_not_equal, { theme: 0 });\n\t}\n}\n\nexport default ThemePreview;", "import './ImagePreview.svelte.css';\n/* src/components/ImagePreview.svelte generated by Svelte v3.59.2 */\nimport {\n\tSvelteComponent,\n\tappend,\n\tattr,\n\tdetach,\n\telement,\n\tinit,\n\tinsert,\n\tnoop,\n\tsafe_not_equal,\n\tsrc_url_equal\n} from \"../../_snowpack/pkg/svelte/internal.js\";\n\nfunction create_fragment(ctx) {\n\tlet div;\n\tlet img;\n\tlet img_src_value;\n\n\treturn {\n\t\tc() {\n\t\t\tdiv = element(\"div\");\n\t\t\timg = element(\"img\");\n\t\t\tif (!src_url_equal(img.src, img_src_value = /*imageUrl*/ ctx[0])) attr(img, \"src\", img_src_value);\n\t\t\tattr(img, \"alt\", \"Your uploaded img\");\n\t\t\tattr(img, \"class\", \"svelte-e6p0si\");\n\t\t\tattr(div, \"class\", \"container svelte-e6p0si\");\n\t\t},\n\t\tm(target, anchor) {\n\t\t\tinsert(target, div, anchor);\n\t\t\tappend(div, img);\n\t\t},\n\t\tp(ctx, [dirty]) {\n\t\t\tif (dirty & /*imageUrl*/ 1 && !src_url_equal(img.src, img_src_value = /*imageUrl*/ ctx[0])) {\n\t\t\t\tattr(img, \"src\", img_src_value);\n\t\t\t}\n\t\t},\n\t\ti: noop,\n\t\to: noop,\n\t\td(detaching) {\n\t\t\tif (detaching) detach(div);\n\t\t}\n\t};\n}\n\nfunction instance($$self, $$props, $$invalidate) {\n\tlet { imageUrl } = $$props;\n\n\t$$self.$$set = $$props => {\n\t\tif ('imageUrl' in $$props) $$invalidate(0, imageUrl = $$props.imageUrl);\n\t};\n\n\treturn [imageUrl];\n}\n\nclass ImagePreview extends SvelteComponent {\n\tconstructor(options) {\n\t\tsuper();\n\t\tinit(this, options, instance, create_fragment, safe_not_equal, { imageUrl: 0 });\n\t}\n}\n\nexport default ImagePreview;", "import './VideoPreview.svelte.css';\n/* src/components/VideoPreview.svelte generated by Svelte v3.59.2 */\nimport {\n\tSvelteComponent,\n\tappend,\n\tattr,\n\tdetach,\n\telement,\n\tinit,\n\tinsert,\n\tnoop,\n\tsafe_not_equal,\n\tsrc_url_equal\n} from \"../../_snowpack/pkg/svelte/internal.js\";\n\nfunction create_fragment(ctx) {\n\tlet div;\n\tlet video;\n\tlet video_src_value;\n\n\treturn {\n\t\tc() {\n\t\t\tdiv = element(\"div\");\n\t\t\tvideo = element(\"video\");\n\t\t\tif (!src_url_equal(video.src, video_src_value = /*videoUrl*/ ctx[0])) attr(video, \"src\", video_src_value);\n\t\t\tvideo.autoplay = true;\n\t\t\tvideo.playsInline = true;\n\t\t\tattr(video, \"class\", \"svelte-15f7yeq\");\n\t\t\tattr(div, \"class\", \"container svelte-15f7yeq\");\n\t\t},\n\t\tm(target, anchor) {\n\t\t\tinsert(target, div, anchor);\n\t\t\tappend(div, video);\n\t\t},\n\t\tp(ctx, [dirty]) {\n\t\t\tif (dirty & /*videoUrl*/ 1 && !src_url_equal(video.src, video_src_value = /*videoUrl*/ ctx[0])) {\n\t\t\t\tattr(video, \"src\", video_src_value);\n\t\t\t}\n\t\t},\n\t\ti: noop,\n\t\to: noop,\n\t\td(detaching) {\n\t\t\tif (detaching) detach(div);\n\t\t}\n\t};\n}\n\nfunction instance($$self, $$props, $$invalidate) {\n\tlet { videoUrl } = $$props;\n\n\t$$self.$$set = $$props => {\n\t\tif ('videoUrl' in $$props) $$invalidate(0, videoUrl = $$props.videoUrl);\n\t};\n\n\treturn [videoUrl];\n}\n\nclass VideoPreview extends SvelteComponent {\n\tconstructor(options) {\n\t\tsuper();\n\t\tinit(this, options, instance, create_fragment, safe_not_equal, { videoUrl: 0 });\n\t}\n}\n\nexport default VideoPreview;", "import './Product.svelte.css';\n/* src/screens/Product.svelte generated by Svelte v3.59.2 */\nimport {\n\tSvelteComponent,\n\tadd_render_callback,\n\tappend,\n\tattr,\n\tbinding_callbacks,\n\tcheck_outros,\n\tcomponent_subscribe,\n\tcreate_component,\n\tdestroy_component,\n\tdestroy_each,\n\tdetach,\n\telement,\n\tempty,\n\tgroup_outros,\n\tinit,\n\tinit_binding_group,\n\tinsert,\n\tis_function,\n\tlisten,\n\tmount_component,\n\trun_all,\n\tsafe_not_equal,\n\tselect_option,\n\tselect_value,\n\tset_data,\n\tset_style,\n\tspace,\n\tsrc_url_equal,\n\ttext,\n\ttransition_in,\n\ttransition_out\n} from \"../../_snowpack/pkg/svelte/internal.js\";\n\nimport { onMount } from \"../../_snowpack/pkg/svelte.js\";\nimport { getSavedCheckoutId, setSavedCheckoutId } from \"../util.js\";\nimport api from \"../ApiClient.js\";\nimport upload from \"../UploadClient.js\";\nimport NavBar from \"../components/NavBar.svelte.js\";\nimport Footer from \"../components/Footer.svelte.js\";\nimport LoadingAnimation from \"../components/LoadingAnimation.svelte.js\";\nimport Modal from '../../_snowpack/pkg/svelte-simple-modal.js';\nimport { bind } from '../../_snowpack/pkg/svelte-simple-modal.js';\nimport ThemePreview from '../components/ThemePreview.svelte.js';\nimport ImagePreview from '../components/ImagePreview.svelte.js';\nimport VideoPreview from '../components/VideoPreview.svelte.js';\nimport OffsetButton from \"../components/OffsetButtons.svelte.js\";\nimport { navigate } from \"../../_snowpack/pkg/svelte-routing.js\";\nimport { modal } from \"../stores.js\";\nimport MediaQuery from \"../components/MediaQuery.svelte.js\";\n\nfunction get_each_context(ctx, list, i) {\n\tconst child_ctx = ctx.slice();\n\tchild_ctx[24] = list[i];\n\treturn child_ctx;\n}\n\nfunction get_each_context_1(ctx, list, i) {\n\tconst child_ctx = ctx.slice();\n\tchild_ctx[57] = list[i];\n\treturn child_ctx;\n}\n\n// (161:0) {#if product}\nfunction create_if_block(ctx) {\n\tlet div20;\n\tlet mediaquery;\n\tlet t0;\n\tlet div19;\n\tlet div1;\n\tlet t1;\n\tlet div0;\n\tlet video;\n\tlet video_src_value;\n\tlet t2;\n\tlet div18;\n\tlet h1;\n\tlet t3_value = /*product*/ ctx[2].title + \"\";\n\tlet t3;\n\tlet t4;\n\tlet h20;\n\tlet t5;\n\tlet p;\n\tlet raw_value = /*product*/ ctx[2].descriptionHtml + \"\";\n\tlet t6;\n\tlet div2;\n\tlet span0;\n\tlet t8;\n\tlet select0;\n\tlet t9;\n\tlet div3;\n\tlet span1;\n\tlet t11;\n\tlet input0;\n\tlet t12;\n\tlet div4;\n\tlet span2;\n\tlet t14;\n\tlet label0;\n\tlet input1;\n\tlet strong;\n\tlet t16;\n\tlet label1;\n\tlet input2;\n\tlet t17;\n\tlet t18;\n\tlet div6;\n\tlet span3;\n\tlet t20;\n\tlet div5;\n\tlet select1;\n\tlet option0;\n\tlet option1;\n\tlet option2;\n\tlet option3;\n\tlet option4;\n\tlet option5;\n\tlet t27;\n\tlet offsetbutton0;\n\tlet t28;\n\tlet div11;\n\tlet span4;\n\tlet t30;\n\tlet div10;\n\tlet div7;\n\tlet label2;\n\tlet t32;\n\tlet input3;\n\tlet t33;\n\tlet div8;\n\tlet h21;\n\tlet t35;\n\tlet offsetbutton1;\n\tlet t36;\n\tlet t37;\n\tlet div9;\n\tlet t38;\n\tlet div16;\n\tlet span5;\n\tlet t40;\n\tlet div15;\n\tlet div12;\n\tlet label3;\n\tlet t42;\n\tlet input4;\n\tlet t43;\n\tlet div13;\n\tlet h22;\n\tlet t45;\n\tlet offsetbutton2;\n\tlet t46;\n\tlet t47;\n\tlet div14;\n\tlet t48;\n\tlet div17;\n\tlet offsetbutton3;\n\tlet current;\n\tlet binding_group;\n\tlet mounted;\n\tlet dispose;\n\n\tmediaquery = new MediaQuery({\n\t\t\tprops: {\n\t\t\t\tquery: \"only screen and (min-width: 1900px)\",\n\t\t\t\t$$slots: {\n\t\t\t\t\tdefault: [\n\t\t\t\t\t\tcreate_default_slot_6,\n\t\t\t\t\t\t({ matches }) => ({ 60: matches }),\n\t\t\t\t\t\t({ matches }) => [0, matches ? 536870912 : 0]\n\t\t\t\t\t]\n\t\t\t\t},\n\t\t\t\t$$scope: { ctx }\n\t\t\t}\n\t\t});\n\n\tfunction select_block_type(ctx, dirty) {\n\t\tif (/*product*/ ctx[2].images.edges) return create_if_block_7;\n\t\treturn create_else_block_1;\n\t}\n\n\tlet current_block_type = select_block_type(ctx, [-1, -1]);\n\tlet if_block0 = current_block_type(ctx);\n\n\tfunction select_block_type_1(ctx, dirty) {\n\t\tif (/*variantComparePrice*/ ctx[7]) return create_if_block_6;\n\t\treturn create_else_block;\n\t}\n\n\tlet current_block_type_1 = select_block_type_1(ctx, [-1, -1]);\n\tlet if_block1 = current_block_type_1(ctx);\n\tlet each_value = /*product*/ ctx[2].variants.edges;\n\tlet each_blocks = [];\n\n\tfor (let i = 0; i < each_value.length; i += 1) {\n\t\teach_blocks[i] = create_each_block(get_each_context(ctx, each_value, i));\n\t}\n\n\toffsetbutton0 = new OffsetButton({\n\t\t\tprops: {\n\t\t\t\tcolor: \"#ff89de\",\n\t\t\t\tcustomStyle: \"margin-top:16px;\",\n\t\t\t\t$$slots: { default: [create_default_slot_5] },\n\t\t\t\t$$scope: { ctx }\n\t\t\t}\n\t\t});\n\n\toffsetbutton0.$on(\"click\", /*handleModalOpen*/ ctx[33]);\n\n\tlet offsetbutton1_props = {\n\t\tcolor: \"#5cbdf9\",\n\t\tcustomStyle: \"margin-top:16px; margin-right: 2rem;\",\n\t\tdisabled: /*photoButtonDisabled*/ ctx[12],\n\t\t$$slots: { default: [create_default_slot_4] },\n\t\t$$scope: { ctx }\n\t};\n\n\toffsetbutton1 = new OffsetButton({ props: offsetbutton1_props });\n\t/*offsetbutton1_binding*/ ctx[49](offsetbutton1);\n\toffsetbutton1.$on(\"click\", /*addPhoto*/ ctx[27]);\n\tlet if_block2 = /*photoUrl*/ ctx[14] && create_if_block_4(ctx);\n\tlet if_block3 = /*showPhotoUploading*/ ctx[13] && create_if_block_3(ctx);\n\n\tlet offsetbutton2_props = {\n\t\tcolor: \"#5cbdf9\",\n\t\tcustomStyle: \"margin-top:16px; margin-right: 2rem;\",\n\t\tdisabled: /*videoButtonDisabled*/ ctx[18],\n\t\t$$slots: { default: [create_default_slot_2] },\n\t\t$$scope: { ctx }\n\t};\n\n\toffsetbutton2 = new OffsetButton({ props: offsetbutton2_props });\n\t/*offsetbutton2_binding*/ ctx[51](offsetbutton2);\n\toffsetbutton2.$on(\"click\", /*addVideo*/ ctx[29]);\n\tlet if_block4 = /*videoUrl*/ ctx[20] && create_if_block_2(ctx);\n\tlet if_block5 = /*showVideoUploading*/ ctx[19] && create_if_block_1(ctx);\n\n\tlet offsetbutton3_props = {\n\t\tcolor: \"#f2a240\",\n\t\twidth: \"55%\",\n\t\tcustomStyle: \"min-width: 230px; margin-bottom: 25px;\",\n\t\tdisabled: /*addToCartDisabled*/ ctx[22],\n\t\t$$slots: { default: [create_default_slot] },\n\t\t$$scope: { ctx }\n\t};\n\n\toffsetbutton3 = new OffsetButton({ props: offsetbutton3_props });\n\t/*offsetbutton3_binding*/ ctx[52](offsetbutton3);\n\toffsetbutton3.$on(\"click\", /*addToCheckout*/ ctx[25]);\n\tbinding_group = init_binding_group(/*$$binding_groups*/ ctx[45][0]);\n\n\treturn {\n\t\tc() {\n\t\t\tdiv20 = element(\"div\");\n\t\t\tcreate_component(mediaquery.$$.fragment);\n\t\t\tt0 = space();\n\t\t\tdiv19 = element(\"div\");\n\t\t\tdiv1 = element(\"div\");\n\t\t\tif_block0.c();\n\t\t\tt1 = space();\n\t\t\tdiv0 = element(\"div\");\n\t\t\tvideo = element(\"video\");\n\t\t\tt2 = space();\n\t\t\tdiv18 = element(\"div\");\n\t\t\th1 = element(\"h1\");\n\t\t\tt3 = text(t3_value);\n\t\t\tt4 = space();\n\t\t\th20 = element(\"h2\");\n\t\t\tif_block1.c();\n\t\t\tt5 = space();\n\t\t\tp = element(\"p\");\n\t\t\tt6 = space();\n\t\t\tdiv2 = element(\"div\");\n\t\t\tspan0 = element(\"span\");\n\t\t\tspan0.textContent = \"SIZE\";\n\t\t\tt8 = space();\n\t\t\tselect0 = element(\"select\");\n\n\t\t\tfor (let i = 0; i < each_blocks.length; i += 1) {\n\t\t\t\teach_blocks[i].c();\n\t\t\t}\n\n\t\t\tt9 = space();\n\t\t\tdiv3 = element(\"div\");\n\t\t\tspan1 = element(\"span\");\n\t\t\tspan1.textContent = \"QTY\";\n\t\t\tt11 = space();\n\t\t\tinput0 = element(\"input\");\n\t\t\tt12 = space();\n\t\t\tdiv4 = element(\"div\");\n\t\t\tspan2 = element(\"span\");\n\t\t\tspan2.textContent = \"Would you like to have your photo Cartoonized?\";\n\t\t\tt14 = space();\n\t\t\tlabel0 = element(\"label\");\n\t\t\tinput1 = element(\"input\");\n\t\t\tstrong = element(\"strong\");\n\t\t\tstrong.textContent = \"YES, cartoonize my photo!\";\n\t\t\tt16 = space();\n\t\t\tlabel1 = element(\"label\");\n\t\t\tinput2 = element(\"input\");\n\t\t\tt17 = text(\"No\");\n\t\t\tt18 = space();\n\t\t\tdiv6 = element(\"div\");\n\t\t\tspan3 = element(\"span\");\n\t\t\tspan3.textContent = \"Step 1: Select your video theme\";\n\t\t\tt20 = space();\n\t\t\tdiv5 = element(\"div\");\n\t\t\tselect1 = element(\"select\");\n\t\t\toption0 = element(\"option\");\n\t\t\toption0.textContent = \"Beach\";\n\t\t\toption1 = element(\"option\");\n\t\t\toption1.textContent = \"Love\";\n\t\t\toption2 = element(\"option\");\n\t\t\toption2.textContent = \"Field\";\n\t\t\toption3 = element(\"option\");\n\t\t\toption3.textContent = \"Birthday\";\n\t\t\toption4 = element(\"option\");\n\t\t\toption4.textContent = \"BFF\";\n\t\t\toption5 = element(\"option\");\n\t\t\toption5.textContent = \"Sleep\";\n\t\t\tt27 = space();\n\t\t\tcreate_component(offsetbutton0.$$.fragment);\n\t\t\tt28 = space();\n\t\t\tdiv11 = element(\"div\");\n\t\t\tspan4 = element(\"span\");\n\t\t\tspan4.textContent = \"Step 2: Choose your pet's photo\";\n\t\t\tt30 = space();\n\t\t\tdiv10 = element(\"div\");\n\t\t\tdiv7 = element(\"div\");\n\t\t\tlabel2 = element(\"label\");\n\t\t\tlabel2.textContent = \"1.\";\n\t\t\tt32 = space();\n\t\t\tinput3 = element(\"input\");\n\t\t\tt33 = space();\n\t\t\tdiv8 = element(\"div\");\n\t\t\th21 = element(\"h2\");\n\t\t\th21.textContent = \"2.\";\n\t\t\tt35 = space();\n\t\t\tcreate_component(offsetbutton1.$$.fragment);\n\t\t\tt36 = space();\n\t\t\tif (if_block2) if_block2.c();\n\t\t\tt37 = space();\n\t\t\tdiv9 = element(\"div\");\n\t\t\tif (if_block3) if_block3.c();\n\t\t\tt38 = space();\n\t\t\tdiv16 = element(\"div\");\n\t\t\tspan5 = element(\"span\");\n\t\t\tspan5.textContent = \"Step 3: Choose video clip (approx. 15 secs or 20 MB max)\";\n\t\t\tt40 = space();\n\t\t\tdiv15 = element(\"div\");\n\t\t\tdiv12 = element(\"div\");\n\t\t\tlabel3 = element(\"label\");\n\t\t\tlabel3.textContent = \"1.\";\n\t\t\tt42 = space();\n\t\t\tinput4 = element(\"input\");\n\t\t\tt43 = space();\n\t\t\tdiv13 = element(\"div\");\n\t\t\th22 = element(\"h2\");\n\t\t\th22.textContent = \"2.\";\n\t\t\tt45 = space();\n\t\t\tcreate_component(offsetbutton2.$$.fragment);\n\t\t\tt46 = space();\n\t\t\tif (if_block4) if_block4.c();\n\t\t\tt47 = space();\n\t\t\tdiv14 = element(\"div\");\n\t\t\tif (if_block5) if_block5.c();\n\t\t\tt48 = space();\n\t\t\tdiv17 = element(\"div\");\n\t\t\tcreate_component(offsetbutton3.$$.fragment);\n\t\t\tvideo.controls = true;\n\t\t\tif (!src_url_equal(video.src, video_src_value = \"/vid/infomercial.mp4#t=0.5\")) attr(video, \"src\", video_src_value);\n\t\t\tattr(video, \"class\", \"vid svelte-13yqyyf\");\n\t\t\tattr(div0, \"class\", \"main-vid svelte-13yqyyf\");\n\t\t\tattr(div1, \"class\", \"flex-child svelte-13yqyyf\");\n\t\t\tattr(p, \"class\", \"description svelte-13yqyyf\");\n\t\t\tattr(span0, \"class\", \"label svelte-13yqyyf\");\n\t\t\tattr(select0, \"id\", \"variant\");\n\t\t\tattr(select0, \"class\", \"svelte-13yqyyf\");\n\t\t\tif (/*variantSelected*/ ctx[5] === void 0) add_render_callback(() => /*select0_change_handler*/ ctx[42].call(select0));\n\t\t\tattr(div2, \"class\", \"variant svelte-13yqyyf\");\n\t\t\tattr(span1, \"class\", \"label svelte-13yqyyf\");\n\t\t\tattr(input0, \"type\", \"number\");\n\t\t\tattr(input0, \"id\", \"qty\");\n\t\t\tinput0.value = \"1\";\n\t\t\tattr(input0, \"min\", \"1\");\n\t\t\tattr(input0, \"max\", \"50\");\n\t\t\tattr(input0, \"class\", \"svelte-13yqyyf\");\n\t\t\tattr(div3, \"class\", \"variant svelte-13yqyyf\");\n\t\t\tattr(span2, \"class\", \"label svelte-13yqyyf\");\n\t\t\tattr(input1, \"type\", \"radio\");\n\t\t\tattr(input1, \"name\", \"ctz\");\n\t\t\tinput1.__value = \"yes\";\n\t\t\tinput1.value = input1.__value;\n\t\t\tattr(input1, \"class\", \"svelte-13yqyyf\");\n\t\t\tset_style(label0, \"margin-right\", \"50px\");\n\t\t\tattr(input2, \"type\", \"radio\");\n\t\t\tattr(input2, \"name\", \"ctz\");\n\t\t\tinput2.__value = \"no\";\n\t\t\tinput2.value = input2.__value;\n\t\t\tattr(input2, \"class\", \"svelte-13yqyyf\");\n\t\t\tset_style(label1, \"font-size\", \"1.2rem\");\n\t\t\tattr(div4, \"class\", \"variant svelte-13yqyyf\");\n\t\t\tattr(span3, \"class\", \"prompt svelte-13yqyyf\");\n\t\t\toption0.__value = \"beach\";\n\t\t\toption0.value = option0.__value;\n\t\t\toption1.__value = \"love\";\n\t\t\toption1.value = option1.__value;\n\t\t\toption2.__value = \"field\";\n\t\t\toption2.value = option2.__value;\n\t\t\toption3.__value = \"birthday\";\n\t\t\toption3.value = option3.__value;\n\t\t\toption4.__value = \"bff\";\n\t\t\toption4.value = option4.__value;\n\t\t\toption5.__value = \"sleep\";\n\t\t\toption5.value = option5.__value;\n\t\t\tattr(select1, \"id\", \"theme\");\n\t\t\tattr(select1, \"class\", \"svelte-13yqyyf\");\n\t\t\tattr(div5, \"class\", \"step-container-content svelte-13yqyyf\");\n\t\t\tattr(div6, \"class\", \"variant svelte-13yqyyf\");\n\t\t\tattr(span4, \"class\", \"prompt svelte-13yqyyf\");\n\t\t\tattr(label2, \"class\", \"upload-label svelte-13yqyyf\");\n\t\t\tattr(label2, \"for\", \"photoFile\");\n\t\t\tattr(input3, \"id\", \"photoFile\");\n\t\t\tattr(input3, \"class\", \"action-xs svelte-13yqyyf\");\n\t\t\tattr(input3, \"type\", \"file\");\n\t\t\tattr(input3, \"accept\", \"image/*\");\n\t\t\tattr(div7, \"class\", \"file-input-container svelte-13yqyyf\");\n\t\t\tattr(h21, \"class\", \"upload-label svelte-13yqyyf\");\n\t\t\tattr(div8, \"class\", \"buttons svelte-13yqyyf\");\n\t\t\tattr(div9, \"class\", \"upload-status svelte-13yqyyf\");\n\t\t\tattr(div10, \"class\", \"step-container-content upload-container svelte-13yqyyf\");\n\t\t\tattr(div11, \"class\", \"variant svelte-13yqyyf\");\n\t\t\tattr(span5, \"class\", \"prompt svelte-13yqyyf\");\n\t\t\tattr(label3, \"class\", \"upload-label svelte-13yqyyf\");\n\t\t\tattr(label3, \"for\", \"videoFile\");\n\t\t\tattr(input4, \"id\", \"videoFile\");\n\t\t\tattr(input4, \"class\", \"action-xs svelte-13yqyyf\");\n\t\t\tattr(input4, \"type\", \"file\");\n\t\t\tattr(input4, \"accept\", \"video/*\");\n\t\t\tinput4.disabled = /*videoFileDisabled*/ ctx[16];\n\t\t\tattr(div12, \"class\", \"file-input-container svelte-13yqyyf\");\n\t\t\tattr(h22, \"class\", \"upload-label svelte-13yqyyf\");\n\t\t\tattr(div13, \"class\", \"buttons svelte-13yqyyf\");\n\t\t\tattr(div14, \"class\", \"upload-status svelte-13yqyyf\");\n\t\t\tattr(div15, \"class\", \"step-container-content upload-container svelte-13yqyyf\");\n\t\t\tattr(div16, \"class\", \"variant svelte-13yqyyf\");\n\t\t\tattr(div17, \"class\", \"actions-container svelte-13yqyyf\");\n\t\t\tattr(div18, \"class\", \"flex-child svelte-13yqyyf\");\n\t\t\tattr(div19, \"class\", \"flex-container svelte-13yqyyf\");\n\t\t\tattr(div20, \"class\", \"main svelte-13yqyyf\");\n\t\t\tbinding_group.p(input1, input2);\n\t\t},\n\t\tm(target, anchor) {\n\t\t\tinsert(target, div20, anchor);\n\t\t\tmount_component(mediaquery, div20, null);\n\t\t\tappend(div20, t0);\n\t\t\tappend(div20, div19);\n\t\t\tappend(div19, div1);\n\t\t\tif_block0.m(div1, null);\n\t\t\tappend(div1, t1);\n\t\t\tappend(div1, div0);\n\t\t\tappend(div0, video);\n\t\t\t/*video_binding*/ ctx[40](video);\n\t\t\tappend(div19, t2);\n\t\t\tappend(div19, div18);\n\t\t\tappend(div18, h1);\n\t\t\tappend(h1, t3);\n\t\t\tappend(div18, t4);\n\t\t\tappend(div18, h20);\n\t\t\tif_block1.m(h20, null);\n\t\t\tappend(div18, t5);\n\t\t\tappend(div18, p);\n\t\t\tp.innerHTML = raw_value;\n\t\t\tappend(div18, t6);\n\t\t\tappend(div18, div2);\n\t\t\tappend(div2, span0);\n\t\t\tappend(div2, t8);\n\t\t\tappend(div2, select0);\n\n\t\t\tfor (let i = 0; i < each_blocks.length; i += 1) {\n\t\t\t\tif (each_blocks[i]) {\n\t\t\t\t\teach_blocks[i].m(select0, null);\n\t\t\t\t}\n\t\t\t}\n\n\t\t\t/*select0_binding*/ ctx[41](select0);\n\t\t\tselect_option(select0, /*variantSelected*/ ctx[5], true);\n\t\t\tappend(div18, t9);\n\t\t\tappend(div18, div3);\n\t\t\tappend(div3, span1);\n\t\t\tappend(div3, t11);\n\t\t\tappend(div3, input0);\n\t\t\t/*input0_binding*/ ctx[43](input0);\n\t\t\tappend(div18, t12);\n\t\t\tappend(div18, div4);\n\t\t\tappend(div4, span2);\n\t\t\tappend(div4, t14);\n\t\t\tappend(div4, label0);\n\t\t\tappend(label0, input1);\n\t\t\tinput1.checked = input1.__value === /*cartoonize*/ ctx[9];\n\t\t\tappend(label0, strong);\n\t\t\tappend(div4, t16);\n\t\t\tappend(div4, label1);\n\t\t\tappend(label1, input2);\n\t\t\tinput2.checked = input2.__value === /*cartoonize*/ ctx[9];\n\t\t\tappend(label1, t17);\n\t\t\tappend(div18, t18);\n\t\t\tappend(div18, div6);\n\t\t\tappend(div6, span3);\n\t\t\tappend(div6, t20);\n\t\t\tappend(div6, div5);\n\t\t\tappend(div5, select1);\n\t\t\tappend(select1, option0);\n\t\t\tappend(select1, option1);\n\t\t\tappend(select1, option2);\n\t\t\tappend(select1, option3);\n\t\t\tappend(select1, option4);\n\t\t\tappend(select1, option5);\n\t\t\t/*select1_binding*/ ctx[47](select1);\n\t\t\tappend(div5, t27);\n\t\t\tmount_component(offsetbutton0, div5, null);\n\t\t\tappend(div18, t28);\n\t\t\tappend(div18, div11);\n\t\t\tappend(div11, span4);\n\t\t\tappend(div11, t30);\n\t\t\tappend(div11, div10);\n\t\t\tappend(div10, div7);\n\t\t\tappend(div7, label2);\n\t\t\tappend(div7, t32);\n\t\t\tappend(div7, input3);\n\t\t\t/*input3_binding*/ ctx[48](input3);\n\t\t\tappend(div10, t33);\n\t\t\tappend(div10, div8);\n\t\t\tappend(div8, h21);\n\t\t\tappend(div8, t35);\n\t\t\tmount_component(offsetbutton1, div8, null);\n\t\t\tappend(div8, t36);\n\t\t\tif (if_block2) if_block2.m(div8, null);\n\t\t\tappend(div10, t37);\n\t\t\tappend(div10, div9);\n\t\t\tif (if_block3) if_block3.m(div9, null);\n\t\t\tappend(div18, t38);\n\t\t\tappend(div18, div16);\n\t\t\tappend(div16, span5);\n\t\t\tappend(div16, t40);\n\t\t\tappend(div16, div15);\n\t\t\tappend(div15, div12);\n\t\t\tappend(div12, label3);\n\t\t\tappend(div12, t42);\n\t\t\tappend(div12, input4);\n\t\t\t/*input4_binding*/ ctx[50](input4);\n\t\t\tappend(div15, t43);\n\t\t\tappend(div15, div13);\n\t\t\tappend(div13, h22);\n\t\t\tappend(div13, t45);\n\t\t\tmount_component(offsetbutton2, div13, null);\n\t\t\tappend(div13, t46);\n\t\t\tif (if_block4) if_block4.m(div13, null);\n\t\t\tappend(div15, t47);\n\t\t\tappend(div15, div14);\n\t\t\tif (if_block5) if_block5.m(div14, null);\n\t\t\tappend(div18, t48);\n\t\t\tappend(div18, div17);\n\t\t\tmount_component(offsetbutton3, div17, null);\n\t\t\tcurrent = true;\n\n\t\t\tif (!mounted) {\n\t\t\t\tdispose = [\n\t\t\t\t\tlisten(video, \"loadedmetadata\", /*loadedmetadata_handler*/ ctx[39]),\n\t\t\t\t\tlisten(select0, \"change\", /*select0_change_handler*/ ctx[42]),\n\t\t\t\t\tlisten(select0, \"change\", /*handleVariantChange*/ ctx[32]),\n\t\t\t\t\tlisten(input1, \"change\", /*input1_change_handler*/ ctx[44]),\n\t\t\t\t\tlisten(input2, \"change\", /*input2_change_handler*/ ctx[46]),\n\t\t\t\t\tlisten(input3, \"change\", /*handleAddPhoto*/ ctx[26]),\n\t\t\t\t\tlisten(input4, \"change\", /*handleAddVideo*/ ctx[28])\n\t\t\t\t];\n\n\t\t\t\tmounted = true;\n\t\t\t}\n\t\t},\n\t\tp(ctx, dirty) {\n\t\t\tconst mediaquery_changes = {};\n\n\t\t\tif (dirty[1] & /*$$scope, matches*/ 1610612736) {\n\t\t\t\tmediaquery_changes.$$scope = { dirty, ctx };\n\t\t\t}\n\n\t\t\tmediaquery.$set(mediaquery_changes);\n\n\t\t\tif (current_block_type === (current_block_type = select_block_type(ctx, dirty)) && if_block0) {\n\t\t\t\tif_block0.p(ctx, dirty);\n\t\t\t} else {\n\t\t\t\tif_block0.d(1);\n\t\t\t\tif_block0 = current_block_type(ctx);\n\n\t\t\t\tif (if_block0) {\n\t\t\t\t\tif_block0.c();\n\t\t\t\t\tif_block0.m(div1, t1);\n\t\t\t\t}\n\t\t\t}\n\n\t\t\tif ((!current || dirty[0] & /*product*/ 4) && t3_value !== (t3_value = /*product*/ ctx[2].title + \"\")) set_data(t3, t3_value);\n\n\t\t\tif (current_block_type_1 === (current_block_type_1 = select_block_type_1(ctx, dirty)) && if_block1) {\n\t\t\t\tif_block1.p(ctx, dirty);\n\t\t\t} else {\n\t\t\t\tif_block1.d(1);\n\t\t\t\tif_block1 = current_block_type_1(ctx);\n\n\t\t\t\tif (if_block1) {\n\t\t\t\t\tif_block1.c();\n\t\t\t\t\tif_block1.m(h20, null);\n\t\t\t\t}\n\t\t\t}\n\n\t\t\tif ((!current || dirty[0] & /*product*/ 4) && raw_value !== (raw_value = /*product*/ ctx[2].descriptionHtml + \"\")) p.innerHTML = raw_value;;\n\n\t\t\tif (dirty[0] & /*product*/ 4) {\n\t\t\t\teach_value = /*product*/ ctx[2].variants.edges;\n\t\t\t\tlet i;\n\n\t\t\t\tfor (i = 0; i < each_value.length; i += 1) {\n\t\t\t\t\tconst child_ctx = get_each_context(ctx, each_value, i);\n\n\t\t\t\t\tif (each_blocks[i]) {\n\t\t\t\t\t\teach_blocks[i].p(child_ctx, dirty);\n\t\t\t\t\t} else {\n\t\t\t\t\t\teach_blocks[i] = create_each_block(child_ctx);\n\t\t\t\t\t\teach_blocks[i].c();\n\t\t\t\t\t\teach_blocks[i].m(select0, null);\n\t\t\t\t\t}\n\t\t\t\t}\n\n\t\t\t\tfor (; i < each_blocks.length; i += 1) {\n\t\t\t\t\teach_blocks[i].d(1);\n\t\t\t\t}\n\n\t\t\t\teach_blocks.length = each_value.length;\n\t\t\t}\n\n\t\t\tif (dirty[0] & /*variantSelected, product*/ 36) {\n\t\t\t\tselect_option(select0, /*variantSelected*/ ctx[5]);\n\t\t\t}\n\n\t\t\tif (dirty[0] & /*cartoonize*/ 512) {\n\t\t\t\tinput1.checked = input1.__value === /*cartoonize*/ ctx[9];\n\t\t\t}\n\n\t\t\tif (dirty[0] & /*cartoonize*/ 512) {\n\t\t\t\tinput2.checked = input2.__value === /*cartoonize*/ ctx[9];\n\t\t\t}\n\n\t\t\tconst offsetbutton0_changes = {};\n\n\t\t\tif (dirty[1] & /*$$scope*/ 1073741824) {\n\t\t\t\toffsetbutton0_changes.$$scope = { dirty, ctx };\n\t\t\t}\n\n\t\t\toffsetbutton0.$set(offsetbutton0_changes);\n\t\t\tconst offsetbutton1_changes = {};\n\t\t\tif (dirty[0] & /*photoButtonDisabled*/ 4096) offsetbutton1_changes.disabled = /*photoButtonDisabled*/ ctx[12];\n\n\t\t\tif (dirty[1] & /*$$scope*/ 1073741824) {\n\t\t\t\toffsetbutton1_changes.$$scope = { dirty, ctx };\n\t\t\t}\n\n\t\t\toffsetbutton1.$set(offsetbutton1_changes);\n\n\t\t\tif (/*photoUrl*/ ctx[14]) {\n\t\t\t\tif (if_block2) {\n\t\t\t\t\tif_block2.p(ctx, dirty);\n\n\t\t\t\t\tif (dirty[0] & /*photoUrl*/ 16384) {\n\t\t\t\t\t\ttransition_in(if_block2, 1);\n\t\t\t\t\t}\n\t\t\t\t} else {\n\t\t\t\t\tif_block2 = create_if_block_4(ctx);\n\t\t\t\t\tif_block2.c();\n\t\t\t\t\ttransition_in(if_block2, 1);\n\t\t\t\t\tif_block2.m(div8, null);\n\t\t\t\t}\n\t\t\t} else if (if_block2) {\n\t\t\t\tgroup_outros();\n\n\t\t\t\ttransition_out(if_block2, 1, 1, () => {\n\t\t\t\t\tif_block2 = null;\n\t\t\t\t});\n\n\t\t\t\tcheck_outros();\n\t\t\t}\n\n\t\t\tif (/*showPhotoUploading*/ ctx[13]) {\n\t\t\t\tif (if_block3) {\n\t\t\t\t\tif (dirty[0] & /*showPhotoUploading*/ 8192) {\n\t\t\t\t\t\ttransition_in(if_block3, 1);\n\t\t\t\t\t}\n\t\t\t\t} else {\n\t\t\t\t\tif_block3 = create_if_block_3(ctx);\n\t\t\t\t\tif_block3.c();\n\t\t\t\t\ttransition_in(if_block3, 1);\n\t\t\t\t\tif_block3.m(div9, null);\n\t\t\t\t}\n\t\t\t} else if (if_block3) {\n\t\t\t\tgroup_outros();\n\n\t\t\t\ttransition_out(if_block3, 1, 1, () => {\n\t\t\t\t\tif_block3 = null;\n\t\t\t\t});\n\n\t\t\t\tcheck_outros();\n\t\t\t}\n\n\t\t\tif (!current || dirty[0] & /*videoFileDisabled*/ 65536) {\n\t\t\t\tinput4.disabled = /*videoFileDisabled*/ ctx[16];\n\t\t\t}\n\n\t\t\tconst offsetbutton2_changes = {};\n\t\t\tif (dirty[0] & /*videoButtonDisabled*/ 262144) offsetbutton2_changes.disabled = /*videoButtonDisabled*/ ctx[18];\n\n\t\t\tif (dirty[1] & /*$$scope*/ 1073741824) {\n\t\t\t\toffsetbutton2_changes.$$scope = { dirty, ctx };\n\t\t\t}\n\n\t\t\toffsetbutton2.$set(offsetbutton2_changes);\n\n\t\t\tif (/*videoUrl*/ ctx[20]) {\n\t\t\t\tif (if_block4) {\n\t\t\t\t\tif_block4.p(ctx, dirty);\n\n\t\t\t\t\tif (dirty[0] & /*videoUrl*/ 1048576) {\n\t\t\t\t\t\ttransition_in(if_block4, 1);\n\t\t\t\t\t}\n\t\t\t\t} else {\n\t\t\t\t\tif_block4 = create_if_block_2(ctx);\n\t\t\t\t\tif_block4.c();\n\t\t\t\t\ttransition_in(if_block4, 1);\n\t\t\t\t\tif_block4.m(div13, null);\n\t\t\t\t}\n\t\t\t} else if (if_block4) {\n\t\t\t\tgroup_outros();\n\n\t\t\t\ttransition_out(if_block4, 1, 1, () => {\n\t\t\t\t\tif_block4 = null;\n\t\t\t\t});\n\n\t\t\t\tcheck_outros();\n\t\t\t}\n\n\t\t\tif (/*showVideoUploading*/ ctx[19]) {\n\t\t\t\tif (if_block5) {\n\t\t\t\t\tif (dirty[0] & /*showVideoUploading*/ 524288) {\n\t\t\t\t\t\ttransition_in(if_block5, 1);\n\t\t\t\t\t}\n\t\t\t\t} else {\n\t\t\t\t\tif_block5 = create_if_block_1(ctx);\n\t\t\t\t\tif_block5.c();\n\t\t\t\t\ttransition_in(if_block5, 1);\n\t\t\t\t\tif_block5.m(div14, null);\n\t\t\t\t}\n\t\t\t} else if (if_block5) {\n\t\t\t\tgroup_outros();\n\n\t\t\t\ttransition_out(if_block5, 1, 1, () => {\n\t\t\t\t\tif_block5 = null;\n\t\t\t\t});\n\n\t\t\t\tcheck_outros();\n\t\t\t}\n\n\t\t\tconst offsetbutton3_changes = {};\n\t\t\tif (dirty[0] & /*addToCartDisabled*/ 4194304) offsetbutton3_changes.disabled = /*addToCartDisabled*/ ctx[22];\n\n\t\t\tif (dirty[1] & /*$$scope*/ 1073741824) {\n\t\t\t\toffsetbutton3_changes.$$scope = { dirty, ctx };\n\t\t\t}\n\n\t\t\toffsetbutton3.$set(offsetbutton3_changes);\n\t\t},\n\t\ti(local) {\n\t\t\tif (current) return;\n\t\t\ttransition_in(mediaquery.$$.fragment, local);\n\t\t\ttransition_in(offsetbutton0.$$.fragment, local);\n\t\t\ttransition_in(offsetbutton1.$$.fragment, local);\n\t\t\ttransition_in(if_block2);\n\t\t\ttransition_in(if_block3);\n\t\t\ttransition_in(offsetbutton2.$$.fragment, local);\n\t\t\ttransition_in(if_block4);\n\t\t\ttransition_in(if_block5);\n\t\t\ttransition_in(offsetbutton3.$$.fragment, local);\n\t\t\tcurrent = true;\n\t\t},\n\t\to(local) {\n\t\t\ttransition_out(mediaquery.$$.fragment, local);\n\t\t\ttransition_out(offsetbutton0.$$.fragment, local);\n\t\t\ttransition_out(offsetbutton1.$$.fragment, local);\n\t\t\ttransition_out(if_block2);\n\t\t\ttransition_out(if_block3);\n\t\t\ttransition_out(offsetbutton2.$$.fragment, local);\n\t\t\ttransition_out(if_block4);\n\t\t\ttransition_out(if_block5);\n\t\t\ttransition_out(offsetbutton3.$$.fragment, local);\n\t\t\tcurrent = false;\n\t\t},\n\t\td(detaching) {\n\t\t\tif (detaching) detach(div20);\n\t\t\tdestroy_component(mediaquery);\n\t\t\tif_block0.d();\n\t\t\t/*video_binding*/ ctx[40](null);\n\t\t\tif_block1.d();\n\t\t\tdestroy_each(each_blocks, detaching);\n\t\t\t/*select0_binding*/ ctx[41](null);\n\t\t\t/*input0_binding*/ ctx[43](null);\n\t\t\t/*select1_binding*/ ctx[47](null);\n\t\t\tdestroy_component(offsetbutton0);\n\t\t\t/*input3_binding*/ ctx[48](null);\n\t\t\t/*offsetbutton1_binding*/ ctx[49](null);\n\t\t\tdestroy_component(offsetbutton1);\n\t\t\tif (if_block2) if_block2.d();\n\t\t\tif (if_block3) if_block3.d();\n\t\t\t/*input4_binding*/ ctx[50](null);\n\t\t\t/*offsetbutton2_binding*/ ctx[51](null);\n\t\t\tdestroy_component(offsetbutton2);\n\t\t\tif (if_block4) if_block4.d();\n\t\t\tif (if_block5) if_block5.d();\n\t\t\t/*offsetbutton3_binding*/ ctx[52](null);\n\t\t\tdestroy_component(offsetbutton3);\n\t\t\tbinding_group.r();\n\t\t\tmounted = false;\n\t\t\trun_all(dispose);\n\t\t}\n\t};\n}\n\n// (164:6) {#if matches}\nfunction create_if_block_9(ctx) {\n\tlet img0;\n\tlet img0_src_value;\n\tlet t;\n\tlet img1;\n\tlet img1_src_value;\n\n\treturn {\n\t\tc() {\n\t\t\timg0 = element(\"img\");\n\t\t\tt = space();\n\t\t\timg1 = element(\"img\");\n\t\t\tif (!src_url_equal(img0.src, img0_src_value = \"/img/cat_landing.png\")) attr(img0, \"src\", img0_src_value);\n\t\t\tattr(img0, \"alt\", \"\");\n\t\t\tset_style(img0, \"position\", \"absolute\");\n\t\t\tset_style(img0, \"left\", \"0\");\n\t\t\tset_style(img0, \"width\", \"260px\");\n\t\t\tif (!src_url_equal(img1.src, img1_src_value = \"/img/dog_landing.png\")) attr(img1, \"src\", img1_src_value);\n\t\t\tattr(img1, \"alt\", \"\");\n\t\t\tset_style(img1, \"position\", \"absolute\");\n\t\t\tset_style(img1, \"right\", \"0\");\n\t\t\tset_style(img1, \"bottom\", \"0\");\n\t\t\tset_style(img1, \"width\", \"260px\");\n\t\t},\n\t\tm(target, anchor) {\n\t\t\tinsert(target, img0, anchor);\n\t\t\tinsert(target, t, anchor);\n\t\t\tinsert(target, img1, anchor);\n\t\t},\n\t\td(detaching) {\n\t\t\tif (detaching) detach(img0);\n\t\t\tif (detaching) detach(t);\n\t\t\tif (detaching) detach(img1);\n\t\t}\n\t};\n}\n\n// (163:4) <MediaQuery query=\"only screen and (min-width: 1900px)\" let:matches>\nfunction create_default_slot_6(ctx) {\n\tlet if_block_anchor;\n\tlet if_block = /*matches*/ ctx[60] && create_if_block_9(ctx);\n\n\treturn {\n\t\tc() {\n\t\t\tif (if_block) if_block.c();\n\t\t\tif_block_anchor = empty();\n\t\t},\n\t\tm(target, anchor) {\n\t\t\tif (if_block) if_block.m(target, anchor);\n\t\t\tinsert(target, if_block_anchor, anchor);\n\t\t},\n\t\tp(ctx, dirty) {\n\t\t\tif (/*matches*/ ctx[60]) {\n\t\t\t\tif (if_block) {\n\t\t\t\t\t\n\t\t\t\t} else {\n\t\t\t\t\tif_block = create_if_block_9(ctx);\n\t\t\t\t\tif_block.c();\n\t\t\t\t\tif_block.m(if_block_anchor.parentNode, if_block_anchor);\n\t\t\t\t}\n\t\t\t} else if (if_block) {\n\t\t\t\tif_block.d(1);\n\t\t\t\tif_block = null;\n\t\t\t}\n\t\t},\n\t\td(detaching) {\n\t\t\tif (if_block) if_block.d(detaching);\n\t\t\tif (detaching) detach(if_block_anchor);\n\t\t}\n\t};\n}\n\n// (181:8) {:else}\nfunction create_else_block_1(ctx) {\n\tlet img;\n\tlet img_src_value;\n\n\treturn {\n\t\tc() {\n\t\t\timg = element(\"img\");\n\t\t\tattr(img, \"class\", \"main-img svelte-13yqyyf\");\n\t\t\tif (!src_url_equal(img.src, img_src_value = /*imageSrc*/ ctx[0])) attr(img, \"src\", img_src_value);\n\t\t\tattr(img, \"alt\", \"\");\n\t\t},\n\t\tm(target, anchor) {\n\t\t\tinsert(target, img, anchor);\n\t\t\t/*img_binding_1*/ ctx[38](img);\n\t\t},\n\t\tp(ctx, dirty) {\n\t\t\tif (dirty[0] & /*imageSrc*/ 1 && !src_url_equal(img.src, img_src_value = /*imageSrc*/ ctx[0])) {\n\t\t\t\tattr(img, \"src\", img_src_value);\n\t\t\t}\n\t\t},\n\t\td(detaching) {\n\t\t\tif (detaching) detach(img);\n\t\t\t/*img_binding_1*/ ctx[38](null);\n\t\t}\n\t};\n}\n\n// (171:8) {#if product.images.edges}\nfunction create_if_block_7(ctx) {\n\tlet img;\n\tlet img_src_value;\n\tlet t;\n\tlet if_block_anchor;\n\tlet if_block = /*product*/ ctx[2].images.edges.length > 1 && create_if_block_8(ctx);\n\n\treturn {\n\t\tc() {\n\t\t\timg = element(\"img\");\n\t\t\tt = space();\n\t\t\tif (if_block) if_block.c();\n\t\t\tif_block_anchor = empty();\n\t\t\tattr(img, \"class\", \"main-img svelte-13yqyyf\");\n\t\t\tif (!src_url_equal(img.src, img_src_value = /*product*/ ctx[2].images.edges[0].node.transformedSrc)) attr(img, \"src\", img_src_value);\n\t\t\tattr(img, \"alt\", \"\");\n\t\t},\n\t\tm(target, anchor) {\n\t\t\tinsert(target, img, anchor);\n\t\t\t/*img_binding*/ ctx[37](img);\n\t\t\tinsert(target, t, anchor);\n\t\t\tif (if_block) if_block.m(target, anchor);\n\t\t\tinsert(target, if_block_anchor, anchor);\n\t\t},\n\t\tp(ctx, dirty) {\n\t\t\tif (dirty[0] & /*product*/ 4 && !src_url_equal(img.src, img_src_value = /*product*/ ctx[2].images.edges[0].node.transformedSrc)) {\n\t\t\t\tattr(img, \"src\", img_src_value);\n\t\t\t}\n\n\t\t\tif (/*product*/ ctx[2].images.edges.length > 1) {\n\t\t\t\tif (if_block) {\n\t\t\t\t\tif_block.p(ctx, dirty);\n\t\t\t\t} else {\n\t\t\t\t\tif_block = create_if_block_8(ctx);\n\t\t\t\t\tif_block.c();\n\t\t\t\t\tif_block.m(if_block_anchor.parentNode, if_block_anchor);\n\t\t\t\t}\n\t\t\t} else if (if_block) {\n\t\t\t\tif_block.d(1);\n\t\t\t\tif_block = null;\n\t\t\t}\n\t\t},\n\t\td(detaching) {\n\t\t\tif (detaching) detach(img);\n\t\t\t/*img_binding*/ ctx[37](null);\n\t\t\tif (detaching) detach(t);\n\t\t\tif (if_block) if_block.d(detaching);\n\t\t\tif (detaching) detach(if_block_anchor);\n\t\t}\n\t};\n}\n\n// (173:10) {#if product.images.edges.length > 1}\nfunction create_if_block_8(ctx) {\n\tlet div;\n\tlet each_value_1 = /*product*/ ctx[2].images.edges;\n\tlet each_blocks = [];\n\n\tfor (let i = 0; i < each_value_1.length; i += 1) {\n\t\teach_blocks[i] = create_each_block_1(get_each_context_1(ctx, each_value_1, i));\n\t}\n\n\treturn {\n\t\tc() {\n\t\t\tdiv = element(\"div\");\n\n\t\t\tfor (let i = 0; i < each_blocks.length; i += 1) {\n\t\t\t\teach_blocks[i].c();\n\t\t\t}\n\n\t\t\tattr(div, \"class\", \"thumb-container svelte-13yqyyf\");\n\t\t},\n\t\tm(target, anchor) {\n\t\t\tinsert(target, div, anchor);\n\n\t\t\tfor (let i = 0; i < each_blocks.length; i += 1) {\n\t\t\t\tif (each_blocks[i]) {\n\t\t\t\t\teach_blocks[i].m(div, null);\n\t\t\t\t}\n\t\t\t}\n\t\t},\n\t\tp(ctx, dirty) {\n\t\t\tif (dirty[0] & /*product*/ 4 | dirty[1] & /*handleImageSwap*/ 16) {\n\t\t\t\teach_value_1 = /*product*/ ctx[2].images.edges;\n\t\t\t\tlet i;\n\n\t\t\t\tfor (i = 0; i < each_value_1.length; i += 1) {\n\t\t\t\t\tconst child_ctx = get_each_context_1(ctx, each_value_1, i);\n\n\t\t\t\t\tif (each_blocks[i]) {\n\t\t\t\t\t\teach_blocks[i].p(child_ctx, dirty);\n\t\t\t\t\t} else {\n\t\t\t\t\t\teach_blocks[i] = create_each_block_1(child_ctx);\n\t\t\t\t\t\teach_blocks[i].c();\n\t\t\t\t\t\teach_blocks[i].m(div, null);\n\t\t\t\t\t}\n\t\t\t\t}\n\n\t\t\t\tfor (; i < each_blocks.length; i += 1) {\n\t\t\t\t\teach_blocks[i].d(1);\n\t\t\t\t}\n\n\t\t\t\teach_blocks.length = each_value_1.length;\n\t\t\t}\n\t\t},\n\t\td(detaching) {\n\t\t\tif (detaching) detach(div);\n\t\t\tdestroy_each(each_blocks, detaching);\n\t\t}\n\t};\n}\n\n// (175:14) {#each product.images.edges as image}\nfunction create_each_block_1(ctx) {\n\tlet img;\n\tlet img_src_value;\n\tlet mounted;\n\tlet dispose;\n\n\treturn {\n\t\tc() {\n\t\t\timg = element(\"img\");\n\t\t\tattr(img, \"class\", \"thumb-img svelte-13yqyyf\");\n\t\t\tif (!src_url_equal(img.src, img_src_value = /*image*/ ctx[57].node.transformedSrc)) attr(img, \"src\", img_src_value);\n\t\t\tattr(img, \"alt\", \"\");\n\t\t},\n\t\tm(target, anchor) {\n\t\t\tinsert(target, img, anchor);\n\n\t\t\tif (!mounted) {\n\t\t\t\tdispose = listen(img, \"click\", function () {\n\t\t\t\t\tif (is_function(/*handleImageSwap*/ ctx[35](/*image*/ ctx[57].node.transformedSrc))) /*handleImageSwap*/ ctx[35](/*image*/ ctx[57].node.transformedSrc).apply(this, arguments);\n\t\t\t\t});\n\n\t\t\t\tmounted = true;\n\t\t\t}\n\t\t},\n\t\tp(new_ctx, dirty) {\n\t\t\tctx = new_ctx;\n\n\t\t\tif (dirty[0] & /*product*/ 4 && !src_url_equal(img.src, img_src_value = /*image*/ ctx[57].node.transformedSrc)) {\n\t\t\t\tattr(img, \"src\", img_src_value);\n\t\t\t}\n\t\t},\n\t\td(detaching) {\n\t\t\tif (detaching) detach(img);\n\t\t\tmounted = false;\n\t\t\tdispose();\n\t\t}\n\t};\n}\n\n// (196:10) {:else}\nfunction create_else_block(ctx) {\n\tlet t0;\n\tlet t1;\n\n\treturn {\n\t\tc() {\n\t\t\tt0 = text(\"$\");\n\t\t\tt1 = text(/*variantPrice*/ ctx[6]);\n\t\t},\n\t\tm(target, anchor) {\n\t\t\tinsert(target, t0, anchor);\n\t\t\tinsert(target, t1, anchor);\n\t\t},\n\t\tp(ctx, dirty) {\n\t\t\tif (dirty[0] & /*variantPrice*/ 64) set_data(t1, /*variantPrice*/ ctx[6]);\n\t\t},\n\t\td(detaching) {\n\t\t\tif (detaching) detach(t0);\n\t\t\tif (detaching) detach(t1);\n\t\t}\n\t};\n}\n\n// (193:10) {#if variantComparePrice}\nfunction create_if_block_6(ctx) {\n\tlet span0;\n\tlet t0;\n\tlet t1;\n\tlet t2;\n\tlet span1;\n\tlet t3;\n\tlet t4;\n\n\treturn {\n\t\tc() {\n\t\t\tspan0 = element(\"span\");\n\t\t\tt0 = text(\"$\");\n\t\t\tt1 = text(/*variantComparePrice*/ ctx[7]);\n\t\t\tt2 = space();\n\t\t\tspan1 = element(\"span\");\n\t\t\tt3 = text(\"$\");\n\t\t\tt4 = text(/*variantPrice*/ ctx[6]);\n\t\t\tattr(span0, \"class\", \"compare-price svelte-13yqyyf\");\n\t\t\tattr(span1, \"class\", \"red svelte-13yqyyf\");\n\t\t},\n\t\tm(target, anchor) {\n\t\t\tinsert(target, span0, anchor);\n\t\t\tappend(span0, t0);\n\t\t\tappend(span0, t1);\n\t\t\tinsert(target, t2, anchor);\n\t\t\tinsert(target, span1, anchor);\n\t\t\tappend(span1, t3);\n\t\t\tappend(span1, t4);\n\t\t},\n\t\tp(ctx, dirty) {\n\t\t\tif (dirty[0] & /*variantComparePrice*/ 128) set_data(t1, /*variantComparePrice*/ ctx[7]);\n\t\t\tif (dirty[0] & /*variantPrice*/ 64) set_data(t4, /*variantPrice*/ ctx[6]);\n\t\t},\n\t\td(detaching) {\n\t\t\tif (detaching) detach(span0);\n\t\t\tif (detaching) detach(t2);\n\t\t\tif (detaching) detach(span1);\n\t\t}\n\t};\n}\n\n// (208:14) {#if variant.node.availableForSale}\nfunction create_if_block_5(ctx) {\n\tlet option;\n\tlet t_value = /*variant*/ ctx[24].node.title + \"\";\n\tlet t;\n\tlet option_value_value;\n\n\treturn {\n\t\tc() {\n\t\t\toption = element(\"option\");\n\t\t\tt = text(t_value);\n\t\t\toption.__value = option_value_value = /*variant*/ ctx[24].node;\n\t\t\toption.value = option.__value;\n\t\t},\n\t\tm(target, anchor) {\n\t\t\tinsert(target, option, anchor);\n\t\t\tappend(option, t);\n\t\t},\n\t\tp(ctx, dirty) {\n\t\t\tif (dirty[0] & /*product*/ 4 && t_value !== (t_value = /*variant*/ ctx[24].node.title + \"\")) set_data(t, t_value);\n\n\t\t\tif (dirty[0] & /*product*/ 4 && option_value_value !== (option_value_value = /*variant*/ ctx[24].node)) {\n\t\t\t\toption.__value = option_value_value;\n\t\t\t\toption.value = option.__value;\n\t\t\t}\n\t\t},\n\t\td(detaching) {\n\t\t\tif (detaching) detach(option);\n\t\t}\n\t};\n}\n\n// (207:12) {#each product.variants.edges as variant}\nfunction create_each_block(ctx) {\n\tlet if_block_anchor;\n\tlet if_block = /*variant*/ ctx[24].node.availableForSale && create_if_block_5(ctx);\n\n\treturn {\n\t\tc() {\n\t\t\tif (if_block) if_block.c();\n\t\t\tif_block_anchor = empty();\n\t\t},\n\t\tm(target, anchor) {\n\t\t\tif (if_block) if_block.m(target, anchor);\n\t\t\tinsert(target, if_block_anchor, anchor);\n\t\t},\n\t\tp(ctx, dirty) {\n\t\t\tif (/*variant*/ ctx[24].node.availableForSale) {\n\t\t\t\tif (if_block) {\n\t\t\t\t\tif_block.p(ctx, dirty);\n\t\t\t\t} else {\n\t\t\t\t\tif_block = create_if_block_5(ctx);\n\t\t\t\t\tif_block.c();\n\t\t\t\t\tif_block.m(if_block_anchor.parentNode, if_block_anchor);\n\t\t\t\t}\n\t\t\t} else if (if_block) {\n\t\t\t\tif_block.d(1);\n\t\t\t\tif_block = null;\n\t\t\t}\n\t\t},\n\t\td(detaching) {\n\t\t\tif (if_block) if_block.d(detaching);\n\t\t\tif (detaching) detach(if_block_anchor);\n\t\t}\n\t};\n}\n\n// (238:12) <OffsetButton color=\"#ff89de\" on:click={handleModalOpen} customStyle=\"margin-top:16px;\">\nfunction create_default_slot_5(ctx) {\n\tlet t;\n\n\treturn {\n\t\tc() {\n\t\t\tt = text(\"Preview\");\n\t\t},\n\t\tm(target, anchor) {\n\t\t\tinsert(target, t, anchor);\n\t\t},\n\t\td(detaching) {\n\t\t\tif (detaching) detach(t);\n\t\t}\n\t};\n}\n\n// (252:14) <OffsetButton color=\"#5cbdf9\" on:click={addPhoto} customStyle=\"margin-top:16px; margin-right: 2rem;\" bind:this=\"{photoButton}\" disabled=\"{photoButtonDisabled}\">\nfunction create_default_slot_4(ctx) {\n\tlet t;\n\n\treturn {\n\t\tc() {\n\t\t\tt = text(\"Upload My Photo\");\n\t\t},\n\t\tm(target, anchor) {\n\t\t\tinsert(target, t, anchor);\n\t\t},\n\t\td(detaching) {\n\t\t\tif (detaching) detach(t);\n\t\t}\n\t};\n}\n\n// (253:14) {#if photoUrl}\nfunction create_if_block_4(ctx) {\n\tlet offsetbutton;\n\tlet current;\n\n\toffsetbutton = new OffsetButton({\n\t\t\tprops: {\n\t\t\t\tcolor: \"green\",\n\t\t\t\tcustomStyle: \"margin-top:16px;\",\n\t\t\t\t$$slots: { default: [create_default_slot_3] },\n\t\t\t\t$$scope: { ctx }\n\t\t\t}\n\t\t});\n\n\toffsetbutton.$on(\"click\", /*handlePhotoPreviewClick*/ ctx[30]);\n\n\treturn {\n\t\tc() {\n\t\t\tcreate_component(offsetbutton.$$.fragment);\n\t\t},\n\t\tm(target, anchor) {\n\t\t\tmount_component(offsetbutton, target, anchor);\n\t\t\tcurrent = true;\n\t\t},\n\t\tp(ctx, dirty) {\n\t\t\tconst offsetbutton_changes = {};\n\n\t\t\tif (dirty[1] & /*$$scope*/ 1073741824) {\n\t\t\t\toffsetbutton_changes.$$scope = { dirty, ctx };\n\t\t\t}\n\n\t\t\toffsetbutton.$set(offsetbutton_changes);\n\t\t},\n\t\ti(local) {\n\t\t\tif (current) return;\n\t\t\ttransition_in(offsetbutton.$$.fragment, local);\n\t\t\tcurrent = true;\n\t\t},\n\t\to(local) {\n\t\t\ttransition_out(offsetbutton.$$.fragment, local);\n\t\t\tcurrent = false;\n\t\t},\n\t\td(detaching) {\n\t\t\tdestroy_component(offsetbutton, detaching);\n\t\t}\n\t};\n}\n\n// (254:16) <OffsetButton color=\"green\" on:click={handlePhotoPreviewClick} customStyle=\"margin-top:16px;\">\nfunction create_default_slot_3(ctx) {\n\tlet t;\n\n\treturn {\n\t\tc() {\n\t\t\tt = text(\"Photo Uploaded\");\n\t\t},\n\t\tm(target, anchor) {\n\t\t\tinsert(target, t, anchor);\n\t\t},\n\t\td(detaching) {\n\t\t\tif (detaching) detach(t);\n\t\t}\n\t};\n}\n\n// (258:14) {#if showPhotoUploading}\nfunction create_if_block_3(ctx) {\n\tlet loadinganimation;\n\tlet current;\n\tloadinganimation = new LoadingAnimation({});\n\n\treturn {\n\t\tc() {\n\t\t\tcreate_component(loadinganimation.$$.fragment);\n\t\t},\n\t\tm(target, anchor) {\n\t\t\tmount_component(loadinganimation, target, anchor);\n\t\t\tcurrent = true;\n\t\t},\n\t\ti(local) {\n\t\t\tif (current) return;\n\t\t\ttransition_in(loadinganimation.$$.fragment, local);\n\t\t\tcurrent = true;\n\t\t},\n\t\to(local) {\n\t\t\ttransition_out(loadinganimation.$$.fragment, local);\n\t\t\tcurrent = false;\n\t\t},\n\t\td(detaching) {\n\t\t\tdestroy_component(loadinganimation, detaching);\n\t\t}\n\t};\n}\n\n// (275:14) <OffsetButton color=\"#5cbdf9\" on:click={addVideo} customStyle=\"margin-top:16px; margin-right: 2rem;\" bind:this=\"{videoButton}\" disabled=\"{videoButtonDisabled}\">\nfunction create_default_slot_2(ctx) {\n\tlet t;\n\n\treturn {\n\t\tc() {\n\t\t\tt = text(\"Upload My Video\");\n\t\t},\n\t\tm(target, anchor) {\n\t\t\tinsert(target, t, anchor);\n\t\t},\n\t\td(detaching) {\n\t\t\tif (detaching) detach(t);\n\t\t}\n\t};\n}\n\n// (276:14) {#if videoUrl}\nfunction create_if_block_2(ctx) {\n\tlet offsetbutton;\n\tlet current;\n\n\toffsetbutton = new OffsetButton({\n\t\t\tprops: {\n\t\t\t\tcolor: \"green\",\n\t\t\t\tcustomStyle: \"margin-top:16px;\",\n\t\t\t\t$$slots: { default: [create_default_slot_1] },\n\t\t\t\t$$scope: { ctx }\n\t\t\t}\n\t\t});\n\n\toffsetbutton.$on(\"click\", /*handleVideoPreviewClick*/ ctx[31]);\n\n\treturn {\n\t\tc() {\n\t\t\tcreate_component(offsetbutton.$$.fragment);\n\t\t},\n\t\tm(target, anchor) {\n\t\t\tmount_component(offsetbutton, target, anchor);\n\t\t\tcurrent = true;\n\t\t},\n\t\tp(ctx, dirty) {\n\t\t\tconst offsetbutton_changes = {};\n\n\t\t\tif (dirty[1] & /*$$scope*/ 1073741824) {\n\t\t\t\toffsetbutton_changes.$$scope = { dirty, ctx };\n\t\t\t}\n\n\t\t\toffsetbutton.$set(offsetbutton_changes);\n\t\t},\n\t\ti(local) {\n\t\t\tif (current) return;\n\t\t\ttransition_in(offsetbutton.$$.fragment, local);\n\t\t\tcurrent = true;\n\t\t},\n\t\to(local) {\n\t\t\ttransition_out(offsetbutton.$$.fragment, local);\n\t\t\tcurrent = false;\n\t\t},\n\t\td(detaching) {\n\t\t\tdestroy_component(offsetbutton, detaching);\n\t\t}\n\t};\n}\n\n// (277:16) <OffsetButton color=\"green\" on:click={handleVideoPreviewClick} customStyle=\"margin-top:16px;\">\nfunction create_default_slot_1(ctx) {\n\tlet t;\n\n\treturn {\n\t\tc() {\n\t\t\tt = text(\"Video Uploaded\");\n\t\t},\n\t\tm(target, anchor) {\n\t\t\tinsert(target, t, anchor);\n\t\t},\n\t\td(detaching) {\n\t\t\tif (detaching) detach(t);\n\t\t}\n\t};\n}\n\n// (281:14) {#if showVideoUploading}\nfunction create_if_block_1(ctx) {\n\tlet loadinganimation;\n\tlet current;\n\tloadinganimation = new LoadingAnimation({});\n\n\treturn {\n\t\tc() {\n\t\t\tcreate_component(loadinganimation.$$.fragment);\n\t\t},\n\t\tm(target, anchor) {\n\t\t\tmount_component(loadinganimation, target, anchor);\n\t\t\tcurrent = true;\n\t\t},\n\t\ti(local) {\n\t\t\tif (current) return;\n\t\t\ttransition_in(loadinganimation.$$.fragment, local);\n\t\t\tcurrent = true;\n\t\t},\n\t\to(local) {\n\t\t\ttransition_out(loadinganimation.$$.fragment, local);\n\t\t\tcurrent = false;\n\t\t},\n\t\td(detaching) {\n\t\t\tdestroy_component(loadinganimation, detaching);\n\t\t}\n\t};\n}\n\n// (289:10) <OffsetButton color=\"#f2a240\" on:click={addToCheckout} width=\"55%\" customStyle=\"min-width: 230px; margin-bottom: 25px;\" bind:this=\"{addToCartButton}\" disabled=\"{addToCartDisabled}\">\nfunction create_default_slot(ctx) {\n\tlet t;\n\n\treturn {\n\t\tc() {\n\t\t\tt = text(\"Add To Cart\");\n\t\t},\n\t\tm(target, anchor) {\n\t\t\tinsert(target, t, anchor);\n\t\t},\n\t\td(detaching) {\n\t\t\tif (detaching) detach(t);\n\t\t}\n\t};\n}\n\nfunction create_fragment(ctx) {\n\tlet navbar;\n\tlet t0;\n\tlet t1;\n\tlet footer;\n\tlet t2;\n\tlet modal_1;\n\tlet current;\n\tnavbar = new NavBar({});\n\tlet if_block = /*product*/ ctx[2] && create_if_block(ctx);\n\tfooter = new Footer({});\n\n\tmodal_1 = new Modal({\n\t\t\tprops: {\n\t\t\t\tshow: /*$modal*/ ctx[23],\n\t\t\t\tcloseButton: true\n\t\t\t}\n\t\t});\n\n\tmodal_1.$on(\"closed\", /*handleModalClosed*/ ctx[34]);\n\n\treturn {\n\t\tc() {\n\t\t\tcreate_component(navbar.$$.fragment);\n\t\t\tt0 = space();\n\t\t\tif (if_block) if_block.c();\n\t\t\tt1 = space();\n\t\t\tcreate_component(footer.$$.fragment);\n\t\t\tt2 = space();\n\t\t\tcreate_component(modal_1.$$.fragment);\n\t\t},\n\t\tm(target, anchor) {\n\t\t\tmount_component(navbar, target, anchor);\n\t\t\tinsert(target, t0, anchor);\n\t\t\tif (if_block) if_block.m(target, anchor);\n\t\t\tinsert(target, t1, anchor);\n\t\t\tmount_component(footer, target, anchor);\n\t\t\tinsert(target, t2, anchor);\n\t\t\tmount_component(modal_1, target, anchor);\n\t\t\tcurrent = true;\n\t\t},\n\t\tp(ctx, dirty) {\n\t\t\tif (/*product*/ ctx[2]) {\n\t\t\t\tif (if_block) {\n\t\t\t\t\tif_block.p(ctx, dirty);\n\n\t\t\t\t\tif (dirty[0] & /*product*/ 4) {\n\t\t\t\t\t\ttransition_in(if_block, 1);\n\t\t\t\t\t}\n\t\t\t\t} else {\n\t\t\t\t\tif_block = create_if_block(ctx);\n\t\t\t\t\tif_block.c();\n\t\t\t\t\ttransition_in(if_block, 1);\n\t\t\t\t\tif_block.m(t1.parentNode, t1);\n\t\t\t\t}\n\t\t\t} else if (if_block) {\n\t\t\t\tgroup_outros();\n\n\t\t\t\ttransition_out(if_block, 1, 1, () => {\n\t\t\t\t\tif_block = null;\n\t\t\t\t});\n\n\t\t\t\tcheck_outros();\n\t\t\t}\n\n\t\t\tconst modal_1_changes = {};\n\t\t\tif (dirty[0] & /*$modal*/ 8388608) modal_1_changes.show = /*$modal*/ ctx[23];\n\t\t\tmodal_1.$set(modal_1_changes);\n\t\t},\n\t\ti(local) {\n\t\t\tif (current) return;\n\t\t\ttransition_in(navbar.$$.fragment, local);\n\t\t\ttransition_in(if_block);\n\t\t\ttransition_in(footer.$$.fragment, local);\n\t\t\ttransition_in(modal_1.$$.fragment, local);\n\t\t\tcurrent = true;\n\t\t},\n\t\to(local) {\n\t\t\ttransition_out(navbar.$$.fragment, local);\n\t\t\ttransition_out(if_block);\n\t\t\ttransition_out(footer.$$.fragment, local);\n\t\t\ttransition_out(modal_1.$$.fragment, local);\n\t\t\tcurrent = false;\n\t\t},\n\t\td(detaching) {\n\t\t\tdestroy_component(navbar, detaching);\n\t\t\tif (detaching) detach(t0);\n\t\t\tif (if_block) if_block.d(detaching);\n\t\t\tif (detaching) detach(t1);\n\t\t\tdestroy_component(footer, detaching);\n\t\t\tif (detaching) detach(t2);\n\t\t\tdestroy_component(modal_1, detaching);\n\t\t}\n\t};\n}\n\nfunction instance($$self, $$props, $$invalidate) {\n\tlet $modal;\n\tcomponent_subscribe($$self, modal, $$value => $$invalidate(23, $modal = $$value));\n\tlet { type } = $$props;\n\tlet imageSrc;\n\n\tswitch (type) {\n\t\tcase \"shirt\":\n\t\t\timageSrc = \"/img/tshirt_product.png\";\n\t\t\tbreak;\n\t\tcase \"mug\":\n\t\t\timageSrc = \"/img/mug_product.png\";\n\t\t\tbreak;\n\t\tcase \"photo\":\n\t\t\timageSrc = \"/img/photo_product.png\";\n\t\t\tbreak;\n\t\tdefault:\n\t\t\timageSrc = \"/img/tshirt_product.png\";\n\t\t\tbreak;\n\t}\n\n\tlet vid;\n\n\tonMount(async () => {\n\t\t// Get the product detail\n\t\tlet res = await api.getProductByType(type);\n\n\t\t$$invalidate(2, product = res.data.products.edges[0].node);\n\t\t$$invalidate(6, variantPrice = product.variants.edges[0].node.price);\n\t\t$$invalidate(7, variantComparePrice = product.variants.edges[0].node.compareAtPrice);\n\t});\n\n\tlet product;\n\tlet checkoutId = getSavedCheckoutId();\n\tlet mainImage;\n\tlet theme;\n\tlet variant;\n\tlet variantSelected;\n\tlet variantPrice;\n\tlet variantComparePrice;\n\tlet qty;\n\tlet cartoonize = \"yes\";\n\tlet photoFile;\n\tlet photoButton;\n\tlet photoButtonDisabled = true;\n\tlet showPhotoUploading = false;\n\tlet photoUrl;\n\tlet videoFile;\n\tlet videoFileDisabled = true;\n\tlet videoButton;\n\tlet videoButtonDisabled = true;\n\tlet showVideoUploading = false;\n\tlet videoUrl;\n\tlet addToCartButton;\n\tlet addToCartDisabled = true;\n\n\tasync function createCheckout() {\n\t\tlet checkoutDeets = await api.createCheckout();\n\t\tcheckoutId = checkoutDeets.data.checkoutCreate.checkout.id;\n\t}\n\n\tasync function addToCheckout() {\n\t\ttry {\n\t\t\tlet checkout = await api.getCheckout(checkoutId);\n\n\t\t\tif (checkout.data.node.order) {\n\t\t\t\tawait createCheckout();\n\t\t\t\tsetSavedCheckoutId(checkoutId);\n\t\t\t}\n\t\t} catch(err) {\n\t\t\tawait createCheckout();\n\t\t\tsetSavedCheckoutId(checkoutId);\n\t\t}\n\n\t\tif (!cartoonize) {\n\t\t\talert(\"Please select whether or not you would like to cartoonize your photo.\");\n\t\t\treturn;\n\t\t}\n\n\t\tif (photoUrl && videoUrl) {\n\t\t\tawait api.addToCheckout(checkoutId, variantSelected.id, qty.value, cartoonize, theme.value, photoUrl, videoUrl);\n\t\t\t$$invalidate(10, photoFile.value = '', photoFile);\n\t\t\t$$invalidate(14, photoUrl = null);\n\t\t\t$$invalidate(15, videoFile.value = '', videoFile);\n\t\t\t$$invalidate(20, videoUrl = null);\n\t\t\twindow.location.href = '/cart';\n\t\t} else {\n\t\t\talert(\"Please upload a photo and video.\");\n\t\t}\n\t}\n\n\tfunction handleAddPhoto() {\n\t\t$$invalidate(12, photoButtonDisabled = false);\n\t}\n\n\tasync function addPhoto() {\n\t\t$$invalidate(13, showPhotoUploading = true);\n\t\t$$invalidate(14, photoUrl = await upload.addPhoto(photoFile.files));\n\t\t$$invalidate(13, showPhotoUploading = false);\n\t\t$$invalidate(16, videoFileDisabled = false);\n\t}\n\n\tfunction handleAddVideo() {\n\t\t$$invalidate(18, videoButtonDisabled = false);\n\t}\n\n\tasync function addVideo() {\n\t\t$$invalidate(19, showVideoUploading = true);\n\t\t$$invalidate(20, videoUrl = await upload.addVideo(videoFile.files));\n\t\t$$invalidate(19, showVideoUploading = false);\n\t\t$$invalidate(22, addToCartDisabled = false);\n\t}\n\n\tfunction handlePhotoPreviewClick() {\n\t\tmodal.set(bind(ImagePreview, { imageUrl: photoUrl }));\n\t}\n\n\tfunction handleVideoPreviewClick() {\n\t\tmodal.set(bind(VideoPreview, { videoUrl }));\n\t}\n\n\tasync function handleVariantChange() {\n\t\t$$invalidate(6, variantPrice = variantSelected.price);\n\t\t$$invalidate(7, variantComparePrice = variantSelected.compareAtPrice);\n\t}\n\n\tasync function handleModalOpen() {\n\t\tmodal.set(bind(ThemePreview, { theme: theme.value }));\n\t}\n\n\tasync function handleModalClosed() {\n\t\tmodal.set();\n\t}\n\n\tasync function handleImageSwap(img) {\n\t\t$$invalidate(3, mainImage.src = img, mainImage);\n\t}\n\n\tconst $$binding_groups = [[]];\n\n\tfunction img_binding($$value) {\n\t\tbinding_callbacks[$$value ? 'unshift' : 'push'](() => {\n\t\t\tmainImage = $$value;\n\t\t\t$$invalidate(3, mainImage);\n\t\t});\n\t}\n\n\tfunction img_binding_1($$value) {\n\t\tbinding_callbacks[$$value ? 'unshift' : 'push'](() => {\n\t\t\tmainImage = $$value;\n\t\t\t$$invalidate(3, mainImage);\n\t\t});\n\t}\n\n\tconst loadedmetadata_handler = () => $$invalidate(1, vid.currentTime = 0.5, vid);\n\n\tfunction video_binding($$value) {\n\t\tbinding_callbacks[$$value ? 'unshift' : 'push'](() => {\n\t\t\tvid = $$value;\n\t\t\t$$invalidate(1, vid);\n\t\t});\n\t}\n\n\tfunction select0_binding($$value) {\n\t\tbinding_callbacks[$$value ? 'unshift' : 'push'](() => {\n\t\t\tvariant = $$value;\n\t\t\t$$invalidate(24, variant);\n\t\t});\n\t}\n\n\tfunction select0_change_handler() {\n\t\tvariantSelected = select_value(this);\n\t\t$$invalidate(5, variantSelected);\n\t\t$$invalidate(2, product);\n\t}\n\n\tfunction input0_binding($$value) {\n\t\tbinding_callbacks[$$value ? 'unshift' : 'push'](() => {\n\t\t\tqty = $$value;\n\t\t\t$$invalidate(8, qty);\n\t\t});\n\t}\n\n\tfunction input1_change_handler() {\n\t\tcartoonize = this.__value;\n\t\t$$invalidate(9, cartoonize);\n\t}\n\n\tfunction input2_change_handler() {\n\t\tcartoonize = this.__value;\n\t\t$$invalidate(9, cartoonize);\n\t}\n\n\tfunction select1_binding($$value) {\n\t\tbinding_callbacks[$$value ? 'unshift' : 'push'](() => {\n\t\t\ttheme = $$value;\n\t\t\t$$invalidate(4, theme);\n\t\t});\n\t}\n\n\tfunction input3_binding($$value) {\n\t\tbinding_callbacks[$$value ? 'unshift' : 'push'](() => {\n\t\t\tphotoFile = $$value;\n\t\t\t$$invalidate(10, photoFile);\n\t\t});\n\t}\n\n\tfunction offsetbutton1_binding($$value) {\n\t\tbinding_callbacks[$$value ? 'unshift' : 'push'](() => {\n\t\t\tphotoButton = $$value;\n\t\t\t$$invalidate(11, photoButton);\n\t\t});\n\t}\n\n\tfunction input4_binding($$value) {\n\t\tbinding_callbacks[$$value ? 'unshift' : 'push'](() => {\n\t\t\tvideoFile = $$value;\n\t\t\t$$invalidate(15, videoFile);\n\t\t});\n\t}\n\n\tfunction offsetbutton2_binding($$value) {\n\t\tbinding_callbacks[$$value ? 'unshift' : 'push'](() => {\n\t\t\tvideoButton = $$value;\n\t\t\t$$invalidate(17, videoButton);\n\t\t});\n\t}\n\n\tfunction offsetbutton3_binding($$value) {\n\t\tbinding_callbacks[$$value ? 'unshift' : 'push'](() => {\n\t\t\taddToCartButton = $$value;\n\t\t\t$$invalidate(21, addToCartButton);\n\t\t});\n\t}\n\n\t$$self.$$set = $$props => {\n\t\tif ('type' in $$props) $$invalidate(36, type = $$props.type);\n\t};\n\n\treturn [\n\t\timageSrc,\n\t\tvid,\n\t\tproduct,\n\t\tmainImage,\n\t\ttheme,\n\t\tvariantSelected,\n\t\tvariantPrice,\n\t\tvariantComparePrice,\n\t\tqty,\n\t\tcartoonize,\n\t\tphotoFile,\n\t\tphotoButton,\n\t\tphotoButtonDisabled,\n\t\tshowPhotoUploading,\n\t\tphotoUrl,\n\t\tvideoFile,\n\t\tvideoFileDisabled,\n\t\tvideoButton,\n\t\tvideoButtonDisabled,\n\t\tshowVideoUploading,\n\t\tvideoUrl,\n\t\taddToCartButton,\n\t\taddToCartDisabled,\n\t\t$modal,\n\t\tvariant,\n\t\taddToCheckout,\n\t\thandleAddPhoto,\n\t\taddPhoto,\n\t\thandleAddVideo,\n\t\taddVideo,\n\t\thandlePhotoPreviewClick,\n\t\thandleVideoPreviewClick,\n\t\thandleVariantChange,\n\t\thandleModalOpen,\n\t\thandleModalClosed,\n\t\thandleImageSwap,\n\t\ttype,\n\t\timg_binding,\n\t\timg_binding_1,\n\t\tloadedmetadata_handler,\n\t\tvideo_binding,\n\t\tselect0_binding,\n\t\tselect0_change_handler,\n\t\tinput0_binding,\n\t\tinput1_change_handler,\n\t\t$$binding_groups,\n\t\tinput2_change_handler,\n\t\tselect1_binding,\n\t\tinput3_binding,\n\t\toffsetbutton1_binding,\n\t\tinput4_binding,\n\t\toffsetbutton2_binding,\n\t\toffsetbutton3_binding\n\t];\n}\n\nclass Product extends SvelteComponent {\n\tconstructor(options) {\n\t\tsuper();\n\t\tinit(this, options, instance, create_fragment, safe_not_equal, { type: 36 }, null, [-1, -1]);\n\t}\n}\n\nexport default Product;", "import './CartItem.svelte.css';\n/* src/components/CartItem.svelte generated by Svelte v3.59.2 */\nimport {\n\tSvelteComponent,\n\tappend,\n\tattr,\n\tcreate_component,\n\tdestroy_component,\n\tdetach,\n\telement,\n\tinit,\n\tinsert,\n\tis_function,\n\tlisten,\n\tmount_component,\n\tsafe_not_equal,\n\tset_data,\n\tspace,\n\tsrc_url_equal,\n\ttext,\n\ttransition_in,\n\ttransition_out\n} from \"../../_snowpack/pkg/svelte/internal.js\";\n\nimport { createEventDispatcher } from '../../_snowpack/pkg/svelte.js';\nimport { bind } from '../../_snowpack/pkg/svelte-simple-modal.js';\nimport { modal } from \"../stores.js\";\nimport ImagePreview from './ImagePreview.svelte.js';\nimport VideoPreview from './VideoPreview.svelte.js';\nimport OffsetButton from \"./OffsetButtons.svelte.js\";\n\nfunction create_if_block_2(ctx) {\n\tlet img;\n\tlet img_src_value;\n\tlet img_alt_value;\n\tlet mounted;\n\tlet dispose;\n\n\treturn {\n\t\tc() {\n\t\t\timg = element(\"img\");\n\t\t\tattr(img, \"class\", \"cart-item-product-image svelte-1cksl88\");\n\t\t\tif (!src_url_equal(img.src, img_src_value = /*checkoutLineItemEdge*/ ctx[0].node.variant.image.originalSrc)) attr(img, \"src\", img_src_value);\n\t\t\tattr(img, \"alt\", img_alt_value = /*checkoutLineItemEdge*/ ctx[0].node.title);\n\t\t},\n\t\tm(target, anchor) {\n\t\t\tinsert(target, img, anchor);\n\n\t\t\tif (!mounted) {\n\t\t\t\tdispose = listen(img, \"click\", function () {\n\t\t\t\t\tif (is_function(/*handlePhotoPreviewClick*/ ctx[2](/*checkoutLineItemEdge*/ ctx[0].node.variant.image.originalSrc))) /*handlePhotoPreviewClick*/ ctx[2](/*checkoutLineItemEdge*/ ctx[0].node.variant.image.originalSrc).apply(this, arguments);\n\t\t\t\t});\n\n\t\t\t\tmounted = true;\n\t\t\t}\n\t\t},\n\t\tp(new_ctx, dirty) {\n\t\t\tctx = new_ctx;\n\n\t\t\tif (dirty & /*checkoutLineItemEdge*/ 1 && !src_url_equal(img.src, img_src_value = /*checkoutLineItemEdge*/ ctx[0].node.variant.image.originalSrc)) {\n\t\t\t\tattr(img, \"src\", img_src_value);\n\t\t\t}\n\n\t\t\tif (dirty & /*checkoutLineItemEdge*/ 1 && img_alt_value !== (img_alt_value = /*checkoutLineItemEdge*/ ctx[0].node.title)) {\n\t\t\t\tattr(img, \"alt\", img_alt_value);\n\t\t\t}\n\t\t},\n\t\td(detaching) {\n\t\t\tif (detaching) detach(img);\n\t\t\tmounted = false;\n\t\t\tdispose();\n\t\t}\n\t};\n}\n\n// (39:8) {#if checkoutLineItemEdge.node.customAttributes}\nfunction create_if_block_1(ctx) {\n\tlet t0;\n\tlet t1_value = /*checkoutLineItemEdge*/ ctx[0].node.customAttributes.find(func).value + \"\";\n\tlet t1;\n\n\treturn {\n\t\tc() {\n\t\t\tt0 = text(\"Theme: \");\n\t\t\tt1 = text(t1_value);\n\t\t},\n\t\tm(target, anchor) {\n\t\t\tinsert(target, t0, anchor);\n\t\t\tinsert(target, t1, anchor);\n\t\t},\n\t\tp(ctx, dirty) {\n\t\t\tif (dirty & /*checkoutLineItemEdge*/ 1 && t1_value !== (t1_value = /*checkoutLineItemEdge*/ ctx[0].node.customAttributes.find(func).value + \"\")) set_data(t1, t1_value);\n\t\t},\n\t\td(detaching) {\n\t\t\tif (detaching) detach(t0);\n\t\t\tif (detaching) detach(t1);\n\t\t}\n\t};\n}\n\n// (44:8) {#if checkoutLineItemEdge.node.variant.selectedOptions}\nfunction create_if_block(ctx) {\n\tlet t0;\n\tlet t1_value = /*checkoutLineItemEdge*/ ctx[0].node.variant.selectedOptions.find(func_1).value + \"\";\n\tlet t1;\n\n\treturn {\n\t\tc() {\n\t\t\tt0 = text(\"Size: \");\n\t\t\tt1 = text(t1_value);\n\t\t},\n\t\tm(target, anchor) {\n\t\t\tinsert(target, t0, anchor);\n\t\t\tinsert(target, t1, anchor);\n\t\t},\n\t\tp(ctx, dirty) {\n\t\t\tif (dirty & /*checkoutLineItemEdge*/ 1 && t1_value !== (t1_value = /*checkoutLineItemEdge*/ ctx[0].node.variant.selectedOptions.find(func_1).value + \"\")) set_data(t1, t1_value);\n\t\t},\n\t\td(detaching) {\n\t\t\tif (detaching) detach(t0);\n\t\t\tif (detaching) detach(t1);\n\t\t}\n\t};\n}\n\n// (49:8) <OffsetButton color=\"#f2a240\" on:click={handlePhotoPreviewClick((checkoutLineItemEdge.node.customAttributes.find(customAttribute => customAttribute.key == \"_photoUrl\")).value)} customStyle=\"margin-top:10px;\">\nfunction create_default_slot_2(ctx) {\n\tlet t;\n\n\treturn {\n\t\tc() {\n\t\t\tt = text(\"View Photo\");\n\t\t},\n\t\tm(target, anchor) {\n\t\t\tinsert(target, t, anchor);\n\t\t},\n\t\td(detaching) {\n\t\t\tif (detaching) detach(t);\n\t\t}\n\t};\n}\n\n// (50:8) <OffsetButton color=\"#f2a240\" on:click={handleVideoPreviewClick((checkoutLineItemEdge.node.customAttributes.find(customAttribute => customAttribute.key == \"_videoUrl\")).value)} customStyle=\"margin-top:10px;\">\nfunction create_default_slot_1(ctx) {\n\tlet t;\n\n\treturn {\n\t\tc() {\n\t\t\tt = text(\"View Video\");\n\t\t},\n\t\tm(target, anchor) {\n\t\t\tinsert(target, t, anchor);\n\t\t},\n\t\td(detaching) {\n\t\t\tif (detaching) detach(t);\n\t\t}\n\t};\n}\n\n// (51:8) <OffsetButton color=\"#e01100\" on:click={removeItem(checkoutLineItemEdge)} customStyle=\"margin-top:10px;\">\nfunction create_default_slot(ctx) {\n\tlet t;\n\n\treturn {\n\t\tc() {\n\t\t\tt = text(\"Remove\");\n\t\t},\n\t\tm(target, anchor) {\n\t\t\tinsert(target, t, anchor);\n\t\t},\n\t\td(detaching) {\n\t\t\tif (detaching) detach(t);\n\t\t}\n\t};\n}\n\nfunction create_fragment(ctx) {\n\tlet div3;\n\tlet t0;\n\tlet div2;\n\tlet div1;\n\tlet p0;\n\tlet t1_value = /*checkoutLineItemEdge*/ ctx[0].node.title + \"\";\n\tlet t1;\n\tlet t2;\n\tlet p1;\n\tlet t3;\n\tlet p2;\n\tlet t4;\n\tlet div0;\n\tlet offsetbutton0;\n\tlet t5;\n\tlet offsetbutton1;\n\tlet t6;\n\tlet offsetbutton2;\n\tlet current;\n\tlet if_block0 = /*checkoutLineItemEdge*/ ctx[0].node.variant.image && create_if_block_2(ctx);\n\tlet if_block1 = /*checkoutLineItemEdge*/ ctx[0].node.customAttributes && create_if_block_1(ctx);\n\tlet if_block2 = /*checkoutLineItemEdge*/ ctx[0].node.variant.selectedOptions && create_if_block(ctx);\n\n\toffsetbutton0 = new OffsetButton({\n\t\t\tprops: {\n\t\t\t\tcolor: \"#f2a240\",\n\t\t\t\tcustomStyle: \"margin-top:10px;\",\n\t\t\t\t$$slots: { default: [create_default_slot_2] },\n\t\t\t\t$$scope: { ctx }\n\t\t\t}\n\t\t});\n\n\toffsetbutton0.$on(\"click\", function () {\n\t\tif (is_function(/*handlePhotoPreviewClick*/ ctx[2](/*checkoutLineItemEdge*/ ctx[0].node.customAttributes.find(click_handler).value))) /*handlePhotoPreviewClick*/ ctx[2](/*checkoutLineItemEdge*/ ctx[0].node.customAttributes.find(click_handler).value).apply(this, arguments);\n\t});\n\n\toffsetbutton1 = new OffsetButton({\n\t\t\tprops: {\n\t\t\t\tcolor: \"#f2a240\",\n\t\t\t\tcustomStyle: \"margin-top:10px;\",\n\t\t\t\t$$slots: { default: [create_default_slot_1] },\n\t\t\t\t$$scope: { ctx }\n\t\t\t}\n\t\t});\n\n\toffsetbutton1.$on(\"click\", function () {\n\t\tif (is_function(/*handleVideoPreviewClick*/ ctx[3](/*checkoutLineItemEdge*/ ctx[0].node.customAttributes.find(click_handler_1).value))) /*handleVideoPreviewClick*/ ctx[3](/*checkoutLineItemEdge*/ ctx[0].node.customAttributes.find(click_handler_1).value).apply(this, arguments);\n\t});\n\n\toffsetbutton2 = new OffsetButton({\n\t\t\tprops: {\n\t\t\t\tcolor: \"#e01100\",\n\t\t\t\tcustomStyle: \"margin-top:10px;\",\n\t\t\t\t$$slots: { default: [create_default_slot] },\n\t\t\t\t$$scope: { ctx }\n\t\t\t}\n\t\t});\n\n\toffsetbutton2.$on(\"click\", function () {\n\t\tif (is_function(/*removeItem*/ ctx[1](/*checkoutLineItemEdge*/ ctx[0]))) /*removeItem*/ ctx[1](/*checkoutLineItemEdge*/ ctx[0]).apply(this, arguments);\n\t});\n\n\treturn {\n\t\tc() {\n\t\t\tdiv3 = element(\"div\");\n\t\t\tif (if_block0) if_block0.c();\n\t\t\tt0 = space();\n\t\t\tdiv2 = element(\"div\");\n\t\t\tdiv1 = element(\"div\");\n\t\t\tp0 = element(\"p\");\n\t\t\tt1 = text(t1_value);\n\t\t\tt2 = space();\n\t\t\tp1 = element(\"p\");\n\t\t\tif (if_block1) if_block1.c();\n\t\t\tt3 = space();\n\t\t\tp2 = element(\"p\");\n\t\t\tif (if_block2) if_block2.c();\n\t\t\tt4 = space();\n\t\t\tdiv0 = element(\"div\");\n\t\t\tcreate_component(offsetbutton0.$$.fragment);\n\t\t\tt5 = space();\n\t\t\tcreate_component(offsetbutton1.$$.fragment);\n\t\t\tt6 = space();\n\t\t\tcreate_component(offsetbutton2.$$.fragment);\n\t\t\tattr(p0, \"class\", \"cart-item-info-title svelte-1cksl88\");\n\t\t\tattr(p1, \"class\", \"cart-item-info-theme svelte-1cksl88\");\n\t\t\tattr(p2, \"class\", \"cart-item-info-size svelte-1cksl88\");\n\t\t\tattr(div0, \"class\", \"cart-item-info-preview-buttons svelte-1cksl88\");\n\t\t\tattr(div1, \"class\", \"cart-item-info-row\");\n\t\t\tattr(div2, \"class\", \"cart-item-info svelte-1cksl88\");\n\t\t\tattr(div3, \"class\", \"cart-item svelte-1cksl88\");\n\t\t},\n\t\tm(target, anchor) {\n\t\t\tinsert(target, div3, anchor);\n\t\t\tif (if_block0) if_block0.m(div3, null);\n\t\t\tappend(div3, t0);\n\t\t\tappend(div3, div2);\n\t\t\tappend(div2, div1);\n\t\t\tappend(div1, p0);\n\t\t\tappend(p0, t1);\n\t\t\tappend(div1, t2);\n\t\t\tappend(div1, p1);\n\t\t\tif (if_block1) if_block1.m(p1, null);\n\t\t\tappend(div1, t3);\n\t\t\tappend(div1, p2);\n\t\t\tif (if_block2) if_block2.m(p2, null);\n\t\t\tappend(div1, t4);\n\t\t\tappend(div1, div0);\n\t\t\tmount_component(offsetbutton0, div0, null);\n\t\t\tappend(div0, t5);\n\t\t\tmount_component(offsetbutton1, div0, null);\n\t\t\tappend(div0, t6);\n\t\t\tmount_component(offsetbutton2, div0, null);\n\t\t\tcurrent = true;\n\t\t},\n\t\tp(new_ctx, [dirty]) {\n\t\t\tctx = new_ctx;\n\n\t\t\tif (/*checkoutLineItemEdge*/ ctx[0].node.variant.image) {\n\t\t\t\tif (if_block0) {\n\t\t\t\t\tif_block0.p(ctx, dirty);\n\t\t\t\t} else {\n\t\t\t\t\tif_block0 = create_if_block_2(ctx);\n\t\t\t\t\tif_block0.c();\n\t\t\t\t\tif_block0.m(div3, t0);\n\t\t\t\t}\n\t\t\t} else if (if_block0) {\n\t\t\t\tif_block0.d(1);\n\t\t\t\tif_block0 = null;\n\t\t\t}\n\n\t\t\tif ((!current || dirty & /*checkoutLineItemEdge*/ 1) && t1_value !== (t1_value = /*checkoutLineItemEdge*/ ctx[0].node.title + \"\")) set_data(t1, t1_value);\n\n\t\t\tif (/*checkoutLineItemEdge*/ ctx[0].node.customAttributes) {\n\t\t\t\tif (if_block1) {\n\t\t\t\t\tif_block1.p(ctx, dirty);\n\t\t\t\t} else {\n\t\t\t\t\tif_block1 = create_if_block_1(ctx);\n\t\t\t\t\tif_block1.c();\n\t\t\t\t\tif_block1.m(p1, null);\n\t\t\t\t}\n\t\t\t} else if (if_block1) {\n\t\t\t\tif_block1.d(1);\n\t\t\t\tif_block1 = null;\n\t\t\t}\n\n\t\t\tif (/*checkoutLineItemEdge*/ ctx[0].node.variant.selectedOptions) {\n\t\t\t\tif (if_block2) {\n\t\t\t\t\tif_block2.p(ctx, dirty);\n\t\t\t\t} else {\n\t\t\t\t\tif_block2 = create_if_block(ctx);\n\t\t\t\t\tif_block2.c();\n\t\t\t\t\tif_block2.m(p2, null);\n\t\t\t\t}\n\t\t\t} else if (if_block2) {\n\t\t\t\tif_block2.d(1);\n\t\t\t\tif_block2 = null;\n\t\t\t}\n\n\t\t\tconst offsetbutton0_changes = {};\n\n\t\t\tif (dirty & /*$$scope*/ 32) {\n\t\t\t\toffsetbutton0_changes.$$scope = { dirty, ctx };\n\t\t\t}\n\n\t\t\toffsetbutton0.$set(offsetbutton0_changes);\n\t\t\tconst offsetbutton1_changes = {};\n\n\t\t\tif (dirty & /*$$scope*/ 32) {\n\t\t\t\toffsetbutton1_changes.$$scope = { dirty, ctx };\n\t\t\t}\n\n\t\t\toffsetbutton1.$set(offsetbutton1_changes);\n\t\t\tconst offsetbutton2_changes = {};\n\n\t\t\tif (dirty & /*$$scope*/ 32) {\n\t\t\t\toffsetbutton2_changes.$$scope = { dirty, ctx };\n\t\t\t}\n\n\t\t\toffsetbutton2.$set(offsetbutton2_changes);\n\t\t},\n\t\ti(local) {\n\t\t\tif (current) return;\n\t\t\ttransition_in(offsetbutton0.$$.fragment, local);\n\t\t\ttransition_in(offsetbutton1.$$.fragment, local);\n\t\t\ttransition_in(offsetbutton2.$$.fragment, local);\n\t\t\tcurrent = true;\n\t\t},\n\t\to(local) {\n\t\t\ttransition_out(offsetbutton0.$$.fragment, local);\n\t\t\ttransition_out(offsetbutton1.$$.fragment, local);\n\t\t\ttransition_out(offsetbutton2.$$.fragment, local);\n\t\t\tcurrent = false;\n\t\t},\n\t\td(detaching) {\n\t\t\tif (detaching) detach(div3);\n\t\t\tif (if_block0) if_block0.d();\n\t\t\tif (if_block1) if_block1.d();\n\t\t\tif (if_block2) if_block2.d();\n\t\t\tdestroy_component(offsetbutton0);\n\t\t\tdestroy_component(offsetbutton1);\n\t\t\tdestroy_component(offsetbutton2);\n\t\t}\n\t};\n}\n\nconst func = customAttribute => customAttribute.key == \"_theme\";\nconst func_1 = option => option.name == \"Size\";\nconst click_handler = customAttribute => customAttribute.key == \"_photoUrl\";\nconst click_handler_1 = customAttribute => customAttribute.key == \"_videoUrl\";\n\nfunction instance($$self, $$props, $$invalidate) {\n\tconst dispatch = createEventDispatcher();\n\tlet { checkoutLineItemEdge } = $$props;\n\n\tfunction removeItem(lineItemEdge) {\n\t\tdispatch('removeItem', { checkoutItem: lineItemEdge });\n\t}\n\n\tfunction handlePhotoPreviewClick(url) {\n\t\tmodal.set(bind(ImagePreview, { imageUrl: url }));\n\t}\n\n\tfunction handleVideoPreviewClick(url) {\n\t\tmodal.set(bind(VideoPreview, { videoUrl: url }));\n\t}\n\n\t$$self.$$set = $$props => {\n\t\tif ('checkoutLineItemEdge' in $$props) $$invalidate(0, checkoutLineItemEdge = $$props.checkoutLineItemEdge);\n\t};\n\n\treturn [\n\t\tcheckoutLineItemEdge,\n\t\tremoveItem,\n\t\thandlePhotoPreviewClick,\n\t\thandleVideoPreviewClick\n\t];\n}\n\nclass CartItem extends SvelteComponent {\n\tconstructor(options) {\n\t\tsuper();\n\t\tinit(this, options, instance, create_fragment, safe_not_equal, { checkoutLineItemEdge: 0 });\n\t}\n}\n\nexport default CartItem;", "import './CartCheckout.svelte.css';\n/* src/components/CartCheckout.svelte generated by Svelte v3.59.2 */\nimport {\n\tSvelteComponent,\n\tappend,\n\tattr,\n\tcreate_component,\n\tdestroy_component,\n\tdetach,\n\telement,\n\tinit,\n\tinsert,\n\tmount_component,\n\tsafe_not_equal,\n\tset_data,\n\tspace,\n\ttext,\n\ttransition_in,\n\ttransition_out\n} from \"../../_snowpack/pkg/svelte/internal.js\";\n\nimport api from \"../ApiClient.js\";\nimport OffsetButton from \"./OffsetButtons.svelte.js\";\n\nfunction create_default_slot(ctx) {\n\tlet t;\n\n\treturn {\n\t\tc() {\n\t\t\tt = text(\"PROCEED TO CHECKOUT\");\n\t\t},\n\t\tm(target, anchor) {\n\t\t\tinsert(target, t, anchor);\n\t\t},\n\t\td(detaching) {\n\t\t\tif (detaching) detach(t);\n\t\t}\n\t};\n}\n\nfunction create_fragment(ctx) {\n\tlet section;\n\tlet h30;\n\tlet t0;\n\tlet t1_value = displayMoneyAmount(/*checkout*/ ctx[0].data.node.subtotalPrice) + \"\";\n\tlet t1;\n\tlet t2;\n\tlet t3_value = /*checkout*/ ctx[0].data.node.currencyCode + \"\";\n\tlet t3;\n\tlet t4;\n\tlet p;\n\tlet t6;\n\tlet offsetbutton;\n\tlet t7;\n\tlet h31;\n\tlet current;\n\n\toffsetbutton = new OffsetButton({\n\t\t\tprops: {\n\t\t\t\tdark: true,\n\t\t\t\tcolor: \"#494949\",\n\t\t\t\tcustomStyle: \"width: 55%; color: white;\",\n\t\t\t\t$$slots: { default: [create_default_slot] },\n\t\t\t\t$$scope: { ctx }\n\t\t\t}\n\t\t});\n\n\toffsetbutton.$on(\"click\", /*handleProceedToCheckout*/ ctx[1]);\n\n\treturn {\n\t\tc() {\n\t\t\tsection = element(\"section\");\n\t\t\th30 = element(\"h3\");\n\t\t\tt0 = text(\"SUBTOTAL: $\");\n\t\t\tt1 = text(t1_value);\n\t\t\tt2 = space();\n\t\t\tt3 = text(t3_value);\n\t\t\tt4 = space();\n\t\t\tp = element(\"p\");\n\t\t\tp.textContent = \"Taxes and shipping calculated at checkout\";\n\t\t\tt6 = space();\n\t\t\tcreate_component(offsetbutton.$$.fragment);\n\t\t\tt7 = space();\n\t\t\th31 = element(\"h3\");\n\t\t\th31.innerHTML = `<a href=\"/#products-anchor\" class=\"svelte-1punedg\">Continue shopping</a>`;\n\t\t\tattr(p, \"class\", \"checkout-info svelte-1punedg\");\n\t\t\tattr(h31, \"class\", \"cart-secondary-title centered-text svelte-1punedg\");\n\t\t\tattr(section, \"class\", \"cart-checkout svelte-1punedg\");\n\t\t},\n\t\tm(target, anchor) {\n\t\t\tinsert(target, section, anchor);\n\t\t\tappend(section, h30);\n\t\t\tappend(h30, t0);\n\t\t\tappend(h30, t1);\n\t\t\tappend(h30, t2);\n\t\t\tappend(h30, t3);\n\t\t\tappend(section, t4);\n\t\t\tappend(section, p);\n\t\t\tappend(section, t6);\n\t\t\tmount_component(offsetbutton, section, null);\n\t\t\tappend(section, t7);\n\t\t\tappend(section, h31);\n\t\t\tcurrent = true;\n\t\t},\n\t\tp(ctx, [dirty]) {\n\t\t\tif ((!current || dirty & /*checkout*/ 1) && t1_value !== (t1_value = displayMoneyAmount(/*checkout*/ ctx[0].data.node.subtotalPrice) + \"\")) set_data(t1, t1_value);\n\t\t\tif ((!current || dirty & /*checkout*/ 1) && t3_value !== (t3_value = /*checkout*/ ctx[0].data.node.currencyCode + \"\")) set_data(t3, t3_value);\n\t\t\tconst offsetbutton_changes = {};\n\n\t\t\tif (dirty & /*$$scope*/ 8) {\n\t\t\t\toffsetbutton_changes.$$scope = { dirty, ctx };\n\t\t\t}\n\n\t\t\toffsetbutton.$set(offsetbutton_changes);\n\t\t},\n\t\ti(local) {\n\t\t\tif (current) return;\n\t\t\ttransition_in(offsetbutton.$$.fragment, local);\n\t\t\tcurrent = true;\n\t\t},\n\t\to(local) {\n\t\t\ttransition_out(offsetbutton.$$.fragment, local);\n\t\t\tcurrent = false;\n\t\t},\n\t\td(detaching) {\n\t\t\tif (detaching) detach(section);\n\t\t\tdestroy_component(offsetbutton);\n\t\t}\n\t};\n}\n\nfunction displayMoneyAmount(moneyAmount) {\n\treturn parseFloat(moneyAmount).toFixed(2).toString();\n}\n\nfunction instance($$self, $$props, $$invalidate) {\n\tlet { checkout } = $$props;\n\tlet { checkoutId } = $$props;\n\n\tasync function handleProceedToCheckout() {\n\t\ttry {\n\t\t\tlet res = await api.getWebCheckoutUrl(checkoutId);\n\t\t\twindow.location.href = res.data.node.webUrl;\n\t\t} catch(err) {\n\t\t\talert(err);\n\t\t}\n\t}\n\n\t$$self.$$set = $$props => {\n\t\tif ('checkout' in $$props) $$invalidate(0, checkout = $$props.checkout);\n\t\tif ('checkoutId' in $$props) $$invalidate(2, checkoutId = $$props.checkoutId);\n\t};\n\n\treturn [checkout, handleProceedToCheckout, checkoutId];\n}\n\nclass CartCheckout extends SvelteComponent {\n\tconstructor(options) {\n\t\tsuper();\n\t\tinit(this, options, instance, create_fragment, safe_not_equal, { checkout: 0, checkoutId: 2 });\n\t}\n}\n\nexport default CartCheckout;", "import './Cart.svelte.css';\n/* src/screens/Cart.svelte generated by Svelte v3.59.2 */\nimport {\n\tSvelteComponent,\n\tappend,\n\tattr,\n\tcheck_outros,\n\tcomponent_subscribe,\n\tcreate_component,\n\tdestroy_component,\n\tdestroy_each,\n\tdetach,\n\telement,\n\tempty,\n\tgroup_outros,\n\tinit,\n\tinsert,\n\tis_function,\n\tlisten,\n\tmount_component,\n\tsafe_not_equal,\n\tset_data,\n\tspace,\n\ttext,\n\ttransition_in,\n\ttransition_out\n} from \"../../_snowpack/pkg/svelte/internal.js\";\n\nimport { onMount } from \"../../_snowpack/pkg/svelte.js\";\nimport NavBar from \"../components/NavBar.svelte.js\";\nimport api from \"../ApiClient.js\";\nimport { getSavedCheckoutId } from \"../util.js\";\nimport Footer from \"../components/Footer.svelte.js\";\nimport Modal from '../../_snowpack/pkg/svelte-simple-modal.js';\nimport { modal } from \"../stores.js\";\nimport CartItem from \"../components/CartItem.svelte.js\";\nimport CartCheckout from \"../components/CartCheckout.svelte.js\";\nimport { cartItemCount } from '../stores.js';\n\nfunction get_each_context(ctx, list, i) {\n\tconst child_ctx = ctx.slice();\n\tchild_ctx[9] = list[i];\n\treturn child_ctx;\n}\n\n// (100:26) \nfunction create_if_block_4(ctx) {\n\tlet t;\n\n\treturn {\n\t\tc() {\n\t\t\tt = text(\"YOUR CART IS EMPTY\");\n\t\t},\n\t\tm(target, anchor) {\n\t\t\tinsert(target, t, anchor);\n\t\t},\n\t\td(detaching) {\n\t\t\tif (detaching) detach(t);\n\t\t}\n\t};\n}\n\n// (98:44) \nfunction create_if_block_3(ctx) {\n\tlet t;\n\n\treturn {\n\t\tc() {\n\t\t\tt = text(\"YOUR CART IS EMPTY\");\n\t\t},\n\t\tm(target, anchor) {\n\t\t\tinsert(target, t, anchor);\n\t\t},\n\t\td(detaching) {\n\t\t\tif (detaching) detach(t);\n\t\t}\n\t};\n}\n\n// (96:6) {#if checkout && cartHasItems()}\nfunction create_if_block_2(ctx) {\n\tlet t;\n\n\treturn {\n\t\tc() {\n\t\t\tt = text(\"YOUR CART\");\n\t\t},\n\t\tm(target, anchor) {\n\t\t\tinsert(target, t, anchor);\n\t\t},\n\t\td(detaching) {\n\t\t\tif (detaching) detach(t);\n\t\t}\n\t};\n}\n\n// (105:4) {#if checkout && cartHasItems()}\nfunction create_if_block(ctx) {\n\tlet section;\n\tlet table;\n\tlet tr;\n\tlet t7;\n\tlet t8;\n\tlet show_if = /*checkout*/ ctx[0] && /*cartHasItems*/ ctx[5]();\n\tlet if_block_anchor;\n\tlet current;\n\tlet each_value = /*checkout*/ ctx[0].data.node.lineItems.edges;\n\tlet each_blocks = [];\n\n\tfor (let i = 0; i < each_value.length; i += 1) {\n\t\teach_blocks[i] = create_each_block(get_each_context(ctx, each_value, i));\n\t}\n\n\tconst out = i => transition_out(each_blocks[i], 1, 1, () => {\n\t\teach_blocks[i] = null;\n\t});\n\n\tlet if_block = show_if && create_if_block_1(ctx);\n\n\treturn {\n\t\tc() {\n\t\t\tsection = element(\"section\");\n\t\t\ttable = element(\"table\");\n\t\t\ttr = element(\"tr\");\n\n\t\t\ttr.innerHTML = `<th style=\"width: 45%;\">Product</th> \n            <th>Price</th> \n            <th>Quantity</th> \n            <th>Total</th>`;\n\n\t\t\tt7 = space();\n\n\t\t\tfor (let i = 0; i < each_blocks.length; i += 1) {\n\t\t\t\teach_blocks[i].c();\n\t\t\t}\n\n\t\t\tt8 = space();\n\t\t\tif (if_block) if_block.c();\n\t\t\tif_block_anchor = empty();\n\t\t\tattr(table, \"class\", \"cart-items-table svelte-izgz8u\");\n\t\t\tattr(section, \"class\", \"cart-items-container svelte-izgz8u\");\n\t\t},\n\t\tm(target, anchor) {\n\t\t\tinsert(target, section, anchor);\n\t\t\tappend(section, table);\n\t\t\tappend(table, tr);\n\t\t\tappend(table, t7);\n\n\t\t\tfor (let i = 0; i < each_blocks.length; i += 1) {\n\t\t\t\tif (each_blocks[i]) {\n\t\t\t\t\teach_blocks[i].m(table, null);\n\t\t\t\t}\n\t\t\t}\n\n\t\t\tinsert(target, t8, anchor);\n\t\t\tif (if_block) if_block.m(target, anchor);\n\t\t\tinsert(target, if_block_anchor, anchor);\n\t\t\tcurrent = true;\n\t\t},\n\t\tp(ctx, dirty) {\n\t\t\tif (dirty & /*displayMoneyAmount, checkout, updateLineItemQuantity, handleRemoveCartItem*/ 25) {\n\t\t\t\teach_value = /*checkout*/ ctx[0].data.node.lineItems.edges;\n\t\t\t\tlet i;\n\n\t\t\t\tfor (i = 0; i < each_value.length; i += 1) {\n\t\t\t\t\tconst child_ctx = get_each_context(ctx, each_value, i);\n\n\t\t\t\t\tif (each_blocks[i]) {\n\t\t\t\t\t\teach_blocks[i].p(child_ctx, dirty);\n\t\t\t\t\t\ttransition_in(each_blocks[i], 1);\n\t\t\t\t\t} else {\n\t\t\t\t\t\teach_blocks[i] = create_each_block(child_ctx);\n\t\t\t\t\t\teach_blocks[i].c();\n\t\t\t\t\t\ttransition_in(each_blocks[i], 1);\n\t\t\t\t\t\teach_blocks[i].m(table, null);\n\t\t\t\t\t}\n\t\t\t\t}\n\n\t\t\t\tgroup_outros();\n\n\t\t\t\tfor (i = each_value.length; i < each_blocks.length; i += 1) {\n\t\t\t\t\tout(i);\n\t\t\t\t}\n\n\t\t\t\tcheck_outros();\n\t\t\t}\n\n\t\t\tif (dirty & /*checkout*/ 1) show_if = /*checkout*/ ctx[0] && /*cartHasItems*/ ctx[5]();\n\n\t\t\tif (show_if) {\n\t\t\t\tif (if_block) {\n\t\t\t\t\tif_block.p(ctx, dirty);\n\n\t\t\t\t\tif (dirty & /*checkout*/ 1) {\n\t\t\t\t\t\ttransition_in(if_block, 1);\n\t\t\t\t\t}\n\t\t\t\t} else {\n\t\t\t\t\tif_block = create_if_block_1(ctx);\n\t\t\t\t\tif_block.c();\n\t\t\t\t\ttransition_in(if_block, 1);\n\t\t\t\t\tif_block.m(if_block_anchor.parentNode, if_block_anchor);\n\t\t\t\t}\n\t\t\t} else if (if_block) {\n\t\t\t\tgroup_outros();\n\n\t\t\t\ttransition_out(if_block, 1, 1, () => {\n\t\t\t\t\tif_block = null;\n\t\t\t\t});\n\n\t\t\t\tcheck_outros();\n\t\t\t}\n\t\t},\n\t\ti(local) {\n\t\t\tif (current) return;\n\n\t\t\tfor (let i = 0; i < each_value.length; i += 1) {\n\t\t\t\ttransition_in(each_blocks[i]);\n\t\t\t}\n\n\t\t\ttransition_in(if_block);\n\t\t\tcurrent = true;\n\t\t},\n\t\to(local) {\n\t\t\teach_blocks = each_blocks.filter(Boolean);\n\n\t\t\tfor (let i = 0; i < each_blocks.length; i += 1) {\n\t\t\t\ttransition_out(each_blocks[i]);\n\t\t\t}\n\n\t\t\ttransition_out(if_block);\n\t\t\tcurrent = false;\n\t\t},\n\t\td(detaching) {\n\t\t\tif (detaching) detach(section);\n\t\t\tdestroy_each(each_blocks, detaching);\n\t\t\tif (detaching) detach(t8);\n\t\t\tif (if_block) if_block.d(detaching);\n\t\t\tif (detaching) detach(if_block_anchor);\n\t\t}\n\t};\n}\n\n// (114:10) {#each checkout.data.node.lineItems.edges as lineItemEdge}\nfunction create_each_block(ctx) {\n\tlet tr;\n\tlet td0;\n\tlet cartitem;\n\tlet t0;\n\tlet td1;\n\tlet t1;\n\tlet t2_value = displayMoneyAmount(/*lineItemEdge*/ ctx[9].node.variant.price) + \"\";\n\tlet t2;\n\tlet t3;\n\tlet td2;\n\tlet input;\n\tlet input_value_value;\n\tlet t4;\n\tlet td3;\n\tlet t5;\n\tlet t6_value = displayMoneyAmount(/*lineItemEdge*/ ctx[9].node.variant.price * /*lineItemEdge*/ ctx[9].node.quantity) + \"\";\n\tlet t6;\n\tlet t7;\n\tlet current;\n\tlet mounted;\n\tlet dispose;\n\n\tcartitem = new CartItem({\n\t\t\tprops: {\n\t\t\t\tcheckoutLineItemEdge: /*lineItemEdge*/ ctx[9]\n\t\t\t}\n\t\t});\n\n\tcartitem.$on(\"removeItem\", /*handleRemoveCartItem*/ ctx[3]);\n\n\treturn {\n\t\tc() {\n\t\t\ttr = element(\"tr\");\n\t\t\ttd0 = element(\"td\");\n\t\t\tcreate_component(cartitem.$$.fragment);\n\t\t\tt0 = space();\n\t\t\ttd1 = element(\"td\");\n\t\t\tt1 = text(\"$\");\n\t\t\tt2 = text(t2_value);\n\t\t\tt3 = space();\n\t\t\ttd2 = element(\"td\");\n\t\t\tinput = element(\"input\");\n\t\t\tt4 = space();\n\t\t\ttd3 = element(\"td\");\n\t\t\tt5 = text(\"$\");\n\t\t\tt6 = text(t6_value);\n\t\t\tt7 = space();\n\t\t\tattr(td1, \"class\", \"centered-text svelte-izgz8u\");\n\t\t\tattr(input, \"class\", \"input-quantity svelte-izgz8u\");\n\t\t\tattr(input, \"type\", \"number\");\n\t\t\tinput.value = input_value_value = /*lineItemEdge*/ ctx[9].node.quantity;\n\t\t\tattr(td2, \"class\", \"centered-text svelte-izgz8u\");\n\t\t\tattr(td3, \"class\", \"centered-text svelte-izgz8u\");\n\t\t\tattr(tr, \"class\", \"item-row svelte-izgz8u\");\n\t\t},\n\t\tm(target, anchor) {\n\t\t\tinsert(target, tr, anchor);\n\t\t\tappend(tr, td0);\n\t\t\tmount_component(cartitem, td0, null);\n\t\t\tappend(tr, t0);\n\t\t\tappend(tr, td1);\n\t\t\tappend(td1, t1);\n\t\t\tappend(td1, t2);\n\t\t\tappend(tr, t3);\n\t\t\tappend(tr, td2);\n\t\t\tappend(td2, input);\n\t\t\tappend(tr, t4);\n\t\t\tappend(tr, td3);\n\t\t\tappend(td3, t5);\n\t\t\tappend(td3, t6);\n\t\t\tappend(tr, t7);\n\t\t\tcurrent = true;\n\n\t\t\tif (!mounted) {\n\t\t\t\tdispose = listen(input, \"change\", function () {\n\t\t\t\t\tif (is_function(/*updateLineItemQuantity*/ ctx[4](/*lineItemEdge*/ ctx[9], this.value))) /*updateLineItemQuantity*/ ctx[4](/*lineItemEdge*/ ctx[9], this.value).apply(this, arguments);\n\t\t\t\t});\n\n\t\t\t\tmounted = true;\n\t\t\t}\n\t\t},\n\t\tp(new_ctx, dirty) {\n\t\t\tctx = new_ctx;\n\t\t\tconst cartitem_changes = {};\n\t\t\tif (dirty & /*checkout*/ 1) cartitem_changes.checkoutLineItemEdge = /*lineItemEdge*/ ctx[9];\n\t\t\tcartitem.$set(cartitem_changes);\n\t\t\tif ((!current || dirty & /*checkout*/ 1) && t2_value !== (t2_value = displayMoneyAmount(/*lineItemEdge*/ ctx[9].node.variant.price) + \"\")) set_data(t2, t2_value);\n\n\t\t\tif (!current || dirty & /*checkout*/ 1 && input_value_value !== (input_value_value = /*lineItemEdge*/ ctx[9].node.quantity) && input.value !== input_value_value) {\n\t\t\t\tinput.value = input_value_value;\n\t\t\t}\n\n\t\t\tif ((!current || dirty & /*checkout*/ 1) && t6_value !== (t6_value = displayMoneyAmount(/*lineItemEdge*/ ctx[9].node.variant.price * /*lineItemEdge*/ ctx[9].node.quantity) + \"\")) set_data(t6, t6_value);\n\t\t},\n\t\ti(local) {\n\t\t\tif (current) return;\n\t\t\ttransition_in(cartitem.$$.fragment, local);\n\t\t\tcurrent = true;\n\t\t},\n\t\to(local) {\n\t\t\ttransition_out(cartitem.$$.fragment, local);\n\t\t\tcurrent = false;\n\t\t},\n\t\td(detaching) {\n\t\t\tif (detaching) detach(tr);\n\t\t\tdestroy_component(cartitem);\n\t\t\tmounted = false;\n\t\t\tdispose();\n\t\t}\n\t};\n}\n\n// (130:6) {#if checkout && cartHasItems()}\nfunction create_if_block_1(ctx) {\n\tlet cartcheckout;\n\tlet current;\n\n\tcartcheckout = new CartCheckout({\n\t\t\tprops: {\n\t\t\t\tcheckout: /*checkout*/ ctx[0],\n\t\t\t\tcheckoutId: /*checkoutId*/ ctx[1]\n\t\t\t}\n\t\t});\n\n\treturn {\n\t\tc() {\n\t\t\tcreate_component(cartcheckout.$$.fragment);\n\t\t},\n\t\tm(target, anchor) {\n\t\t\tmount_component(cartcheckout, target, anchor);\n\t\t\tcurrent = true;\n\t\t},\n\t\tp(ctx, dirty) {\n\t\t\tconst cartcheckout_changes = {};\n\t\t\tif (dirty & /*checkout*/ 1) cartcheckout_changes.checkout = /*checkout*/ ctx[0];\n\t\t\tif (dirty & /*checkoutId*/ 2) cartcheckout_changes.checkoutId = /*checkoutId*/ ctx[1];\n\t\t\tcartcheckout.$set(cartcheckout_changes);\n\t\t},\n\t\ti(local) {\n\t\t\tif (current) return;\n\t\t\ttransition_in(cartcheckout.$$.fragment, local);\n\t\t\tcurrent = true;\n\t\t},\n\t\to(local) {\n\t\t\ttransition_out(cartcheckout.$$.fragment, local);\n\t\t\tcurrent = false;\n\t\t},\n\t\td(detaching) {\n\t\t\tdestroy_component(cartcheckout, detaching);\n\t\t}\n\t};\n}\n\nfunction create_fragment(ctx) {\n\tlet navbar;\n\tlet t0;\n\tlet div;\n\tlet main;\n\tlet h1;\n\tlet show_if_1;\n\tlet show_if_2;\n\tlet t1;\n\tlet show_if = /*checkout*/ ctx[0] && /*cartHasItems*/ ctx[5]();\n\tlet t2;\n\tlet footer;\n\tlet t3;\n\tlet modal_1;\n\tlet current;\n\tnavbar = new NavBar({});\n\n\tfunction select_block_type(ctx, dirty) {\n\t\tif (dirty & /*checkout*/ 1) show_if_1 = null;\n\t\tif (dirty & /*checkout*/ 1) show_if_2 = null;\n\t\tif (show_if_1 == null) show_if_1 = !!(/*checkout*/ ctx[0] && /*cartHasItems*/ ctx[5]());\n\t\tif (show_if_1) return create_if_block_2;\n\t\tif (show_if_2 == null) show_if_2 = !!(/*checkout*/ ctx[0] && !/*cartHasItems*/ ctx[5]());\n\t\tif (show_if_2) return create_if_block_3;\n\t\tif (!/*checkout*/ ctx[0]) return create_if_block_4;\n\t}\n\n\tlet current_block_type = select_block_type(ctx, -1);\n\tlet if_block0 = current_block_type && current_block_type(ctx);\n\tlet if_block1 = show_if && create_if_block(ctx);\n\tfooter = new Footer({});\n\n\tmodal_1 = new Modal({\n\t\t\tprops: {\n\t\t\t\tshow: /*$modal*/ ctx[2],\n\t\t\t\tcloseButton: true\n\t\t\t}\n\t\t});\n\n\tmodal_1.$on(\"closed\", /*handleModalClosed*/ ctx[6]);\n\n\treturn {\n\t\tc() {\n\t\t\tcreate_component(navbar.$$.fragment);\n\t\t\tt0 = space();\n\t\t\tdiv = element(\"div\");\n\t\t\tmain = element(\"main\");\n\t\t\th1 = element(\"h1\");\n\t\t\tif (if_block0) if_block0.c();\n\t\t\tt1 = space();\n\t\t\tif (if_block1) if_block1.c();\n\t\t\tt2 = space();\n\t\t\tcreate_component(footer.$$.fragment);\n\t\t\tt3 = space();\n\t\t\tcreate_component(modal_1.$$.fragment);\n\t\t\tattr(h1, \"class\", \"cart-title centered-text svelte-izgz8u\");\n\t\t\tattr(main, \"class\", \"cart-main svelte-izgz8u\");\n\t\t\tattr(div, \"class\", \"cart svelte-izgz8u\");\n\t\t},\n\t\tm(target, anchor) {\n\t\t\tmount_component(navbar, target, anchor);\n\t\t\tinsert(target, t0, anchor);\n\t\t\tinsert(target, div, anchor);\n\t\t\tappend(div, main);\n\t\t\tappend(main, h1);\n\t\t\tif (if_block0) if_block0.m(h1, null);\n\t\t\tappend(main, t1);\n\t\t\tif (if_block1) if_block1.m(main, null);\n\t\t\tinsert(target, t2, anchor);\n\t\t\tmount_component(footer, target, anchor);\n\t\t\tinsert(target, t3, anchor);\n\t\t\tmount_component(modal_1, target, anchor);\n\t\t\tcurrent = true;\n\t\t},\n\t\tp(ctx, [dirty]) {\n\t\t\tif (current_block_type !== (current_block_type = select_block_type(ctx, dirty))) {\n\t\t\t\tif (if_block0) if_block0.d(1);\n\t\t\t\tif_block0 = current_block_type && current_block_type(ctx);\n\n\t\t\t\tif (if_block0) {\n\t\t\t\t\tif_block0.c();\n\t\t\t\t\tif_block0.m(h1, null);\n\t\t\t\t}\n\t\t\t}\n\n\t\t\tif (dirty & /*checkout*/ 1) show_if = /*checkout*/ ctx[0] && /*cartHasItems*/ ctx[5]();\n\n\t\t\tif (show_if) {\n\t\t\t\tif (if_block1) {\n\t\t\t\t\tif_block1.p(ctx, dirty);\n\n\t\t\t\t\tif (dirty & /*checkout*/ 1) {\n\t\t\t\t\t\ttransition_in(if_block1, 1);\n\t\t\t\t\t}\n\t\t\t\t} else {\n\t\t\t\t\tif_block1 = create_if_block(ctx);\n\t\t\t\t\tif_block1.c();\n\t\t\t\t\ttransition_in(if_block1, 1);\n\t\t\t\t\tif_block1.m(main, null);\n\t\t\t\t}\n\t\t\t} else if (if_block1) {\n\t\t\t\tgroup_outros();\n\n\t\t\t\ttransition_out(if_block1, 1, 1, () => {\n\t\t\t\t\tif_block1 = null;\n\t\t\t\t});\n\n\t\t\t\tcheck_outros();\n\t\t\t}\n\n\t\t\tconst modal_1_changes = {};\n\t\t\tif (dirty & /*$modal*/ 4) modal_1_changes.show = /*$modal*/ ctx[2];\n\t\t\tmodal_1.$set(modal_1_changes);\n\t\t},\n\t\ti(local) {\n\t\t\tif (current) return;\n\t\t\ttransition_in(navbar.$$.fragment, local);\n\t\t\ttransition_in(if_block1);\n\t\t\ttransition_in(footer.$$.fragment, local);\n\t\t\ttransition_in(modal_1.$$.fragment, local);\n\t\t\tcurrent = true;\n\t\t},\n\t\to(local) {\n\t\t\ttransition_out(navbar.$$.fragment, local);\n\t\t\ttransition_out(if_block1);\n\t\t\ttransition_out(footer.$$.fragment, local);\n\t\t\ttransition_out(modal_1.$$.fragment, local);\n\t\t\tcurrent = false;\n\t\t},\n\t\td(detaching) {\n\t\t\tdestroy_component(navbar, detaching);\n\t\t\tif (detaching) detach(t0);\n\t\t\tif (detaching) detach(div);\n\n\t\t\tif (if_block0) {\n\t\t\t\tif_block0.d();\n\t\t\t}\n\n\t\t\tif (if_block1) if_block1.d();\n\t\t\tif (detaching) detach(t2);\n\t\t\tdestroy_component(footer, detaching);\n\t\t\tif (detaching) detach(t3);\n\t\t\tdestroy_component(modal_1, detaching);\n\t\t}\n\t};\n}\n\nfunction displayMoneyAmount(moneyAmount) {\n\treturn parseFloat(moneyAmount).toFixed(2).toString();\n}\n\nfunction instance($$self, $$props, $$invalidate) {\n\tlet $modal;\n\tcomponent_subscribe($$self, modal, $$value => $$invalidate(2, $modal = $$value));\n\tlet checkout;\n\tlet checkoutId;\n\n\tonMount(async () => {\n\t\t$$invalidate(1, checkoutId = getSavedCheckoutId());\n\t\t$$invalidate(0, checkout = await api.getCheckout(checkoutId));\n\t\tconsole.log(checkout);\n\t});\n\n\tasync function removeFromCheckout(lineItemEdge) {\n\t\ttry {\n\t\t\tlet res = await api.removeFromCheckout(checkoutId, [lineItemEdge.node.id]);\n\t\t\t$$invalidate(0, checkout.data.node.lineItems.edges = checkout.data.node.lineItems.edges.filter(edge => edge !== lineItemEdge), checkout);\n\t\t\t$$invalidate(0, checkout);\n\t\t\tcartItemCount.set(checkout.data.node.lineItems.edges.length);\n\t\t\tupdateSubtotal();\n\t\t\tconsole.log(res);\n\t\t} catch(err) {\n\t\t\tconsole.log(err);\n\t\t}\n\t}\n\n\tfunction handleRemoveCartItem(event) {\n\t\tremoveFromCheckout(event.detail.checkoutItem);\n\t}\n\n\tasync function updateLineItemQuantity(lineItemEdge, newQuantity) {\n\t\ttry {\n\t\t\tif (newQuantity == 0) {\n\t\t\t\tremoveFromCheckout(lineItemEdge);\n\t\t\t} else if (newQuantity < 0) {\n\t\t\t\talert('Please enter a quantity larger than 0!');\n\t\t\t\treturn;\n\t\t\t}\n\n\t\t\tlet theme = lineItemEdge.node.customAttributes.find(customAttribute => customAttribute.key == \"_theme\").value;\n\t\t\tlet videoUrl = lineItemEdge.node.customAttributes.find(customAttribute => customAttribute.key == \"_videoUrl\").value;\n\t\t\tlet photoUrl = lineItemEdge.node.customAttributes.find(customAttribute => customAttribute.key == \"_photoUrl\").value;\n\t\t\tlet res = await api.updateCheckoutLineItem(checkoutId, lineItemEdge.node.id, lineItemEdge.node.quantity = newQuantity, theme, lineItemEdge.node.variant.id, photoUrl, videoUrl);\n\t\t\t$$invalidate(0, checkout);\n\t\t\tupdateSubtotal();\n\t\t\tconsole.log(res);\n\t\t} catch(err) {\n\t\t\tconsole.log(err);\n\t\t}\n\t}\n\n\tfunction updateSubtotal() {\n\t\tlet cartTotal = 0;\n\n\t\tcheckout.data.node.lineItems.edges.forEach(lineItemEdge => {\n\t\t\tlet productTotal = lineItemEdge.node.variant.price * lineItemEdge.node.quantity;\n\t\t\tcartTotal += productTotal;\n\t\t});\n\n\t\t$$invalidate(0, checkout.data.node.subtotalPrice = cartTotal.toFixed(2).toString(), checkout);\n\t}\n\n\tfunction cartHasItems() {\n\t\tif (checkout.data.node.lineItems.edges.length > 0) {\n\t\t\treturn true;\n\t\t} else {\n\t\t\treturn false;\n\t\t}\n\t}\n\n\tasync function handleModalClosed() {\n\t\tmodal.set();\n\t}\n\n\treturn [\n\t\tcheckout,\n\t\tcheckoutId,\n\t\t$modal,\n\t\thandleRemoveCartItem,\n\t\tupdateLineItemQuantity,\n\t\tcartHasItems,\n\t\thandleModalClosed\n\t];\n}\n\nclass Cart extends SvelteComponent {\n\tconstructor(options) {\n\t\tsuper();\n\t\tinit(this, options, instance, create_fragment, safe_not_equal, {});\n\t}\n}\n\nexport default Cart;", "import './TermsAndConditions.svelte.css';\n/* src/screens/TermsAndConditions.svelte generated by Svelte v3.59.2 */\nimport {\n\tSvelteComponent,\n\tattr,\n\tcreate_component,\n\tdestroy_component,\n\tdetach,\n\telement,\n\tinit,\n\tinsert,\n\tmount_component,\n\tnoop,\n\tsafe_not_equal,\n\tspace,\n\ttransition_in,\n\ttransition_out\n} from \"../../_snowpack/pkg/svelte/internal.js\";\n\nimport NavBar from \"../components/NavBar.svelte.js\";\nimport Footer from \"../components/Footer.svelte.js\";\n\nfunction create_fragment(ctx) {\n\tlet navbar;\n\tlet t0;\n\tlet div;\n\tlet t54;\n\tlet footer;\n\tlet current;\n\tnavbar = new NavBar({});\n\tfooter = new Footer({});\n\n\treturn {\n\t\tc() {\n\t\t\tcreate_component(navbar.$$.fragment);\n\t\t\tt0 = space();\n\t\t\tdiv = element(\"div\");\n\n\t\t\tdiv.innerHTML = `<h1>Terms and conditions</h1> \n  <p>These terms and conditions (&quot;Agreement&quot;) set forth the general terms and conditions of your use of the mypetar.com website (&quot;Website&quot; or &quot;Service&quot;) and any of its related products and services (collectively, &quot;Services&quot;). This Agreement is legally binding between you (&quot;User&quot;, &quot;you&quot; or &quot;your&quot;) and Pro Exp Media Inc. (&quot;Pro Exp Media Inc.&quot;, &quot;we&quot;, &quot;us&quot; or &quot;our&quot;). By accessing and using the Website and Services, you acknowledge that you have read, understood, and agree to be bound by the terms of this Agreement. If you are entering into this Agreement on behalf of a business or other legal entity, you represent that you have the authority to bind such entity to this Agreement, in which case the terms &quot;User&quot;, &quot;you&quot; or &quot;your&quot; shall refer to such entity. If you do not have such authority, or if you do not agree with the terms of this Agreement, you must not accept this Agreement and may not access and use the Website and Services. You acknowledge that this Agreement is a contract between you and Pro Exp Media Inc., even though it is electronic and is not physically signed by you, and it governs your use of the Website and Services.</p> \n\n  <h2>Billing and payments</h2> \n  <p>You shall pay all fees or charges to your account in accordance with the fees, charges, and billing terms in effect at the time a fee or charge is due and payable. If, in our judgment, your purchase constitutes a high-risk transaction, we will require you to provide us with a copy of your valid government-issued photo identification, and possibly a copy of a recent bank statement for the credit or debit card used for the purchase. We reserve the right to change products and product pricing at any time. We also reserve the right to refuse any order you place with us. We may, in our sole discretion, limit or cancel quantities purchased per person, per household or per order. These restrictions may include orders placed by or under the same customer account, the same credit card, and/or orders that use the same billing and/or shipping address. In the event that we make a change to or cancel an order, we may attempt to notify you by contacting the e-mail and/or billing address/phone number provided at the time the order was made.</p> \n\n  <h2>Accuracy of information</h2> \n  <p>Occasionally there may be information on the Website that contains typographical errors, inaccuracies or omissions that may relate to promotions and offers. We reserve the right to correct any errors, inaccuracies or omissions, and to change or update information or cancel orders if any information on the Website or Services is inaccurate at any time without prior notice (including after you have submitted your order). We undertake no obligation to update, amend or clarify information on the Website including, without limitation, pricing information, except as required by law. No specified update or refresh date applied on the Website should be taken to indicate that all information on the Website or Services has been modified or updated.</p> \n\n  <h2>Links to other resources</h2> \n  <p>Although the Website and Services may link to other resources (such as websites, mobile applications, etc.), we are not, directly or indirectly, implying any approval, association, sponsorship, endorsement, or affiliation with any linked resource, unless specifically stated herein. We are not responsible for examining or evaluating, and we do not warrant the offerings of, any businesses or individuals or the content of their resources. We do not assume any responsibility or liability for the actions, products, services, and content of any other third parties. You should carefully review the legal statements and other conditions of use of any resource which you access through a link on the Website and Services. Your linking to any other off-site resources is at your own risk.</p> \n\n  <h2>Prohibited uses</h2> \n  <p>In addition to other terms as set forth in the Agreement, you are prohibited from using the Website and Services or Content: (a) for any unlawful purpose; (b) to solicit others to perform or participate in any unlawful acts; (c) to violate any international, federal, provincial or state regulations, rules, laws, or local ordinances; (d) to infringe upon or violate our intellectual property rights or the intellectual property rights of others; (e) to harass, abuse, insult, harm, defame, slander, disparage, intimidate, or discriminate based on gender, sexual orientation, religion, ethnicity, race, age, national origin, or disability; (f) to submit false or misleading information; (g) to upload or transmit viruses or any other type of malicious code that will or may be used in any way that will affect the functionality or operation of the Website and Services, third party products and services, or the Internet; (h) to spam, phish, pharm, pretext, spider, crawl, or scrape; (i) for any obscene or immoral purpose; or (j) to interfere with or circumvent the security features of the Website and Services, third party products and services, or the Internet. We reserve the right to terminate your use of the Website and Services for violating any of the prohibited uses.</p> \n\n  <h2>Intellectual property rights</h2> \n  <p>&quot;Intellectual Property Rights&quot; means all present and future rights conferred by statute, common law or equity in or in relation to any copyright and related rights, trademarks, designs, patents, inventions, goodwill and the right to sue for passing off, rights to inventions, rights to use, and all other intellectual property rights, in each case whether registered or unregistered and including all applications and rights to apply for and be granted, rights to claim priority from, such rights and all similar or equivalent rights or forms of protection and any other results of intellectual activity which subsist or will subsist now or in the future in any part of the world. This Agreement does not transfer to you any intellectual property owned by Pro Exp Media Inc. or third parties, and all rights, titles, and interests in and to such property will remain (as between the parties) solely with Pro Exp Media Inc. All trademarks, service marks, graphics and logos used in connection with the Website and Services, are trademarks or registered trademarks of Pro Exp Media Inc. or its licensors. Other trademarks, service marks, graphics and logos used in connection with the Website and Services may be the trademarks of other third parties. Your use of the Website and Services grants you no right or license to reproduce or otherwise use any of Pro Exp Media Inc. or third party trademarks.</p> \n\n  <h2>Disclaimer of warranty</h2> \n  <p>You agree that such Service is provided on an &quot;as is&quot; and &quot;as available&quot; basis and that your use of the Website and Services is solely at your own risk. We expressly disclaim all warranties of any kind, whether express or implied, including but not limited to the implied warranties of merchantability, fitness for a particular purpose and non-infringement. We make no warranty that the Services will meet your requirements, or that the Service will be uninterrupted, timely, secure, or error-free; nor do we make any warranty as to the results that may be obtained from the use of the Service or as to the accuracy or reliability of any information obtained through the Service or that defects in the Service will be corrected. You understand and agree that any material and/or data downloaded or otherwise obtained through the use of Service is done at your own discretion and risk and that you will be solely responsible for any damage or loss of data that results from the download of such material and/or data. We make no warranty regarding any goods or services purchased or obtained through the Service or any transactions entered into through the Service unless stated otherwise. No advice or information, whether oral or written, obtained by you from us or through the Service shall create any warranty not expressly made herein.</p> \n\n  <h2>Limitation of liability</h2> \n  <p>To the fullest extent permitted by applicable law, in no event will Pro Exp Media Inc., its affiliates, directors, officers, employees, agents, suppliers or licensors be liable to any person for any indirect, incidental, special, punitive, cover or consequential damages (including, without limitation, damages for lost profits, revenue, sales, goodwill, use of content, impact on business, business interruption, loss of anticipated savings, loss of business opportunity) however caused, under any theory of liability, including, without limitation, contract, tort, warranty, breach of statutory duty, negligence or otherwise, even if the liable party has been advised as to the possibility of such damages or could have foreseen such damages. To the maximum extent permitted by applicable law, the aggregate liability of Pro Exp Media Inc. and its affiliates, officers, employees, agents, suppliers and licensors relating to the services will be limited to an amount greater of one dollar or any amounts actually paid in cash by you to Pro Exp Media Inc. for the prior one month period prior to the first event or occurrence giving rise to such liability. The limitations and exclusions also apply if this remedy does not fully compensate you for any losses or fails of its essential purpose.</p> \n\n  <h2>Indemnification</h2> \n  <p>You agree to indemnify and hold Pro Exp Media Inc. and its affiliates, directors, officers, employees, agents, suppliers and licensors harmless from and against any liabilities, losses, damages or costs, including reasonable attorneys’ fees, incurred in connection with or arising from any third party allegations, claims, actions, disputes, or demands asserted against any of them as a result of or relating to your Content, your use of the Website and Services or any willful misconduct on your part.</p> \n\n  <h2>Dispute resolution</h2> \n  <p>The formation, interpretation, and performance of this Agreement and any disputes arising out of it shall be governed by the substantive and procedural laws of British Columbia, Canada without regard to its rules on conflicts or choice of law and, to the extent applicable, the laws of Canada. The exclusive jurisdiction and venue for actions related to the subject matter hereof shall be the courts located in British Columbia, Canada, and you hereby submit to the personal jurisdiction of such courts. You hereby waive any right to a jury trial in any proceeding arising out of or related to this Agreement. The United Nations Convention on Contracts for the International Sale of Goods does not apply to this Agreement.</p> \n\n  <h2>Changes and amendments</h2> \n  <p>We reserve the right to modify this Agreement or its terms relating to the Website and Services at any time, effective upon posting of an updated version of this Agreement on the Website. When we do, we will revise the updated date at the bottom of this page. Continued use of the Website and Services after any such changes shall constitute your consent to such changes.</p> \n\n  <h2>Acceptance of these terms</h2> \n  <p>You acknowledge that you have read this Agreement and agree to all its terms and conditions. By accessing and using the Website and Services you agree to be bound by this Agreement. If you do not agree to abide by the terms of this Agreement, you are not authorized to access or use the Website and Services.</p> \n\n  <h2>Contacting us</h2> \n  <p>If you would like to contact us to understand more about this Agreement or wish to contact us concerning any matter relating to it, you may send an email to info@proexp.net.</p> \n\n  <p>This document was last updated on July 13, 2021</p>`;\n\n\t\t\tt54 = space();\n\t\t\tcreate_component(footer.$$.fragment);\n\t\t\tattr(div, \"class\", \"container svelte-t8979s\");\n\t\t},\n\t\tm(target, anchor) {\n\t\t\tmount_component(navbar, target, anchor);\n\t\t\tinsert(target, t0, anchor);\n\t\t\tinsert(target, div, anchor);\n\t\t\tinsert(target, t54, anchor);\n\t\t\tmount_component(footer, target, anchor);\n\t\t\tcurrent = true;\n\t\t},\n\t\tp: noop,\n\t\ti(local) {\n\t\t\tif (current) return;\n\t\t\ttransition_in(navbar.$$.fragment, local);\n\t\t\ttransition_in(footer.$$.fragment, local);\n\t\t\tcurrent = true;\n\t\t},\n\t\to(local) {\n\t\t\ttransition_out(navbar.$$.fragment, local);\n\t\t\ttransition_out(footer.$$.fragment, local);\n\t\t\tcurrent = false;\n\t\t},\n\t\td(detaching) {\n\t\t\tdestroy_component(navbar, detaching);\n\t\t\tif (detaching) detach(t0);\n\t\t\tif (detaching) detach(div);\n\t\t\tif (detaching) detach(t54);\n\t\t\tdestroy_component(footer, detaching);\n\t\t}\n\t};\n}\n\nclass TermsAndConditions extends SvelteComponent {\n\tconstructor(options) {\n\t\tsuper();\n\t\tinit(this, options, null, create_fragment, safe_not_equal, {});\n\t}\n}\n\nexport default TermsAndConditions;", "import './ReturnPolicy.svelte.css';\n/* src/screens/ReturnPolicy.svelte generated by Svelte v3.59.2 */\nimport {\n\tSvelteComponent,\n\tattr,\n\tcreate_component,\n\tdestroy_component,\n\tdetach,\n\telement,\n\tinit,\n\tinsert,\n\tmount_component,\n\tnoop,\n\tsafe_not_equal,\n\tspace,\n\ttransition_in,\n\ttransition_out\n} from \"../../_snowpack/pkg/svelte/internal.js\";\n\nimport NavBar from \"../components/NavBar.svelte.js\";\nimport Footer from \"../components/Footer.svelte.js\";\n\nfunction create_fragment(ctx) {\n\tlet navbar;\n\tlet t0;\n\tlet div;\n\tlet t14;\n\tlet footer;\n\tlet current;\n\tnavbar = new NavBar({});\n\tfooter = new Footer({});\n\n\treturn {\n\t\tc() {\n\t\t\tcreate_component(navbar.$$.fragment);\n\t\t\tt0 = space();\n\t\t\tdiv = element(\"div\");\n\n\t\t\tdiv.innerHTML = `<h1>Return policy</h1> \n  <p>We’re so convinced you’ll absolutely love our products, that we’re willing to offer a 30 day risk free money back guarantee. If you receive your order and are not satisfied for any reason you can return the product for a refund within 30 days of making a purchase.</p> \n\n  <h2>Shipping items</h2> \n  <p>In order to return an order, you must contact us first and obtain and include a Return Merchandise Authorization (RMA). Returns will not be accepted without a valid Return Merchandise Authorization.\n    Returns can be mailed to: 223-21300 Gordon Way, Richmond BC V6W 1M2. You will be responsible for paying for the shipping costs with regard to the items that you wish to return. We will not refund the shipping costs.\n    You must take care to ensure that the goods are properly packaged so that they will not be damaged while in transit. If the product is found damaged or used beyond what it takes for us to reasonably inspect it, then we may reject a refund.\n    All refunds may be subject to a 20% restocking fee.</p> \n\n  <h2>Contacting us</h2> \n  <p>If you would like to contact us concerning any matter relating to this Return Policy, you may send an email to customerservice@mypetar.com</p> \n\n  <p>This document was last updated on July 13, 2021</p>`;\n\n\t\t\tt14 = space();\n\t\t\tcreate_component(footer.$$.fragment);\n\t\t\tattr(div, \"class\", \"container svelte-t8979s\");\n\t\t},\n\t\tm(target, anchor) {\n\t\t\tmount_component(navbar, target, anchor);\n\t\t\tinsert(target, t0, anchor);\n\t\t\tinsert(target, div, anchor);\n\t\t\tinsert(target, t14, anchor);\n\t\t\tmount_component(footer, target, anchor);\n\t\t\tcurrent = true;\n\t\t},\n\t\tp: noop,\n\t\ti(local) {\n\t\t\tif (current) return;\n\t\t\ttransition_in(navbar.$$.fragment, local);\n\t\t\ttransition_in(footer.$$.fragment, local);\n\t\t\tcurrent = true;\n\t\t},\n\t\to(local) {\n\t\t\ttransition_out(navbar.$$.fragment, local);\n\t\t\ttransition_out(footer.$$.fragment, local);\n\t\t\tcurrent = false;\n\t\t},\n\t\td(detaching) {\n\t\t\tdestroy_component(navbar, detaching);\n\t\t\tif (detaching) detach(t0);\n\t\t\tif (detaching) detach(div);\n\t\t\tif (detaching) detach(t14);\n\t\t\tdestroy_component(footer, detaching);\n\t\t}\n\t};\n}\n\nclass ReturnPolicy extends SvelteComponent {\n\tconstructor(options) {\n\t\tsuper();\n\t\tinit(this, options, null, create_fragment, safe_not_equal, {});\n\t}\n}\n\nexport default ReturnPolicy;", "import './PrivacyPolicy.svelte.css';\n/* src/screens/PrivacyPolicy.svelte generated by Svelte v3.59.2 */\nimport {\n\tSvelteComponent,\n\tattr,\n\tcreate_component,\n\tdestroy_component,\n\tdetach,\n\telement,\n\tinit,\n\tinsert,\n\tmount_component,\n\tnoop,\n\tsafe_not_equal,\n\tspace,\n\ttransition_in,\n\ttransition_out\n} from \"../../_snowpack/pkg/svelte/internal.js\";\n\nimport NavBar from \"../components/NavBar.svelte.js\";\nimport Footer from \"../components/Footer.svelte.js\";\n\nfunction create_fragment(ctx) {\n\tlet navbar;\n\tlet t0;\n\tlet div;\n\tlet t102;\n\tlet footer;\n\tlet current;\n\tnavbar = new NavBar({});\n\tfooter = new Footer({});\n\n\treturn {\n\t\tc() {\n\t\t\tcreate_component(navbar.$$.fragment);\n\t\t\tt0 = space();\n\t\t\tdiv = element(\"div\");\n\n\t\t\tdiv.innerHTML = `<h1>Privacy policy</h1> \n  <p>This privacy policy (&quot;Policy&quot;) describes how the personally identifiable information (&quot;Personal Information&quot;) you may provide on the mypetar.com website (&quot;Website&quot; or &quot;Service&quot;) and any of its related products and services (collectively, &quot;Services&quot;) is collected, protected and used. It also describes the choices available to you regarding our use of your Personal Information and how you can access and update this information. This Policy is a legally binding agreement between you (&quot;User&quot;, &quot;you&quot; or &quot;your&quot;) and Pro Exp Media Inc. (&quot;Pro Exp Media Inc.&quot;, &quot;we&quot;, &quot;us&quot; or &quot;our&quot;). By accessing and using the Website and Services, you acknowledge that you have read, understood, and agree to be bound by the terms of this Policy. This Policy does not apply to the practices of companies that we do not own or control, or to individuals that we do not employ or manage.</p> \n\n  <h2>Automatic collection of information</h2> \n  <p>Our top priority is customer data security and, as such, we exercise the no logs policy. We may process only minimal user data, only as much as it is absolutely necessary to maintain the Website and Services. Information collected automatically is used only to identify potential cases of abuse and establish statistical information regarding the usage and traffic of the Website and Services. This statistical information is not otherwise aggregated in such a way that would identify any particular user of the system.</p> \n\n  <h2>Collection of personal information</h2> \n  <p>You can access and use the Website and Services without telling us who you are or revealing any information by which someone could identify you as a specific, identifiable individual. If, however, you wish to use some of the features on the Website, you may be asked to provide certain Personal Information (for example, your name and e-mail address). We receive and store any information you knowingly provide to us when you make a purchase, or fill any online forms on the Website. When required, this information may include the following:</p> \n  <ul><li>Personal details such as name, country of residence, etc.</li> \n    <li>Contact information such as email address, address, etc.</li> \n    <li>Any other materials you willingly submit to us such as articles, images, feedback, etc.</li></ul> \n  <p>Some of the information we collect is directly from you via the Website and Services. However, we may also collect Personal Information about you from other sources such as public databases and our joint marketing partners. You can choose not to provide us with your Personal Information, but then you may not be able to take advantage of some of the features on the Website. Users who are uncertain about what information is mandatory are welcome to contact us.</p> \n\n  <h2>Use and processing of collected information</h2> \n  <p>In order to make the Website and Services available to you, or to meet a legal obligation, we may need to collect and use certain Personal Information. If you do not provide the information that we request, we may not be able to provide you with the requested products or services. Any of the information we collect from you may be used for the following purposes:</p> \n  <ul><li>Fulfill and manage orders</li> \n    <li>Deliver products or services</li> \n    <li>Send marketing and promotional communications</li> \n    <li>Respond to inquiries and offer support</li> \n    <li>Post customer testimonials</li> \n    <li>Run and operate the Website and Services</li></ul> \n  <p>Processing your Personal Information depends on how you interact with the Website and Services, where you are located in the world and if one of the following applies: (i) you have given your consent for one or more specific purposes; this, however, does not apply, whenever the processing of Personal Information is subject to California Consumer Privacy Act or European data protection law; (ii) provision of information is necessary for the performance of an agreement with you and/or for any pre-contractual obligations thereof; (iii) processing is necessary for compliance with a legal obligation to which you are subject; (iv) processing is related to a task that is carried out in the public interest or in the exercise of official authority vested in us; (v) processing is necessary for the purposes of the legitimate interests pursued by us or by a third party.</p> \n  <p>Note that under some legislations we may be allowed to process information until you object to such processing (by opting out), without having to rely on consent or any other of the following legal bases below. In any case, we will be happy to clarify the specific legal basis that applies to the processing, and in particular whether the provision of Personal Information is a statutory or contractual requirement, or a requirement necessary to enter into a contract.</p> \n\n  <h2>Billing and payments</h2> \n  <p>In case of services requiring payment, we request credit card or other payment account information, which will be used solely for processing payments. Your purchase transaction data is stored only as long as is necessary to complete your purchase transaction. After that is complete, your purchase transaction information is deleted. All direct payment gateways adhere to the latest security standards as managed by the PCI Security Standards Council, which is a joint effort of brands like Visa, MasterCard, American Express and Discover. Sensitive and private data exchange happens over a SSL secured communication channel and is encrypted and protected with digital signatures, and the Website and Services are also in compliance with PCI vulnerability standards in order to create as secure of an environment as possible for Users. Scans for malware are performed on a regular basis for additional security and protection.</p> \n\n  <h2>Disclosure of information</h2> \n  <p>Depending on the requested Services or as necessary to complete any transaction or provide any service you have requested, we may share your information with your consent with our trusted third parties that work with us, any other affiliates and subsidiaries we rely upon to assist in the operation of the Website and Services available to you. We do not share Personal Information with unaffiliated third parties. These service providers are not authorized to use or disclose your information except as necessary to perform services on our behalf or comply with legal requirements. We may share your Personal Information for these purposes only with third parties whose privacy policies are consistent with ours or who agree to abide by our policies with respect to Personal Information. These third parties are given Personal Information they need only in order to perform their designated functions, and we do not authorize them to use or disclose Personal Information for their own marketing or other purposes.</p> \n  <p>We will disclose any Personal Information we collect, use or receive if required or permitted by law, such as to comply with a subpoena, or similar legal process, and when we believe in good faith that disclosure is necessary to protect our rights, protect your safety or the safety of others, investigate fraud, or respond to a government request.</p> \n  <p>In the event we go through a business transition, such as a merger or acquisition by another company, or sale of all or a portion of its assets, your user account, and Personal Information will likely be among the assets transferred.</p> \n\n  <h2>Retention of information</h2> \n  <p>We will retain and use your Personal Information for the period necessary to comply with our legal obligations, resolve disputes, and enforce our agreements unless a longer retention period is required or permitted by law. We may use any aggregated data derived from or incorporating your Personal Information after you update or delete it, but not in a manner that would identify you personally. Once the retention period expires, Personal Information shall be deleted. Therefore, the right to access, the right to erasure, the right to rectification and the right to data portability cannot be enforced after the expiration of the retention period.</p> \n\n  <h2>The rights of users</h2> \n  <p>You may exercise certain rights regarding your information processed by us. In particular, you have the right to do the following: (i) you have the right to withdraw consent where you have previously given your consent to the processing of your information; (ii) you have the right to object to the processing of your information if the processing is carried out on a legal basis other than consent; (iii) you have the right to learn if information is being processed by us, obtain disclosure regarding certain aspects of the processing and obtain a copy of the information undergoing processing; (iv) you have the right to verify the accuracy of your information and ask for it to be updated or corrected; (v) you have the right, under certain circumstances, to restrict the processing of your information, in which case, we will not process your information for any purpose other than storing it; (vi) you have the right, under certain circumstances, to obtain the erasure of your Personal Information from us; (vii) you have the right to receive your information in a structured, commonly used and machine readable format and, if technically feasible, to have it transmitted to another controller without any hindrance. This provision is applicable provided that your information is processed by automated means and that the processing is based on your consent, on a contract which you are part of or on pre-contractual obligations thereof.</p> \n\n  <h2>California privacy rights</h2> \n  <p>In addition to the rights as explained in this Policy, California residents who provide Personal Information (as defined in the statute) to obtain products or services for personal, family, or household use are entitled to request and obtain from us, once a calendar year, information about the Personal Information we shared, if any, with other businesses for marketing uses. If applicable, this information would include the categories of Personal Information and the names and addresses of those businesses with which we shared such personal information for the immediately prior calendar year (e.g., requests made in the current year will receive information about the prior year). To obtain this information please contact us.</p> \n\n  <h2>How to exercise these rights</h2> \n  <p>Any requests to exercise your rights can be directed to Pro Exp Media Inc. through the contact details provided in this document. Please note that we may ask you to verify your identity before responding to such requests. Your request must provide sufficient information that allows us to verify that you are the person you are claiming to be or that you are the authorized representative of such person. You must include sufficient details to allow us to properly understand the request and respond to it. We cannot respond to your request or provide you with Personal Information unless we first verify your identity or authority to make such a request and confirm that the Personal Information relates to you.</p> \n\n  <h2>Privacy of children</h2> \n  <p>We do not knowingly collect any Personal Information from children under the age of 18. If you are under the age of 18, please do not submit any Personal Information through the Website and Services. We encourage parents and legal guardians to monitor their children&#39;s Internet usage and to help enforce this Policy by instructing their children never to provide Personal Information through the Website and Services without their permission. If you have reason to believe that a child under the age of 18 has provided Personal Information to us through the Website and Services, please contact us. You must also be old enough to consent to the processing of your Personal Information in your country (in some countries we may allow your parent or guardian to do so on your behalf).</p> \n\n  <h2>Do Not Track signals</h2> \n  <p>Some browsers incorporate a Do Not Track feature that signals to websites you visit that you do not want to have your online activity tracked. Tracking is not the same as using or collecting information in connection with a website. For these purposes, tracking refers to collecting personally identifiable information from consumers who use or visit a website or online service as they move across different websites over time. How browsers communicate the Do Not Track signal is not yet uniform. As a result, the Website and Services are not yet set up to interpret or respond to Do Not Track signals communicated by your browser. Even so, as described in more detail throughout this Policy, we limit our use and collection of your personal information.</p> \n\n  <h2>Links to other resources</h2> \n  <p>The Website and Services contain links to other resources that are not owned or controlled by us. Please be aware that we are not responsible for the privacy practices of such other resources or third parties. We encourage you to be aware when you leave the Website and Services and to read the privacy statements of each and every resource that may collect Personal Information.</p> \n\n  <h2>Information security</h2> \n  <p>We secure information you provide on computer servers in a controlled, secure environment, protected from unauthorized access, use, or disclosure. We maintain reasonable administrative, technical, and physical safeguards in an effort to protect against unauthorized access, use, modification, and disclosure of Personal Information in its control and custody. However, no data transmission over the Internet or wireless network can be guaranteed. Therefore, while we strive to protect your Personal Information, you acknowledge that (i) there are security and privacy limitations of the Internet which are beyond our control; (ii) the security, integrity, and privacy of any and all information and data exchanged between you and the Website and Services cannot be guaranteed; and (iii) any such information and data may be viewed or tampered with in transit by a third party, despite best efforts.</p> \n\n  <h2>Data breach</h2> \n  <p>In the event we become aware that the security of the Website and Services has been compromised or users Personal Information has been disclosed to unrelated third parties as a result of external activity, including, but not limited to, security attacks or fraud, we reserve the right to take reasonably appropriate measures, including, but not limited to, investigation and reporting, as well as notification to and cooperation with law enforcement authorities. In the event of a data breach, we will make reasonable efforts to notify affected individuals if we believe that there is a reasonable risk of harm to the user as a result of the breach or if notice is otherwise required by law. When we do, we will send you an email.</p> \n\n  <h2>Changes and amendments</h2> \n  <p>We reserve the right to modify this Policy or its terms relating to the Website and Services from time to time in our discretion and will notify you of any material changes to the way in which we treat Personal Information. When we do, we will revise the updated date at the bottom of this page. We may also provide notice to you in other ways in our discretion, such as through contact information you have provided. Any updated version of this Policy will be effective immediately upon the posting of the revised Policy unless otherwise specified. Your continued use of the Website and Services after the effective date of the revised Policy (or such other act specified at that time) will constitute your consent to those changes. However, we will not, without your consent, use your Personal Information in a manner materially different than what was stated at the time your Personal Information was collected.</p> \n\n  <h2>Acceptance of this policy</h2> \n  <p>You acknowledge that you have read this Policy and agree to all its terms and conditions. By accessing and using the Website and Services you agree to be bound by this Policy. If you do not agree to abide by the terms of this Policy, you are not authorized to access or use the Website and Services.</p> \n\n  <h2>Contacting us</h2> \n  <p>If you would like to contact us to understand more about this Policy or wish to contact us concerning any matter relating to individual rights and your Personal Information, you may send an email to info@proexp.net.</p> \n\n  <p>This document was last updated on July 13, 2021</p>`;\n\n\t\t\tt102 = space();\n\t\t\tcreate_component(footer.$$.fragment);\n\t\t\tattr(div, \"class\", \"container svelte-t8979s\");\n\t\t},\n\t\tm(target, anchor) {\n\t\t\tmount_component(navbar, target, anchor);\n\t\t\tinsert(target, t0, anchor);\n\t\t\tinsert(target, div, anchor);\n\t\t\tinsert(target, t102, anchor);\n\t\t\tmount_component(footer, target, anchor);\n\t\t\tcurrent = true;\n\t\t},\n\t\tp: noop,\n\t\ti(local) {\n\t\t\tif (current) return;\n\t\t\ttransition_in(navbar.$$.fragment, local);\n\t\t\ttransition_in(footer.$$.fragment, local);\n\t\t\tcurrent = true;\n\t\t},\n\t\to(local) {\n\t\t\ttransition_out(navbar.$$.fragment, local);\n\t\t\ttransition_out(footer.$$.fragment, local);\n\t\t\tcurrent = false;\n\t\t},\n\t\td(detaching) {\n\t\t\tdestroy_component(navbar, detaching);\n\t\t\tif (detaching) detach(t0);\n\t\t\tif (detaching) detach(div);\n\t\t\tif (detaching) detach(t102);\n\t\t\tdestroy_component(footer, detaching);\n\t\t}\n\t};\n}\n\nclass PrivacyPolicy extends SvelteComponent {\n\tconstructor(options) {\n\t\tsuper();\n\t\tinit(this, options, null, create_fragment, safe_not_equal, {});\n\t}\n}\n\nexport default PrivacyPolicy;", "import * as __SNOWPACK_ENV__ from '../../_snowpack/env.js';\n\nimport './AffiliateForm.svelte.css';\n/* src/components/AffiliateForm.svelte generated by Svelte v3.59.2 */\nimport {\n\tSvelteComponent,\n\tappend,\n\tattr,\n\tdetach,\n\telement,\n\tinit,\n\tinsert,\n\tlisten,\n\tnoop,\n\tprevent_default,\n\trun_all,\n\tsafe_not_equal,\n\tset_input_value,\n\tset_style,\n\tspace\n} from \"../../_snowpack/pkg/svelte/internal.js\";\n\nimport { createEventDispatcher } from \"../../_snowpack/pkg/svelte.js\";\n\nfunction create_fragment(ctx) {\n\tlet form;\n\tlet div0;\n\tlet label0;\n\tlet t1;\n\tlet input0;\n\tlet t2;\n\tlet div1;\n\tlet label1;\n\tlet t4;\n\tlet input1;\n\tlet t5;\n\tlet input2;\n\tlet t6;\n\tlet input3;\n\tlet t7;\n\tlet input4;\n\tlet t8;\n\tlet input5;\n\tlet t9;\n\tlet div2;\n\tlet label2;\n\tlet t11;\n\tlet input6;\n\tlet t12;\n\tlet div3;\n\tlet label3;\n\tlet t14;\n\tlet input7;\n\tlet t15;\n\tlet input8;\n\tlet t16;\n\tlet div4;\n\tlet label4;\n\tlet t18;\n\tlet input9;\n\tlet t19;\n\tlet div5;\n\tlet t23;\n\tlet input11;\n\tlet mounted;\n\tlet dispose;\n\n\treturn {\n\t\tc() {\n\t\t\tform = element(\"form\");\n\t\t\tdiv0 = element(\"div\");\n\t\t\tlabel0 = element(\"label\");\n\t\t\tlabel0.textContent = \"Name\";\n\t\t\tt1 = space();\n\t\t\tinput0 = element(\"input\");\n\t\t\tt2 = space();\n\t\t\tdiv1 = element(\"div\");\n\t\t\tlabel1 = element(\"label\");\n\t\t\tlabel1.textContent = \"Address\";\n\t\t\tt4 = space();\n\t\t\tinput1 = element(\"input\");\n\t\t\tt5 = space();\n\t\t\tinput2 = element(\"input\");\n\t\t\tt6 = space();\n\t\t\tinput3 = element(\"input\");\n\t\t\tt7 = space();\n\t\t\tinput4 = element(\"input\");\n\t\t\tt8 = space();\n\t\t\tinput5 = element(\"input\");\n\t\t\tt9 = space();\n\t\t\tdiv2 = element(\"div\");\n\t\t\tlabel2 = element(\"label\");\n\t\t\tlabel2.textContent = \"Email Address\";\n\t\t\tt11 = space();\n\t\t\tinput6 = element(\"input\");\n\t\t\tt12 = space();\n\t\t\tdiv3 = element(\"div\");\n\t\t\tlabel3 = element(\"label\");\n\t\t\tlabel3.textContent = \"Social Handles (Please include at least one)\";\n\t\t\tt14 = space();\n\t\t\tinput7 = element(\"input\");\n\t\t\tt15 = space();\n\t\t\tinput8 = element(\"input\");\n\t\t\tt16 = space();\n\t\t\tdiv4 = element(\"div\");\n\t\t\tlabel4 = element(\"label\");\n\t\t\tlabel4.textContent = \"Payouts are done via Paypal. Please include your Paypal address\";\n\t\t\tt18 = space();\n\t\t\tinput9 = element(\"input\");\n\t\t\tt19 = space();\n\t\t\tdiv5 = element(\"div\");\n\n\t\t\tdiv5.innerHTML = `<label style=\"font-weight: 400; font-size: 0.9em; margin-right: 12px; display: inline; flex-basis: auto;\" for=\"agree\" class=\"svelte-qcclo2\">I have read and agree to the <a href=\"/affiliate-agreement\">MyPetAR Affiliate Agreement</a></label> \n    <input required=\"\" style=\"margin: 0;\" id=\"agree\" type=\"checkbox\" class=\"svelte-qcclo2\"/>`;\n\n\t\t\tt23 = space();\n\t\t\tinput11 = element(\"input\");\n\t\t\tattr(label0, \"class\", \"required svelte-qcclo2\");\n\t\t\tattr(label0, \"for\", \"name\");\n\t\t\tinput0.required = true;\n\t\t\tattr(input0, \"class\", \"half svelte-qcclo2\");\n\t\t\tattr(input0, \"type\", \"text\");\n\t\t\tattr(input0, \"placeholder\", \"Name\");\n\t\t\tattr(input0, \"id\", \"name\");\n\t\t\tattr(div0, \"class\", \"svelte-qcclo2\");\n\t\t\tattr(label1, \"class\", \"required svelte-qcclo2\");\n\t\t\tattr(label1, \"for\", \"shop-street-1\");\n\t\t\tinput1.required = true;\n\t\t\tattr(input1, \"class\", \"full svelte-qcclo2\");\n\t\t\tattr(input1, \"id\", \"shop-street-1\");\n\t\t\tattr(input1, \"type\", \"text\");\n\t\t\tattr(input1, \"placeholder\", \"Street Address\");\n\t\t\tattr(input2, \"class\", \"full svelte-qcclo2\");\n\t\t\tattr(input2, \"type\", \"text\");\n\t\t\tattr(input2, \"placeholder\", \"Street Address Line 2\");\n\t\t\tinput3.required = true;\n\t\t\tattr(input3, \"class\", \"half svelte-qcclo2\");\n\t\t\tattr(input3, \"type\", \"text\");\n\t\t\tattr(input3, \"placeholder\", \"City\");\n\t\t\tinput4.required = true;\n\t\t\tattr(input4, \"class\", \"half svelte-qcclo2\");\n\t\t\tattr(input4, \"type\", \"text\");\n\t\t\tattr(input4, \"placeholder\", \"State / Province\");\n\t\t\tinput5.required = true;\n\t\t\tattr(input5, \"class\", \"full svelte-qcclo2\");\n\t\t\tattr(input5, \"type\", \"text\");\n\t\t\tattr(input5, \"placeholder\", \"Postal / Zip Code\");\n\t\t\tattr(div1, \"class\", \"svelte-qcclo2\");\n\t\t\tattr(label2, \"class\", \"required svelte-qcclo2\");\n\t\t\tattr(label2, \"for\", \"email\");\n\t\t\tinput6.required = true;\n\t\t\tattr(input6, \"class\", \"half svelte-qcclo2\");\n\t\t\tattr(input6, \"id\", \"email\");\n\t\t\tattr(input6, \"type\", \"email\");\n\t\t\tattr(input6, \"placeholder\", \"Email\");\n\t\t\tattr(div2, \"class\", \"svelte-qcclo2\");\n\t\t\tattr(label3, \"for\", \"instagram\");\n\t\t\tattr(label3, \"class\", \"required svelte-qcclo2\");\n\t\t\tattr(input7, \"class\", \"initial half svelte-qcclo2\");\n\t\t\tattr(input7, \"id\", \"instagram\");\n\t\t\tattr(input7, \"type\", \"text\");\n\t\t\tattr(input7, \"placeholder\", \"Instagram\");\n\t\t\tattr(input8, \"class\", \"half svelte-qcclo2\");\n\t\t\tattr(input8, \"id\", \"tiktok\");\n\t\t\tattr(input8, \"type\", \"text\");\n\t\t\tattr(input8, \"placeholder\", \"TikTok\");\n\t\t\tattr(div3, \"class\", \"svelte-qcclo2\");\n\t\t\tattr(label4, \"for\", \"referral\");\n\t\t\tattr(label4, \"class\", \"required svelte-qcclo2\");\n\t\t\tinput9.required = true;\n\t\t\tattr(input9, \"class\", \"full svelte-qcclo2\");\n\t\t\tattr(input9, \"id\", \"referral\");\n\t\t\tattr(input9, \"type\", \"text\");\n\t\t\tattr(input9, \"placeholder\", \"\");\n\t\t\tattr(div4, \"class\", \"svelte-qcclo2\");\n\t\t\tset_style(div5, \"justify-content\", \"end\");\n\t\t\tattr(div5, \"class\", \"svelte-qcclo2\");\n\t\t\tattr(input11, \"class\", \"submit svelte-qcclo2\");\n\t\t\tattr(input11, \"type\", \"submit\");\n\t\t\tinput11.value = \"SUBMIT\";\n\t\t\tattr(form, \"class\", \"svelte-qcclo2\");\n\t\t},\n\t\tm(target, anchor) {\n\t\t\tinsert(target, form, anchor);\n\t\t\tappend(form, div0);\n\t\t\tappend(div0, label0);\n\t\t\tappend(div0, t1);\n\t\t\tappend(div0, input0);\n\t\t\tset_input_value(input0, /*data*/ ctx[0].name);\n\t\t\tappend(form, t2);\n\t\t\tappend(form, div1);\n\t\t\tappend(div1, label1);\n\t\t\tappend(div1, t4);\n\t\t\tappend(div1, input1);\n\t\t\tset_input_value(input1, /*data*/ ctx[0].address_line_1);\n\t\t\tappend(div1, t5);\n\t\t\tappend(div1, input2);\n\t\t\tset_input_value(input2, /*data*/ ctx[0].address_line_2);\n\t\t\tappend(div1, t6);\n\t\t\tappend(div1, input3);\n\t\t\tset_input_value(input3, /*data*/ ctx[0].address_city);\n\t\t\tappend(div1, t7);\n\t\t\tappend(div1, input4);\n\t\t\tset_input_value(input4, /*data*/ ctx[0].address_state);\n\t\t\tappend(div1, t8);\n\t\t\tappend(div1, input5);\n\t\t\tset_input_value(input5, /*data*/ ctx[0].address_postal);\n\t\t\tappend(form, t9);\n\t\t\tappend(form, div2);\n\t\t\tappend(div2, label2);\n\t\t\tappend(div2, t11);\n\t\t\tappend(div2, input6);\n\t\t\tset_input_value(input6, /*data*/ ctx[0].email);\n\t\t\tappend(form, t12);\n\t\t\tappend(form, div3);\n\t\t\tappend(div3, label3);\n\t\t\tappend(div3, t14);\n\t\t\tappend(div3, input7);\n\t\t\tset_input_value(input7, /*data*/ ctx[0].instagram);\n\t\t\tappend(div3, t15);\n\t\t\tappend(div3, input8);\n\t\t\tset_input_value(input8, /*data*/ ctx[0].tiktok);\n\t\t\tappend(form, t16);\n\t\t\tappend(form, div4);\n\t\t\tappend(div4, label4);\n\t\t\tappend(div4, t18);\n\t\t\tappend(div4, input9);\n\t\t\tset_input_value(input9, /*data*/ ctx[0].paypal);\n\t\t\tappend(form, t19);\n\t\t\tappend(form, div5);\n\t\t\tappend(form, t23);\n\t\t\tappend(form, input11);\n\n\t\t\tif (!mounted) {\n\t\t\t\tdispose = [\n\t\t\t\t\tlisten(input0, \"input\", /*input0_input_handler*/ ctx[3]),\n\t\t\t\t\tlisten(input1, \"input\", /*input1_input_handler*/ ctx[4]),\n\t\t\t\t\tlisten(input2, \"input\", /*input2_input_handler*/ ctx[5]),\n\t\t\t\t\tlisten(input3, \"input\", /*input3_input_handler*/ ctx[6]),\n\t\t\t\t\tlisten(input4, \"input\", /*input4_input_handler*/ ctx[7]),\n\t\t\t\t\tlisten(input5, \"input\", /*input5_input_handler*/ ctx[8]),\n\t\t\t\t\tlisten(input6, \"input\", /*input6_input_handler*/ ctx[9]),\n\t\t\t\t\tlisten(input7, \"input\", /*input7_input_handler*/ ctx[10]),\n\t\t\t\t\tlisten(input8, \"input\", /*input8_input_handler*/ ctx[11]),\n\t\t\t\t\tlisten(input9, \"input\", /*input9_input_handler*/ ctx[12]),\n\t\t\t\t\tlisten(form, \"submit\", prevent_default(/*onSubmit*/ ctx[1]))\n\t\t\t\t];\n\n\t\t\t\tmounted = true;\n\t\t\t}\n\t\t},\n\t\tp(ctx, [dirty]) {\n\t\t\tif (dirty & /*data*/ 1 && input0.value !== /*data*/ ctx[0].name) {\n\t\t\t\tset_input_value(input0, /*data*/ ctx[0].name);\n\t\t\t}\n\n\t\t\tif (dirty & /*data*/ 1 && input1.value !== /*data*/ ctx[0].address_line_1) {\n\t\t\t\tset_input_value(input1, /*data*/ ctx[0].address_line_1);\n\t\t\t}\n\n\t\t\tif (dirty & /*data*/ 1 && input2.value !== /*data*/ ctx[0].address_line_2) {\n\t\t\t\tset_input_value(input2, /*data*/ ctx[0].address_line_2);\n\t\t\t}\n\n\t\t\tif (dirty & /*data*/ 1 && input3.value !== /*data*/ ctx[0].address_city) {\n\t\t\t\tset_input_value(input3, /*data*/ ctx[0].address_city);\n\t\t\t}\n\n\t\t\tif (dirty & /*data*/ 1 && input4.value !== /*data*/ ctx[0].address_state) {\n\t\t\t\tset_input_value(input4, /*data*/ ctx[0].address_state);\n\t\t\t}\n\n\t\t\tif (dirty & /*data*/ 1 && input5.value !== /*data*/ ctx[0].address_postal) {\n\t\t\t\tset_input_value(input5, /*data*/ ctx[0].address_postal);\n\t\t\t}\n\n\t\t\tif (dirty & /*data*/ 1 && input6.value !== /*data*/ ctx[0].email) {\n\t\t\t\tset_input_value(input6, /*data*/ ctx[0].email);\n\t\t\t}\n\n\t\t\tif (dirty & /*data*/ 1 && input7.value !== /*data*/ ctx[0].instagram) {\n\t\t\t\tset_input_value(input7, /*data*/ ctx[0].instagram);\n\t\t\t}\n\n\t\t\tif (dirty & /*data*/ 1 && input8.value !== /*data*/ ctx[0].tiktok) {\n\t\t\t\tset_input_value(input8, /*data*/ ctx[0].tiktok);\n\t\t\t}\n\n\t\t\tif (dirty & /*data*/ 1 && input9.value !== /*data*/ ctx[0].paypal) {\n\t\t\t\tset_input_value(input9, /*data*/ ctx[0].paypal);\n\t\t\t}\n\t\t},\n\t\ti: noop,\n\t\to: noop,\n\t\td(detaching) {\n\t\t\tif (detaching) detach(form);\n\t\t\tmounted = false;\n\t\t\trun_all(dispose);\n\t\t}\n\t};\n}\n\nfunction instance($$self, $$props, $$invalidate) {\n\tlet { onDone } = $$props;\n\tconst dispatch = createEventDispatcher();\n\n\tlet data = {\n\t\tname: \"\",\n\t\taddress_line_1: \"\",\n\t\taddress_line_2: \"\",\n\t\taddress_city: \"\",\n\t\taddress_state: \"\",\n\t\taddress_postal: \"\",\n\t\temail: \"\",\n\t\tinstagram: \"\",\n\t\ttiktok: \"\",\n\t\tpaypal: \"\"\n\t};\n\n\tconst onSubmit = async () => {\n\t\tif (!data.tiktok.replace(/\\s+/g, '') && !data.instagram.replace(/\\s+/g, '')) {\n\t\t\talert(\"Please input at least one social handle.\");\n\t\t\treturn;\n\t\t}\n\n\t\tdispatch('load', { load: true });\n\n\t\ttry {\n\t\t\tlet res = await fetch(__SNOWPACK_ENV__.SNOWPACK_PUBLIC_API_URL + \"/affiliate_applications\", {\n\t\t\t\tmethod: \"POST\",\n\t\t\t\theaders: { 'Content-Type': 'application/json' },\n\t\t\t\tbody: JSON.stringify(data)\n\t\t\t});\n\n\t\t\tres = await res.json();\n\t\t\tdispatch('load', { load: false });\n\n\t\t\tif (res.status) {\n\t\t\t\tif (res.status === \"OK\") {\n\t\t\t\t\tonDone(false, res.message);\n\t\t\t\t} else {\n\t\t\t\t\tonDone(true, res.message);\n\t\t\t\t}\n\t\t\t} else {\n\t\t\t\tonDone(true, \"Something went wrong. Try again later.\");\n\t\t\t}\n\t\t} catch(err) {\n\t\t\tconsole.log(err);\n\t\t\tdispatch('load', { load: false });\n\t\t\tonDone(true, \"Something went wrong. Try again later.\");\n\t\t}\n\t};\n\n\tfunction input0_input_handler() {\n\t\tdata.name = this.value;\n\t\t$$invalidate(0, data);\n\t}\n\n\tfunction input1_input_handler() {\n\t\tdata.address_line_1 = this.value;\n\t\t$$invalidate(0, data);\n\t}\n\n\tfunction input2_input_handler() {\n\t\tdata.address_line_2 = this.value;\n\t\t$$invalidate(0, data);\n\t}\n\n\tfunction input3_input_handler() {\n\t\tdata.address_city = this.value;\n\t\t$$invalidate(0, data);\n\t}\n\n\tfunction input4_input_handler() {\n\t\tdata.address_state = this.value;\n\t\t$$invalidate(0, data);\n\t}\n\n\tfunction input5_input_handler() {\n\t\tdata.address_postal = this.value;\n\t\t$$invalidate(0, data);\n\t}\n\n\tfunction input6_input_handler() {\n\t\tdata.email = this.value;\n\t\t$$invalidate(0, data);\n\t}\n\n\tfunction input7_input_handler() {\n\t\tdata.instagram = this.value;\n\t\t$$invalidate(0, data);\n\t}\n\n\tfunction input8_input_handler() {\n\t\tdata.tiktok = this.value;\n\t\t$$invalidate(0, data);\n\t}\n\n\tfunction input9_input_handler() {\n\t\tdata.paypal = this.value;\n\t\t$$invalidate(0, data);\n\t}\n\n\t$$self.$$set = $$props => {\n\t\tif ('onDone' in $$props) $$invalidate(2, onDone = $$props.onDone);\n\t};\n\n\treturn [\n\t\tdata,\n\t\tonSubmit,\n\t\tonDone,\n\t\tinput0_input_handler,\n\t\tinput1_input_handler,\n\t\tinput2_input_handler,\n\t\tinput3_input_handler,\n\t\tinput4_input_handler,\n\t\tinput5_input_handler,\n\t\tinput6_input_handler,\n\t\tinput7_input_handler,\n\t\tinput8_input_handler,\n\t\tinput9_input_handler\n\t];\n}\n\nclass AffiliateForm extends SvelteComponent {\n\tconstructor(options) {\n\t\tsuper();\n\t\tinit(this, options, instance, create_fragment, safe_not_equal, { onDone: 2 });\n\t}\n}\n\nexport default AffiliateForm;", "import './Loader.svelte.css';\n/* src/components/Loader.svelte generated by Svelte v3.59.2 */\nimport {\n\tSvelteComponent,\n\tattr,\n\tdetach,\n\telement,\n\tinit,\n\tinsert,\n\tnoop,\n\tsafe_not_equal\n} from \"../../_snowpack/pkg/svelte/internal.js\";\n\nfunction create_fragment(ctx) {\n\tlet div8;\n\n\treturn {\n\t\tc() {\n\t\t\tdiv8 = element(\"div\");\n\t\t\tdiv8.innerHTML = `<div class=\"svelte-1ct9flf\"></div><div class=\"svelte-1ct9flf\"></div><div class=\"svelte-1ct9flf\"></div><div class=\"svelte-1ct9flf\"></div><div class=\"svelte-1ct9flf\"></div><div class=\"svelte-1ct9flf\"></div><div class=\"svelte-1ct9flf\"></div><div class=\"svelte-1ct9flf\"></div>`;\n\t\t\tattr(div8, \"class\", \"lds-roller svelte-1ct9flf\");\n\t\t},\n\t\tm(target, anchor) {\n\t\t\tinsert(target, div8, anchor);\n\t\t},\n\t\tp: noop,\n\t\ti: noop,\n\t\to: noop,\n\t\td(detaching) {\n\t\t\tif (detaching) detach(div8);\n\t\t}\n\t};\n}\n\nclass Loader extends SvelteComponent {\n\tconstructor(options) {\n\t\tsuper();\n\t\tinit(this, options, null, create_fragment, safe_not_equal, {});\n\t}\n}\n\nexport default Loader;", "import './AffiliateScreen.svelte.css';\n/* src/screens/AffiliateScreen.svelte generated by Svelte v3.59.2 */\nimport {\n\tSvelteComponent,\n\tappend,\n\tattr,\n\tcheck_outros,\n\tcreate_component,\n\tdestroy_component,\n\tdetach,\n\telement,\n\tempty,\n\tgroup_outros,\n\tinit,\n\tinsert,\n\tmount_component,\n\tnoop,\n\tsafe_not_equal,\n\tset_data,\n\tset_style,\n\tspace,\n\ttext,\n\ttransition_in,\n\ttransition_out\n} from \"../../_snowpack/pkg/svelte/internal.js\";\n\nimport NavBar from \"../components/NavBar.svelte.js\";\nimport AffiliateForm from '../components/AffiliateForm.svelte.js';\nimport Footer from '../components/Footer.svelte.js';\nimport Loader from '../components/Loader.svelte.js';\n\nfunction create_else_block_1(ctx) {\n\tlet div;\n\tlet h1;\n\tlet t1;\n\tlet p;\n\tlet t3;\n\tlet hr;\n\tlet t4;\n\tlet affiliateform;\n\tlet current;\n\taffiliateform = new AffiliateForm({ props: { onDone: /*handleDone*/ ctx[4] } });\n\taffiliateform.$on(\"load\", /*handleLoading*/ ctx[5]);\n\n\treturn {\n\t\tc() {\n\t\t\tdiv = element(\"div\");\n\t\t\th1 = element(\"h1\");\n\t\t\th1.textContent = \"Affiliate Application\";\n\t\t\tt1 = space();\n\t\t\tp = element(\"p\");\n\t\t\tp.textContent = \"Please complete the form below to apply as a MyPetAR affiliate.\";\n\t\t\tt3 = space();\n\t\t\thr = element(\"hr\");\n\t\t\tt4 = space();\n\t\t\tcreate_component(affiliateform.$$.fragment);\n\t\t\tattr(h1, \"class\", \"svelte-1kr5t2g\");\n\t\t\tattr(p, \"class\", \"svelte-1kr5t2g\");\n\t\t\tattr(hr, \"class\", \"solid svelte-1kr5t2g\");\n\t\t\tattr(div, \"class\", \"form-container svelte-1kr5t2g\");\n\t\t\tset_style(div, \"margin-bottom\", \"100px\");\n\t\t},\n\t\tm(target, anchor) {\n\t\t\tinsert(target, div, anchor);\n\t\t\tappend(div, h1);\n\t\t\tappend(div, t1);\n\t\t\tappend(div, p);\n\t\t\tappend(div, t3);\n\t\t\tappend(div, hr);\n\t\t\tappend(div, t4);\n\t\t\tmount_component(affiliateform, div, null);\n\t\t\tcurrent = true;\n\t\t},\n\t\tp: noop,\n\t\ti(local) {\n\t\t\tif (current) return;\n\t\t\ttransition_in(affiliateform.$$.fragment, local);\n\t\t\tcurrent = true;\n\t\t},\n\t\to(local) {\n\t\t\ttransition_out(affiliateform.$$.fragment, local);\n\t\t\tcurrent = false;\n\t\t},\n\t\td(detaching) {\n\t\t\tif (detaching) detach(div);\n\t\t\tdestroy_component(affiliateform);\n\t\t}\n\t};\n}\n\n// (28:2) {#if isDone}\nfunction create_if_block_1(ctx) {\n\tlet if_block_anchor;\n\n\tfunction select_block_type_1(ctx, dirty) {\n\t\tif (/*hasErr*/ ctx[2]) return create_if_block_2;\n\t\treturn create_else_block;\n\t}\n\n\tlet current_block_type = select_block_type_1(ctx, -1);\n\tlet if_block = current_block_type(ctx);\n\n\treturn {\n\t\tc() {\n\t\t\tif_block.c();\n\t\t\tif_block_anchor = empty();\n\t\t},\n\t\tm(target, anchor) {\n\t\t\tif_block.m(target, anchor);\n\t\t\tinsert(target, if_block_anchor, anchor);\n\t\t},\n\t\tp(ctx, dirty) {\n\t\t\tif (current_block_type === (current_block_type = select_block_type_1(ctx, dirty)) && if_block) {\n\t\t\t\tif_block.p(ctx, dirty);\n\t\t\t} else {\n\t\t\t\tif_block.d(1);\n\t\t\t\tif_block = current_block_type(ctx);\n\n\t\t\t\tif (if_block) {\n\t\t\t\t\tif_block.c();\n\t\t\t\t\tif_block.m(if_block_anchor.parentNode, if_block_anchor);\n\t\t\t\t}\n\t\t\t}\n\t\t},\n\t\ti: noop,\n\t\to: noop,\n\t\td(detaching) {\n\t\t\tif_block.d(detaching);\n\t\t\tif (detaching) detach(if_block_anchor);\n\t\t}\n\t};\n}\n\n// (23:0) {#if isLoading}\nfunction create_if_block(ctx) {\n\tlet div;\n\tlet loader;\n\tlet current;\n\tloader = new Loader({});\n\n\treturn {\n\t\tc() {\n\t\t\tdiv = element(\"div\");\n\t\t\tcreate_component(loader.$$.fragment);\n\t\t\tset_style(div, \"display\", \"flex\");\n\t\t\tset_style(div, \"justify-content\", \"center\");\n\t\t\tset_style(div, \"margin-top\", \"50px\");\n\t\t},\n\t\tm(target, anchor) {\n\t\t\tinsert(target, div, anchor);\n\t\t\tmount_component(loader, div, null);\n\t\t\tcurrent = true;\n\t\t},\n\t\tp: noop,\n\t\ti(local) {\n\t\t\tif (current) return;\n\t\t\ttransition_in(loader.$$.fragment, local);\n\t\t\tcurrent = true;\n\t\t},\n\t\to(local) {\n\t\t\ttransition_out(loader.$$.fragment, local);\n\t\t\tcurrent = false;\n\t\t},\n\t\td(detaching) {\n\t\t\tif (detaching) detach(div);\n\t\t\tdestroy_component(loader);\n\t\t}\n\t};\n}\n\n// (34:4) {:else}\nfunction create_else_block(ctx) {\n\tlet div;\n\tlet h3;\n\tlet t1;\n\tlet p;\n\tlet t2;\n\n\treturn {\n\t\tc() {\n\t\t\tdiv = element(\"div\");\n\t\t\th3 = element(\"h3\");\n\t\t\th3.textContent = \"Success!\";\n\t\t\tt1 = space();\n\t\t\tp = element(\"p\");\n\t\t\tt2 = text(/*message*/ ctx[3]);\n\t\t\tattr(h3, \"class\", \"svelte-1kr5t2g\");\n\t\t\tattr(p, \"class\", \"svelte-1kr5t2g\");\n\t\t\tattr(div, \"class\", \"res success svelte-1kr5t2g\");\n\t\t},\n\t\tm(target, anchor) {\n\t\t\tinsert(target, div, anchor);\n\t\t\tappend(div, h3);\n\t\t\tappend(div, t1);\n\t\t\tappend(div, p);\n\t\t\tappend(p, t2);\n\t\t},\n\t\tp(ctx, dirty) {\n\t\t\tif (dirty & /*message*/ 8) set_data(t2, /*message*/ ctx[3]);\n\t\t},\n\t\td(detaching) {\n\t\t\tif (detaching) detach(div);\n\t\t}\n\t};\n}\n\n// (29:4) {#if hasErr}\nfunction create_if_block_2(ctx) {\n\tlet div;\n\tlet h3;\n\tlet t1;\n\tlet p;\n\tlet t2;\n\n\treturn {\n\t\tc() {\n\t\t\tdiv = element(\"div\");\n\t\t\th3 = element(\"h3\");\n\t\t\th3.textContent = \"Error\";\n\t\t\tt1 = space();\n\t\t\tp = element(\"p\");\n\t\t\tt2 = text(/*message*/ ctx[3]);\n\t\t\tattr(h3, \"class\", \"svelte-1kr5t2g\");\n\t\t\tattr(p, \"class\", \"svelte-1kr5t2g\");\n\t\t\tattr(div, \"class\", \"res error svelte-1kr5t2g\");\n\t\t},\n\t\tm(target, anchor) {\n\t\t\tinsert(target, div, anchor);\n\t\t\tappend(div, h3);\n\t\t\tappend(div, t1);\n\t\t\tappend(div, p);\n\t\t\tappend(p, t2);\n\t\t},\n\t\tp(ctx, dirty) {\n\t\t\tif (dirty & /*message*/ 8) set_data(t2, /*message*/ ctx[3]);\n\t\t},\n\t\td(detaching) {\n\t\t\tif (detaching) detach(div);\n\t\t}\n\t};\n}\n\nfunction create_fragment(ctx) {\n\tlet navbar;\n\tlet t0;\n\tlet current_block_type_index;\n\tlet if_block;\n\tlet t1;\n\tlet footer;\n\tlet current;\n\tnavbar = new NavBar({});\n\tconst if_block_creators = [create_if_block, create_if_block_1, create_else_block_1];\n\tconst if_blocks = [];\n\n\tfunction select_block_type(ctx, dirty) {\n\t\tif (/*isLoading*/ ctx[0]) return 0;\n\t\tif (/*isDone*/ ctx[1]) return 1;\n\t\treturn 2;\n\t}\n\n\tcurrent_block_type_index = select_block_type(ctx, -1);\n\tif_block = if_blocks[current_block_type_index] = if_block_creators[current_block_type_index](ctx);\n\tfooter = new Footer({});\n\n\treturn {\n\t\tc() {\n\t\t\tcreate_component(navbar.$$.fragment);\n\t\t\tt0 = space();\n\t\t\tif_block.c();\n\t\t\tt1 = space();\n\t\t\tcreate_component(footer.$$.fragment);\n\t\t},\n\t\tm(target, anchor) {\n\t\t\tmount_component(navbar, target, anchor);\n\t\t\tinsert(target, t0, anchor);\n\t\t\tif_blocks[current_block_type_index].m(target, anchor);\n\t\t\tinsert(target, t1, anchor);\n\t\t\tmount_component(footer, target, anchor);\n\t\t\tcurrent = true;\n\t\t},\n\t\tp(ctx, [dirty]) {\n\t\t\tlet previous_block_index = current_block_type_index;\n\t\t\tcurrent_block_type_index = select_block_type(ctx, dirty);\n\n\t\t\tif (current_block_type_index === previous_block_index) {\n\t\t\t\tif_blocks[current_block_type_index].p(ctx, dirty);\n\t\t\t} else {\n\t\t\t\tgroup_outros();\n\n\t\t\t\ttransition_out(if_blocks[previous_block_index], 1, 1, () => {\n\t\t\t\t\tif_blocks[previous_block_index] = null;\n\t\t\t\t});\n\n\t\t\t\tcheck_outros();\n\t\t\t\tif_block = if_blocks[current_block_type_index];\n\n\t\t\t\tif (!if_block) {\n\t\t\t\t\tif_block = if_blocks[current_block_type_index] = if_block_creators[current_block_type_index](ctx);\n\t\t\t\t\tif_block.c();\n\t\t\t\t} else {\n\t\t\t\t\tif_block.p(ctx, dirty);\n\t\t\t\t}\n\n\t\t\t\ttransition_in(if_block, 1);\n\t\t\t\tif_block.m(t1.parentNode, t1);\n\t\t\t}\n\t\t},\n\t\ti(local) {\n\t\t\tif (current) return;\n\t\t\ttransition_in(navbar.$$.fragment, local);\n\t\t\ttransition_in(if_block);\n\t\t\ttransition_in(footer.$$.fragment, local);\n\t\t\tcurrent = true;\n\t\t},\n\t\to(local) {\n\t\t\ttransition_out(navbar.$$.fragment, local);\n\t\t\ttransition_out(if_block);\n\t\t\ttransition_out(footer.$$.fragment, local);\n\t\t\tcurrent = false;\n\t\t},\n\t\td(detaching) {\n\t\t\tdestroy_component(navbar, detaching);\n\t\t\tif (detaching) detach(t0);\n\t\t\tif_blocks[current_block_type_index].d(detaching);\n\t\t\tif (detaching) detach(t1);\n\t\t\tdestroy_component(footer, detaching);\n\t\t}\n\t};\n}\n\nfunction instance($$self, $$props, $$invalidate) {\n\tlet isLoading = false;\n\tlet isDone = false;\n\tlet hasErr = false;\n\tlet message = \"\";\n\n\tconst handleDone = (err, msg) => {\n\t\t$$invalidate(1, isDone = true);\n\t\t$$invalidate(2, hasErr = err);\n\t\t$$invalidate(3, message = msg);\n\t};\n\n\tconst handleLoading = event => $$invalidate(0, isLoading = event.detail.load);\n\treturn [isLoading, isDone, hasErr, message, handleDone, handleLoading];\n}\n\nclass AffiliateScreen extends SvelteComponent {\n\tconstructor(options) {\n\t\tsuper();\n\t\tinit(this, options, instance, create_fragment, safe_not_equal, {});\n\t}\n}\n\nexport default AffiliateScreen;", "import './AffiliateAgreement.svelte.css';\n/* src/screens/AffiliateAgreement.svelte generated by Svelte v3.59.2 */\nimport {\n\tSvelteComponent,\n\tattr,\n\tcreate_component,\n\tdestroy_component,\n\tdetach,\n\telement,\n\tinit,\n\tinsert,\n\tmount_component,\n\tnoop,\n\tsafe_not_equal,\n\tspace,\n\ttransition_in,\n\ttransition_out\n} from \"../../_snowpack/pkg/svelte/internal.js\";\n\nimport NavBar from \"../components/NavBar.svelte.js\";\nimport Footer from \"../components/Footer.svelte.js\";\n\nfunction create_fragment(ctx) {\n\tlet navbar;\n\tlet t0;\n\tlet div;\n\tlet t220;\n\tlet footer;\n\tlet current;\n\tnavbar = new NavBar({});\n\tfooter = new Footer({});\n\n\treturn {\n\t\tc() {\n\t\t\tcreate_component(navbar.$$.fragment);\n\t\t\tt0 = space();\n\t\t\tdiv = element(\"div\");\n\n\t\t\tdiv.innerHTML = `<h1>Affiliate Agreement</h1> \n<h2>Effective Date: July 15th, 2021</h2> \n<h2>Primary Website: www.mypetar.com</h2> \n\n<p><strong>THE AGREEMENT:</strong> This Affiliate Agreement (hereinafter called the &quot;Agreement&quot;) is provided by the following organization, hereinafter referred to as &quot;Company&quot;: Pro Exp Media Inc. Our primary website is located at the address listed above. The Agreement is a legal document between you and the Company that describes the affiliate relationship we are entering into. This Agreement covers your responsibilities as an affiliate and our responsibilities to you. Please ensure you read and understand the entirety of this document, as well as have a lawyer&#39;s assistance if you desire, because each of the terms of this Agreement are important to our working relationship.</p> \n\n<h2>1) DEFINITIONS</h2> \n<p>The parties referred to in this Agreement shall be defined as follows:</p> \n<ul class=\"svelte-1dpxgd3\"><li class=\"svelte-1dpxgd3\">a) Company, Us, We: As we describe above, we&#39;ll be referred to as the Company. Us, we, our, ours and other first-person pronouns will also refer to the Company, as well as all employees or legal agents of the Company.</li> \n  <li class=\"svelte-1dpxgd3\">b) You, the Affiliate: You will be referred to as the &quot;Affiliate.&quot; You&#39;ll also be referred to throughout this Agreement with second-person pronouns such as You, Your, or Yours.</li> \n  <li class=\"svelte-1dpxgd3\">c) Parties: Collectively, the parties to this Agreement (the Company and You) will be referred to as &quot;Parties&quot; or individually as &quot;Party.&quot;</li> \n  <li class=\"svelte-1dpxgd3\">d) Affiliate Program: The program we&#39;ve set up for our affiliates as described in this Agreement.</li> \n  <li class=\"svelte-1dpxgd3\">e) Affiliate Application: The fully completed form which must be provided to us for consideration of your inclusion in the Affiliate Program.</li> \n  <li class=\"svelte-1dpxgd3\">f) Website: The primary website we&#39;ve noted above will be referred to as Website.</li></ul> \n\n\n<h2>2) ASSENT &amp; ACCEPTANCE</h2> \n<p>By submitting an application to our Affiliate Program, you warrant that you have read and reviewed this Agreement and that you agree to be bound by it. If you do not agree to be bound by this Agreement, please leave the website immediately and do not submit an application to our Affiliate Program. This Agreement specifically incorporates by reference any Terms of Conditions, Privacy Policies, End-User License Agreements, or other legal documents which we may have on our website.</p> \n\n\n<h2>3) AGE RESTRICTION</h2> \n<p>You must be at least 18 (eighteen) years of age to join our Affiliate Program or use this Website. By submitting an application to our Affiliate Program, you represent and warrant that you are at least 18 years of age and may legally agree to this Agreement. The Company assumes no responsibility or liability for any misrepresentation of your age.</p> \n\n<h2>4) PROGRAM SIGN-UP</h2> \n<p>In order to sign up for our Affiliate Program, you will first be asked to submit an Affiliate Application to join. The Affiliate Application may be found at the following website: www.mypetar.com/affiliate.</p> \n<p>Submitting an Affiliate Application does not guarantee inclusion in the Affiliate Program. We evaluate each and every application and are the sole and exclusive decision-makers on Affiliate acceptance. If we choose not to allow your inclusion in the Affiliate Program, we will attempt to notify you in a reasonable manner. If you do not hear from us within a reasonable time frame, please consider your application rejected. We are not obligated to provide you any explanation for your rejection, but please be advised we may reject applicants for any reason or manner, including but not limited to a website or social media page which violates our Acceptable Use Policy.</p> \n<p>If your Affiliate Application is rejected, you may not reapply. If your Affiliate Application is accepted, each of the terms and conditions in this Agreement applies to your participation. We may also ask for additional information to complete your Affiliate Application or for you to undertake additional steps to ensure eligibility in the Affiliate Program.</p> \n\n<h2>5) NON-EXCLUSIVITY</h2> \n<p>This Agreement does not create an exclusive relationship between you and us. You are free to work with similar affiliate program providers in any category. This agreement imposes no restrictions on us to work with any individual or company we may choose.</p> \n\n<h2>6) AFFILIATE PROGRAM</h2> \n<p>After your acceptance in the Affiliate Program, you must ensure your account is set up thoroughly, including specific payout information and location (such as a bank or online account which we may use to post payment).</p> \n<p><strong><u>Please be advised the below is a general description of the Affiliate Program. Everything contained in this subsection is subject to the specific terms and conditions throughout the rest of this Agreement.</u></strong></p> \n<p>We will provide you with a specific Coupon Code, personalized to you as an Affiliate, for your promotion. The Coupon Code will be keyed to your identity. You hereby agree to fully cooperate with us regarding the Coupon Code and that you will explicitly comply with all of the terms of this Agreement for the promotion of the Coupon Code at all times. We may modify the specific Coupon Code and will notify you if we do so. You agree to only use Coupon Code which are prior approved by us and to display the Coupon Code prominently on your website or social media page, as described in your Affiliate Application (collectively, the &quot;Affiliate Site&quot;).</p> \n<p><strong>No cookie stuffing:</strong> You agree not to use cookie &quot;stuffing,&quot; or other techniques which may incorporate a tracking code without specific knowledge of the online user.</p> \n<p>All information which will be displayed on the Affiliate Site regarding the Company must be approved by us in writing prior to display.</p> \n<p>Each time a user makes a purchase using the Affiliates Coupon Code on the Affiliate Site and we determine it is a valid Coupon Code, as described below, you will be eligible to receive the following amount: 20% commission of net amount of the cart total. Net amount meaning total purchase price minus taxes, shipping, promotional discounts or other unspecified amounts.</p> \n\n<h2>7) SPECIFIC TERMS APPLICABLE</h2> \n<p>We will determine whether payout is permissible in our sole and exclusive discretion. We reserve the right to reject sales that do not comply with the terms of this Agreement.</p> \n<p>As described above, in order to be eligible for payout, Affiliate Coupons must be valid and account in good standing.</p> \n\n<h2>8) PAYOUT INFORMATION</h2> \n<p>Payouts will only be available when the Company has your current address information as well as accounting and tax documentation. You will be asked to submit a W8/W9 tax form. Accounting information may include the routing and account number of a bank where you wish to post a direct deposit or may include an email address for an online method of payment.</p> \n<p>Currently, the Company employs the following methods of payout:</p> \n<ul class=\"svelte-1dpxgd3\"><li class=\"svelte-1dpxgd3\">Paypal</li></ul> \n<p>For any changes in your address or accounting information, you must notify us immediately and we will endeavor to make the changes to your payout information as soon as possible.</p> \n<p>Payouts will be available the month or period after they accrue. For example, if payouts are made every 30 days, an entire 30 day period must finish for the payout of that period to be available in the following period.</p> \n<p>We explicitly reserve the right to change payout information in our sole and exclusive discretion. If we do so, you will be notified.</p> \n<p>Payouts are also subject to the following restriction:</p> \n<ul class=\"svelte-1dpxgd3\"><li class=\"svelte-1dpxgd3\">a) Payouts are only available when a threshold of the following amount is met: \\$100 (one hundred US dollars).</li></ul> \n<p>For any disputes as to payout, the Company must be notified within thirty days of your receipt of the payout. We will review each dispute notification as well as the underlying payout transaction to which it is related. Disputes filed after thirty days of payout will not be addressed.</p> \n\n<h2>9) TERM, TERMINATION &amp; SUSPENSION</h2> \n<p>The term of this Agreement will begin when we accept you into the Affiliate Program. It can be terminated by either Party at any time with or without cause.</p> \n<p>You may only earn payouts as long as you are an Affiliate in good standing during the term. If you terminate this Agreement with us, you will qualify to receive payouts earned prior to the date of termination.</p> \n<p>If you fail to follow the terms of this Agreement or any other legal terms we have posted anywhere on our website or websites, you forfeit all rights, including the right to any unclaimed payout.</p> \n<p>We specifically reserve the right to terminate this Agreement if you violate any of the terms outlined herein, including, but not limited to, violating the intellectual property rights of the Company or a third party, failing to comply with applicable laws or other legal obligations, and/or publishing or distributing illegal material.</p> \n<p>At the termination of this Agreement, any provisions that would be expected to survive termination by their nature shall remain in full force and effect.</p> \n\n<h2>10) INTELLECTUAL PROPERTY</h2> \n<p>You agree that the intellectual property owned by the Company includes all copyrights, trademarks, trade secrets, patents, and other intellectual property belonging to the Company (&quot;Company IP&quot;).</p> \n<p>Subject to the limitations listed below, we hereby grant you a non-exclusive, non-transferable, revocable license to access our websites in conjunction with the Affiliate Program and use the Company IP solely and exclusively in conjunction with identifying our company and brand on the Affiliate Site to send customers to the Affiliate links we provide. You may not modify the Company IP in any way and you are only permitted to use the Company IP if you are an Affiliate in good standing with us.</p> \n<p>We may revoke this license at any time and if we find that you are using the Company IP in any manner not contemplated by this Agreement, we reserve the right to terminate this Agreement.</p> \n<p>Other than as provided herein, you are not permitted to use any of the Company IP or any confusingly similar variation of the Company IP without our express prior written permission. This includes a restriction on using the Company IP in any domain or website name, in any keywords or advertising, in any metatags or code, or in any way that is likely to cause consumer confusion.</p> \n<p>Please be advised that your unauthorized use of any Company IP shall constitute unlawful infringement and we reserve all of our rights, including the right to pursue an infringement suit against you in federal court. You may be obligated to pay monetary damages or legal fees and costs.</p> \n<p>You hereby provide us a non-exclusive license to use your name, trademarks and servicemarks if applicable and other business intellectual property to advertise our Affiliate Program.</p> \n\n<h2>11) MODIFICATION &amp; VARIATION</h2> \n<p>The Company may, from time to time and at any time, modify this Agreement. You agree that the Company has the right to modify this Agreement or revise anything contained herein. You further agree that all modifications to this Agreement are in full force and effect immediately upon posting on the Website and that modifications or variations will replace any prior version of this Agreement, unless prior versions are specifically referred to or incorporated into the latest modification or variation of this Agreement. If we update or replace the terms of this Agreement, we will let you know via electronic means, which may include an email. If you don&#39;t agree to the update or replacement, you can choose to terminate this Agreement as described below.</p> \n<ul class=\"svelte-1dpxgd3\"><li class=\"svelte-1dpxgd3\">a) To the extent any part or subpart of this Agreement is held ineffective or invalid by any court of law, you agree that the prior, effective version of this Agreement shall be considered enforceable and valid to the fullest extent.</li> \n  <li class=\"svelte-1dpxgd3\">b) You agree to routinely monitor this Agreement and refer to the Effective Date posted at the top of this Agreement to note modifications or variations. You further agree to clear your cache when doing so to avoid accessing a prior version of this Agreement.</li></ul> \n\n<h2>12) RELATIONSHIP OF THE PARTIES</h2> \n<p>Nothing contained within this Agreement shall be construed to form any partnership, joint venture, agency, franchise, or employment relationship. You are an independent contractor of the Company and will remain so at all times.</p> \n\n<h2>13) ACCEPTABLE USE</h2> \n<p>You agree not to use the Affiliate Program or our Company for any unlawful purpose or any purpose prohibited under this clause. You agree not to use the Affiliate Program in any way that could damage our websites, products, services, or the general business of the Company.</p> \n<ul class=\"svelte-1dpxgd3\"><li class=\"svelte-1dpxgd3\">a) You further agree not to use the Affiliate Program:</li> \n  <li class=\"svelte-1dpxgd3\">I) To harass, abuse, or threaten others or otherwise violate any person&#39;s legal rights;</li> \n  <li class=\"svelte-1dpxgd3\">II) To violate any intellectual property rights of the Company or any third party;</li> \n  <li class=\"svelte-1dpxgd3\">III) To upload or otherwise disseminate any computer viruses or other software that may damage the property of another;</li> \n  <li class=\"svelte-1dpxgd3\">IV) To perpetrate any fraud;</li> \n  <li class=\"svelte-1dpxgd3\">V) To engage in or create any unlawful gambling, sweepstakes, or pyramid scheme;</li> \n  <li class=\"svelte-1dpxgd3\">VI) To publish or distribute any obscene or defamatory material;</li> \n  <li class=\"svelte-1dpxgd3\">VII) To publish or distribute any material that incites violence, hate, or discrimination towards any group;</li> \n  <li class=\"svelte-1dpxgd3\">VIII) To unlawfully gather information about others.</li></ul> \n\n<h2>14) AFFILIATE OBLIGATIONS &amp; FTC COMPLIANCE</h2> \n<p>You are responsible for ensuring operation and maintenance of the Affiliate Site/Social Channels, including technical operations, written claims, links, and accuracy of materials. You must ensure, as noted above, that the Affiliate Site does not infringe upon the intellectual property rights of any third party or otherwise violate any legal rights.</p> \n<p>We may monitor your account, as well as clicks and/or purchases coming through your account. If we determine you are not in compliance with any of the terms of this Agreement, we have the right to immediately terminate your participation in the Affiliate Program.</p> \n<p>We require all of our Affiliates to comply with all applicable statutes, regulations, and guidelines set by the federal government, through the Federal Trade Commission, as well as state and local governments as mandated. The Federal Trade Commission requires that affiliate relationships, such as the relationship between you and the Company, be disclosed to consumers.</p> \n<p>We recommend that you seek independent legal counsel to advise you of our obligations to disclose in this manner.</p> \n<p>You are required to post a conspicuous notice on your website regarding the Affiliate Program. The notice does not have to contain the precise words as the example given below, but should be similar:</p> \n<p>We engage in affiliate marketing whereby we receive funds through the use of an Affiliate Coupon where we receive funds through the sale of goods or services on or through this website. We may also accept advertising and sponsorships from commercial businesses or receive other forms of advertising compensation. This disclosure is intended to comply with the US Federal Trade Commission Rules on marketing and advertising, as well as any other legal requirements which may apply.</p> \n<p>We also require you to comply with any and all applicable data privacy and security laws and regulations, including all of those which may impact your country of residence or your visitors. Such regulations include, but are not limited to, any applicable laws in the United States or the General Data Protection Regulation of the European Union. We also require that you implement adequate organizational and technical measures to ensure an appropriate level of security for the data that you process. Further, you hereby agree to comply with any requests which we may make to you regarding compliance with the General Data Protection Regulation or requests which you may receive from data subjects.</p> \n<p>If we find you are not in compliance with any of the requirements of this subpart, we may terminate our relationship with you at our sole and exclusive discretion.</p> \n\n<h2>15) REVERSE ENGINEERING &amp; SECURITY</h2> \n<p>You agree not to undertake any of the following actions:</p> \n<ul class=\"svelte-1dpxgd3\"><li class=\"svelte-1dpxgd3\">a) Reverse engineer, or attempt to reverse engineer or disassemble any code or software from or on any of our websites or services;</li> \n  <li class=\"svelte-1dpxgd3\">b) Violate the security of any of our websites or services through any unauthorized access, circumvention of encryption or other security tools, data mining or interference to any host, user or network.</li></ul> \n\n<h2>16) DATA LOSS</h2> \n<p>The Company does not accept responsibility for the security of your account or content. You agree that your participation in the Affiliate Program is at your own risk.</p> \n\n<h2>17) INDEMNIFICATION</h2> \n<p>You agree to defend and indemnify the Company and any of its agents (if applicable) and hold us harmless against any and all legal claims and demands, including reasonable attorney&#39;s fees, which may arise from or relate to your use or misuse of the Affiliate Program, your breach of this Agreement, or your conduct or actions. You agree that the Company shall be able to select its own legal counsel and may participate in its own defense, if the Company wishes.</p> \n\n<h2>18) SPAM POLICY</h2> \n<p>You are strictly prohibited from using the Affiliate Program for illegal spam activities, including gathering email addresses and personal information from others or sending any mass commercial emails.</p> \n\n<h2>19) ENTIRE AGREEMENT</h2> \n<p>This Agreement constitutes the entire understanding between the Parties with respect to the Affiliate Program. This Agreement supersedes and replaces all prior or contemporaneous agreements or understandings, written or oral.</p> \n\n<h2>20) SERVICE INTERRUPTIONS</h2> \n<p>The Company may need to interrupt your access to the Affiliate Program to perform maintenance or emergency services on a scheduled or unscheduled basis. You agree that your access may be affected by unanticipated or unscheduled downtime, for any reason, but that the Company shall have no liability for any damage or loss caused as a result of such downtime.</p> \n\n<h2>21) NO WARRANTIES</h2> \n<p>You agree that your use of the Affiliate Program is at your sole and exclusive risk and that any services provided by us are on an &quot;As Is&quot; basis. The Company hereby expressly disclaims any and all express or implied warranties of any kind, including, but not limited to the implied warranty of fitness for a particular purpose and the implied warranty of merchantability. The Company makes no warranties that the Affiliate Program will meet your needs or that it will be uninterrupted, error-free, or secure. The Company also makes no warranties as to the reliability or accuracy of any information. You agree that any damage that may occur to you, through your computer system, or as a result of loss of your data from your use of the Affiliate Program is your sole responsibility and that the Company is not liable for any such damage or loss.</p> \n\n<h2>22) LIMITATION ON LIABILITY</h2> \n<p>The Company is not liable for any damages that may occur to you as a result of your participation in the Affiliate Program, to the fullest extent permitted by law. The maximum liability of the Company arising from or relating to this Agreement is limited to one hundred (\\$100) US Dollars. This section applies to any and all claims by you, including, but not limited to, lost profits or revenues, consequential or punitive damages, negligence, strict liability, fraud, or torts of any kind.</p> \n\n<h2>23) GENERAL PROVISIONS:</h2> \n<ul class=\"svelte-1dpxgd3\"><li class=\"svelte-1dpxgd3\">A) LANGUAGE: All communications made or notices given pursuant to this Agreement shall be in the English language.</li> \n  <li class=\"svelte-1dpxgd3\">B) JURISDICTION, VENUE &amp; CHOICE OF LAW: Through your participation in the Affiliate Program, you agree that British Columbia, Canada shall govern any matter or dispute relating to or arising out of this Agreement, as well as any dispute of any kind that may arise between you and the Company, with the exception of its conflict of law provisions. In case any litigation specifically permitted under this Agreement is initiated, the Parties agree to submit to the personal jurisdiction of the state and federal courts of the following county: Richmond, British Columbia. The Parties agree that this choice of law, venue, and jurisdiction provision is not permissive, but rather mandatory in nature. You hereby waive the right to any objection of venue, including assertion of the doctrine of forum non conveniens or similar doctrine.</li> \n  <li class=\"svelte-1dpxgd3\">C) ARBITRATION: In case of a dispute between the Parties relating to or arising out of this Agreement, the Parties shall first attempt to resolve the dispute personally and in good faith. If these personal resolution attempts fail, the Parties shall then submit the dispute to binding arbitration. The arbitration shall be conducted in the following municipality: Richmond. The arbitration shall be conducted by a single arbitrator, and such arbitrator shall have no authority to add Parties, vary the provisions of this Agreement, award punitive damages, or certify a class. The arbitrator shall be bound by applicable and governing Federal law as well as the law of British Columbia. Each Party shall pay their own costs and fees. Claims necessitating arbitration under this section include, but are not limited to: contract claims, tort claims, claims based on Federal and state law, and claims based on local laws, ordinances, statutes or regulations. Intellectual property claims by the Company will not be subject to arbitration and may, as an exception to this subpart, be litigated. The Parties, in agreement with this subpart of this Agreement, waive any rights they may have to a jury trial in regard to arbitral claims.</li> \n  <li class=\"svelte-1dpxgd3\">D) ASSIGNMENT: This Agreement, or the rights granted hereunder, may not be assigned, sold, leased or otherwise transferred in whole or part by you. Should this Agreement, or the rights granted hereunder, by assigned, sold, leased or otherwise transferred by the Company, the rights and liabilities of the Company will bind and inure to any assignees, administrators, successors, and executors.</li> \n  <li class=\"svelte-1dpxgd3\">E) SEVERABILITY: If any part or subpart of this Agreement is held invalid or unenforceable by a court of law or competent arbitrator, the remaining parts and subparts will be enforced to the maximum extent possible. In such condition, the remainder of this Agreement shall continue in full force.</li> \n  <li class=\"svelte-1dpxgd3\">F) NO WAIVER: In the event that we fail to enforce any provision of this Agreement, this shall not constitute a waiver of any future enforcement of that provision or of any other provision. Waiver of any part or subpart of this Agreement will not constitute a waiver of any other part or subpart.</li> \n  <li class=\"svelte-1dpxgd3\">G) HEADINGS FOR CONVENIENCE ONLY: Headings of parts and subparts under this Agreement are for convenience and organization, only. Headings shall not affect the meaning of any provisions of this Agreement.</li> \n  <li class=\"svelte-1dpxgd3\">H) FORCE MAJEURE: The Company is not liable for any failure to perform due to causes beyond its reasonable control including, but not limited to, acts of God, acts of civil authorities, acts of military authorities, riots, embargoes, acts of nature and natural disasters, and other acts which may be due to unforeseen circumstances.</li> \n  <li class=\"svelte-1dpxgd3\">I) ELECTRONIC COMMUNICATIONS PERMITTED: Electronic communications are permitted to both Parties under this Agreement, including email only. For any questions or concerns, please email us at the following address: info@mypetar.com.</li></ul>`;\n\n\t\t\tt220 = space();\n\t\t\tcreate_component(footer.$$.fragment);\n\t\t\tattr(div, \"class\", \"container svelte-1dpxgd3\");\n\t\t},\n\t\tm(target, anchor) {\n\t\t\tmount_component(navbar, target, anchor);\n\t\t\tinsert(target, t0, anchor);\n\t\t\tinsert(target, div, anchor);\n\t\t\tinsert(target, t220, anchor);\n\t\t\tmount_component(footer, target, anchor);\n\t\t\tcurrent = true;\n\t\t},\n\t\tp: noop,\n\t\ti(local) {\n\t\t\tif (current) return;\n\t\t\ttransition_in(navbar.$$.fragment, local);\n\t\t\ttransition_in(footer.$$.fragment, local);\n\t\t\tcurrent = true;\n\t\t},\n\t\to(local) {\n\t\t\ttransition_out(navbar.$$.fragment, local);\n\t\t\ttransition_out(footer.$$.fragment, local);\n\t\t\tcurrent = false;\n\t\t},\n\t\td(detaching) {\n\t\t\tdestroy_component(navbar, detaching);\n\t\t\tif (detaching) detach(t0);\n\t\t\tif (detaching) detach(div);\n\t\t\tif (detaching) detach(t220);\n\t\t\tdestroy_component(footer, detaching);\n\t\t}\n\t};\n}\n\nclass AffiliateAgreement extends SvelteComponent {\n\tconstructor(options) {\n\t\tsuper();\n\t\tinit(this, options, null, create_fragment, safe_not_equal, {});\n\t}\n}\n\nexport default AffiliateAgreement;", "/* src/routing/Routes.svelte generated by Svelte v3.59.2 */\nimport {\n\tSvelteComponent,\n\tcreate_component,\n\tdestroy_component,\n\tdetach,\n\tinit,\n\tinsert,\n\tmount_component,\n\tnoop,\n\tsafe_not_equal,\n\tspace,\n\ttext,\n\ttransition_in,\n\ttransition_out\n} from \"../../_snowpack/pkg/svelte/internal.js\";\n\nimport { isDevelopment } from \"../util.js\";\nimport { Router, Route } from \"../../_snowpack/pkg/svelte-routing.js\";\nimport Redirect from \"./Redirect.svelte.js\";\nimport Home from \"../screens/Home.svelte.js\";\nimport Front from \"../screens/Front.svelte.js\";\nimport Product from \"../screens/Product.svelte.js\";\nimport About from \"../components/About.svelte.js\";\nimport Cart from \"../screens/Cart.svelte.js\";\nimport TermsAndConditions from \"../screens/TermsAndConditions.svelte.js\";\nimport ReturnPolicy from \"../screens/ReturnPolicy.svelte.js\";\nimport PrivacyPolicy from \"../screens/PrivacyPolicy.svelte.js\";\nimport AffiliateScreen from \"../screens/AffiliateScreen.svelte.js\";\nimport AffiliateAgreement from \"../screens/AffiliateAgreement.svelte.js\";\n\nfunction create_default_slot_10(ctx) {\n\tlet front;\n\tlet current;\n\tfront = new Front({});\n\n\treturn {\n\t\tc() {\n\t\t\tcreate_component(front.$$.fragment);\n\t\t},\n\t\tm(target, anchor) {\n\t\t\tmount_component(front, target, anchor);\n\t\t\tcurrent = true;\n\t\t},\n\t\ti(local) {\n\t\t\tif (current) return;\n\t\t\ttransition_in(front.$$.fragment, local);\n\t\t\tcurrent = true;\n\t\t},\n\t\to(local) {\n\t\t\ttransition_out(front.$$.fragment, local);\n\t\t\tcurrent = false;\n\t\t},\n\t\td(detaching) {\n\t\t\tdestroy_component(front, detaching);\n\t\t}\n\t};\n}\n\n// (23:2) <Route path=\"/products/:type\" let:params>\nfunction create_default_slot_9(ctx) {\n\tlet product;\n\tlet current;\n\n\tproduct = new Product({\n\t\t\tprops: {\n\t\t\t\ttype: encodeURIComponent(/*params*/ ctx[1].type)\n\t\t\t}\n\t\t});\n\n\treturn {\n\t\tc() {\n\t\t\tcreate_component(product.$$.fragment);\n\t\t},\n\t\tm(target, anchor) {\n\t\t\tmount_component(product, target, anchor);\n\t\t\tcurrent = true;\n\t\t},\n\t\tp(ctx, dirty) {\n\t\t\tconst product_changes = {};\n\t\t\tif (dirty & /*params*/ 2) product_changes.type = encodeURIComponent(/*params*/ ctx[1].type);\n\t\t\tproduct.$set(product_changes);\n\t\t},\n\t\ti(local) {\n\t\t\tif (current) return;\n\t\t\ttransition_in(product.$$.fragment, local);\n\t\t\tcurrent = true;\n\t\t},\n\t\to(local) {\n\t\t\ttransition_out(product.$$.fragment, local);\n\t\t\tcurrent = false;\n\t\t},\n\t\td(detaching) {\n\t\t\tdestroy_component(product, detaching);\n\t\t}\n\t};\n}\n\n// (26:2) <Route path=\"/terms-and-conditions\">\nfunction create_default_slot_8(ctx) {\n\tlet termsandconditions;\n\tlet current;\n\ttermsandconditions = new TermsAndConditions({});\n\n\treturn {\n\t\tc() {\n\t\t\tcreate_component(termsandconditions.$$.fragment);\n\t\t},\n\t\tm(target, anchor) {\n\t\t\tmount_component(termsandconditions, target, anchor);\n\t\t\tcurrent = true;\n\t\t},\n\t\ti(local) {\n\t\t\tif (current) return;\n\t\t\ttransition_in(termsandconditions.$$.fragment, local);\n\t\t\tcurrent = true;\n\t\t},\n\t\to(local) {\n\t\t\ttransition_out(termsandconditions.$$.fragment, local);\n\t\t\tcurrent = false;\n\t\t},\n\t\td(detaching) {\n\t\t\tdestroy_component(termsandconditions, detaching);\n\t\t}\n\t};\n}\n\n// (29:2) <Route path=\"/return-policy\">\nfunction create_default_slot_7(ctx) {\n\tlet returnpolicy;\n\tlet current;\n\treturnpolicy = new ReturnPolicy({});\n\n\treturn {\n\t\tc() {\n\t\t\tcreate_component(returnpolicy.$$.fragment);\n\t\t},\n\t\tm(target, anchor) {\n\t\t\tmount_component(returnpolicy, target, anchor);\n\t\t\tcurrent = true;\n\t\t},\n\t\ti(local) {\n\t\t\tif (current) return;\n\t\t\ttransition_in(returnpolicy.$$.fragment, local);\n\t\t\tcurrent = true;\n\t\t},\n\t\to(local) {\n\t\t\ttransition_out(returnpolicy.$$.fragment, local);\n\t\t\tcurrent = false;\n\t\t},\n\t\td(detaching) {\n\t\t\tdestroy_component(returnpolicy, detaching);\n\t\t}\n\t};\n}\n\n// (32:2) <Route path=\"/privacy-policy\">\nfunction create_default_slot_6(ctx) {\n\tlet privacypolicy;\n\tlet current;\n\tprivacypolicy = new PrivacyPolicy({});\n\n\treturn {\n\t\tc() {\n\t\t\tcreate_component(privacypolicy.$$.fragment);\n\t\t},\n\t\tm(target, anchor) {\n\t\t\tmount_component(privacypolicy, target, anchor);\n\t\t\tcurrent = true;\n\t\t},\n\t\ti(local) {\n\t\t\tif (current) return;\n\t\t\ttransition_in(privacypolicy.$$.fragment, local);\n\t\t\tcurrent = true;\n\t\t},\n\t\to(local) {\n\t\t\ttransition_out(privacypolicy.$$.fragment, local);\n\t\t\tcurrent = false;\n\t\t},\n\t\td(detaching) {\n\t\t\tdestroy_component(privacypolicy, detaching);\n\t\t}\n\t};\n}\n\n// (35:2) <Route path=\"/affiliate\">\nfunction create_default_slot_5(ctx) {\n\tlet affiliatescreen;\n\tlet current;\n\taffiliatescreen = new AffiliateScreen({});\n\n\treturn {\n\t\tc() {\n\t\t\tcreate_component(affiliatescreen.$$.fragment);\n\t\t},\n\t\tm(target, anchor) {\n\t\t\tmount_component(affiliatescreen, target, anchor);\n\t\t\tcurrent = true;\n\t\t},\n\t\ti(local) {\n\t\t\tif (current) return;\n\t\t\ttransition_in(affiliatescreen.$$.fragment, local);\n\t\t\tcurrent = true;\n\t\t},\n\t\to(local) {\n\t\t\ttransition_out(affiliatescreen.$$.fragment, local);\n\t\t\tcurrent = false;\n\t\t},\n\t\td(detaching) {\n\t\t\tdestroy_component(affiliatescreen, detaching);\n\t\t}\n\t};\n}\n\n// (38:2) <Route path=\"/affiliate-agreement\">\nfunction create_default_slot_4(ctx) {\n\tlet affiliateagreement;\n\tlet current;\n\taffiliateagreement = new AffiliateAgreement({});\n\n\treturn {\n\t\tc() {\n\t\t\tcreate_component(affiliateagreement.$$.fragment);\n\t\t},\n\t\tm(target, anchor) {\n\t\t\tmount_component(affiliateagreement, target, anchor);\n\t\t\tcurrent = true;\n\t\t},\n\t\ti(local) {\n\t\t\tif (current) return;\n\t\t\ttransition_in(affiliateagreement.$$.fragment, local);\n\t\t\tcurrent = true;\n\t\t},\n\t\to(local) {\n\t\t\ttransition_out(affiliateagreement.$$.fragment, local);\n\t\t\tcurrent = false;\n\t\t},\n\t\td(detaching) {\n\t\t\tdestroy_component(affiliateagreement, detaching);\n\t\t}\n\t};\n}\n\n// (41:2) <Route path=\"/404\">\nfunction create_default_slot_3(ctx) {\n\tlet t;\n\n\treturn {\n\t\tc() {\n\t\t\tt = text(\"404\");\n\t\t},\n\t\tm(target, anchor) {\n\t\t\tinsert(target, t, anchor);\n\t\t},\n\t\td(detaching) {\n\t\t\tif (detaching) detach(t);\n\t\t}\n\t};\n}\n\n// (44:2) <Route path=\"/cart\">\nfunction create_default_slot_2(ctx) {\n\tlet cart;\n\tlet current;\n\tcart = new Cart({});\n\n\treturn {\n\t\tc() {\n\t\t\tcreate_component(cart.$$.fragment);\n\t\t},\n\t\tm(target, anchor) {\n\t\t\tmount_component(cart, target, anchor);\n\t\t\tcurrent = true;\n\t\t},\n\t\ti(local) {\n\t\t\tif (current) return;\n\t\t\ttransition_in(cart.$$.fragment, local);\n\t\t\tcurrent = true;\n\t\t},\n\t\to(local) {\n\t\t\ttransition_out(cart.$$.fragment, local);\n\t\t\tcurrent = false;\n\t\t},\n\t\td(detaching) {\n\t\t\tdestroy_component(cart, detaching);\n\t\t}\n\t};\n}\n\n// (47:2) <Route path=\"/*\">\nfunction create_default_slot_1(ctx) {\n\tlet redirect;\n\tlet current;\n\tredirect = new Redirect({ props: { path: \"/404\" } });\n\n\treturn {\n\t\tc() {\n\t\t\tcreate_component(redirect.$$.fragment);\n\t\t},\n\t\tm(target, anchor) {\n\t\t\tmount_component(redirect, target, anchor);\n\t\t\tcurrent = true;\n\t\t},\n\t\tp: noop,\n\t\ti(local) {\n\t\t\tif (current) return;\n\t\t\ttransition_in(redirect.$$.fragment, local);\n\t\t\tcurrent = true;\n\t\t},\n\t\to(local) {\n\t\t\ttransition_out(redirect.$$.fragment, local);\n\t\t\tcurrent = false;\n\t\t},\n\t\td(detaching) {\n\t\t\tdestroy_component(redirect, detaching);\n\t\t}\n\t};\n}\n\n// (19:0) <Router url=\"{url}\">\nfunction create_default_slot(ctx) {\n\tlet route0;\n\tlet t0;\n\tlet route1;\n\tlet t1;\n\tlet route2;\n\tlet t2;\n\tlet route3;\n\tlet t3;\n\tlet route4;\n\tlet t4;\n\tlet route5;\n\tlet t5;\n\tlet route6;\n\tlet t6;\n\tlet route7;\n\tlet t7;\n\tlet route8;\n\tlet t8;\n\tlet route9;\n\tlet current;\n\n\troute0 = new Route({\n\t\t\tprops: {\n\t\t\t\tpath: \"/\",\n\t\t\t\t$$slots: { default: [create_default_slot_10] },\n\t\t\t\t$$scope: { ctx }\n\t\t\t}\n\t\t});\n\n\troute1 = new Route({\n\t\t\tprops: {\n\t\t\t\tpath: \"/products/:type\",\n\t\t\t\t$$slots: {\n\t\t\t\t\tdefault: [\n\t\t\t\t\t\tcreate_default_slot_9,\n\t\t\t\t\t\t({ params }) => ({ 1: params }),\n\t\t\t\t\t\t({ params }) => params ? 2 : 0\n\t\t\t\t\t]\n\t\t\t\t},\n\t\t\t\t$$scope: { ctx }\n\t\t\t}\n\t\t});\n\n\troute2 = new Route({\n\t\t\tprops: {\n\t\t\t\tpath: \"/terms-and-conditions\",\n\t\t\t\t$$slots: { default: [create_default_slot_8] },\n\t\t\t\t$$scope: { ctx }\n\t\t\t}\n\t\t});\n\n\troute3 = new Route({\n\t\t\tprops: {\n\t\t\t\tpath: \"/return-policy\",\n\t\t\t\t$$slots: { default: [create_default_slot_7] },\n\t\t\t\t$$scope: { ctx }\n\t\t\t}\n\t\t});\n\n\troute4 = new Route({\n\t\t\tprops: {\n\t\t\t\tpath: \"/privacy-policy\",\n\t\t\t\t$$slots: { default: [create_default_slot_6] },\n\t\t\t\t$$scope: { ctx }\n\t\t\t}\n\t\t});\n\n\troute5 = new Route({\n\t\t\tprops: {\n\t\t\t\tpath: \"/affiliate\",\n\t\t\t\t$$slots: { default: [create_default_slot_5] },\n\t\t\t\t$$scope: { ctx }\n\t\t\t}\n\t\t});\n\n\troute6 = new Route({\n\t\t\tprops: {\n\t\t\t\tpath: \"/affiliate-agreement\",\n\t\t\t\t$$slots: { default: [create_default_slot_4] },\n\t\t\t\t$$scope: { ctx }\n\t\t\t}\n\t\t});\n\n\troute7 = new Route({\n\t\t\tprops: {\n\t\t\t\tpath: \"/404\",\n\t\t\t\t$$slots: { default: [create_default_slot_3] },\n\t\t\t\t$$scope: { ctx }\n\t\t\t}\n\t\t});\n\n\troute8 = new Route({\n\t\t\tprops: {\n\t\t\t\tpath: \"/cart\",\n\t\t\t\t$$slots: { default: [create_default_slot_2] },\n\t\t\t\t$$scope: { ctx }\n\t\t\t}\n\t\t});\n\n\troute9 = new Route({\n\t\t\tprops: {\n\t\t\t\tpath: \"/*\",\n\t\t\t\t$$slots: { default: [create_default_slot_1] },\n\t\t\t\t$$scope: { ctx }\n\t\t\t}\n\t\t});\n\n\treturn {\n\t\tc() {\n\t\t\tcreate_component(route0.$$.fragment);\n\t\t\tt0 = space();\n\t\t\tcreate_component(route1.$$.fragment);\n\t\t\tt1 = space();\n\t\t\tcreate_component(route2.$$.fragment);\n\t\t\tt2 = space();\n\t\t\tcreate_component(route3.$$.fragment);\n\t\t\tt3 = space();\n\t\t\tcreate_component(route4.$$.fragment);\n\t\t\tt4 = space();\n\t\t\tcreate_component(route5.$$.fragment);\n\t\t\tt5 = space();\n\t\t\tcreate_component(route6.$$.fragment);\n\t\t\tt6 = space();\n\t\t\tcreate_component(route7.$$.fragment);\n\t\t\tt7 = space();\n\t\t\tcreate_component(route8.$$.fragment);\n\t\t\tt8 = space();\n\t\t\tcreate_component(route9.$$.fragment);\n\t\t},\n\t\tm(target, anchor) {\n\t\t\tmount_component(route0, target, anchor);\n\t\t\tinsert(target, t0, anchor);\n\t\t\tmount_component(route1, target, anchor);\n\t\t\tinsert(target, t1, anchor);\n\t\t\tmount_component(route2, target, anchor);\n\t\t\tinsert(target, t2, anchor);\n\t\t\tmount_component(route3, target, anchor);\n\t\t\tinsert(target, t3, anchor);\n\t\t\tmount_component(route4, target, anchor);\n\t\t\tinsert(target, t4, anchor);\n\t\t\tmount_component(route5, target, anchor);\n\t\t\tinsert(target, t5, anchor);\n\t\t\tmount_component(route6, target, anchor);\n\t\t\tinsert(target, t6, anchor);\n\t\t\tmount_component(route7, target, anchor);\n\t\t\tinsert(target, t7, anchor);\n\t\t\tmount_component(route8, target, anchor);\n\t\t\tinsert(target, t8, anchor);\n\t\t\tmount_component(route9, target, anchor);\n\t\t\tcurrent = true;\n\t\t},\n\t\tp(ctx, dirty) {\n\t\t\tconst route0_changes = {};\n\n\t\t\tif (dirty & /*$$scope*/ 4) {\n\t\t\t\troute0_changes.$$scope = { dirty, ctx };\n\t\t\t}\n\n\t\t\troute0.$set(route0_changes);\n\t\t\tconst route1_changes = {};\n\n\t\t\tif (dirty & /*$$scope, params*/ 6) {\n\t\t\t\troute1_changes.$$scope = { dirty, ctx };\n\t\t\t}\n\n\t\t\troute1.$set(route1_changes);\n\t\t\tconst route2_changes = {};\n\n\t\t\tif (dirty & /*$$scope*/ 4) {\n\t\t\t\troute2_changes.$$scope = { dirty, ctx };\n\t\t\t}\n\n\t\t\troute2.$set(route2_changes);\n\t\t\tconst route3_changes = {};\n\n\t\t\tif (dirty & /*$$scope*/ 4) {\n\t\t\t\troute3_changes.$$scope = { dirty, ctx };\n\t\t\t}\n\n\t\t\troute3.$set(route3_changes);\n\t\t\tconst route4_changes = {};\n\n\t\t\tif (dirty & /*$$scope*/ 4) {\n\t\t\t\troute4_changes.$$scope = { dirty, ctx };\n\t\t\t}\n\n\t\t\troute4.$set(route4_changes);\n\t\t\tconst route5_changes = {};\n\n\t\t\tif (dirty & /*$$scope*/ 4) {\n\t\t\t\troute5_changes.$$scope = { dirty, ctx };\n\t\t\t}\n\n\t\t\troute5.$set(route5_changes);\n\t\t\tconst route6_changes = {};\n\n\t\t\tif (dirty & /*$$scope*/ 4) {\n\t\t\t\troute6_changes.$$scope = { dirty, ctx };\n\t\t\t}\n\n\t\t\troute6.$set(route6_changes);\n\t\t\tconst route7_changes = {};\n\n\t\t\tif (dirty & /*$$scope*/ 4) {\n\t\t\t\troute7_changes.$$scope = { dirty, ctx };\n\t\t\t}\n\n\t\t\troute7.$set(route7_changes);\n\t\t\tconst route8_changes = {};\n\n\t\t\tif (dirty & /*$$scope*/ 4) {\n\t\t\t\troute8_changes.$$scope = { dirty, ctx };\n\t\t\t}\n\n\t\t\troute8.$set(route8_changes);\n\t\t\tconst route9_changes = {};\n\n\t\t\tif (dirty & /*$$scope*/ 4) {\n\t\t\t\troute9_changes.$$scope = { dirty, ctx };\n\t\t\t}\n\n\t\t\troute9.$set(route9_changes);\n\t\t},\n\t\ti(local) {\n\t\t\tif (current) return;\n\t\t\ttransition_in(route0.$$.fragment, local);\n\t\t\ttransition_in(route1.$$.fragment, local);\n\t\t\ttransition_in(route2.$$.fragment, local);\n\t\t\ttransition_in(route3.$$.fragment, local);\n\t\t\ttransition_in(route4.$$.fragment, local);\n\t\t\ttransition_in(route5.$$.fragment, local);\n\t\t\ttransition_in(route6.$$.fragment, local);\n\t\t\ttransition_in(route7.$$.fragment, local);\n\t\t\ttransition_in(route8.$$.fragment, local);\n\t\t\ttransition_in(route9.$$.fragment, local);\n\t\t\tcurrent = true;\n\t\t},\n\t\to(local) {\n\t\t\ttransition_out(route0.$$.fragment, local);\n\t\t\ttransition_out(route1.$$.fragment, local);\n\t\t\ttransition_out(route2.$$.fragment, local);\n\t\t\ttransition_out(route3.$$.fragment, local);\n\t\t\ttransition_out(route4.$$.fragment, local);\n\t\t\ttransition_out(route5.$$.fragment, local);\n\t\t\ttransition_out(route6.$$.fragment, local);\n\t\t\ttransition_out(route7.$$.fragment, local);\n\t\t\ttransition_out(route8.$$.fragment, local);\n\t\t\ttransition_out(route9.$$.fragment, local);\n\t\t\tcurrent = false;\n\t\t},\n\t\td(detaching) {\n\t\t\tdestroy_component(route0, detaching);\n\t\t\tif (detaching) detach(t0);\n\t\t\tdestroy_component(route1, detaching);\n\t\t\tif (detaching) detach(t1);\n\t\t\tdestroy_component(route2, detaching);\n\t\t\tif (detaching) detach(t2);\n\t\t\tdestroy_component(route3, detaching);\n\t\t\tif (detaching) detach(t3);\n\t\t\tdestroy_component(route4, detaching);\n\t\t\tif (detaching) detach(t4);\n\t\t\tdestroy_component(route5, detaching);\n\t\t\tif (detaching) detach(t5);\n\t\t\tdestroy_component(route6, detaching);\n\t\t\tif (detaching) detach(t6);\n\t\t\tdestroy_component(route7, detaching);\n\t\t\tif (detaching) detach(t7);\n\t\t\tdestroy_component(route8, detaching);\n\t\t\tif (detaching) detach(t8);\n\t\t\tdestroy_component(route9, detaching);\n\t\t}\n\t};\n}\n\nfunction create_fragment(ctx) {\n\tlet router;\n\tlet current;\n\n\trouter = new Router({\n\t\t\tprops: {\n\t\t\t\turl: /*url*/ ctx[0],\n\t\t\t\t$$slots: { default: [create_default_slot] },\n\t\t\t\t$$scope: { ctx }\n\t\t\t}\n\t\t});\n\n\treturn {\n\t\tc() {\n\t\t\tcreate_component(router.$$.fragment);\n\t\t},\n\t\tm(target, anchor) {\n\t\t\tmount_component(router, target, anchor);\n\t\t\tcurrent = true;\n\t\t},\n\t\tp(ctx, [dirty]) {\n\t\t\tconst router_changes = {};\n\t\t\tif (dirty & /*url*/ 1) router_changes.url = /*url*/ ctx[0];\n\n\t\t\tif (dirty & /*$$scope*/ 4) {\n\t\t\t\trouter_changes.$$scope = { dirty, ctx };\n\t\t\t}\n\n\t\t\trouter.$set(router_changes);\n\t\t},\n\t\ti(local) {\n\t\t\tif (current) return;\n\t\t\ttransition_in(router.$$.fragment, local);\n\t\t\tcurrent = true;\n\t\t},\n\t\to(local) {\n\t\t\ttransition_out(router.$$.fragment, local);\n\t\t\tcurrent = false;\n\t\t},\n\t\td(detaching) {\n\t\t\tdestroy_component(router, detaching);\n\t\t}\n\t};\n}\n\nfunction instance($$self, $$props, $$invalidate) {\n\tlet { url = \"\" } = $$props;\n\n\t$$self.$$set = $$props => {\n\t\tif ('url' in $$props) $$invalidate(0, url = $$props.url);\n\t};\n\n\treturn [url];\n}\n\nclass Routes extends SvelteComponent {\n\tconstructor(options) {\n\t\tsuper();\n\t\tinit(this, options, instance, create_fragment, safe_not_equal, { url: 0 });\n\t}\n}\n\nexport default Routes;", "import * as __SNOWPACK_ENV__ from '../_snowpack/env.js';\n\n/* src/App.svelte generated by Svelte v3.59.2 */\nimport {\n\tSvelteComponent,\n\tcreate_component,\n\tdestroy_component,\n\tdetach,\n\telement,\n\tinit,\n\tinsert,\n\tmount_component,\n\tnoop,\n\tsafe_not_equal,\n\tset_style,\n\ttransition_in,\n\ttransition_out\n} from \"../_snowpack/pkg/svelte/internal.js\";\n\nimport { onMount } from \"../_snowpack/pkg/svelte.js\";\nimport Routes from \"./routing/Routes.svelte.js\";\nimport { isMobile } from \"./util.js\";\n\nfunction create_fragment(ctx) {\n\tlet main;\n\tlet routes;\n\tlet current;\n\troutes = new Routes({});\n\n\treturn {\n\t\tc() {\n\t\t\tmain = element(\"main\");\n\t\t\tcreate_component(routes.$$.fragment);\n\t\t\tset_style(main, \"height\", \"100%\");\n\t\t},\n\t\tm(target, anchor) {\n\t\t\tinsert(target, main, anchor);\n\t\t\tmount_component(routes, main, null);\n\t\t\tcurrent = true;\n\t\t},\n\t\tp: noop,\n\t\ti(local) {\n\t\t\tif (current) return;\n\t\t\ttransition_in(routes.$$.fragment, local);\n\t\t\tcurrent = true;\n\t\t},\n\t\to(local) {\n\t\t\ttransition_out(routes.$$.fragment, local);\n\t\t\tcurrent = false;\n\t\t},\n\t\td(detaching) {\n\t\t\tif (detaching) detach(main);\n\t\t\tdestroy_component(routes);\n\t\t}\n\t};\n}\n\nfunction instance($$self) {\n\tonMount(() => {\n\t\tconsole.log(\"The current mode is: \" + __SNOWPACK_ENV__.MODE);\n\t});\n\n\treturn [];\n}\n\nclass App extends SvelteComponent {\n\tconstructor(options) {\n\t\tsuper();\n\t\tinit(this, options, instance, create_fragment, safe_not_equal, {});\n\t}\n}\n\nexport default App;", "import * as __SNOWPACK_ENV__ from '../_snowpack/env.js';\nimport.meta.env = __SNOWPACK_ENV__;\n\nimport App from \"./App.svelte.js\";\n\nlet app = new App({\n  target: document.body,\n});\n\nexport default app;\n\n// Hot Module Replacement (HMR) - Remove this snippet to remove HMR.\n// Learn more: https://www.snowpack.dev/concepts/hot-module-replacement\nif (undefined /* [snowpack] import.meta.hot */ ) {\n  undefined /* [snowpack] import.meta.hot */ .accept();\n  undefined /* [snowpack] import.meta.hot */ .dispose(() => {\n    app.$destroy();\n  });\n}\n"],
  "mappings": "6FAAA,oLAAO,GAAM,IAA0B,0BAC1B,GAAgC,mCAChC,GAAkC,gCAClC,GAAU,aACV,GAAO,aACP,GAAW,aACX,GAAM,GCNnB,YAAgB,EAEhB,GAAM,IAAW,AAAC,GAAM,EACxB,YAAgB,EAAK,EAAK,CACxB,OAAW,KAAK,GACd,EAAI,GAAK,EAAI,GACf,MAAO,GAET,YAAoB,EAAO,CACzB,MAAO,CAAC,CAAC,GAAU,OAAO,IAAU,UAAY,MAAO,IAAU,aAAe,MAAO,GAAM,MAAS,WAExG,YAAa,EAAI,CACf,MAAO,KAET,aAAwB,CACtB,MAAO,QAAO,OAAO,MAEvB,YAAiB,EAAK,CACpB,EAAI,QAAQ,IAEd,YAAqB,EAAO,CAC1B,MAAO,OAAO,IAAU,WAE1B,WAAwB,EAAG,EAAG,CAC5B,MAAO,IAAK,EAAI,GAAK,EAAI,IAAM,GAAM,GAAK,MAAO,IAAM,UAAY,MAAO,IAAM,WAElF,GAAI,IACJ,YAAuB,EAAa,EAAK,CACvC,MAAK,KACH,IAAuB,SAAS,cAAc,MAEhD,GAAqB,KAAO,EACrB,IAAgB,GAAqB,KAE9C,YAAkB,EAAK,CACrB,MAAO,QAAO,KAAK,GAAK,SAAW,EAErC,YAAmB,KAAU,EAAW,CACtC,GAAI,GAAS,KACX,MAAO,GAET,GAAM,GAAQ,EAAM,UAAU,GAAG,GACjC,MAAO,GAAM,YAAc,IAAM,EAAM,cAAgB,EAEzD,YAA6B,EAAW,EAAO,EAAU,CACvD,EAAU,GAAG,WAAW,KAAK,GAAU,EAAO,IAEhD,YAAqB,EAAY,EAAK,EAAS,EAAI,CACjD,GAAI,EAAY,CACd,GAAM,GAAW,GAAiB,EAAY,EAAK,EAAS,GAC5D,MAAO,GAAW,GAAG,IAGzB,YAA0B,EAAY,EAAK,EAAS,EAAI,CACtD,MAAO,GAAW,IAAM,EAAK,GAAO,EAAQ,IAAI,QAAS,EAAW,GAAG,EAAG,KAAS,EAAQ,IAE7F,YAA0B,EAAY,EAAS,EAAO,EAAI,CACxD,GAAI,EAAW,IAAM,EAAI,CACvB,GAAM,GAAO,EAAW,GAAG,EAAG,IAC9B,GAAI,EAAQ,QAAU,OACpB,MAAO,GAET,GAAI,MAAO,IAAS,SAAU,CAC5B,GAAM,GAAS,GACT,EAAM,KAAK,IAAI,EAAQ,MAAM,OAAQ,EAAK,QAChD,OAAS,GAAI,EAAG,EAAI,EAAK,GAAK,EAC5B,EAAO,GAAK,EAAQ,MAAM,GAAK,EAAK,GAEtC,MAAO,GAET,MAAO,GAAQ,MAAQ,EAEzB,MAAO,GAAQ,MAEjB,YAA0B,EAAM,EAAiB,EAAK,EAAS,EAAc,EAAqB,CAChG,GAAI,EAAc,CAChB,GAAM,GAAe,GAAiB,EAAiB,EAAK,EAAS,GACrE,EAAK,EAAE,EAAc,IAGzB,YAAkC,EAAS,CACzC,GAAI,EAAQ,IAAI,OAAS,GAAI,CAC3B,GAAM,GAAQ,GACR,EAAS,EAAQ,IAAI,OAAS,GACpC,OAAS,GAAI,EAAG,EAAI,EAAQ,IAC1B,EAAM,GAAK,GAEb,MAAO,GAET,MAAO,GAET,YAAgC,EAAO,CACrC,GAAM,GAAS,GACf,OAAW,KAAK,GACd,AAAI,EAAE,KAAO,KACX,GAAO,GAAK,EAAM,IACtB,MAAO,GAET,YAA4B,EAAO,EAAM,CACvC,GAAM,GAAO,GACb,EAAO,GAAI,KAAI,GACf,OAAW,KAAK,GACd,AAAI,CAAC,EAAK,IAAI,IAAM,EAAE,KAAO,KAC3B,GAAK,GAAK,EAAM,IACpB,MAAO,GAET,YAA0B,EAAe,CACvC,MAAO,IAAiB,GAAY,EAAc,SAAW,EAAc,QAAU,EAEvF,GAAM,IAAY,MAAO,SAAW,YAChC,GAAM,GAAY,IAAM,OAAO,YAAY,MAAQ,IAAM,KAAK,MAC9D,GAAM,GAAY,AAAC,GAAO,sBAAsB,GAAM,EACpD,GAAQ,GAAI,KAClB,YAAmB,EAAM,CACvB,GAAM,QAAQ,AAAC,GAAS,CACtB,AAAK,EAAK,EAAE,IACV,IAAM,OAAO,GACb,EAAK,OAGL,GAAM,OAAS,GACjB,GAAI,IAER,YAAc,EAAU,CACtB,GAAI,GACJ,MAAI,IAAM,OAAS,GACjB,GAAI,IACC,CACL,QAAS,GAAI,SAAQ,AAAC,GAAY,CAChC,GAAM,IAAI,EAAO,CAAC,EAAG,EAAU,EAAG,MAEpC,OAAQ,CACN,GAAM,OAAO,KAInB,GAAM,IAAU,MAAO,SAAW,YAAc,OAAS,MAAO,aAAe,YAAc,WAAa,OAC1G,WAAgB,EAAQ,EAAM,CAC5B,EAAO,YAAY,GAErB,YAAuB,EAAQ,EAAgB,EAAQ,CACrD,GAAM,GAAmB,GAAmB,GAC5C,GAAI,CAAC,EAAiB,eAAe,GAAiB,CACpD,GAAM,GAAQ,EAAQ,SACtB,EAAM,GAAK,EACX,EAAM,YAAc,EACpB,GAAkB,EAAkB,IAGxC,YAA4B,EAAM,CAChC,GAAI,CAAC,EACH,MAAO,UACT,GAAM,GAAO,EAAK,YAAc,EAAK,cAAgB,EAAK,cAC1D,MAAI,IAAQ,EAAK,KACR,EAEF,EAAK,cAEd,YAAiC,EAAM,CACrC,GAAM,GAAgB,EAAQ,SAC9B,UAAkB,GAAmB,GAAO,GACrC,EAAc,MAEvB,YAA2B,EAAM,EAAO,CACtC,SAAO,EAAK,MAAQ,EAAM,GACnB,EAAM,MAEf,WAAgB,EAAQ,EAAM,EAAQ,CACpC,EAAO,aAAa,EAAM,GAAU,MAEtC,WAAgB,EAAM,CACpB,AAAI,EAAK,YACP,EAAK,WAAW,YAAY,GAGhC,YAAsB,EAAY,EAAW,CAC3C,OAAS,GAAI,EAAG,EAAI,EAAW,OAAQ,GAAK,EAC1C,AAAI,EAAW,IACb,EAAW,GAAG,EAAE,GAGtB,WAAiB,EAAM,CACrB,MAAO,UAAS,cAAc,GAEhC,YAAc,EAAM,CAClB,MAAO,UAAS,eAAe,GAEjC,YAAiB,CACf,MAAO,IAAK,KAEd,aAAiB,CACf,MAAO,IAAK,IAEd,YAAgB,EAAM,EAAO,EAAS,EAAS,CAC7C,SAAK,iBAAiB,EAAO,EAAS,GAC/B,IAAM,EAAK,oBAAoB,EAAO,EAAS,GAExD,YAAyB,EAAI,CAC3B,MAAO,UAAS,EAAO,CACrB,SAAM,iBACC,EAAG,KAAK,KAAM,IAGzB,WAAc,EAAM,EAAW,EAAO,CACpC,AAAI,GAAS,KACX,EAAK,gBAAgB,GACd,EAAK,aAAa,KAAe,GACxC,EAAK,aAAa,EAAW,GAEjC,GAAM,IAAmC,CAAC,QAAS,UACnD,YAAwB,EAAM,EAAY,CACxC,GAAM,GAAc,OAAO,0BAA0B,EAAK,WAC1D,OAAW,KAAO,GAChB,AAAI,EAAW,IAAQ,KACrB,EAAK,gBAAgB,GAChB,AAAI,IAAQ,QACjB,EAAK,MAAM,QAAU,EAAW,GAC3B,AAAI,IAAQ,UACjB,EAAK,MAAQ,EAAK,GAAO,EAAW,GAC/B,AAAI,EAAY,IAAQ,EAAY,GAAK,KAAO,GAAiC,QAAQ,KAAS,GACvG,EAAK,GAAO,EAAW,GAEvB,EAAK,EAAM,EAAK,EAAW,IAIjC,YAA4B,EAAO,CACjC,GAAI,GACJ,MAAO,CACL,KAAK,EAAQ,CACX,EAAU,EACV,EAAQ,QAAQ,AAAC,GAAU,EAAM,KAAK,KAExC,GAAI,CACF,EAAQ,QAAQ,AAAC,GAAU,EAAM,OAAO,EAAM,QAAQ,GAAQ,MAIpE,YAAkB,EAAU,CAC1B,MAAO,OAAM,KAAK,EAAS,YAE7B,YAAkB,EAAO,EAAM,CAE7B,AADA,EAAO,GAAK,EACR,EAAM,OAAS,GAEnB,GAAM,KAAO,GAEf,YAAyB,EAAO,EAAO,CACrC,EAAM,MAAQ,GAAgB,GAEhC,YAAmB,EAAM,EAAK,EAAO,EAAW,CAC9C,AAAI,GAAS,KACX,EAAK,MAAM,eAAe,GAE1B,EAAK,MAAM,YAAY,EAAK,EAAO,EAAY,YAAc,IAGjE,YAAuB,EAAQ,EAAO,EAAU,CAC9C,OAAS,GAAI,EAAG,EAAI,EAAO,QAAQ,OAAQ,GAAK,EAAG,CACjD,GAAM,GAAS,EAAO,QAAQ,GAC9B,GAAI,EAAO,UAAY,EAAO,CAC5B,EAAO,SAAW,GAClB,QAGJ,AAAI,EAAC,GAAY,IAAU,SACzB,GAAO,cAAgB,IAG3B,YAAsB,EAAQ,CAC5B,GAAM,GAAkB,EAAO,cAAc,YAC7C,MAAO,IAAmB,EAAgB,QAE5C,YAAsB,EAAU,EAAM,EAAQ,CAC5C,EAAS,UAAU,EAAS,MAAQ,UAAU,GAEhD,YAAsB,EAAM,EAAQ,CAAC,UAAU,GAAO,aAAa,IAAS,GAAI,CAC9E,GAAM,GAAI,SAAS,YAAY,eAC/B,SAAE,gBAAgB,EAAM,EAAS,EAAY,GACtC,EAET,YAAoC,EAAW,EAAO,CACpD,MAAO,IAAI,GAAU,GAEvB,GAAM,IAAiB,GAAI,KACvB,GAAS,EACb,YAAc,EAAK,CACjB,GAAI,GAAQ,KACR,EAAI,EAAI,OACZ,KAAO,KACL,EAAS,IAAS,GAAK,EAAQ,EAAI,WAAW,GAChD,MAAO,KAAU,EAEnB,YAAkC,EAAK,EAAM,CAC3C,GAAM,GAAO,CAAC,WAAY,GAAwB,GAAO,MAAO,IAChE,UAAe,IAAI,EAAK,GACjB,EAET,YAAqB,EAAM,EAAG,EAAG,EAAU,EAAO,EAAM,EAAI,EAAM,EAAG,CACnE,GAAM,GAAO,OAAS,EAClB,EAAY;AAAA,EAChB,OAAS,GAAI,EAAG,GAAK,EAAG,GAAK,EAAM,CACjC,GAAM,GAAI,EAAK,GAAI,GAAK,EAAK,GAC7B,GAAa,EAAI,IAAM,KAAK,EAAG,EAAG,EAAI;AAAA,EAGxC,GAAM,GAAO,EAAY,SAAS,EAAG,EAAG,EAAI;AAAA,GAEtC,EAAO,YAAY,GAAK,MAAS,IACjC,EAAM,GAAmB,GACzB,CAAC,aAAY,SAAS,GAAe,IAAI,IAAQ,GAAyB,EAAK,GACrF,AAAK,EAAM,IACT,GAAM,GAAQ,GACd,EAAW,WAAW,cAAc,KAAQ,IAAQ,EAAW,SAAS,SAE1E,GAAM,GAAY,EAAK,MAAM,WAAa,GAC1C,SAAK,MAAM,UAAY,GAAG,EAAY,GAAG,MAAgB,KAAK,KAAQ,cAAqB,aAC3F,IAAU,EACH,EAET,YAAqB,EAAM,EAAM,CAC/B,GAAM,GAAY,GAAK,MAAM,WAAa,IAAI,MAAM,MAC9C,EAAO,EAAS,OAAO,EAAO,AAAC,GAAS,EAAK,QAAQ,GAAQ,EAAI,AAAC,GAAS,EAAK,QAAQ,cAAgB,IACxG,EAAU,EAAS,OAAS,EAAK,OACvC,AAAI,GACF,GAAK,MAAM,UAAY,EAAK,KAAK,MACjC,IAAU,EACL,IACH,MAGN,aAAuB,CACrB,GAAI,IAAM,CACR,AAAI,IAEJ,IAAe,QAAQ,AAAC,GAAS,CAC/B,GAAM,CAAC,aAAa,EAAK,WACzB,AAAI,GACF,EAAO,KAEX,GAAe,WAGnB,GAAI,IACJ,YAA+B,EAAW,CACxC,GAAoB,EAEtB,aAAiC,CAC/B,GAAI,CAAC,GACH,KAAM,IAAI,OAAM,oDAClB,MAAO,IAET,YAAiB,EAAI,CACnB,KAAwB,GAAG,SAAS,KAAK,GAE3C,YAAmB,EAAI,CACrB,KAAwB,GAAG,WAAW,KAAK,GAE7C,aAAiC,CAC/B,GAAM,GAAY,KAClB,MAAO,CAAC,EAAM,EAAQ,CAAC,aAAa,IAAS,KAAO,CAClD,GAAM,GAAY,EAAU,GAAG,UAAU,GACzC,GAAI,EAAW,CACb,GAAM,GAAQ,GAAa,EAAM,EAAQ,CAAC,eAC1C,SAAU,QAAQ,QAAQ,AAAC,GAAO,CAChC,EAAG,KAAK,EAAW,KAEd,CAAC,EAAM,iBAEhB,MAAO,IAGX,YAAoB,EAAK,EAAS,CAChC,YAAwB,GAAG,QAAQ,IAAI,EAAK,GACrC,EAET,YAAoB,EAAK,CACvB,MAAO,MAAwB,GAAG,QAAQ,IAAI,GAEhD,YAAgB,EAAW,EAAO,CAChC,GAAM,GAAY,EAAU,GAAG,UAAU,EAAM,MAC/C,AAAI,GACF,EAAU,QAAQ,QAAQ,AAAC,GAAO,EAAG,KAAK,KAAM,IAGpD,GAAM,IAAmB,GACnB,GAAoB,GACtB,GAAmB,GACjB,GAAkB,GAClB,GAAmC,QAAQ,UAC7C,GAAmB,GACvB,aAA2B,CACzB,AAAK,IACH,IAAmB,GACnB,GAAiB,KAAK,KAG1B,aAAgB,CACd,YACO,GAET,YAA6B,EAAI,CAC/B,GAAiB,KAAK,GAExB,GAAM,IAAiB,GAAI,KACvB,GAAW,EACf,aAAiB,CACf,GAAI,KAAa,EACf,OAEF,GAAM,GAAkB,GACxB,EAAG,CACD,GAAI,CACF,KAAO,GAAW,GAAiB,QAAQ,CACzC,GAAM,GAAY,GAAiB,IACnC,KACA,GAAsB,GACtB,GAAO,EAAU,WAEZ,EAAP,CACA,SAAiB,OAAS,EAC1B,GAAW,EACL,EAKR,IAHA,GAAsB,MACtB,GAAiB,OAAS,EAC1B,GAAW,EACJ,GAAkB,QACvB,GAAkB,QACpB,OAAS,GAAI,EAAG,EAAI,GAAiB,OAAQ,GAAK,EAAG,CACnD,GAAM,GAAW,GAAiB,GAClC,AAAK,GAAe,IAAI,IACtB,IAAe,IAAI,GACnB,KAGJ,GAAiB,OAAS,QACnB,GAAiB,QAC1B,KAAO,GAAgB,QACrB,GAAgB,QAElB,GAAmB,GACnB,GAAe,QACf,GAAsB,GAExB,YAAgB,EAAI,CAClB,GAAI,EAAG,WAAa,KAAM,CACxB,EAAG,SACH,GAAQ,EAAG,eACX,GAAM,GAAQ,EAAG,MACjB,EAAG,MAAQ,CAAC,IACZ,EAAG,UAAY,EAAG,SAAS,EAAE,EAAG,IAAK,GACrC,EAAG,aAAa,QAAQ,KAG5B,YAAgC,EAAK,CACnC,GAAM,GAAW,GACX,EAAU,GAChB,GAAiB,QAAQ,AAAC,GAAM,EAAI,QAAQ,KAAO,GAAK,EAAS,KAAK,GAAK,EAAQ,KAAK,IACxF,EAAQ,QAAQ,AAAC,GAAM,KACvB,GAAmB,EAErB,GAAI,IACJ,aAAgB,CACd,MAAK,KACH,IAAU,QAAQ,UAClB,GAAQ,KAAK,IAAM,CACjB,GAAU,QAGP,GAET,YAAkB,EAAM,EAAW,EAAM,CACvC,EAAK,cAAc,GAAa,GAAG,EAAY,QAAU,UAAU,MAErE,GAAM,IAAW,GAAI,KACjB,GACJ,aAAwB,CACtB,GAAS,CACP,EAAG,EACH,EAAG,GACH,EAAG,IAGP,aAAwB,CACtB,AAAK,GAAO,GACV,GAAQ,GAAO,GAEjB,GAAS,GAAO,EAElB,WAAuB,EAAO,EAAO,CACnC,AAAI,GAAS,EAAM,GACjB,IAAS,OAAO,GAChB,EAAM,EAAE,IAGZ,WAAwB,EAAO,EAAO,EAAS,EAAU,CACvD,GAAI,GAAS,EAAM,EAAG,CACpB,GAAI,GAAS,IAAI,GACf,OACF,GAAS,IAAI,GACb,GAAO,EAAE,KAAK,IAAM,CAClB,GAAS,OAAO,GACZ,GACE,IACF,EAAM,EAAE,GACV,OAGJ,EAAM,EAAE,OACH,AAAI,IACT,IAGJ,GAAM,IAAkB,CAAC,SAAU,GACnC,YAAyC,EAAM,EAAI,EAAQ,EAAO,CAChE,GAAM,GAAU,CAAC,UAAW,QACxB,EAAS,EAAG,EAAM,EAAQ,GAC1B,EAAI,EAAQ,EAAI,EAChB,EAAkB,KAClB,EAAkB,KAClB,EAAiB,KACrB,YAA2B,CACzB,AAAI,GACF,GAAY,EAAM,GAEtB,WAAe,EAAS,EAAU,CAChC,GAAM,GAAI,EAAQ,EAAI,EACtB,UAAY,KAAK,IAAI,GACd,CACL,EAAG,EACH,EAAG,EAAQ,EACX,IACA,WACA,MAAO,EAAQ,MACf,IAAK,EAAQ,MAAQ,EACrB,MAAO,EAAQ,OAGnB,WAAY,EAAG,CACb,GAAM,CAAC,QAAQ,EAAG,WAAW,IAAK,SAAS,GAAU,KAAM,EAAQ,EAAM,OAAO,GAAU,GACpF,EAAU,CACd,MAAO,KAAQ,EACf,KAEF,AAAK,GACH,GAAQ,MAAQ,GAChB,GAAO,GAAK,GAEd,AAAI,GAAmB,EACrB,EAAkB,EAEd,IACF,KACA,EAAiB,GAAY,EAAM,EAAG,EAAG,EAAU,EAAO,EAAQ,IAEhE,GACF,EAAM,EAAG,GACX,EAAkB,EAAM,EAAS,GACjC,GAAoB,IAAM,GAAS,EAAM,EAAG,UAC5C,GAAK,AAAC,GAAS,CAUb,GATI,GAAmB,EAAO,EAAgB,OAC5C,GAAkB,EAAM,EAAiB,GACzC,EAAkB,KAClB,GAAS,EAAM,EAAgB,EAAG,SAC9B,GACF,KACA,EAAiB,GAAY,EAAM,EAAG,EAAgB,EAAG,EAAgB,SAAU,EAAG,EAAQ,EAAO,OAGrG,GACF,GAAI,GAAQ,EAAgB,IAC1B,EAAM,EAAI,EAAgB,EAAG,EAAI,GACjC,GAAS,EAAM,EAAgB,EAAG,OAC7B,GACH,CAAI,EAAgB,EAClB,IAEK,EAAE,EAAgB,MAAM,GAC3B,GAAQ,EAAgB,MAAM,IAGpC,EAAkB,aACT,GAAQ,EAAgB,MAAO,CACxC,GAAM,GAAI,EAAO,EAAgB,MACjC,EAAI,EAAgB,EAAI,EAAgB,EAAI,EAAO,EAAI,EAAgB,UACvE,EAAM,EAAG,EAAI,IAGjB,MAAO,CAAC,CAAE,IAAmB,MAInC,MAAO,CACL,IAAI,EAAG,CACL,AAAI,GAAY,GACd,KAAO,KAAK,IAAM,CAChB,EAAS,EAAO,GAChB,EAAG,KAGL,EAAG,IAGP,KAAM,CACJ,IACA,EAAkB,EAAkB,OAI1C,YAAwB,EAAU,EAAM,CACtC,GAAM,GAAQ,EAAK,MAAQ,GAC3B,WAAiB,EAAM,EAAO,EAAK,EAAO,CACxC,GAAI,EAAK,QAAU,EACjB,OACF,EAAK,SAAW,EAChB,GAAI,GAAY,EAAK,IACrB,AAAI,IAAQ,QACV,GAAY,EAAU,QACtB,EAAU,GAAO,GAEnB,GAAM,GAAQ,GAAS,GAAK,QAAU,GAAM,GACxC,EAAc,GAClB,AAAI,EAAK,OACP,CAAI,EAAK,OACP,EAAK,OAAO,QAAQ,CAAC,EAAQ,IAAM,CACjC,AAAI,IAAM,GAAS,GACjB,MACA,EAAe,EAAQ,EAAG,EAAG,IAAM,CACjC,AAAI,EAAK,OAAO,KAAO,GACrB,GAAK,OAAO,GAAK,QAGrB,QAIJ,EAAK,MAAM,EAAE,GAEf,EAAM,IACN,EAAc,EAAO,GACrB,EAAM,EAAE,EAAK,QAAS,EAAK,QAC3B,EAAc,IAEhB,EAAK,MAAQ,EACT,EAAK,QACP,GAAK,OAAO,GAAS,GACnB,GACF,KAGJ,GAAI,GAAW,GAAW,CACxB,GAAM,GAAqB,KAa3B,GAZA,EAAS,KAAK,AAAC,GAAU,CACvB,GAAsB,GACtB,EAAQ,EAAK,KAAM,EAAG,EAAK,MAAO,GAClC,GAAsB,OACrB,AAAC,GAAU,CAIZ,GAHA,GAAsB,GACtB,EAAQ,EAAK,MAAO,EAAG,EAAK,MAAO,GACnC,GAAsB,MAClB,CAAC,EAAK,SACR,KAAM,KAGN,EAAK,UAAY,EAAK,QACxB,SAAQ,EAAK,QAAS,GACf,OAEJ,CACL,GAAI,EAAK,UAAY,EAAK,KACxB,SAAQ,EAAK,KAAM,EAAG,EAAK,MAAO,GAC3B,GAET,EAAK,SAAW,GAGpB,YAAmC,EAAM,EAAK,EAAO,CACnD,GAAM,GAAY,EAAI,QAChB,CAAC,YAAY,EACnB,AAAI,EAAK,UAAY,EAAK,MACxB,GAAU,EAAK,OAAS,GAEtB,EAAK,UAAY,EAAK,OACxB,GAAU,EAAK,OAAS,GAE1B,EAAK,MAAM,EAAE,EAAW,GAE1B,YAAiC,EAAO,EAAQ,CAC9C,EAAe,EAAO,EAAG,EAAG,IAAM,CAChC,EAAO,OAAO,EAAM,OAGxB,YAA2B,EAAY,EAAO,EAAS,EAAS,EAAK,EAAM,EAAQ,EAAM,EAAS,EAAmB,EAAM,EAAa,CACtI,GAAI,GAAI,EAAW,OACf,EAAI,EAAK,OACT,EAAI,EACF,EAAc,GACpB,KAAO,KACL,EAAY,EAAW,GAAG,KAAO,EACnC,GAAM,GAAa,GACb,EAAa,GAAI,KACjB,EAAS,GAAI,KACb,EAAU,GAEhB,IADA,EAAI,EACG,KAAK,CACV,GAAM,GAAY,EAAY,EAAK,EAAM,GACnC,EAAM,EAAQ,GAChB,GAAQ,EAAO,IAAI,GACvB,AAAK,GAGM,GACT,EAAQ,KAAK,IAAM,GAAM,EAAE,EAAW,IAHtC,IAAQ,EAAkB,EAAK,GAC/B,GAAM,KAIR,EAAW,IAAI,EAAK,EAAW,GAAK,IAChC,IAAO,IACT,EAAO,IAAI,EAAK,KAAK,IAAI,EAAI,EAAY,KAE7C,GAAM,GAAY,GAAI,KAChB,EAAW,GAAI,KACrB,WAAiB,EAAO,CACtB,EAAc,EAAO,GACrB,EAAM,EAAE,EAAM,GACd,EAAO,IAAI,EAAM,IAAK,GACtB,EAAO,EAAM,MACb,IAEF,KAAO,GAAK,GAAG,CACb,GAAM,GAAY,EAAW,EAAI,GAC3B,EAAY,EAAW,EAAI,GAC3B,GAAU,EAAU,IACpB,GAAU,EAAU,IAC1B,AAAI,IAAc,EAChB,GAAO,EAAU,MACjB,IACA,KACK,AAAK,EAAW,IAAI,IAGpB,AAAI,CAAC,EAAO,IAAI,KAAY,EAAU,IAAI,IAC/C,EAAQ,GACH,AAAI,EAAS,IAAI,IACtB,IACK,AAAI,EAAO,IAAI,IAAW,EAAO,IAAI,IAC1C,GAAS,IAAI,IACb,EAAQ,IAER,GAAU,IAAI,IACd,KAXA,GAAQ,EAAW,GACnB,KAaJ,KAAO,KAAK,CACV,GAAM,GAAY,EAAW,GAC7B,AAAK,EAAW,IAAI,EAAU,MAC5B,EAAQ,EAAW,GAEvB,KAAO,GACL,EAAQ,EAAW,EAAI,IACzB,UAAQ,GACD,EAET,YAA2B,EAAQ,EAAS,CAC1C,GAAM,GAAU,GACV,EAAc,GACd,EAAgB,CAAC,QAAS,GAC5B,EAAI,EAAO,OACf,KAAO,KAAK,CACV,GAAM,GAAI,EAAO,GACX,EAAI,EAAQ,GAClB,GAAI,EAAG,CACL,OAAW,KAAO,GAChB,AAAM,IAAO,IACX,GAAY,GAAO,GAEvB,OAAW,KAAO,GAChB,AAAK,EAAc,IACjB,GAAQ,GAAO,EAAE,GACjB,EAAc,GAAO,GAGzB,EAAO,GAAK,MAEZ,QAAW,KAAO,GAChB,EAAc,GAAO,EAI3B,OAAW,KAAO,GAChB,AAAM,IAAO,IACX,GAAQ,GAAO,QAEnB,MAAO,GAET,YAA2B,EAAc,CACvC,MAAO,OAAO,IAAiB,UAAY,IAAiB,KAAO,EAAe,GAEpF,WAA0B,EAAO,CAC/B,GAAS,EAAM,IAEjB,WAAyB,EAAW,EAAQ,EAAQ,EAAe,CACjE,GAAM,CAAC,WAAU,gBAAgB,EAAU,GAC3C,GAAY,EAAS,EAAE,EAAQ,GAC1B,GACH,GAAoB,IAAM,CACxB,GAAM,GAAiB,EAAU,GAAG,SAAS,IAAI,IAAK,OAAO,IAC7D,AAAI,EAAU,GAAG,WACf,EAAU,GAAG,WAAW,KAAK,GAAG,GAEhC,GAAQ,GAEV,EAAU,GAAG,SAAW,KAG5B,EAAa,QAAQ,IAEvB,WAA2B,EAAW,EAAW,CAC/C,GAAM,GAAK,EAAU,GACrB,AAAI,EAAG,WAAa,MAClB,IAAuB,EAAG,cAC1B,GAAQ,EAAG,YACX,EAAG,UAAY,EAAG,SAAS,EAAE,GAC7B,EAAG,WAAa,EAAG,SAAW,KAC9B,EAAG,IAAM,IAGb,YAAoB,EAAW,EAAG,CAChC,AAAI,EAAU,GAAG,MAAM,KAAO,IAC5B,IAAiB,KAAK,GACtB,KACA,EAAU,GAAG,MAAM,KAAK,IAE1B,EAAU,GAAG,MAAM,EAAI,GAAK,IAAM,GAAK,EAAI,GAE7C,WAAc,EAAW,EAAS,EAAU,EAAiB,EAAY,EAAO,EAAgB,EAAQ,CAAC,IAAK,CAC5G,GAAM,GAAmB,GACzB,GAAsB,GACtB,GAAM,GAAK,EAAU,GAAK,CACxB,SAAU,KACV,IAAK,GACL,QACA,OAAQ,EACR,UAAW,EACX,MAAO,KACP,SAAU,GACV,WAAY,GACZ,cAAe,GACf,cAAe,GACf,aAAc,GACd,QAAS,GAAI,KAAI,EAAQ,SAAY,GAAmB,EAAiB,GAAG,QAAU,KACtF,UAAW,KACX,QACA,WAAY,GACZ,KAAM,EAAQ,QAAU,EAAiB,GAAG,MAE9C,GAAkB,EAAe,EAAG,MACpC,GAAI,GAAQ,GAeZ,GAdA,EAAG,IAAM,EAAW,EAAS,EAAW,EAAQ,OAAS,GAAI,CAAC,EAAG,KAAQ,IAAS,CAChF,GAAM,GAAQ,EAAK,OAAS,EAAK,GAAK,EACtC,MAAI,GAAG,KAAO,EAAW,EAAG,IAAI,GAAI,EAAG,IAAI,GAAK,IAC1C,EAAC,EAAG,YAAc,EAAG,MAAM,IAC7B,EAAG,MAAM,GAAG,GACV,GACF,GAAW,EAAW,IAEnB,IACJ,GACL,EAAG,SACH,EAAQ,GACR,GAAQ,EAAG,eACX,EAAG,SAAW,EAAkB,EAAgB,EAAG,KAAO,GACtD,EAAQ,OAAQ,CAClB,GAAI,EAAQ,QAAS,CACnB,GAAM,GAAQ,GAAS,EAAQ,QAC/B,EAAG,UAAY,EAAG,SAAS,EAAE,GAC7B,EAAM,QAAQ,OAEd,GAAG,UAAY,EAAG,SAAS,IAE7B,AAAI,EAAQ,OACV,EAAc,EAAU,GAAG,UAC7B,EAAgB,EAAW,EAAQ,OAAQ,EAAQ,OAAQ,EAAQ,eACnE,KAEF,GAAsB,GAExB,WAAsB,CACpB,UAAW,CACT,EAAkB,KAAM,GACxB,KAAK,SAAW,EAElB,IAAI,EAAM,EAAU,CAClB,GAAI,CAAC,GAAY,GACf,MAAO,GAET,GAAM,GAAY,KAAK,GAAG,UAAU,IAAU,MAAK,GAAG,UAAU,GAAQ,IACxE,SAAU,KAAK,GACR,IAAM,CACX,GAAM,GAAQ,EAAU,QAAQ,GAChC,AAAI,IAAU,IACZ,EAAU,OAAO,EAAO,IAG9B,KAAK,EAAS,CACZ,AAAI,KAAK,OAAS,CAAC,GAAS,IAC1B,MAAK,GAAG,WAAa,GACrB,KAAK,MAAM,GACX,KAAK,GAAG,WAAa,MCz4BpB,aAAkC,CACvC,GAAI,GAAuB,GAE3B,MAAK,IACH,SAAQ,IAAI,4EACZ,EAAM,yBAGD,EAGF,aAA8B,CACnC,GAAI,GAAyB,GAE7B,MAAK,IACH,SAAQ,IAAI,0EACZ,EAAQ,SAGH,EAGF,aAA8B,CACnC,MAAO,QAAO,aAAa,QAAQ,cAG9B,YAA4B,EAAY,CAC7C,OAAO,aAAa,QAAQ,aAAc,GAOrC,aAAoB,CACzB,GAAI,GAAQ,GACZ,MAAC,UAAS,EAAE,CAAC,AAAG,uVAAsV,KAAK,IAAI,0kDAA0kD,KAAK,EAAE,OAAO,EAAE,MAAK,GAAQ,KAAQ,UAAU,WAAW,UAAU,QAAQ,OAAO,OACrgE,ECrCT,GAAM,IAAmB,GACzB,YAAkB,EAAO,EAAO,CAC9B,MAAO,CACL,UAAW,GAAS,EAAO,GAAO,WAGtC,YAAkB,EAAO,EAAQ,EAAM,CACrC,GAAI,GACE,EAAc,GAAI,KACxB,WAAa,EAAW,CACtB,GAAI,EAAe,EAAO,IACxB,GAAQ,EACJ,GAAM,CACR,GAAM,GAAY,CAAC,GAAiB,OACpC,OAAW,KAAc,GACvB,EAAW,KACX,GAAiB,KAAK,EAAY,GAEpC,GAAI,EAAW,CACb,OAAS,GAAI,EAAG,EAAI,GAAiB,OAAQ,GAAK,EAChD,GAAiB,GAAG,GAAG,GAAiB,EAAI,IAE9C,GAAiB,OAAS,IAKlC,WAAgB,EAAI,CAClB,EAAI,EAAG,IAET,WAAoB,EAAK,EAAa,EAAM,CAC1C,GAAM,GAAa,CAAC,EAAK,GACzB,SAAY,IAAI,GACZ,EAAY,OAAS,GACvB,GAAO,EAAM,IAAQ,GAEvB,EAAI,GACG,IAAM,CACX,EAAY,OAAO,GACf,EAAY,OAAS,GAAK,GAC5B,KACA,EAAO,OAIb,MAAO,CAAC,MAAK,SAAQ,UAAW,GAElC,YAAiB,EAAQ,EAAI,EAAe,CAC1C,GAAM,GAAS,CAAC,MAAM,QAAQ,GACxB,EAAe,EAAS,CAAC,GAAU,EACnC,EAAO,EAAG,OAAS,EACzB,MAAO,IAAS,EAAe,AAAC,GAAQ,CACtC,GAAI,GAAU,GACR,EAAS,GACX,EAAU,EACV,EAAU,EACR,EAAO,IAAM,CACjB,GAAI,EACF,OAEF,IACA,GAAM,GAAS,EAAG,EAAS,EAAO,GAAK,EAAQ,GAC/C,AAAI,EACF,EAAI,GAEJ,EAAU,GAAY,GAAU,EAAS,GAGvC,EAAgB,EAAa,IAAI,CAAC,EAAO,IAAM,GAAU,EAAO,AAAC,GAAU,CAC/E,EAAO,GAAK,EACZ,GAAW,CAAE,IAAK,GACd,GACF,KAED,IAAM,CACP,GAAW,GAAK,KAElB,SAAU,GACV,IACO,UAAgB,CACrB,GAAQ,GACR,IACA,EAAU,MCjFhB,GAAM,IAAW,GACX,GAAS,GACT,GAAU,GAOV,GAAQ,SACR,GAAiB,EACjB,GAAgB,EAChB,GAAiB,EACjB,GAAgB,EAChB,GAAc,EAQd,GAAa,AAAC,GAAQ,EAAI,QAAQ,eAAgB,IAAI,MAAM,KAM5D,GAAe,AAAC,GAAW,EAAO,QAAQ,eAAgB,IAO1D,GAAY,CAAC,EAAO,IAAU,CAChC,GAAM,GAAQ,EAAM,QACd,EACA,GAAW,EAAM,MAAM,OAAO,CAAC,EAAO,IAClC,IAAS,GAET,AAAI,IAAY,GACZ,GAAS,GACN,AAAI,GAAM,KAAK,GAClB,GAAS,GACN,AAAI,EAAQ,KAAO,IACtB,GAAS,GAAiB,GAE1B,GAAS,GAGN,GACR,GAET,MAAO,CAAE,QAAO,QAAO,UAQrB,GAAa,AAAC,GAChB,EACK,IAAI,IACJ,KAAK,CAAC,EAAG,IACN,EAAE,MAAQ,EAAE,MAAQ,EAAI,EAAE,MAAQ,EAAE,MAAQ,GAAK,EAAE,MAAQ,EAAE,OAwBnE,GAAO,CAAC,EAAQ,IAAQ,CAC1B,GAAI,GACA,EAEE,CAAC,GAAe,EAAI,MAAM,KAC1B,EAAc,GAAW,GACzB,EAAY,EAAY,KAAO,GAC/B,EAAS,GAAW,GAE1B,OAAS,GAAI,EAAG,EAAI,EAAO,OAAQ,EAAI,EAAG,IAAK,CAC3C,GAAM,GAAQ,EAAO,GAAG,MACpB,EAAS,GAEb,GAAI,EAAM,QAAS,CACf,EAAW,CACP,QACA,OAAQ,GACR,OAEJ,SAGJ,GAAM,GAAgB,GAAW,EAAM,MACjC,EAAS,GACT,EAAM,KAAK,IAAI,EAAY,OAAQ,EAAc,QACnD,EAAQ,EAEZ,KAAO,EAAQ,EAAK,IAAS,CACzB,GAAM,GAAe,EAAc,GAC7B,EAAa,EAAY,GAE/B,GAAI,GAAgB,EAAa,KAAO,IAAK,CAIzC,GAAM,GACF,IAAiB,IAAM,IAAM,EAAa,MAAM,GAEpD,EAAO,GAAa,EACf,MAAM,GACN,IAAI,oBACJ,KAAK,KACV,MAGJ,GAAI,MAAO,IAAe,YAAa,CAInC,EAAS,GACT,MAGJ,GAAM,GAAe,GAAM,KAAK,GAEhC,GAAI,GAAgB,CAAC,EAAW,CAC5B,GAAM,GAAQ,mBAAmB,GACjC,EAAO,EAAa,IAAM,UACnB,IAAiB,EAAY,CAIpC,EAAS,GACT,OAIR,GAAI,CAAC,EAAQ,CACT,EAAQ,CACJ,QACA,SACA,IAAK,IAAM,EAAY,MAAM,EAAG,GAAO,KAAK,MAEhD,OAIR,MAAO,IAAS,GAAY,MAQ1B,GAAW,CAAC,EAAU,IAAU,EAAY,GAAQ,IAAI,IAAU,IA6BlE,GAAU,CAAC,EAAI,IAAS,CAE1B,GAAI,EAAG,WAAW,KAAM,MAAO,GAE/B,GAAM,CAAC,EAAY,GAAW,EAAG,MAAM,KACjC,CAAC,GAAgB,EAAK,MAAM,KAC5B,EAAa,GAAW,GACxB,EAAe,GAAW,GAGhC,GAAI,EAAW,KAAO,GAAI,MAAO,IAAS,EAAc,GAIxD,GAAI,CAAC,EAAW,GAAG,WAAW,KAAM,CAChC,GAAM,GAAW,EAAa,OAAO,GAAY,KAAK,KACtD,MAAO,IAAU,KAAiB,IAAM,GAAK,KAAO,EAAU,GAQlE,GAAM,GAAc,EAAa,OAAO,GAClC,EAAW,GAEjB,SAAY,QAAQ,AAAC,GAAY,CAC7B,AAAI,IAAY,KAAM,EAAS,MACtB,IAAY,KAAK,EAAS,KAAK,KAGrC,GAAS,IAAM,EAAS,KAAK,KAAM,IAOxC,GAAe,CAAC,EAAU,IAC5B,GAAG,GACC,IAAS,IACH,EACA,GAAG,GAAa,MAAa,GAAa,SAMlD,GAAiB,AAAC,GACpB,CAAC,EAAM,kBACP,EAAM,SAAW,GACjB,CAAE,GAAM,SAAW,EAAM,QAAU,EAAM,SAAW,EAAM,UAExD,GAAY,IACd,MAAO,SAAW,aAClB,YAAc,SACd,YAAc,QAGZ,GAA2B,GAAU,EAAE,OAAQ,EAAwB,IACvE,GAA2B,GAAQ,EAAE,OAAQ,CAAC,CAAiB,EAAI,KAEzE,YAAyB,EAAK,CAC7B,GAAI,GACA,EACA,EACA,EACE,EAAmC,EAAI,IAAI,QAC3C,EAAe,GAAY,EAAuB,EAAiB,EAAI,IAAK,IAE9E,EAAW,CACd,CAAE,KAAe,EAAI,IACrB,CAAE,eAAgC,EAAI,IAC5B,EAAI,GACE,EAAI,IAGjB,EAAS,GAEb,OAAS,GAAI,EAAG,EAAI,EAAS,OAAQ,GAAK,EACzC,EAAS,GAAO,EAAQ,EAAS,IAGlC,MAAO,CACN,GAAI,CACH,EAAI,EAAQ,KACR,GAAc,EAAa,IAC/B,GAAe,EAAG,IAEnB,EAAE,EAAQ,EAAQ,CACjB,EAAO,EAAQ,EAAG,GAEd,GACH,EAAa,EAAE,EAAG,MAGnB,EAAU,GAEL,GACJ,GAAU,GAAO,EAAG,QAAqB,EAAI,IAC7C,EAAU,KAGZ,EAAE,EAAK,CAAC,GAAQ,CACf,AAAI,GACC,EAAa,GAAM,EAAC,GAAW,EAAiC,QACnE,GACC,EACA,EACA,EACY,EAAI,IAChB,AAAC,EAEC,GAAiB,EAAmC,EAAI,IAAK,EAAO,IADpE,GAAqC,EAAI,KAE3C,IAKH,GAAe,EAAG,EAAS,GAAkB,EAAU,CACrD,EAAC,GAAW,EAAiB,IAAM,CAAE,KAAe,EAAI,IACxD,EAAC,GAAW,EAAwB,IAAM,CAAE,eAAgC,EAAI,IACjF,EAAkB,GAAe,EAAI,GACrC,EAAwB,IAAsB,EAAI,OAGpD,EAAE,EAAO,CACR,AAAI,GACJ,GAAc,EAAc,GAC5B,EAAU,KAEX,EAAE,EAAO,CACR,EAAe,EAAc,GAC7B,EAAU,IAEX,EAAE,EAAW,CACZ,AAAI,GAAW,EAAO,GAClB,GAAc,EAAa,EAAE,GACjC,EAAU,GACV,MAKH,YAAkB,EAAQ,EAAS,EAAc,CAChD,GAAI,GACE,EAAmB,CAAC,KAAK,UAAU,QAAQ,YAC7C,EAAc,GAAmB,EAAS,GAC1C,EACA,EACA,CAAE,QAAS,EAAQ,GAAI,WAAY,EACnC,CAAE,KAAK,KAAQ,EACf,CAAE,UAAU,IAAU,EACtB,CAAE,QAAQ,IAAO,EACjB,CAAE,WAAW,IAAO,MAAQ,EAC1B,EAAW,GAAW,IAC5B,GAAoB,EAAQ,EAAU,GAAS,EAAa,GAAI,EAAY,IAC5E,GAAM,CAAE,QAAS,GAAW,IAC5B,GAAoB,EAAQ,EAAM,GAAS,EAAa,GAAI,EAAQ,IACpE,GAAM,CAAE,YAAa,GAAW,IAC1B,EAAW,KACb,EAAM,EAAoB,EAAW,EAEnC,EAAU,GAAS,CAGxB,GAFA,EAAS,QAAS,GAEd,GAAe,GAAQ,CAC1B,EAAM,iBAIN,GAAM,GAAgB,EAAU,WAAa,GAAQ,EAErD,EAAS,EAAM,CAAE,QAAO,QAAS,MAInC,SAAO,MAAQ,GAAe,CAC7B,EAAU,GAAO,GAAO,GAAI,GAAU,GAAuB,IAC7D,EAAa,EAAG,EAAc,GAAmB,EAAS,IACtD,MAAQ,IAAa,EAAa,EAAG,EAAK,EAAY,IACtD,WAAa,IAAa,EAAa,EAAG,EAAU,EAAY,SAChE,SAAW,IAAa,EAAa,EAAG,EAAQ,EAAY,OAC5D,YAAc,IAAa,EAAa,GAAI,EAAW,EAAY,UACnE,WAAa,IAAa,EAAa,GAAI,EAAU,EAAY,UAGtE,EAAO,GAAG,OAAS,IAAM,CACxB,AAAI,EAAO,GAAG,MAAsB,OAClC,EAAa,EAAG,EAAO,IAAO,IAAM,EAAM,IAAM,GAAQ,EAAI,EAAM,MAGhE,EAAO,GAAG,MAA4B,MACxC,EAAa,GAAI,EAAqB,EAAU,SAAS,WAAW,IAGlE,EAAO,GAAG,MAA4B,MACxC,EAAa,GAAI,EAAY,IAAS,EAAU,UAG9C,EAAO,GAAG,MAAsB,MAClC,EAAa,EAAG,EAAc,EAAY,OAAS,QAGpD,EAAa,EAAG,EAAQ,EAAS,CACjC,SAAU,EACV,OACA,qBACA,YACA,cAAe,MAIV,CACN,EACA,EACA,EACA,EACA,EACA,EACA,EACA,EACA,EACA,EACA,EACA,EACA,EACA,EACA,EACA,EACA,GAIF,oBAAmB,EAAgB,CAClC,YAAY,EAAS,CACpB,QAEA,EAAK,KAAM,EAAS,GAAU,GAAiB,EAAgB,CAC9D,GAAI,EACJ,QAAS,EACT,MAAO,EACP,SAAU,OAMP,GAA6B,GAAU,EAAE,OAAQ,EAAwB,IACzE,GAA6B,GAAQ,EAAE,OAAwB,EAAI,KAGzE,YAAyB,EAAK,CAC7B,GAAI,GACA,EACA,EACA,EACE,EAAoB,CAAC,GAAmB,IACxC,EAAY,GAElB,WAA2B,EAAK,EAAO,CACtC,MAAkB,GAAI,GAAW,EAC1B,EAGR,SAA2B,EAAkB,GAC7C,EAAW,EAAU,GAA4B,EAAkB,GAA0B,GAEtF,CACN,GAAI,CACH,EAAS,IACT,EAAkB,MAEnB,EAAE,EAAQ,EAAQ,CACjB,EAAU,GAA0B,EAAE,EAAQ,GAC9C,EAAO,EAAQ,EAAiB,GAChC,EAAU,IAEX,EAAE,EAAK,EAAO,CACb,GAAI,GAAuB,EAC3B,EAA2B,EAAkB,GAE7C,AAAI,IAA6B,EAChC,EAAU,GAA0B,EAAE,EAAK,GAE3C,MAEA,EAAe,EAAU,GAAuB,EAAG,EAAG,IAAM,CAC3D,EAAU,GAAwB,OAGnC,KACA,EAAW,EAAU,GAErB,AAAK,EAIJ,EAAS,EAAE,EAAK,GAHhB,GAAW,EAAU,GAA4B,EAAkB,GAA0B,GAC7F,EAAS,KAKV,EAAc,EAAU,GACxB,EAAS,EAAE,EAAgB,WAAY,KAGzC,EAAE,EAAO,CACR,AAAI,GACJ,GAAc,GACd,EAAU,KAEX,EAAE,EAAO,CACR,EAAe,GACf,EAAU,IAEX,EAAE,EAAW,CACZ,EAAU,GAA0B,EAAE,GAClC,GAAW,EAAO,KAMzB,YAA2B,EAAK,CAC/B,GAAI,GACE,EAAmC,EAAI,GAAG,QAC1C,EAAe,GAAY,EAAuB,EAAiB,EAAI,GAAI,IAEjF,MAAO,CACN,GAAI,CACH,AAAI,GAAc,EAAa,KAEhC,EAAE,EAAQ,EAAQ,CACjB,AAAI,GACH,EAAa,EAAE,EAAQ,GAGxB,EAAU,IAEX,EAAE,EAAK,EAAO,CACb,AAAI,GACC,EAAa,GAAM,EAAC,GAAW,EAAiC,MACnE,GACC,EACA,EACA,EACY,EAAI,GAChB,AAAC,EAEC,GAAiB,EAAmC,EAAI,GAAI,EAAO,IADnE,GAAqC,EAAI,IAE3C,KAKJ,EAAE,EAAO,CACR,AAAI,GACJ,GAAc,EAAc,GAC5B,EAAU,KAEX,EAAE,EAAO,CACR,EAAe,EAAc,GAC7B,EAAU,IAEX,EAAE,EAAW,CACZ,AAAI,GAAc,EAAa,EAAE,KAMpC,YAA2B,EAAK,CAC/B,GAAI,GACA,EACA,EAEA,EAAO,CACV,MACA,QAAS,KACT,MAAO,KACP,SAAU,GACV,QAAS,GACT,KAAM,GACN,MAAO,GACP,MAAO,GACP,OAAQ,CAAC,CAAC,CAAC,IAGZ,UAAe,EAAwB,EAAI,GAAI,GAExC,CACN,GAAI,CACH,EAAqB,KACrB,EAAK,MAAM,KAEZ,EAAE,EAAQ,EAAQ,CACjB,EAAO,EAAQ,EAAoB,GACnC,EAAK,MAAM,EAAE,EAAQ,EAAK,OAAS,GACnC,EAAK,MAAQ,IAAM,EAAmB,WACtC,EAAK,OAAS,EACd,EAAU,IAEX,EAAE,EAAS,EAAO,CACjB,EAAM,EACN,EAAK,IAAM,EAEP,EAAsB,GAAK,IAAa,GAAwB,EAAI,KAAO,GAAe,EAAS,IACtG,GAA0B,EAAM,EAAK,IAGvC,EAAE,EAAO,CACR,AAAI,GACJ,GAAc,EAAK,OACnB,EAAU,KAEX,EAAE,EAAO,CACR,OAAS,GAAI,EAAG,EAAI,EAAG,GAAK,EAAG,CAC9B,GAAM,GAAQ,EAAK,OAAO,GAC1B,EAAe,GAGhB,EAAU,IAEX,EAAE,EAAW,CACZ,AAAI,GAAW,EAAO,GACtB,EAAK,MAAM,EAAE,GACb,EAAK,MAAQ,KACb,EAAO,OAMV,YAA4B,EAAK,CAChC,MAAO,CACN,EAAG,EACH,EAAG,EACH,EAAG,EACH,EAAG,EACH,EAAG,EACH,EAAG,GAKL,YAA2B,EAAK,CAC/B,GAAI,GACA,EACA,EACE,EAAgC,CAAiB,EAAI,GAAmB,EAAI,IAClF,GAAI,GAAqC,EAAI,KAAK,SAAiC,EAAI,IAEvF,WAAsB,EAAK,CAC1B,GAAI,GAAwB,GAE5B,OAAS,GAAI,EAAG,EAAI,EAA8B,OAAQ,GAAK,EAC9D,EAAwB,GAAO,EAAuB,EAA8B,IAGrF,MAAO,CAAE,MAAO,GAGjB,MAAI,IACH,GAAkB,GAA2B,EAAc,MAGrD,CACN,GAAI,CACH,AAAI,GAAiB,EAAiB,EAAgB,GAAG,UACzD,EAAyB,MAE1B,EAAE,EAAQ,EAAQ,CACjB,AAAI,GAAiB,EAAgB,EAAiB,EAAQ,GAC9D,EAAO,EAAQ,EAAwB,GACvC,EAAU,IAEX,EAAE,EAAK,EAAO,CACb,GAAM,GAA2B,EAAoC,GACnE,GAAkB,EAA+B,CACjD,EAAwB,GAAK,GAAkC,EAAI,IACnE,EAAuB,GAAK,GAAiC,EAAI,MAEjE,GAEF,GAAI,EAAsB,GAAK,IAAkB,GAAqC,EAAI,KAAK,SAAiC,EAAI,KAAM,CACzI,GAAI,EAAiB,CACpB,KACA,GAAM,GAAgB,EAEtB,EAAe,EAAc,GAAG,SAAU,EAAG,EAAG,IAAM,CACrD,EAAkB,EAAe,KAGlC,KAGD,AAAI,EACH,GAAkB,GAA2B,EAAc,KAC3D,EAAiB,EAAgB,GAAG,UACpC,EAAc,EAAgB,GAAG,SAAU,GAC3C,EAAgB,EAAiB,EAAuB,WAAY,IAEpE,EAAkB,SAEb,AAAI,IACV,EAAgB,KAAK,IAGvB,EAAE,EAAO,CACR,AAAI,GACA,IAAiB,EAAc,EAAgB,GAAG,SAAU,GAChE,EAAU,KAEX,EAAE,EAAO,CACR,AAAI,GAAiB,EAAe,EAAgB,GAAG,SAAU,GACjE,EAAU,IAEX,EAAE,EAAW,CACZ,AAAI,GAAW,EAAO,GAClB,GAAiB,EAAkB,EAAiB,KAM3D,YAA8B,EAAK,CAClC,MAAO,CACN,EAAG,EACH,EAAG,EACH,EAAG,EACH,EAAG,EACH,EAAG,EACH,EAAG,GAIL,YAA2B,EAAK,CAC/B,GAAI,GACA,EACA,EAA4B,EAAI,IAAuB,EAAI,GAAG,QAAoB,EAAI,IAAM,GAAgB,GAEhH,MAAO,CACN,GAAI,CACH,AAAI,GAAU,EAAS,IACvB,EAAkB,MAEnB,EAAE,EAAQ,EAAQ,CACjB,AAAI,GAAU,EAAS,EAAE,EAAQ,GACjC,EAAO,EAAQ,EAAiB,GAChC,EAAU,IAEX,EAAE,EAAK,CAAC,GAAQ,CACf,AAAqB,EAAI,IAAuB,EAAI,GAAG,QAAoB,EAAI,GAC9E,AAAI,EACH,GAAS,EAAE,EAAK,GAEZ,EAAyB,GAC5B,EAAc,EAAU,IAGzB,GAAW,GAAgB,GAC3B,EAAS,IACT,EAAc,EAAU,GACxB,EAAS,EAAE,EAAgB,WAAY,IAE9B,GACV,MAEA,EAAe,EAAU,EAAG,EAAG,IAAM,CACpC,EAAW,OAGZ,OAGF,EAAE,EAAO,CACR,AAAI,GACJ,GAAc,GACd,EAAU,KAEX,EAAE,EAAO,CACR,EAAe,GACf,EAAU,IAEX,EAAE,EAAW,CACZ,AAAI,GAAU,EAAS,EAAE,GACrB,GAAW,EAAO,KAKzB,YAAoB,EAAQ,EAAS,EAAc,CAClD,GAAI,GACA,CAAE,QAAS,EAAQ,GAAI,WAAY,EACnC,CAAE,OAAO,IAAO,EAChB,CAAE,YAAY,MAAS,EACvB,EAAc,GACd,EAAa,GACX,CAAE,gBAAe,kBAAiB,eAAgB,GAAW,IACnE,GAAoB,EAAQ,EAAa,GAAS,EAAa,EAAG,EAAe,IAEjF,GAAM,GAAQ,CACb,OAGA,QAAS,IAAS,IAGnB,SAAc,GAEd,GAAU,IAAM,CACf,EAAgB,KAGjB,EAAO,MAAQ,GAAe,CAC7B,EAAa,GAAI,EAAU,GAAO,GAAO,GAAI,GAAU,GAAuB,KAC1E,QAAU,IAAa,EAAa,EAAG,EAAO,EAAY,MAC1D,aAAe,IAAa,EAAa,EAAG,EAAY,EAAY,WACpE,WAAa,IAAa,EAAa,EAAG,EAAU,EAAY,UAGrE,EAAO,GAAG,OAAS,IAAM,CACvB,GAAI,GAAgB,EAAa,QAAU,EAAO,CAClD,EAAa,EAAG,EAAc,EAAa,QAC3C,GAAM,CAAE,UAAW,EAAG,UAAS,GAAS,EACxC,EAAa,EAAG,EAAa,GAEzB,GACH,CAAI,EAAE,WAAW,WAAW,UAAW,EAAa,EAAG,EAAY,GAAS,EAAa,EAAG,EAAY,MAGzG,MAAe,QAAQ,SAAS,EAAG,KAIrC,EAAU,GAAuB,GAE1B,CACN,EACA,EACA,EACA,EACA,EACA,EACA,EACA,EACA,GAIF,oBAAoB,EAAgB,CACnC,YAAY,EAAS,CACpB,QACA,EAAK,KAAM,EAAS,GAAY,GAAmB,EAAgB,CAAE,KAAM,EAAG,UAAW,MASrF,GAAc,AAAC,GACV,KACA,EAAO,SACV,MAAO,EAAO,QAAQ,MACtB,IAAM,EAAO,QAAQ,OAAS,EAAO,QAAQ,MAAM,KAAQ,YAG7D,GAAgB,AAAC,GAAW,CAC9B,GAAM,GAAY,GACd,EAAW,GAAY,GAE3B,MAAO,IACC,WAAW,CACX,MAAO,IAGX,OAAO,EAAU,CACb,EAAU,KAAK,GAEf,GAAM,GAAmB,IAAM,CAC3B,EAAW,GAAY,GACvB,EAAS,CAAE,WAAU,OAAQ,SAGjC,SAAO,iBAAiB,WAAY,GAE7B,IAAM,CACT,EAAO,oBAAoB,WAAY,GACvC,GAAM,GAAQ,EAAU,QAAQ,GAChC,EAAU,OAAO,EAAO,KAIhC,SAAS,EAAI,CAAE,QAAO,UAAU,IAAU,GAAI,CAC1C,EAAQ,IAAK,EAAO,IAAK,KAAK,MAAQ,IAEtC,GAAI,CACA,AAAI,EAAS,EAAO,QAAQ,aAAa,EAAO,GAAI,GAC/C,EAAO,QAAQ,UAAU,EAAO,GAAI,SACpC,EAAP,CACE,EAAO,SAAS,EAAU,UAAY,UAAU,GAEpD,EAAW,GAAY,GACvB,EAAU,QAAQ,AAAC,GACf,EAAS,CAAE,WAAU,OAAQ,UAEjC,SAAS,cAAc,UAK7B,GAAqB,CAAC,EAAkB,MAAQ,CAClD,GAAI,GAAQ,EACN,EAAQ,CAAC,CAAE,SAAU,EAAiB,OAAQ,KAC9C,EAAS,GAEf,MAAO,IACC,WAAW,CACX,MAAO,GAAM,IAEjB,iBAAiB,EAAM,EAAI,GAC3B,oBAAoB,EAAM,EAAI,GAC9B,QAAS,IACD,UAAU,CACV,MAAO,OAEP,QAAQ,CACR,MAAO,OAEP,QAAQ,CACR,MAAO,GAAO,IAElB,UAAU,EAAO,EAAG,EAAK,CACrB,GAAM,CAAC,EAAU,EAAS,IAAM,EAAI,MAAM,KAC1C,IACA,EAAM,KAAK,CAAE,WAAU,WACvB,EAAO,KAAK,IAEhB,aAAa,EAAO,EAAG,EAAK,CACxB,GAAM,CAAC,EAAU,EAAS,IAAM,EAAI,MAAM,KAC1C,EAAM,GAAS,CAAE,WAAU,UAC3B,EAAO,GAAS,MAO1B,GAAgB,GAClB,KAAc,OAAS,MAErB,CAAE,aAAa,GAIf,GAA6B,GAAU,EAC5C,MAAO,EAAyB,EAChC,SAAU,EAAsB,IAG3B,GAA6B,GAAQ,EAC1C,MAAwB,EAAI,IAAuB,EAAI,GAAG,IAC1D,SAAwB,EAAI,KAG7B,YAA2B,EAAK,CAC/B,GAAI,GACE,EAAmC,EAAI,IAAI,QAC3C,EAAe,GAAY,EAAuB,EAAiB,EAAI,IAAK,IAElF,MAAO,CACN,GAAI,CACH,AAAI,GAAc,EAAa,KAEhC,EAAE,EAAQ,EAAQ,CACjB,AAAI,GACH,EAAa,EAAE,EAAQ,GAGxB,EAAU,IAEX,EAAE,EAAK,CAAC,GAAQ,CACf,AAAI,GACC,EAAa,GAAM,EAAC,GAAW,EAA6C,OAC/E,GACC,EACA,EACA,EACY,EAAI,IAChB,AAAC,EAEC,GAAiB,EAAmC,EAAI,IAAK,EAAO,IADpE,GAAqC,EAAI,KAE3C,KAKJ,EAAE,EAAO,CACR,AAAI,GACJ,GAAc,EAAc,GAC5B,EAAU,KAEX,EAAE,EAAO,CACR,EAAe,EAAc,GAC7B,EAAU,IAEX,EAAE,EAAW,CACZ,AAAI,GAAc,EAAa,EAAE,KAKpC,YAAoB,EAAQ,EAAS,EAAc,CAClD,GAAI,GACA,EACA,EACA,EACA,CAAE,QAAS,EAAQ,GAAI,WAAY,EACnC,CAAE,WAAW,KAAQ,EACrB,CAAE,MAAM,MAAS,EACjB,CAAE,UAAU,IAAkB,EAClC,GAAW,GAAS,GACpB,GAAM,GAAkB,GAAW,IAC7B,EAAgB,GAAW,IAC3B,EAAS,GAAS,IACxB,GAAoB,EAAQ,EAAQ,GAAS,EAAa,EAAG,EAAU,IACvE,GAAM,GAAc,GAAS,MAC7B,GAAoB,EAAQ,EAAa,GAAS,EAAa,EAAG,EAAe,IACjF,GAAI,GAAiB,GAIf,EAAW,GAAmB,GAAS,EAAM,CAAE,SAAU,GAAQ,EAAQ,UAE/E,GAAoB,EAAQ,EAAU,GAAS,EAAa,EAAG,EAAY,IAM3E,GAAM,GAAO,EACX,EAAc,WACd,GAAS,CAAE,KAAM,EAAU,IAAK,IAElC,GAAoB,EAAQ,EAAM,GAAS,EAAa,GAAI,EAAQ,IAEpE,GAAM,GAAa,GAAQ,CAAC,EAAM,GAAc,CAAC,CAAC,EAAM,KAAiB,CAExE,GAAI,CAAC,EAAa,MAAO,GAEzB,GAAM,CAAE,KAAM,GAAa,EACrB,CAAE,SAAO,QAAQ,EAQvB,MAAO,CAAE,KAJI,GAAM,QACjB,EACA,GAAM,KAAK,QAAQ,QAAS,IAEf,UAGV,EAAgB,GAAS,CAC9B,GAAM,CAAE,KAAM,GAAa,EACvB,CAAE,QAAS,EASf,GAJA,EAAM,MAAQ,EAEd,EAAM,KAAO,GAAa,EAAU,GAEhC,MAAO,SAAW,YAAa,CAIlC,GAAI,EAAgB,OAEpB,GAAM,IAAgB,GAAK,CAAC,GAAQ,EAAU,UAE9C,AAAI,IACH,GAAY,IAAI,IAChB,EAAiB,QAGlB,GAAO,OAAO,IAAM,CAAC,GAAG,GAAI,KAIxB,EAAkB,GAAS,CAChC,EAAO,OAAO,GAAM,EAAG,OAAO,GAAK,IAAM,KAG1C,MAAK,IAGJ,IAAQ,IACU,EAAQ,OAAO,GAAS,CACxC,EAAS,IAAI,EAAM,aAMrB,GAAW,GAAU,IAGtB,GAAW,GAAQ,CAClB,cACA,OACA,aACA,gBACA,oBAGD,EAAO,MAAQ,GAAW,CACzB,AAAI,YAAc,IAAS,EAAa,EAAG,EAAW,EAAQ,UAC1D,OAAS,IAAS,EAAa,EAAG,EAAM,EAAQ,KAChD,WAAa,IAAS,EAAa,EAAG,EAAU,EAAQ,SACxD,WAAa,IAAS,EAAa,GAAI,EAAU,EAAQ,UAG9D,EAAO,GAAG,OAAS,IAAM,CACxB,GAAI,EAAO,GAAG,MAAkB,KAG9B,CACA,GAAM,CAAE,KAAM,GAAa,EAC3B,EAAO,OAAO,GAAM,EAAG,IAAI,GAAK,OAAO,OAAO,EAAG,CAAE,KAAM,GAAa,EAAU,EAAE,WAIpF,GAAI,EAAO,GAAG,MAA+B,IAK3C,CACA,GAAM,GAAY,GAAK,EAAS,EAAU,UAC1C,EAAY,IAAI,KAKZ,CACN,EACA,EACA,EACA,EACA,EACA,EACA,EACA,EACA,EACA,EACA,EACA,EACA,GAIF,oBAAqB,EAAgB,CACpC,YAAY,EAAS,CACpB,QACA,EAAK,KAAM,EAAS,GAAY,GAAmB,EAAgB,CAAE,SAAU,EAAG,IAAK,EAAG,QAAS,MChpCrG,YAAkB,EAAQ,EAAS,EAAc,CAChD,GAAI,CAAE,OAAO,QAAW,EAExB,UAAQ,IAAM,CACb,GAAS,EAAM,CAAE,QAAS,OAG3B,EAAO,MAAQ,GAAW,CACzB,AAAI,QAAU,IAAS,EAAa,EAAG,EAAO,EAAQ,OAGhD,CAAC,GAGT,oBAAuB,EAAgB,CACtC,YAAY,EAAS,CACpB,QACA,EAAK,KAAM,EAAS,GAAU,KAAM,EAAgB,CAAE,KAAM,MAIvD,GAAQ,GCzBf,GAAM,IAAe,KACf,GAAQ,KAER,GAAiB,MAAO,EAAQ,EAAM,EAAM,IAAU,CAC1D,GAAM,GAAc,CAClB,OAAQ,EACR,KAAM,GAGR,EAAY,QAAU,IACjB,EAAY,QACf,eAAgB,sBAChB,oCAAqC,GAIvC,GAAI,GAAW,KAAM,OAAM,GAAe,EAAM,GAChD,GAAI,EAAS,GAAI,CACf,GAAI,GAAO,KAAM,GAAS,OAG1B,GAAI,EAAK,OACP,cAAQ,IAAI,GACN,GAAI,OAAM,EAAK,OAAO,OAAO,CAAC,EAAO,IAAa,EAAQ,GAAG,EAAQ,YAAc,KAG3F,MAAO,OAEP,MAAM,IAAI,OAAM,KAAM,GAAS,SAInC,QAA+B,aAChB,iBAAiB,CAE5B,MAAO,MAAM,IAAe,OAAQ,oBADxB,gCACoD,gBAGrD,YAAW,EAAI,CAC1B,GAAI,GAAQ;AAAA;AAAA,kBAEE;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA,MAsBd,MAAO,MAAM,IAAe,OAAQ,oBAAqB,EAAO,gBAGrD,mBAAkB,EAAO,CACpC,GAAI,GAAQ;AAAA,0CAC0B;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA,OAgCtC,MAAO,MAAM,IAAe,OAAQ,oBAAqB,EAAO,gBAGrD,kBAAiB,EAAM,CAClC,GAAI,GAAQ;AAAA,iDACiC;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA,OAgC7C,MAAO,MAAM,IAAe,OAAQ,oBAAqB,EAAO,gBAGrD,iBAAiB,CAY5B,MAAO,MAAM,IAAe,OAAQ,oBAXxB;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA,MAWoD,gBAGrD,eAAc,EAAY,EAAW,EAAU,EAAY,EAAO,EAAU,EAAU,CACjG,GAAI,GAAQ;AAAA;AAAA;AAAA;AAAA;AAAA,0BAKU,iBAAyB;AAAA,8CACL;AAAA,yCACL;AAAA,4CACG;AAAA,4CACA;AAAA;AAAA;AAAA;AAAA,uBAIrB;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA,MA6BnB,MAAO,MAAM,IAAe,OAAQ,oBAAqB,EAAO,gBAGrD,oBAAmB,EAAY,EAAa,CACvD,GAAI,GAAQ;AAAA;AAAA,+CAE+B,qBAA8B;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA,MAYzE,MAAO,MAAM,IAAe,OAAQ,oBAAqB,EAAO,gBAGrD,wBAAuB,EAAY,EAAY,EAAU,EAAO,EAAW,EAAU,EAAU,CAC1G,GAAI,GAAQ;AAAA;AAAA;AAAA,yBAGS;AAAA;AAAA;AAAA,qBAGJ,mBAA4B,iBAAyB;AAAA,2CAC/B;AAAA,8CACG;AAAA,8CACA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA,MAiB1C,MAAO,MAAM,IAAe,OAAQ,oBAAqB,EAAO,gBAIrD,aAAY,EAAY,CACnC,GAAM,GAAQ;AAAA;AAAA,kBAEA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA,MA4Cd,MAAO,MAAM,IAAe,OAAQ,oBAAqB,EAAO,gBAGrD,mBAAkB,EAAY,CACzC,GAAM,GAAQ;AAAA;AAAA,iBAED;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA,MAQb,MAAO,MAAM,IAAe,OAAQ,oBAAqB,EAAO,MAvR7D,GAAP,GCrBA,YAAyB,EAAK,CAC7B,GAAI,GAEJ,MAAO,CACN,GAAI,CACH,EAAO,EAAQ,OAEf,EAAK,UAAY;AAAA;AAAA;AAAA,oFAKjB,EAAK,EAAM,QAAS,6BAErB,EAAE,EAAQ,EAAQ,CACjB,EAAO,EAAQ,EAAM,IAEtB,EAAG,EACH,EAAG,EACH,EAAG,EACH,EAAE,EAAW,CACZ,AAAI,GAAW,EAAO,KAKzB,oBAAmB,EAAgB,CAClC,YAAY,EAAS,CACpB,QACA,EAAK,KAAM,EAAS,KAAM,GAAiB,EAAgB,MAItD,GAAQ,GC5Cf,YAAc,EAAM,CAAC,QAAQ,EAAG,WAAW,IAAK,SAAS,IAAY,GAAI,CACvE,GAAM,GAAI,CAAC,iBAAiB,GAAM,QAClC,MAAO,CACL,QACA,WACA,SACA,IAAK,AAAC,GAAM,YAAY,EAAI,KAMhC,GAAM,CAAE,OAAQ,IAAa,GAE7B,YAAiB,EAAQ,CACxB,GAAc,EAAQ,gBAAiB;AAAA;AAAA,4xBAIxC,YAAyB,EAAK,CAC7B,GAAI,GACA,EACA,EACA,EACA,EACA,EACA,EACA,EACA,EACA,EACA,EACA,EAAqB,EAAI,GAAG,aAAe,GAAkB,GACjE,GAAI,GAA6B,EAAI,GAErC,WAAsB,EAAK,CAC1B,MAAO,GAGR,MAAI,IACH,GAAkB,GAA2B,EAAc,MAGrD,CACN,GAAI,CACH,EAAO,EAAQ,OACf,EAAO,EAAQ,OACf,EAAO,EAAQ,OACX,GAAU,EAAS,IACvB,EAAI,IACJ,EAAO,EAAQ,OACX,GAAiB,EAAiB,EAAgB,GAAG,UACzD,EAAK,EAAM,QAAS,yBACpB,EAAK,EAAM,QAAwB,EAAI,IACvC,EAAK,EAAM,QAAS,wBACpB,EAAK,EAAM,OAAQ,UACnB,EAAK,EAAM,aAAc,QACzB,EAAK,EAAM,QAAuB,EAAI,IACtC,EAAK,EAAM,QAAS,6BACpB,EAAK,EAAM,QAA2B,EAAI,IAC1C,EAAK,EAAM,QAAS,oBACpB,EAAK,EAAM,QAAmB,EAAI,KAEnC,EAAE,EAAQ,EAAQ,CACjB,EAAO,EAAQ,EAAM,GACrB,EAAO,EAAM,GACb,EAAO,EAAM,GACT,GAAU,EAAS,EAAE,EAAM,MAC/B,EAAO,EAAM,GACb,EAAO,EAAM,GACT,GAAiB,EAAgB,EAAiB,EAAM,MAC3C,EAAI,IAAI,GACR,EAAI,IAAI,GACR,EAAI,IAAI,GACzB,EAAU,GAEL,GACJ,GAAU,CACT,GAAO,EAAM,aAAc,UAAY,CACtC,AAAI,GAAuB,EAAI,MAAiB,EAAI,IAAI,MAAM,KAAM,aAErE,GAAO,EAAM,aAAc,UAAY,CACtC,AAAI,GAAwB,EAAI,MAAkB,EAAI,IAAI,MAAM,KAAM,aAEvE,GAAO,EAAM,WAAY,UAAY,CACpC,AAAI,GAAyB,EAAI,MAAmB,EAAI,IAAI,MAAM,KAAM,aAEzE,GAAO,EAAM,WAAY,UAAY,CACpC,AAAI,GAAyB,EAAI,MAAmB,EAAI,IAAI,MAAM,KAAM,aAEzE,GAAO,EAAM,YAAsC,EAAI,KACvD,GAAO,EAAM,UAAkC,EAAI,MAGpD,EAAU,KAGZ,EAAE,EAAS,EAAO,CA0BjB,GAzBA,EAAM,EAEN,AAAc,EAAI,GAAG,YACpB,AAAI,EACH,GAAS,EAAE,EAAK,GAEZ,EAAM,GAAe,GACxB,EAAc,EAAU,IAGzB,GAAW,GAAkB,GAC7B,EAAS,IACT,EAAc,EAAU,GACxB,EAAS,EAAE,EAAM,IAER,GACV,MAEA,EAAe,EAAU,EAAG,EAAG,IAAM,CACpC,EAAW,OAGZ,MAGG,EAAM,GAAmB,GAAK,IAAkB,GAA6B,EAAI,IAAK,CACzF,GAAI,EAAiB,CACpB,KACA,GAAM,GAAgB,EAEtB,EAAe,EAAc,GAAG,SAAU,EAAG,EAAG,IAAM,CACrD,EAAkB,EAAe,KAGlC,KAGD,AAAI,EACH,GAAkB,GAA2B,EAAc,KAC3D,EAAiB,EAAgB,GAAG,UACpC,EAAc,EAAgB,GAAG,SAAU,GAC3C,EAAgB,EAAiB,EAAM,OAEvC,EAAkB,KAIpB,AAAI,EAAC,GAAW,EAAM,GAAoB,MACzC,EAAK,EAAM,QAAwB,EAAI,IAGpC,EAAC,GAAW,EAAM,GAAmB,MACxC,EAAK,EAAM,QAAuB,EAAI,IAGnC,EAAC,GAAW,EAAM,GAAuB,KAC5C,EAAK,EAAM,QAA2B,EAAI,IAGvC,EAAC,GAAW,EAAM,GAAe,KACpC,EAAK,EAAM,QAAmB,EAAI,KAGpC,EAAE,EAAO,CACR,AAAI,GACJ,GAAc,GACV,GAAiB,EAAc,EAAgB,GAAG,SAAU,GAEhE,GAAoB,IAAM,CACzB,AAAI,CAAC,GACA,IAAiB,GAAkB,GAAgC,EAAkC,EAAI,IAAe,EAAI,GAAG,sBAAuB,KAC3J,EAAgB,IAAI,MAGrB,GAAoB,IAAM,CACzB,AAAI,CAAC,GACA,IAAiB,GAAkB,GAAgC,EAA8B,EAAI,IAAe,EAAI,GAAG,kBAAmB,KACnJ,EAAgB,IAAI,MAGrB,EAAU,KAEX,EAAE,EAAO,CACR,EAAe,GACX,GAAiB,EAAe,EAAgB,GAAG,SAAU,GAC5D,GAAiB,GAAkB,GAAgC,EAAkC,EAAI,IAAe,EAAI,GAAG,sBAAuB,KAC3J,EAAgB,IAAI,GACf,GAAiB,GAAkB,GAAgC,EAA8B,EAAI,IAAe,EAAI,GAAG,kBAAmB,KACnJ,EAAgB,IAAI,GACpB,EAAU,IAEX,EAAE,EAAW,CACZ,AAAI,GAAW,EAAO,GAClB,GAAU,EAAS,IACnB,GAAiB,EAAkB,GACtB,EAAI,IAAI,MACrB,GAAa,GAAiB,EAAgB,MACjC,EAAI,IAAI,MACR,EAAI,IAAI,MACrB,GAAa,GAAiB,EAAgB,MAClD,EAAU,GACV,GAAQ,KAMX,YAA2B,EAAK,CAC/B,GAAI,GACA,EACA,EACA,EACA,EACE,EAAoB,CAAC,GAAmB,IACxC,EAAY,GAElB,WAA2B,EAAK,EAAO,CAGtC,MAFI,GAAM,GAAe,GAAG,GAAU,MAClC,GAAW,MAAM,GAAU,CAAC,CAAgB,EAAI,IAAc,EAAI,GAAG,cACrE,EAAgB,EACb,EAGR,SAA2B,EAAkB,EAAK,CAAC,GAAI,KACvD,EAAW,EAAU,GAA4B,EAAkB,GAA0B,GAEtF,CACN,GAAI,CACH,EAAS,IACT,EAAkB,MAEnB,EAAE,EAAQ,EAAQ,CACjB,EAAU,GAA0B,EAAE,EAAQ,GAC9C,EAAO,EAAQ,EAAiB,GAChC,EAAU,IAEX,EAAE,EAAK,EAAO,CACb,GAAI,GAAuB,EAC3B,EAA2B,EAAkB,EAAK,GAElD,AAAI,IAA6B,EAChC,EAAU,GAA0B,EAAE,EAAK,GAE3C,MAEA,EAAe,EAAU,GAAuB,EAAG,EAAG,IAAM,CAC3D,EAAU,GAAwB,OAGnC,KACA,EAAW,EAAU,GAErB,AAAK,EAIJ,EAAS,EAAE,EAAK,GAHhB,GAAW,EAAU,GAA4B,EAAkB,GAA0B,GAC7F,EAAS,KAKV,EAAc,EAAU,GACxB,EAAS,EAAE,EAAgB,WAAY,KAGzC,EAAE,EAAO,CACR,AAAI,GACJ,GAAc,GACd,EAAU,KAEX,EAAE,EAAO,CACR,EAAe,GACf,EAAU,IAEX,EAAE,EAAW,CACZ,EAAU,GAA0B,EAAE,GAClC,GAAW,EAAO,KAMzB,YAA2B,EAAK,CAC/B,GAAI,GACA,EACA,EAEJ,MAAO,CACN,GAAI,CACH,EAAS,EAAQ,UACjB,EAAK,EAAQ,QAAS,uBACtB,EAAK,EAAQ,QAA4B,EAAI,KAE9C,EAAE,EAAQ,EAAQ,CACjB,EAAO,EAAQ,EAAQ,GAElB,GACJ,GAAU,GAAO,EAAQ,QAAmB,EAAI,KAChD,EAAU,KAGZ,EAAE,EAAK,EAAO,CACb,AAAI,EAAM,GAAwB,KACjC,EAAK,EAAQ,QAA4B,EAAI,KAG/C,EAAG,EACH,EAAG,EACH,EAAE,EAAW,CACZ,AAAI,GAAW,EAAO,GACtB,EAAU,GACV,MAMH,YAA2B,EAAK,CAC/B,GAAI,GACA,EACA,EACJ,GAAI,GAAyB,EAAI,GAAG,YAEpC,WAAsB,EAAK,CAC1B,MAAO,CAAE,MAAO,CAAE,QAAmB,EAAI,MAG1C,MAAI,IACH,GAAkB,GAA2B,EAAc,EAAa,KAGlE,CACN,GAAI,CACH,AAAI,GAAiB,EAAiB,EAAgB,GAAG,UACzD,EAAyB,MAE1B,EAAE,EAAQ,EAAQ,CACjB,AAAI,GAAiB,EAAgB,EAAiB,EAAQ,GAC9D,EAAO,EAAQ,EAAwB,GACvC,EAAU,IAEX,EAAE,EAAK,EAAO,CACb,GAAI,EAAM,GAAe,GAAK,IAAkB,GAAyB,EAAI,GAAG,aAAc,CAC7F,GAAI,EAAiB,CACpB,KACA,GAAM,GAAgB,EAEtB,EAAe,EAAc,GAAG,SAAU,EAAG,EAAG,IAAM,CACrD,EAAkB,EAAe,KAGlC,KAGD,AAAI,EACH,GAAkB,GAA2B,EAAc,EAAa,IACxE,EAAiB,EAAgB,GAAG,UACpC,EAAc,EAAgB,GAAG,SAAU,GAC3C,EAAgB,EAAiB,EAAuB,WAAY,IAEpE,EAAkB,OAIrB,EAAE,EAAO,CACR,AAAI,GACA,IAAiB,EAAc,EAAgB,GAAG,SAAU,GAChE,EAAU,KAEX,EAAE,EAAO,CACR,AAAI,GAAiB,EAAe,EAAgB,GAAG,SAAU,GACjE,EAAU,IAEX,EAAE,EAAW,CACZ,AAAI,GAAW,EAAO,GAClB,GAAiB,EAAkB,EAAiB,KAK3D,YAAyB,EAAK,CAC7B,GAAI,GACA,EACA,EACA,EACA,EAAyB,EAAI,IAAM,GAAgB,GACjD,EAAmC,EAAI,IAAI,QAC3C,EAAe,GAAY,EAAuB,EAAiB,EAAI,IAAK,MAElF,MAAO,CACN,GAAI,CACH,AAAI,GAAU,EAAS,IACvB,EAAI,IACA,GAAc,EAAa,KAEhC,EAAE,EAAQ,EAAQ,CACjB,AAAI,GAAU,EAAS,EAAE,EAAQ,GACjC,EAAO,EAAQ,EAAG,GAEd,GACH,EAAa,EAAE,EAAQ,GAGxB,EAAU,GAEL,GACJ,GAAU,GAAO,GAAU,UAA6B,EAAI,KAC5D,EAAU,KAGZ,EAAE,EAAK,EAAO,CACb,AAAkB,EAAI,GACrB,AAAI,EACH,GAAS,EAAE,EAAK,GAEZ,EAAM,GAAmB,GAC5B,EAAc,EAAU,IAGzB,GAAW,GAAgB,GAC3B,EAAS,IACT,EAAc,EAAU,GACxB,EAAS,EAAE,EAAE,WAAY,IAEhB,GACV,MAEA,EAAe,EAAU,EAAG,EAAG,IAAM,CACpC,EAAW,OAGZ,MAGG,GACC,EAAa,GAAM,EAAC,GAAW,EAAM,GAAiB,KACzD,GACC,EACA,EACA,EACY,EAAI,IAChB,AAAC,EAEC,GAAiB,EAAmC,EAAI,IAAK,EAAO,MADpE,GAAqC,EAAI,KAE3C,OAKJ,EAAE,EAAO,CACR,AAAI,GACJ,GAAc,GACd,EAAc,EAAc,GAC5B,EAAU,KAEX,EAAE,EAAO,CACR,EAAe,GACf,EAAe,EAAc,GAC7B,EAAU,IAEX,EAAE,EAAW,CACZ,AAAI,GAAU,EAAS,EAAE,GACrB,GAAW,EAAO,GAClB,GAAc,EAAa,EAAE,GACjC,EAAU,GACV,MAKH,YAAc,EAAW,EAAQ,GAAI,CACpC,MAAO,UAAwB,EAAS,CACvC,MAAO,IAAI,GAAU,IAChB,EACH,MAAO,IAAK,KAAU,EAAQ,UAKlC,YAAkB,EAAQ,EAAS,EAAc,CAChD,GAAI,CAAE,QAAS,EAAQ,GAAI,WAAY,EACjC,EAAW,KACX,EAAiB,GACnB,CAAE,OAAO,MAAS,EAClB,CAAE,MAAM,gBAAmB,EAC3B,CAAE,cAAc,IAAS,EACzB,CAAE,aAAa,IAAS,EACxB,CAAE,oBAAoB,IAAS,EAC/B,CAAE,UAAU,IAAO,EACnB,CAAE,kBAAkB,IAAO,EAC3B,CAAE,cAAc,IAAO,EACvB,CAAE,eAAe,IAAO,EACxB,CAAE,mBAAmB,IAAO,EAC5B,CAAE,WAAY,EAAe,GAAmB,EAChD,CAAE,eAAe,IAAS,EAC1B,CAAE,oBAAoB,CAAE,SAAU,MAAU,EAC5C,CAAE,mBAAmB,GAAiB,EACtC,CAAE,wBAAwB,GAAsB,EAE9C,EAAe,CACpB,cACA,aACA,oBACA,UACA,kBACA,cACA,eACA,mBACA,eACA,oBACA,mBACA,yBAGG,EAAQ,IAAK,GACb,EAAY,KACZ,GACA,GACA,EACA,GACA,GACA,GACA,GACA,GACA,GACA,GACA,GACA,GACA,GACA,GACE,GAAkB,GAAO,EAAI,QAAQ,uBAAwB,OAAO,cAEpE,GAAc,GAAS,EAC3B,OAAO,KAAK,GAAO,OAAO,CAAC,GAAK,KAAQ,GAAG,OAAQ,GAAgB,QAAS,EAAM,MAAQ,IAC1F,GAEI,GAAa,GAAK,CAAC,CAAE,IAAK,EAAE,aAAe,EAAE,MAAQ,EAAE,OAEvD,GAAwB,IAAM,CACnC,EAAa,EAAG,GAAQ,GAAY,OAAO,OAC1C,GACA,CACC,MAAO,OAAO,WACd,OAAQ,OAAO,aAEhB,EAAM,WAGP,EAAa,EAAG,GAAgB,GAAY,EAAM,kBAClD,EAAa,EAAG,GAAY,GAAY,EAAM,cAC9C,EAAa,EAAG,GAAa,GAAY,EAAM,eAC/C,EAAa,EAAG,GAAiB,GAAY,EAAM,mBACnD,EAAa,GAAI,GAAsB,EAAM,cAC7C,EAAa,GAAI,GAA0B,EAAM,mBAG5C,GAAS,IAAM,GAIjB,GAAS,GACT,GAAU,GACV,GAAW,GACX,GAAW,GAET,GAAO,CAAC,EAAc,GAAW,GAAI,GAAU,GAAI,GAAW,KAAO,CAC1E,EAAa,EAAG,EAAY,GAAK,EAAc,KAC/C,EAAa,EAAG,EAAQ,IAAK,KAAiB,KAC9C,KACA,KAEC,EAAa,GAAI,GAAS,IAAS,CACnC,AAAI,GAAS,QAAQ,GAAS,OAAO,IACrC,EAAS,QACT,EAAS,aACN,EAAa,GAAI,GAAU,IAAS,CACvC,AAAI,GAAS,SAAS,GAAS,QAAQ,IACvC,EAAS,SACT,EAAS,aACN,EAAa,GAAI,GAAW,IAAS,CACxC,AAAI,GAAS,UAAU,GAAS,SAAS,IACzC,EAAS,YAGV,EAAa,GAAI,GAAW,IAAS,CACpC,AAAI,GAAS,UAAU,GAAS,SAAS,IACzC,EAAS,aAIL,GAAQ,CAAC,EAAW,KAAO,CAChC,EAAa,GAAI,GAAU,EAAS,SAAW,IAC/C,EAAa,GAAI,GAAW,EAAS,UAAY,IACjD,EAAa,EAAG,EAAY,MAC5B,MAGK,GAAgB,GAAS,CAM9B,GALI,EAAM,YAAc,GAAa,EAAM,MAAQ,UAClD,GAAM,iBACN,MAGG,GAAa,EAAM,MAAQ,MAAO,CAErC,GAAM,IAAQ,EAAY,iBAAiB,KAErC,GAAW,MAAM,KAAK,IAAO,OAAO,IAAQ,GAAK,UAAY,GAC/D,GAAQ,GAAS,QAAQ,SAAS,eACtC,AAAI,KAAU,IAAM,EAAM,UAAU,IAAQ,GAC5C,IAAS,GAAS,OAAU,GAAM,SAAW,GAAK,GAClD,IAAS,GAAS,OAClB,GAAS,IAAO,QAChB,EAAM,mBAIF,EAAuB,GAAS,CACrC,AAAI,EAAM,mBAAsB,GAAM,SAAW,IAAc,EAAM,SAAW,KAAO,IAAmB,EAAM,SAG3G,GAAqB,GAAS,CACnC,AAAI,EAAM,mBAAqB,EAAM,SAAW,IAC/C,GAAM,iBACN,OAII,GAAgB,IAAM,CAC3B,GAAU,OAAO,QACjB,GAAmB,SAAS,KAAK,MAAM,SACvC,GAAmB,SAAS,KAAK,MAAM,SACvC,SAAS,KAAK,MAAM,SAAW,QAC/B,SAAS,KAAK,MAAM,IAAM,IAAI,OAC9B,SAAS,KAAK,MAAM,SAAW,UAG1B,GAAe,IAAM,CAC1B,SAAS,KAAK,MAAM,SAAW,IAAoB,GACnD,SAAS,KAAK,MAAM,IAAM,GAC1B,SAAS,KAAK,MAAM,SAAW,IAAoB,GACnD,OAAO,SAAS,EAAG,KAGpB,EAAa,EAAK,CAAE,QAAM,WAC1B,GAAI,IAAY,GAEhB,GAAU,IAAM,CACf,AAAI,IAAW,OAGhB,GAAQ,IAAM,CACb,EAAa,GAAI,GAAY,MAG9B,YAAsB,EAAS,CAC9B,GAAkB,EAAU,UAAY,QAAQ,IAAM,CACrD,EAAc,EACd,EAAa,EAAG,KAIlB,YAAsB,EAAS,CAC9B,GAAkB,EAAU,UAAY,QAAQ,IAAM,CACrD,GAAO,EACP,EAAa,EAAG,MAIlB,YAAsB,EAAS,CAC9B,GAAkB,EAAU,UAAY,QAAQ,IAAM,CACrD,GAAa,EACb,EAAa,EAAG,MAIlB,SAAO,MAAQ,GAAW,CACzB,AAAI,QAAU,IAAS,EAAa,GAAI,EAAO,EAAQ,MACnD,OAAS,IAAS,EAAa,GAAI,EAAM,EAAQ,KACjD,eAAiB,IAAS,EAAa,GAAI,EAAc,EAAQ,aACjE,cAAgB,IAAS,EAAa,GAAI,EAAa,EAAQ,YAC/D,qBAAuB,IAAS,EAAa,GAAI,EAAoB,EAAQ,mBAC7E,WAAa,IAAS,EAAa,GAAI,EAAU,EAAQ,SACzD,mBAAqB,IAAS,EAAa,GAAI,EAAkB,EAAQ,iBACzE,eAAiB,IAAS,EAAa,GAAI,EAAc,EAAQ,aACjE,gBAAkB,IAAS,EAAa,GAAI,EAAe,EAAQ,cACnE,oBAAsB,IAAS,EAAa,GAAI,EAAmB,EAAQ,kBAC3E,cAAgB,IAAS,EAAa,GAAI,EAAe,EAAQ,YACjE,gBAAkB,IAAS,EAAa,GAAI,EAAe,EAAQ,cACnE,qBAAuB,IAAS,EAAa,GAAI,EAAoB,EAAQ,mBAC7E,oBAAsB,IAAS,EAAa,GAAI,EAAmB,EAAQ,kBAC3E,yBAA2B,IAAS,EAAa,GAAI,EAAwB,EAAQ,uBACrF,WAAa,IAAS,EAAa,GAAI,EAAU,EAAQ,UAG9D,EAAO,GAAG,OAAS,IAAM,CACxB,AAAI,EAAO,GAAG,MAAM,GAAc,QAAU,EAAO,GAAG,MAAM,GAAmB,IAEzE,IACH,CAAI,GAAW,GACd,GAAK,GAEL,OAOE,CACN,EACA,EACA,GACA,GACA,EACA,GACA,GACA,GACA,GACA,GACA,GACA,GACA,GACA,GACA,GACA,GACA,GACA,GACA,GACA,EACA,GACA,EACA,EACA,EACA,EACA,EACA,EACA,EACA,EACA,EACA,EACA,EACA,EACA,EACA,EACA,EACA,GACA,EACA,EACA,GACA,GACA,IAIF,oBAAoB,EAAgB,CACnC,YAAY,EAAS,CACpB,QAEA,EACC,KACA,EACA,GACA,GACA,EACA,CACC,KAAM,GACN,IAAK,GACL,YAAa,GACb,WAAY,GACZ,kBAAmB,GACnB,QAAS,GACT,gBAAiB,GACjB,YAAa,GACb,aAAc,GACd,iBAAkB,GAClB,WAAY,GACZ,aAAc,GACd,kBAAmB,GACnB,iBAAkB,GAClB,sBAAuB,IAExB,GACA,CAAC,GAAI,OAKD,GAAQ,GC/vBf,YAAyB,EAAK,CAC7B,GAAI,GACA,EACA,EACA,EACA,EACA,EACA,EAEJ,MAAO,CACN,GAAI,CACH,EAAM,EAAQ,OACd,EAAO,EAAQ,QACf,EAAO,EAAQ,QACf,EAAK,YAAc,gFACnB,EAAK,IACL,EAAS,EAAQ,SACjB,EAAK,IACL,EAAS,EAAQ,SACjB,EAAK,EAAM,QAAS,uBACpB,EAAK,EAAQ,OAAQ,SACrB,EAAK,EAAQ,OAAQ,MACrB,EAAK,EAAQ,cAAe,sBAC5B,EAAK,EAAQ,QAAS,iBACtB,EAAK,EAAQ,OAAQ,UACrB,EAAO,MAAQ,YACf,EAAK,EAAQ,QAAS,iBACtB,EAAK,EAAM,SAAU,iCACrB,EAAK,EAAM,SAAU,OACrB,EAAK,EAAK,QAAS,4BAEpB,EAAE,EAAQ,EAAQ,CACjB,EAAO,EAAQ,EAAK,GACpB,EAAO,EAAK,GACZ,EAAO,EAAM,GACb,EAAO,EAAM,GACb,EAAO,EAAM,GACM,EAAI,GAAG,GAC1B,EAAO,EAAM,GACb,EAAO,EAAM,IAEd,EAAG,EACH,EAAG,EACH,EAAG,EACH,EAAE,EAAW,CACZ,AAAI,GAAW,EAAO,GACH,EAAI,GAAG,QAK7B,YAAkB,EAAQ,EAAS,EAAc,CAChD,GAAQ,SAAY,CACnB,EAAG,UAGJ,GAAI,GAEJ,WAAwB,EAAS,CAChC,GAAkB,EAAU,UAAY,QAAQ,IAAM,CACrD,EAAK,EACL,EAAa,EAAG,KAIlB,MAAO,CAAC,EAAI,GAGb,oBAA8B,EAAgB,CAC7C,YAAY,EAAS,CACpB,QACA,EAAK,KAAM,EAAS,GAAU,GAAiB,EAAgB,MAI1D,GAAQ,GC3FR,GAAM,IAAM,GAAS,IACf,GAAQ,GAAS,MACjB,GAAY,GAAS,MACrB,GAAgB,GAAS,GCStC,GAAM,IAA2B,GAAU,EAAE,QAAS,EAAoB,IACpE,GAA2B,GAAQ,EAAE,QAAqB,EAAI,KAEpE,YAAyB,EAAK,CAC7B,GAAI,GACE,EAAmC,EAAI,GAAG,QAC1C,EAAe,GAAY,EAAuB,EAAiB,EAAI,GAAI,IAEjF,MAAO,CACN,GAAI,CACH,AAAI,GAAc,EAAa,KAEhC,EAAE,EAAQ,EAAQ,CACjB,AAAI,GACH,EAAa,EAAE,EAAQ,GAGxB,EAAU,IAEX,EAAE,EAAK,CAAC,GAAQ,CACf,AAAI,GACC,EAAa,GAAM,EAAC,GAAW,EAA6B,IAC/D,GACC,EACA,EACA,EACY,EAAI,GAChB,AAAC,EAEC,GAAiB,EAAmC,EAAI,GAAI,EAAO,IADnE,GAAqC,EAAI,IAE3C,KAKJ,EAAE,EAAO,CACR,AAAI,GACJ,GAAc,EAAc,GAC5B,EAAU,KAEX,EAAE,EAAO,CACR,EAAe,EAAc,GAC7B,EAAU,IAEX,EAAE,EAAW,CACZ,AAAI,GAAc,EAAa,EAAE,KAKpC,YAAkB,EAAQ,EAAS,EAAc,CAChD,GAAI,CAAE,QAAS,EAAQ,GAAI,WAAY,EACnC,CAAE,SAAU,EACZ,EACA,EACA,EAAa,GACb,EAAU,GAEd,GAAQ,IACP,GAAa,EAAG,EAAa,IAEtB,IAAM,CACZ,OAIF,WAAwB,EAAO,CAC9B,EAAM,OAAO,WAAW,GACxB,EAAc,GAAK,EAAa,EAAG,EAAU,EAAE,SAC/C,EAAI,iBAAiB,SAAU,GAC/B,EAAa,EAAG,EAAU,EAAI,SAG/B,YAAgC,CAC/B,AAAI,GAAO,GACV,EAAI,oBAAoB,SAAU,GAIpC,SAAO,MAAQ,GAAW,CACzB,AAAI,SAAW,IAAS,EAAa,EAAG,EAAQ,EAAQ,OACpD,WAAa,IAAS,EAAa,EAAG,EAAU,EAAQ,UAG7D,EAAO,GAAG,OAAS,IAAM,CACxB,GAAI,EAAO,GAAG,MAA8B,EAAG,CAC9C,EACC,AAAI,GACH,KACA,EAAe,MAMZ,CAAC,EAAS,EAAO,EAAY,EAAS,GAG9C,oBAAyB,EAAgB,CACxC,YAAY,EAAS,CACpB,QACA,EAAK,KAAM,EAAS,GAAU,GAAiB,EAAgB,CAAE,MAAO,MAInE,GAAQ,GC9Ef,YAA2B,EAAK,CAC/B,GAAI,GACA,EAEJ,SAAO,GAAI,IAAK,CACd,MAAO,CACN,MAAO,6CACP,GAAI,IACJ,QAAS,CAAE,QAAS,CAAC,KACrB,QAAS,CAAE,UAIP,CACN,GAAI,CACH,EAAiB,EAAK,GAAG,WAE1B,EAAE,EAAQ,EAAQ,CACjB,EAAgB,EAAM,EAAQ,GAC9B,EAAU,IAEX,EAAE,EAAO,CACR,AAAI,GACJ,GAAc,EAAK,GAAG,SAAU,GAChC,EAAU,KAEX,EAAE,EAAO,CACR,EAAe,EAAK,GAAG,SAAU,GACjC,EAAU,IAEX,EAAE,EAAW,CACZ,EAAkB,EAAM,KAM3B,YAA2B,EAAK,CAC/B,GAAI,GACA,EAEJ,SAAO,GAAI,IAAK,CACd,MAAO,CACN,MAAO,6CACP,GAAI,IACJ,QAAS,CAAE,QAAS,CAAC,KACrB,QAAS,CAAE,UAIP,CACN,GAAI,CACH,EAAiB,EAAK,GAAG,WAE1B,EAAE,EAAQ,EAAQ,CACjB,EAAgB,EAAM,EAAQ,GAC9B,EAAU,IAEX,EAAE,EAAO,CACR,AAAI,GACJ,GAAc,EAAK,GAAG,SAAU,GAChC,EAAU,KAEX,EAAE,EAAO,CACR,EAAe,EAAK,GAAG,SAAU,GACjC,EAAU,IAEX,EAAE,EAAW,CACZ,EAAkB,EAAM,KAM3B,YAA+B,EAAK,CACnC,GAAI,GACA,EAEJ,MAAO,CACN,GAAI,CACH,EAAM,EAAQ,OACd,EAAK,EAAK,QAAS,sBACd,GAAc,EAAI,IAAK,EAAgB,kBAAkB,EAAK,EAAK,MAAO,GAC/E,EAAK,EAAK,MAAO,KAElB,EAAE,EAAQ,EAAQ,CACjB,EAAO,EAAQ,EAAK,IAErB,EAAG,EACH,EAAE,EAAW,CACZ,AAAI,GAAW,EAAO,KAMzB,YAA+B,EAAK,CACnC,GAAI,GACA,EAEJ,MAAO,CACN,GAAI,CACH,EAAM,EAAQ,OACd,EAAK,EAAK,QAAS,sBACd,GAAc,EAAI,IAAK,EAAgB,sBAAsB,EAAK,EAAK,MAAO,GACnF,EAAK,EAAK,MAAO,KAElB,EAAE,EAAQ,EAAQ,CACjB,EAAO,EAAQ,EAAK,IAErB,EAAG,EACH,EAAE,EAAW,CACZ,AAAI,GAAW,EAAO,KAMzB,YAA6B,EAAK,CACjC,GAAI,GACA,EACA,EACA,EACE,EAAoB,CAAC,GAAmB,IACxC,EAAY,GAElB,WAA2B,EAAK,EAAO,CACtC,MAAgB,GAAI,IAAY,EACzB,EAGR,SAA2B,EAAkB,EAAK,IAClD,EAAW,EAAU,GAA4B,EAAkB,GAA0B,GAEtF,CACN,GAAI,CACH,EAAS,IACT,EAAkB,MAEnB,EAAE,EAAQ,EAAQ,CACjB,EAAU,GAA0B,EAAE,EAAQ,GAC9C,EAAO,EAAQ,EAAiB,GAChC,EAAU,IAEX,EAAE,EAAK,EAAO,CACb,GAAI,GAAuB,EAC3B,EAA2B,EAAkB,EAAK,GAE9C,IAA6B,GAChC,MAEA,EAAe,EAAU,GAAuB,EAAG,EAAG,IAAM,CAC3D,EAAU,GAAwB,OAGnC,KACA,EAAW,EAAU,GAEhB,GACJ,GAAW,EAAU,GAA4B,EAAkB,GAA0B,GAC7F,EAAS,KAKV,EAAc,EAAU,GACxB,EAAS,EAAE,EAAgB,WAAY,KAGzC,EAAE,EAAO,CACR,AAAI,GACJ,GAAc,GACd,EAAU,KAEX,EAAE,EAAO,CACR,EAAe,GACf,EAAU,IAEX,EAAE,EAAW,CACZ,EAAU,GAA0B,EAAE,GAClC,GAAW,EAAO,KAMzB,YAA2B,EAAK,CAC/B,GAAI,GACA,EACA,EACA,EAEJ,MAAO,CACN,GAAI,CACH,EAAM,EAAQ,OACd,EAAS,EAAQ,UACjB,EAAO,YAAc,gBACrB,EAAK,EAAQ,QAAS,8BACtB,EAAK,EAAK,QAAS,kCAEpB,EAAE,EAAQ,EAAQ,CACjB,EAAO,EAAQ,EAAK,GACpB,EAAO,EAAK,GAEP,GACJ,GAAU,GAAO,EAAQ,QAAiC,EAAI,IAC9D,EAAU,KAGZ,EAAG,EACH,EAAE,EAAW,CACZ,AAAI,GAAW,EAAO,GACtB,EAAU,GACV,MAMH,YAAyB,EAAK,CAC7B,GAAI,GACA,EAA0B,GAAI,GAAmB,EAAI,IAAM,GAC3D,EACA,EAEJ,MAAO,CACN,GAAI,CACH,EAAK,GAAK,KACV,EAAK,GAAK,GACV,EAAK,GAAK,MAEX,EAAE,EAAQ,EAAQ,CACjB,EAAO,EAAQ,EAAI,GACnB,EAAO,EAAQ,EAAI,GACnB,EAAO,EAAQ,EAAI,IAEpB,EAAE,EAAK,EAAO,CACb,AAAI,EAAsB,GAAK,IAAc,GAA0B,GAAI,GAAmB,EAAI,IAAM,KAAK,GAAS,EAAI,IAE3H,EAAE,EAAW,CACZ,AAAI,GAAW,EAAO,GAClB,GAAW,EAAO,GAClB,GAAW,EAAO,KAKzB,YAAyB,EAAK,CAC7B,GAAI,GACA,EACA,EACA,EAAU,KACV,EACA,EACA,EACA,EACA,EACA,EACA,EACA,EACA,EACA,EACA,EACA,EACA,EACA,EACA,EACA,EACA,EACA,EACA,EACA,EAEJ,EAAa,GAAI,IAAW,CAC1B,MAAO,CACN,MAAO,qCACP,QAAS,CACR,QAAS,CACR,GACA,CAAC,CAAE,aAAe,EAAE,GAAI,IACxB,CAAC,CAAE,aAAc,EAAU,KAAO,IAGpC,QAAS,CAAE,UAId,GAAI,IAAY,GAAW,GAAkB,GACzC,GAA0B,EAAI,GAAK,GAAK,GAAgB,GAE5D,SAAQ,GAAI,IAAM,CAChB,MAAO,CACN,KAAqB,EAAI,GACzB,YAAa,GACb,gBAAiB,CAAE,UAAW,QAC9B,YAAa,CAAE,WAAY,cAI9B,EAAM,IAAI,SAAoC,EAAI,IAE3C,CACN,GAAI,CACH,EAAO,EAAQ,OACf,EAAiB,EAAW,GAAG,UAC/B,EAAK,IACD,IAAW,GAAU,IACzB,EAAK,IACL,EAAM,EAAQ,OACd,EAAK,IACL,EAAO,EAAQ,OACf,EAAO,EAAQ,OACf,EAAK,EAAQ,KACb,EAAG,UAAY,0CACf,EAAK,IACL,EAAK,EAAQ,KACb,EAAG,UAAY,8CACf,EAAK,IACL,EAAK,EAAQ,KACb,EAAG,UAAY,yCACf,EAAK,IACL,EAAK,EAAQ,KACb,EAAQ,EAAQ,QAChB,EAAK,GAAK,QACN,IAAW,GAAU,IACzB,EAAM,IACN,EAAiB,EAAM,GAAG,UACrB,GAAc,EAAI,IAAK,EAAgB,uBAAuB,EAAK,EAAK,MAAO,GACpF,EAAK,EAAK,MAAO,eACjB,EAAK,EAAK,QAAS,2BACnB,EAAK,EAAI,OAAQ,KACjB,EAAK,EAAI,QAAS,iBAClB,EAAK,EAAI,OAAQ,WACjB,EAAK,EAAI,QAAS,iBAClB,EAAK,EAAI,OAAQ,SACjB,EAAK,EAAI,QAAS,iBAClB,EAAK,EAAO,QAAS,iBACrB,EAAK,EAAI,OAAQ,SACjB,EAAK,EAAI,QAAS,iBAClB,EAAK,EAAM,QAAS,qBACpB,EAAK,EAAM,QAAS,wBACpB,GAAa,EAAM,cAA+B,EAAI,IACtD,EAAK,EAAM,QAAS,wBACpB,GAAa,EAAM,SAAqB,EAAI,KAE7C,EAAE,EAAQ,GAAQ,CACjB,EAAO,EAAQ,EAAM,IACrB,EAAgB,EAAY,EAAM,MAClC,EAAO,EAAM,GACT,IAAW,GAAU,EAAE,EAAM,MACjC,EAAO,EAAM,GACb,EAAO,EAAM,GACb,EAAO,EAAM,GACb,EAAO,EAAM,GACb,EAAO,EAAM,GACb,EAAO,EAAM,GACb,EAAO,EAAM,GACb,EAAO,EAAM,GACb,EAAO,EAAM,GACb,EAAO,EAAM,GACb,EAAO,EAAM,GACb,EAAO,EAAM,GACb,EAAO,EAAI,GACX,EAAO,EAAO,GACV,IAAW,GAAU,EAAE,EAAO,MAClC,EAAO,EAAQ,EAAK,IACpB,EAAgB,EAAO,EAAQ,IAC/B,EAAU,GAEL,GACJ,GAAU,CACT,GAAO,EAAK,QAA6B,EAAI,IAC7C,GAAO,EAAM,QAA8B,EAAI,KAGhD,EAAU,KAGZ,EAAE,EAAK,CAAC,IAAQ,CACf,GAAM,IAAqB,GAE3B,AAAI,GAA6B,MAChC,IAAmB,QAAU,CAAE,SAAO,QAGvC,EAAW,KAAK,IACZ,GAAS,GAAU,EAAE,EAAK,IAE9B,AAAkB,EAAI,GAAK,EAC1B,AAAI,GACH,GAAU,EAAE,EAAK,IAEjB,IAAY,GAAgB,GAC5B,GAAU,IACV,GAAU,EAAE,EAAO,OAEV,IACV,IAAU,EAAE,GACZ,GAAY,MAGT,EAAC,GAAW,GAAwB,IACvC,GAAa,EAAM,cAA+B,EAAI,IAGnD,EAAC,GAAW,GAAmB,IAClC,GAAa,EAAM,SAAqB,EAAI,IAG7C,GAAM,IAAgB,GACtB,AAAI,GAAuB,GAAG,IAAc,KAAsB,EAAI,IACtE,EAAM,KAAK,KAEZ,EAAE,EAAO,CACR,AAAI,GACJ,GAAc,EAAW,GAAG,SAAU,GACtC,EAAc,EAAM,GAAG,SAAU,GACjC,EAAU,KAEX,EAAE,EAAO,CACR,EAAe,EAAW,GAAG,SAAU,GACvC,EAAe,EAAM,GAAG,SAAU,GAClC,EAAU,IAEX,EAAE,EAAW,CACZ,AAAI,GAAW,EAAO,GACtB,EAAkB,GACd,IAAW,GAAU,IACrB,IAAW,GAAU,IACrB,GAAW,EAAO,GACtB,EAAkB,EAAO,GACzB,EAAU,GACV,GAAQ,KAKX,YAAkB,EAAQ,EAAS,EAAc,CAChD,GAAI,GACJ,GAAoB,EAAQ,GAAW,GAAW,EAAa,EAAG,EAAa,IAC/E,GAAI,GAAY,EACZ,EAEJ,GAAQ,SAAY,CAMnB,GALA,GAAU,MAGV,EAAa,KAET,EACH,GAAI,CACH,GAAI,GAAW,KAAM,IAAI,YAAY,GAErC,AAAI,GACH,GAAa,EAAG,EAAY,EAAS,KAAK,KAAK,UAAU,MAAM,QAE3D,EAAS,KAAK,KAAK,OAEtB,MAAM,KAEN,GAAmB,GACnB,EAAa,EAAG,EAAY,WAGvB,EAAN,CACD,QAAQ,IAAI,MAKf,GAAI,GAAS,GACT,EAAc,GAElB,OAAO,SAAW,IAAM,CACvB,AAAI,OAAO,QAAU,GAAI,EAAa,EAAG,EAAS,IAAY,EAAa,EAAG,EAAS,KAGxF,GAAM,GAAkB,IAAM,CAC7B,EAAa,EAAG,EAAc,CAAC,IAG1B,EAAmB,IAAM,GAAe,IAExC,EAAsB,IAAM,CACjC,GAAU,IAAI,GAAK,GAAiB,MAG/B,EAAwB,IAAM,CACnC,GAAU,OAGL,EAAc,GAAc,UAAU,GAAS,CACpD,EAAa,EAAG,EAAY,KAG7B,kBAAgC,CAI/B,EAAa,AAHO,MAAM,IAAI,kBAGH,KAAK,eAAe,SAAS,GAGzD,UAAU,GAEH,CACN,EACA,EACA,EACA,EACA,EACA,EACA,EACA,GAIF,oBAAqB,EAAgB,CACpC,YAAY,EAAS,CACpB,QACA,EAAK,KAAM,EAAS,GAAU,GAAiB,EAAgB,MAI1D,GAAQ,GC3hBf,YAA6B,EAAK,CACjC,GAAI,GACA,EAEJ,MAAO,CACN,GAAI,CACH,EAAM,EAAQ,OACd,GAAU,EAAK,eAAgC,EAAI,IAC9C,GAAc,EAAI,IAAK,EAA2B,EAAI,KAAK,EAAK,EAAK,MAAO,GACjF,EAAK,EAAK,MAAO,IACjB,EAAK,EAAK,QAAS,kBAEpB,EAAE,EAAQ,EAAQ,CACjB,EAAO,EAAQ,EAAK,IAErB,EAAE,EAAK,EAAO,CACb,AAAI,EAAwB,GAC3B,GAAU,EAAK,eAAgC,EAAI,IAGhD,EAAmB,GAAK,CAAC,GAAc,EAAI,IAAK,EAA2B,EAAI,KAClF,EAAK,EAAK,MAAO,IAGnB,EAAE,EAAW,CACZ,AAAI,GAAW,EAAO,KAKzB,YAAyB,EAAK,CAC7B,GAAI,GACA,EACA,EAAqB,GAAI,GAAc,EAAI,GAAK,IAAM,GACtD,EACA,EACA,EACA,EAEJ,SAAO,GAAI,IAAK,CACd,MAAO,CACN,GAAI,aAAwB,EAAI,GAChC,QAAS,CAAE,QAAS,CAAC,KACrB,QAAS,CAAE,UAIP,CACN,GAAI,CACH,EAAM,EAAQ,OACd,EAAI,EAAQ,KACZ,EAAK,GAAO,GACZ,EAAK,IACL,EAAiB,EAAK,GAAG,UACzB,GAAU,EAAG,QAAyB,EAAI,IAC1C,EAAK,EAAG,QAAS,iBACjB,EAAK,EAAK,QAAS,kBAEpB,EAAE,EAAQ,EAAQ,CACjB,EAAO,EAAQ,EAAK,GACpB,EAAO,EAAK,GACZ,EAAO,EAAG,GACV,EAAO,EAAK,GACZ,EAAgB,EAAM,EAAK,MAC3B,EAAU,IAEX,EAAE,EAAK,CAAC,GAAQ,CACf,AAAK,EAAC,GAAW,EAAiB,IAAM,IAAc,GAAqB,GAAI,GAAc,EAAI,GAAK,IAAM,KAAK,GAAS,EAAI,GAE1H,EAAC,GAAW,EAAwB,IACvC,GAAU,EAAG,QAAyB,EAAI,IAG3C,GAAM,GAAe,GACrB,AAAI,EAAiB,GAAG,GAAa,GAAK,aAAwB,EAAI,IAElE,EAAyC,IAC5C,GAAa,QAAU,CAAE,QAAO,QAGjC,EAAK,KAAK,IAEX,EAAE,EAAO,CACR,AAAI,GACJ,GAAc,EAAK,GAAG,SAAU,GAChC,EAAU,KAEX,EAAE,EAAO,CACR,EAAe,EAAK,GAAG,SAAU,GACjC,EAAU,IAEX,EAAE,EAAW,CACZ,AAAI,GAAW,EAAO,GACtB,EAAkB,KAKrB,YAAkB,EAAQ,EAAS,EAAc,CAChD,GAAI,CAAE,eAAgB,EAClB,CAAE,QAAS,EACX,CAAE,QAAS,EACX,CAAE,UAAW,EAEjB,SAAO,MAAQ,GAAW,CACzB,AAAI,eAAiB,IAAS,EAAa,EAAG,EAAc,EAAQ,aAChE,QAAU,IAAS,EAAa,EAAG,EAAO,EAAQ,MAClD,QAAU,IAAS,EAAa,EAAG,EAAO,EAAQ,MAClD,UAAY,IAAS,EAAa,EAAG,EAAS,EAAQ,SAGpD,CAAC,EAAa,EAAM,EAAM,GAGlC,oBAAyB,EAAgB,CACxC,YAAY,EAAS,CACpB,QAEA,EAAK,KAAM,EAAS,GAAU,GAAiB,EAAgB,CAC9D,YAAa,EACb,KAAM,EACN,KAAM,EACN,OAAQ,MAKJ,GAAQ,GClIf,YAAyB,EAAK,CAC7B,GAAI,GACA,EACA,EACA,EACA,EACA,EACA,EAEJ,SAAa,GAAI,IAAW,CAC1B,MAAO,CACN,YAAa,UACb,KAAM,aACN,KAAM,QACN,OAAQ,4BAIJ,CACN,GAAI,CACH,EAAI,EAAQ,KACZ,EAAI,IACJ,EAAO,EAAQ,OACf,EAAO,EAAQ,OACf,EAAO,EAAQ,OACf,EAAiB,EAAW,GAAG,UAC/B,EAAK,EAAG,KAAM,mBACd,EAAK,EAAG,QAAS,kBACjB,EAAK,EAAM,QAAS,0BACpB,EAAK,EAAM,QAAS,6BACpB,EAAK,EAAM,QAAS,6BAErB,EAAE,EAAQ,EAAQ,CACjB,EAAO,EAAQ,EAAG,GAClB,EAAO,EAAQ,EAAG,GAClB,EAAO,EAAQ,EAAM,GACrB,EAAO,EAAM,GACb,EAAO,EAAM,GACb,EAAgB,EAAY,EAAM,MAClC,EAAU,IAEX,EAAG,EACH,EAAE,EAAO,CACR,AAAI,GACJ,GAAc,EAAW,GAAG,SAAU,GACtC,EAAU,KAEX,EAAE,EAAO,CACR,EAAe,EAAW,GAAG,SAAU,GACvC,EAAU,IAEX,EAAE,EAAW,CACZ,AAAI,GAAW,EAAO,GAClB,GAAW,EAAO,GAClB,GAAW,EAAO,GACtB,EAAkB,KAKrB,oBAAuB,EAAgB,CACtC,YAAY,EAAS,CACpB,QACA,EAAK,KAAM,EAAS,KAAM,GAAiB,EAAgB,MAItD,GAAQ,GC3Ef,YAAyB,EAAK,CAC7B,GAAI,GACA,EACA,EAEJ,MAAO,CACN,GAAI,CACH,EAAI,EAAQ,KACZ,EAAK,IACL,EAAO,EAAQ,OAEf,EAAK,UAAY;AAAA;AAAA,+bAIjB,EAAK,EAAG,KAAM,SACd,EAAK,EAAM,QAAS,6BAErB,EAAE,EAAQ,EAAQ,CACjB,EAAO,EAAQ,EAAG,GAClB,EAAO,EAAQ,EAAI,GACnB,EAAO,EAAQ,EAAM,IAEtB,EAAG,EACH,EAAG,EACH,EAAG,EACH,EAAE,EAAW,CACZ,AAAI,GAAW,EAAO,GAClB,GAAW,EAAO,GAClB,GAAW,EAAO,KAKzB,oBAAoB,EAAgB,CACnC,YAAY,EAAS,CACpB,QACA,EAAK,KAAM,EAAS,KAAM,GAAiB,EAAgB,MAItD,GAAQ,GC5Bf,YAA2B,EAAK,CAC/B,GAAI,GACA,EACA,EACA,EACA,EACA,EACA,EAEJ,MAAO,CACN,GAAI,CACH,EAAO,EAAQ,OACf,EAAQ,EAAQ,SAChB,EAAI,IACJ,EAAO,EAAQ,OACf,EAAK,UAAY,yEACjB,EAAM,SAAW,GACZ,GAAc,EAAM,IAAK,EAAkB,+BAA+B,EAAK,EAAO,MAAO,GAClG,EAAK,EAAO,QAAS,iBACrB,EAAK,EAAM,QAAS,yBACpB,EAAK,EAAM,QAAS,yBAErB,EAAE,EAAQ,EAAQ,CACjB,EAAO,EAAQ,EAAM,GACrB,EAAO,EAAM,GACO,EAAI,GAAG,GAC3B,EAAO,EAAQ,EAAG,GAClB,EAAO,EAAQ,EAAM,GAEhB,GACJ,GAAU,GAAO,EAAO,iBAA+C,EAAI,IAC3E,EAAU,KAGZ,EAAG,EACH,EAAE,EAAW,CACZ,AAAI,GAAW,EAAO,GACF,EAAI,GAAG,MACvB,GAAW,EAAO,GAClB,GAAW,EAAO,GACtB,EAAU,GACV,MAMH,YAAyB,EAAK,CAC7B,GAAI,GACA,EACA,EACA,EACA,EACA,EACA,EAEJ,MAAO,CACN,GAAI,CACH,EAAO,EAAQ,OACf,EAAK,UAAY,yEACjB,EAAI,IACJ,EAAO,EAAQ,OACf,EAAQ,EAAQ,SAChB,EAAK,EAAM,QAAS,wBACpB,EAAM,SAAW,GACZ,GAAc,EAAM,IAAK,EAAkB,+BAA+B,EAAK,EAAO,MAAO,GAClG,EAAK,EAAO,QAAS,iBACrB,EAAK,EAAM,QAAS,0BAErB,EAAE,EAAQ,EAAQ,CACjB,EAAO,EAAQ,EAAM,GACrB,EAAO,EAAQ,EAAG,GAClB,EAAO,EAAQ,EAAM,GACrB,EAAO,EAAM,GACK,EAAI,GAAG,GAEpB,GACJ,GAAU,GAAO,EAAO,iBAA6C,EAAI,IACzE,EAAU,KAGZ,EAAG,EACH,EAAE,EAAW,CACZ,AAAI,GAAW,EAAO,GAClB,GAAW,EAAO,GAClB,GAAW,EAAO,GACJ,EAAI,GAAG,MACzB,EAAU,GACV,MAMH,YAA6B,EAAK,CACjC,GAAI,GAEJ,WAA2B,EAAK,EAAO,CACtC,MAAgB,GAAI,GAAW,GACxB,GAGR,GAAI,GAAqB,EAAkB,EAAK,IAC5C,EAAW,EAAmB,GAElC,MAAO,CACN,GAAI,CACH,EAAS,IACT,EAAkB,MAEnB,EAAE,EAAQ,EAAQ,CACjB,EAAS,EAAE,EAAQ,GACnB,EAAO,EAAQ,EAAiB,IAEjC,EAAE,EAAK,EAAO,CACb,AAAI,IAAwB,GAAqB,EAAkB,EAAK,KAAW,EAClF,EAAS,EAAE,EAAK,GAEhB,GAAS,EAAE,GACX,EAAW,EAAmB,GAE1B,GACH,GAAS,IACT,EAAS,EAAE,EAAgB,WAAY,MAI1C,EAAE,EAAW,CACZ,EAAS,EAAE,GACP,GAAW,EAAO,KAKzB,YAAyB,EAAK,CAC7B,GAAI,GACA,EACA,EACA,EAEJ,SAAa,GAAI,IAAW,CAC1B,MAAO,CACN,MAAO,qCACP,QAAS,CACR,QAAS,CACR,GACA,CAAC,CAAE,aAAe,EAAE,EAAG,IACvB,CAAC,CAAE,aAAc,EAAU,GAAK,IAGlC,QAAS,CAAE,UAIP,CACN,GAAI,CACH,EAAO,EAAQ,OACf,EAAO,EAAQ,OACf,EAAiB,EAAW,GAAG,UAC/B,EAAK,EAAM,QAAS,sBACpB,EAAK,EAAM,QAAS,4BAErB,EAAE,EAAQ,EAAQ,CACjB,EAAO,EAAQ,EAAM,GACrB,EAAO,EAAM,GACb,EAAgB,EAAY,EAAM,MAClC,EAAU,IAEX,EAAE,EAAK,CAAC,GAAQ,CACf,GAAM,GAAqB,GAE3B,AAAI,EAAkC,IACrC,GAAmB,QAAU,CAAE,QAAO,QAGvC,EAAW,KAAK,IAEjB,EAAE,EAAO,CACR,AAAI,GACJ,GAAc,EAAW,GAAG,SAAU,GACtC,EAAU,KAEX,EAAE,EAAO,CACR,EAAe,EAAW,GAAG,SAAU,GACvC,EAAU,IAEX,EAAE,EAAW,CACZ,AAAI,GAAW,EAAO,GACtB,EAAkB,KAKrB,YAAkB,EAAQ,EAAS,EAAc,CAChD,GAAI,GACE,EAAyB,IAAM,EAAa,EAAG,EAAI,YAAc,GAAK,GAE5E,WAAuB,EAAS,CAC/B,GAAkB,EAAU,UAAY,QAAQ,IAAM,CACrD,EAAM,EACN,EAAa,EAAG,KAIlB,GAAM,GAA2B,IAAM,EAAa,EAAG,EAAI,YAAc,GAAK,GAE9E,WAAyB,EAAS,CACjC,GAAkB,EAAU,UAAY,QAAQ,IAAM,CACrD,EAAM,EACN,EAAa,EAAG,KAIlB,MAAO,CACN,EACA,EACA,EACA,EACA,GAIF,oBAA0B,EAAgB,CACzC,YAAY,EAAS,CACpB,QACA,EAAK,KAAM,EAAS,GAAU,GAAiB,EAAgB,MAI1D,GAAQ,GClPf,YAAyB,EAAK,CAC7B,GAAI,GACA,EACA,EAEJ,MAAO,CACN,GAAI,CACH,EAAK,EAAQ,KACb,EAAK,IACL,EAAO,EAAQ,OAEf,EAAK,UAAY;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA,wKAejB,EAAK,EAAI,KAAM,OACf,EAAK,EAAM,QAAS,6BAErB,EAAE,EAAQ,EAAQ,CACjB,EAAO,EAAQ,EAAI,GACnB,EAAO,EAAQ,EAAI,GACnB,EAAO,EAAQ,EAAM,IAEtB,EAAG,EACH,EAAG,EACH,EAAG,EACH,EAAE,EAAW,CACZ,AAAI,GAAW,EAAO,GAClB,GAAW,EAAO,GAClB,GAAW,EAAO,KAKzB,oBAAkB,EAAgB,CACjC,YAAY,EAAS,CACpB,QACA,EAAK,KAAM,EAAS,KAAM,GAAiB,EAAgB,MAItD,GAAQ,GCrDf,YAAyB,EAAK,CAC7B,GAAI,GAEJ,MAAO,CACN,GAAI,CACH,EAAM,EAAQ,OACd,EAAK,EAAK,QAAS,mBAEpB,EAAE,EAAQ,EAAQ,CACjB,EAAO,EAAQ,EAAK,IAErB,EAAG,EACH,EAAG,EACH,EAAG,EACH,EAAE,EAAW,CACZ,AAAI,GAAW,EAAO,KAKzB,oBAAqB,EAAgB,CACpC,YAAY,EAAS,CACpB,QACA,EAAK,KAAM,EAAS,KAAM,GAAiB,EAAgB,MAItD,GAAQ,GCnBf,YAAyB,EAAK,CAC7B,GAAI,GACA,EACA,EACA,EACA,EACE,EAAmC,EAAI,GAAG,QAC1C,EAAe,GAAY,EAAuB,EAAiB,EAAI,GAAI,MAEjF,MAAO,CACN,GAAI,CACH,EAAS,EAAQ,UACb,GAAc,EAAa,IAC/B,EAAK,EAAQ,QAAS,EAAqB,iBAA6B,EAAI,GAAK,KAAkB,GAAI,GAAK,UAAoB,EAAI,MAAQ,IAAM,IAAkB,GAAI,GAAK,WAAsB,EAAI,MAAQ,IAAM,IAAsB,EAAI,GAAK,KACpP,EAAO,SAAwB,EAAI,GACnC,EAAK,EAAQ,QAAS,kBACtB,GAAa,EAAQ,MAAe,EAAI,IACxC,GAAa,EAAQ,OAAkB,EAAI,KAAO,QAClD,GAAa,EAAQ,WAAyB,EAAI,KAEnD,EAAE,EAAQ,EAAQ,CACjB,EAAO,EAAQ,EAAQ,GAEnB,GACH,EAAa,EAAE,EAAQ,MAGxB,EAAU,GAEL,GACJ,GAAU,GAAO,EAAQ,QAA2B,EAAI,IACxD,EAAU,KAGZ,EAAE,EAAK,CAAC,GAAQ,CACf,AAAI,GACC,EAAa,GAAM,EAAC,GAAW,EAAoB,MACtD,GACC,EACA,EACA,EACY,EAAI,GAChB,AAAC,EAEC,GAAiB,EAAmC,EAAI,GAAI,EAAO,MADnE,GAAqC,EAAI,IAE3C,MAKC,EAAC,GAAW,EAA8C,IAAM,IAAwB,GAAqB,iBAA6B,EAAI,GAAK,KAAkB,GAAI,GAAK,UAAoB,EAAI,MAAQ,IAAM,IAAkB,GAAI,GAAK,WAAsB,EAAI,MAAQ,IAAM,IAAsB,EAAI,GAAK,OACzT,EAAK,EAAQ,QAAS,GAGnB,EAAC,GAAW,EAAqB,KACpC,GAAO,SAAwB,EAAI,IAGhC,EAAC,GAAW,EAAgB,IAC/B,GAAa,EAAQ,MAAe,EAAI,IAGrC,EAAC,GAAW,EAAkB,KACjC,GAAa,EAAQ,OAAkB,EAAI,KAAO,QAG/C,EAAC,GAAW,EAAqB,KACpC,GAAa,EAAQ,WAAyB,EAAI,KAGpD,EAAE,EAAO,CACR,AAAI,GACJ,GAAc,EAAc,GAC5B,EAAU,KAEX,EAAE,EAAO,CACR,EAAe,EAAc,GAC7B,EAAU,IAEX,EAAE,EAAW,CACZ,AAAI,GAAW,EAAO,GAClB,GAAc,EAAa,EAAE,GACjC,EAAU,GACV,MAKH,YAAkB,EAAQ,EAAS,EAAc,CAChD,GAAI,CAAE,QAAS,EAAQ,GAAI,WAAY,EACnC,CAAE,MAAM,IAAU,EAClB,CAAE,QAAQ,cAAiB,EAC3B,CAAE,SAAU,EACZ,CAAE,UAAW,EACb,CAAE,cAAc,IAAO,EACvB,CAAE,SAAU,EACZ,CAAE,WAAW,IAAU,EAE3B,WAAuB,EAAO,CAC7B,GAAO,KAAK,KAAM,EAAQ,GAG3B,SAAO,MAAQ,GAAW,CACzB,AAAI,OAAS,IAAS,EAAa,EAAG,EAAM,EAAQ,KAChD,SAAW,IAAS,EAAa,EAAG,EAAQ,EAAQ,OACpD,SAAW,IAAS,EAAa,EAAG,EAAQ,EAAQ,OACpD,UAAY,IAAS,EAAa,EAAG,EAAS,EAAQ,QACtD,eAAiB,IAAS,EAAa,EAAG,EAAc,EAAQ,aAChE,SAAW,IAAS,EAAa,EAAG,EAAQ,EAAQ,OACpD,YAAc,IAAS,EAAa,EAAG,EAAW,EAAQ,UAC1D,WAAa,IAAS,EAAa,EAAG,EAAU,EAAQ,UAGtD,CACN,EACA,EACA,EACA,EACA,EACA,EACA,EACA,EACA,EACA,GAIF,oBAA4B,EAAgB,CAC3C,YAAY,EAAS,CACpB,QAEA,EAAK,KAAM,EAAS,GAAU,GAAiB,EAAgB,CAC9D,IAAK,EACL,MAAO,EACP,MAAO,EACP,OAAQ,EACR,YAAa,EACb,MAAO,EACP,SAAU,MAKN,GAAQ,GCjJf,YAAyB,EAAK,CAC7B,GAAI,GACA,EACA,EACA,EACA,EACA,EAEJ,MAAO,CACN,GAAI,CACH,EAAO,EAAQ,OACf,EAAO,EAAQ,OACf,EAAM,EAAQ,OACT,GAAc,EAAI,IAAK,EAAgB,uBAAuB,EAAK,EAAK,MAAO,GACpF,EAAK,EAAK,MAAO,wBACjB,EAAK,EAAK,QAAS,kBACnB,EAAK,EAAM,QAAS,0BACpB,EAAK,EAAM,QAAS,6BAErB,EAAE,EAAQ,EAAQ,CACjB,EAAO,EAAQ,EAAM,GACrB,EAAO,EAAM,GACb,EAAO,EAAM,GAER,GACJ,GAAU,GAAO,EAAK,QAA2B,EAAI,IACrD,EAAU,KAGZ,EAAG,EACH,EAAG,EACH,EAAG,EACH,EAAE,EAAW,CACZ,AAAI,GAAW,EAAO,GACtB,EAAU,GACV,MAKH,YAAkB,EAAQ,CAEzB,MAAO,CADe,IAAM,GAAS,oBAItC,oBAAqB,EAAgB,CACpC,YAAY,EAAS,CACpB,QACA,EAAK,KAAM,EAAS,GAAU,GAAiB,EAAgB,MAI1D,GAAQ,GCvDf,YAAyB,EAAK,CAC7B,GAAI,GAEJ,MAAO,CACN,GAAI,CACH,EAAO,EAAQ,OAEf,EAAK,UAAY;AAAA;AAAA;AAAA,+MAKjB,EAAK,EAAM,QAAS,6BAErB,EAAE,EAAQ,EAAQ,CACjB,EAAO,EAAQ,EAAM,IAEtB,EAAG,EACH,EAAG,EACH,EAAG,EACH,EAAE,EAAW,CACZ,AAAI,GAAW,EAAO,KAKzB,oBAAwB,EAAgB,CACvC,YAAY,EAAS,CACpB,QACA,EAAK,KAAM,EAAS,KAAM,GAAiB,EAAgB,MAItD,GAAQ,GCzBf,YAA6B,EAAK,CACjC,GAAI,GAEJ,MAAO,CACN,GAAI,CACH,EAAI,GAAK,0BAEV,EAAE,EAAQ,EAAQ,CACjB,EAAO,EAAQ,EAAG,IAEnB,EAAE,EAAW,CACZ,AAAI,GAAW,EAAO,KAKzB,YAAyB,EAAK,CAC7B,GAAI,GACA,EACA,EACA,EACA,EACA,EACA,EACA,EACA,EACA,EACA,EACA,EACA,EACA,EACA,EACA,EACA,EAEJ,SAAe,GAAI,IAAa,CAC9B,MAAO,CACN,MAAO,UACP,QAAS,CAAE,QAAS,CAAC,KACrB,QAAS,CAAE,UAIP,CACN,GAAI,CACH,EAAO,EAAQ,OACf,EAAO,EAAQ,OAEf,EAAK,UAAY;AAAA,mIAGjB,EAAK,IACL,EAAO,EAAQ,OACf,EAAO,EAAQ,OACf,EAAK,YAAc,eAA+B,EAAI,wBACtD,EAAK,IACL,EAAO,EAAQ,OACf,EAAK,UAAY,iFACjB,EAAK,IACL,EAAO,EAAQ,OACf,EAAK,UAAY,mEACjB,EAAK,IACL,EAAO,EAAQ,OACf,EAAK,UAAY,qEACjB,EAAM,IACN,EAAO,EAAQ,OACf,EAAiB,EAAa,GAAG,UACjC,EAAK,EAAM,QAAS,8BACpB,EAAK,EAAM,QAAS,iBACpB,EAAK,EAAM,QAAS,iBACpB,EAAK,EAAM,QAAS,iBACpB,EAAK,EAAM,QAAS,iBACpB,EAAK,EAAM,QAAS,qCACpB,EAAK,EAAM,QAAS,uBACpB,EAAK,EAAM,QAAS,4BAErB,EAAE,EAAQ,EAAQ,CACjB,EAAO,EAAQ,EAAM,GACrB,EAAO,EAAM,GACb,EAAO,EAAM,GACb,EAAO,EAAM,GACb,EAAO,EAAM,GACb,EAAO,EAAM,GACb,EAAO,EAAM,GACb,EAAO,EAAM,GACb,EAAO,EAAM,GACb,EAAO,EAAM,GACb,EAAO,EAAM,GACb,EAAO,EAAM,GACb,EAAO,EAAM,GACb,EAAgB,EAAc,EAAM,MACpC,EAAU,GAEL,GACJ,GAAU,GAAO,EAAM,QAA2B,EAAI,IACtD,EAAU,KAGZ,EAAE,EAAK,CAAC,GAAQ,CACf,GAAM,GAAuB,GAE7B,AAAI,EAAoB,GACvB,GAAqB,QAAU,CAAE,QAAO,QAGzC,EAAa,KAAK,IAEnB,EAAE,EAAO,CACR,AAAI,GACJ,GAAc,EAAa,GAAG,SAAU,GACxC,EAAU,KAEX,EAAE,EAAO,CACR,EAAe,EAAa,GAAG,SAAU,GACzC,EAAU,IAEX,EAAE,EAAW,CACZ,AAAI,GAAW,EAAO,GACtB,EAAkB,GAClB,EAAU,GACV,MAKH,YAAkB,EAAQ,CAGzB,MAAO,CAFW,GAAI,QAAO,cACP,IAAM,GAAS,eAItC,oBAAqB,EAAgB,CACpC,YAAY,EAAS,CACpB,QACA,EAAK,KAAM,EAAS,GAAU,GAAiB,EAAgB,MAI1D,GAAQ,GClKf,GAAI,IAAiB,MAAO,aAAe,YAAc,WAAa,MAAO,SAAW,YAAc,OAAS,MAAO,SAAW,YAAc,OAAS,MAAO,OAAS,YAAc,KAAO,GAE7L,YAA8B,EAAI,EAAS,EAAQ,CAClD,MAAO,GAAS,CACf,KAAM,EACN,QAAS,GACT,QAAS,SAAU,EAAM,EAAM,CAC9B,MAAO,IAAgB,EAA6B,GAAiB,EAAO,QAE3E,EAAG,EAAQ,EAAO,SAAU,EAAO,QAGvC,aAA4B,CAC3B,KAAM,IAAI,OAAM,2ECRjB,YAAiB,EAAQ,CACxB,GAAc,EAAQ,gBAAiB;AAAA;AAAA,8UAGxC,YAAyB,EAAK,CAC7B,GAAI,GACA,EACA,EAEJ,MAAO,CACN,GAAI,CACH,EAAS,EAAQ,UACjB,EAAK,EAAQ,QAAS,yDACtB,GAAa,EAAQ,8BAA0C,EAAI,KAEpE,EAAE,EAAQ,EAAQ,CACjB,EAAO,EAAQ,EAAQ,GAElB,GACJ,GAAU,GAAO,EAAQ,QAA2B,EAAI,IACxD,EAAU,KAGZ,EAAE,EAAK,CAAC,GAAQ,CACf,AAAI,EAAmB,GACtB,GAAa,EAAQ,8BAA0C,EAAI,KAGrE,EAAG,EACH,EAAG,EACH,EAAE,EAAW,CACZ,AAAI,GAAW,EAAO,GACtB,EAAU,GACV,MAKH,YAAkB,EAAQ,EAAS,EAAc,CAChD,GAAI,CAAE,SAAS,IAAU,EAEzB,WAAuB,EAAO,CAC7B,GAAO,KAAK,KAAM,EAAQ,GAG3B,SAAO,MAAQ,GAAW,CACzB,AAAI,UAAY,IAAS,EAAa,EAAG,EAAS,EAAQ,SAGpD,CAAC,EAAQ,GAGjB,oBAAkB,EAAgB,CACjC,YAAY,EAAS,CACpB,QACA,EAAK,KAAM,EAAS,GAAU,GAAiB,EAAgB,CAAE,OAAQ,GAAK,MAMhF,YAAmB,EAAQ,CAC1B,GAAc,EAAQ,iBAAkB,yTAGzC,YAA0B,EAAK,EAAM,EAAG,CACvC,GAAM,GAAY,EAAI,QACtB,SAAU,GAAK,EAAK,GACpB,EAAU,GAAK,EACR,EAIR,YAA2B,EAAO,EAAK,CACtC,GAAI,GACA,EACA,EACA,EAEJ,YAAyB,CACxB,MAAyB,GAAI,GAAiB,EAAI,IAGnD,SAAM,GAAI,IAAI,CACZ,MAAO,CACN,OAA6B,EAAI,KAAqB,EAAI,MAI7D,EAAI,IAAI,QAAS,GAEV,CACN,IAAK,EACL,MAAO,KACP,GAAI,CACH,EAAM,EAAQ,OACd,EAAiB,EAAI,GAAG,UACxB,EAAI,IACJ,EAAK,EAAK,QAAS,kDACnB,KAAK,MAAQ,GAEd,EAAE,EAAQ,EAAQ,CACjB,EAAO,EAAQ,EAAK,GACpB,EAAgB,EAAK,EAAK,MAC1B,EAAO,EAAK,GACZ,EAAU,IAEX,EAAE,EAAS,EAAO,CACjB,EAAM,EACN,GAAM,GAAc,GACpB,AAAI,EAAyC,GAAG,GAAY,OAA8B,EAAI,KAAqB,EAAI,IACvH,EAAI,KAAK,IAEV,EAAE,EAAO,CACR,AAAI,GACJ,GAAc,EAAI,GAAG,SAAU,GAC/B,EAAU,KAEX,EAAE,EAAO,CACR,EAAe,EAAI,GAAG,SAAU,GAChC,EAAU,IAEX,EAAE,EAAW,CACZ,AAAI,GAAW,EAAO,GACtB,EAAkB,KAKrB,YAA2B,EAAK,CAC/B,GAAI,GACA,EAAc,GACd,EAAgB,GAAI,KACpB,EACA,EAAa,MAAqB,EAAI,IACpC,EAAU,GAAqB,EAAI,GAEzC,OAAS,GAAI,EAAG,EAAI,EAAW,OAAQ,GAAK,EAAG,CAC9C,GAAI,GAAY,GAAiB,EAAK,EAAY,GAC9C,EAAM,EAAQ,GAClB,EAAc,IAAI,EAAK,EAAY,GAAK,GAAkB,EAAK,IAGhE,MAAO,CACN,GAAI,CACH,EAAM,EAAQ,OAEd,OAAS,GAAI,EAAG,EAAI,EAAY,OAAQ,GAAK,EAC5C,EAAY,GAAG,IAGhB,EAAK,EAAK,QAAS,+CAEpB,EAAE,EAAQ,EAAQ,CACjB,EAAO,EAAQ,EAAK,GAEpB,OAAS,GAAI,EAAG,EAAI,EAAY,OAAQ,GAAK,EAC5C,AAAI,EAAY,IACf,EAAY,GAAG,EAAE,EAAK,MAIxB,EAAU,IAEX,EAAE,EAAK,CAAC,GAAQ,CACf,AAAI,EAAgE,GACnE,GAAa,MAAqB,EAAI,IACtC,KACA,EAAc,GAAkB,EAAa,EAAO,EAAS,EAAG,EAAK,EAAY,EAAe,EAAK,GAAyB,GAAmB,KAAM,IACvJ,OAGF,EAAE,EAAO,CACR,GAAI,GAEJ,QAAS,GAAI,EAAG,EAAI,EAAW,OAAQ,GAAK,EAC3C,EAAc,EAAY,IAG3B,EAAU,KAEX,EAAE,EAAO,CACR,OAAS,GAAI,EAAG,EAAI,EAAY,OAAQ,GAAK,EAC5C,EAAe,EAAY,IAG5B,EAAU,IAEX,EAAE,EAAW,CACZ,AAAI,GAAW,EAAO,GAEtB,OAAS,GAAI,EAAG,EAAI,EAAY,OAAQ,GAAK,EAC5C,EAAY,GAAG,MAMnB,YAAoB,EAAQ,EAAS,EAAc,CAClD,GAAM,GAAW,KACb,CAAE,aAAa,GAAM,EACrB,CAAE,mBAAmB,GAAM,EAE/B,WAAwB,EAAW,CAClC,EAAS,aAAc,GAGxB,GAAM,GAAgB,GAAa,EAAe,GAElD,SAAO,MAAQ,GAAW,CACzB,AAAI,cAAgB,IAAS,EAAa,EAAG,EAAa,EAAQ,YAC9D,oBAAsB,IAAS,EAAa,EAAG,EAAmB,EAAQ,mBAGxE,CAAC,EAAY,EAAkB,EAAgB,GAGvD,oBAAmB,EAAgB,CAClC,YAAY,EAAS,CACpB,QACA,EAAK,KAAM,EAAS,GAAY,GAAmB,EAAgB,CAAE,WAAY,EAAG,iBAAkB,GAAK,MAIvG,GAAO,OACP,GAAO,OAIb,YAAmB,EAAQ,CAC1B,GAAc,EAAQ,gBAAiB,22BAGxC,YAA2B,EAAK,CAC/B,GAAI,GACA,EACA,EACA,EAEJ,MAAO,CACN,GAAI,CACH,EAAS,EAAQ,UACjB,EAAI,EAAQ,KACZ,EAAK,EAAG,QAAS,0CACjB,GAAa,EAAG,gCAA+C,EAAI,KAAO,IAC1E,GAAa,EAAG,gCAA+C,EAAI,KAAO,IAC1E,EAAK,EAAQ,QAAS,8DACtB,GAAa,EAAQ,qCAAmD,EAAI,KAE7E,EAAE,EAAQ,EAAQ,CACjB,EAAO,EAAQ,EAAQ,GACvB,EAAO,EAAQ,GAEV,GACJ,GAAU,GAAO,EAAQ,QAA2B,EAAI,IACxD,EAAU,KAGZ,EAAE,EAAK,CAAC,GAAQ,CACf,AAAI,EAA4B,GAC/B,GAAa,EAAG,gCAA+C,EAAI,KAAO,IAGvE,EAA4B,GAC/B,GAAa,EAAG,gCAA+C,EAAI,KAAO,IAGvE,EAAqB,GACxB,GAAa,EAAQ,qCAAmD,EAAI,KAG9E,EAAG,EACH,EAAG,EACH,EAAE,EAAW,CACZ,AAAI,GAAW,EAAO,GACtB,EAAU,GACV,MAKH,YAAoB,EAAQ,EAAS,EAAc,CAClD,GAAI,CAAE,YAAY,IAAS,EACvB,CAAE,WAAW,IAAU,EAE3B,WAAuB,EAAO,CAC7B,GAAO,KAAK,KAAM,EAAQ,GAG3B,SAAO,MAAQ,GAAW,CACzB,AAAI,aAAe,IAAS,EAAa,EAAG,EAAY,EAAQ,WAC5D,YAAc,IAAS,EAAa,EAAG,EAAW,EAAQ,WAGxD,CAAC,EAAW,EAAU,GAG9B,oBAAoB,EAAgB,CACnC,YAAY,EAAS,CACpB,QACA,EAAK,KAAM,EAAS,GAAY,GAAmB,EAAgB,CAAE,UAAW,EAAG,SAAU,GAAK,MAMpG,YAAmB,EAAQ,CAC1B,GAAc,EAAQ,gBAAiB,6GAGxC,YAA2B,EAAK,CAC/B,GAAI,GAEJ,MAAO,CACN,GAAI,CACH,EAAM,EAAQ,OACd,EAAK,EAAK,QAAS,iDACnB,GAAU,EAAK,QAAmB,EAAI,GAAK,MAE5C,EAAE,EAAQ,EAAQ,CACjB,EAAO,EAAQ,EAAK,IAErB,EAAE,EAAK,CAAC,GAAQ,CACf,AAAI,EAAkB,GACrB,GAAU,EAAK,QAAmB,EAAI,GAAK,MAG7C,EAAG,EACH,EAAG,EACH,EAAE,EAAW,CACZ,AAAI,GAAW,EAAO,KAKzB,GAAM,IAAc,IAEpB,YAAoB,EAAQ,EAAS,EAAc,CAClD,GAAI,GACA,CAAE,QAAQ,GAAM,EAEpB,SAAO,MAAQ,GAAW,CACzB,AAAI,SAAW,IAAS,EAAa,EAAG,EAAQ,EAAQ,QAGzD,EAAO,GAAG,OAAS,IAAM,CACxB,AAAI,EAAO,GAAG,MAAkB,GAC9B,EAAa,EAAG,EAAQ,KAAK,IAAI,KAAK,IAAI,EAAQ,GAAa,GAAI,MAI/D,CAAC,EAAO,GAGhB,oBAAuB,EAAgB,CACtC,YAAY,EAAS,CACpB,QACA,EAAK,KAAM,EAAS,GAAY,GAAmB,EAAgB,CAAE,MAAO,GAAK,MAKnF,YAA+B,EAAQ,EAAI,CACzC,EAAO,iBAAiB,YAAa,GACrC,EAAO,iBAAiB,aAAc,EAAI,CAAE,QAAS,KAEvD,YAAkC,EAAQ,EAAI,CAC5C,EAAO,oBAAoB,YAAa,GACxC,EAAO,oBAAoB,aAAc,GAI3C,YAA6B,EAAQ,EAAI,CACvC,EAAO,iBAAiB,UAAW,GACnC,EAAO,iBAAiB,WAAY,GAEtC,YAAgC,EAAQ,EAAI,CAC1C,EAAO,oBAAoB,UAAW,GACtC,EAAO,oBAAoB,WAAY,GAIzC,YAA8B,EAAQ,EAAI,CACxC,EAAO,iBAAiB,YAAa,GACrC,EAAO,iBAAiB,YAAa,GAEvC,YAAiC,EAAQ,EAAI,CAC3C,EAAO,oBAAoB,YAAa,GACxC,EAAO,oBAAoB,YAAa,GAG1C,YAA0B,EAAQ,CAChC,MAAO,UAAU,EAAO,EAAM,CAC5B,EAAO,cACL,GAAI,aAAY,EAAO,CACrB,OAAQ,MAMhB,GAAM,IAAkB,IAClB,GAAkB,EAElB,GAAwB,IACxB,GAAwB,GAE9B,YAAmB,EAAO,CACxB,GAAI,cAAgB,SAAU,YAAiB,YAAY,CACzD,GAAM,GAAQ,EAAM,QAAQ,GAC5B,MAAO,CACL,EAAG,EAAQ,EAAM,QAAU,EAC3B,EAAG,EAAQ,EAAM,QAAU,GAG/B,MAAO,CACL,EAAG,EAAM,QACT,EAAG,EAAM,SAIb,YAAmB,EAAM,CAAE,qBAAqB,CAC9C,GAAM,GAAW,GAAiB,GAC9B,EACA,EACA,EAAQ,EACR,EACA,EAAa,GAEjB,YAAwB,CAEtB,MAAO,AADiB,MAAK,MAAQ,GACX,IAAyB,KAAK,IAAI,IAAU,GAGxE,WAAoB,EAAO,CACzB,EAAiB,KAAK,MACtB,EAAQ,EACR,EAAa,GACb,GAAM,GAAS,GAAU,GACzB,EAAI,EAAO,EACX,EAAI,EAAO,EACX,EAAS,aAAc,CAAE,IAAG,MAC5B,GAAqB,OAAQ,GAC7B,GAAoB,OAAQ,GAG9B,WAAoB,EAAO,CACzB,GAAI,CAAC,EAAY,OACjB,GAAM,GAAS,GAAU,GACnB,EAAK,EAAO,EAAI,EAChB,EAAK,EAAO,EAAI,EACtB,EAAI,EAAO,EACX,EAAI,EAAO,EACX,EAAS,YAAa,CAAE,IAAG,IAAG,KAAI,OAE9B,IAAO,GAAK,KAAK,KAAK,KAAQ,KAAK,KAAK,IAC1C,GAAQ,GAEV,GAAS,EACL,KAAK,IAAI,GAAS,KACpB,GAAS,wBAAyB,CAAE,UAAW,EAAQ,EAAI,GAAO,KAClE,GAAuB,OAAQ,GAC/B,GAAwB,OAAQ,IAIpC,WAAkB,EAAO,CAMvB,GALA,GAAuB,OAAQ,GAC/B,GAAwB,OAAQ,GAEhC,EAAa,GAET,CAAC,IAAgB,CACnB,EAAS,eACT,OAEF,GAAM,GAAS,GAAU,GACzB,EAAS,WAAY,CAAE,EAAG,EAAO,EAAG,EAAG,EAAO,IAGhD,UAAsB,EAAM,GACrB,CACL,SAAU,CACR,GAAyB,EAAM,KAMrC,YAAiC,EAAQ,EAAI,CAC3C,EAAO,iBAAiB,aAAc,GAExC,YAAoC,EAAQ,EAAI,CAC9C,EAAO,oBAAoB,aAAc,GAI3C,YAAkC,EAAQ,EAAI,CAC5C,EAAO,iBAAiB,aAAc,GAExC,YAAqC,EAAQ,EAAI,CAC/C,EAAO,oBAAoB,aAAc,GAM3C,YAAmB,EAAM,CACvB,GAAM,GAAW,GAAiB,GAElC,YAAyB,CACvB,GAAyB,EAAM,GAC/B,EAAS,UAAW,CAAE,MAAO,KAG/B,YAA0B,CACxB,EAAS,UAAW,CAAE,MAAO,KAC7B,GAA4B,EAAM,GAGpC,UAAwB,EAAM,GAEvB,CACL,SAAU,CACR,GAA2B,EAAM,GACjC,GAA4B,EAAM,KAKxC,GAAM,IAAc,CAAC,EAAI,IAAO,CAC9B,GAAM,GAAQ,EAAG,EAAI,EAAG,EAClB,EAAQ,EAAG,EAAI,EAAG,EAExB,MAAO,MAAK,KAAM,EAAQ,EAAU,EAAQ,IAG9C,YAAyB,EAAK,EAAO,EAAK,CACxC,MAAO,MAAK,IAAI,EAAK,KAAK,IAAI,EAAO,IAIvC,YAAiC,EAAQ,EAAI,CAC3C,EAAO,iBAAiB,aAAc,EAAI,CAAE,QAAS,KAEvD,YAAoC,EAAQ,EAAI,CAC9C,EAAO,oBAAoB,aAAc,GAI3C,YAAkC,EAAQ,EAAI,CAC5C,EAAO,iBAAiB,WAAY,GAEtC,YAAqC,EAAQ,EAAI,CAC/C,EAAO,oBAAoB,WAAY,GAMzC,YAAkB,EAAM,CACtB,GAAM,GAAW,GAAiB,GAE9B,EAAe,EACf,EAAc,CAAE,EAAG,EAAG,EAAG,GAE7B,WAAuB,CACrB,aACA,eACC,CACD,GAAM,GAAU,EAAa,EACvB,EAAU,GAAY,EAAa,GACzC,MACE,IAAW,IACX,GAAW,GAIf,WAAwB,EAAO,CAC7B,EAAe,KAAK,MAEpB,GAAM,GAAQ,EAAM,QAAQ,GAC5B,EAAc,CAAE,EAAG,EAAM,QAAS,EAAG,EAAM,SAE3C,GAAyB,EAAM,GAGjC,WAAsB,EAAO,CAC3B,GAA4B,EAAM,GAElC,GAAM,GAAQ,EAAM,eAAe,GACnC,AAAI,EAAc,CAChB,WAAY,KAAK,MACjB,YAAa,CAAE,EAAG,EAAM,QAAS,EAAG,EAAM,YAE1C,EAAS,UAIb,UAAwB,EAAM,GAEvB,CACL,SAAU,CACR,GAA2B,EAAM,GACjC,GAA4B,EAAM,KAOxC,YAA4D,CAC1D,uBACA,iBACA,kBACA,mBACA,qBACC,CACD,MAAI,KAAyB,EAAiB,EAAwB,EAClE,IAAyB,EAAU,GAAuC,CAC5E,4BAA6B,EAAiB,EAC9C,sBACG,EACE,KAAK,MAAO,GAAuB,GAAmB,GAG/D,YAA2D,CACzD,uBACA,qBACC,CACD,MAAO,MAAK,KAAK,EAAuB,GAG1C,YAAmD,CACjD,uBACA,iBACA,kBACA,mBACA,WACA,qBACC,CACD,MAAO,GACH,GAAmD,CACnD,uBACA,iBACA,kBACA,mBACA,sBAEA,GAAkD,CAClD,uBACA,sBAMN,YAAgD,CAC9C,8BACA,qBACC,CACD,MAAO,MAAK,KAAK,EAA8B,GAGjD,YAA+C,CAC7C,8BACA,oBACA,mBACC,CACD,GAAM,GAAkB,GAAmB,CACzC,8BACA,oBACA,oBAEF,MAAO,MAAK,KAAK,EAA8B,GAAqB,EAGtE,YAAuC,CACrC,WACA,8BACA,oBACA,mBACC,CACD,MAAO,GACH,GAAuC,CACvC,8BACA,sBAEA,GAAsC,CACtC,8BACA,oBACA,oBAMN,YAA8C,CAC5C,YACA,kBACA,kBACA,oBACA,kBACC,CACD,MAAO,IACL,EACA,KAAK,IAAI,EAAkB,EAAY,EAAmB,EAAiB,GAC3E,EAAiB,GAIrB,YAA6C,CAC3C,YACA,oBACA,iBACA,mBACC,CACD,MAAO,IACL,EACA,KAAK,IAAI,EAAY,EAAmB,EAAiB,GACzD,EAAiB,GAIrB,YAAqC,CACnC,WACA,YACA,kBACA,kBACA,oBACA,iBACA,mBACC,CACD,MAAO,GACH,GAAqC,CACrC,YACA,kBACA,kBACA,oBACA,mBAEA,GAAoC,CACpC,YACA,oBACA,iBACA,oBAIN,YAA4B,CAC1B,6BACA,iBACC,CACD,OAAS,GAAc,EAAG,EAAc,EAA2B,OAAQ,IACzE,EAA2B,GAAe,MAAM,SAAW,GAAG,MAC9D,EAA2B,GAAe,MAAM,SAAW,GAAG,MAIlE,YAA4B,CAC1B,oBACA,kBACA,+BACC,CACD,GAAM,GAAU,EAAoB,EAChC,EAAiB,EAErB,OAAY,CACV,GAAM,GAAO,EAA8B,EAAiB,EAC5D,GAAI,EAAO,EACT,MAAO,MAAK,IAAI,EAAM,GAExB,GAAkB,EAAkB,GAIxC,YAA8B,EAAU,CACtC,MAAO,IAAI,gBAAe,GAAW,CACnC,EAAS,CACP,MAAO,EAAQ,GAAG,YAAY,UAKpC,YAAmB,CACjB,kBACA,kBACA,8BACC,CAED,GAAM,GAAiB,GACvB,OAAS,GAAE,EAAG,EAAE,EAAiB,IAC/B,EAAe,KAAK,EAA2B,GAAG,UAAU,KAG9D,GAAM,GAAkB,GAClB,EAAM,EAA2B,OACvC,OAAS,GAAE,EAAI,EAAG,EAAE,EAAI,EAAE,EAAiB,IACzC,EAAgB,KAAK,EAA2B,GAAG,UAAU,KAG/D,MAAO,CACL,iBACA,mBAIJ,YAAqB,CACnB,qBACA,iBACA,mBACC,CACD,OAAS,GAAE,EAAG,EAAE,EAAe,OAAQ,IACrC,EAAmB,OAAO,EAAe,IAE3C,OAAS,GAAE,EAAG,EAAE,EAAgB,OAAQ,IACtC,EAAmB,QAAQ,EAAgB,IAI/C,YAAwB,CACtB,WACA,kBACA,mBACC,CACD,GAAM,GAAc,EAChB,CAEA,KAAM,KAAK,KAAK,GAAmB,GACnC,KAAM,KAAK,KAAK,IACd,CACF,KAAM,EACN,KAAM,GAGV,MAAO,IACF,EACH,MAAO,EAAY,KAAO,EAAY,MAI1C,GAAM,IAAM,CAAC,EAAQ,EAAW,IAAiB,CAC/C,GAAI,GAAU,EAAO,eAAe,GAClC,MAAO,GAAO,GAEhB,GAAI,IAAiB,OACnB,KAAM,IAAI,OAAM,iBAAiB,uBAEnC,MAAO,IAGH,GAAW,AAAC,GAAgB,AAAC,GAAQ,CACzC,EAAY,IAAQ,EAAY,MAa9B,GAAkB,sBAGlB,GAAiB,4BAGjB,GAAW,EAAI,EAGf,GAAU,oBACV,GAAS,6BACT,GAAY,kBAGZ,GAAe,mDACf,GAAgB,QAChB,GAAe,MACf,GAAa,mGAMb,GAAe,sBAGf,GAAe,WAGf,GAAe,8BAGf,GAAa,MAAO,KAAkB,UAAY,IAAkB,GAAe,SAAW,QAAU,GAGxG,GAAW,MAAO,OAAQ,UAAY,MAAQ,KAAK,SAAW,QAAU,KAGxE,GAAO,IAAc,IAAY,SAAS,iBAU9C,YAAkB,EAAQ,EAAK,CAC7B,MAAO,IAAU,KAAO,OAAY,EAAO,GAU7C,YAAsB,EAAO,CAG3B,GAAI,GAAS,GACb,GAAI,GAAS,MAAQ,MAAO,GAAM,UAAY,WAC5C,GAAI,CACF,EAAS,CAAC,CAAE,GAAQ,UACb,EAAP,EAEJ,MAAO,GAIT,GAAI,IAAa,MAAM,UACnB,GAAY,SAAS,UACrB,GAAc,OAAO,UAGrB,GAAa,GAAK,sBAGlB,GAAc,UAAW,CAC3B,GAAI,GAAM,SAAS,KAAK,IAAc,GAAW,MAAQ,GAAW,KAAK,UAAY,IACrF,MAAO,GAAO,iBAAmB,EAAO,MAItC,GAAe,GAAU,SAGzB,GAAiB,GAAY,eAO7B,GAAiB,GAAY,SAG7B,GAAa,OAAO,IACtB,GAAa,KAAK,IAAgB,QAAQ,GAAc,QACvD,QAAQ,yDAA0D,SAAW,KAI5E,GAAS,GAAK,OACd,GAAS,GAAW,OAGpB,GAAQ,GAAU,GAAM,OACxB,GAAe,GAAU,OAAQ,UAGjC,GAAc,GAAS,GAAO,UAAY,OAC1C,GAAiB,GAAc,GAAY,SAAW,OAS1D,YAAc,EAAS,CACrB,GAAI,GAAQ,GACR,EAAS,EAAU,EAAQ,OAAS,EAGxC,IADA,KAAK,QACE,EAAE,EAAQ,GAAQ,CACvB,GAAI,GAAQ,EAAQ,GACpB,KAAK,IAAI,EAAM,GAAI,EAAM,KAW7B,aAAqB,CACnB,KAAK,SAAW,GAAe,GAAa,MAAQ,GAatD,YAAoB,EAAK,CACvB,MAAO,MAAK,IAAI,IAAQ,MAAO,MAAK,SAAS,GAY/C,YAAiB,EAAK,CACpB,GAAI,GAAO,KAAK,SAChB,GAAI,GAAc,CAChB,GAAI,GAAS,EAAK,GAClB,MAAO,KAAW,GAAiB,OAAY,EAEjD,MAAO,IAAe,KAAK,EAAM,GAAO,EAAK,GAAO,OAYtD,YAAiB,EAAK,CACpB,GAAI,GAAO,KAAK,SAChB,MAAO,IAAe,EAAK,KAAS,OAAY,GAAe,KAAK,EAAM,GAa5E,YAAiB,EAAK,EAAO,CAC3B,GAAI,GAAO,KAAK,SAChB,SAAK,GAAQ,IAAgB,IAAU,OAAa,GAAiB,EAC9D,KAIT,GAAK,UAAU,MAAQ,GACvB,GAAK,UAAU,OAAY,GAC3B,GAAK,UAAU,IAAM,GACrB,GAAK,UAAU,IAAM,GACrB,GAAK,UAAU,IAAM,GASrB,YAAmB,EAAS,CAC1B,GAAI,GAAQ,GACR,EAAS,EAAU,EAAQ,OAAS,EAGxC,IADA,KAAK,QACE,EAAE,EAAQ,GAAQ,CACvB,GAAI,GAAQ,EAAQ,GACpB,KAAK,IAAI,EAAM,GAAI,EAAM,KAW7B,aAA0B,CACxB,KAAK,SAAW,GAYlB,YAAyB,EAAK,CAC5B,GAAI,GAAO,KAAK,SACZ,EAAQ,GAAa,EAAM,GAE/B,GAAI,EAAQ,EACV,MAAO,GAET,GAAI,GAAY,EAAK,OAAS,EAC9B,MAAI,IAAS,EACX,EAAK,MAEL,GAAO,KAAK,EAAM,EAAO,GAEpB,GAYT,YAAsB,EAAK,CACzB,GAAI,GAAO,KAAK,SACZ,EAAQ,GAAa,EAAM,GAE/B,MAAO,GAAQ,EAAI,OAAY,EAAK,GAAO,GAY7C,YAAsB,EAAK,CACzB,MAAO,IAAa,KAAK,SAAU,GAAO,GAa5C,YAAsB,EAAK,EAAO,CAChC,GAAI,GAAO,KAAK,SACZ,EAAQ,GAAa,EAAM,GAE/B,MAAI,GAAQ,EACV,EAAK,KAAK,CAAC,EAAK,IAEhB,EAAK,GAAO,GAAK,EAEZ,KAIT,GAAU,UAAU,MAAQ,GAC5B,GAAU,UAAU,OAAY,GAChC,GAAU,UAAU,IAAM,GAC1B,GAAU,UAAU,IAAM,GAC1B,GAAU,UAAU,IAAM,GAS1B,YAAkB,EAAS,CACzB,GAAI,GAAQ,GACR,EAAS,EAAU,EAAQ,OAAS,EAGxC,IADA,KAAK,QACE,EAAE,EAAQ,GAAQ,CACvB,GAAI,GAAQ,EAAQ,GACpB,KAAK,IAAI,EAAM,GAAI,EAAM,KAW7B,aAAyB,CACvB,KAAK,SAAW,CACd,KAAQ,GAAI,IACZ,IAAO,GAAK,KAAS,IACrB,OAAU,GAAI,KAalB,YAAwB,EAAK,CAC3B,MAAO,IAAW,KAAM,GAAK,OAAU,GAYzC,YAAqB,EAAK,CACxB,MAAO,IAAW,KAAM,GAAK,IAAI,GAYnC,YAAqB,EAAK,CACxB,MAAO,IAAW,KAAM,GAAK,IAAI,GAanC,YAAqB,EAAK,EAAO,CAC/B,UAAW,KAAM,GAAK,IAAI,EAAK,GACxB,KAIT,GAAS,UAAU,MAAQ,GAC3B,GAAS,UAAU,OAAY,GAC/B,GAAS,UAAU,IAAM,GACzB,GAAS,UAAU,IAAM,GACzB,GAAS,UAAU,IAAM,GAUzB,YAAsB,EAAO,EAAK,CAEhC,OADI,GAAS,EAAM,OACZ,KACL,GAAI,GAAG,EAAM,GAAQ,GAAI,GACvB,MAAO,GAGX,MAAO,GAWT,YAAiB,EAAQ,EAAM,CAC7B,EAAO,GAAM,EAAM,GAAU,CAAC,GAAQ,GAAS,GAK/C,OAHI,GAAQ,EACR,EAAS,EAAK,OAEX,GAAU,MAAQ,EAAQ,GAC/B,EAAS,EAAO,GAAM,EAAK,OAE7B,MAAQ,IAAS,GAAS,EAAU,EAAS,OAW/C,YAAsB,EAAO,CAC3B,GAAI,CAAC,GAAS,IAAU,GAAS,GAC/B,MAAO,GAET,GAAI,GAAW,GAAW,IAAU,GAAa,GAAU,GAAa,GACxE,MAAO,GAAQ,KAAK,GAAS,IAW/B,YAAsB,EAAO,CAE3B,GAAI,MAAO,IAAS,SAClB,MAAO,GAET,GAAI,GAAS,GACX,MAAO,IAAiB,GAAe,KAAK,GAAS,GAEvD,GAAI,GAAU,EAAQ,GACtB,MAAQ,IAAU,KAAQ,EAAI,GAAU,CAAC,GAAY,KAAO,EAU9D,YAAkB,EAAO,CACvB,MAAO,IAAQ,GAAS,EAAQ,GAAa,GAW/C,YAAoB,EAAK,EAAK,CAC5B,GAAI,GAAO,EAAI,SACf,MAAO,IAAU,GACb,EAAK,MAAO,IAAO,SAAW,SAAW,QACzC,EAAK,IAWX,YAAmB,EAAQ,EAAK,CAC9B,GAAI,GAAQ,GAAS,EAAQ,GAC7B,MAAO,IAAa,GAAS,EAAQ,OAWvC,YAAe,EAAO,EAAQ,CAC5B,GAAI,GAAQ,GACV,MAAO,GAET,GAAI,GAAO,MAAO,GAClB,MAAI,IAAQ,UAAY,GAAQ,UAAY,GAAQ,WAChD,GAAS,MAAQ,GAAS,GACrB,GAEF,GAAc,KAAK,IAAU,CAAC,GAAa,KAAK,IACpD,GAAU,MAAQ,IAAS,QAAO,GAUvC,YAAmB,EAAO,CACxB,GAAI,GAAO,MAAO,GAClB,MAAQ,IAAQ,UAAY,GAAQ,UAAY,GAAQ,UAAY,GAAQ,UACvE,IAAU,YACV,IAAU,KAUjB,YAAkB,EAAM,CACtB,MAAO,CAAC,CAAC,IAAe,KAAc,GAUxC,GAAI,IAAe,GAAQ,SAAS,EAAQ,CAC1C,EAAS,GAAS,GAElB,GAAI,GAAS,GACb,MAAI,IAAa,KAAK,IACpB,EAAO,KAAK,IAEd,EAAO,QAAQ,GAAY,SAAS,EAAO,EAAQ,EAAO,EAAQ,CAChE,EAAO,KAAK,EAAQ,EAAO,QAAQ,GAAc,MAAS,GAAU,KAE/D,IAUT,YAAe,EAAO,CACpB,GAAI,MAAO,IAAS,UAAY,GAAS,GACvC,MAAO,GAET,GAAI,GAAU,EAAQ,GACtB,MAAQ,IAAU,KAAQ,EAAI,GAAU,CAAC,GAAY,KAAO,EAU9D,YAAkB,EAAM,CACtB,GAAI,GAAQ,KAAM,CAChB,GAAI,CACF,MAAO,IAAa,KAAK,SAClB,EAAP,EACF,GAAI,CACF,MAAQ,GAAO,SACR,EAAP,GAEJ,MAAO,GA+CT,YAAiB,EAAM,EAAU,CAC/B,GAAI,MAAO,IAAQ,YAAe,GAAY,MAAO,IAAY,WAC/D,KAAM,IAAI,WAAU,IAEtB,GAAI,GAAW,UAAW,CACxB,GAAI,GAAO,UACP,EAAM,EAAW,EAAS,MAAM,KAAM,GAAQ,EAAK,GACnD,EAAQ,EAAS,MAErB,GAAI,EAAM,IAAI,GACZ,MAAO,GAAM,IAAI,GAEnB,GAAI,GAAS,EAAK,MAAM,KAAM,GAC9B,SAAS,MAAQ,EAAM,IAAI,EAAK,GACzB,GAET,SAAS,MAAQ,GAAK,IAAQ,OAAS,IAChC,EAIT,GAAQ,MAAQ,GAkChB,YAAY,EAAO,EAAO,CACxB,MAAO,KAAU,GAAU,IAAU,GAAS,IAAU,EA0B1D,GAAI,IAAU,MAAM,QAmBpB,YAAoB,EAAO,CAGzB,GAAI,GAAM,GAAS,GAAS,GAAe,KAAK,GAAS,GACzD,MAAO,IAAO,IAAW,GAAO,GA4BlC,YAAkB,EAAO,CACvB,GAAI,GAAO,MAAO,GAClB,MAAO,CAAC,CAAC,GAAU,IAAQ,UAAY,GAAQ,YA2BjD,YAAsB,EAAO,CAC3B,MAAO,CAAC,CAAC,GAAS,MAAO,IAAS,SAoBpC,YAAkB,EAAO,CACvB,MAAO,OAAO,IAAS,UACpB,GAAa,IAAU,GAAe,KAAK,IAAU,GAwB1D,YAAkB,EAAO,CACvB,MAAO,IAAS,KAAO,GAAK,GAAa,GA4B3C,YAAe,EAAQ,EAAM,EAAc,CACzC,GAAI,GAAS,GAAU,KAAO,OAAY,GAAQ,EAAQ,GAC1D,MAAO,KAAW,OAAY,EAAe,EAG/C,GAAI,IAAa,GAEb,GAAmB,GAAqB,SAAU,EAAQ,EAAS,CAWvE,GAAI,GAAmB,IAGnB,EAAiB,4BAGjB,EAAmB,iBAGnB,EAAU,qBACV,EAAW,iBACX,EAAU,mBACV,EAAU,gBACV,EAAW,iBACX,EAAU,oBACV,EAAS,6BACT,EAAS,eACT,EAAY,kBACZ,EAAY,kBACZ,EAAa,mBACb,EAAY,kBACZ,EAAS,eACT,EAAY,kBACZ,EAAY,kBACZ,EAAa,mBAEb,EAAiB,uBACjB,EAAc,oBACd,EAAa,wBACb,EAAa,wBACb,GAAU,qBACV,GAAW,sBACX,EAAW,sBACX,GAAW,sBACX,GAAkB,6BAClB,GAAY,uBACZ,GAAY,uBAMZ,GAAe,sBAGf,GAAU,OAGV,GAAe,8BAGf,GAAW,mBAGX,GAAgB,GACpB,GAAc,GAAW,GAAc,GACvC,GAAc,GAAkB,GAAc,GAC9C,GAAc,GAAW,GAAc,GACvC,GAAc,GAAc,GAAc,GAC1C,GAAc,IAAW,GAAc,IACvC,GAAc,GAAY,GAAc,GACxC,GAAc,GAAa,GAAc,GACzC,GAAc,GAAa,GAAc,GACzC,GAAc,GAAa,GAAc,GACzC,GAAc,IAAY,GAAc,IACxC,GAAc,IAAa,GAAc,IAAa,GACtD,GAAc,GAAY,GAAc,GACxC,GAAc,GAAc,GAG5B,GAAI,IAAa,MAAO,KAAkB,UAAY,IAAkB,GAAe,SAAW,QAAU,GAGxG,GAAW,MAAO,OAAQ,UAAY,MAAQ,KAAK,SAAW,QAAU,KAGxE,GAAO,IAAc,IAAY,SAAS,iBAG1C,GAAe,GAAW,CAAC,EAAQ,UAAY,EAG/C,GAAa,IAAe,IAAwB,GAAU,CAAC,EAAO,UAAY,EAGlF,GAAgB,IAAc,GAAW,UAAY,GAUzD,YAAqB,EAAK,EAAM,CAE9B,SAAI,IAAI,EAAK,GAAI,EAAK,IACf,EAWT,YAAqB,EAAK,EAAO,CAE/B,SAAI,IAAI,GACD,EAYT,YAAmB,EAAO,EAAU,CAIlC,OAHI,GAAQ,GACR,EAAS,EAAQ,EAAM,OAAS,EAE7B,EAAE,EAAQ,GACX,EAAS,EAAM,GAAQ,EAAO,KAAW,IAA7C,CAIF,MAAO,GAWT,YAAmB,EAAO,EAAQ,CAKhC,OAJI,GAAQ,GACR,EAAS,EAAO,OAChB,GAAS,EAAM,OAEZ,EAAE,EAAQ,GACf,EAAM,GAAS,GAAS,EAAO,GAEjC,MAAO,GAeT,YAAqB,EAAO,EAAU,EAAa,EAAW,CAC5D,GAAI,IAAQ,GACR,GAAS,EAAQ,EAAM,OAAS,EAKpC,IAHI,GAAa,IACf,GAAc,EAAM,EAAE,KAEjB,EAAE,GAAQ,IACf,EAAc,EAAS,EAAa,EAAM,IAAQ,GAAO,GAE3D,MAAO,GAYT,YAAmB,EAAG,EAAU,CAI9B,OAHI,GAAQ,GACR,EAAS,MAAM,GAEZ,EAAE,EAAQ,GACf,EAAO,GAAS,EAAS,GAE3B,MAAO,GAWT,YAAkB,EAAQ,EAAK,CAC7B,MAAO,IAAU,KAAO,OAAY,EAAO,GAU7C,YAAsB,EAAO,CAG3B,GAAI,GAAS,GACb,GAAI,GAAS,MAAQ,MAAO,GAAM,UAAY,WAC5C,GAAI,CACF,EAAS,CAAC,CAAE,GAAQ,UACb,EAAP,EAEJ,MAAO,GAUT,WAAoB,EAAK,CACvB,GAAI,GAAQ,GACR,EAAS,MAAM,EAAI,MAEvB,SAAI,QAAQ,SAAS,EAAO,GAAK,CAC/B,EAAO,EAAE,GAAS,CAAC,GAAK,KAEnB,EAWT,YAAiB,EAAM,EAAW,CAChC,MAAO,UAAS,EAAK,CACnB,MAAO,GAAK,EAAU,KAW1B,YAAoB,EAAK,CACvB,GAAI,GAAQ,GACR,EAAS,MAAM,EAAI,MAEvB,SAAI,QAAQ,SAAS,EAAO,CAC1B,EAAO,EAAE,GAAS,IAEb,EAIT,GAAI,IAAa,MAAM,UACnB,GAAY,SAAS,UACrB,GAAc,OAAO,UAGrB,GAAa,GAAK,sBAGlB,GAAc,UAAW,CAC3B,GAAI,GAAM,SAAS,KAAK,IAAc,GAAW,MAAQ,GAAW,KAAK,UAAY,IACrF,MAAO,GAAO,iBAAmB,EAAO,MAItC,EAAe,GAAU,SAGzB,GAAiB,GAAY,eAO7B,GAAiB,GAAY,SAG7B,GAAa,OAAO,IACtB,EAAa,KAAK,IAAgB,QAAQ,GAAc,QACvD,QAAQ,yDAA0D,SAAW,KAI5E,GAAS,GAAgB,GAAK,OAAS,OACvC,GAAS,GAAK,OACd,GAAa,GAAK,WAClB,GAAe,GAAQ,OAAO,eAAgB,QAC9C,GAAe,OAAO,OACtB,GAAuB,GAAY,qBACnC,GAAS,GAAW,OAGpB,GAAmB,OAAO,sBAC1B,GAAiB,GAAS,GAAO,SAAW,OAC5C,GAAa,GAAQ,OAAO,KAAM,QAGlC,GAAW,GAAU,GAAM,YAC3B,GAAM,GAAU,GAAM,OACtB,GAAU,GAAU,GAAM,WAC1B,GAAM,GAAU,GAAM,OACtB,GAAU,GAAU,GAAM,WAC1B,GAAe,GAAU,OAAQ,UAGjC,GAAqB,GAAS,IAC9B,GAAgB,GAAS,IACzB,GAAoB,GAAS,IAC7B,GAAgB,GAAS,IACzB,GAAoB,GAAS,IAG7B,GAAc,GAAS,GAAO,UAAY,OAC1C,GAAgB,GAAc,GAAY,QAAU,OASxD,YAAc,EAAS,CACrB,GAAI,GAAQ,GACR,EAAS,EAAU,EAAQ,OAAS,EAGxC,IADA,KAAK,QACE,EAAE,EAAQ,GAAQ,CACvB,GAAI,GAAQ,EAAQ,GACpB,KAAK,IAAI,EAAM,GAAI,EAAM,KAW7B,aAAqB,CACnB,KAAK,SAAW,GAAe,GAAa,MAAQ,GAatD,YAAoB,EAAK,CACvB,MAAO,MAAK,IAAI,IAAQ,MAAO,MAAK,SAAS,GAY/C,YAAiB,EAAK,CACpB,GAAI,GAAO,KAAK,SAChB,GAAI,GAAc,CAChB,GAAI,GAAS,EAAK,GAClB,MAAO,KAAW,EAAiB,OAAY,EAEjD,MAAO,IAAe,KAAK,EAAM,GAAO,EAAK,GAAO,OAYtD,YAAiB,EAAK,CACpB,GAAI,GAAO,KAAK,SAChB,MAAO,IAAe,EAAK,KAAS,OAAY,GAAe,KAAK,EAAM,GAa5E,YAAiB,EAAK,EAAO,CAC3B,GAAI,GAAO,KAAK,SAChB,SAAK,GAAQ,IAAgB,IAAU,OAAa,EAAiB,EAC9D,KAIT,GAAK,UAAU,MAAQ,GACvB,GAAK,UAAU,OAAY,GAC3B,GAAK,UAAU,IAAM,GACrB,GAAK,UAAU,IAAM,GACrB,GAAK,UAAU,IAAM,GASrB,YAAmB,EAAS,CAC1B,GAAI,GAAQ,GACR,EAAS,EAAU,EAAQ,OAAS,EAGxC,IADA,KAAK,QACE,EAAE,EAAQ,GAAQ,CACvB,GAAI,GAAQ,EAAQ,GACpB,KAAK,IAAI,EAAM,GAAI,EAAM,KAW7B,aAA0B,CACxB,KAAK,SAAW,GAYlB,YAAyB,EAAK,CAC5B,GAAI,GAAO,KAAK,SACZ,EAAQ,GAAa,EAAM,GAE/B,GAAI,EAAQ,EACV,MAAO,GAET,GAAI,GAAY,EAAK,OAAS,EAC9B,MAAI,IAAS,EACX,EAAK,MAEL,GAAO,KAAK,EAAM,EAAO,GAEpB,GAYT,YAAsB,EAAK,CACzB,GAAI,GAAO,KAAK,SACZ,EAAQ,GAAa,EAAM,GAE/B,MAAO,GAAQ,EAAI,OAAY,EAAK,GAAO,GAY7C,YAAsB,EAAK,CACzB,MAAO,IAAa,KAAK,SAAU,GAAO,GAa5C,YAAsB,EAAK,EAAO,CAChC,GAAI,GAAO,KAAK,SACZ,EAAQ,GAAa,EAAM,GAE/B,MAAI,GAAQ,EACV,EAAK,KAAK,CAAC,EAAK,IAEhB,EAAK,GAAO,GAAK,EAEZ,KAIT,GAAU,UAAU,MAAQ,GAC5B,GAAU,UAAU,OAAY,GAChC,GAAU,UAAU,IAAM,GAC1B,GAAU,UAAU,IAAM,GAC1B,GAAU,UAAU,IAAM,GAS1B,YAAkB,EAAS,CACzB,GAAI,GAAQ,GACR,EAAS,EAAU,EAAQ,OAAS,EAGxC,IADA,KAAK,QACE,EAAE,EAAQ,GAAQ,CACvB,GAAI,GAAQ,EAAQ,GACpB,KAAK,IAAI,EAAM,GAAI,EAAM,KAW7B,aAAyB,CACvB,KAAK,SAAW,CACd,KAAQ,GAAI,IACZ,IAAO,GAAK,KAAO,IACnB,OAAU,GAAI,KAalB,YAAwB,EAAK,CAC3B,MAAO,IAAW,KAAM,GAAK,OAAU,GAYzC,YAAqB,EAAK,CACxB,MAAO,IAAW,KAAM,GAAK,IAAI,GAYnC,YAAqB,EAAK,CACxB,MAAO,IAAW,KAAM,GAAK,IAAI,GAanC,YAAqB,EAAK,EAAO,CAC/B,UAAW,KAAM,GAAK,IAAI,EAAK,GACxB,KAIT,GAAS,UAAU,MAAQ,GAC3B,GAAS,UAAU,OAAY,GAC/B,GAAS,UAAU,IAAM,GACzB,GAAS,UAAU,IAAM,GACzB,GAAS,UAAU,IAAM,GASzB,YAAe,EAAS,CACtB,KAAK,SAAW,GAAI,IAAU,GAUhC,aAAsB,CACpB,KAAK,SAAW,GAAI,IAYtB,YAAqB,EAAK,CACxB,MAAO,MAAK,SAAS,OAAU,GAYjC,YAAkB,EAAK,CACrB,MAAO,MAAK,SAAS,IAAI,GAY3B,YAAkB,EAAK,CACrB,MAAO,MAAK,SAAS,IAAI,GAa3B,YAAkB,EAAK,EAAO,CAC5B,GAAI,GAAQ,KAAK,SACjB,GAAI,YAAiB,IAAW,CAC9B,GAAI,GAAQ,EAAM,SAClB,GAAI,CAAC,IAAQ,EAAM,OAAS,EAAmB,EAC7C,SAAM,KAAK,CAAC,EAAK,IACV,KAET,EAAQ,KAAK,SAAW,GAAI,IAAS,GAEvC,SAAM,IAAI,EAAK,GACR,KAIT,GAAM,UAAU,MAAQ,GACxB,GAAM,UAAU,OAAY,GAC5B,GAAM,UAAU,IAAM,GACtB,GAAM,UAAU,IAAM,GACtB,GAAM,UAAU,IAAM,GAUtB,YAAuB,EAAO,EAAW,CAGvC,GAAI,GAAU,GAAQ,IAAU,GAAY,GACxC,GAAU,EAAM,OAAQ,QACxB,GAEA,EAAS,EAAO,OAChB,GAAc,CAAC,CAAC,EAEpB,OAAS,MAAO,GACd,AAAK,IAAa,GAAe,KAAK,EAAO,MACzC,CAAE,KAAgB,KAAO,UAAY,GAAQ,GAAK,MACpD,EAAO,KAAK,IAGhB,MAAO,GAaT,YAAqB,EAAQ,EAAK,EAAO,CACvC,GAAI,GAAW,EAAO,GACtB,AAAI,EAAE,IAAe,KAAK,EAAQ,IAAQ,GAAG,EAAU,KAClD,IAAU,QAAa,CAAE,KAAO,MACnC,GAAO,GAAO,GAYlB,YAAsB,EAAO,EAAK,CAEhC,OADI,GAAS,EAAM,OACZ,KACL,GAAI,GAAG,EAAM,GAAQ,GAAI,GACvB,MAAO,GAGX,MAAO,GAYT,YAAoB,EAAQ,EAAQ,CAClC,MAAO,IAAU,GAAW,EAAQ,GAAK,GAAS,GAiBpD,YAAmB,EAAO,EAAQ,EAAQ,EAAY,GAAK,GAAQ,GAAO,CACxE,GAAI,IAIJ,GAHI,GACF,IAAS,GAAS,EAAW,EAAO,GAAK,GAAQ,IAAS,EAAW,IAEnE,KAAW,OACb,MAAO,IAET,GAAI,CAAC,GAAS,GACZ,MAAO,GAET,GAAI,IAAQ,GAAQ,GACpB,GAAI,IAEF,GADA,GAAS,GAAe,GACpB,CAAC,EACH,MAAO,IAAU,EAAO,QAErB,CACL,GAAI,IAAM,GAAO,GACb,GAAS,IAAO,GAAW,IAAO,EAEtC,GAAI,GAAS,GACX,MAAO,IAAY,EAAO,GAE5B,GAAI,IAAO,GAAa,IAAO,GAAY,IAAU,CAAC,GAAS,CAC7D,GAAI,GAAa,GACf,MAAO,IAAS,EAAQ,GAG1B,GADA,GAAS,GAAgB,GAAS,GAAK,GACnC,CAAC,EACH,MAAO,IAAY,EAAO,GAAW,GAAQ,QAE1C,CACL,GAAI,CAAC,GAAc,IACjB,MAAO,IAAS,EAAQ,GAE1B,GAAS,GAAe,EAAO,GAAK,GAAW,IAInD,IAAU,IAAQ,GAAI,KACtB,GAAI,IAAU,GAAM,IAAI,GACxB,GAAI,GACF,MAAO,IAIT,GAFA,GAAM,IAAI,EAAO,IAEb,CAAC,GACH,GAAI,IAAQ,EAAS,GAAW,GAAS,GAAK,GAEhD,UAAU,IAAS,EAAO,SAAS,GAAU,GAAK,CAChD,AAAI,IACF,IAAM,GACN,GAAW,EAAM,KAGnB,GAAY,GAAQ,GAAK,GAAU,GAAU,EAAQ,EAAQ,EAAY,GAAK,EAAO,OAEhF,GAWT,YAAoB,EAAO,CACzB,MAAO,IAAS,GAAS,GAAa,GAAS,GAcjD,YAAwB,EAAQ,EAAU,EAAa,CACrD,GAAI,GAAS,EAAS,GACtB,MAAO,IAAQ,GAAU,EAAS,GAAU,EAAQ,EAAY,IAUlE,YAAoB,EAAO,CACzB,MAAO,IAAe,KAAK,GAW7B,YAAsB,EAAO,CAC3B,GAAI,CAAC,GAAS,IAAU,GAAS,GAC/B,MAAO,GAET,GAAI,GAAW,GAAW,IAAU,GAAa,GAAU,GAAa,GACxE,MAAO,GAAQ,KAAK,GAAS,IAU/B,YAAkB,EAAQ,CACxB,GAAI,CAAC,GAAY,GACf,MAAO,IAAW,GAEpB,GAAI,GAAS,GACb,OAAS,KAAO,QAAO,GACrB,AAAI,GAAe,KAAK,EAAQ,IAAQ,GAAO,eAC7C,EAAO,KAAK,GAGhB,MAAO,GAWT,YAAqB,EAAQ,EAAQ,CACnC,GAAI,EACF,MAAO,GAAO,QAEhB,GAAI,GAAS,GAAI,GAAO,YAAY,EAAO,QAC3C,SAAO,KAAK,GACL,EAUT,YAA0B,EAAa,CACrC,GAAI,GAAS,GAAI,GAAY,YAAY,EAAY,YACrD,UAAI,IAAW,GAAQ,IAAI,GAAI,IAAW,IACnC,EAWT,YAAuB,EAAU,EAAQ,CACvC,GAAI,GAAS,EAAS,GAAiB,EAAS,QAAU,EAAS,OACnE,MAAO,IAAI,GAAS,YAAY,EAAQ,EAAS,WAAY,EAAS,YAYxE,YAAkB,EAAK,EAAQ,EAAW,CACxC,GAAI,GAAQ,EAAS,EAAU,EAAW,GAAM,IAAQ,EAAW,GACnE,MAAO,IAAY,EAAO,GAAa,GAAI,GAAI,aAUjD,YAAqB,EAAQ,CAC3B,GAAI,GAAS,GAAI,GAAO,YAAY,EAAO,OAAQ,GAAQ,KAAK,IAChE,SAAO,UAAY,EAAO,UACnB,EAYT,YAAkB,EAAK,EAAQ,EAAW,CACxC,GAAI,GAAQ,EAAS,EAAU,GAAW,GAAM,IAAQ,GAAW,GACnE,MAAO,IAAY,EAAO,GAAa,GAAI,GAAI,aAUjD,YAAqB,EAAQ,CAC3B,MAAO,IAAgB,OAAO,GAAc,KAAK,IAAW,GAW9D,YAAyB,EAAY,EAAQ,CAC3C,GAAI,GAAS,EAAS,GAAiB,EAAW,QAAU,EAAW,OACvE,MAAO,IAAI,GAAW,YAAY,EAAQ,EAAW,WAAY,EAAW,QAW9E,YAAmB,EAAQ,EAAO,CAChC,GAAI,GAAQ,GACR,EAAS,EAAO,OAGpB,IADA,GAAU,GAAQ,MAAM,IACjB,EAAE,EAAQ,GACf,EAAM,GAAS,EAAO,GAExB,MAAO,GAaT,YAAoB,EAAQ,EAAO,EAAQ,EAAY,CACrD,GAAW,GAAS,IAKpB,OAHI,IAAQ,GACR,GAAS,EAAM,OAEZ,EAAE,GAAQ,IAAQ,CACvB,GAAI,IAAM,EAAM,IAEZ,GAAW,EACX,EAAW,EAAO,IAAM,EAAO,IAAM,GAAK,EAAQ,GAClD,OAEJ,GAAY,EAAQ,GAAK,KAAa,OAAY,EAAO,IAAO,IAElE,MAAO,GAWT,YAAqB,EAAQ,EAAQ,CACnC,MAAO,IAAW,EAAQ,GAAW,GAAS,GAUhD,YAAoB,EAAQ,CAC1B,MAAO,IAAe,EAAQ,GAAM,IAWtC,YAAoB,EAAK,EAAK,CAC5B,GAAI,GAAO,EAAI,SACf,MAAO,IAAU,GACb,EAAK,MAAO,IAAO,SAAW,SAAW,QACzC,EAAK,IAWX,YAAmB,EAAQ,EAAK,CAC9B,GAAI,GAAQ,GAAS,EAAQ,GAC7B,MAAO,IAAa,GAAS,EAAQ,OAUvC,GAAI,IAAa,GAAmB,GAAQ,GAAkB,QAAU,GASpE,GAAS,GAIb,AAAK,KAAY,GAAO,GAAI,IAAS,GAAI,aAAY,MAAQ,GACxD,IAAO,GAAO,GAAI,MAAQ,GAC1B,IAAW,GAAO,GAAQ,YAAc,GACxC,IAAO,GAAO,GAAI,MAAQ,GAC1B,IAAW,GAAO,GAAI,MAAY,IACrC,IAAS,SAAS,EAAO,CACvB,GAAI,GAAS,GAAe,KAAK,GAC7B,EAAO,GAAU,EAAY,EAAM,YAAc,OACjD,EAAa,EAAO,GAAS,GAAQ,OAEzC,GAAI,EACF,OAAQ,OACD,IAAoB,MAAO,OAC3B,IAAe,MAAO,OACtB,IAAmB,MAAO,OAC1B,IAAe,MAAO,OACtB,IAAmB,MAAO,GAGnC,MAAO,KAWX,YAAwB,EAAO,CAC7B,GAAI,GAAS,EAAM,OACf,EAAS,EAAM,YAAY,GAG/B,MAAI,IAAU,MAAO,GAAM,IAAM,UAAY,GAAe,KAAK,EAAO,UACtE,GAAO,MAAQ,EAAM,MACrB,EAAO,MAAQ,EAAM,OAEhB,EAUT,YAAyB,EAAQ,CAC/B,MAAQ,OAAO,GAAO,aAAe,YAAc,CAAC,GAAY,GAC5D,GAAW,GAAa,IACxB,GAgBN,YAAwB,EAAQ,EAAK,EAAW,EAAQ,CACtD,GAAI,IAAO,EAAO,YAClB,OAAQ,OACD,GACH,MAAO,IAAiB,OAErB,OACA,GACH,MAAO,IAAI,IAAK,CAAC,OAEd,GACH,MAAO,IAAc,EAAQ,OAE1B,OAAiB,OACjB,QAAc,QAAe,OAC7B,QAAe,QAAsB,QAAgB,IACxD,MAAO,IAAgB,EAAQ,OAE5B,GACH,MAAO,IAAS,EAAQ,EAAQ,OAE7B,OACA,GACH,MAAO,IAAI,IAAK,OAEb,GACH,MAAO,IAAY,OAEhB,GACH,MAAO,IAAS,EAAQ,EAAQ,OAE7B,GACH,MAAO,IAAY,IAYzB,YAAiB,EAAO,EAAQ,CAC9B,SAAS,GAAiB,EACnB,CAAC,CAAC,GACN,OAAO,IAAS,UAAY,GAAS,KAAK,KAC1C,EAAQ,IAAM,EAAQ,GAAK,GAAK,EAAQ,EAU7C,YAAmB,EAAO,CACxB,GAAI,GAAO,MAAO,GAClB,MAAQ,IAAQ,UAAY,GAAQ,UAAY,GAAQ,UAAY,GAAQ,UACvE,IAAU,YACV,IAAU,KAUjB,YAAkB,EAAM,CACtB,MAAO,CAAC,CAAC,IAAe,KAAc,GAUxC,YAAqB,EAAO,CAC1B,GAAI,GAAO,GAAS,EAAM,YACtB,EAAS,MAAO,IAAQ,YAAc,EAAK,WAAc,GAE7D,MAAO,KAAU,EAUnB,YAAkB,EAAM,CACtB,GAAI,GAAQ,KAAM,CAChB,GAAI,CACF,MAAO,GAAa,KAAK,SAClB,EAAP,EACF,GAAI,CACF,MAAQ,GAAO,SACR,EAAP,GAEJ,MAAO,GAqBT,YAAmB,EAAO,CACxB,MAAO,IAAU,EAAO,GAAM,IAmChC,YAAY,EAAO,EAAO,CACxB,MAAO,KAAU,GAAU,IAAU,GAAS,IAAU,EAqB1D,YAAqB,EAAO,CAE1B,MAAO,IAAkB,IAAU,GAAe,KAAK,EAAO,WAC3D,EAAC,GAAqB,KAAK,EAAO,WAAa,GAAe,KAAK,IAAU,GA0BlF,GAAI,IAAU,MAAM,QA2BpB,YAAqB,EAAO,CAC1B,MAAO,IAAS,MAAQ,GAAS,EAAM,SAAW,CAAC,GAAW,GA4BhE,YAA2B,EAAO,CAChC,MAAO,IAAa,IAAU,GAAY,GAoB5C,GAAI,IAAW,IAAkB,GAmBjC,YAAoB,EAAO,CAGzB,GAAI,GAAM,GAAS,GAAS,GAAe,KAAK,GAAS,GACzD,MAAO,IAAO,GAAW,GAAO,EA6BlC,YAAkB,EAAO,CACvB,MAAO,OAAO,IAAS,UACrB,EAAQ,IAAM,EAAQ,GAAK,GAAK,GAAS,EA4B7C,YAAkB,EAAO,CACvB,GAAI,GAAO,MAAO,GAClB,MAAO,CAAC,CAAC,GAAU,IAAQ,UAAY,GAAQ,YA2BjD,YAAsB,EAAO,CAC3B,MAAO,CAAC,CAAC,GAAS,MAAO,IAAS,SA+BpC,YAAc,EAAQ,CACpB,MAAO,IAAY,GAAU,GAAc,GAAU,GAAS,GAqBhE,aAAqB,CACnB,MAAO,GAgBT,aAAqB,CACnB,MAAO,GAGT,EAAO,QAAU,KAGb,GAAiB,GAAqB,SAAU,EAAQ,EAAS,CAWrE,GAAI,GAAmB,IAGnB,EAAiB,4BAGjB,EAAuB,EACvB,EAAyB,EAGzB,EAAmB,iBAGnB,EAAU,qBACV,EAAW,iBACX,EAAW,yBACX,EAAU,mBACV,EAAU,gBACV,EAAW,iBACX,EAAU,oBACV,EAAS,6BACT,EAAS,eACT,EAAY,kBACZ,EAAU,gBACV,EAAY,kBACZ,EAAa,mBACb,EAAW,iBACX,EAAY,kBACZ,EAAS,eACT,EAAY,kBACZ,EAAY,kBACZ,GAAe,qBACf,GAAa,mBAEb,EAAiB,uBACjB,GAAc,oBACd,GAAa,wBACb,GAAa,wBACb,GAAU,qBACV,GAAW,sBACX,GAAW,sBACX,GAAW,sBACX,GAAkB,6BAClB,GAAY,uBACZ,GAAY,uBAMZ,GAAe,sBAGf,GAAe,8BAGf,GAAW,mBAGX,GAAiB,GACrB,GAAe,IAAc,GAAe,IAC5C,GAAe,IAAW,GAAe,IACzC,GAAe,IAAY,GAAe,IAC1C,GAAe,IAAmB,GAAe,IACjD,GAAe,IAAa,GAC5B,GAAe,GAAW,GAAe,GACzC,GAAe,GAAkB,GAAe,GAChD,GAAe,IAAe,GAAe,GAC7C,GAAe,GAAY,GAAe,GAC1C,GAAe,GAAU,GAAe,GACxC,GAAe,GAAa,GAAe,GAC3C,GAAe,GAAU,GAAe,GACxC,GAAe,IAAc,GAG7B,GAAI,IAAa,MAAO,KAAkB,UAAY,IAAkB,GAAe,SAAW,QAAU,GAGxG,GAAW,MAAO,OAAQ,UAAY,MAAQ,KAAK,SAAW,QAAU,KAGxE,GAAO,IAAc,IAAY,SAAS,iBAG1C,GAAe,GAAW,CAAC,EAAQ,UAAY,EAG/C,GAAa,IAAe,IAAwB,GAAU,CAAC,EAAO,UAAY,EAGlF,GAAgB,IAAc,GAAW,UAAY,GAGrD,GAAc,IAAiB,GAAW,QAG1C,GAAY,UAAW,CACzB,GAAI,CACF,MAAO,KAAe,GAAY,SAAW,GAAY,QAAQ,cAC1D,EAAP,MAIA,GAAmB,IAAY,GAAS,aAW5C,WAAqB,EAAO,EAAW,CAMrC,OALI,GAAQ,GACR,EAAS,GAAS,KAAO,EAAI,EAAM,OACnC,GAAW,EACX,GAAS,GAEN,EAAE,EAAQ,GAAQ,CACvB,GAAI,IAAQ,EAAM,GAClB,AAAI,EAAU,GAAO,EAAO,IAC1B,IAAO,MAAc,IAGzB,MAAO,IAWT,YAAmB,EAAO,EAAQ,CAKhC,OAJI,GAAQ,GACR,EAAS,EAAO,OAChB,GAAS,EAAM,OAEZ,EAAE,EAAQ,GACf,EAAM,GAAS,GAAS,EAAO,GAEjC,MAAO,GAaT,YAAmB,EAAO,EAAW,CAInC,OAHI,GAAQ,GACR,EAAS,GAAS,KAAO,EAAI,EAAM,OAEhC,EAAE,EAAQ,GACf,GAAI,EAAU,EAAM,GAAQ,EAAO,GACjC,MAAO,GAGX,MAAO,GAYT,YAAmB,EAAG,EAAU,CAI9B,OAHI,GAAQ,GACR,EAAS,MAAM,GAEZ,EAAE,EAAQ,GACf,EAAO,GAAS,EAAS,GAE3B,MAAO,GAUT,YAAmB,EAAM,CACvB,MAAO,UAAS,EAAO,CACrB,MAAO,GAAK,IAYhB,YAAkB,EAAO,EAAK,CAC5B,MAAO,GAAM,IAAI,GAWnB,YAAkB,EAAQ,EAAK,CAC7B,MAAO,IAAU,KAAO,OAAY,EAAO,GAU7C,YAAoB,EAAK,CACvB,GAAI,GAAQ,GACR,EAAS,MAAM,EAAI,MAEvB,SAAI,QAAQ,SAAS,EAAO,GAAK,CAC/B,EAAO,EAAE,GAAS,CAAC,GAAK,KAEnB,EAWT,WAAiB,EAAM,EAAW,CAChC,MAAO,UAAS,EAAK,CACnB,MAAO,GAAK,EAAU,KAW1B,YAAoB,EAAK,CACvB,GAAI,GAAQ,GACR,EAAS,MAAM,EAAI,MAEvB,SAAI,QAAQ,SAAS,EAAO,CAC1B,EAAO,EAAE,GAAS,IAEb,EAIT,GAAI,IAAa,MAAM,UACnB,GAAY,SAAS,UACrB,GAAc,OAAO,UAGrB,GAAa,GAAK,sBAGlB,GAAe,GAAU,SAGzB,GAAiB,GAAY,eAG7B,GAAc,UAAW,CAC3B,GAAI,GAAM,SAAS,KAAK,IAAc,GAAW,MAAQ,GAAW,KAAK,UAAY,IACrF,MAAO,GAAO,iBAAmB,EAAO,MAQtC,GAAuB,GAAY,SAGnC,GAAa,OAAO,IACtB,GAAa,KAAK,IAAgB,QAAQ,GAAc,QACvD,QAAQ,yDAA0D,SAAW,KAI5E,GAAS,GAAgB,GAAK,OAAS,OACvC,GAAS,GAAK,OACd,GAAa,GAAK,WAClB,GAAuB,GAAY,qBACnC,GAAS,GAAW,OACpB,GAAiB,GAAS,GAAO,YAAc,OAG/C,GAAmB,OAAO,sBAC1B,GAAiB,GAAS,GAAO,SAAW,OAC5C,GAAa,EAAQ,OAAO,KAAM,QAGlC,GAAW,GAAU,GAAM,YAC3B,GAAM,GAAU,GAAM,OACtB,GAAU,GAAU,GAAM,WAC1B,GAAM,GAAU,GAAM,OACtB,GAAU,GAAU,GAAM,WAC1B,GAAe,GAAU,OAAQ,UAGjC,GAAqB,GAAS,IAC9B,GAAgB,GAAS,IACzB,GAAoB,GAAS,IAC7B,GAAgB,GAAS,IACzB,GAAoB,GAAS,IAG7B,GAAc,GAAS,GAAO,UAAY,OAC1C,GAAgB,GAAc,GAAY,QAAU,OASxD,YAAc,EAAS,CACrB,GAAI,GAAQ,GACR,EAAS,GAAW,KAAO,EAAI,EAAQ,OAG3C,IADA,KAAK,QACE,EAAE,EAAQ,GAAQ,CACvB,GAAI,GAAQ,EAAQ,GACpB,KAAK,IAAI,EAAM,GAAI,EAAM,KAW7B,aAAqB,CACnB,KAAK,SAAW,GAAe,GAAa,MAAQ,GACpD,KAAK,KAAO,EAad,YAAoB,EAAK,CACvB,GAAI,GAAS,KAAK,IAAI,IAAQ,MAAO,MAAK,SAAS,GACnD,YAAK,MAAQ,EAAS,EAAI,EACnB,EAYT,YAAiB,EAAK,CACpB,GAAI,GAAO,KAAK,SAChB,GAAI,GAAc,CAChB,GAAI,GAAS,EAAK,GAClB,MAAO,KAAW,EAAiB,OAAY,EAEjD,MAAO,IAAe,KAAK,EAAM,GAAO,EAAK,GAAO,OAYtD,YAAiB,EAAK,CACpB,GAAI,GAAO,KAAK,SAChB,MAAO,IAAgB,EAAK,KAAS,OAAa,GAAe,KAAK,EAAM,GAa9E,YAAiB,EAAK,EAAO,CAC3B,GAAI,GAAO,KAAK,SAChB,YAAK,MAAQ,KAAK,IAAI,GAAO,EAAI,EACjC,EAAK,GAAQ,IAAgB,IAAU,OAAa,EAAiB,EAC9D,KAIT,GAAK,UAAU,MAAQ,GACvB,GAAK,UAAU,OAAY,GAC3B,GAAK,UAAU,IAAM,GACrB,GAAK,UAAU,IAAM,GACrB,GAAK,UAAU,IAAM,GASrB,YAAmB,EAAS,CAC1B,GAAI,GAAQ,GACR,EAAS,GAAW,KAAO,EAAI,EAAQ,OAG3C,IADA,KAAK,QACE,EAAE,EAAQ,GAAQ,CACvB,GAAI,GAAQ,EAAQ,GACpB,KAAK,IAAI,EAAM,GAAI,EAAM,KAW7B,aAA0B,CACxB,KAAK,SAAW,GAChB,KAAK,KAAO,EAYd,YAAyB,EAAK,CAC5B,GAAI,GAAO,KAAK,SACZ,EAAQ,GAAa,EAAM,GAE/B,GAAI,EAAQ,EACV,MAAO,GAET,GAAI,GAAY,EAAK,OAAS,EAC9B,MAAI,IAAS,EACX,EAAK,MAEL,GAAO,KAAK,EAAM,EAAO,GAE3B,EAAE,KAAK,KACA,GAYT,YAAsB,EAAK,CACzB,GAAI,GAAO,KAAK,SACZ,EAAQ,GAAa,EAAM,GAE/B,MAAO,GAAQ,EAAI,OAAY,EAAK,GAAO,GAY7C,YAAsB,EAAK,CACzB,MAAO,IAAa,KAAK,SAAU,GAAO,GAa5C,YAAsB,EAAK,EAAO,CAChC,GAAI,GAAO,KAAK,SACZ,EAAQ,GAAa,EAAM,GAE/B,MAAI,GAAQ,EACV,GAAE,KAAK,KACP,EAAK,KAAK,CAAC,EAAK,KAEhB,EAAK,GAAO,GAAK,EAEZ,KAIT,GAAU,UAAU,MAAQ,GAC5B,GAAU,UAAU,OAAY,GAChC,GAAU,UAAU,IAAM,GAC1B,GAAU,UAAU,IAAM,GAC1B,GAAU,UAAU,IAAM,GAS1B,YAAkB,EAAS,CACzB,GAAI,GAAQ,GACR,EAAS,GAAW,KAAO,EAAI,EAAQ,OAG3C,IADA,KAAK,QACE,EAAE,EAAQ,GAAQ,CACvB,GAAI,GAAQ,EAAQ,GACpB,KAAK,IAAI,EAAM,GAAI,EAAM,KAW7B,aAAyB,CACvB,KAAK,KAAO,EACZ,KAAK,SAAW,CACd,KAAQ,GAAI,IACZ,IAAO,GAAK,KAAO,IACnB,OAAU,GAAI,KAalB,YAAwB,EAAK,CAC3B,GAAI,GAAS,GAAW,KAAM,GAAK,OAAU,GAC7C,YAAK,MAAQ,EAAS,EAAI,EACnB,EAYT,YAAqB,EAAK,CACxB,MAAO,IAAW,KAAM,GAAK,IAAI,GAYnC,YAAqB,EAAK,CACxB,MAAO,IAAW,KAAM,GAAK,IAAI,GAanC,YAAqB,EAAK,EAAO,CAC/B,GAAI,GAAO,GAAW,KAAM,GACxB,EAAO,EAAK,KAEhB,SAAK,IAAI,EAAK,GACd,KAAK,MAAQ,EAAK,MAAQ,EAAO,EAAI,EAC9B,KAIT,GAAS,UAAU,MAAQ,GAC3B,GAAS,UAAU,OAAY,GAC/B,GAAS,UAAU,IAAM,GACzB,GAAS,UAAU,IAAM,GACzB,GAAS,UAAU,IAAM,GAUzB,YAAkB,EAAQ,CACxB,GAAI,GAAQ,GACR,EAAS,GAAU,KAAO,EAAI,EAAO,OAGzC,IADA,KAAK,SAAW,GAAI,IACb,EAAE,EAAQ,GACf,KAAK,IAAI,EAAO,IAcpB,YAAqB,EAAO,CAC1B,YAAK,SAAS,IAAI,EAAO,GAClB,KAYT,YAAqB,EAAO,CAC1B,MAAO,MAAK,SAAS,IAAI,GAI3B,GAAS,UAAU,IAAM,GAAS,UAAU,KAAO,GACnD,GAAS,UAAU,IAAM,GASzB,YAAe,EAAS,CACtB,GAAI,GAAO,KAAK,SAAW,GAAI,IAAU,GACzC,KAAK,KAAO,EAAK,KAUnB,aAAsB,CACpB,KAAK,SAAW,GAAI,IACpB,KAAK,KAAO,EAYd,YAAqB,EAAK,CACxB,GAAI,GAAO,KAAK,SACZ,EAAS,EAAK,OAAU,GAE5B,YAAK,KAAO,EAAK,KACV,EAYT,YAAkB,EAAK,CACrB,MAAO,MAAK,SAAS,IAAI,GAY3B,YAAkB,EAAK,CACrB,MAAO,MAAK,SAAS,IAAI,GAa3B,YAAkB,EAAK,EAAO,CAC5B,GAAI,GAAO,KAAK,SAChB,GAAI,YAAgB,IAAW,CAC7B,GAAI,GAAQ,EAAK,SACjB,GAAI,CAAC,IAAQ,EAAM,OAAS,EAAmB,EAC7C,SAAM,KAAK,CAAC,EAAK,IACjB,KAAK,KAAO,EAAE,EAAK,KACZ,KAET,EAAO,KAAK,SAAW,GAAI,IAAS,GAEtC,SAAK,IAAI,EAAK,GACd,KAAK,KAAO,EAAK,KACV,KAIT,GAAM,UAAU,MAAQ,GACxB,GAAM,UAAU,OAAY,GAC5B,GAAM,UAAU,IAAM,GACtB,GAAM,UAAU,IAAM,GACtB,GAAM,UAAU,IAAM,GAUtB,YAAuB,EAAO,EAAW,CACvC,GAAI,GAAQ,GAAQ,GAChB,EAAQ,CAAC,GAAS,GAAY,GAC9B,GAAS,CAAC,GAAS,CAAC,GAAS,GAAS,GACtC,GAAS,CAAC,GAAS,CAAC,GAAS,CAAC,IAAU,GAAa,GACrD,GAAc,GAAS,GAAS,IAAU,GAC1C,GAAS,GAAc,GAAU,EAAM,OAAQ,QAAU,GACzD,GAAS,GAAO,OAEpB,OAAS,MAAO,GACd,AAAK,IAAa,GAAe,KAAK,EAAO,MACzC,CAAE,KAEC,KAAO,UAEN,IAAW,KAAO,UAAY,IAAO,WAErC,IAAW,KAAO,UAAY,IAAO,cAAgB,IAAO,eAE7D,GAAQ,GAAK,OAElB,GAAO,KAAK,IAGhB,MAAO,IAWT,YAAsB,EAAO,EAAK,CAEhC,OADI,GAAS,EAAM,OACZ,KACL,GAAI,GAAG,EAAM,GAAQ,GAAI,GACvB,MAAO,GAGX,MAAO,GAcT,YAAwB,EAAQ,EAAU,EAAa,CACrD,GAAI,GAAS,EAAS,GACtB,MAAO,IAAQ,GAAU,EAAS,GAAU,EAAQ,EAAY,IAUlE,YAAoB,EAAO,CACzB,MAAI,IAAS,KACJ,IAAU,OAAY,GAAe,EAEtC,IAAkB,KAAkB,QAAO,GAC/C,GAAU,GACV,GAAe,GAUrB,YAAyB,EAAO,CAC9B,MAAO,IAAa,IAAU,GAAW,IAAU,EAiBrD,YAAqB,EAAO,EAAO,EAAS,EAAY,GAAO,CAC7D,MAAI,KAAU,EACL,GAEL,GAAS,MAAQ,GAAS,MAAS,CAAC,GAAa,IAAU,CAAC,GAAa,GACpE,IAAU,GAAS,IAAU,EAE/B,GAAgB,EAAO,EAAO,EAAS,EAAY,GAAa,IAiBzE,YAAyB,EAAQ,EAAO,EAAS,EAAY,GAAW,GAAO,CAC7E,GAAI,IAAW,GAAQ,GACnB,GAAW,GAAQ,GACnB,GAAS,GAAW,EAAW,GAAO,GACtC,GAAS,GAAW,EAAW,GAAO,GAE1C,GAAS,IAAU,EAAU,EAAY,GACzC,GAAS,IAAU,EAAU,EAAY,GAEzC,GAAI,IAAW,IAAU,EACrB,GAAW,IAAU,EACrB,GAAY,IAAU,GAE1B,GAAI,IAAa,GAAS,GAAS,CACjC,GAAI,CAAC,GAAS,GACZ,MAAO,GAET,GAAW,GACX,GAAW,GAEb,GAAI,IAAa,CAAC,GAChB,WAAU,IAAQ,GAAI,KACd,IAAY,GAAa,GAC7B,GAAY,EAAQ,EAAO,EAAS,EAAY,GAAW,IAC3D,GAAW,EAAQ,EAAO,GAAQ,EAAS,EAAY,GAAW,IAExE,GAAI,CAAE,GAAU,GAAuB,CACrC,GAAI,IAAe,IAAY,GAAe,KAAK,EAAQ,eACvD,GAAe,IAAY,GAAe,KAAK,EAAO,eAE1D,GAAI,IAAgB,GAAc,CAChC,GAAI,IAAe,GAAe,EAAO,QAAU,EAC/C,GAAe,GAAe,EAAM,QAAU,EAElD,WAAU,IAAQ,GAAI,KACf,GAAU,GAAc,GAAc,EAAS,EAAY,KAGtE,MAAK,IAGL,KAAU,IAAQ,GAAI,KACf,GAAa,EAAQ,EAAO,EAAS,EAAY,GAAW,KAH1D,GAcX,YAAsB,EAAO,CAC3B,GAAI,CAAC,GAAS,IAAU,GAAS,GAC/B,MAAO,GAET,GAAI,GAAU,GAAW,GAAS,GAAa,GAC/C,MAAO,GAAQ,KAAK,GAAS,IAU/B,YAA0B,EAAO,CAC/B,MAAO,IAAa,IAClB,GAAS,EAAM,SAAW,CAAC,CAAC,GAAe,GAAW,IAU1D,YAAkB,EAAQ,CACxB,GAAI,CAAC,GAAY,GACf,MAAO,IAAW,GAEpB,GAAI,GAAS,GACb,OAAS,KAAO,QAAO,GACrB,AAAI,GAAe,KAAK,EAAQ,IAAQ,GAAO,eAC7C,EAAO,KAAK,GAGhB,MAAO,GAgBT,YAAqB,EAAO,EAAO,EAAS,EAAY,GAAW,GAAO,CACxE,GAAI,IAAY,EAAU,EACtB,GAAY,EAAM,OAClB,GAAY,EAAM,OAEtB,GAAI,IAAa,IAAa,CAAE,KAAa,GAAY,IACvD,MAAO,GAGT,GAAI,IAAU,GAAM,IAAI,GACxB,GAAI,IAAW,GAAM,IAAI,GACvB,MAAO,KAAW,EAEpB,GAAI,IAAQ,GACR,GAAS,GACT,GAAQ,EAAU,EAA0B,GAAI,IAAW,OAM/D,IAJA,GAAM,IAAI,EAAO,GACjB,GAAM,IAAI,EAAO,GAGV,EAAE,GAAQ,IAAW,CAC1B,GAAI,IAAW,EAAM,IACjB,GAAW,EAAM,IAErB,GAAI,EACF,GAAI,IAAW,GACX,EAAW,GAAU,GAAU,GAAO,EAAO,EAAO,IACpD,EAAW,GAAU,GAAU,GAAO,EAAO,EAAO,IAE1D,GAAI,KAAa,OAAW,CAC1B,GAAI,GACF,SAEF,GAAS,GACT,MAGF,GAAI,IACF,GAAI,CAAC,GAAU,EAAO,SAAS,GAAU,GAAU,CAC7C,GAAI,CAAC,GAAS,GAAM,KACf,MAAa,IAAY,GAAU,GAAU,GAAU,EAAS,EAAY,KAC/E,MAAO,IAAK,KAAK,MAEjB,CACN,GAAS,GACT,eAEO,CACL,MAAa,IACX,GAAU,GAAU,GAAU,EAAS,EAAY,KACpD,CACL,GAAS,GACT,OAGJ,UAAM,OAAU,GAChB,GAAM,OAAU,GACT,GAoBT,YAAoB,EAAQ,EAAO,EAAK,EAAS,GAAY,GAAW,GAAO,CAC7E,OAAQ,OACD,IACH,GAAK,EAAO,YAAc,EAAM,YAC3B,EAAO,YAAc,EAAM,WAC9B,MAAO,GAET,EAAS,EAAO,OAChB,EAAQ,EAAM,WAEX,GACH,MAAK,IAAO,YAAc,EAAM,YAC5B,CAAC,GAAU,GAAI,IAAW,GAAS,GAAI,IAAW,SAKnD,OACA,OACA,GAGH,MAAO,IAAG,CAAC,EAAQ,CAAC,OAEjB,GACH,MAAO,GAAO,MAAQ,EAAM,MAAQ,EAAO,SAAW,EAAM,YAEzD,OACA,GAIH,MAAO,IAAW,EAAQ,OAEvB,GACH,GAAI,IAAU,OAEX,GACH,GAAI,IAAY,EAAU,EAG1B,GAFA,IAAY,IAAU,IAElB,EAAO,MAAQ,EAAM,MAAQ,CAAC,GAChC,MAAO,GAGT,GAAI,IAAU,GAAM,IAAI,GACxB,GAAI,GACF,MAAO,KAAW,EAEpB,GAAW,EAGX,GAAM,IAAI,EAAQ,GAClB,GAAI,IAAS,GAAY,GAAQ,GAAS,GAAQ,GAAQ,EAAS,GAAY,GAAW,IAC1F,UAAM,OAAU,GACT,OAEJ,GACH,GAAI,GACF,MAAO,IAAc,KAAK,IAAW,GAAc,KAAK,GAG9D,MAAO,GAgBT,YAAsB,EAAQ,EAAO,EAAS,EAAY,GAAW,GAAO,CAC1E,GAAI,IAAY,EAAU,EACtB,GAAW,GAAW,GACtB,GAAY,GAAS,OACrB,GAAW,GAAW,GACtB,GAAY,GAAS,OAEzB,GAAI,IAAa,IAAa,CAAC,GAC7B,MAAO,GAGT,OADI,IAAQ,GACL,MAAS,CACd,GAAI,IAAM,GAAS,IACnB,GAAI,CAAE,IAAY,KAAO,GAAQ,GAAe,KAAK,EAAO,KAC1D,MAAO,GAIX,GAAI,IAAU,GAAM,IAAI,GACxB,GAAI,IAAW,GAAM,IAAI,GACvB,MAAO,KAAW,EAEpB,GAAI,IAAS,GACb,GAAM,IAAI,EAAQ,GAClB,GAAM,IAAI,EAAO,GAGjB,OADI,IAAW,GACR,EAAE,GAAQ,IAAW,CAC1B,GAAM,GAAS,IACf,GAAI,IAAW,EAAO,IAClB,GAAW,EAAM,IAErB,GAAI,EACF,GAAI,IAAW,GACX,EAAW,GAAU,GAAU,GAAK,EAAO,EAAQ,IACnD,EAAW,GAAU,GAAU,GAAK,EAAQ,EAAO,IAGzD,GAAI,CAAE,MAAa,OACV,KAAa,IAAY,GAAU,GAAU,GAAU,EAAS,EAAY,IAC7E,IACD,CACL,GAAS,GACT,MAEF,IAAa,IAAW,IAAO,eAEjC,GAAI,IAAU,CAAC,GAAU,CACvB,GAAI,IAAU,EAAO,YACjB,GAAU,EAAM,YAGpB,AAAI,IAAW,IACV,eAAiB,IAAU,eAAiB,IAC7C,CAAE,OAAO,KAAW,YAAc,aAAmB,KACnD,MAAO,KAAW,YAAc,aAAmB,MACvD,IAAS,IAGb,UAAM,OAAU,GAChB,GAAM,OAAU,GACT,GAUT,YAAoB,EAAQ,CAC1B,MAAO,IAAe,EAAQ,GAAM,IAWtC,YAAoB,EAAK,EAAK,CAC5B,GAAI,GAAO,EAAI,SACf,MAAO,IAAU,GACb,EAAK,MAAO,IAAO,SAAW,SAAW,QACzC,EAAK,IAWX,YAAmB,EAAQ,EAAK,CAC9B,GAAI,GAAQ,GAAS,EAAQ,GAC7B,MAAO,IAAa,GAAS,EAAQ,OAUvC,YAAmB,EAAO,CACxB,GAAI,GAAQ,GAAe,KAAK,EAAO,IACnC,EAAM,EAAM,IAEhB,GAAI,CACF,EAAM,IAAkB,OACxB,GAAI,GAAW,SACR,GAAP,EAEF,GAAI,IAAS,GAAqB,KAAK,GACvC,MAAI,IACF,CAAI,EACF,EAAM,IAAkB,EAExB,MAAO,GAAM,KAGV,GAUT,GAAI,IAAa,AAAC,GAA+B,SAAS,EAAQ,CAChE,MAAI,IAAU,KACL,GAET,GAAS,OAAO,GACT,EAAY,GAAiB,GAAS,SAAS,EAAQ,CAC5D,MAAO,IAAqB,KAAK,EAAQ,OANR,GAiBjC,GAAS,GAGb,AAAK,KAAY,GAAO,GAAI,IAAS,GAAI,aAAY,MAAQ,IACxD,IAAO,GAAO,GAAI,MAAQ,GAC1B,IAAW,GAAO,GAAQ,YAAc,GACxC,IAAO,GAAO,GAAI,MAAQ,GAC1B,IAAW,GAAO,GAAI,MAAY,KACrC,IAAS,SAAS,EAAO,CACvB,GAAI,GAAS,GAAW,GACpB,EAAO,GAAU,EAAY,EAAM,YAAc,OACjD,EAAa,EAAO,GAAS,GAAQ,GAEzC,GAAI,EACF,OAAQ,OACD,IAAoB,MAAO,QAC3B,IAAe,MAAO,OACtB,IAAmB,MAAO,OAC1B,IAAe,MAAO,OACtB,IAAmB,MAAO,IAGnC,MAAO,KAYX,YAAiB,EAAO,EAAQ,CAC9B,SAAS,GAAiB,EACnB,CAAC,CAAC,GACN,OAAO,IAAS,UAAY,GAAS,KAAK,KAC1C,EAAQ,IAAM,EAAQ,GAAK,GAAK,EAAQ,EAU7C,YAAmB,EAAO,CACxB,GAAI,GAAO,MAAO,GAClB,MAAQ,IAAQ,UAAY,GAAQ,UAAY,GAAQ,UAAY,GAAQ,UACvE,IAAU,YACV,IAAU,KAUjB,YAAkB,EAAM,CACtB,MAAO,CAAC,CAAC,IAAe,KAAc,GAUxC,YAAqB,EAAO,CAC1B,GAAI,GAAO,GAAS,EAAM,YACtB,EAAS,MAAO,IAAQ,YAAc,EAAK,WAAc,GAE7D,MAAO,KAAU,EAUnB,YAAwB,EAAO,CAC7B,MAAO,IAAqB,KAAK,GAUnC,YAAkB,EAAM,CACtB,GAAI,GAAQ,KAAM,CAChB,GAAI,CACF,MAAO,IAAa,KAAK,SAClB,EAAP,EACF,GAAI,CACF,MAAQ,GAAO,SACR,EAAP,GAEJ,MAAO,GAmCT,YAAY,EAAO,EAAO,CACxB,MAAO,KAAU,GAAU,IAAU,GAAS,IAAU,EAqB1D,GAAI,IAAc,GAAgB,UAAW,CAAE,MAAO,eAAkB,GAAkB,SAAS,EAAO,CACxG,MAAO,IAAa,IAAU,GAAe,KAAK,EAAO,WACvD,CAAC,GAAqB,KAAK,EAAO,WA0BlC,GAAU,MAAM,QA2BpB,YAAqB,EAAO,CAC1B,MAAO,IAAS,MAAQ,GAAS,EAAM,SAAW,CAAC,GAAW,GAoBhE,GAAI,IAAW,IAAkB,GA8BjC,YAAiB,EAAO,EAAO,CAC7B,MAAO,IAAY,EAAO,GAoB5B,YAAoB,EAAO,CACzB,GAAI,CAAC,GAAS,GACZ,MAAO,GAIT,GAAI,GAAM,GAAW,GACrB,MAAO,IAAO,GAAW,GAAO,GAAU,GAAO,GAAY,GAAO,EA6BtE,YAAkB,EAAO,CACvB,MAAO,OAAO,IAAS,UACrB,EAAQ,IAAM,EAAQ,GAAK,GAAK,GAAS,EA4B7C,YAAkB,EAAO,CACvB,GAAI,GAAO,MAAO,GAClB,MAAO,IAAS,MAAS,IAAQ,UAAY,GAAQ,YA2BvD,YAAsB,EAAO,CAC3B,MAAO,IAAS,MAAQ,MAAO,IAAS,SAoB1C,GAAI,IAAe,GAAmB,GAAU,IAAoB,GA8BpE,YAAc,EAAQ,CACpB,MAAO,IAAY,GAAU,GAAc,GAAU,GAAS,GAqBhE,aAAqB,CACnB,MAAO,GAgBT,aAAqB,CACnB,MAAO,GAGT,EAAO,QAAU,KAGX,GAAe,CAAC,EAAO,IACpB,GAAe,EAAO,GAGzB,GAAc,AAAC,GACZ,OAAO,KAAK,GAAQ,IAGvB,GAAiB,CAAC,EAAU,IAAgB,CAChD,GAAM,GAAc,GACpB,SAAS,QAAQ,AAAC,GAAY,CAC5B,EAAY,GAAW,EAAY,KAE9B,GAGH,GAAqB,IAAM,CAC/B,GAAM,GAAc,GAEd,EAAiB,CAAC,EAAQ,IAAQ,CACtC,GAAM,CAAE,cAAa,MAAO,EACtB,CAAE,OAAM,SAAU,EAExB,AAAK,EAAY,IACf,GAAY,GAAe,CACzB,KAAM,GACN,OAGJ,EAAY,GAAa,KAAK,GAAQ,GAGxC,MAAO,CACL,cACA,UAAU,EAAQ,EAAK,CACrB,AAAI,GACF,EAAe,EAAQ,IAG3B,OAAO,EAAM,EAAM,CACjB,OAAO,QAAQ,GAAa,QAAQ,CAAC,CAAC,EAAW,CAAE,OAAM,SAAU,CACjE,GAAM,GAAW,GAAY,GAE7B,GAAI,EAAS,SAAS,GAAO,CAC3B,GAAM,GAAc,GAAe,EAAU,GAC7C,AAAK,GAAa,EAAM,IACtB,GAAY,GAAW,KAAO,EAC9B,WAQN,GAAsB,IAAM,CAChC,GAAI,GAAS,KAEb,MAAO,CACL,cAAc,EAAa,EAAI,CAC7B,EAAS,CACP,cACA,MAEF,EAAO,KACP,EAAS,MAEX,WAAY,CACV,MAAO,MAKb,YAAwB,EAAU,EAAS,CACzC,GAAM,GAAO,GAAW,EAAU,OAAQ,IACpC,EAAQ,GAAW,EAAU,QAAS,IACtC,EAAU,GAAW,EAAU,UAAW,IAC1C,EAAW,GAAW,EAAS,WAAY,IAAM,IAEjD,CAAE,YAAW,SAAQ,eAAgB,KACrC,CAAE,gBAAe,aAAc,KAEjC,EACE,EAAW,GACX,EAAa,IAAO,EACxB,KAAM,EACN,QAAS,IAGP,EAAgB,GACd,EAAkB,AAAC,GAAO,IAAI,IAAS,CAC3C,EAAgB,GAChB,GAAM,GAAS,EAAG,GAAG,GACrB,SAAgB,GACT,GAIT,OAAO,QAAQ,GAAS,QAAQ,CAAC,CAAC,EAAY,KAAgB,CAC5D,EAAS,GAAc,EAAgB,IAAI,IACzC,EAAW,IAAc,GAAG,IAE9B,OAAO,eAAe,EAAS,GAAa,OAAQ,CAAE,MAAO,MAG/D,EAAQ,GAAI,OAAM,GAAiB,GAAO,CACxC,IAAI,EAAQ,EAAM,CAChB,MAAI,MAAe,CAAC,GAClB,EAAU,IAAa,CAAE,OAAM,MAAO,EAAO,KAExC,QAAQ,IAAI,GAAG,YAExB,IAAI,EAAQ,EAAM,EAAO,CAEvB,MAAI,GAAO,KAAU,GAIrB,SAAQ,IAAI,GAAG,WAEV,KACH,IAAY,EAAS,EAAM,GAC3B,EAAO,EAAO,KAGT,MAIX,OAAO,QAAQ,GAAO,QAAQ,CAAC,CAAC,EAAW,KAAe,CACxD,EAAc,EAAW,IAAM,CAC7B,EAAU,SAId,GAAM,GAAS,CAAC,EAAO,GACvB,SAAO,UAAY,CACjB,iBAAkB,CAChB,MAAO,KAIJ,EAGT,YAAkD,CAChD,YACA,kBACA,oBACA,kBACC,CACD,GAAM,GAAU,IAAc,EAAI,EAAI,EAAkB,EAClD,EAAO,EAAY,EAAkB,EAAY,EACjD,EAAK,EAAO,KAAK,IAAI,EAAiB,GAAqB,EAC3D,EAAU,GAChB,OAAS,GAAE,EAAM,GAAG,KAAK,IAAI,EAAiB,EAAG,GAAK,IACpD,EAAQ,KAAK,GAEf,MAAO,GAGT,YAA4B,CAC1B,WACA,YACA,aACA,iBACA,kBACA,qBACC,CACD,GAAM,GAAa,GAAgB,EAAG,EAAW,EAAa,GAE1D,EAAa,EAAa,EAC1B,EAAW,EAAa,EAE5B,EAAa,EACT,EAAa,EAAI,EAAa,EAAI,EAClC,KAAK,IAAI,EAAG,GAEhB,EAAW,EACP,EAAW,EAAa,EAAI,EAAI,EAChC,KAAK,IAAI,EAAa,EAAG,GAE7B,GAAM,GAAc,CAAC,GAAG,GAAI,KAAI,CAC9B,EACA,EACA,EAGA,EACA,EAAa,KACX,KAAK,CAAC,EAAG,IAAM,EAAI,GACjB,EAAkB,EAAY,QAClC,GAAa,GAAyC,CACpD,YACA,kBACA,oBACA,oBAGJ,MAAO,CACL,cACA,gBAAiB,CAAC,GAAG,GAAI,KAAI,IAAkB,KAAK,CAAC,EAAG,IAAM,EAAI,IAItE,GAAM,IAAuB,CAAC,EAAI,IAChC,KACO,YAAY,EAAI,IAGnB,GAAU,GACV,GAAY,EAElB,QAAsB,CACpB,YAAY,CAAE,yBAAyB,CACrC,KAAK,uBAAyB,EAE9B,KAAK,kBACL,KAAK,uBAEL,KAAK,UACL,KAAK,QAAU,GAGjB,oBAAoB,EAAkB,CACpC,KAAK,kBAAoB,EAG3B,MAAM,EAAU,CACd,MAAO,IAAI,SAAQ,AAAC,GAAY,CAC9B,KAAK,QAEL,GAAM,GAAS,KAAK,IAAI,GAAS,KAAK,IAAI,KAAK,kBAAmB,IAC9D,EAAW,CAAC,EAEhB,KAAK,UAAY,GAAqB,SAAY,CAChD,GAAI,KAAK,QACP,OAEF,GAAY,EAEZ,GAAM,GAAQ,EAAW,KAAK,kBAC9B,KAAK,uBAAuB,GAExB,EAAQ,IACV,MAAK,QACL,KAAM,KACN,MAED,KAIP,OAAQ,CACN,KAAK,QAAU,GAGjB,QAAS,CACP,KAAK,QAAU,GAGjB,OAAQ,CACN,cAAc,KAAK,WACnB,KAAK,uBAAuB,MAIhC,YAAwB,EAAU,CAChC,GAAM,GAAkB,GAAI,IAAgB,CAC1C,sBAAuB,AAAC,GAAU,CAChC,EAAS,gBAAiB,EAAI,MAI5B,EAAW,GACf,CACE,KAAM,CACJ,4BAA6B,EAC7B,gBAAiB,EACjB,oBAAqB,EACrB,kBAAmB,EACnB,sBAAuB,EACvB,eAAgB,EAChB,qBAAsB,EACtB,SAAU,GACV,iBAAkB,IAClB,gBAAiB,EACjB,gBAAiB,EACjB,iBAAkB,EAClB,gBAAiB,EACjB,iBAAkB,EAClB,WAAY,EACZ,aAAc,GACd,QAAS,GACT,SAAU,GACV,kBAAmB,OACnB,SAAU,GACV,eAAgB,IAChB,WAAY,IACZ,OAAQ,EACR,cAAe,EACf,OAAQ,IAEV,MAAO,CACL,UAAU,CAAE,QAAQ,CAClB,EAAK,OAAS,GAAmB,CAC/B,SAAU,EAAK,SACf,UAAW,EAAK,iBAChB,WAAY,EAAK,WACjB,eAAgB,EAAK,4BACrB,gBAAiB,EAAK,gBACtB,kBAAmB,EAAK,oBACvB,iBAEL,oBAAoB,CAAE,QAAQ,CAC5B,EAAK,iBAAmB,GAA0C,CAChE,qBAAsB,EAAK,qBAC3B,eAAgB,EAAK,eACrB,gBAAiB,EAAK,gBACtB,iBAAkB,EAAK,iBACvB,SAAU,EAAK,SACf,kBAAmB,EAAK,qBAG5B,mBAAmB,CAAE,QAAQ,CAC3B,EAAK,gBAAkB,GAAmB,CACxC,kBAAmB,EAAK,kBACxB,gBAAiB,EAAK,gBACtB,4BAA6B,EAAK,+BAGtC,eAAe,CAAE,QAAQ,CACvB,GAAM,CAAE,OAAM,QAAS,GAAe,CACpC,SAAU,EAAK,SACf,gBAAiB,EAAK,gBACtB,gBAAiB,EAAK,kBAExB,EAAK,gBAAkB,EACvB,EAAK,gBAAkB,EACvB,EAAK,iBAAmB,EAAO,GAEjC,mCAAmC,CAAE,QAAQ,CAC3C,EAAgB,oBAAoB,EAAK,mBAE3C,sBAAsB,CAAE,KAAM,CAAE,eAAc,YAAa,CAEzD,AAAI,GACF,CAAI,EACF,EAAgB,QAEhB,EAAgB,WAItB,aAAa,CAAE,QAAQ,CACrB,EAAK,WAAa,EAAK,gBAEzB,cAAc,CAAE,OAAM,QAAS,CAAE,2BAA4B,CAG3D,EAAK,UAAY,EAAuB,EAAK,WAE/C,cAAc,CAAE,QAAQ,CACtB,EAAK,WAAa,GAA8B,CAC9C,SAAU,EAAK,SACf,4BAA6B,EAAK,4BAClC,kBAAmB,EAAK,kBACxB,gBAAiB,EAAK,mBAG1B,mBAAmB,CAAE,QAAQ,CAC3B,EAAK,gBAAkB,GACrB,EACA,EAAK,oBACL,EAAK,8BAGT,qBAAqB,CAAE,QAAQ,CAC7B,EAAK,kBAAoB,GACvB,EACA,EAAK,sBACL,EAAK,+BAIX,QAAS,CACP,MAAM,CAAE,QAAQ,CACd,EAAK,qBAAuB,GAA4B,CACtD,SAAU,EAAK,SACf,UAAW,EAAK,iBAAmB,EACnC,gBAAiB,EAAK,gBACtB,gBAAiB,EAAK,gBACtB,kBAAmB,EAAK,kBACxB,eAAgB,EAAK,eACrB,gBAAiB,EAAK,mBAG1B,MAAM,CAAE,QAAQ,CACd,EAAK,qBAAuB,GAA4B,CACtD,SAAU,EAAK,SACf,UAAW,EAAK,iBAAmB,EACnC,gBAAiB,EAAK,gBACtB,gBAAiB,EAAK,gBACtB,kBAAmB,EAAK,kBACxB,eAAgB,EAAK,eACrB,gBAAiB,EAAK,mBAG1B,gBAAgB,CAAE,QAAQ,EAAe,CACvC,EAAK,qBAAuB,GAC1B,EACA,EACA,EAAK,eAAiB,IAG1B,cAAc,CAAE,QAAQ,CACtB,EAAK,QAAU,CAAC,EAAK,cAEjB,wBAAuB,CAAE,OAAM,WAAW,CAE9C,GACE,CAAC,EAAK,UACJ,GAAK,oBAAsB,IAC3B,EAAK,uBAAyB,EAAK,eAAiB,GACnD,EAAK,oBAAsB,IAC1B,EAAK,uBAAyB,GAClC,CACA,EAAgB,QAChB,OAGF,GAAI,EAAK,SAAU,CACjB,GAAM,GAAW,IACf,GAAS,EACN,IAAO,SAAY,EAAQ,gBAC3B,IAAO,SAAY,EAAQ,iBAC3B,EAAK,mBAEV,KAAM,GAAgB,MAAM,UAI1B,eAAc,CAAE,OAAM,WAAW,CACrC,GAAI,GAAS,GACb,MAAI,GAAK,UACP,CAAI,EAAK,uBAAyB,EAChC,MAAM,GAAQ,aACZ,EAAK,eAAiB,EAAK,iBAC3B,CACE,SAAU,KAGd,EAAS,IAET,EAAK,uBACL,EAAK,eAAiB,EAAK,iBAE3B,MAAM,GAAQ,aAAa,EAAK,gBAAiB,CAC/C,SAAU,KAEZ,EAAS,KAGN,QAEH,YAAW,CAAE,OAAM,WAAW,EAAe,EAAS,CAE1D,GADA,EAAgB,QACZ,EAAK,SAAU,OACnB,EAAK,SAAW,GAEhB,IACA,KAAM,GAAQ,WAAW,CAAE,SAAU,GAAI,EAAS,WAAY,MAC9D,EAAK,SAAW,GAGhB,CADe,KAAM,GAAQ,iBAClB,EAAQ,+BAEf,cAAa,CAAE,OAAM,WAAW,EAAS,CAC7C,AAAI,EAAK,UACT,KAAM,GAAQ,WAAW,EAAQ,MAAO,SAEpC,cAAa,CAAE,OAAM,WAAW,EAAS,CAC7C,AAAI,EAAK,UACT,KAAM,GAAQ,WAAW,EAAQ,MAAO,SAEpC,cAAa,CAAE,WAAW,EAAe,EAAS,CACtD,KAAM,GAAQ,WACZ,IAAM,EAAQ,gBAAgB,GAC9B,IAGJ,6BAA6B,CAAE,QAAQ,EAAW,CAChD,MAAO,IAA4B,CACjC,SAAU,EAAK,SACf,YACA,gBAAiB,EAAK,gBACtB,gBAAiB,EAAK,gBACtB,kBAAmB,EAAK,kBACxB,eAAgB,EAAK,eACrB,gBAAiB,EAAK,wBAGpB,UAAS,CAAE,WAAW,EAAW,EAAS,CAC9C,GAAM,GAAgB,EAAQ,6BAA6B,GAC3D,KAAM,GAAQ,aAAa,EAAe,IAE5C,WAAW,CAAE,QAAQ,EAAS,CAC5B,GAAM,GAAW,GAAI,EAAS,WAAY,IAC1C,MAAO,IAAI,SAAQ,AAAC,GAAY,CAE9B,EAAK,WAAa,EAAW,EAAK,eAAiB,EACnD,EAAK,OAAS,CAAC,EAAK,qBAAuB,EAAK,cAChD,WAAW,IAAM,CACf,KACC,EAAK,iBAKhB,CACE,aAGE,CAAC,EAAM,GAAW,EAExB,MAAO,CAAC,CAAE,OAAM,mBAAmB,EAAS,EAAS,WAKvD,YAAmB,EAAQ,CAC1B,GAAc,EAAQ,gBAAiB,26BAGxC,GAAM,IAAwB,GAAU,EACvC,iBAAkB,EAAM,GAA0B,GAClD,WAAY,EAAM,GAAoB,KACtC,OAAQ,EAAM,GAAgB,KAGzB,GAAwB,GAAQ,EACrC,iBAAuC,EAAI,GAC3C,WAA2B,EAAI,IAC/B,SAA+B,EAAI,IACnC,OAAmB,EAAI,KAGlB,GAAwB,GAAU,EACvC,OAAQ,EAAM,GAAgB,GAC9B,iBAAkB,EAAM,GAA0B,KAG7C,GAAwB,GAAQ,EACrC,aAA0B,EAAI,IAAI,aAClC,OAAmB,EAAI,GACvB,iBAAuC,EAAI,KAGtC,GAA2B,GAAU,EAC1C,OAAQ,EAAM,GAAgB,GAC9B,iBAAkB,EAAM,GAA0B,KAG7C,GAA2B,GAAQ,EACxC,OAAmB,EAAI,GACvB,iBAAuC,EAAI,KAGtC,GAAwB,GAAU,EACvC,OAAQ,EAAM,GAAgB,GAC9B,iBAAkB,EAAM,GAA0B,KAG7C,GAAwB,GAAQ,EACrC,aAA0B,EAAI,IAAI,aAClC,OAAmB,EAAI,GACvB,iBAAuC,EAAI,KAI5C,YAA2B,EAAK,CAC/B,GAAI,GACE,EAAgC,EAAI,IAAI,KACxC,EAAY,GAAY,EAAoB,EAAiB,EAAI,IAAK,IACtE,EAAwB,GAAa,GAAiB,GAE5D,MAAO,CACN,GAAI,CACH,AAAI,GAAuB,EAAsB,KAElD,EAAE,EAAQ,EAAQ,CACjB,AAAI,GACH,EAAsB,EAAE,EAAQ,GAGjC,EAAU,IAEX,EAAE,EAAK,EAAO,CACb,AAAI,EACC,EAAU,GAAM,EAAC,GAAW,EAAM,GAAkC,GAAK,EAAM,GAAiB,KACnG,GACC,EACA,EACA,EACY,EAAI,IAChB,AAAC,EAEC,GAAiB,EAAgC,EAAI,IAAK,EAAO,IADjE,GAAqC,EAAI,KAE3C,IAIE,GAAyB,EAAsB,GAAM,EAAC,GAAW,EAAM,GAAoC,KAC9G,EAAsB,EAAE,EAAK,AAAC,EAAqB,EAAX,CAAC,GAAI,MAIhD,EAAE,EAAO,CACR,AAAI,GACJ,GAAc,EAAuB,GACrC,EAAU,KAEX,EAAE,EAAO,CACR,EAAe,EAAuB,GACtC,EAAU,IAEX,EAAE,EAAW,CACZ,AAAI,GAAuB,EAAsB,EAAE,KAMtD,YAA0B,EAAK,CAC9B,GAAI,GACA,EACA,EAEJ,SAAQ,GAAI,IAAM,CAChB,MAAO,CACN,UAAW,OACX,SAAU,CAAc,EAAI,IAA2B,EAAI,KAAO,KAIrE,EAAM,IAAI,QAA0B,EAAI,KAEjC,CACN,GAAI,CACH,EAAM,EAAQ,OACd,EAAiB,EAAM,GAAG,UAC1B,EAAK,EAAK,QAAS,+CAEpB,EAAE,EAAQ,EAAQ,CACjB,EAAO,EAAQ,EAAK,GACpB,EAAgB,EAAO,EAAK,MAC5B,EAAU,IAEX,EAAE,EAAK,EAAO,CACb,GAAM,GAAgB,GACtB,AAAI,EAAM,GAAoC,IAAI,GAAc,SAAW,CAAc,EAAI,IAA2B,EAAI,KAAO,GACnI,EAAM,KAAK,IAEZ,EAAE,EAAO,CACR,AAAI,GACJ,GAAc,EAAM,GAAG,SAAU,GACjC,EAAU,KAEX,EAAE,EAAO,CACR,EAAe,EAAM,GAAG,SAAU,GAClC,EAAU,IAEX,EAAE,EAAW,CACZ,AAAI,GAAW,EAAO,GACtB,EAAkB,KAMrB,YAA2B,EAAK,CAC/B,GAAI,GACA,EACA,EAEJ,SAAW,GAAI,IAAS,CACtB,MAAO,CAAE,MAAyB,EAAI,MAGjC,CACN,GAAI,CACH,EAAM,EAAQ,OACd,EAAiB,EAAS,GAAG,UAC7B,EAAK,EAAK,QAAS,kDAEpB,EAAE,EAAQ,EAAQ,CACjB,EAAO,EAAQ,EAAK,GACpB,EAAgB,EAAU,EAAK,MAC/B,EAAU,IAEX,EAAE,EAAK,EAAO,CACb,GAAM,GAAmB,GACzB,AAAI,EAAM,GAAuB,KAAK,GAAiB,MAA0B,EAAI,IACrF,EAAS,KAAK,IAEf,EAAE,EAAO,CACR,AAAI,GACJ,GAAc,EAAS,GAAG,SAAU,GACpC,EAAU,KAEX,EAAE,EAAO,CACR,EAAe,EAAS,GAAG,SAAU,GACrC,EAAU,IAEX,EAAE,EAAW,CACZ,AAAI,GAAW,EAAO,GACtB,EAAkB,KAMrB,YAA2B,EAAK,CAC/B,GAAI,GACE,EAAgC,EAAI,IAAI,KACxC,EAAY,GAAY,EAAoB,EAAiB,EAAI,IAAK,IACtE,EAAwB,GAAa,GAAiB,GAE5D,MAAO,CACN,GAAI,CACH,AAAI,GAAuB,EAAsB,KAElD,EAAE,EAAQ,EAAQ,CACjB,AAAI,GACH,EAAsB,EAAE,EAAQ,GAGjC,EAAU,IAEX,EAAE,EAAK,EAAO,CACb,AAAI,EACC,EAAU,GAAM,EAAC,GAAW,EAAM,GAAkC,GAAK,EAAM,GAAiB,KACnG,GACC,EACA,EACA,EACY,EAAI,IAChB,AAAC,EAEC,GAAiB,EAAgC,EAAI,IAAK,EAAO,IADjE,GAAqC,EAAI,KAE3C,IAIE,GAAyB,EAAsB,GAAM,EAAC,GAAW,EAAM,GAAgD,OAC1H,EAAsB,EAAE,EAAK,AAAC,EAAqB,EAAX,CAAC,GAAI,MAIhD,EAAE,EAAO,CACR,AAAI,GACJ,GAAc,EAAuB,GACrC,EAAU,KAEX,EAAE,EAAO,CACR,EAAe,EAAuB,GACtC,EAAU,IAEX,EAAE,EAAW,CACZ,AAAI,GAAuB,EAAsB,EAAE,KAMtD,YAA0B,EAAK,CAC9B,GAAI,GACA,EACA,EAEJ,SAAQ,GAAI,IAAM,CAChB,MAAO,CACN,UAAW,OACX,SAAU,CAAc,EAAI,IAA2B,EAAI,KAAsB,EAAI,IAAM,KAI9F,EAAM,IAAI,QAAqB,EAAI,IAAI,cAEhC,CACN,GAAI,CACH,EAAM,EAAQ,OACd,EAAiB,EAAM,GAAG,UAC1B,EAAK,EAAK,QAAS,+CAEpB,EAAE,EAAQ,EAAQ,CACjB,EAAO,EAAQ,EAAK,GACpB,EAAgB,EAAO,EAAK,MAC5B,EAAU,IAEX,EAAE,EAAK,EAAO,CACb,GAAM,GAAgB,GACtB,AAAI,EAAM,GAAgD,MAAM,GAAc,SAAW,CAAc,EAAI,IAA2B,EAAI,KAAsB,EAAI,IAAM,GAC1K,EAAM,KAAK,IAEZ,EAAE,EAAO,CACR,AAAI,GACJ,GAAc,EAAM,GAAG,SAAU,GACjC,EAAU,KAEX,EAAE,EAAO,CACR,EAAe,EAAM,GAAG,SAAU,GAClC,EAAU,IAEX,EAAE,EAAW,CACZ,AAAI,GAAW,EAAO,GACtB,EAAkB,KAMrB,YAAyB,EAAK,CAC7B,GAAI,GACE,EAAgC,EAAI,IAAI,KACxC,EAAY,GAAY,EAAoB,EAAiB,EAAI,IAAK,IACtE,EAAwB,GAAa,GAAe,GAE1D,MAAO,CACN,GAAI,CACH,AAAI,GAAuB,EAAsB,KAElD,EAAE,EAAQ,EAAQ,CACjB,AAAI,GACH,EAAsB,EAAE,EAAQ,GAGjC,EAAU,IAEX,EAAE,EAAK,EAAO,CACb,AAAI,EACC,EAAU,GAAM,EAAC,GAAW,EAAM,GAA8C,KAAO,EAAM,GAAiB,KACjH,GACC,EACA,EACA,EACY,EAAI,IAChB,AAAC,EAEC,GAAiB,EAAgC,EAAI,IAAK,EAAO,IADjE,GAAqC,EAAI,KAE3C,IAIE,GAAyB,EAAsB,GAAM,EAAC,GAAW,EAAM,GAAsC,OAChH,EAAsB,EAAE,EAAK,AAAC,EAAqB,EAAX,CAAC,GAAI,MAIhD,EAAE,EAAO,CACR,AAAI,GACJ,GAAc,EAAuB,GACrC,EAAU,KAEX,EAAE,EAAO,CACR,EAAe,EAAuB,GACtC,EAAU,IAEX,EAAE,EAAW,CACZ,AAAI,GAAuB,EAAsB,EAAE,KAMtD,YAAwB,EAAK,CAC5B,GAAI,GACA,EAEJ,SAAS,GAAI,IAAK,CAChB,MAAO,CACN,WAA2B,EAAI,IAC/B,iBAAuC,EAAI,MAI9C,EAAO,IAAI,aAAqC,EAAI,KAE7C,CACN,GAAI,CACH,EAAiB,EAAO,GAAG,WAE5B,EAAE,EAAQ,EAAQ,CACjB,EAAgB,EAAQ,EAAQ,GAChC,EAAU,IAEX,EAAE,EAAK,EAAO,CACb,GAAM,GAAiB,GACvB,AAAI,EAAM,GAAoB,MAAM,GAAe,WAA4B,EAAI,KAC/E,EAAM,GAA0B,IAAI,GAAe,iBAAwC,EAAI,IACnG,EAAO,KAAK,IAEb,EAAE,EAAO,CACR,AAAI,GACJ,GAAc,EAAO,GAAG,SAAU,GAClC,EAAU,KAEX,EAAE,EAAO,CACR,EAAe,EAAO,GAAG,SAAU,GACnC,EAAU,IAEX,EAAE,EAAW,CACZ,EAAkB,EAAQ,KAK7B,YAA2B,EAAK,CAC/B,GAAI,GACA,EACA,EACA,EACA,EACA,EACA,EACA,EACA,EACA,EACA,EACA,EACA,EAAuB,EAAI,IAAM,GAAkB,GACjD,EAAmC,EAAI,IAAI,QAC3C,EAAe,GAAY,EAAuB,EAAiB,EAAI,IAAK,IAC9E,EAAwC,EAAI,IAAM,GAAkB,GACpE,EAAuB,EAAI,IAAM,GAAkB,GACnD,EAAqB,EAAI,IAAM,GAAgB,GAEnD,MAAO,CACN,GAAI,CACH,EAAO,EAAQ,OACf,EAAO,EAAQ,OACX,GAAW,EAAU,IACzB,EAAK,IACL,EAAO,EAAQ,OACf,EAAO,EAAQ,OACX,GAAc,EAAa,IAC/B,EAAK,IACD,GAAW,EAAU,IACzB,EAAK,IACD,GAAW,EAAU,IACzB,EAAK,IACD,GAAW,EAAU,IACzB,EAAK,EAAM,QAAS,8CACpB,GAAU,EAAM,YAAa,cAA2B,EAAI,GAAK,OACjE,GAAU,EAAM,sBAAsC,EAAI,GAAK,MAC/D,GAAU,EAAM,6BAAiD,EAAI,IACrE,EAAK,EAAM,QAAS,2CACpB,EAAK,EAAM,QAAS,gDACpB,EAAK,EAAM,QAAS,kDAErB,EAAE,EAAQ,EAAQ,CACjB,EAAO,EAAQ,EAAM,GACrB,EAAO,EAAM,GACT,GAAW,EAAU,EAAE,EAAM,MACjC,EAAO,EAAM,GACb,EAAO,EAAM,GACb,EAAO,EAAM,GAET,GACH,EAAa,EAAE,EAAM,MAGL,EAAI,IAAI,GACzB,EAAO,EAAM,GACT,GAAW,EAAU,EAAE,EAAM,MAChB,EAAI,IAAI,GACzB,EAAO,EAAM,GACT,GAAW,EAAU,EAAE,EAAM,MACjC,EAAO,EAAM,GACT,GAAW,EAAU,EAAE,EAAM,MACjC,EAAU,GAEL,GACJ,GAAU,CACT,GAAiB,EAAmB,GAAU,KAAK,KAAM,EAAM,CAC9D,kBAA0C,EAAI,OAE/C,GAAO,EAAM,aAAmC,EAAI,KACpD,GAAO,EAAM,YAAiC,EAAI,KAClD,GAAO,EAAM,WAA+B,EAAI,KAChD,GAAO,EAAM,cAAqC,EAAI,KACtD,GAAO,EAAM,wBAAyD,EAAI,KAC1E,GAAiB,GAAU,KAAK,KAAM,IACtC,GAAO,EAAM,UAA6B,EAAI,KAC9C,GAAiB,GAAS,KAAK,KAAM,IACrC,GAAO,EAAM,SAA2B,EAAI,MAG7C,EAAU,KAGZ,EAAE,EAAK,EAAO,CACb,AAAe,EAAI,GAClB,AAAI,EACH,GAAU,EAAE,EAAK,GAEb,EAAM,GAAgB,GACzB,EAAc,EAAW,IAG1B,GAAY,GAAkB,GAC9B,EAAU,IACV,EAAc,EAAW,GACzB,EAAU,EAAE,EAAM,IAET,GACV,MAEA,EAAe,EAAW,EAAG,EAAG,IAAM,CACrC,EAAY,OAGb,MAGG,GACC,EAAa,GAAM,EAAC,GAAW,EAAM,GAAkC,GAAK,EAAM,GAAiB,KACtG,GACC,EACA,EACA,EACY,EAAI,IAChB,AAAC,EAEC,GAAiB,EAAmC,EAAI,IAAK,EAAO,IADpE,GAAqC,EAAI,KAE3C,IAKC,EAAC,GAAW,EAAM,GAAgB,MACrC,GAAU,EAAM,YAAa,cAA2B,EAAI,GAAK,OAG9D,EAAC,GAAW,EAAM,GAAoB,MACzC,GAAU,EAAM,sBAAsC,EAAI,GAAK,MAG5D,EAAC,GAAW,EAAM,GAAwB,IAC7C,GAAU,EAAM,6BAAiD,EAAI,IAGlE,GAAoB,GAAY,EAAiB,SAAW,EAAM,GAAyB,MAAM,EAAiB,OAAO,KAAK,KAAM,CACvI,kBAA0C,EAAI,MAG/C,AAAgC,EAAI,GACnC,AAAI,EACH,GAAU,EAAE,EAAK,GAEb,EAAM,GAAiC,GAC1C,EAAc,EAAW,IAG1B,GAAY,GAAkB,GAC9B,EAAU,IACV,EAAc,EAAW,GACzB,EAAU,EAAE,EAAM,OAET,GACV,MAEA,EAAe,EAAW,EAAG,EAAG,IAAM,CACrC,EAAY,OAGb,MAGD,AAAe,EAAI,GAClB,AAAI,EACH,GAAU,EAAE,EAAK,GAEb,EAAM,GAAgB,GACzB,EAAc,EAAW,IAG1B,GAAY,GAAkB,GAC9B,EAAU,IACV,EAAc,EAAW,GACzB,EAAU,EAAE,EAAM,OAET,GACV,MAEA,EAAe,EAAW,EAAG,EAAG,IAAM,CACrC,EAAY,OAGb,MAGD,AAAa,EAAI,GAChB,AAAI,EACH,GAAU,EAAE,EAAK,GAEb,EAAM,GAAc,IACvB,EAAc,EAAW,IAG1B,GAAY,GAAgB,GAC5B,EAAU,IACV,EAAc,EAAW,GACzB,EAAU,EAAE,EAAM,OAET,GACV,MAEA,EAAe,EAAW,EAAG,EAAG,IAAM,CACrC,EAAY,OAGb,OAGF,EAAE,EAAO,CACR,AAAI,GACJ,GAAc,GACd,EAAc,EAAc,GAC5B,EAAc,GACd,EAAc,GACd,EAAc,GACd,EAAU,KAEX,EAAE,EAAO,CACR,EAAe,GACf,EAAe,EAAc,GAC7B,EAAe,GACf,EAAe,GACf,EAAe,GACf,EAAU,IAEX,EAAE,EAAW,CACZ,AAAI,GAAW,EAAO,GAClB,GAAW,EAAU,IACrB,GAAc,EAAa,EAAE,GAChB,EAAI,IAAI,MACrB,GAAW,EAAU,IACR,EAAI,IAAI,MACrB,GAAW,EAAU,IACrB,GAAW,EAAU,IACzB,EAAU,GACV,GAAQ,KAKX,YAAoB,EAAQ,EAAS,EAAc,CAClD,GAAI,CAAE,QAAS,EAAQ,GAAI,WAAY,EACnC,EAAS,GACT,EACA,EACA,EAAS,EACT,EAAa,EACb,EAAa,EAEX,CAAC,CAAE,OAAM,mBAAmB,EAAS,GAAW,GAAe,CAAC,EAAK,KAAU,CACpF,GAAS,CACR,iBAAoB,IAAM,EAAa,EAAG,EAAmB,IAC7D,cAAiB,IAAM,EAAa,EAAG,EAAgB,IACvD,OAAU,IAAM,EAAa,EAAG,EAAS,IACzC,WAAc,IAAM,EAAa,EAAG,EAAa,IACjD,WAAc,IAAM,EAAa,GAAI,EAAa,IAClD,OAAU,IAAM,EAAa,EAAG,EAAS,MACvC,KAGE,EAAW,KACb,CAAE,iBAAiB,eAAkB,EACrC,CAAE,SAAS,IAAS,EACpB,CAAE,WAAW,IAAS,EACtB,CAAE,mBAAmB,GAAM,EAC3B,CAAE,WAAW,KAAQ,EACrB,CAAE,WAAW,IAAU,EACvB,CAAE,mBAAmB,KAAS,EAC9B,CAAE,oBAAoB,IAAS,EAC/B,CAAE,eAAe,IAAU,EAC3B,CAAE,2BAA0B,IAAU,EACtC,CAAE,QAAO,IAAS,EAClB,CAAE,UAAU,IAAS,EACrB,CAAE,mBAAkB,GAAM,EAC1B,CAAE,qBAAoB,GAAM,EAEhC,kBAAoB,EAAW,GAAS,CACvC,GAAM,IAAW,GAAI,GAAS,WAAY,IAE1C,GAAI,MAAO,IAAc,SACxB,KAAM,IAAI,OAAM,gCAGjB,KAAM,GAAQ,SAAS,EAAW,CAAE,cAGrC,kBAAwB,EAAS,CAChC,GAAM,IAAW,GAAI,EAAS,WAAY,IAC1C,KAAM,GAAQ,aAAa,CAAE,cAG9B,kBAAwB,EAAS,CAChC,GAAM,IAAW,GAAI,EAAS,WAAY,IAC1C,KAAM,GAAQ,aAAa,CAAE,cAG9B,GAAI,IAAkB,EAClB,GACA,GAEE,GAAkC,GAAqB,CAAC,CAAE,WAAY,CAC3E,EAAa,GAAI,GAAkB,GACnC,EAAK,cAAgB,GAAkB,EAAK,gBAE5C,GAAmB,CAClB,2BAA4B,GAAmB,SAC/C,cAAe,EAAK,gBAGrB,EAAQ,WAAW,CAAE,SAAU,OAGhC,aAAqB,CACpB,GAAM,CAAE,iBAAgB,oBAAoB,GAAU,CACrD,gBAAiB,EAAK,gBACtB,gBAAiB,EAAK,gBACtB,2BAA4B,GAAmB,WAGhD,GAAY,CACX,sBACA,iBACA,qBAIF,GAAQ,IAAM,CACb,AAAC,UAAY,CACZ,KAAM,MAEF,IAAsB,IACzB,GAAK,4BAA8B,GAAmB,SAAS,OAC/D,KAAM,MACN,EAAK,UAAY,KAGjB,EAAK,eAAiB,GAAmB,SAAS,OAElD,EAAQ,SAAS,EAAkB,CAAE,SAAU,KAC/C,GAAgC,QAAQ,WAK3C,GAAU,IAAM,CACf,GAAgC,aAChC,EAAgB,UAGjB,kBAAgC,EAAW,CAC1C,KAAM,GAAQ,SAAS,EAAW,CAAE,SAAU,KAI/C,aAA4B,CAC3B,AAAI,CAAC,GACL,GAAK,WAAa,GAGnB,kBAA2C,EAAO,CACjD,AAAI,CAAC,GAEL,KAAM,IAAS,EACb,IAAO,EAAQ,cACf,IAAO,EAAQ,eACd,EAAM,OAAO,WAGjB,YAAyB,EAAO,CAC/B,AAAI,CAAC,GACL,GAAK,QAAU,EAAM,OAAO,IAG7B,aAA0B,CACzB,AAAI,CAAC,GACL,EAAQ,aAAa,EAAK,sBAG3B,mBAAmC,CAClC,AAAI,CAAC,GACL,KAAM,GAAQ,WAAW,CAAE,SAAU,KAGtC,YAAuB,EAAO,CAC7B,EAAK,QAAU,EAAM,OAAO,MAG7B,aAAwB,CACvB,EAAQ,gBAGT,aAAwB,CACvB,EAAQ,eAGT,GAAM,IAAqB,IAAM,GAAkB,EAEnD,YAAsB,EAAS,CAC9B,GAAkB,EAAU,UAAY,QAAQ,IAAM,CACrD,GAAqB,EACrB,EAAa,GAAI,MAInB,YAAsB,EAAS,CAC9B,GAAkB,EAAU,UAAY,QAAQ,IAAM,CACrD,GAAoB,EACpB,EAAa,GAAI,MAInB,GAAM,IAAqB,GAAS,GAAiB,EAAM,QAE3D,SAAO,MAAQ,GAAW,CACzB,AAAI,kBAAoB,IAAS,EAAa,EAAG,EAAiB,EAAQ,gBACtE,UAAY,IAAS,EAAa,EAAG,EAAS,EAAQ,QACtD,YAAc,IAAS,EAAa,EAAG,EAAW,EAAQ,UAC1D,oBAAsB,IAAS,EAAa,GAAI,EAAmB,EAAQ,kBAC3E,YAAc,IAAS,EAAa,GAAI,EAAW,EAAQ,UAC3D,YAAc,IAAS,EAAa,GAAI,EAAW,EAAQ,UAC3D,oBAAsB,IAAS,EAAa,GAAI,EAAmB,EAAQ,kBAC3E,qBAAuB,IAAS,EAAa,GAAI,EAAoB,EAAQ,mBAC7E,gBAAkB,IAAS,EAAa,GAAI,EAAe,EAAQ,cACnE,2BAA6B,IAAS,EAAa,EAAG,GAA0B,EAAQ,yBACxF,QAAU,IAAS,EAAa,EAAG,GAAO,EAAQ,MAClD,WAAa,IAAS,EAAa,GAAI,EAAU,EAAQ,SACzD,mBAAqB,IAAS,EAAa,GAAI,GAAkB,EAAQ,iBACzE,qBAAuB,IAAS,EAAa,GAAI,GAAoB,EAAQ,mBAC7E,WAAa,IAAS,EAAa,GAAI,EAAU,EAAQ,UAG9D,EAAO,GAAG,OAAS,IAAM,CACxB,AAAI,EAAO,GAAG,MAAM,GAA0B,IAE5C,EAAS,aAAc,GAIrB,EAAO,GAAG,MAAM,GAAkB,GAEpC,GAAK,SAAW,GAId,EAAO,GAAG,MAAM,GAAkB,UAEpC,GAAK,eAAiB,GAIpB,EAAO,GAAG,MAAM,GAAkB,UAEpC,GAAK,SAAW,GAId,EAAO,GAAG,MAAM,GAA0B,WAE5C,GAAK,iBAAmB,GAItB,EAAO,GAAG,MAAM,GAA2B,WAE7C,GAAK,kBAAoB,GAIvB,EAAO,GAAG,MAAM,GAAsB,WAExC,GAAK,aAAe,GAIlB,EAAO,GAAG,MAAM,GAAyB,GAE3C,GAAK,oBAAsB,IAIzB,EAAO,GAAG,MAAM,GAA2B,GAE7C,GAAK,sBAAwB,KAKzB,CACN,EACA,EACA,EACA,GACA,GACA,EACA,EACA,EACA,EACA,EACA,EACA,GACA,GACA,GACA,EACA,GACA,GACA,GACA,GACA,GACA,GACA,GACA,GACA,GACA,EACA,EACA,EACA,EACA,EACA,EACA,EACA,GACA,GACA,GACA,GACA,GACA,EACA,EACA,GACA,GACA,GACA,IAIF,oBAAuB,EAAgB,CACtC,YAAY,EAAS,CACpB,QAEA,EACC,KACA,EACA,GACA,GACA,EACA,CACC,eAAgB,EAChB,OAAQ,EACR,SAAU,EACV,iBAAkB,GAClB,SAAU,GACV,SAAU,GACV,iBAAkB,GAClB,kBAAmB,GACnB,aAAc,GACd,wBAAyB,EACzB,KAAM,EACN,QAAS,GACT,gBAAiB,GACjB,kBAAmB,GACnB,KAAM,GACN,SAAU,GACV,SAAU,IAEX,GACA,CAAC,GAAI,QAIH,OAAO,CACV,MAAO,MAAK,GAAG,IAAI,OAGhB,WAAW,CACd,MAAO,MAAK,GAAG,IAAI,OAGhB,WAAW,CACd,MAAO,MAAK,GAAG,IAAI,MAId,GAAQ,GCxtNf,YAAyB,EAAK,CAC7B,GAAI,GACA,EACA,EACA,EACA,EACA,EACA,EACA,EACA,EACA,EACA,EACA,EACA,EACA,EACA,EACA,EACA,EACA,EACA,EACA,EACA,EACA,EACA,EACA,EACA,GACA,GAEJ,MAAO,CACN,GAAI,CACH,EAAO,EAAQ,OACf,EAAO,EAAQ,OACf,EAAO,EAAQ,OACf,EAAO,EAAQ,OACf,EAAK,EAAQ,MACb,EAAG,YAAc,IACjB,EAAK,IACL,EAAK,EAAQ,KACb,EAAK,GAAc,EAAI,IACvB,EAAK,IACL,EAAO,EAAQ,OACf,EAAO,EAAQ,OACf,EAAK,IACL,EAAO,EAAQ,OACf,EAAK,EAAQ,MACb,EAAK,GAAsB,EAAI,IAC/B,EAAK,IACL,EAAK,EAAQ,KACb,EAAK,EAAQ,KACb,EAAO,EAAQ,OACf,EAAK,IACL,EAAK,EAAQ,KACb,GAAK,GAAwB,EAAI,IACjC,EAAK,EAAI,QAAS,kCAClB,EAAK,EAAI,QAAS,eAClB,EAAK,EAAM,QAAS,uEACf,GAAc,EAAK,IAAK,EAAyC,EAAI,KAAK,EAAK,EAAM,MAAO,GACjG,EAAK,EAAM,MAAO,YAClB,EAAK,EAAM,QAAS,+BACpB,EAAK,EAAM,QAAS,2EACpB,EAAK,EAAI,QAAS,4BACb,GAAc,EAAK,IAAK,EAAiB,gBAAgB,EAAK,EAAM,MAAO,GAChF,EAAK,EAAM,SAAU,MACrB,EAAK,EAAM,QAAS,MACpB,EAAK,EAAM,MAAO,aAClB,EAAK,EAAI,OAAQ,EAAgB,6BAAkD,EAAI,IACvF,GAAU,EAAI,iBAAkB,OAChC,EAAK,EAAI,SAAU,UACnB,EAAK,EAAI,QAAS,kBAClB,EAAK,EAAI,OAAQ,GAAgB,6BAAkD,EAAI,IACvF,EAAK,EAAI,QAAS,mCAClB,EAAK,EAAI,QAAS,4BAClB,EAAK,EAAM,QAAS,wFACpB,EAAK,EAAM,QAAS,iFACpB,EAAK,EAAM,QAAS,6EAErB,EAAE,EAAQ,GAAQ,CACjB,EAAO,EAAQ,EAAM,IACrB,EAAO,EAAM,GACb,EAAO,EAAM,GACb,EAAO,EAAM,GACb,EAAO,EAAM,GACb,EAAO,EAAM,GACb,EAAO,EAAM,GACb,EAAO,EAAI,GACX,EAAO,EAAM,GACb,EAAO,EAAM,GACb,EAAO,EAAM,GACb,EAAO,EAAM,GACb,EAAO,EAAM,GACb,EAAO,EAAM,GACb,EAAO,EAAI,GACX,EAAO,EAAM,GACb,EAAO,EAAM,GACb,EAAO,EAAI,GACX,EAAO,EAAI,GACX,EAAO,EAAI,GACX,EAAO,EAAI,GACX,EAAO,EAAI,KAEZ,EAAE,EAAK,CAAC,IAAQ,CACf,AAAI,GAAiB,GAAG,GAAS,EAAa,EAAI,IAE9C,GAAgC,GAAK,CAAC,GAAc,EAAK,IAAK,EAAyC,EAAI,KAC9G,EAAK,EAAM,MAAO,GAGf,GAAyB,GAAG,GAAS,EAAqB,EAAI,IAE9D,GAA2B,GAAK,IAAmB,GAAgB,6BAAkD,EAAI,KAC5H,EAAK,EAAI,OAAQ,GAGd,GAA2B,GAAG,GAAS,GAAuB,EAAI,IAElE,GAA2B,GAAK,KAAmB,IAAgB,6BAAkD,EAAI,KAC5H,EAAK,EAAI,OAAQ,KAGnB,EAAG,EACH,EAAG,EACH,EAAE,EAAW,CACZ,AAAI,GAAW,EAAO,KAKzB,YAAkB,EAAQ,EAAS,EAAc,CAChD,GAAI,CAAE,QAAS,EACX,CAAE,gBAAiB,EACnB,CAAE,kBAAmB,EACrB,CAAE,uBAAwB,EAE9B,SAAO,MAAQ,GAAW,CACzB,AAAI,QAAU,IAAS,EAAa,EAAG,EAAO,EAAQ,MAClD,gBAAkB,IAAS,EAAa,EAAG,EAAe,EAAQ,cAClE,kBAAoB,IAAS,EAAa,EAAG,EAAiB,EAAQ,gBACtE,uBAAyB,IAAS,EAAa,EAAG,EAAsB,EAAQ,sBAG9E,CAAC,EAAM,EAAc,EAAgB,GAG7C,oBAA0B,EAAgB,CACzC,YAAY,EAAS,CACpB,QAEA,EAAK,KAAM,EAAS,GAAU,GAAiB,EAAgB,CAC9D,KAAM,EACN,aAAc,EACd,eAAgB,EAChB,oBAAqB,MAKjB,GAAQ,GCxJf,YAA6B,EAAK,CACjC,GAAI,GACA,EACA,EACA,EACA,EACA,EACA,EACA,EACA,EACA,EACA,EACA,EACA,EACA,EACA,EACA,EACA,EACA,EAEJ,SAAe,GAAI,IAAY,CAC7B,MAAO,CACN,KAAM,0JACN,aAAc,SACd,eAAgB,cAChB,oBAAqB,gCAIxB,EAAe,GAAI,IAAY,CAC7B,MAAO,CACN,KAAM,kBACN,aAAc,aACd,eAAgB,uBAChB,oBAAqB,oCAIxB,EAAe,GAAI,IAAY,CAC7B,MAAO,CACN,KAAM,uIACN,aAAc,UACd,eAAgB,oBAChB,oBAAqB,iCAIxB,EAAe,GAAI,IAAY,CAC7B,MAAO,CACN,KAAM,sHACN,aAAc,SACd,eAAgB,eAChB,oBAAqB,gCAIxB,EAAe,GAAI,IAAY,CAC7B,MAAO,CACN,KAAM,kIACN,aAAc,cACd,eAAgB,sBAChB,oBAAqB,4CAIxB,EAAe,GAAI,IAAY,CAC7B,MAAO,CACN,KAAM,mEACN,aAAc,UACd,eAAgB,iBAChB,oBAAqB,iCAIxB,EAAe,GAAI,IAAY,CAC7B,MAAO,CACN,KAAM,yDACN,aAAc,eACd,eAAgB,gBAChB,oBAAqB,oCAIxB,EAAe,GAAI,IAAY,CAC7B,MAAO,CACN,KAAM,+BACN,aAAc,cACd,eAAgB,iBAChB,oBAAqB,qCAIxB,EAAe,GAAI,IAAY,CAC7B,MAAO,CACN,KAAM,+IACN,aAAc,kBACd,eAAgB,oBAChB,oBAAqB,uCAIjB,CACN,GAAI,CACH,EAAiB,EAAa,GAAG,UACjC,EAAK,IACL,EAAiB,EAAa,GAAG,UACjC,EAAK,IACL,EAAiB,EAAa,GAAG,UACjC,EAAK,IACL,EAAiB,EAAa,GAAG,UACjC,EAAK,IACL,EAAiB,EAAa,GAAG,UACjC,EAAK,IACL,EAAiB,EAAa,GAAG,UACjC,EAAK,IACL,EAAiB,EAAa,GAAG,UACjC,EAAK,IACL,EAAiB,EAAa,GAAG,UACjC,EAAK,IACL,EAAiB,EAAa,GAAG,WAElC,EAAE,EAAQ,EAAQ,CACjB,EAAgB,EAAc,EAAQ,GACtC,EAAO,EAAQ,EAAI,GACnB,EAAgB,EAAc,EAAQ,GACtC,EAAO,EAAQ,EAAI,GACnB,EAAgB,EAAc,EAAQ,GACtC,EAAO,EAAQ,EAAI,GACnB,EAAgB,EAAc,EAAQ,GACtC,EAAO,EAAQ,EAAI,GACnB,EAAgB,EAAc,EAAQ,GACtC,EAAO,EAAQ,EAAI,GACnB,EAAgB,EAAc,EAAQ,GACtC,EAAO,EAAQ,EAAI,GACnB,EAAgB,EAAc,EAAQ,GACtC,EAAO,EAAQ,EAAI,GACnB,EAAgB,EAAc,EAAQ,GACtC,EAAO,EAAQ,EAAI,GACnB,EAAgB,EAAc,EAAQ,GACtC,EAAU,IAEX,EAAG,EACH,EAAE,EAAO,CACR,AAAI,GACJ,GAAc,EAAa,GAAG,SAAU,GACxC,EAAc,EAAa,GAAG,SAAU,GACxC,EAAc,EAAa,GAAG,SAAU,GACxC,EAAc,EAAa,GAAG,SAAU,GACxC,EAAc,EAAa,GAAG,SAAU,GACxC,EAAc,EAAa,GAAG,SAAU,GACxC,EAAc,EAAa,GAAG,SAAU,GACxC,EAAc,EAAa,GAAG,SAAU,GACxC,EAAc,EAAa,GAAG,SAAU,GACxC,EAAU,KAEX,EAAE,EAAO,CACR,EAAe,EAAa,GAAG,SAAU,GACzC,EAAe,EAAa,GAAG,SAAU,GACzC,EAAe,EAAa,GAAG,SAAU,GACzC,EAAe,EAAa,GAAG,SAAU,GACzC,EAAe,EAAa,GAAG,SAAU,GACzC,EAAe,EAAa,GAAG,SAAU,GACzC,EAAe,EAAa,GAAG,SAAU,GACzC,EAAe,EAAa,GAAG,SAAU,GACzC,EAAe,EAAa,GAAG,SAAU,GACzC,EAAU,IAEX,EAAE,EAAW,CACZ,EAAkB,EAAc,GAC5B,GAAW,EAAO,GACtB,EAAkB,EAAc,GAC5B,GAAW,EAAO,GACtB,EAAkB,EAAc,GAC5B,GAAW,EAAO,GACtB,EAAkB,EAAc,GAC5B,GAAW,EAAO,GACtB,EAAkB,EAAc,GAC5B,GAAW,EAAO,GACtB,EAAkB,EAAc,GAC5B,GAAW,EAAO,GACtB,EAAkB,EAAc,GAC5B,GAAW,EAAO,GACtB,EAAkB,EAAc,GAC5B,GAAW,EAAO,GACtB,EAAkB,EAAc,KAKnC,YAAyB,EAAK,CAC7B,GAAI,GACA,EACA,EACA,EAEJ,SAAW,GAAI,IAAS,CACtB,MAAO,CACN,QAAS,CAAE,QAAS,CAAC,KACrB,QAAS,CAAE,UAIP,CACN,GAAI,CACH,EAAO,EAAQ,OACf,EAAO,EAAQ,OACf,EAAiB,EAAS,GAAG,UAC7B,EAAK,EAAM,QAAS,qCACpB,EAAK,EAAM,QAAS,wCAErB,EAAE,EAAQ,EAAQ,CACjB,EAAO,EAAQ,EAAM,GACrB,EAAO,EAAM,GACb,EAAgB,EAAU,EAAM,MAChC,EAAU,IAEX,EAAE,EAAK,CAAC,GAAQ,CACf,GAAM,GAAmB,GAEzB,AAAI,EAAoB,GACvB,GAAiB,QAAU,CAAE,QAAO,QAGrC,EAAS,KAAK,IAEf,EAAE,EAAO,CACR,AAAI,GACJ,GAAc,EAAS,GAAG,SAAU,GACpC,EAAU,KAEX,EAAE,EAAO,CACR,EAAe,EAAS,GAAG,SAAU,GACrC,EAAU,IAEX,EAAE,EAAW,CACZ,AAAI,GAAW,EAAO,GACtB,EAAkB,KAKrB,oBAAkC,EAAgB,CACjD,YAAY,EAAS,CACpB,QACA,EAAK,KAAM,EAAS,KAAM,GAAiB,EAAgB,MAItD,GAAQ,GClPf,YAAyB,EAAK,CAC7B,GAAI,GACA,EACA,EACA,EACA,EACA,EACA,EACA,EACA,EACA,EACA,EACA,EACA,EACA,EACA,EACA,EACA,EACA,EACA,EACA,EACA,EACA,EACJ,SAAS,GAAI,IAAO,IACpB,EAAO,GAAI,IAAK,IAChB,EAAW,GAAI,IAAS,IACxB,EAAQ,GAAI,IAAM,IAClB,EAAc,GAAI,IAAY,IAC9B,EAAS,GAAI,IAAO,IACpB,EAAS,GAAI,IAAO,IACpB,EAAsB,GAAI,IAAoB,IAC9C,EAAM,GAAI,IAAI,IACd,EAAY,GAAI,IAAU,IAC1B,EAAS,GAAI,IAAO,IAEb,CACN,GAAI,CACH,EAAiB,EAAO,GAAG,UAC3B,EAAK,IACL,EAAiB,EAAK,GAAG,UACzB,EAAK,IACL,EAAiB,EAAS,GAAG,UAC7B,EAAK,IACL,EAAiB,EAAM,GAAG,UAC1B,EAAK,IACL,EAAiB,EAAY,GAAG,UAChC,EAAK,IACL,EAAiB,EAAO,GAAG,UAC3B,EAAK,IACL,EAAiB,EAAO,GAAG,UAC3B,EAAK,IACL,EAAiB,EAAoB,GAAG,UACxC,EAAK,IACL,EAAiB,EAAI,GAAG,UACxB,EAAK,IACL,EAAiB,EAAU,GAAG,UAC9B,EAAK,IACL,EAAiB,EAAO,GAAG,WAE5B,EAAE,EAAQ,EAAQ,CACjB,EAAgB,EAAQ,EAAQ,GAChC,EAAO,EAAQ,EAAI,GACnB,EAAgB,EAAM,EAAQ,GAC9B,EAAO,EAAQ,EAAI,GACnB,EAAgB,EAAU,EAAQ,GAClC,EAAO,EAAQ,EAAI,GACnB,EAAgB,EAAO,EAAQ,GAC/B,EAAO,EAAQ,EAAI,GACnB,EAAgB,EAAa,EAAQ,GACrC,EAAO,EAAQ,EAAI,GACnB,EAAgB,EAAQ,EAAQ,GAChC,EAAO,EAAQ,EAAI,GACnB,EAAgB,EAAQ,EAAQ,GAChC,EAAO,EAAQ,EAAI,GACnB,EAAgB,EAAqB,EAAQ,GAC7C,EAAO,EAAQ,EAAI,GACnB,EAAgB,EAAK,EAAQ,GAC7B,EAAO,EAAQ,EAAI,GACnB,EAAgB,EAAW,EAAQ,GACnC,EAAO,EAAQ,EAAI,GACnB,EAAgB,EAAQ,EAAQ,GAChC,EAAU,IAEX,EAAG,EACH,EAAE,EAAO,CACR,AAAI,GACJ,GAAc,EAAO,GAAG,SAAU,GAClC,EAAc,EAAK,GAAG,SAAU,GAChC,EAAc,EAAS,GAAG,SAAU,GACpC,EAAc,EAAM,GAAG,SAAU,GACjC,EAAc,EAAY,GAAG,SAAU,GACvC,EAAc,EAAO,GAAG,SAAU,GAClC,EAAc,EAAO,GAAG,SAAU,GAClC,EAAc,EAAoB,GAAG,SAAU,GAC/C,EAAc,EAAI,GAAG,SAAU,GAC/B,EAAc,EAAU,GAAG,SAAU,GACrC,EAAc,EAAO,GAAG,SAAU,GAClC,EAAU,KAEX,EAAE,EAAO,CACR,EAAe,EAAO,GAAG,SAAU,GACnC,EAAe,EAAK,GAAG,SAAU,GACjC,EAAe,EAAS,GAAG,SAAU,GACrC,EAAe,EAAM,GAAG,SAAU,GAClC,EAAe,EAAY,GAAG,SAAU,GACxC,EAAe,EAAO,GAAG,SAAU,GACnC,EAAe,EAAO,GAAG,SAAU,GACnC,EAAe,EAAoB,GAAG,SAAU,GAChD,EAAe,EAAI,GAAG,SAAU,GAChC,EAAe,EAAU,GAAG,SAAU,GACtC,EAAe,EAAO,GAAG,SAAU,GACnC,EAAU,IAEX,EAAE,EAAW,CACZ,EAAkB,EAAQ,GACtB,GAAW,EAAO,GACtB,EAAkB,EAAM,GACpB,GAAW,EAAO,GACtB,EAAkB,EAAU,GACxB,GAAW,EAAO,GACtB,EAAkB,EAAO,GACrB,GAAW,EAAO,GACtB,EAAkB,EAAa,GAC3B,GAAW,EAAO,GACtB,EAAkB,EAAQ,GACtB,GAAW,EAAO,GACtB,EAAkB,EAAQ,GACtB,GAAW,EAAO,GACtB,EAAkB,EAAqB,GACnC,GAAW,EAAO,GACtB,EAAkB,EAAK,GACnB,GAAW,EAAO,GACtB,EAAkB,EAAW,GACzB,GAAW,EAAO,GACtB,EAAkB,EAAQ,KAK7B,oBAAoB,EAAgB,CACnC,YAAY,EAAS,CACpB,QACA,EAAK,KAAM,EAAS,KAAM,GAAiB,EAAgB,MAItD,GAAQ,GC/Kf,GAAI,IACJ,AAAC,UAAU,EAAkB,CACzB,EAAiB,OAAY,SAC7B,EAAiB,MAAW,UAC7B,IAAqB,IAAmB,KAE3C,GAAI,IACJ,AAAC,UAAU,EAAmB,CAC1B,EAAkB,KAAU,OAC5B,EAAkB,MAAW,UAC9B,IAAsB,IAAoB,KAE7C,GAAI,IACJ,AAAC,UAAU,EAAe,CACtB,EAAc,EAAc,OAAY,GAAK,SAC7C,EAAc,EAAc,QAAa,GAAK,YAC/C,IAAkB,IAAgB,KAErC,GAAI,IACJ,AAAC,UAAU,EAAwB,CAC/B,EAAuB,SAAc,WACrC,EAAuB,SAAc,WACrC,EAAuB,QAAa,YACrC,IAA2B,IAAyB,KAEvD,YAAkB,CACd,YAAY,EAAS,CACjB,KAAK,OAAS,EAAQ,QAAU,MAChC,KAAK,SAAW,EAAQ,UAAY,YACpC,KAAK,KAAO,EAAQ,KACpB,KAAK,MAAQ,EAAQ,OAAS,GAC9B,KAAK,QAAU,EAAQ,SAAW,GAClC,KAAK,KAAO,EAAQ,KACpB,KAAK,SAAW,EAAQ,SAClB,EAAQ,SAAS,MAAM,MAAQ,IAC3B,GAAG,EAAQ,YACX,EAAQ,SACZ,SACN,KAAK,KAAO,EAAQ,KAAQ,EAAQ,KAAK,OAAO,KAAO,IAAM,IAAI,EAAQ,OAAS,EAAQ,KAAQ,IAClG,KAAK,SAAW,EAAQ,SACxB,KAAK,SAAW,EAAQ,SACxB,KAAK,SAAW,EAAQ,eAErB,YAAW,EAAS,CACvB,GAAI,CAAC,EACD,MAAO,GACX,GAAM,GAAM,EACZ,MAAQ,UAAY,IAChB,YAAc,IACd,YAAc,IACd,QAAU,IACV,MAAO,GAAI,OAAa,UACxB,MAAO,GAAI,SAAe,SAElC,OAAQ,CACJ,GAAM,GAAS,GAAI,IAAY,IACxB,KACH,QAAS,IAAK,KAAK,WAEvB,MAAI,GAAO,OACP,GAAO,MAAQ,GAAW,EAAO,QAC9B,IAGf,YAAoB,EAAO,CACvB,MAAO,QAAO,KAAK,GAAO,OAAO,CAAC,EAAO,IAAc,CACnD,GAAM,GAAQ,EAAM,GACpB,MAAO,IACA,GACF,GAAY,MAAM,QAAQ,GAAS,CAAC,GAAG,GAAS,IAEtD,IAGP,GAAM,IAAe,GACf,GAAe,GACrB,OAAS,GAAI,EAAG,EAAI,IAAK,IAAK,CAC1B,GAAI,GAAc,EAAE,SAAS,IAAI,cACjC,AAAI,EAAY,SAAW,GACvB,GAAc,IAAI,KAEtB,GAAa,GAAK,EAClB,GAAa,GAAe,EAEhC,YAAiB,EAAS,CACtB,GAAI,EAAQ,OAAS,GAAM,EACvB,KAAM,IAAI,OAAM,uDAEpB,GAAM,GAAM,GAAI,YAAW,EAAQ,OAAS,GAC5C,OAAS,GAAI,EAAG,EAAI,EAAQ,OAAQ,GAAK,EAAG,CACxC,GAAM,GAAc,EAAQ,MAAM,EAAG,EAAI,GAAG,cAC5C,GAAI,IAAe,IACf,EAAI,EAAI,GAAK,GAAa,OAG1B,MAAM,IAAI,OAAM,uCAAuC,oBAG/D,MAAO,GAEX,YAAe,EAAO,CAClB,GAAI,GAAM,GACV,OAAS,GAAI,EAAG,EAAI,EAAM,WAAY,IAClC,GAAO,GAAa,EAAM,IAE9B,MAAO,GAGX,GAAM,IAAW,AAAC,GAAU,GAAI,eAAc,OAAO,GAE/C,GAAS,AAAC,GAAU,GAAI,aAAY,SAAS,OAAO,GAEpD,GAAiB,IAAM,CACzB,GAAI,GAAkB,GAClB,EAAkB,GAChB,EAAiB,GAAI,KACrB,EAAO,AAAC,GAAY,EAAQ,KAAK,CAAC,EAAG,IAAM,GAAY,EAAE,MAAQ,GAAY,EAAE,OACjF,GAAgB,EAAE,UAAY,UAAY,GAAgB,EAAE,UAAY,WACtE,EAAe,AAAC,GAAa,CAC/B,GAAI,GAAY,GACV,EAAW,AAAC,GACV,EAAM,MAAQ,EAAM,OAAS,EAC7B,GAAY,GACZ,EAAe,OAAO,GACf,IAEJ,GAEX,SAAkB,EAAgB,OAAO,GACzC,EAAkB,EAAgB,OAAO,GAClC,GAEL,EAAoB,AAAC,GAAa,CACpC,GAAI,GAAY,GACV,EAAW,AAAC,GACV,EAAM,aAAe,EACrB,GAAY,GACR,EAAM,MACN,EAAe,OAAO,EAAM,MACzB,IAEJ,GAEX,SAAkB,EAAgB,OAAO,GACzC,EAAkB,EAAgB,OAAO,GAClC,GAEL,EAAU,AAAC,GACb,GAAgB,QAAQ,AAAC,GAAU,CAC/B,EAAQ,IAAI,EAAM,WAAY,IAAK,MAEvC,EAAgB,QAAQ,AAAC,GAAU,CAC/B,EAAQ,cAAc,EAAM,WAAY,IAAK,MAE1C,GAEL,EAA+B,AAAC,GAAS,CAC3C,GAAM,GAAyB,GAC/B,SAAK,OAAO,QAAQ,AAAC,GAAU,CAC3B,AAAI,EAAM,OAAO,SAAW,GAAK,EAAM,MAAM,SAAW,EACpD,EAAuB,KAAK,GAG5B,EAAuB,KAAK,GAAG,EAA6B,MAGpE,EAAuB,KAAK,GAC5B,EAAK,MAAM,UAAU,QAAQ,AAAC,GAAU,CACpC,AAAI,EAAM,OAAO,SAAW,GAAK,EAAM,MAAM,SAAW,EACpD,EAAuB,KAAK,GAG5B,EAAuB,KAAK,GAAG,EAA6B,MAG7D,GAEL,EAAoB,CAAC,EAAQ,KAAU,CACzC,GAAM,GAA4B,GAC5B,EAA4B,GAC5B,EAA2B,GACjC,SAAgB,QAAQ,AAAC,GAAU,CAC/B,GAAM,GAAkB,IACjB,EACH,OAAQ,GACR,MAAO,IAEX,AAAI,EAAgB,MAChB,GAAyB,EAAgB,MAAQ,GACrD,EAA0B,KAAK,KAEnC,EAAgB,QAAQ,AAAC,GAAU,CAC/B,GAAM,GAAkB,IACjB,EACH,OAAQ,GACR,MAAO,IAEX,AAAI,EAAgB,MAChB,GAAyB,EAAgB,MAAQ,GACrD,EAA0B,KAAK,KAEnC,EAA0B,QAAQ,AAAC,GAAU,CACzC,GAAI,EAAM,aAAc,CACpB,GAAM,GAAe,EAAyB,EAAM,cACpD,GAAI,IAAiB,OAAW,CAC5B,GAAI,EACA,OAEJ,KAAM,IAAI,OAAM,GAAG,EAAM,yCAAyC,EAAM,MAAQ,0BAA0B,EAAM,YAAY,EAAM,gBAEtI,AAAI,EAAM,WAAa,SACnB,EAAa,MAAM,KAAK,GAExB,EAAM,WAAa,UACnB,EAAa,OAAO,KAAK,MAInB,EAAK,GAClB,IAAI,GACJ,OAAO,CAAC,EAAW,IACpB,GAAU,KAAK,GAAG,GACX,GACR,KAGD,EAAQ,CACV,IAAK,CAAC,EAAY,EAAU,KAAO,CAC/B,GAAM,CAAE,OAAM,YAAa,EACrB,EAAQ,CACV,KAAM,aACN,SAAU,SACV,gBACG,GAEP,GAAI,EAAM,CACN,GAAI,EAAe,IAAI,GAAO,CAC1B,GAAI,CAAC,EACD,KAAM,IAAI,OAAM,8BAA8B,MAClD,GAAM,GAAkB,EAAgB,UAAU,AAAC,GAAU,EAAM,OAAS,GACtE,EAAa,EAAgB,GACnC,GAAI,EAAW,OAAS,EAAM,MAAQ,EAAW,WAAa,EAAM,SAChE,KAAM,IAAI,OAAM,IAAI,sBAAyB,EAAW,wBAAwB,EAAW,+DAC5C,EAAM,wBAAwB,EAAM,cAEvF,EAAgB,OAAO,EAAiB,GAE5C,EAAe,IAAI,GAEvB,EAAgB,KAAK,IAEzB,cAAe,CAAC,EAAY,IAAY,CACpC,GAAM,CAAE,OAAM,YAAa,EACrB,EAAQ,CACV,gBACG,GAEP,GAAI,EAAM,CACN,GAAI,EAAe,IAAI,GAAO,CAC1B,GAAI,CAAC,EACD,KAAM,IAAI,OAAM,8BAA8B,MAClD,GAAM,GAAkB,EAAgB,UAAU,AAAC,GAAU,EAAM,OAAS,GACtE,EAAa,EAAgB,GACnC,GAAI,EAAW,eAAiB,EAAM,cAAgB,EAAW,WAAa,EAAM,SAChF,KAAM,IAAI,OAAM,IAAI,iBAAoB,EAAW,aAAa,EAAW,yEAC5C,EAAM,aAAa,EAAM,6BAE5D,EAAgB,OAAO,EAAiB,GAE5C,EAAe,IAAI,GAEvB,EAAgB,KAAK,IAEzB,MAAO,IAAM,EAAQ,MACrB,IAAK,AAAC,GAAW,CACb,EAAO,aAAa,IAExB,OAAQ,AAAC,GACD,MAAO,IAAa,SACb,EAAa,GAEb,EAAkB,GAEjC,YAAa,AAAC,GAAa,CACvB,GAAI,GAAY,GACV,EAAW,AAAC,GAAU,CACxB,GAAM,CAAE,OAAM,QAAS,EACvB,MAAI,IAAQ,EAAK,SAAS,GAClB,IACA,EAAe,OAAO,GAC1B,EAAY,GACL,IAEJ,IAEX,SAAkB,EAAgB,OAAO,GACzC,EAAkB,EAAgB,OAAO,GAClC,GAEX,OAAQ,AAAC,GAAS,CACd,GAAM,GAAS,EAAQ,MACvB,SAAO,IAAI,GACJ,GAEX,aAAc,EACd,SAAU,IACC,EAAkB,IAAM,IAAI,AAAC,GACzB,EAAG,KAAO,KAAQ,GAAG,MAAQ,IAAI,KAAK,MAGrD,QAAS,CAAC,EAAS,IAAY,CAC3B,OAAW,KAAc,KACpB,IAAI,AAAC,GAAU,EAAM,YACrB,UACD,EAAU,EAAW,EAAS,GAElC,MAAO,KAGf,MAAO,IAEL,GAAc,CAChB,WAAY,EACZ,UAAW,EACX,MAAO,EACP,gBAAiB,EACjB,YAAa,GAEX,GAAkB,CACpB,KAAM,EACN,OAAQ,EACR,IAAK,GAGH,GAAqB,GACrB,GAAkB,GAAI,OAAM,IAClC,OAAS,GAAI,EAAG,EAAQ,IAAI,WAAW,GAAI,EAAQ,IAAI,WAAW,GAAI,EAAI,GAAS,EAAO,IAAK,CAC3F,GAAM,GAAO,OAAO,aAAa,EAAI,GACrC,GAAmB,GAAQ,EAC3B,GAAgB,GAAK,EAEzB,OAAS,GAAI,EAAG,EAAQ,IAAI,WAAW,GAAI,EAAQ,IAAI,WAAW,GAAI,EAAI,GAAS,EAAO,IAAK,CAC3F,GAAM,GAAO,OAAO,aAAa,EAAI,GAC/B,EAAQ,EAAI,GAClB,GAAmB,GAAQ,EAC3B,GAAgB,GAAS,EAE7B,OAAS,GAAI,EAAG,EAAI,GAAI,IAAK,CACzB,GAAmB,EAAE,SAAS,KAAO,EAAI,GACzC,GAAM,GAAO,EAAE,SAAS,IAClB,EAAQ,EAAI,GAClB,GAAmB,GAAQ,EAC3B,GAAgB,GAAS,EAE7B,GAAmB,KAAO,GAC1B,GAAgB,IAAM,IACtB,GAAmB,KAAO,GAC1B,GAAgB,IAAM,IACtB,GAAM,IAAgB,EAChB,GAAc,EACd,GAAiB,GAEjB,GAAa,AAAC,GAAU,CAC1B,GAAI,GAAmB,EAAM,OAAS,EAAK,EAC3C,AAAI,EAAM,MAAM,MAAQ,KACpB,GAAmB,EAEd,EAAM,MAAM,MAAQ,KACzB,IAEJ,GAAM,GAAM,GAAI,aAAY,GACtB,EAAW,GAAI,UAAS,GAC9B,OAAS,GAAI,EAAG,EAAI,EAAM,OAAQ,GAAK,EAAG,CACtC,GAAI,GAAO,EACP,EAAY,EAChB,OAAS,GAAI,EAAG,EAAQ,EAAI,EAAG,GAAK,EAAO,IACvC,GAAI,EAAM,KAAO,IAAK,CAClB,GAAI,CAAE,GAAM,IAAM,KACd,KAAM,IAAI,WAAU,qBAAqB,EAAM,wBAEnD,GAAQ,GAAmB,EAAM,KAAS,GAAQ,GAAK,GACvD,GAAa,OAGb,KAAS,GAGjB,GAAM,GAAe,EAAI,EAAK,EAC9B,IAAS,EAAY,GACrB,GAAM,GAAa,KAAK,MAAM,EAAY,IAC1C,OAAS,GAAI,EAAG,EAAI,EAAY,IAAK,CACjC,GAAM,GAAU,GAAa,EAAI,GAAK,GACtC,EAAS,SAAS,EAAc,EAAI,GAAQ,KAAO,IAAY,IAGvE,MAAO,IAAI,YAAW,IAG1B,YAAkB,EAAO,CACrB,GAAI,GAAM,GACV,OAAS,GAAI,EAAG,EAAI,EAAM,OAAQ,GAAK,EAAG,CACtC,GAAI,GAAO,EACP,EAAY,EAChB,OAAS,GAAI,EAAG,EAAQ,KAAK,IAAI,EAAI,EAAG,EAAM,QAAS,EAAI,EAAO,IAC9D,GAAQ,EAAM,IAAQ,GAAQ,EAAI,GAAK,GACvC,GAAa,GAEjB,GAAM,GAAkB,KAAK,KAAK,EAAY,IAC9C,IAAS,EAAkB,GAAgB,EAC3C,OAAS,GAAI,EAAG,GAAK,EAAiB,IAAK,CACvC,GAAM,GAAU,GAAkB,GAAK,GACvC,GAAO,GAAiB,GAAQ,IAAkB,IAAY,GAElE,GAAO,KAAK,MAAM,EAAG,EAAI,GAE7B,MAAO,GAGX,GAAM,IAAgB,UAAY,CAC9B,GAAM,GAAQ,OAAO,eAAe,MAAM,YACpC,EAAc,SAAS,KAAK,MAAM,OAAQ,CAAC,KAAM,GAAG,YACpD,EAAW,GAAI,GACrB,cAAO,eAAe,EAAU,EAAM,WAC/B,GAEX,GAAc,UAAY,OAAO,OAAO,OAAO,UAAW,CACtD,YAAa,CACT,MAAO,GACP,WAAY,GACZ,SAAU,GACV,aAAc,MAGtB,OAAO,eAAe,GAAe,QC9arC,GAAI,IACA,GAAQ,GAAI,YAAW,IAC3B,aAAe,CAEb,GAAI,CAAC,IAGH,IAAkB,MAAO,SAAW,aAAe,OAAO,iBAAmB,OAAO,gBAAgB,KAAK,SAAW,MAAO,WAAa,aAAe,MAAO,UAAS,iBAAoB,YAAc,SAAS,gBAAgB,KAAK,UAEnO,CAAC,IACH,KAAM,IAAI,OAAM,4GAIpB,MAAO,IAAgB,IAGzB,GAAI,IAAQ,sHAEZ,YAAkB,EAAM,CACtB,MAAO,OAAO,IAAS,UAAY,GAAM,KAAK,GAQhD,GAAI,IAAY,GAEhB,OAAS,IAAI,EAAG,GAAI,IAAK,EAAE,GACzB,GAAU,KAAM,IAAI,KAAO,SAAS,IAAI,OAAO,IAGjD,YAAmB,EAAK,CACtB,GAAI,GAAS,UAAU,OAAS,GAAK,UAAU,KAAO,OAAY,UAAU,GAAK,EAG7E,EAAQ,IAAU,EAAI,EAAS,IAAM,GAAU,EAAI,EAAS,IAAM,GAAU,EAAI,EAAS,IAAM,GAAU,EAAI,EAAS,IAAM,IAAM,GAAU,EAAI,EAAS,IAAM,GAAU,EAAI,EAAS,IAAM,IAAM,GAAU,EAAI,EAAS,IAAM,GAAU,EAAI,EAAS,IAAM,IAAM,GAAU,EAAI,EAAS,IAAM,GAAU,EAAI,EAAS,IAAM,IAAM,GAAU,EAAI,EAAS,KAAO,GAAU,EAAI,EAAS,KAAO,GAAU,EAAI,EAAS,KAAO,GAAU,EAAI,EAAS,KAAO,GAAU,EAAI,EAAS,KAAO,GAAU,EAAI,EAAS,MAAM,cAMzf,GAAI,CAAC,GAAS,GACZ,KAAM,WAAU,+BAGlB,MAAO,GAGT,YAAY,EAAS,EAAK,EAAQ,CAChC,EAAU,GAAW,GACrB,GAAI,GAAO,EAAQ,QAAW,GAAQ,KAAO,MAK7C,GAHA,EAAK,GAAK,EAAK,GAAK,GAAO,GAC3B,EAAK,GAAK,EAAK,GAAK,GAAO,IAEvB,EAAK,CACP,EAAS,GAAU,EAEnB,OAAS,GAAI,EAAG,EAAI,GAAI,EAAE,EACxB,EAAI,EAAS,GAAK,EAAK,GAGzB,MAAO,GAGT,MAAO,IAAU,GCnEnB,YAAmB,CACf,YAAY,EAAS,CACjB,KAAK,WAAa,EAAQ,WAC1B,KAAK,OAAS,EAAQ,OACtB,KAAK,QAAU,EAAQ,SAAW,GAClC,KAAK,KAAO,EAAQ,WAEjB,YAAW,EAAU,CACxB,GAAI,CAAC,EACD,MAAO,GACX,GAAM,GAAO,EACb,MAAO,OAAO,GAAK,YAAe,UAAY,MAAO,GAAK,SAAY,WAI9E,YAAiC,EAAO,CACpC,MAAO,GAEX,GAAM,IAAuB,AAAC,GAAY,AAAC,GAAS,KAAO,IAAS,CAChE,GAAI,CAAC,GAAY,WAAW,EAAK,SAC7B,MAAO,GAAK,GAChB,GAAM,CAAE,WAAY,EACd,CAAE,kBAAkB,IAAO,EAAQ,eAAe,UAAY,GACpE,GAAI,EAAgB,QAAQ,OAAS,GAAK,CAAC,EAAQ,QAAQ,cACvD,MAAO,GAAQ,QAAQ,KACvB,EAAQ,QAAQ,cAAgB,WAE3B,CAAC,EAAQ,QAAQ,KAAS,CAC/B,GAAI,GAAO,EAAQ,SACnB,AAAI,EAAQ,MAAQ,MAChB,IAAQ,IAAI,EAAQ,QACxB,EAAQ,QAAQ,KAAU,EAE9B,MAAO,GAAK,IAEV,GAA8B,CAChC,KAAM,uBACN,KAAM,QACN,SAAU,MACV,KAAM,CAAC,QACP,SAAU,IAER,GAAsB,AAAC,GAAa,EACtC,aAAc,AAAC,GAAgB,CAC3B,EAAY,IAAI,GAAqB,GAAU,OAIjD,GAAmB,IAAM,CAAC,EAAM,IAAY,KAAO,IAAS,CAC9D,GAAI,CACA,GAAM,GAAW,KAAM,GAAK,GACtB,CAAE,aAAY,cAAa,SAAQ,gCAAgC,IAAO,EAC1E,CAAE,kCAAiC,oCAAqC,EACxE,EAA0B,GAAmC,EAAQ,wBACrE,EAA2B,GAAoC,EAAQ,yBACvE,CAAE,eAAc,GAA0B,EAAS,OACzD,UAAQ,OAAO,CACX,aACA,cACA,MAAO,EAAwB,EAAK,OACpC,OAAQ,EAAyB,GACjC,SAAU,IAEP,QAEJ,EAAP,CACI,GAAM,CAAE,aAAY,cAAa,SAAQ,gCAAgC,IAAO,EAC1E,CAAE,mCAAoC,EACtC,EAA0B,GAAmC,EAAQ,wBAC3E,SAAQ,QAAQ,CACZ,aACA,cACA,MAAO,EAAwB,EAAK,OACpC,QACA,SAAU,EAAM,YAEd,IAGR,GAA0B,CAC5B,KAAM,mBACN,KAAM,CAAC,UACP,KAAM,aACN,SAAU,IAER,GAAkB,AAAC,GAAa,EAClC,aAAc,AAAC,GAAgB,CAC3B,EAAY,IAAI,KAAoB,OAK5C,aAA4B,CACxB,KAAM,IAAI,OAAM,mCAEpB,aAAgC,CAC5B,KAAM,IAAI,OAAM,qCAEpB,GAAI,IAAmB,GACnB,GAAqB,GACrB,GACJ,AAAI,MAAO,SAAW,YAClB,GAAgB,OACb,AAAI,MAAO,OAAS,YACvB,GAAgB,KAEhB,GAAgB,GAEpB,AAAI,MAAO,IAAc,YAAe,YACpC,IAAmB,YAEvB,AAAI,MAAO,IAAc,cAAiB,YACtC,IAAqB,cAGzB,YAAoB,EAAK,CACrB,GAAI,KAAqB,WAErB,MAAO,YAAW,EAAK,GAG3B,GAAK,MAAqB,IAAoB,CAAC,KAAqB,WAChE,UAAmB,WACZ,WAAW,EAAK,GAE3B,GAAI,CAEA,MAAO,IAAiB,EAAK,SACzB,EAAN,CACE,GAAI,CAEA,MAAO,IAAiB,KAAK,KAAM,EAAK,SACpC,EAAN,CAEE,MAAO,IAAiB,KAAK,KAAM,EAAK,KAMpD,YAAyB,EAAQ,CAC7B,GAAI,KAAuB,aAEvB,MAAO,cAAa,GAGxB,GAAK,MAAuB,IAAuB,CAAC,KAAuB,aACvE,UAAqB,aACd,aAAa,GAExB,GAAI,CAEA,MAAO,IAAmB,SACrB,EAAP,CACE,GAAI,CAEA,MAAO,IAAmB,KAAK,KAAM,SAChC,EAAP,CAGE,MAAO,IAAmB,KAAK,KAAM,KAOjD,GAAI,IAAQ,GACR,GAAW,GACX,GACA,GAAa,GAEjB,aAA2B,CACvB,AAAI,CAAC,IAAY,CAAC,IAGlB,IAAW,GACX,AAAI,GAAa,OACb,GAAQ,GAAa,OAAO,IAE5B,GAAa,GAEb,GAAM,QACN,MAIR,aAAsB,CAClB,GAAI,IAGJ,IAAI,GAAU,GAAW,IACzB,GAAW,GAGX,OADI,GAAM,GAAM,OACV,GAAK,CAGP,IAFA,GAAe,GACf,GAAQ,GACD,EAAE,GAAa,GAClB,AAAI,IACA,GAAa,IAAY,MAGjC,GAAa,GACb,EAAM,GAAM,OAEhB,GAAe,KACf,GAAW,GACX,GAAgB,IAEpB,YAAkB,EAAK,CACnB,GAAI,GAAO,GAAI,OAAM,UAAU,OAAS,GACxC,GAAI,UAAU,OAAS,EACnB,OAAS,GAAI,EAAG,EAAI,UAAU,OAAQ,IAClC,EAAK,EAAI,GAAK,UAAU,GAGhC,GAAM,KAAK,GAAI,IAAK,EAAK,IACrB,GAAM,SAAW,GAAK,CAAC,IACvB,GAAW,IAInB,YAAc,EAAK,EAAO,CACtB,KAAK,IAAM,EACX,KAAK,MAAQ,EAEjB,GAAK,UAAU,IAAM,UAAY,CAC7B,KAAK,IAAI,MAAM,KAAM,KAAK,QAE9B,GAAI,IAAQ,UACR,GAAW,UACX,GAAU,GACV,GAAO,GACP,GAAU,GACV,GAAW,GACX,GAAU,GACV,GAAS,GAEb,aAAgB,EAEhB,GAAI,IAAK,GACL,GAAc,GACd,GAAO,GACP,GAAM,GACN,GAAiB,GACjB,GAAqB,GACrB,GAAO,GAEX,YAAiB,EAAM,CACnB,KAAM,IAAI,OAAM,oCAGpB,aAAgB,CAAE,MAAO,IACzB,YAAgB,EAAK,CACjB,KAAM,IAAI,OAAM,kCACnB,aAAiB,CAAE,MAAO,GAG3B,GAAI,IAAc,GAAc,aAAe,GAC3C,GACF,GAAY,KACZ,GAAY,QACZ,GAAY,OACZ,GAAY,MACZ,GAAY,WACZ,UAAU,CAAE,MAAQ,IAAI,QAAQ,WAIlC,YAAgB,EAAkB,CAChC,GAAI,GAAY,GAAe,KAAK,IAAa,KAC7C,EAAU,KAAK,MAAM,GACrB,EAAc,KAAK,MAAO,EAAU,EAAG,KAC3C,MAAI,IACF,GAAU,EAAU,EAAkB,GACtC,EAAc,EAAc,EAAkB,GAC1C,EAAY,GACd,KACA,GAAe,MAGZ,CAAC,EAAQ,GAGlB,GAAI,IAAY,GAAI,MACpB,aAAkB,CAChB,GAAI,GAAc,GAAI,MAClB,EAAM,EAAc,GACxB,MAAO,GAAM,IAGf,GAAI,IAAU,CACZ,SAAU,GACV,MAAO,GACP,QAAS,GACT,IAAK,CAAC,SAAW,cACjB,KAAM,GACN,QAAS,GACT,SAAU,GACV,GAAI,GACJ,YAAa,GACb,KAAM,GACN,IAAK,GACL,eAAgB,GAChB,mBAAoB,GACpB,KAAM,GACN,QAAS,GACT,IAAK,GACL,MAAO,GACP,MAAO,GACP,OAAQ,GACR,SAAU,GACV,QAAS,GACT,OAAQ,GACR,OAAQ,IAGJ,GAAuB,kBACvB,GAA2B,2BAC3B,GAAe,mBACf,GAA+B,AAAC,GAAY,AAAC,GAAS,KAAO,IAAS,CACxE,GAAM,CAAE,WAAY,EACpB,GAAI,CAAC,GAAY,WAAW,IACxB,EAAQ,UAAY,QACpB,EAAQ,QAAQ,eAAe,IAC/B,MAAO,GAAK,GAEhB,GAAM,GAAe,GAAQ,IAAI,IAC3B,EAAU,GAAQ,IAAI,IACtB,EAAiB,AAAC,GAAQ,MAAO,IAAQ,UAAY,EAAI,OAAS,EACxE,MAAI,GAAe,IAAiB,EAAe,IAC/C,GAAQ,QAAQ,IAAwB,GAErC,EAAK,IACL,EACH,aAGF,GAAyC,CAC3C,KAAM,QACN,KAAM,CAAC,uBACP,KAAM,+BACN,SAAU,GACV,SAAU,OAER,GAA8B,AAAC,GAAa,EAC9C,aAAc,AAAC,GAAgB,CAC3B,EAAY,IAAI,GAA6B,GAAU,OAIzD,GAAU,CAAC,EAAU,EAAW,IAAoB,CACtD,GAAI,GACA,EACA,EACA,EAAa,GACX,EAAmB,SAAY,CACjC,AAAK,GACD,GAAU,KAEd,GAAI,CACA,EAAW,KAAM,GACjB,EAAY,GACZ,EAAa,UAEjB,CACI,EAAU,OAEd,MAAO,IAEX,MAAI,KAAc,OACP,KAAO,IACN,GAAC,GAAa,GAAS,eACvB,GAAW,KAAM,MAEd,GAGR,KAAO,IACN,GAAC,GAAa,GAAS,eACvB,GAAW,KAAM,MAEjB,EACO,EAEP,GAAmB,CAAC,EAAgB,GACpC,GAAa,GACN,GAEP,GAAU,IACV,KAAM,KACC,KAMnB,AAgBA,GAAI,IAAgB,SAAS,EAAG,EAAG,CAC/B,UAAgB,OAAO,gBAClB,CAAE,UAAW,aAAgB,QAAS,SAAU,EAAG,EAAG,CAAE,EAAE,UAAY,IACvE,SAAU,EAAG,EAAG,CAAE,OAAS,KAAK,GAAG,AAAI,EAAE,eAAe,IAAI,GAAE,GAAK,EAAE,KAClE,GAAc,EAAG,IAG5B,YAAmB,EAAG,EAAG,CACrB,GAAc,EAAG,GACjB,YAAc,CAAE,KAAK,YAAc,EACnC,EAAE,UAAY,IAAM,KAAO,OAAO,OAAO,GAAM,GAAG,UAAY,EAAE,UAAW,GAAI,IAGnF,GAAI,IAAW,UAAW,CACtB,UAAW,OAAO,QAAU,SAAkB,EAAG,CAC7C,OAAS,GAAG,EAAI,EAAG,EAAI,UAAU,OAAQ,EAAI,EAAG,IAAK,CACjD,EAAI,UAAU,GACd,OAAS,KAAK,GAAG,AAAI,OAAO,UAAU,eAAe,KAAK,EAAG,IAAI,GAAE,GAAK,EAAE,IAE9E,MAAO,IAEJ,GAAS,MAAM,KAAM,YAGhC,YAAgB,EAAG,EAAG,CAClB,GAAI,GAAI,GACR,OAAS,KAAK,GAAG,AAAI,OAAO,UAAU,eAAe,KAAK,EAAG,IAAM,EAAE,QAAQ,GAAK,GAC9E,GAAE,GAAK,EAAE,IACb,GAAI,GAAK,MAAQ,MAAO,QAAO,uBAA0B,WACrD,OAAS,GAAI,EAAG,EAAI,OAAO,sBAAsB,GAAI,EAAI,EAAE,OAAQ,IAC/D,AAAI,EAAE,QAAQ,EAAE,IAAM,GAAK,OAAO,UAAU,qBAAqB,KAAK,EAAG,EAAE,KACvE,GAAE,EAAE,IAAM,EAAE,EAAE,KAE1B,MAAO,GAGX,YAAoB,EAAY,EAAQ,EAAK,EAAM,CAC/C,GAAI,GAAI,UAAU,OAAQ,EAAI,EAAI,EAAI,EAAS,IAAS,KAAO,EAAO,OAAO,yBAAyB,EAAQ,GAAO,EAAM,EAC3H,GAAI,MAAO,UAAY,UAAY,MAAO,SAAQ,UAAa,WAAY,EAAI,QAAQ,SAAS,EAAY,EAAQ,EAAK,OACpH,QAAS,GAAI,EAAW,OAAS,EAAG,GAAK,EAAG,IAAK,AAAI,GAAI,EAAW,KAAI,GAAK,GAAI,EAAI,EAAE,GAAK,EAAI,EAAI,EAAE,EAAQ,EAAK,GAAK,EAAE,EAAQ,KAAS,GAChJ,MAAO,GAAI,GAAK,GAAK,OAAO,eAAe,EAAQ,EAAK,GAAI,EAGhE,YAAiB,EAAY,EAAW,CACpC,MAAO,UAAU,EAAQ,EAAK,CAAE,EAAU,EAAQ,EAAK,IAG3D,YAAoB,EAAa,EAAe,CAC5C,GAAI,MAAO,UAAY,UAAY,MAAO,SAAQ,UAAa,WAAY,MAAO,SAAQ,SAAS,EAAa,GAGpH,YAAmB,EAAS,EAAY,EAAG,EAAW,CAClD,WAAe,EAAO,CAAE,MAAO,aAAiB,GAAI,EAAQ,GAAI,GAAE,SAAU,EAAS,CAAE,EAAQ,KAC/F,MAAO,IAAK,IAAM,GAAI,UAAU,SAAU,EAAS,EAAQ,CACvD,WAAmB,EAAO,CAAE,GAAI,CAAE,EAAK,EAAU,KAAK,UAAkB,EAAP,CAAY,EAAO,IACpF,WAAkB,EAAO,CAAE,GAAI,CAAE,EAAK,EAAU,MAAS,UAAkB,EAAP,CAAY,EAAO,IACvF,WAAc,EAAQ,CAAE,EAAO,KAAO,EAAQ,EAAO,OAAS,EAAM,EAAO,OAAO,KAAK,EAAW,GAClG,EAAM,GAAY,EAAU,MAAM,EAAS,GAAc,KAAK,UAItE,YAAqB,EAAS,EAAM,CAChC,GAAI,GAAI,CAAE,MAAO,EAAG,KAAM,UAAW,CAAE,GAAI,EAAE,GAAK,EAAG,KAAM,GAAE,GAAI,MAAO,GAAE,IAAO,KAAM,GAAI,IAAK,IAAM,EAAG,EAAG,EAAG,EAC/G,MAAO,GAAI,CAAE,KAAM,EAAK,GAAI,MAAS,EAAK,GAAI,OAAU,EAAK,IAAM,MAAO,SAAW,YAAe,GAAE,OAAO,UAAY,UAAW,CAAE,MAAO,QAAU,EACvJ,WAAc,EAAG,CAAE,MAAO,UAAU,EAAG,CAAE,MAAO,GAAK,CAAC,EAAG,KACzD,WAAc,EAAI,CACd,GAAI,EAAG,KAAM,IAAI,WAAU,mCAC3B,KAAO,GAAG,GAAI,CACV,GAAI,EAAI,EAAG,GAAM,GAAI,EAAG,GAAK,EAAI,EAAE,OAAY,EAAG,GAAK,EAAE,OAAc,IAAI,EAAE,SAAc,EAAE,KAAK,GAAI,GAAK,EAAE,OAAS,CAAE,GAAI,EAAE,KAAK,EAAG,EAAG,KAAK,KAAM,MAAO,GAE3J,OADI,EAAI,EAAG,GAAG,GAAK,CAAC,EAAG,GAAK,EAAG,EAAE,QACzB,EAAG,QACF,OAAQ,GAAG,EAAI,EAAI,UACnB,GAAG,SAAE,QAAgB,CAAE,MAAO,EAAG,GAAI,KAAM,QAC3C,GAAG,EAAE,QAAS,EAAI,EAAG,GAAI,EAAK,CAAC,GAAI,aACnC,GAAG,EAAK,EAAE,IAAI,MAAO,EAAE,KAAK,MAAO,iBAEpC,GAAM,EAAI,EAAE,KAAM,IAAI,EAAE,OAAS,GAAK,EAAE,EAAE,OAAS,KAAQ,GAAG,KAAO,GAAK,EAAG,KAAO,GAAI,CAAE,EAAI,EAAG,SACjG,GAAI,EAAG,KAAO,GAAM,EAAC,GAAM,EAAG,GAAK,EAAE,IAAM,EAAG,GAAK,EAAE,IAAM,CAAE,EAAE,MAAQ,EAAG,GAAI,MAC9E,GAAI,EAAG,KAAO,GAAK,EAAE,MAAQ,EAAE,GAAI,CAAE,EAAE,MAAQ,EAAE,GAAI,EAAI,EAAI,MAC7D,GAAI,GAAK,EAAE,MAAQ,EAAE,GAAI,CAAE,EAAE,MAAQ,EAAE,GAAI,EAAE,IAAI,KAAK,GAAK,MAC3D,AAAI,EAAE,IAAI,EAAE,IAAI,MAChB,EAAE,KAAK,MAAO,SAEtB,EAAK,EAAK,KAAK,EAAS,SACnB,EAAP,CAAY,EAAK,CAAC,EAAG,GAAI,EAAI,SAAK,CAAU,EAAI,EAAI,EACtD,GAAI,EAAG,GAAK,EAAG,KAAM,GAAG,GAAI,MAAO,CAAE,MAAO,EAAG,GAAK,EAAG,GAAK,OAAQ,KAAM,KAIlF,YAAyB,EAAG,EAAG,EAAG,EAAI,CAClC,AAAI,IAAO,QAAW,GAAK,GAC3B,EAAE,GAAM,EAAE,GAGd,YAAsB,EAAG,EAAS,CAC9B,OAAS,KAAK,GAAG,AAAI,IAAM,WAAa,CAAC,EAAQ,eAAe,IAAI,GAAQ,GAAK,EAAE,IAGvF,YAAkB,EAAG,CACjB,GAAI,GAAI,MAAO,SAAW,YAAc,OAAO,SAAU,EAAI,GAAK,EAAE,GAAI,EAAI,EAC5E,GAAI,EAAG,MAAO,GAAE,KAAK,GACrB,GAAI,GAAK,MAAO,GAAE,QAAW,SAAU,MAAO,CAC1C,KAAM,UAAY,CACd,MAAI,IAAK,GAAK,EAAE,QAAQ,GAAI,QACrB,CAAE,MAAO,GAAK,EAAE,KAAM,KAAM,CAAC,KAG5C,KAAM,IAAI,WAAU,EAAI,0BAA4B,mCAGxD,YAAgB,EAAG,EAAG,CAClB,GAAI,GAAI,MAAO,SAAW,YAAc,EAAE,OAAO,UACjD,GAAI,CAAC,EAAG,MAAO,GACf,GAAI,GAAI,EAAE,KAAK,GAAI,EAAG,EAAK,GAAI,EAC/B,GAAI,CACA,KAAQ,KAAM,QAAU,KAAM,IAAM,CAAE,GAAI,EAAE,QAAQ,MAAM,EAAG,KAAK,EAAE,aAEjE,EAAP,CAAgB,EAAI,CAAE,MAAO,UAC7B,CACI,GAAI,CACA,AAAI,GAAK,CAAC,EAAE,MAAS,GAAI,EAAE,SAAY,EAAE,KAAK,UAElD,CAAU,GAAI,EAAG,KAAM,GAAE,OAE7B,MAAO,GAGX,aAAoB,CAChB,OAAS,GAAK,GAAI,EAAI,EAAG,EAAI,UAAU,OAAQ,IAC3C,EAAK,EAAG,OAAO,GAAO,UAAU,KACpC,MAAO,GAGX,aAA0B,CACtB,OAAS,GAAI,EAAG,EAAI,EAAG,EAAK,UAAU,OAAQ,EAAI,EAAI,IAAK,GAAK,UAAU,GAAG,OAC7E,OAAS,GAAI,MAAM,GAAI,EAAI,EAAG,EAAI,EAAG,EAAI,EAAI,IACzC,OAAS,GAAI,UAAU,GAAI,EAAI,EAAG,EAAK,EAAE,OAAQ,EAAI,EAAI,IAAK,IAC1D,EAAE,GAAK,EAAE,GACjB,MAAO,GAEX,YAAiB,EAAG,CAChB,MAAO,gBAAgB,IAAW,MAAK,EAAI,EAAG,MAAQ,GAAI,IAAQ,GAGtE,YAA0B,EAAS,EAAY,EAAW,CACtD,GAAI,CAAC,OAAO,cAAe,KAAM,IAAI,WAAU,wCAC/C,GAAI,GAAI,EAAU,MAAM,EAAS,GAAc,IAAK,EAAG,EAAI,GAC3D,MAAO,GAAI,GAAI,EAAK,QAAS,EAAK,SAAU,EAAK,UAAW,EAAE,OAAO,eAAiB,UAAY,CAAE,MAAO,OAAS,EACpH,WAAc,EAAG,CAAE,AAAI,EAAE,IAAI,GAAE,GAAK,SAAU,EAAG,CAAE,MAAO,IAAI,SAAQ,SAAU,EAAG,EAAG,CAAE,EAAE,KAAK,CAAC,EAAG,EAAG,EAAG,IAAM,GAAK,EAAO,EAAG,OAC9H,WAAgB,EAAG,EAAG,CAAE,GAAI,CAAE,EAAK,EAAE,GAAG,UAAc,EAAP,CAAY,EAAO,EAAE,GAAG,GAAI,IAC3E,WAAc,EAAG,CAAE,EAAE,gBAAiB,IAAU,QAAQ,QAAQ,EAAE,MAAM,GAAG,KAAK,EAAS,GAAU,EAAO,EAAE,GAAG,GAAI,GACnH,WAAiB,EAAO,CAAE,EAAO,OAAQ,GACzC,WAAgB,EAAO,CAAE,EAAO,QAAS,GACzC,WAAgB,EAAG,EAAG,CAAE,AAAI,EAAE,GAAI,EAAE,QAAS,EAAE,QAAQ,EAAO,EAAE,GAAG,GAAI,EAAE,GAAG,KAGhF,YAA0B,EAAG,CACzB,GAAI,GAAG,EACP,MAAO,GAAI,GAAI,EAAK,QAAS,EAAK,QAAS,SAAU,EAAG,CAAE,KAAM,KAAO,EAAK,UAAW,EAAE,OAAO,UAAY,UAAY,CAAE,MAAO,OAAS,EAC1I,WAAc,EAAG,EAAG,CAAE,EAAE,GAAK,EAAE,GAAK,SAAU,EAAG,CAAE,MAAQ,GAAI,CAAC,GAAK,CAAE,MAAO,GAAQ,EAAE,GAAG,IAAK,KAAM,IAAM,UAAa,EAAI,EAAE,GAAK,GAAO,GAG/I,YAAuB,EAAG,CACtB,GAAI,CAAC,OAAO,cAAe,KAAM,IAAI,WAAU,wCAC/C,GAAI,GAAI,EAAE,OAAO,eAAgB,EACjC,MAAO,GAAI,EAAE,KAAK,GAAM,GAAI,MAAO,KAAa,WAAa,GAAS,GAAK,EAAE,OAAO,YAAa,EAAI,GAAI,EAAK,QAAS,EAAK,SAAU,EAAK,UAAW,EAAE,OAAO,eAAiB,UAAY,CAAE,MAAO,OAAS,GAC9M,WAAc,EAAG,CAAE,EAAE,GAAK,EAAE,IAAM,SAAU,EAAG,CAAE,MAAO,IAAI,SAAQ,SAAU,EAAS,EAAQ,CAAE,EAAI,EAAE,GAAG,GAAI,EAAO,EAAS,EAAQ,EAAE,KAAM,EAAE,UAChJ,WAAgB,EAAS,EAAQ,EAAG,EAAG,CAAE,QAAQ,QAAQ,GAAG,KAAK,SAAS,EAAG,CAAE,EAAQ,CAAE,MAAO,EAAG,KAAM,KAAS,IAGtH,YAA8B,EAAQ,EAAK,CACvC,MAAI,QAAO,eAAkB,OAAO,eAAe,EAAQ,MAAO,CAAE,MAAO,IAAiB,EAAO,IAAM,EAClG,EAEX,YAAsB,EAAK,CACvB,GAAI,GAAO,EAAI,WAAY,MAAO,GAClC,GAAI,GAAS,GACb,GAAI,GAAO,KAAM,OAAS,KAAK,GAAK,AAAI,OAAO,eAAe,KAAK,EAAK,IAAI,GAAO,GAAK,EAAI,IAC5F,SAAO,QAAU,EACV,EAGX,YAAyB,EAAK,CAC1B,MAAQ,IAAO,EAAI,WAAc,EAAM,CAAE,QAAS,GAGtD,YAAgC,EAAU,EAAY,CAClD,GAAI,CAAC,EAAW,IAAI,GAChB,KAAM,IAAI,WAAU,kDAExB,MAAO,GAAW,IAAI,GAG1B,YAAgC,EAAU,EAAY,EAAO,CACzD,GAAI,CAAC,EAAW,IAAI,GAChB,KAAM,IAAI,WAAU,kDAExB,SAAW,IAAI,EAAU,GAClB,EAGX,GAAI,IAAyB,OAAO,OAAO,CACvC,UAAW,KACX,UAAW,MACP,WAAY,CAAE,MAAO,KACzB,OAAQ,GACR,WAAY,GACZ,QAAS,GACT,WAAY,GACZ,UAAW,GACX,YAAa,GACb,gBAAiB,GACjB,aAAc,GACd,SAAU,GACV,OAAQ,GACR,SAAU,GACV,eAAgB,GAChB,QAAS,GACT,iBAAkB,GAClB,iBAAkB,GAClB,cAAe,GACf,qBAAsB,GACtB,aAAc,GACd,gBAAiB,GACjB,uBAAwB,GACxB,uBAAwB,KAGtB,GAAW,AAAC,GAAU,CACxB,GAAM,GAAQ,GACd,OAAS,GAAI,EAAG,EAAM,EAAM,OAAQ,EAAI,EAAK,IAAK,CAC9C,GAAM,GAAQ,EAAM,WAAW,GAC/B,GAAI,EAAQ,IACR,EAAM,KAAK,WAEN,EAAQ,KACb,EAAM,KAAM,GAAS,EAAK,IAAa,EAAQ,GAAY,aAEtD,EAAI,EAAI,EAAM,QAAW,GAAQ,QAAY,OAAW,GAAM,WAAW,EAAI,GAAK,QAAY,MAAQ,CAC3G,GAAM,GAAgB,MAAY,IAAQ,OAAiB,IAAO,GAAM,WAAW,EAAE,GAAK,MAC1F,EAAM,KAAM,GAAiB,GAAM,IAAc,GAAiB,GAAM,GAAY,IAAc,GAAiB,EAAK,GAAY,IAAa,EAAgB,GAAY,SAG7K,GAAM,KAAM,GAAS,GAAM,IAAc,GAAS,EAAK,GAAY,IAAa,EAAQ,GAAY,KAG5G,MAAO,YAAW,KAAK,IAErB,GAAS,AAAC,GAAU,CACtB,GAAI,GAAU,GACd,OAAS,GAAI,EAAG,EAAM,EAAM,OAAQ,EAAI,EAAK,IAAK,CAC9C,GAAM,GAAO,EAAM,GACnB,GAAI,EAAO,IACP,GAAW,OAAO,aAAa,WAE1B,KAAc,GAAQ,EAAO,IAAY,CAC9C,GAAM,GAAW,EAAM,EAAE,GACzB,GAAW,OAAO,aAAe,GAAO,KAAY,EAAM,EAAW,YAEhE,KAAc,GAAQ,EAAO,IAAa,CAC/C,GAAM,GAAgB,CAAC,EAAM,EAAM,EAAE,GAAI,EAAM,EAAE,GAAI,EAAM,EAAE,IACvD,EAAU,IAAM,EAAc,IAAI,AAAC,GAAc,EAAU,SAAS,KAAK,KAAK,KACpF,GAAW,mBAAmB,OAG9B,IAAW,OAAO,aAAe,GAAO,KAAW,GAAQ,GAAM,EAAE,GAAK,KAAa,EAAM,EAAM,EAAE,GAAK,IAGhH,MAAO,IAGX,YAAoB,EAAO,CACvB,MAAO,IAAI,eAAc,OAAO,GAEpC,YAAkB,EAAO,CACrB,MAAO,IAAI,aAAY,SAAS,OAAO,GAG3C,GAAM,IAAa,AAAC,GAAU,MAAO,cAAgB,WAAa,GAAW,GAAS,GAAS,GACzF,GAAW,AAAC,GAAU,MAAO,cAAgB,WAAa,GAAS,GAAS,GAAO,GAErF,GAAsB,OAAO,OAAO,CACpC,UAAW,KACX,SAAU,GACV,OAAQ,KAGR,GAAoB,GAAqB,SAAU,EAAQ,EAAS,CAGxE,OAAO,eAAe,EAAS,aAAc,CAAE,MAAO,KACtD,EAAQ,gBAAkB,OAG1B,GAAI,GAAW,MAAO,SAAW,aAAe,OAAO,KACjD,SAAU,EAAO,CAAE,MAAO,QAAO,KAAK,EAAO,SAC7C,GAAO,SACb,WAAyB,EAAM,CAE3B,MAAI,aAAgB,YACT,EACP,MAAO,IAAS,SACT,EAAS,GAEhB,YAAY,OAAO,GACZ,GAAI,YAAW,EAAK,OAAQ,EAAK,WAAY,EAAK,WAAa,WAAW,mBAE9E,GAAI,YAAW,GAE1B,EAAQ,gBAAkB,IAItB,GAAgB,GAAqB,SAAU,EAAQ,EAAS,CAGpE,OAAO,eAAe,EAAS,aAAc,CAAE,MAAO,KACtD,EAAQ,YAAc,OACtB,WAAqB,EAAM,CACvB,MAAI,OAAO,IAAS,SACT,EAAK,SAAW,EAEpB,EAAK,aAAe,EAE/B,EAAQ,YAAc,IAIlB,GAAe,GAAqB,SAAU,EAAQ,EAAS,CAGnE,OAAO,eAAe,EAAS,aAAc,CAAE,MAAO,KACtD,EAAQ,WAAa,OACrB,WAAoB,EAAK,CACrB,MAAO,IAAI,YAAW,CACjB,GAAM,aAAe,GACrB,GAAM,WAAe,GACrB,GAAM,QAAe,EACtB,EAAM,MAGd,EAAQ,WAAa,IAIjB,GAAoB,GAAqB,SAAU,EAAQ,EAAS,CAGxE,OAAO,eAAe,EAAS,aAAc,CAAE,MAAO,KACtD,EAAQ,gBAAkB,OAE1B,WAAyB,EAAe,CACpC,GAAI,CAAC,YAAY,KAAM,CAGnB,OAFI,GAAe,GAAI,aAAY,EAAc,QAC7C,EAAU,EACP,EAAU,EAAc,QAC3B,EAAa,GAAW,EAAc,GACtC,GAAW,EAEf,MAAO,GAEX,MAAO,aAAY,KAAK,GAE5B,EAAQ,gBAAkB,IAItB,GAAQ,GAAqB,SAAU,EAAQ,EAAS,CAG5D,OAAO,eAAe,EAAS,aAAc,CAAE,MAAO,KACtD,EAAQ,gBAAkB,EAAQ,WAAa,EAAQ,YAAc,EAAQ,gBAAkB,OAE/F,OAAO,eAAe,EAAS,kBAAmB,CAAE,WAAY,GAAM,IAAK,UAAY,CAAE,MAAO,IAAkB,mBAElH,OAAO,eAAe,EAAS,cAAe,CAAE,WAAY,GAAM,IAAK,UAAY,CAAE,MAAO,IAAc,eAE1G,OAAO,eAAe,EAAS,aAAc,CAAE,WAAY,GAAM,IAAK,UAAY,CAAE,MAAO,IAAa,cAExG,OAAO,eAAe,EAAS,kBAAmB,CAAE,WAAY,GAAM,IAAK,UAAY,CAAE,MAAO,IAAkB,qBAI9G,GAAY,GAAqB,SAAU,EAAQ,EAAS,CAGhE,OAAO,eAAe,EAAS,aAAc,CAAE,MAAO,KACtD,EAAQ,SAAW,OAInB,GAAI,GAA0B,UAAY,CACtC,YAAoB,CAChB,KAAK,MAAQ,GAAI,IAAQ,MAE7B,SAAS,UAAU,OAAS,SAAU,EAAQ,CAC1C,AAAK,AA9yBb,GA8yBgB,GAAM,aAAa,IAE3B,KAAK,MAAM,OAAQ,AAhzB3B,GAgzB8B,GAAM,iBAAiB,KAEjD,EAAS,UAAU,OAAS,UAAY,CACpC,MAAO,IAAU,UAAU,KAAM,OAAQ,OAAQ,UAAY,CACzD,MAAO,IAAU,YAAY,KAAM,SAAU,EAAI,CAC7C,MAAO,CAAC,EAAe,AArzBvC,GAqzB0C,GAAM,YAAY,KAAK,MAAM,gBAInE,EAAS,UAAU,MAAQ,UAAY,CACnC,KAAK,MAAQ,GAAI,IAAQ,OAEtB,KAEX,EAAQ,SAAW,IAIf,GAAU,GAAqB,SAAU,EAAQ,EAAS,CAC9D,OAAO,eAAe,EAAS,aAAc,CAAE,MAAO,KACtD,EAAQ,SAAW,EAAQ,MAAQ,EAAQ,MAAQ,OAGnD,WAAe,EAAM,CACjB,MAAO,IAAI,KAAQ,OAAO,GAAM,SAEpC,EAAQ,MAAQ,EAChB,GAAI,GAAuB,UAAY,CACnC,YAAiB,CACb,KAAK,SAAW,WAEpB,SAAM,UAAU,OAAS,SAAU,EAAM,CACrC,GAAI,GAAK,EACT,GAAI,CACA,OAAS,GAAS,GAAU,SAAS,GAAO,EAAW,EAAO,OAAQ,CAAC,EAAS,KAAM,EAAW,EAAO,OAAQ,CAC5G,GAAI,GAAO,EAAS,MACpB,KAAK,SACA,KAAK,WAAa,EAAK,EAAa,MAAK,SAAW,GAAQ,YAGlE,EAAP,CAAgB,EAAM,CAAE,MAAO,UAC/B,CACI,GAAI,CACA,AAAI,GAAY,CAAC,EAAS,MAAS,GAAK,EAAO,SAAS,EAAG,KAAK,UAEpE,CAAU,GAAI,EAAK,KAAM,GAAI,OAEjC,MAAO,OAEX,EAAM,UAAU,OAAS,UAAY,CACjC,MAAQ,MAAK,SAAW,cAAgB,GAErC,KAEX,EAAQ,MAAQ,EAEhB,GAAI,GAAgB,CAChB,EAAY,WAAY,WAAY,WACpC,UAAY,WAAY,WAAY,WACpC,UAAY,WAAY,WAAY,WACpC,UAAY,WAAY,WAAY,WACpC,UAAY,WAAY,WAAY,WACpC,UAAY,WAAY,WAAY,WACpC,UAAY,WAAY,WAAY,WACpC,UAAY,WAAY,WAAY,WACpC,UAAY,WAAY,WAAY,WACpC,WAAY,WAAY,WAAY,WACpC,UAAY,WAAY,WAAY,WACpC,UAAY,WAAY,WAAY,WACpC,UAAY,WAAY,WAAY,WACpC,UAAY,WAAY,WAAY,WACpC,UAAY,WAAY,WAAY,WACpC,UAAY,WAAY,WAAY,WACpC,WAAY,SAAY,WAAY,WACpC,WAAY,UAAY,WAAY,WACpC,WAAY,UAAY,WAAY,WACpC,WAAY,UAAY,WAAY,WACpC,WAAY,UAAY,WAAY,WACpC,WAAY,UAAY,WAAY,WACpC,WAAY,UAAY,WAAY,WACpC,WAAY,UAAY,WAAY,WACpC,WAAY,UAAY,WAAY,WACpC,WAAY,WAAY,WAAY,WACpC,WAAY,UAAY,WAAY,WACpC,WAAY,UAAY,WAAY,WACpC,WAAY,UAAY,WAAY,WACpC,WAAY,UAAY,WAAY,WACpC,WAAY,UAAY,WAAY,WACpC,WAAY,UAAY,WAAY,WACpC,WAAY,WAAY,SAAY,WACpC,WAAY,WAAY,SAAY,WACpC,WAAY,WAAY,UAAY,WACpC,WAAY,WAAY,UAAY,WACpC,WAAY,WAAY,UAAY,WACpC,WAAY,WAAY,UAAY,WACpC,WAAY,WAAY,UAAY,WACpC,WAAY,WAAY,UAAY,WACpC,WAAY,WAAY,UAAY,WACpC,WAAY,WAAY,WAAY,WACpC,WAAY,WAAY,UAAY,WACpC,WAAY,WAAY,UAAY,WACpC,WAAY,WAAY,UAAY,WACpC,WAAY,WAAY,UAAY,WACpC,WAAY,WAAY,UAAY,WACpC,WAAY,WAAY,UAAY,WACpC,WAAY,WAAY,WAAY,SACpC,WAAY,WAAY,WAAY,SACpC,WAAY,WAAY,WAAY,UACpC,WAAY,WAAY,WAAY,UACpC,WAAY,WAAY,WAAY,UACpC,WAAY,WAAY,WAAY,UACpC,WAAY,WAAY,WAAY,UACpC,WAAY,WAAY,WAAY,UACpC,WAAY,WAAY,WAAY,UACpC,WAAY,WAAY,WAAY,WACpC,WAAY,WAAY,WAAY,SACpC,WAAY,WAAY,WAAY,UACpC,WAAY,WAAY,WAAY,UACpC,WAAY,WAAY,WAAY,UACpC,WAAY,WAAY,WAAY,UACpC,WAAY,WAAY,WAAY,WAEpC,EAAe,AA16BnB,GA06BsB,GAAM,iBAAiB,GAE7C,OAAO,eAAe,EAAS,WAAY,CAAE,WAAY,GAAM,IAAK,UAAY,CAAE,MAAO,IAAU,cAInG,QAAY,CACR,YAAY,EAAO,CAEf,GADA,KAAK,MAAQ,EACT,EAAM,aAAe,EACrB,KAAM,IAAI,OAAM,+CAGjB,YAAW,EAAQ,CACtB,GAAI,EAAS,oBAAuB,EAAS,oBACzC,KAAM,IAAI,OAAM,GAAG,wEAEvB,GAAM,GAAQ,GAAI,YAAW,GAC7B,OAAS,GAAI,EAAG,EAAY,KAAK,IAAI,KAAK,MAAM,IAAU,EAAI,IAAM,EAAY,EAAG,IAAK,GAAa,IACjG,EAAM,GAAK,EAEf,MAAI,GAAS,GACT,GAAO,GAEJ,GAAI,IAAM,GAErB,SAAU,CACN,GAAM,GAAQ,KAAK,MAAM,MAAM,GACzB,EAAW,EAAM,GAAK,IAC5B,MAAI,IACA,GAAO,GAEJ,SAAS,GAAM,GAAQ,IAAO,GAAW,GAAK,GAEzD,UAAW,CACP,MAAO,QAAO,KAAK,aAG3B,YAAgB,EAAO,CACnB,OAAS,GAAI,EAAG,EAAI,EAAG,IACnB,EAAM,IAAM,IAEhB,OAAS,GAAI,EAAG,EAAI,IAChB,GAAM,KACF,EAAM,KAAO,GAFG,IAEpB,EAKR,YAAuB,CACnB,YAAY,EAAQ,EAAU,CAC1B,KAAK,OAAS,EACd,KAAK,SAAW,EAEpB,OAAO,EAAS,CACZ,GAAM,GAAS,GACf,OAAW,KAAc,QAAO,KAAK,GAAU,CAC3C,GAAM,GAAQ,KAAK,SAAS,GAC5B,EAAO,KAAK,WAAW,KAAK,CAAC,EAAM,aAAc,EAAO,KAAK,kBAAkB,EAAQ,KAE3F,GAAM,GAAM,GAAI,YAAW,EAAO,OAAO,CAAC,EAAO,IAAU,EAAQ,EAAM,WAAY,IACjF,EAAW,EACf,OAAW,KAAS,GAChB,EAAI,IAAI,EAAO,GACf,GAAY,EAAM,WAEtB,MAAO,GAEX,kBAAkB,EAAQ,CACtB,OAAQ,EAAO,UACN,UACD,MAAO,YAAW,KAAK,CAAC,EAAO,MAAQ,EAAI,QAC1C,OACD,MAAO,YAAW,KAAK,CAAC,EAAG,EAAO,YACjC,QACD,GAAM,GAAY,GAAI,UAAS,GAAI,aAAY,IAC/C,SAAU,SAAS,EAAG,GACtB,EAAU,SAAS,EAAG,EAAO,MAAO,IAC7B,GAAI,YAAW,EAAU,YAC/B,UACD,GAAM,GAAU,GAAI,UAAS,GAAI,aAAY,IAC7C,SAAQ,SAAS,EAAG,GACpB,EAAQ,SAAS,EAAG,EAAO,MAAO,IAC3B,GAAI,YAAW,EAAQ,YAC7B,OACD,GAAM,GAAY,GAAI,YAAW,GACjC,SAAU,GAAK,EACf,EAAU,IAAI,EAAO,MAAM,MAAO,GAC3B,MACN,SACD,GAAM,GAAU,GAAI,UAAS,GAAI,aAAY,EAAI,EAAO,MAAM,aAC9D,EAAQ,SAAS,EAAG,GACpB,EAAQ,UAAU,EAAG,EAAO,MAAM,WAAY,IAC9C,GAAM,GAAW,GAAI,YAAW,EAAQ,QACxC,SAAS,IAAI,EAAO,MAAO,GACpB,MACN,SACD,GAAM,GAAY,KAAK,SAAS,EAAO,OACjC,EAAU,GAAI,UAAS,GAAI,aAAY,EAAI,EAAU,aAC3D,EAAQ,SAAS,EAAG,GACpB,EAAQ,UAAU,EAAG,EAAU,WAAY,IAC3C,GAAM,GAAW,GAAI,YAAW,EAAQ,QACxC,SAAS,IAAI,EAAW,GACjB,MACN,YACD,GAAM,GAAU,GAAI,YAAW,GAC/B,SAAQ,GAAK,EACb,EAAQ,IAAI,GAAM,WAAW,EAAO,MAAM,WAAW,MAAO,GACrD,MACN,OACD,GAAI,CAAC,GAAa,KAAK,EAAO,OAC1B,KAAM,IAAI,OAAM,0BAA0B,EAAO,SAErD,GAAM,GAAY,GAAI,YAAW,IACjC,SAAU,GAAK,EACf,EAAU,IAAI,GAAQ,EAAO,MAAM,QAAQ,MAAO,KAAM,GACjD,GAGnB,MAAM,EAAS,CACX,GAAM,GAAM,GACR,EAAW,EACf,KAAO,EAAW,EAAQ,YAAY,CAClC,GAAM,GAAa,EAAQ,SAAS,KAC9B,EAAO,KAAK,OAAO,GAAI,YAAW,EAAQ,OAAQ,EAAQ,WAAa,EAAU,IAEvF,OADA,GAAY,EACJ,EAAQ,SAAS,UAChB,GACD,EAAI,GAAQ,CACR,KAAM,GACN,MAAO,IAEX,UACC,GACD,EAAI,GAAQ,CACR,KAAM,GACN,MAAO,IAEX,UACC,GACD,EAAI,GAAQ,CACR,KAAM,GACN,MAAO,EAAQ,QAAQ,MAE3B,UACC,GACD,EAAI,GAAQ,CACR,KAAM,GACN,MAAO,EAAQ,SAAS,EAAU,KAEtC,GAAY,EACZ,UACC,GACD,EAAI,GAAQ,CACR,KAAM,GACN,MAAO,EAAQ,SAAS,EAAU,KAEtC,GAAY,EACZ,UACC,GACD,EAAI,GAAQ,CACR,KAAM,GACN,MAAO,GAAI,IAAM,GAAI,YAAW,EAAQ,OAAQ,EAAQ,WAAa,EAAU,KAEnF,GAAY,EACZ,UACC,GACD,GAAM,GAAe,EAAQ,UAAU,EAAU,IACjD,GAAY,EACZ,EAAI,GAAQ,CACR,KAAM,GACN,MAAO,GAAI,YAAW,EAAQ,OAAQ,EAAQ,WAAa,EAAU,IAEzE,GAAY,EACZ,UACC,GACD,GAAM,GAAe,EAAQ,UAAU,EAAU,IACjD,GAAY,EACZ,EAAI,GAAQ,CACR,KAAM,GACN,MAAO,KAAK,OAAO,GAAI,YAAW,EAAQ,OAAQ,EAAQ,WAAa,EAAU,KAErF,GAAY,EACZ,UACC,GACD,EAAI,GAAQ,CACR,KAAM,GACN,MAAO,GAAI,MAAK,GAAI,IAAM,GAAI,YAAW,EAAQ,OAAQ,EAAQ,WAAa,EAAU,IAAI,YAEhG,GAAY,EACZ,UACC,GACD,GAAM,GAAY,GAAI,YAAW,EAAQ,OAAQ,EAAQ,WAAa,EAAU,IAChF,GAAY,GACZ,EAAI,GAAQ,CACR,KAAM,GACN,MAAO,GAAG,GAAM,EAAU,SAAS,EAAG,OAAO,GAAM,EAAU,SAAS,EAAG,OAAO,GAAM,EAAU,SAAS,EAAG,OAAO,GAAM,EAAU,SAAS,EAAG,QAAQ,GAAM,EAAU,SAAS,QAEpL,cAEA,KAAM,IAAI,OAAM,iCAG5B,MAAO,KAGX,GACJ,AAAC,UAAU,EAAmB,CAC1B,EAAkB,EAAkB,SAAc,GAAK,WACvD,EAAkB,EAAkB,UAAe,GAAK,YACxD,EAAkB,EAAkB,KAAU,GAAK,OACnD,EAAkB,EAAkB,MAAW,GAAK,QACpD,EAAkB,EAAkB,QAAa,GAAK,UACtD,EAAkB,EAAkB,KAAU,GAAK,OACnD,EAAkB,EAAkB,UAAe,GAAK,YACxD,EAAkB,EAAkB,OAAY,GAAK,SACrD,EAAkB,EAAkB,UAAe,GAAK,YACxD,EAAkB,EAAkB,KAAU,GAAK,SACpD,IAAsB,IAAoB,KAC7C,GAAM,IAAc,UACd,GAAW,OACX,GAAY,QACZ,GAAU,UACV,GAAW,OACX,GAAa,SACb,GAAa,SACb,GAAgB,YAChB,GAAW,OACX,GAAe,iEAEf,GAAoB,AAAC,GAAU,CACjC,GAAI,MAAO,IAAU,WACjB,MAAO,GACX,GAAM,GAAc,QAAQ,QAAQ,GACpC,MAAO,IAAM,GAGX,GAAe,AAAC,GACd,MAAO,IAAS,SACT,GAAW,GAElB,YAAY,OAAO,GACZ,GAAI,YAAW,EAAK,OAAQ,EAAK,WAAY,EAAK,WAAa,WAAW,mBAE9E,GAAI,YAAW,GAGpB,GAAwB,kBACxB,GAAyB,mBACzB,GAAuB,aACvB,GAA6B,sBAC7B,GAAsB,gBACtB,GAAwB,kBACxB,GAAoB,uBACpB,GAAc,gBACd,GAAkB,GAAqB,cACvC,GAAc,OACd,GAAoB,CAAC,GAAa,GAAiB,IACnD,GAAmB,GAAsB,cACzC,GAAgB,uBAChB,GAAe,GAAkB,cACjC,GAA4B,CAC9B,cAAe,GACf,gBAAiB,GACjB,WAAY,GACZ,OAAQ,GACR,KAAM,GACN,aAAc,GACd,eAAgB,GAChB,OAAQ,GACR,QAAS,GACT,GAAI,GACJ,QAAS,GACT,oBAAqB,GACrB,QAAS,GACT,aAAc,GACd,kBAAmB,IAEjB,GAAuB,UACvB,GAAqB,QACrB,GAAuB,mBACvB,GAA6B,2BAC7B,GAAmB,mBACnB,GAAiB,GACjB,GAAsB,eACtB,GAAoB,GAAK,GAAK,GAAK,EAEnC,GAAkB,GAClB,GAAa,GACb,GAAc,CAAC,EAAW,EAAQ,IAAY,GAAG,KAAa,KAAU,KAAW,KACnF,GAAgB,MAAO,EAAmB,EAAa,EAAW,EAAQ,IAAY,CACxF,GAAM,GAAY,KAAM,IAAK,EAAmB,EAAY,gBAAiB,EAAY,aACnF,EAAW,GAAG,KAAa,KAAU,KAAW,GAAM,MAAc,EAAY,eACtF,GAAI,IAAY,IACZ,MAAO,IAAgB,GAG3B,IADA,GAAW,KAAK,GACT,GAAW,OAAS,IACvB,MAAO,IAAgB,GAAW,SAEtC,GAAI,GAAM,OAAO,EAAY,kBAC7B,OAAW,KAAY,CAAC,EAAW,EAAQ,EAAS,IAChD,EAAM,KAAM,IAAK,EAAmB,EAAK,GAE7C,MAAQ,IAAgB,GAAY,GAElC,GAAO,CAAC,EAAM,EAAQ,IAAS,CACjC,GAAM,GAAO,GAAI,GAAK,GACtB,SAAK,OAAO,GAAa,IAClB,EAAK,UAGV,GAAsB,CAAC,CAAE,WAAW,EAAmB,IAAoB,CAC7E,GAAM,GAAY,GAClB,OAAW,KAAc,QAAO,KAAK,GAAS,OAAQ,CAClD,GAAI,EAAQ,IAAe,KACvB,SAEJ,GAAM,GAAsB,EAAW,cACvC,AAAI,KAAuB,KACvB,GAAmB,IAAI,IACvB,GAAqB,KAAK,IAC1B,GAAmB,KAAK,KACpB,EAAC,GAAoB,GAAmB,CAAC,EAAgB,IAAI,KAIrE,GAAU,GAAuB,EAAQ,GAAY,OAAO,QAAQ,OAAQ,MAEhF,MAAO,IAGL,GAAY,AAAC,GAAQ,mBAAmB,GAAK,QAAQ,WAAY,IACjE,GAAY,AAAC,GAAM,IAAI,EAAE,WAAW,GAAG,SAAS,IAAI,gBAEpD,GAAoB,CAAC,CAAE,QAAQ,MAAS,CAC1C,GAAM,GAAO,GACP,EAAa,GACnB,OAAW,KAAO,QAAO,KAAK,GAAO,OAAQ,CACzC,GAAI,EAAI,gBAAkB,GACtB,SAEJ,EAAK,KAAK,GACV,GAAM,GAAQ,EAAM,GACpB,AAAI,MAAO,IAAU,SACjB,EAAW,GAAO,GAAG,GAAU,MAAQ,GAAU,KAE5C,MAAM,QAAQ,IACnB,GAAW,GAAO,EACb,MAAM,GACN,OACA,OAAO,CAAC,EAAS,IAAU,EAAQ,OAAO,CAAC,GAAG,GAAU,MAAQ,GAAU,OAAY,IACtF,KAAK,MAGlB,MAAO,GACF,IAAI,AAAC,GAAQ,EAAW,IACxB,OAAO,AAAC,GAAe,GACvB,KAAK,MAGR,GAAgB,AAAC,GAAS,MAAO,cAAgB,YAAc,YAAe,cAChF,OAAO,UAAU,SAAS,KAAK,KAAS,uBAEtC,GAAiB,MAAO,CAAE,UAAS,QAAQ,IAAoB,CACjE,OAAW,KAAc,QAAO,KAAK,GACjC,GAAI,EAAW,gBAAkB,GAC7B,MAAO,GAAQ,GAGvB,GAAI,GAAQ,KACR,MAAO,mEAEN,GAAI,MAAO,IAAS,UAAY,YAAY,OAAO,IAAS,GAAc,GAAO,CAClF,GAAM,GAAW,GAAI,GACrB,SAAS,OAAO,GAAa,IACtB,GAAM,KAAM,GAAS,UAEhC,MAAO,KAGL,GAAY,CAAC,EAAc,IAAY,CACzC,EAAe,EAAa,cAC5B,OAAW,KAAc,QAAO,KAAK,GACjC,GAAI,IAAiB,EAAW,cAC5B,MAAO,GAGf,MAAO,IAGL,GAAe,CAAC,CAAE,UAAS,WAAU,KAAY,KAChD,EACH,QAAS,IAAK,GACd,MAAO,EAAQ,GAAW,GAAS,SAEjC,GAAa,AAAC,GAAU,OAAO,KAAK,GAAO,OAAO,CAAC,EAAO,IAAc,CAC1E,GAAM,GAAQ,EAAM,GACpB,MAAO,IACA,GACF,GAAY,MAAM,QAAQ,GAAS,CAAC,GAAG,GAAS,IAEtD,IAEG,GAAqB,CAAC,EAAS,EAAU,KAAO,CAClD,GAAM,CAAE,UAAS,QAAQ,IAAO,MAAO,GAAQ,OAAU,WAAa,EAAQ,QAAU,GAAa,GACrG,OAAW,KAAQ,QAAO,KAAK,GAAU,CACrC,GAAM,GAAQ,EAAK,cACnB,AAAI,EAAM,MAAM,EAAG,KAAO,UAAY,CAAC,EAAQ,oBAAoB,IAAI,IACnE,GAAM,GAAQ,EAAQ,GACtB,MAAO,GAAQ,IAGvB,MAAO,IACA,EACH,UACA,UAIF,GAAiB,AAAC,GAAY,CAChC,EAAU,MAAO,GAAQ,OAAU,WAAa,EAAQ,QAAU,GAAa,GAC/E,OAAW,KAAc,QAAO,KAAK,EAAQ,SACzC,AAAI,GAAkB,QAAQ,EAAW,eAAiB,IACtD,MAAO,GAAQ,QAAQ,GAG/B,MAAO,IAGL,GAAU,AAAC,GAAS,GAAO,GAC5B,cACA,QAAQ,YAAa,KACpB,GAAS,AAAC,GACR,MAAO,IAAS,SACT,GAAI,MAAK,EAAO,KAEvB,MAAO,IAAS,SACZ,OAAO,GACA,GAAI,MAAK,OAAO,GAAQ,KAE5B,GAAI,MAAK,GAEb,EAGX,QAAkB,CACd,YAAY,CAAE,gBAAe,cAAa,SAAQ,UAAS,SAAQ,gBAAgB,IAAS,CACxF,KAAK,iBAAmB,GAAI,IAAiB,GAAU,IACvD,KAAK,QAAU,EACf,KAAK,OAAS,EACd,KAAK,cAAgB,EACrB,KAAK,cAAgB,MAAO,IAAkB,UAAY,EAAgB,GAC1E,KAAK,eAAiB,GAAkB,GACxC,KAAK,mBAAqB,GAAkB,QAE1C,SAAQ,EAAiB,EAAU,GAAI,CACzC,GAAM,CAAE,cAAc,GAAI,MAAQ,YAAY,KAAM,oBAAmB,qBAAoB,kBAAiB,gBAAe,kBAAoB,EACzI,EAAc,KAAM,MAAK,qBAC/B,KAAK,4BAA4B,GACjC,GAAM,GAAS,GAAkB,KAAM,MAAK,iBACtC,CAAE,WAAU,aAAc,GAAW,GAC3C,GAAI,EAAY,GACZ,MAAO,SAAQ,OAAO,oGAE1B,GAAM,GAAQ,GAAY,EAAW,EAAQ,GAAkB,KAAK,SAC9D,EAAU,GAAmB,GAAe,GAAkB,CAAE,uBACtE,AAAI,EAAY,cACZ,GAAQ,MAAM,IAAqB,EAAY,cAEnD,EAAQ,MAAM,IAAyB,GACvC,EAAQ,MAAM,IAA0B,GAAG,EAAY,eAAe,IACtE,EAAQ,MAAM,IAAwB,EACtC,EAAQ,MAAM,IAAuB,EAAU,SAAS,IACxD,GAAM,GAAmB,GAAoB,EAAS,EAAmB,GACzE,SAAQ,MAAM,IAA8B,GAAuB,GACnE,EAAQ,MAAM,IAAyB,KAAM,MAAK,aAAa,EAAU,EAAO,KAAK,cAAc,EAAa,EAAQ,EAAW,GAAiB,KAAK,uBAAuB,EAAS,EAAkB,KAAM,IAAe,EAAiB,KAAK,UAC/O,OAEL,MAAK,EAAQ,EAAS,CACxB,MAAI,OAAO,IAAW,SACX,KAAK,WAAW,EAAQ,GAE1B,EAAO,SAAW,EAAO,QACvB,KAAK,UAAU,EAAQ,GAEzB,EAAO,QACL,KAAK,YAAY,EAAQ,GAGzB,KAAK,YAAY,EAAQ,QAGlC,WAAU,CAAE,UAAS,WAAW,CAAE,cAAc,GAAI,MAAQ,iBAAgB,gBAAe,kBAAkB,CAC/G,GAAM,GAAS,GAAkB,KAAM,MAAK,iBACtC,CAAE,YAAW,YAAa,GAAW,GACrC,EAAQ,GAAY,EAAW,EAAQ,GAAkB,KAAK,SAC9D,EAAgB,KAAM,IAAe,CAAE,QAAS,GAAI,KAAM,GAAW,KAAK,QAC1E,EAAO,GAAI,MAAK,OACtB,EAAK,OAAO,GACZ,GAAM,GAAgB,GAAM,KAAM,GAAK,UACjC,EAAe,CACjB,GACA,EACA,EACA,EACA,EACA,GACF,KAAK;AAAA,GACP,MAAO,MAAK,WAAW,EAAc,CAAE,cAAa,cAAe,EAAQ,wBAEzE,aAAY,EAAiB,CAAE,cAAc,GAAI,MAAQ,gBAAe,kBAAkB,CAU5F,MAAO,AATS,MAAK,UAAU,CAC3B,QAAS,KAAK,iBAAiB,OAAO,EAAgB,QAAQ,SAC9D,QAAS,EAAgB,QAAQ,MAClC,CACC,cACA,gBACA,iBACA,eAAgB,EAAgB,iBAErB,KAAK,AAAC,GACV,EAAE,QAAS,EAAgB,QAAS,oBAG7C,YAAW,EAAc,CAAE,cAAc,GAAI,MAAQ,gBAAe,kBAAmB,GAAI,CAC7F,GAAM,GAAc,KAAM,MAAK,qBAC/B,KAAK,4BAA4B,GACjC,GAAM,GAAS,GAAkB,KAAM,MAAK,iBACtC,CAAE,aAAc,GAAW,GAC3B,EAAO,GAAI,MAAK,OAAO,KAAM,MAAK,cAAc,EAAa,EAAQ,EAAW,IACtF,SAAK,OAAO,GAAa,IAClB,GAAM,KAAM,GAAK,eAEtB,aAAY,EAAe,CAAE,cAAc,GAAI,MAAQ,kBAAiB,oBAAmB,gBAAe,kBAAoB,GAAI,CACpI,GAAM,GAAc,KAAM,MAAK,qBAC/B,KAAK,4BAA4B,GACjC,GAAM,GAAS,GAAkB,KAAM,MAAK,iBACtC,EAAU,GAAe,GACzB,CAAE,WAAU,aAAc,GAAW,GACrC,EAAQ,GAAY,EAAW,EAAQ,GAAkB,KAAK,SACpE,EAAQ,QAAQ,IAAmB,EAC/B,EAAY,cACZ,GAAQ,QAAQ,IAAgB,EAAY,cAEhD,GAAM,GAAc,KAAM,IAAe,EAAS,KAAK,QACvD,AAAI,CAAC,GAAU,GAAe,EAAQ,UAAY,KAAK,eACnD,GAAQ,QAAQ,IAAiB,GAErC,GAAM,GAAmB,GAAoB,EAAS,EAAmB,GACnE,EAAY,KAAM,MAAK,aAAa,EAAU,EAAO,KAAK,cAAc,EAAa,EAAQ,EAAW,GAAiB,KAAK,uBAAuB,EAAS,EAAkB,IACtL,SAAQ,QAAQ,IACZ,GAAG,iBACe,EAAY,eAAe,oBACxB,GAAuB,iBAC3B,IACd,EAEX,uBAAuB,EAAS,EAAkB,EAAa,CAC3D,GAAM,GAAgB,OAAO,KAAK,GAAkB,OACpD,MAAO,GAAG,EAAQ;AAAA,EACxB,KAAK,iBAAiB;AAAA,EACtB,GAAkB;AAAA,EAClB,EAAc,IAAI,AAAC,GAAS,GAAG,KAAQ,EAAiB,MAAS,KAAK;AAAA;AAAA;AAAA,EAEtE,EAAc,KAAK;AAAA,EACnB,SAEQ,oBAAmB,EAAU,EAAiB,EAAkB,CAClE,GAAM,GAAO,GAAI,MAAK,OACtB,EAAK,OAAO,GAAa,IACzB,GAAM,GAAgB,KAAM,GAAK,SACjC,MAAO,GAAG;AAAA,EAChB;AAAA,EACA;AAAA,EACA,GAAM,KAEJ,iBAAiB,CAAE,QAAQ,CACvB,GAAI,KAAK,cAAe,CACpB,GAAM,GAAyB,GAC/B,OAAW,KAAe,GAAK,MAAM,KACjC,AAAI,GAAa,SAAW,GAExB,IAAgB,KAEpB,CAAI,IAAgB,KAChB,EAAuB,MAGvB,EAAuB,KAAK,IAGpC,GAAM,GAAiB,GAAG,GAAM,WAAW,KAAO,IAAM,KAAK,EAAuB,KAAK,OAAO,EAAuB,OAAS,GAAK,GAAM,SAAS,KAAO,IAAM,KAEjK,MAAO,AADe,oBAAmB,GACpB,QAAQ,OAAQ,KAEzC,MAAO,QAEL,cAAa,EAAU,EAAiB,EAAY,EAAkB,CACxE,GAAM,GAAe,KAAM,MAAK,mBAAmB,EAAU,EAAiB,GACxE,EAAO,GAAI,MAAK,OAAO,KAAM,IACnC,SAAK,OAAO,GAAa,IAClB,GAAM,KAAM,GAAK,UAE5B,cAAc,EAAa,EAAQ,EAAW,EAAS,CACnD,MAAO,IAAc,KAAK,OAAQ,EAAa,EAAW,EAAQ,GAAW,KAAK,SAEtF,4BAA4B,EAAa,CACrC,GAAI,MAAO,IAAgB,UACvB,MAAO,GAAY,aAAgB,UACnC,MAAO,GAAY,iBAAoB,SACvC,KAAM,IAAI,OAAM,6CAItB,GAAa,AAAC,GAAQ,CACxB,GAAM,GAAW,GAAQ,GAAK,QAAQ,SAAU,IAChD,MAAO,CACH,WACA,UAAW,EAAS,MAAM,EAAG,KAG/B,GAAyB,AAAC,GAAY,OAAO,KAAK,GAAS,OAAO,KAAK,KAEvE,GAA2B,IAC3B,GAAuB,AAAC,GAAU,CACpC,GAAM,GAAkB,EAAM,YACxB,GAA4B,EAAM,aAClC,EAAM,0BAA0B,GAChC,CAAE,oBAAoB,GAAM,oBAAoB,EAAM,mBAAqB,EAAG,UAAW,EAC3F,EACJ,MAAI,GAAM,OACN,EAAS,GAAkB,EAAM,QAEhC,AAAI,EAAM,mBACX,EAAS,IAAM,GAAkB,EAAM,UAClC,KAAK,KAAO,IAAW,CACvB,KAAM,GAAM,mBAAmB,EAAQ,CACpC,gBAAiB,KAAM,GAAM,kBAC7B,qBAAsB,KAAM,GAAM,0BAC/B,GACP,IAEC,KAAK,CAAC,CAAC,EAAY,KAAY,CAChC,GAAM,CAAE,gBAAe,kBAAmB,EAC1C,EAAM,cAAgB,EAAM,eAAiB,GAAiB,EAC9D,EAAM,YAAc,EAAM,aAAe,GAAkB,EAAM,UACjE,GAAM,GAAS,IACR,EACH,YAAa,EACb,OAAQ,EAAM,cACd,QAAS,EAAM,YACf,SACA,cAAe,GAEb,EAAa,EAAM,mBAAqB,GAC9C,MAAO,IAAI,GAAW,KAI1B,EAAS,KAAO,IAAe,CAC3B,EAAa,OAAO,OAAO,GAAI,CAC3B,KAAM,QACN,YAAa,EAAM,aAAe,EAAM,mBACxC,cAAe,KAAM,IAAkB,EAAM,UAC7C,WAAY,IACb,GACH,GAAM,GAAgB,EAAW,cAC3B,EAAiB,EAAW,YAClC,EAAM,cAAgB,EAAM,eAAiB,EAC7C,EAAM,YAAc,EAAM,aAAe,GAAkB,EAAM,UACjE,GAAM,GAAS,IACR,EACH,YAAa,EACb,OAAQ,EAAM,cACd,QAAS,EAAM,YACf,SACA,cAAe,GAEb,EAAa,EAAM,mBAAqB,GAC9C,MAAO,IAAI,GAAW,IAGvB,IACA,EACH,oBACA,oBACA,YAAa,EACb,WAGF,GAA8B,AAAC,GAC7B,MAAO,IAAgB,WAChB,GAAQ,EAAa,AAAC,GAAgB,EAAY,aAAe,QACpE,EAAY,WAAW,UAAY,KAAK,MAAQ,GAA0B,AAAC,GAAgB,EAAY,aAAe,QAEvH,GAAkB,GAG7B,YAAgC,EAAO,CACnC,MAAO,IACA,EACH,gBAAiB,MAAO,GAAM,iBAAoB,SAAW,CAAC,CAAC,EAAM,kBAAoB,EAAM,iBAIvG,GAAM,IAAa,CACjB,CACE,GAAI,MACJ,QAAS,CACP,UAAW,gBACX,mBAAoB,UACpB,KAAM,MACN,kBAAmB,GACnB,aAAc,IAEhB,YAAa,yCACb,QAAS,CACP,aAAc,CACZ,YAAa,sBAEf,YAAa,CACX,YAAa,4BAEf,iBAAkB,CAChB,YAAa,wBAEf,iBAAkB,CAChB,YAAa,wBAEf,iBAAkB,CAChB,YAAa,wBAEf,aAAc,CACZ,YAAa,yBAEf,aAAc,CACZ,YAAa,4BAEf,iBAAkB,CAChB,YAAa,4BAEf,iBAAkB,CAChB,YAAa,yBAEf,iBAAkB,CAChB,YAAa,0BAEf,iBAAkB,CAChB,YAAa,4BAEf,aAAc,CACZ,YAAa,8BAEf,eAAgB,CACd,YAAa,oBAEf,eAAgB,CACd,YAAa,sBAEf,eAAgB,CACd,YAAa,mBAEf,aAAc,CACZ,YAAa,sBAEf,aAAc,CACZ,YAAa,kBAEf,aAAc,CACZ,YAAa,kBAEf,YAAa,CACX,YAAa,oBAEf,YAAa,CACX,YAAa,mBAEf,YAAa,CACX,YAAa,kBAEf,eAAgB,CACd,YAAa,qBAEf,aAAc,CACZ,YAAa,yBAEf,YAAa,CACX,YAAa,6BAEf,YAAa,CACX,YAAa,yBAEf,YAAa,CACX,YAAa,kBAEf,YAAa,CACX,YAAa,2BAEf,YAAa,CACX,YAAa,sBAInB,CACE,GAAI,SACJ,QAAS,CACP,UAAW,mBACX,mBAAoB,+BACpB,KAAM,SACN,kBAAmB,GACnB,aAAc,IAEhB,YAAa,qBACb,QAAS,CACP,gBAAiB,CACf,YAAa,2BAEf,aAAc,CACZ,YAAa,mBAEf,iBAAkB,CAChB,YAAa,qBAInB,CACE,GAAI,aACJ,QAAS,CACP,UAAW,gBACX,mBAAoB,UACpB,KAAM,aACN,kBAAmB,GACnB,aAAc,IAEhB,YAAa,2BACb,QAAS,CACP,oBAAqB,CACnB,YAAa,mCAEf,gBAAiB,CACf,YAAa,0BAEf,gBAAiB,CACf,YAAa,4BAInB,CACE,GAAI,UACJ,QAAS,CACP,UAAW,aACX,mBAAoB,aACpB,KAAM,UACN,kBAAmB,GACnB,aAAc,IAEhB,YAAa,2BACb,QAAS,CACP,iBAAkB,CAChB,YAAa,8BAEf,gBAAiB,CACf,YAAa,eAEf,gBAAiB,CACf,YAAa,iBAInB,CACE,GAAI,YACJ,QAAS,CACP,UAAW,gBACX,mBAAoB,gBACpB,KAAM,YACN,kBAAmB,GACnB,aAAc,IAEhB,YAAa,4BACb,QAAS,CACP,mBAAoB,CAClB,YAAa,+BAEf,iBAAkB,CAChB,YAAa,yBAInB,CACE,GAAI,YACJ,QAAS,CACP,UAAW,iBACX,mBAAoB,iBACpB,KAAM,YACN,kBAAmB,GACnB,aAAc,IAEhB,YAAa,4BACb,QAAS,IAGX,CACE,GAAI,YACJ,QAAS,CACP,UAAW,iBACX,mBAAoB,iBACpB,KAAM,YACN,kBAAmB,GACnB,aAAc,IAEhB,YAAa,4BACb,QAAS,KAIP,GAAY,MACd,GAAiB,CACnB,WAAY,GACZ,QAAS,IAGP,GAAyB,GACzB,GAA0B,GACxB,GAAY,AAAC,GAAU,CACzB,GAAM,CAAE,cAAe,GACvB,OAAW,KAAa,GAAY,CAChC,GAAM,CAAE,UAAS,WAAY,EAC7B,OAAW,CAAC,EAAQ,IAAe,QAAO,QAAQ,GAC9C,GAAI,IAAW,EACX,MAAO,IACA,KACA,GAKnB,OAAW,KAAa,GAAY,CAChC,GAAM,CAAE,cAAa,WAAY,EACjC,GAAI,GAAI,QAAO,GAAa,KAAK,GAC7B,MAAO,IACA,GAIf,GAAM,GAAoB,EAAW,KAAK,AAAC,GAAc,EAAU,KAAO,OAC1E,GAAI,CAAC,EACD,KAAM,IAAI,OAAM,qHAGpB,MAAO,IACA,EAAkB,UAGvB,GAAmB,CAAC,EAAgB,EAAkB,KAAO,CAC/D,GAAyB,EACzB,GAA0B,GAExB,GAA0B,IAAM,CAClC,GAAiB,GAAgB,KAE/B,GAAqB,IAAM,GAE3B,GAAc,GAAI,QAAO,oGACzB,GAAc,AAAC,GAAU,GAAY,KAAK,IAAW,EAAM,WAAW,MAAQ,EAAM,SAAS,KAE7F,GAAU,YAEhB,YAAuB,EAAO,CAC1B,MAAI,OAAO,IAAU,UAAY,GAAS,KAC/B,EAEP,OAAS,GACF,IAAI,GAAc,EAAM,OAE/B,MAAQ,GACD,GAAG,EAAM,MAAO,GAAM,MAAQ,IAAI,IAAI,IAAe,KAAK,SAE9D,KAAK,UAAU,EAAO,KAAM,GAGvC,oBAA4B,MAAM,CAC9B,YAAY,EAAS,CACjB,MAAM,GACN,KAAK,KAAO,kBAId,GAAyB,GAAI,QAAO,qCACpC,GAAmB,CAAC,EAAO,EAAkB,KAAU,CACzD,GAAI,CAAC,EACD,MAAO,IAAuB,KAAK,GAEvC,GAAM,GAAS,EAAM,MAAM,KAC3B,OAAW,KAAS,GAChB,GAAI,CAAC,GAAiB,GAClB,MAAO,GAGf,MAAO,IAGL,GAA4B,CAAC,EAAO,EAAkB,KAAU,CAClE,GAAI,EAAiB,CACjB,OAAW,KAAS,GAAM,MAAM,KAC5B,GAAI,CAAC,GAA0B,GAC3B,MAAO,GAGf,MAAO,GAWX,MATI,GAAC,GAAiB,IAGlB,EAAM,OAAS,GAAK,EAAM,OAAS,IAGnC,IAAU,EAAM,eAGhB,GAAY,KAMd,GAAW,AAAC,GAAU,CACxB,GAAM,GAAW,EAAM,MAAM,KAC7B,GAAI,EAAS,OAAS,EAClB,MAAO,MACX,GAAM,CAAC,EAAK,EAAW,EAAS,EAAQ,KAAc,GAAc,EACpE,MAAI,KAAQ,OAAS,IAAc,IAAM,IAAY,IAAM,EAAW,KAAO,GAClE,KACJ,CACH,YACA,UACA,SACA,YACA,WAAY,EAAW,GAAG,SAAS,KAAO,EAAW,GAAG,MAAM,KAAO,IAIzE,GAAqB,OAAO,OAAO,CACnC,UAAW,KACX,0BAA2B,GAC3B,SAAU,GACV,UAAW,GACX,iBAAkB,GAClB,wBAAyB,GACzB,mBAAoB,KAGlB,GAAgB,CAAC,EAAQ,IAAW,IAAW,EAE/C,GAAkB,AAAC,GAAS,CAC9B,GAAM,GAAQ,EAAK,MAAM,KACnB,EAAW,GACjB,OAAW,KAAQ,GAAO,CACtB,GAAM,GAAqB,EAAK,QAAQ,KACxC,GAAI,IAAuB,GAAI,CAC3B,GAAI,EAAK,QAAQ,OAAS,EAAK,OAAS,EACpC,KAAM,IAAI,IAAc,UAAU,4BAEtC,GAAM,GAAa,EAAK,MAAM,EAAqB,EAAG,IACtD,GAAI,OAAO,MAAM,SAAS,IACtB,KAAM,IAAI,IAAc,yBAAyB,gBAAyB,MAE9E,AAAI,IAAuB,GACvB,EAAS,KAAK,EAAK,MAAM,EAAG,IAEhC,EAAS,KAAK,OAGd,GAAS,KAAK,GAGtB,MAAO,IAGL,GAAU,CAAC,EAAO,IAAS,GAAgB,GAAM,OAAO,CAAC,EAAK,IAAU,CAC1E,GAAI,MAAO,IAAQ,SACf,KAAM,IAAI,IAAc,UAAU,UAAc,oBAAuB,KAAK,UAAU,OAErF,MAAI,OAAM,QAAQ,GACZ,EAAI,SAAS,IAEjB,EAAI,IACZ,GAEG,GAAQ,AAAC,GAAU,GAAS,KAE5B,GAAM,AAAC,GAAU,CAAC,EAEpB,GACJ,AAAC,UAAU,EAAiB,CACxB,EAAgB,KAAU,OAC1B,EAAgB,EAAO,MACxB,IAAoB,IAAkB,KAEzC,GAAM,IAAgB,EACjB,GAAkB,MAAO,IACzB,GAAkB,OAAQ,KAEzB,GAAW,AAAC,GAAU,CACxB,GAAM,GAAa,KAAM,CACrB,GAAI,CACA,GAAI,YAAiB,KACjB,MAAO,GAEX,GAAI,MAAO,IAAU,UAAY,YAAc,GAAO,CAClD,GAAM,CAAE,WAAU,OAAM,WAAW,GAAI,OAAO,GAAI,QAAQ,IAAO,EAC3D,EAAM,GAAI,KAAI,GAAG,MAAa,IAAW,EAAO,IAAI,IAAS,KAAK,KACxE,SAAI,OAAS,OAAO,QAAQ,GACvB,IAAI,CAAC,CAAC,EAAG,KAAO,GAAG,KAAK,KACxB,KAAK,KACH,EAEX,MAAO,IAAI,KAAI,SAEZ,EAAP,CACI,MAAO,WAGf,GAAI,CAAC,EACD,eAAQ,MAAM,mBAAmB,KAAK,UAAU,uBACzC,KAEX,GAAM,GAAY,EAAU,KACtB,CAAE,OAAM,WAAU,WAAU,WAAU,UAAW,EACvD,GAAI,EACA,MAAO,MAEX,GAAM,GAAS,EAAS,MAAM,EAAG,IACjC,GAAI,CAAC,OAAO,OAAO,IAAmB,SAAS,GAC3C,MAAO,MAEX,GAAM,GAAO,GAAY,GACnB,EAA2B,EAAU,SAAS,GAAG,KAAQ,GAAc,OACxE,MAAO,IAAU,UAAY,EAAM,SAAS,GAAG,KAAQ,GAAc,MACpE,EAAY,GAAG,IAAO,EAA2B,IAAI,GAAc,KAAY,KACrF,MAAO,CACH,SACA,YACA,KAAM,EACN,eAAgB,EAAS,SAAS,KAAO,EAAW,GAAG,KACvD,SAIF,GAAe,CAAC,EAAQ,IAAW,IAAW,EAE9C,GAAY,CAAC,EAAO,EAAO,EAAM,IAC/B,GAAS,GAAQ,EAAM,OAAS,EACzB,KAEN,EAGE,EAAM,UAAU,EAAM,OAAS,EAAM,EAAM,OAAS,GAFhD,EAAM,UAAU,EAAO,GAKhC,GAAY,AAAC,GAAU,mBAAmB,GAAO,QAAQ,WAAY,AAAC,GAAM,IAAI,EAAE,WAAW,GAAG,SAAS,IAAI,iBAE/G,GAAmB,OAAO,OAAO,CACjC,UAAW,KACX,IAAK,GACL,cAAe,GACf,QAAS,GACT,MAAO,GACP,iBAAkB,GAClB,IAAK,GACL,SAAU,GACV,aAAc,GACd,UAAW,GACX,UAAW,KAGT,GAAmB,CAAC,EAAU,IAAY,CAC5C,GAAM,GAAuB,GACvB,EAAkB,IACjB,EAAQ,kBACR,EAAQ,iBAEX,EAAe,EACnB,KAAO,EAAe,EAAS,QAAQ,CACnC,GAAM,GAAoB,EAAS,QAAQ,IAAK,GAChD,GAAI,IAAsB,GAAI,CAC1B,EAAqB,KAAK,EAAS,MAAM,IACzC,MAEJ,EAAqB,KAAK,EAAS,MAAM,EAAc,IACvD,GAAM,GAAoB,EAAS,QAAQ,IAAK,GAChD,GAAI,IAAsB,GAAI,CAC1B,EAAqB,KAAK,EAAS,MAAM,IACzC,MAEJ,AAAI,EAAS,EAAoB,KAAO,KAAO,EAAS,EAAoB,KAAO,KAC/E,GAAqB,KAAK,EAAS,MAAM,EAAoB,EAAG,IAChE,EAAe,EAAoB,GAEvC,GAAM,GAAgB,EAAS,UAAU,EAAoB,EAAG,GAChE,GAAI,EAAc,SAAS,KAAM,CAC7B,GAAM,CAAC,EAAS,GAAY,EAAc,MAAM,KAChD,EAAqB,KAAK,GAAQ,EAAgB,GAAU,QAG5D,GAAqB,KAAK,EAAgB,IAE9C,EAAe,EAAoB,EAEvC,MAAO,GAAqB,KAAK,KAG/B,GAAoB,CAAC,CAAE,OAAO,IAKzB,AAJiB,KACjB,EAAQ,kBACR,EAAQ,kBAEQ,GAGrB,GAAqB,CAAC,EAAK,EAAS,IAAY,CAClD,GAAI,MAAO,IAAQ,SACf,MAAO,IAAiB,EAAK,GAE5B,GAAI,EAAI,GACT,MAAO,IAAa,EAAK,GAExB,GAAI,EAAI,IACT,MAAO,IAAkB,EAAK,GAElC,KAAM,IAAI,IAAc,IAAI,OAAa,OAAO,+CAG9C,GAAe,CAAC,CAAE,KAAI,QAAQ,IAAY,CAC5C,GAAM,GAAgB,EAAK,IAAI,AAAC,GAAQ,CAAC,UAAW,UAAU,SAAS,MAAO,IAAO,EAAM,GAAmB,EAAK,MAAO,IAC1H,MAAO,GAAG,MAAM,KAAK,OAAO,CAAC,EAAK,IAAQ,EAAI,GAAM,IAAK,GAAG,IAG1D,GAAoB,CAAC,CAAE,YAAW,GAAU,IAAY,CAC1D,GAAI,GAAU,IAAU,GAAQ,gBAC5B,KAAM,IAAI,IAAc,IAAI,8CAEhC,GAAM,GAAQ,GAAa,EAAQ,GACnC,SAAQ,QAAQ,QAAQ,GAAS,sBAAsB,GAAc,QAAa,GAAc,MACzF,CACH,OAAQ,IAAU,GAAK,GAAO,CAAC,CAAC,KAC5B,GAAU,MAAQ,CAAE,SAAU,CAAE,KAAM,EAAQ,YAIpD,GAAqB,CAAC,EAAa,GAAI,IAAY,CACrD,GAAM,GAA4B,GAClC,OAAW,KAAa,GAAY,CAChC,GAAM,CAAE,SAAQ,YAAa,GAAkB,EAAW,IACnD,EACH,gBAAiB,IACV,EAAQ,mBACR,KAGX,GAAI,CAAC,EACD,MAAO,CAAE,UAEb,AAAI,GACA,GAA0B,EAAS,MAAQ,EAAS,MACpD,EAAQ,QAAQ,QAAQ,GAAS,WAAW,EAAS,WAAW,GAAc,EAAS,WAG/F,MAAO,CAAE,OAAQ,GAAM,gBAAiB,IAGtC,GAAqB,CAAC,EAAS,IAAY,OAAO,QAAQ,GAAS,OAAO,CAAC,EAAK,CAAC,EAAW,KAAgB,KAC3G,GACF,GAAY,EAAU,IAAI,AAAC,GAAmB,CAC3C,GAAM,GAAgB,GAAmB,EAAgB,qBAAsB,GAC/E,GAAI,MAAO,IAAkB,SACzB,KAAM,IAAI,IAAc,WAAW,aAAqB,sBAE5D,MAAO,OAEX,IAEE,GAAsB,CAAC,EAAU,IAAY,CAC/C,GAAI,MAAM,QAAQ,GACd,MAAO,GAAS,IAAI,AAAC,GAAkB,GAAoB,EAAe,IAE9E,OAAQ,MAAO,QACN,SACD,MAAO,IAAiB,EAAU,OACjC,SACD,GAAI,IAAa,KACb,KAAM,IAAI,IAAc,iCAAiC,KAE7D,MAAO,IAAsB,EAAU,OACtC,UACD,MAAO,WAEP,KAAM,IAAI,IAAc,sCAAsC,MAAO,QAI3E,GAAwB,CAAC,EAAY,IAAY,OAAO,QAAQ,GAAY,OAAO,CAAC,EAAK,CAAC,EAAa,KAAkB,KACxH,GACF,GAAc,GAAoB,EAAa,KAChD,IAEE,GAAiB,CAAC,EAAa,IAAY,CAC7C,GAAM,GAAa,GAAmB,EAAa,eAAgB,GACnE,GAAI,MAAO,IAAe,SACtB,GAAI,CACA,MAAO,IAAI,KAAI,SAEZ,EAAP,CACI,cAAQ,MAAM,gCAAgC,IAAc,GACtD,EAGd,KAAM,IAAI,IAAc,sCAAsC,MAAO,OAGnE,GAAuB,CAAC,EAAc,IAAY,CACpD,GAAM,CAAE,aAAY,YAAa,EAC3B,CAAE,SAAQ,mBAAoB,GAAmB,EAAY,GACnE,GAAI,CAAC,EACD,OAEJ,GAAM,GAAsB,IACrB,EACH,gBAAiB,IAAK,EAAQ,mBAAoB,IAEhD,CAAE,MAAK,aAAY,WAAY,EACrC,SAAQ,QAAQ,QAAQ,GAAS,qCAAqC,GAAc,MAC7E,IACC,GAAW,MAAa,CACxB,QAAS,GAAmB,EAAS,OAErC,GAAc,MAAa,CAC3B,WAAY,GAAsB,EAAY,IAElD,IAAK,GAAe,EAAK,KAI3B,GAAoB,CAAC,EAAW,IAAY,CAC9C,GAAM,CAAE,aAAY,SAAU,EACxB,CAAE,SAAQ,mBAAoB,GAAmB,EAAY,GACnE,GAAI,EAAC,EAGL,KAAM,IAAI,IAAc,GAAmB,EAAO,QAAS,IACpD,EACH,gBAAiB,IAAK,EAAQ,mBAAoB,OAIpD,GAAmB,CAAC,EAAU,IAAY,CAC5C,GAAM,CAAE,aAAY,SAAU,EACxB,CAAE,SAAQ,mBAAoB,GAAmB,EAAY,GACnE,GAAI,EAAC,EAGL,MAAO,IAAc,EAAO,IACrB,EACH,gBAAiB,IAAK,EAAQ,mBAAoB,MAIpD,GAAgB,CAAC,EAAO,IAAY,CACtC,OAAW,KAAQ,GACf,GAAI,EAAK,OAAS,WAAY,CAC1B,GAAM,GAAsB,GAAqB,EAAM,GACvD,GAAI,EACA,MAAO,WAGN,EAAK,OAAS,QACnB,GAAkB,EAAM,WAEnB,EAAK,OAAS,OAAQ,CAC3B,GAAM,GAAsB,GAAiB,EAAM,GACnD,GAAI,EACA,MAAO,OAIX,MAAM,IAAI,IAAc,0BAA0B,KAG1D,KAAM,IAAI,IAAc,4BAGtB,GAAkB,CAAC,EAAe,IAAY,CAChD,GAAM,CAAE,iBAAgB,UAAW,EAC7B,CAAE,aAAY,SAAU,EAC9B,EAAQ,QAAQ,QAAQ,GAAG,8BAAmC,GAAc,MAC5E,GAAM,GAAoB,OAAO,QAAQ,GACpC,OAAO,CAAC,CAAC,CAAE,KAAO,EAAE,SAAW,MAC/B,IAAI,CAAC,CAAC,EAAG,KAAO,CAAC,EAAG,EAAE,UAC3B,GAAI,EAAkB,OAAS,EAC3B,OAAW,CAAC,EAAU,IAAsB,GACxC,EAAe,GAAY,EAAe,IAAa,EAG/D,GAAM,GAAiB,OAAO,QAAQ,GACjC,OAAO,CAAC,CAAC,CAAE,KAAO,EAAE,UACpB,IAAI,CAAC,CAAC,KAAO,GAClB,OAAW,KAAiB,GACxB,GAAI,EAAe,IAAkB,KACjC,KAAM,IAAI,IAAc,gCAAgC,MAGhE,GAAM,GAAW,GAAc,EAAO,CAAE,iBAAgB,SAAQ,gBAAiB,KACjF,GAAI,EAAQ,gBAAgB,SACxB,GAAI,CACA,GAAM,GAAgB,GAAI,KAAI,EAAQ,eAAe,UAC/C,CAAE,WAAU,QAAS,EAC3B,EAAS,IAAI,SAAW,EACxB,EAAS,IAAI,KAAO,QAEjB,EAAP,EAGJ,SAAQ,QAAQ,QAAQ,GAAG,yBAA8B,GAAc,MAChE,GAGL,GAAa,aACb,GAAmB,mBACnB,GAAQ,IACR,GAAoB,IACpB,GAAuB,uCACvB,GAAwB,yCACxB,GAAiB,IAEjB,GAAsB,AAAC,GAAY,CAAC,EAAM,IAAY,KAAO,IAAS,CACxE,GAAM,CAAE,WAAY,EACpB,GAAI,CAAC,GAAY,WAAW,GACxB,MAAO,GAAK,GAChB,GAAM,CAAE,WAAY,EACd,EAAY,GAAS,WAAW,IAAI,KAAoB,GACxD,EAAoB,MAAM,GAAQ,4BAA4B,IAAI,IAClE,EAAkB,GAAS,iBAAiB,IAAI,KAAoB,GACpE,EAAS,KACT,EAAqB,GAAS,CAAC,GAAU,IAC1C,OAAO,CAAC,GAAG,EAAkB,GAAG,EAAW,GAAG,IAC9C,KAAK,IACJ,EAAgB,CAClB,GAAG,EAAiB,OAAO,AAAC,GAAY,EAAQ,WAAW,aAC3D,GAAG,GACL,KAAK,IACP,MAAI,GAAQ,UAAY,UAChB,IACA,GAAQ,IAAoB,EAAQ,IAC9B,GAAG,EAAQ,OAAe,IAC1B,GAEV,EAAQ,IAAc,GAGtB,EAAQ,IAAoB,EAEzB,EAAK,IACL,EACH,aAGF,GAAkB,AAAC,GAAkB,CACvC,GAAM,GAAO,EAAc,GACtB,MAAM,IACN,IAAI,AAAC,GAAS,EAAK,QAAQ,GAAsB,KACjD,KAAK,IACJ,EAAU,EAAc,IAAI,QAAQ,GAAuB,IAC3D,EAAuB,EAAK,QAAQ,IACpC,EAAS,EAAK,UAAU,EAAG,GAC7B,EAAS,EAAK,UAAU,EAAuB,GACnD,MAAI,KAAW,OACX,GAAS,EAAO,eAEb,CAAC,EAAQ,EAAQ,GACnB,OAAO,AAAC,GAAS,GAAQ,EAAK,OAAS,GACvC,OAAO,CAAC,EAAK,EAAM,IAAU,CAC9B,OAAQ,OACC,GACD,MAAO,OACN,GACD,MAAO,GAAG,KAAO,YAEjB,MAAO,GAAG,KAAO,MAE1B,KAED,GAAgC,CAClC,KAAM,yBACN,KAAM,QACN,SAAU,MACV,KAAM,CAAC,iBAAkB,cACzB,SAAU,IAER,GAAqB,AAAC,GAAY,EACpC,aAAc,AAAC,GAAgB,CAC3B,EAAY,IAAI,GAAoB,GAAS,OAIjD,GACJ,AAAC,UAAU,EAAc,CACrB,EAAa,IAAS,MACtB,EAAa,OAAY,wBAC1B,IAAiB,IAAe,KAEnC,GAAM,IAAiC,GAEjC,GAA4B,GAE5B,GAAe,AAAC,GAAW,MAAO,IAAW,UAAa,GAAO,WAAW,UAAY,EAAO,SAAS,UAExG,GAAgB,AAAC,GAAW,GAAa,GACzC,CAAC,kBAAmB,YAAY,SAAS,GACrC,YACA,EAAO,QAAQ,2BAA4B,IAC/C,EAEA,GAAsB,AAAC,GAAU,CACnC,GAAM,CAAE,SAAQ,mBAAoB,EACpC,GAAI,CAAC,EACD,KAAM,IAAI,OAAM,qBAEpB,MAAO,IACA,EACH,OAAQ,SAAY,CAChB,GAAI,MAAO,IAAW,SAClB,MAAO,IAAc,GAEzB,GAAM,GAAiB,KAAM,KAC7B,MAAO,IAAc,IAEzB,gBAAiB,SAAY,CACzB,GAAM,GAAiB,MAAO,IAAW,SAAW,EAAS,KAAM,KACnE,MAAI,IAAa,GACN,GAEJ,MAAO,IAAoB,WAAa,QAAQ,QAAQ,CAAC,CAAC,GAAmB,OAK1F,GAAwB,iBAC9B,YAAiC,EAAmB,CAChD,MAAO,AAAC,IAAS,KAAO,IAAS,CAC7B,GAAM,GAAU,EAAK,QACrB,GAAI,GAAY,WAAW,GAAU,CACjC,GAAM,CAAE,OAAM,WAAY,EAC1B,GAAI,GACA,OAAO,KAAK,GACP,IAAI,AAAC,GAAQ,EAAI,eACjB,QAAQ,MAA2B,GACxC,GAAI,CACA,GAAM,GAAS,EAAkB,GACjC,EAAQ,QAAU,IACX,EAAQ,SACV,IAAwB,OAAO,UAGjC,EAAP,GAIR,MAAO,GAAK,IACL,EACH,aAIZ,GAAM,IAAiC,CACnC,KAAM,QACN,KAAM,CAAC,qBAAsB,kBAC7B,KAAM,0BACN,SAAU,IAER,GAAyB,AAAC,GAAa,EACzC,aAAc,AAAC,GAAgB,CAC3B,EAAY,IAAI,GAAwB,EAAQ,mBAAoB,OAI5E,YAA0B,EAAa,CACnC,GAAM,GAAQ,GAEd,GADA,EAAc,EAAY,QAAQ,MAAO,IACrC,EACA,OAAW,KAAQ,GAAY,MAAM,KAAM,CACvC,GAAI,CAAC,EAAK,EAAQ,MAAQ,EAAK,MAAM,KACrC,EAAM,mBAAmB,GACrB,GACA,GAAQ,mBAAmB,IAE/B,AAAM,IAAO,GAGR,AAAI,MAAM,QAAQ,EAAM,IACzB,EAAM,GAAK,KAAK,GAGhB,EAAM,GAAO,CAAC,EAAM,GAAM,GAN1B,EAAM,GAAO,EAUzB,MAAO,GAGX,GAAM,IAAW,AAAC,GAAQ,CACtB,GAAI,MAAO,IAAQ,SACf,MAAO,IAAS,GAAI,KAAI,IAE5B,GAAM,CAAE,WAAU,WAAU,OAAM,WAAU,UAAW,EACnD,EACJ,MAAI,IACA,GAAQ,GAAiB,IAEtB,CACH,WACA,KAAM,EAAO,SAAS,GAAQ,OAC9B,WACA,KAAM,EACN,UAIF,GAAe,AAAC,GACd,MAAO,IAAa,SAChB,OAAS,GACF,GAAS,EAAS,KAEtB,EAEJ,GAAS,GAGd,GAAwB,AAAC,GAAU,CACrC,GAAM,GAAM,EAAM,KAAO,GACnB,CAAE,YAAa,EACf,EAAyB,GAAY,KAAO,SAAY,GAAa,KAAM,IAAkB,MAAe,OAElH,MAAO,IACA,EACH,SAAU,EACV,MACA,iBALqB,CAAC,CAAC,EAMvB,qBAAsB,GAAkB,EAAM,sBAAwB,IACtE,gBAAiB,GAAkB,EAAM,iBAAmB,MAIhE,GACJ,AAAC,UAAU,EAAa,CACpB,EAAY,SAAc,WAC1B,EAAY,SAAc,aAC3B,IAAgB,IAAc,KACjC,GAAM,IAAuB,EACvB,GAAqB,GAAY,SAEjC,GAAyB,CAC3B,yBACA,wBACA,yBACA,0BACA,yCACA,uBACA,mBACA,4BACA,WACA,qBACA,aACA,sBACA,2BACA,kCAEE,GAAwB,CAAC,eAAgB,iBAAkB,2BAC3D,GAA+B,CAAC,IAAK,IAAK,IAAK,KAC/C,GAA6B,CAAC,aAAc,eAAgB,QAAS,aAErE,GAAoB,AAAC,GAAU,EAAM,WAAW,iBAAmB,KACrE,GAAuB,SAAS,EAAM,OACtC,EAAM,YAAY,YAAc,GAC9B,GAAmB,AAAC,GAAU,GAAsB,SAAS,EAAM,OACrE,GAA2B,SAAS,GAAO,MAAQ,KACnD,GAA6B,SAAS,EAAM,WAAW,gBAAkB,GACvE,GAAgB,AAAC,GAAU,CAC7B,GAAI,EAAM,WAAW,iBAAmB,OAAW,CAC/C,GAAM,GAAa,EAAM,UAAU,eACnC,MAAI,MAAO,GAAc,GAAc,KAAO,CAAC,GAAiB,GAKpE,MAAO,IAGX,QAAyB,CACrB,YAAY,EAAS,CACjB,KAAK,gBAAkB,EACvB,KAAK,QAAU,GACf,KAAK,YAAc,EACnB,KAAK,eAAiB,EACtB,KAAK,aAAe,EACpB,KAAK,cAAgB,EACrB,KAAK,WAAa,EAClB,KAAK,KAAO,GAAS,MAAQ,GAC7B,KAAK,YAAc,GAAS,aAAe,EAC3C,KAAK,YAAc,GAAS,aAAe,GAC3C,KAAK,cAAgB,GAAS,eAAiB,GAC/C,KAAK,OAAS,GAAS,QAAU,GACjC,GAAM,GAAuB,KAAK,0BAClC,KAAK,iBAAmB,EACxB,KAAK,iBAAmB,KAAK,MAAM,KAAK,2BACxC,KAAK,SAAW,KAAK,YACrB,KAAK,YAAc,KAAK,YAE5B,yBAA0B,CACtB,MAAO,MAAK,MAAQ,SAElB,eAAe,CACjB,MAAO,MAAK,mBAAmB,QAE7B,oBAAmB,EAAQ,CAC7B,GAAI,EAAC,KAAK,QAIV,IADA,KAAK,oBACD,EAAS,KAAK,gBAAiB,CAC/B,GAAM,GAAU,GAAS,KAAK,iBAAmB,KAAK,SAAY,IAClE,KAAM,IAAI,SAAQ,AAAC,GAAY,WAAW,EAAS,IAEvD,KAAK,gBAAkB,KAAK,gBAAkB,GAElD,mBAAoB,CAChB,GAAM,GAAY,KAAK,0BACvB,GAAI,CAAC,KAAK,cAAe,CACrB,KAAK,cAAgB,EACrB,OAEJ,GAAM,GAAc,GAAY,KAAK,eAAiB,KAAK,SAC3D,KAAK,gBAAkB,KAAK,IAAI,KAAK,YAAa,KAAK,gBAAkB,GACzE,KAAK,cAAgB,EAEzB,wBAAwB,EAAU,CAC9B,GAAI,GAEJ,GADA,KAAK,qBACD,GAAkB,GAAW,CAC7B,GAAM,GAAY,AAAC,KAAK,QAAgC,KAAK,IAAI,KAAK,eAAgB,KAAK,UAAzD,KAAK,eACvC,KAAK,YAAc,EACnB,KAAK,sBACL,KAAK,iBAAmB,KAAK,0BAC7B,EAAiB,KAAK,cAAc,GACpC,KAAK,wBAGL,MAAK,sBACL,EAAiB,KAAK,aAAa,KAAK,2BAE5C,GAAM,GAAU,KAAK,IAAI,EAAgB,EAAI,KAAK,gBAClD,KAAK,sBAAsB,GAE/B,qBAAsB,CAClB,KAAK,WAAa,KAAK,WAAW,KAAK,IAAK,KAAK,YAAe,GAAI,KAAK,MAAS,KAAK,cAAe,EAAI,IAE9G,cAAc,EAAW,CACrB,MAAO,MAAK,WAAW,EAAY,KAAK,MAE5C,aAAa,EAAW,CACpB,MAAO,MAAK,WAAW,KAAK,cAAgB,KAAK,IAAI,EAAY,KAAK,iBAAmB,KAAK,WAAY,GAAK,KAAK,aAExH,mBAAoB,CAChB,KAAK,QAAU,GAEnB,sBAAsB,EAAS,CAC3B,KAAK,oBACL,KAAK,SAAW,KAAK,IAAI,EAAS,KAAK,aACvC,KAAK,YAAc,KAAK,IAAI,EAAS,KAAK,aAC1C,KAAK,gBAAkB,KAAK,IAAI,KAAK,gBAAiB,KAAK,aAE/D,oBAAqB,CACjB,GAAM,GAAI,KAAK,0BACT,EAAa,KAAK,MAAM,EAAI,GAAK,EAEvC,GADA,KAAK,eACD,EAAa,KAAK,iBAAkB,CACpC,GAAM,GAAc,KAAK,aAAgB,GAAa,KAAK,kBAC3D,KAAK,eAAiB,KAAK,WAAW,EAAc,KAAK,OAAS,KAAK,eAAkB,GAAI,KAAK,SAClG,KAAK,aAAe,EACpB,KAAK,iBAAmB,GAGhC,WAAW,EAAK,CACZ,MAAO,YAAW,EAAI,QAAQ,MAIhC,GAA2B,IAC3B,GAAsB,GAAK,IAC3B,GAA8B,IAC9B,GAAuB,IACvB,GAAa,EACb,GAAqB,GACrB,GAAqB,EACrB,GAAuB,wBACvB,GAAiB,kBAEjB,GAAiC,IAAM,CACzC,GAAI,GAAY,GAOhB,MAAO,CACH,wBAP4B,AAAC,GACtB,KAAK,MAAM,KAAK,IAAI,GAAqB,KAAK,SAAW,GAAK,EAAW,IAOhF,aALiB,AAAC,GAAU,CAC5B,EAAY,KAQd,GAA0B,CAAC,CAAE,aAAY,aAAY,eAIhD,EACH,cAJkB,IAAM,EAKxB,cAJkB,IAAM,KAAK,IAAI,GAAqB,GAKtD,aAJiB,IAAM,IAQ/B,QAA4B,CACxB,YAAY,EAAa,CACrB,KAAK,YAAc,EACnB,KAAK,KAAO,GAAY,SACxB,KAAK,SAAW,GAChB,KAAK,qBAAuB,KAC5B,KAAK,oBAAsB,MAAO,IAAgB,WAAa,EAAc,SAAY,OAEvF,0BAAyB,EAAiB,CAC5C,MAAO,IAAwB,CAC3B,WAAY,GACZ,WAAY,SAGd,2BAA0B,EAAO,EAAW,CAC9C,GAAM,GAAc,KAAM,MAAK,iBAC/B,GAAI,KAAK,YAAY,EAAO,EAAW,GAAc,CACjD,GAAM,GAAY,EAAU,UAC5B,KAAK,qBAAqB,aAAa,IAAc,aAAe,GAA8B,IAClG,GAAM,GAAqB,KAAK,qBAAqB,wBAAwB,EAAM,iBAC7E,EAAa,EAAU,eACvB,KAAK,IAAI,EAAU,eAAe,UAAY,KAAK,OAAS,EAAG,GAC/D,EACA,EAAe,KAAK,gBAAgB,GAC1C,YAAK,UAAY,EACV,GAAwB,CAC3B,aACA,WAAY,EAAM,gBAAkB,EACpC,UAAW,IAGnB,KAAM,IAAI,OAAM,4BAEpB,cAAc,EAAO,CACjB,KAAK,SAAW,KAAK,IAAI,GAAsB,KAAK,SAAY,GAAM,gBAAkB,KAE5F,aAAc,CACV,MAAO,MAAK,cAEV,iBAAiB,CACnB,GAAI,CACA,MAAO,MAAM,MAAK,4BAEf,EAAP,CACI,eAAQ,KAAK,6DAA6D,MACnE,IAGf,YAAY,EAAc,EAAW,EAAa,CAE9C,MAAQ,AADS,GAAa,gBAAkB,EAC7B,GACf,KAAK,UAAY,KAAK,gBAAgB,EAAU,YAChD,KAAK,iBAAiB,EAAU,WAExC,gBAAgB,EAAW,CACvB,MAAO,KAAc,YAAc,GAAqB,GAE5D,iBAAiB,EAAW,CACxB,MAAO,KAAc,cAAgB,IAAc,cAI3D,QAA4B,CACxB,YAAY,EAAqB,EAAS,CACtC,KAAK,oBAAsB,EAC3B,KAAK,KAAO,GAAY,SACxB,GAAM,CAAE,eAAgB,GAAW,GACnC,KAAK,YAAc,GAAe,GAAI,IACtC,KAAK,sBAAwB,GAAI,IAAsB,QAErD,0BAAyB,EAAiB,CAC5C,YAAM,MAAK,YAAY,eAChB,KAAK,sBAAsB,yBAAyB,QAEzD,2BAA0B,EAAc,EAAW,CACrD,YAAK,YAAY,wBAAwB,GAClC,KAAK,sBAAsB,0BAA0B,EAAc,GAE9E,cAAc,EAAO,CACjB,KAAK,YAAY,wBAAwB,IACzC,KAAK,sBAAsB,cAAc,KAI3C,GAAa,AAAC,GACZ,YAAiB,OACV,EACP,YAAiB,QACV,OAAO,OAAO,GAAI,OAAS,GAClC,MAAO,IAAU,SACV,GAAI,OAAM,GACd,GAAI,OAAM,6BAA6B,KAG5C,GAAqB,AAAC,GAAU,CAClC,GAAM,CAAE,iBAAkB,EACpB,EAAc,GAAkB,EAAM,aAAe,IAC3D,MAAO,IACA,EACH,cACA,cAAe,SACP,GAIA,CADc,KAAM,IAAkB,EAAM,eAC9B,GAAY,SACnB,GAAI,IAAsB,GAE9B,GAAI,IAAsB,MAKvC,GAAkB,AAAC,GAAY,CAAC,EAAM,IAAY,KAAO,IAAS,CACpE,GAAI,GAAgB,KAAM,GAAQ,gBAC5B,EAAc,KAAM,GAAQ,cAClC,GAAI,GAAkB,GAAgB,CAClC,EAAgB,EAChB,GAAI,GAAa,KAAM,GAAc,yBAAyB,EAAQ,cAClE,EAAY,GAAI,OAChB,EAAW,EACX,EAAkB,EAChB,CAAE,WAAY,EAIpB,IAHI,GAAY,WAAW,IACvB,GAAQ,QAAQ,IAAwB,QAGxC,GAAI,CACA,AAAI,GAAY,WAAW,IACvB,GAAQ,QAAQ,IAAkB,WAAW,EAAW,UAAU,KAEtE,GAAM,CAAE,WAAU,UAAW,KAAM,GAAK,GACxC,SAAc,cAAc,GAC5B,EAAO,UAAU,SAAW,EAAW,EACvC,EAAO,UAAU,gBAAkB,EAC5B,CAAE,WAAU,gBAEhB,EAAP,CACI,GAAM,GAAiB,GAAkB,GACzC,EAAY,GAAW,GACvB,GAAI,CACA,EAAa,KAAM,GAAc,0BAA0B,EAAY,SAEpE,EAAP,CACI,KAAK,GAAU,WACX,GAAU,UAAY,IAE1B,EAAU,UAAU,SAAW,EAAW,EAC1C,EAAU,UAAU,gBAAkB,EAChC,EAEV,EAAW,EAAW,gBACtB,GAAM,GAAQ,EAAW,gBACzB,GAAmB,EACnB,KAAM,IAAI,SAAQ,AAAC,GAAY,WAAW,EAAS,SAK3D,UAAgB,EACZ,GAAe,MACf,GAAQ,UAAY,CAAC,GAAI,EAAQ,WAAa,GAAK,CAAC,iBAAkB,EAAc,QACjF,EAAc,MAAM,EAAM,IAGnC,GAAoB,AAAC,GAAkB,MAAO,GAAc,0BAA6B,aAC3F,MAAO,GAAc,2BAA8B,aACnD,MAAO,GAAc,eAAkB,YACrC,GAAoB,AAAC,GAAU,CACjC,GAAM,GAAY,CACd,UAAW,GAAkB,IAE3B,EAAiB,GAAkB,EAAM,WAC/C,MAAI,IACA,GAAU,eAAiB,GAExB,GAEL,GAAoB,AAAC,GACnB,GAAkB,GACX,aACP,GAAiB,GACV,YACP,GAAc,GACP,eACJ,eAEL,GAAyB,CAC3B,KAAM,kBACN,KAAM,CAAC,SACP,KAAM,kBACN,SAAU,OACV,SAAU,IAER,GAAiB,AAAC,GAAa,EACjC,aAAc,AAAC,GAAgB,CAC3B,EAAY,IAAI,GAAgB,GAAU,OAG5C,GAAoB,AAAC,GAAa,CACpC,GAAI,CAAC,GAAa,WAAW,GACzB,OACJ,GAAM,GAAuB,OAAO,KAAK,EAAS,SAAS,KAAK,AAAC,GAAQ,EAAI,gBAAkB,eAC/F,GAAI,CAAC,EACD,OACJ,GAAM,GAAa,EAAS,QAAQ,GAC9B,EAAoB,OAAO,GACjC,MAAK,QAAO,MAAM,GAEK,GAAI,MAAK,GADrB,GAAI,MAAK,EAAoB,MAK5C,QAAiB,CACb,OAAQ,EACR,OAAQ,EACR,MAAO,EACP,MAAO,EACP,OAAQ,IAGZ,QAAa,CACT,YAAY,EAAQ,CAChB,KAAK,gBAAkB,KACvB,KAAK,OAAS,EAElB,KAAK,EAAS,EAAa,EAAI,CAC3B,GAAM,GAAU,MAAO,IAAgB,WAAa,EAAc,OAC5D,EAAW,MAAO,IAAgB,WAAa,EAAc,EAC7D,EAAU,EAAQ,kBAAkB,KAAK,gBAAiB,KAAK,OAAQ,GAC7E,GAAI,EACA,EAAQ,GACH,KAAK,AAAC,GAAW,EAAS,KAAM,EAAO,QAAS,AAAC,GAAQ,EAAS,IAClE,MAAM,IAAM,QAGjB,OAAO,GAAQ,GAAS,KAAK,AAAC,GAAW,EAAO,QAGxD,SAAU,CACN,AAAI,KAAK,OAAO,eAAe,SAC3B,KAAK,OAAO,eAAe,YAIvC,YAA0B,EAAO,CAC7B,GAAM,GAAQ,GACd,OAAS,KAAO,QAAO,KAAK,GAAO,OAAQ,CACvC,GAAM,GAAQ,EAAM,GAEpB,GADA,EAAM,GAAU,GACZ,MAAM,QAAQ,GACd,OAAS,GAAI,EAAG,EAAO,EAAM,OAAQ,EAAI,EAAM,IAC3C,EAAM,KAAK,GAAG,KAAO,GAAU,EAAM,WAGxC,CACD,GAAI,GAAU,EACd,AAAI,IAAS,MAAO,IAAU,WAC1B,IAAW,IAAI,GAAU,MAE7B,EAAM,KAAK,IAGnB,MAAO,GAAM,KAAK,KAGtB,YAAwB,EAAc,EAAG,CACrC,MAAO,IAAI,SAAQ,CAAC,EAAS,IAAW,CACpC,AAAI,GACA,WAAW,IAAM,CACb,GAAM,GAAe,GAAI,OAAM,mCAAmC,QAClE,EAAa,KAAO,eACpB,EAAO,IACR,KAKf,YAAuB,CACnB,YAAY,EAAS,CACjB,AAAI,MAAO,IAAY,WACnB,KAAK,eAAiB,IAAU,KAAK,AAAC,GAAS,GAAQ,IAGvD,MAAK,OAAS,GAAW,GACzB,KAAK,eAAiB,QAAQ,QAAQ,KAAK,SAGnD,SAAU,OAEJ,QAAO,EAAS,CAAE,eAAgB,GAAI,CACxC,AAAK,KAAK,QACN,MAAK,OAAS,KAAM,MAAK,gBAE7B,GAAM,GAAqB,KAAK,OAAO,eACvC,GAAI,GAAa,QAAS,CACtB,GAAM,GAAa,GAAI,OAAM,mBAC7B,SAAW,KAAO,aACX,QAAQ,OAAO,GAE1B,GAAI,GAAO,EAAQ,KACb,EAAc,GAAiB,EAAQ,OAAS,IACtD,AAAI,GACA,IAAQ,IAAI,KAEZ,EAAQ,UACR,IAAQ,IAAI,EAAQ,YAExB,GAAI,GAAO,GACX,GAAI,EAAQ,UAAY,MAAQ,EAAQ,UAAY,KAAM,CACtD,GAAM,GAAW,EAAQ,UAAY,GAC/B,EAAW,EAAQ,UAAY,GACrC,EAAO,GAAG,KAAY,KAE1B,GAAM,CAAE,OAAM,UAAW,EACnB,EAAM,GAAG,EAAQ,aAAa,IAAO,EAAQ,WAAW,EAAO,IAAI,IAAS,KAAK,IAEjF,EAAiB,CACnB,KAFS,IAAW,OAAS,IAAW,OAAS,OAAY,EAAQ,KAGrE,QAAS,GAAI,SAAQ,EAAQ,SAC7B,OAAQ,GAEZ,AAAI,MAAO,kBAAoB,aAC3B,GAAe,OAAY,GAE/B,GAAM,GAAe,GAAI,SAAQ,EAAK,GAChC,EAAiB,CACnB,MAAM,GAAc,KAAK,AAAC,GAAa,CACnC,GAAM,GAAe,EAAS,QACxB,EAAqB,GAC3B,OAAW,KAAQ,GAAa,UAC5B,EAAmB,EAAK,IAAM,EAAK,GAGvC,MAD0B,GAAS,MAAQ,KAWpC,CACH,SAAU,GAAI,IAAa,CACvB,QAAS,EACT,OAAQ,EAAS,WACjB,WAAY,EAAS,OACrB,KAAM,EAAS,QAdZ,EAAS,OAAO,KAAK,AAAC,GAAU,EACnC,SAAU,GAAI,IAAa,CACvB,QAAS,EACT,OAAQ,EAAS,WACjB,WAAY,EAAS,OACrB,cAahB,GAAe,IAEnB,MAAI,IACA,EAAe,KAAK,GAAI,SAAQ,CAAC,EAAS,IAAW,CACjD,EAAY,QAAU,IAAM,CACxB,GAAM,GAAa,GAAI,OAAM,mBAC7B,EAAW,KAAO,aAClB,EAAO,OAIZ,QAAQ,KAAK,KAItB,GAAkB,AAAC,GACjB,MAAO,OAAS,YAAc,YAAkB,MACzC,GAAY,GAEhB,GAAc,GAEzB,kBAA2B,EAAM,CAC7B,GAAM,GAAS,KAAM,IAAa,GAC5B,EAAc,GAAW,GAC/B,MAAO,IAAI,YAAW,GAE1B,kBAA6B,EAAQ,CACjC,GAAI,GAAM,GAAI,YAAW,GACnB,EAAS,EAAO,YAClB,EAAS,GACb,KAAO,CAAC,GAAQ,CACZ,GAAM,CAAE,OAAM,SAAU,KAAM,GAAO,OACrC,GAAI,EAAO,CACP,GAAM,GAAQ,EACd,EAAM,GAAI,YAAW,EAAM,OAAS,EAAM,QAC1C,EAAI,IAAI,GACR,EAAI,IAAI,EAAO,EAAM,QAEzB,EAAS,EAEb,MAAO,GAEX,YAAsB,EAAM,CACxB,MAAO,IAAI,SAAQ,CAAC,EAAS,IAAW,CACpC,GAAM,GAAS,GAAI,YACnB,EAAO,UAAY,IAAM,CACrB,GAAI,EAAO,aAAe,EACtB,MAAO,GAAO,GAAI,OAAM,6BAE5B,GAAM,GAAU,EAAO,QAAU,GAC3B,EAAa,EAAO,QAAQ,KAC5B,EAAa,EAAa,GAAK,EAAa,EAAI,EAAO,OAC7D,EAAQ,EAAO,UAAU,KAE7B,EAAO,QAAU,IAAM,EAAO,GAAI,OAAM,iBACxC,EAAO,QAAU,IAAM,EAAO,EAAO,OACrC,EAAO,cAAc,KAI7B,GAAM,IAA4B,AAAC,GAAS,CACxC,OAAQ,OACC,WACD,MAAO,CACH,UAAW,WACX,kBAAmB,UAEtB,YACD,MAAO,CACH,UAAW,WACX,kBAAmB,UAEtB,eACD,MAAO,CACH,UAAW,WACX,kBAAmB,UAEtB,SACD,MAAO,CACH,UAAW,WACX,kBAAmB,aAGvB,MAAO,KAInB,AAgBA,GAAI,IAAkB,SAAS,EAAG,EAAG,CACjC,UAAkB,OAAO,gBACpB,CAAE,UAAW,aAAgB,QAAS,SAAU,EAAG,EAAG,CAAE,EAAE,UAAY,IACvE,SAAU,EAAG,EAAG,CAAE,OAAS,KAAK,GAAG,AAAI,EAAE,eAAe,IAAI,GAAE,GAAK,EAAE,KAClE,GAAgB,EAAG,IAG9B,YAAqB,EAAG,EAAG,CACvB,GAAgB,EAAG,GACnB,YAAc,CAAE,KAAK,YAAc,EACnC,EAAE,UAAY,IAAM,KAAO,OAAO,OAAO,GAAM,GAAG,UAAY,EAAE,UAAW,GAAI,IAGnF,GAAI,IAAa,UAAW,CACxB,UAAa,OAAO,QAAU,SAAkB,EAAG,CAC/C,OAAS,GAAG,EAAI,EAAG,EAAI,UAAU,OAAQ,EAAI,EAAG,IAAK,CACjD,EAAI,UAAU,GACd,OAAS,KAAK,GAAG,AAAI,OAAO,UAAU,eAAe,KAAK,EAAG,IAAI,GAAE,GAAK,EAAE,IAE9E,MAAO,IAEJ,GAAW,MAAM,KAAM,YAGlC,YAAkB,EAAG,EAAG,CACpB,GAAI,GAAI,GACR,OAAS,KAAK,GAAG,AAAI,OAAO,UAAU,eAAe,KAAK,EAAG,IAAM,EAAE,QAAQ,GAAK,GAC9E,GAAE,GAAK,EAAE,IACb,GAAI,GAAK,MAAQ,MAAO,QAAO,uBAA0B,WACrD,OAAS,GAAI,EAAG,EAAI,OAAO,sBAAsB,GAAI,EAAI,EAAE,OAAQ,IAC/D,AAAI,EAAE,QAAQ,EAAE,IAAM,GAAK,OAAO,UAAU,qBAAqB,KAAK,EAAG,EAAE,KACvE,GAAE,EAAE,IAAM,EAAE,EAAE,KAE1B,MAAO,GAGX,YAAsB,EAAY,EAAQ,EAAK,EAAM,CACjD,GAAI,GAAI,UAAU,OAAQ,EAAI,EAAI,EAAI,EAAS,IAAS,KAAO,EAAO,OAAO,yBAAyB,EAAQ,GAAO,EAAM,EAC3H,GAAI,MAAO,UAAY,UAAY,MAAO,SAAQ,UAAa,WAAY,EAAI,QAAQ,SAAS,EAAY,EAAQ,EAAK,OACpH,QAAS,GAAI,EAAW,OAAS,EAAG,GAAK,EAAG,IAAK,AAAI,GAAI,EAAW,KAAI,GAAK,GAAI,EAAI,EAAE,GAAK,EAAI,EAAI,EAAE,EAAQ,EAAK,GAAK,EAAE,EAAQ,KAAS,GAChJ,MAAO,GAAI,GAAK,GAAK,OAAO,eAAe,EAAQ,EAAK,GAAI,EAGhE,YAAmB,EAAY,EAAW,CACtC,MAAO,UAAU,EAAQ,EAAK,CAAE,EAAU,EAAQ,EAAK,IAG3D,YAAsB,EAAa,EAAe,CAC9C,GAAI,MAAO,UAAY,UAAY,MAAO,SAAQ,UAAa,WAAY,MAAO,SAAQ,SAAS,EAAa,GAGpH,YAAqB,EAAS,EAAY,EAAG,EAAW,CACpD,WAAe,EAAO,CAAE,MAAO,aAAiB,GAAI,EAAQ,GAAI,GAAE,SAAU,EAAS,CAAE,EAAQ,KAC/F,MAAO,IAAK,IAAM,GAAI,UAAU,SAAU,EAAS,EAAQ,CACvD,WAAmB,EAAO,CAAE,GAAI,CAAE,EAAK,EAAU,KAAK,UAAkB,EAAP,CAAY,EAAO,IACpF,WAAkB,EAAO,CAAE,GAAI,CAAE,EAAK,EAAU,MAAS,UAAkB,EAAP,CAAY,EAAO,IACvF,WAAc,EAAQ,CAAE,EAAO,KAAO,EAAQ,EAAO,OAAS,EAAM,EAAO,OAAO,KAAK,EAAW,GAClG,EAAM,GAAY,EAAU,MAAM,EAAS,GAAc,KAAK,UAItE,YAAuB,EAAS,EAAM,CAClC,GAAI,GAAI,CAAE,MAAO,EAAG,KAAM,UAAW,CAAE,GAAI,EAAE,GAAK,EAAG,KAAM,GAAE,GAAI,MAAO,GAAE,IAAO,KAAM,GAAI,IAAK,IAAM,EAAG,EAAG,EAAG,EAC/G,MAAO,GAAI,CAAE,KAAM,EAAK,GAAI,MAAS,EAAK,GAAI,OAAU,EAAK,IAAM,MAAO,SAAW,YAAe,GAAE,OAAO,UAAY,UAAW,CAAE,MAAO,QAAU,EACvJ,WAAc,EAAG,CAAE,MAAO,UAAU,EAAG,CAAE,MAAO,GAAK,CAAC,EAAG,KACzD,WAAc,EAAI,CACd,GAAI,EAAG,KAAM,IAAI,WAAU,mCAC3B,KAAO,GAAG,GAAI,CACV,GAAI,EAAI,EAAG,GAAM,GAAI,EAAG,GAAK,EAAI,EAAE,OAAY,EAAG,GAAK,EAAE,OAAc,IAAI,EAAE,SAAc,EAAE,KAAK,GAAI,GAAK,EAAE,OAAS,CAAE,GAAI,EAAE,KAAK,EAAG,EAAG,KAAK,KAAM,MAAO,GAE3J,OADI,EAAI,EAAG,GAAG,GAAK,CAAC,EAAG,GAAK,EAAG,EAAE,QACzB,EAAG,QACF,OAAQ,GAAG,EAAI,EAAI,UACnB,GAAG,SAAE,QAAgB,CAAE,MAAO,EAAG,GAAI,KAAM,QAC3C,GAAG,EAAE,QAAS,EAAI,EAAG,GAAI,EAAK,CAAC,GAAI,aACnC,GAAG,EAAK,EAAE,IAAI,MAAO,EAAE,KAAK,MAAO,iBAEpC,GAAM,EAAI,EAAE,KAAM,IAAI,EAAE,OAAS,GAAK,EAAE,EAAE,OAAS,KAAQ,GAAG,KAAO,GAAK,EAAG,KAAO,GAAI,CAAE,EAAI,EAAG,SACjG,GAAI,EAAG,KAAO,GAAM,EAAC,GAAM,EAAG,GAAK,EAAE,IAAM,EAAG,GAAK,EAAE,IAAM,CAAE,EAAE,MAAQ,EAAG,GAAI,MAC9E,GAAI,EAAG,KAAO,GAAK,EAAE,MAAQ,EAAE,GAAI,CAAE,EAAE,MAAQ,EAAE,GAAI,EAAI,EAAI,MAC7D,GAAI,GAAK,EAAE,MAAQ,EAAE,GAAI,CAAE,EAAE,MAAQ,EAAE,GAAI,EAAE,IAAI,KAAK,GAAK,MAC3D,AAAI,EAAE,IAAI,EAAE,IAAI,MAChB,EAAE,KAAK,MAAO,SAEtB,EAAK,EAAK,KAAK,EAAS,SACnB,EAAP,CAAY,EAAK,CAAC,EAAG,GAAI,EAAI,SAAK,CAAU,EAAI,EAAI,EACtD,GAAI,EAAG,GAAK,EAAG,KAAM,GAAG,GAAI,MAAO,CAAE,MAAO,EAAG,GAAK,EAAG,GAAK,OAAQ,KAAM,KAIlF,YAA2B,EAAG,EAAG,EAAG,EAAI,CACpC,AAAI,IAAO,QAAW,GAAK,GAC3B,EAAE,GAAM,EAAE,GAGd,YAAwB,EAAG,EAAS,CAChC,OAAS,KAAK,GAAG,AAAI,IAAM,WAAa,CAAC,EAAQ,eAAe,IAAI,GAAQ,GAAK,EAAE,IAGvF,YAAoB,EAAG,CACnB,GAAI,GAAI,MAAO,SAAW,YAAc,OAAO,SAAU,EAAI,GAAK,EAAE,GAAI,EAAI,EAC5E,GAAI,EAAG,MAAO,GAAE,KAAK,GACrB,GAAI,GAAK,MAAO,GAAE,QAAW,SAAU,MAAO,CAC1C,KAAM,UAAY,CACd,MAAI,IAAK,GAAK,EAAE,QAAQ,GAAI,QACrB,CAAE,MAAO,GAAK,EAAE,KAAM,KAAM,CAAC,KAG5C,KAAM,IAAI,WAAU,EAAI,0BAA4B,mCAGxD,YAAkB,EAAG,EAAG,CACpB,GAAI,GAAI,MAAO,SAAW,YAAc,EAAE,OAAO,UACjD,GAAI,CAAC,EAAG,MAAO,GACf,GAAI,GAAI,EAAE,KAAK,GAAI,EAAG,EAAK,GAAI,EAC/B,GAAI,CACA,KAAQ,KAAM,QAAU,KAAM,IAAM,CAAE,GAAI,EAAE,QAAQ,MAAM,EAAG,KAAK,EAAE,aAEjE,EAAP,CAAgB,EAAI,CAAE,MAAO,UAC7B,CACI,GAAI,CACA,AAAI,GAAK,CAAC,EAAE,MAAS,GAAI,EAAE,SAAY,EAAE,KAAK,UAElD,CAAU,GAAI,EAAG,KAAM,GAAE,OAE7B,MAAO,GAGX,aAAsB,CAClB,OAAS,GAAK,GAAI,EAAI,EAAG,EAAI,UAAU,OAAQ,IAC3C,EAAK,EAAG,OAAO,GAAS,UAAU,KACtC,MAAO,GAGX,aAA4B,CACxB,OAAS,GAAI,EAAG,EAAI,EAAG,EAAK,UAAU,OAAQ,EAAI,EAAI,IAAK,GAAK,UAAU,GAAG,OAC7E,OAAS,GAAI,MAAM,GAAI,EAAI,EAAG,EAAI,EAAG,EAAI,EAAI,IACzC,OAAS,GAAI,UAAU,GAAI,EAAI,EAAG,EAAK,EAAE,OAAQ,EAAI,EAAI,IAAK,IAC1D,EAAE,GAAK,EAAE,GACjB,MAAO,GAEX,YAAmB,EAAG,CAClB,MAAO,gBAAgB,IAAa,MAAK,EAAI,EAAG,MAAQ,GAAI,IAAU,GAG1E,YAA4B,EAAS,EAAY,EAAW,CACxD,GAAI,CAAC,OAAO,cAAe,KAAM,IAAI,WAAU,wCAC/C,GAAI,GAAI,EAAU,MAAM,EAAS,GAAc,IAAK,EAAG,EAAI,GAC3D,MAAO,GAAI,GAAI,EAAK,QAAS,EAAK,SAAU,EAAK,UAAW,EAAE,OAAO,eAAiB,UAAY,CAAE,MAAO,OAAS,EACpH,WAAc,EAAG,CAAE,AAAI,EAAE,IAAI,GAAE,GAAK,SAAU,EAAG,CAAE,MAAO,IAAI,SAAQ,SAAU,EAAG,EAAG,CAAE,EAAE,KAAK,CAAC,EAAG,EAAG,EAAG,IAAM,GAAK,EAAO,EAAG,OAC9H,WAAgB,EAAG,EAAG,CAAE,GAAI,CAAE,EAAK,EAAE,GAAG,UAAc,EAAP,CAAY,EAAO,EAAE,GAAG,GAAI,IAC3E,WAAc,EAAG,CAAE,EAAE,gBAAiB,IAAY,QAAQ,QAAQ,EAAE,MAAM,GAAG,KAAK,EAAS,GAAU,EAAO,EAAE,GAAG,GAAI,GACrH,WAAiB,EAAO,CAAE,EAAO,OAAQ,GACzC,WAAgB,EAAO,CAAE,EAAO,QAAS,GACzC,WAAgB,EAAG,EAAG,CAAE,AAAI,EAAE,GAAI,EAAE,QAAS,EAAE,QAAQ,EAAO,EAAE,GAAG,GAAI,EAAE,GAAG,KAGhF,YAA4B,EAAG,CAC3B,GAAI,GAAG,EACP,MAAO,GAAI,GAAI,EAAK,QAAS,EAAK,QAAS,SAAU,EAAG,CAAE,KAAM,KAAO,EAAK,UAAW,EAAE,OAAO,UAAY,UAAY,CAAE,MAAO,OAAS,EAC1I,WAAc,EAAG,EAAG,CAAE,EAAE,GAAK,EAAE,GAAK,SAAU,EAAG,CAAE,MAAQ,GAAI,CAAC,GAAK,CAAE,MAAO,GAAU,EAAE,GAAG,IAAK,KAAM,IAAM,UAAa,EAAI,EAAE,GAAK,GAAO,GAGjJ,YAAyB,EAAG,CACxB,GAAI,CAAC,OAAO,cAAe,KAAM,IAAI,WAAU,wCAC/C,GAAI,GAAI,EAAE,OAAO,eAAgB,EACjC,MAAO,GAAI,EAAE,KAAK,GAAM,GAAI,MAAO,KAAe,WAAa,GAAW,GAAK,EAAE,OAAO,YAAa,EAAI,GAAI,EAAK,QAAS,EAAK,SAAU,EAAK,UAAW,EAAE,OAAO,eAAiB,UAAY,CAAE,MAAO,OAAS,GAClN,WAAc,EAAG,CAAE,EAAE,GAAK,EAAE,IAAM,SAAU,EAAG,CAAE,MAAO,IAAI,SAAQ,SAAU,EAAS,EAAQ,CAAE,EAAI,EAAE,GAAG,GAAI,EAAO,EAAS,EAAQ,EAAE,KAAM,EAAE,UAChJ,WAAgB,EAAS,EAAQ,EAAG,EAAG,CAAE,QAAQ,QAAQ,GAAG,KAAK,SAAS,EAAG,CAAE,EAAQ,CAAE,MAAO,EAAG,KAAM,KAAS,IAGtH,YAAgC,EAAQ,EAAK,CACzC,MAAI,QAAO,eAAkB,OAAO,eAAe,EAAQ,MAAO,CAAE,MAAO,IAAiB,EAAO,IAAM,EAClG,EAEX,YAAwB,EAAK,CACzB,GAAI,GAAO,EAAI,WAAY,MAAO,GAClC,GAAI,GAAS,GACb,GAAI,GAAO,KAAM,OAAS,KAAK,GAAK,AAAI,OAAO,eAAe,KAAK,EAAK,IAAI,GAAO,GAAK,EAAI,IAC5F,SAAO,QAAU,EACV,EAGX,YAA2B,EAAK,CAC5B,MAAQ,IAAO,EAAI,WAAc,EAAM,CAAE,QAAS,GAGtD,YAAkC,EAAU,EAAY,CACpD,GAAI,CAAC,EAAW,IAAI,GAChB,KAAM,IAAI,WAAU,kDAExB,MAAO,GAAW,IAAI,GAG1B,YAAkC,EAAU,EAAY,EAAO,CAC3D,GAAI,CAAC,EAAW,IAAI,GAChB,KAAM,IAAI,WAAU,kDAExB,SAAW,IAAI,EAAU,GAClB,EAGX,GAAI,IAA2B,OAAO,OAAO,CACzC,UAAW,KACX,UAAW,MACP,WAAY,CAAE,MAAO,KACzB,OAAQ,GACR,WAAY,GACZ,QAAS,GACT,WAAY,GACZ,UAAW,GACX,YAAa,GACb,gBAAiB,GACjB,aAAc,GACd,SAAU,GACV,OAAQ,GACR,SAAU,GACV,eAAgB,GAChB,QAAS,GACT,iBAAkB,GAClB,iBAAkB,GAClB,cAAe,GACf,qBAAsB,GACtB,aAAc,GACd,gBAAiB,GACjB,uBAAwB,GACxB,uBAAwB,KAGxB,GAAkB,GAAqB,SAAU,EAAQ,EAAS,CACtE,OAAO,eAAe,EAAS,aAAc,CAAE,MAAO,KACtD,EAAQ,YAAc,OACtB,WAAqB,EAAM,CACvB,MAAI,OAAO,IAAS,SACT,EAAK,SAAW,EAEpB,EAAK,aAAe,EAE/B,EAAQ,YAAc,IAIlB,GAAY,GAAqB,SAAU,EAAQ,EAAS,CAChE,OAAO,eAAe,EAAS,aAAc,CAAE,MAAO,KACtD,EAAQ,mBAAqB,EAAQ,kBAAoB,EAAQ,aAAe,OAChF,EAAQ,aAAe,CAAE,KAAM,WAC/B,EAAQ,kBAAoB,CACxB,KAAM,OACN,KAAM,EAAQ,cAElB,EAAQ,mBAAqB,GAAI,YAAW,CACxC,IACA,IACA,IACA,GACA,IACA,IACA,GACA,GACA,IACA,IACA,IACA,IACA,IACA,IACA,IACA,GACA,GACA,IACA,GACA,IACA,IACA,IACA,IACA,GACA,IACA,IACA,IACA,GACA,IACA,GACA,IACA,OAKE,GAAiB,GACvB,aAAwB,CACpB,MAAI,OAAO,SAAW,YACX,OAEF,MAAO,OAAS,YACd,KAEJ,GAGX,GAAI,IAAwB,OAAO,OAAO,CACtC,UAAW,KACX,aAAc,KAGd,GAAa,GAAqB,SAAU,EAAQ,EAAS,CACjE,OAAO,eAAe,EAAS,aAAc,CAAE,MAAO,KACtD,EAAQ,OAAS,OAKjB,GAAI,GAAwB,UAAY,CACpC,WAAgB,EAAQ,CACpB,KAAK,OAAS,EACd,KAAK,QAET,SAAO,UAAU,OAAS,SAAU,EAAQ,CACxC,GAAI,GAAQ,KACZ,AAAK,AAt9Gb,GAs9GgB,GAAgB,aAAa,IAGrC,MAAK,UAAY,KAAK,UAAU,KAAK,SAAU,EAAW,CACtD,SAAU,QAAU,UAAY,CAC5B,EAAM,UAAY,QAAQ,OAAO,GAAI,OAAM,qCAE/C,EAAU,QAAQ,EAAkB,IAC7B,IAEX,KAAK,UAAU,MAAM,UAAY,MAErC,EAAO,UAAU,OAAS,UAAY,CAClC,MAAO,MAAK,UAAU,KAAK,SAAU,EAAW,CAC5C,MAAO,IAAI,SAAQ,SAAU,EAAS,EAAQ,CAC1C,EAAU,QAAU,UAAY,CAC5B,EAAO,GAAI,OAAM,uCAErB,EAAU,WAAa,UAAY,CAC/B,AAAI,EAAU,QACV,EAAQ,GAAI,YAAW,EAAU,SAErC,EAAO,GAAI,OAAM,uCAErB,EAAU,cAItB,EAAO,UAAU,MAAQ,UAAY,CACjC,AAAI,KAAK,OACL,MAAK,UAAY,EAAc,KAAK,QAAQ,KAAK,SAAU,EAAS,CAChE,MAAQ,AAr/GxB,GAq/G2B,GAAS,gBAAgB,SAAS,OAAO,KAAK,GAAU,kBAAmB,KAE1F,KAAK,UAAU,MAAM,UAAY,KAGjC,KAAK,UAAY,QAAQ,QAAS,AA1/G9C,GA0/GiD,GAAS,gBAAgB,SAAS,OAAO,OAAO,aAGtF,KAEX,EAAQ,OAAS,EACjB,WAAuB,EAAQ,CAC3B,MAAO,IAAI,SAAQ,SAAU,EAAS,EAAQ,CAC1C,GAAI,GAAgB,AAlgH5B,GAkgH+B,GAAS,gBAAgB,SAAS,OAAO,UAAU,MAAO,EAAkB,GAAS,GAAU,kBAAmB,GAAO,CAAC,SACjJ,EAAa,WAAa,UAAY,CAClC,AAAI,EAAa,QACb,EAAQ,EAAa,QAEzB,EAAO,GAAI,OAAM,gDAErB,EAAa,QAAU,UAAY,CAC/B,EAAO,GAAI,OAAM,uCAI7B,WAA2B,EAAM,CAC7B,MAAI,OAAO,IAAS,SACR,AAhhHhB,GAghHmB,GAAO,UAAU,GAE5B,YAAY,OAAO,GACZ,GAAI,YAAW,EAAK,OAAQ,EAAK,WAAY,EAAK,WAAa,WAAW,mBAE9E,GAAI,YAAW,MAKtB,GAAkB,GAAqB,SAAU,EAAQ,EAAS,CACtE,OAAO,eAAe,EAAS,aAAc,CAAE,MAAO,KACtD,EAAQ,OAAS,OAIjB,GAAI,GAAwB,UAAY,CACpC,WAAgB,EAAQ,CACpB,KAAK,OAAS,GAAI,YAAW,GAC7B,KAAK,OAAS,EACd,KAAK,QAET,SAAO,UAAU,OAAS,SAAU,EAAM,CACtC,GAAK,CAviHb,GAuiHgB,GAAM,aAAa,GAG3B,IAAI,GAAU,AA1iHtB,GA0iHyB,GAAM,iBAAiB,GACpC,EAAa,GAAI,YAAW,KAAK,OAAO,WAAa,EAAO,YAChE,EAAW,IAAI,KAAK,OAAQ,GAC5B,EAAW,IAAI,EAAQ,KAAK,OAAO,YACnC,KAAK,OAAS,IAElB,EAAO,UAAU,OAAS,UAAY,CAClC,GAAI,GAAQ,KACZ,MAAI,MAAK,IACE,KAAK,IAAI,KAAK,SAAU,EAAK,CAChC,MAAQ,AApjHxB,GAojH2B,GAAS,gBACf,OAAO,OAAO,KAAK,GAAU,kBAAmB,EAAK,EAAM,QAC3D,KAAK,SAAU,EAAM,CAAE,MAAO,IAAI,YAAW,OAGrD,AAzjHb,GAyjHgB,GAAM,aAAa,KAAK,QACrB,QAAQ,QAAQ,GAAU,oBAE9B,QAAQ,UACV,KAAK,UAAY,CAClB,MAAQ,AA9jHpB,GA8jHuB,GAAS,gBAAgB,OAAO,OAAO,OAAO,GAAU,aAAc,EAAM,UAEtF,KAAK,SAAU,EAAM,CAAE,MAAO,SAAQ,QAAQ,GAAI,YAAW,OAEtE,EAAO,UAAU,MAAQ,UAAY,CACjC,GAAI,GAAQ,KACZ,KAAK,OAAS,GAAI,YAAW,GACzB,KAAK,QAAU,KAAK,SAAW,QAC/B,MAAK,IAAM,GAAI,SAAQ,SAAU,EAAS,EAAQ,CAC9C,AAAC,AAvkHjB,GAukHoB,GAAS,gBACR,OAAO,OAAO,UAAU,MAAQ,AAxkHrD,GAwkHwD,GAAM,iBAAiB,EAAM,QAAS,GAAU,kBAAmB,GAAO,CAAC,SAC9G,KAAK,EAAS,KAEvB,KAAK,IAAI,MAAM,UAAY,MAG5B,KAEX,EAAQ,OAAS,IAIjB,AAgBA,GAAI,IAAkB,SAAS,EAAG,EAAG,CACjC,UAAkB,OAAO,gBACpB,CAAE,UAAW,aAAgB,QAAS,SAAU,EAAG,EAAG,CAAE,EAAE,UAAY,IACvE,SAAU,EAAG,EAAG,CAAE,OAAS,KAAK,GAAG,AAAI,EAAE,eAAe,IAAI,GAAE,GAAK,EAAE,KAClE,GAAgB,EAAG,IAG9B,YAAqB,EAAG,EAAG,CACvB,GAAgB,EAAG,GACnB,YAAc,CAAE,KAAK,YAAc,EACnC,EAAE,UAAY,IAAM,KAAO,OAAO,OAAO,GAAM,GAAG,UAAY,EAAE,UAAW,GAAI,IAGnF,GAAI,IAAa,UAAW,CACxB,UAAa,OAAO,QAAU,SAAkB,EAAG,CAC/C,OAAS,GAAG,EAAI,EAAG,EAAI,UAAU,OAAQ,EAAI,EAAG,IAAK,CACjD,EAAI,UAAU,GACd,OAAS,KAAK,GAAG,AAAI,OAAO,UAAU,eAAe,KAAK,EAAG,IAAI,GAAE,GAAK,EAAE,IAE9E,MAAO,IAEJ,GAAW,MAAM,KAAM,YAGlC,YAAkB,EAAG,EAAG,CACpB,GAAI,GAAI,GACR,OAAS,KAAK,GAAG,AAAI,OAAO,UAAU,eAAe,KAAK,EAAG,IAAM,EAAE,QAAQ,GAAK,GAC9E,GAAE,GAAK,EAAE,IACb,GAAI,GAAK,MAAQ,MAAO,QAAO,uBAA0B,WACrD,OAAS,GAAI,EAAG,EAAI,OAAO,sBAAsB,GAAI,EAAI,EAAE,OAAQ,IAC/D,AAAI,EAAE,QAAQ,EAAE,IAAM,GAAK,OAAO,UAAU,qBAAqB,KAAK,EAAG,EAAE,KACvE,GAAE,EAAE,IAAM,EAAE,EAAE,KAE1B,MAAO,GAGX,YAAsB,EAAY,EAAQ,EAAK,EAAM,CACjD,GAAI,GAAI,UAAU,OAAQ,EAAI,EAAI,EAAI,EAAS,IAAS,KAAO,EAAO,OAAO,yBAAyB,EAAQ,GAAO,EAAM,EAC3H,GAAI,MAAO,UAAY,UAAY,MAAO,SAAQ,UAAa,WAAY,EAAI,QAAQ,SAAS,EAAY,EAAQ,EAAK,OACpH,QAAS,GAAI,EAAW,OAAS,EAAG,GAAK,EAAG,IAAK,AAAI,GAAI,EAAW,KAAI,GAAK,GAAI,EAAI,EAAE,GAAK,EAAI,EAAI,EAAE,EAAQ,EAAK,GAAK,EAAE,EAAQ,KAAS,GAChJ,MAAO,GAAI,GAAK,GAAK,OAAO,eAAe,EAAQ,EAAK,GAAI,EAGhE,YAAmB,EAAY,EAAW,CACtC,MAAO,UAAU,EAAQ,EAAK,CAAE,EAAU,EAAQ,EAAK,IAG3D,YAAsB,EAAa,EAAe,CAC9C,GAAI,MAAO,UAAY,UAAY,MAAO,SAAQ,UAAa,WAAY,MAAO,SAAQ,SAAS,EAAa,GAGpH,YAAqB,EAAS,EAAY,EAAG,EAAW,CACpD,WAAe,EAAO,CAAE,MAAO,aAAiB,GAAI,EAAQ,GAAI,GAAE,SAAU,EAAS,CAAE,EAAQ,KAC/F,MAAO,IAAK,IAAM,GAAI,UAAU,SAAU,EAAS,EAAQ,CACvD,WAAmB,EAAO,CAAE,GAAI,CAAE,EAAK,EAAU,KAAK,UAAkB,EAAP,CAAY,EAAO,IACpF,WAAkB,EAAO,CAAE,GAAI,CAAE,EAAK,EAAU,MAAS,UAAkB,EAAP,CAAY,EAAO,IACvF,WAAc,EAAQ,CAAE,EAAO,KAAO,EAAQ,EAAO,OAAS,EAAM,EAAO,OAAO,KAAK,EAAW,GAClG,EAAM,GAAY,EAAU,MAAM,EAAS,GAAc,KAAK,UAItE,YAAuB,EAAS,EAAM,CAClC,GAAI,GAAI,CAAE,MAAO,EAAG,KAAM,UAAW,CAAE,GAAI,EAAE,GAAK,EAAG,KAAM,GAAE,GAAI,MAAO,GAAE,IAAO,KAAM,GAAI,IAAK,IAAM,EAAG,EAAG,EAAG,EAC/G,MAAO,GAAI,CAAE,KAAM,EAAK,GAAI,MAAS,EAAK,GAAI,OAAU,EAAK,IAAM,MAAO,SAAW,YAAe,GAAE,OAAO,UAAY,UAAW,CAAE,MAAO,QAAU,EACvJ,WAAc,EAAG,CAAE,MAAO,UAAU,EAAG,CAAE,MAAO,GAAK,CAAC,EAAG,KACzD,WAAc,EAAI,CACd,GAAI,EAAG,KAAM,IAAI,WAAU,mCAC3B,KAAO,GAAG,GAAI,CACV,GAAI,EAAI,EAAG,GAAM,GAAI,EAAG,GAAK,EAAI,EAAE,OAAY,EAAG,GAAK,EAAE,OAAc,IAAI,EAAE,SAAc,EAAE,KAAK,GAAI,GAAK,EAAE,OAAS,CAAE,GAAI,EAAE,KAAK,EAAG,EAAG,KAAK,KAAM,MAAO,GAE3J,OADI,EAAI,EAAG,GAAG,GAAK,CAAC,EAAG,GAAK,EAAG,EAAE,QACzB,EAAG,QACF,OAAQ,GAAG,EAAI,EAAI,UACnB,GAAG,SAAE,QAAgB,CAAE,MAAO,EAAG,GAAI,KAAM,QAC3C,GAAG,EAAE,QAAS,EAAI,EAAG,GAAI,EAAK,CAAC,GAAI,aACnC,GAAG,EAAK,EAAE,IAAI,MAAO,EAAE,KAAK,MAAO,iBAEpC,GAAM,EAAI,EAAE,KAAM,IAAI,EAAE,OAAS,GAAK,EAAE,EAAE,OAAS,KAAQ,GAAG,KAAO,GAAK,EAAG,KAAO,GAAI,CAAE,EAAI,EAAG,SACjG,GAAI,EAAG,KAAO,GAAM,EAAC,GAAM,EAAG,GAAK,EAAE,IAAM,EAAG,GAAK,EAAE,IAAM,CAAE,EAAE,MAAQ,EAAG,GAAI,MAC9E,GAAI,EAAG,KAAO,GAAK,EAAE,MAAQ,EAAE,GAAI,CAAE,EAAE,MAAQ,EAAE,GAAI,EAAI,EAAI,MAC7D,GAAI,GAAK,EAAE,MAAQ,EAAE,GAAI,CAAE,EAAE,MAAQ,EAAE,GAAI,EAAE,IAAI,KAAK,GAAK,MAC3D,AAAI,EAAE,IAAI,EAAE,IAAI,MAChB,EAAE,KAAK,MAAO,SAEtB,EAAK,EAAK,KAAK,EAAS,SACnB,EAAP,CAAY,EAAK,CAAC,EAAG,GAAI,EAAI,SAAK,CAAU,EAAI,EAAI,EACtD,GAAI,EAAG,GAAK,EAAG,KAAM,GAAG,GAAI,MAAO,CAAE,MAAO,EAAG,GAAK,EAAG,GAAK,OAAQ,KAAM,KAIlF,YAA2B,EAAG,EAAG,EAAG,EAAI,CACpC,AAAI,IAAO,QAAW,GAAK,GAC3B,EAAE,GAAM,EAAE,GAGd,YAAwB,EAAG,EAAS,CAChC,OAAS,KAAK,GAAG,AAAI,IAAM,WAAa,CAAC,EAAQ,eAAe,IAAI,GAAQ,GAAK,EAAE,IAGvF,YAAoB,EAAG,CACnB,GAAI,GAAI,MAAO,SAAW,YAAc,OAAO,SAAU,EAAI,GAAK,EAAE,GAAI,EAAI,EAC5E,GAAI,EAAG,MAAO,GAAE,KAAK,GACrB,GAAI,GAAK,MAAO,GAAE,QAAW,SAAU,MAAO,CAC1C,KAAM,UAAY,CACd,MAAI,IAAK,GAAK,EAAE,QAAQ,GAAI,QACrB,CAAE,MAAO,GAAK,EAAE,KAAM,KAAM,CAAC,KAG5C,KAAM,IAAI,WAAU,EAAI,0BAA4B,mCAGxD,YAAkB,EAAG,EAAG,CACpB,GAAI,GAAI,MAAO,SAAW,YAAc,EAAE,OAAO,UACjD,GAAI,CAAC,EAAG,MAAO,GACf,GAAI,GAAI,EAAE,KAAK,GAAI,EAAG,EAAK,GAAI,EAC/B,GAAI,CACA,KAAQ,KAAM,QAAU,KAAM,IAAM,CAAE,GAAI,EAAE,QAAQ,MAAM,EAAG,KAAK,EAAE,aAEjE,EAAP,CAAgB,EAAI,CAAE,MAAO,UAC7B,CACI,GAAI,CACA,AAAI,GAAK,CAAC,EAAE,MAAS,GAAI,EAAE,SAAY,EAAE,KAAK,UAElD,CAAU,GAAI,EAAG,KAAM,GAAE,OAE7B,MAAO,GAGX,aAAsB,CAClB,OAAS,GAAK,GAAI,EAAI,EAAG,EAAI,UAAU,OAAQ,IAC3C,EAAK,EAAG,OAAO,GAAS,UAAU,KACtC,MAAO,GAGX,aAA4B,CACxB,OAAS,GAAI,EAAG,EAAI,EAAG,EAAK,UAAU,OAAQ,EAAI,EAAI,IAAK,GAAK,UAAU,GAAG,OAC7E,OAAS,GAAI,MAAM,GAAI,EAAI,EAAG,EAAI,EAAG,EAAI,EAAI,IACzC,OAAS,GAAI,UAAU,GAAI,EAAI,EAAG,EAAK,EAAE,OAAQ,EAAI,EAAI,IAAK,IAC1D,EAAE,GAAK,EAAE,GACjB,MAAO,GAEX,YAAmB,EAAG,CAClB,MAAO,gBAAgB,IAAa,MAAK,EAAI,EAAG,MAAQ,GAAI,IAAU,GAG1E,YAA4B,EAAS,EAAY,EAAW,CACxD,GAAI,CAAC,OAAO,cAAe,KAAM,IAAI,WAAU,wCAC/C,GAAI,GAAI,EAAU,MAAM,EAAS,GAAc,IAAK,EAAG,EAAI,GAC3D,MAAO,GAAI,GAAI,EAAK,QAAS,EAAK,SAAU,EAAK,UAAW,EAAE,OAAO,eAAiB,UAAY,CAAE,MAAO,OAAS,EACpH,WAAc,EAAG,CAAE,AAAI,EAAE,IAAI,GAAE,GAAK,SAAU,EAAG,CAAE,MAAO,IAAI,SAAQ,SAAU,EAAG,EAAG,CAAE,EAAE,KAAK,CAAC,EAAG,EAAG,EAAG,IAAM,GAAK,EAAO,EAAG,OAC9H,WAAgB,EAAG,EAAG,CAAE,GAAI,CAAE,EAAK,EAAE,GAAG,UAAc,EAAP,CAAY,EAAO,EAAE,GAAG,GAAI,IAC3E,WAAc,EAAG,CAAE,EAAE,gBAAiB,IAAY,QAAQ,QAAQ,EAAE,MAAM,GAAG,KAAK,EAAS,GAAU,EAAO,EAAE,GAAG,GAAI,GACrH,WAAiB,EAAO,CAAE,EAAO,OAAQ,GACzC,WAAgB,EAAO,CAAE,EAAO,QAAS,GACzC,WAAgB,EAAG,EAAG,CAAE,AAAI,EAAE,GAAI,EAAE,QAAS,EAAE,QAAQ,EAAO,EAAE,GAAG,GAAI,EAAE,GAAG,KAGhF,YAA4B,EAAG,CAC3B,GAAI,GAAG,EACP,MAAO,GAAI,GAAI,EAAK,QAAS,EAAK,QAAS,SAAU,EAAG,CAAE,KAAM,KAAO,EAAK,UAAW,EAAE,OAAO,UAAY,UAAY,CAAE,MAAO,OAAS,EAC1I,WAAc,EAAG,EAAG,CAAE,EAAE,GAAK,EAAE,GAAK,SAAU,EAAG,CAAE,MAAQ,GAAI,CAAC,GAAK,CAAE,MAAO,GAAU,EAAE,GAAG,IAAK,KAAM,IAAM,UAAa,EAAI,EAAE,GAAK,GAAO,GAGjJ,YAAyB,EAAG,CACxB,GAAI,CAAC,OAAO,cAAe,KAAM,IAAI,WAAU,wCAC/C,GAAI,GAAI,EAAE,OAAO,eAAgB,EACjC,MAAO,GAAI,EAAE,KAAK,GAAM,GAAI,MAAO,KAAe,WAAa,GAAW,GAAK,EAAE,OAAO,YAAa,EAAI,GAAI,EAAK,QAAS,EAAK,SAAU,EAAK,UAAW,EAAE,OAAO,eAAiB,UAAY,CAAE,MAAO,OAAS,GAClN,WAAc,EAAG,CAAE,EAAE,GAAK,EAAE,IAAM,SAAU,EAAG,CAAE,MAAO,IAAI,SAAQ,SAAU,EAAS,EAAQ,CAAE,EAAI,EAAE,GAAG,GAAI,EAAO,EAAS,EAAQ,EAAE,KAAM,EAAE,UAChJ,WAAgB,EAAS,EAAQ,EAAG,EAAG,CAAE,QAAQ,QAAQ,GAAG,KAAK,SAAS,EAAG,CAAE,EAAQ,CAAE,MAAO,EAAG,KAAM,KAAS,IAGtH,YAAgC,EAAQ,EAAK,CACzC,MAAI,QAAO,eAAkB,OAAO,eAAe,EAAQ,MAAO,CAAE,MAAO,IAAiB,EAAO,IAAM,EAClG,EAEX,YAAwB,EAAK,CACzB,GAAI,GAAO,EAAI,WAAY,MAAO,GAClC,GAAI,GAAS,GACb,GAAI,GAAO,KAAM,OAAS,KAAK,GAAK,AAAI,OAAO,eAAe,KAAK,EAAK,IAAI,GAAO,GAAK,EAAI,IAC5F,SAAO,QAAU,EACV,EAGX,YAA2B,EAAK,CAC5B,MAAQ,IAAO,EAAI,WAAc,EAAM,CAAE,QAAS,GAGtD,YAAkC,EAAU,EAAY,CACpD,GAAI,CAAC,EAAW,IAAI,GAChB,KAAM,IAAI,WAAU,kDAExB,MAAO,GAAW,IAAI,GAG1B,YAAkC,EAAU,EAAY,EAAO,CAC3D,GAAI,CAAC,EAAW,IAAI,GAChB,KAAM,IAAI,WAAU,kDAExB,SAAW,IAAI,EAAU,GAClB,EAGX,GAAI,IAA2B,OAAO,OAAO,CACzC,UAAW,KACX,UAAW,MACP,WAAY,CAAE,MAAO,KACzB,OAAQ,GACR,WAAY,GACZ,QAAS,GACT,WAAY,GACZ,UAAW,GACX,YAAa,GACb,gBAAiB,GACjB,aAAc,GACd,SAAU,GACV,OAAQ,GACR,SAAU,GACV,eAAgB,GAChB,QAAS,GACT,iBAAkB,GAClB,iBAAkB,GAClB,cAAe,GACf,qBAAsB,GACtB,aAAc,GACd,gBAAiB,GACjB,uBAAwB,GACxB,uBAAwB,KAGxB,GAAc,GAAqB,SAAU,EAAQ,EAAS,CAClE,OAAO,eAAe,EAAS,aAAc,CAAE,MAAO,KACtD,EAAQ,oBAAsB,EAAQ,KAAO,EAAQ,IAAM,EAAQ,cAAgB,EAAQ,WAAa,OAIxG,EAAQ,WAAa,GAIrB,EAAQ,cAAgB,GAIxB,EAAQ,IAAM,GAAI,aAAY,CAC1B,WACA,WACA,WACA,WACA,UACA,WACA,WACA,WACA,WACA,UACA,UACA,WACA,WACA,WACA,WACA,WACA,WACA,WACA,UACA,UACA,UACA,WACA,WACA,WACA,WACA,WACA,WACA,WACA,WACA,WACA,UACA,UACA,UACA,UACA,WACA,WACA,WACA,WACA,WACA,WACA,WACA,WACA,WACA,WACA,WACA,WACA,WACA,UACA,UACA,UACA,UACA,UACA,UACA,WACA,WACA,WACA,WACA,WACA,WACA,WACA,WACA,WACA,WACA,aAKJ,EAAQ,KAAO,CACX,WACA,WACA,WACA,WACA,WACA,WACA,UACA,YAKJ,EAAQ,oBAAsB,KAAK,IAAI,EAAG,IAAM,IAI5C,GAAc,GAAqB,SAAU,EAAQ,EAAS,CAClE,OAAO,eAAe,EAAS,aAAc,CAAE,MAAO,KACtD,EAAQ,UAAY,OAKpB,GAAI,GAA2B,UAAY,CACvC,YAAqB,CACjB,KAAK,MAAQ,WAAW,KAAK,GAAY,MACzC,KAAK,KAAO,GAAI,YAAW,IAC3B,KAAK,OAAS,GAAI,YAAW,IAC7B,KAAK,aAAe,EACpB,KAAK,YAAc,EAInB,KAAK,SAAW,GAEpB,SAAU,UAAU,OAAS,SAAU,EAAM,CACzC,GAAI,KAAK,SACL,KAAM,IAAI,OAAM,iDAEpB,GAAI,GAAW,EACX,EAAa,EAAK,WAEtB,GADA,KAAK,aAAe,EAChB,KAAK,YAAc,EAAI,GAAY,oBACnC,KAAM,IAAI,OAAM,uCAEpB,KAAO,EAAa,GAChB,KAAK,OAAO,KAAK,gBAAkB,EAAK,KACxC,IACI,KAAK,eAAiB,GAAY,YAClC,MAAK,aACL,KAAK,aAAe,IAIhC,EAAU,UAAU,OAAS,UAAY,CACrC,GAAI,CAAC,KAAK,SAAU,CAChB,GAAI,GAAa,KAAK,YAAc,EAChC,EAAa,GAAI,UAAS,KAAK,OAAO,OAAQ,KAAK,OAAO,WAAY,KAAK,OAAO,YAClF,EAAoB,KAAK,aAG7B,GAFA,EAAW,SAAS,KAAK,eAAgB,KAErC,EAAoB,GAAY,YAAc,GAAY,WAAa,EAAG,CAC1E,OAAS,GAAI,KAAK,aAAc,EAAI,GAAY,WAAY,IACxD,EAAW,SAAS,EAAG,GAE3B,KAAK,aACL,KAAK,aAAe,EAExB,OAAS,GAAI,KAAK,aAAc,EAAI,GAAY,WAAa,EAAG,IAC5D,EAAW,SAAS,EAAG,GAE3B,EAAW,UAAU,GAAY,WAAa,EAAG,KAAK,MAAM,EAAa,YAAc,IACvF,EAAW,UAAU,GAAY,WAAa,EAAG,GACjD,KAAK,aACL,KAAK,SAAW,GAKpB,OADI,GAAM,GAAI,YAAW,GAAY,eAC5B,EAAI,EAAG,EAAI,EAAG,IACnB,EAAI,EAAI,GAAM,KAAK,MAAM,KAAO,GAAM,IACtC,EAAI,EAAI,EAAI,GAAM,KAAK,MAAM,KAAO,GAAM,IAC1C,EAAI,EAAI,EAAI,GAAM,KAAK,MAAM,KAAO,EAAK,IACzC,EAAI,EAAI,EAAI,GAAM,KAAK,MAAM,KAAO,EAAK,IAE7C,MAAO,IAEX,EAAU,UAAU,WAAa,UAAY,CAGzC,OAFI,GAAK,KAAM,EAAS,EAAG,OAAQ,EAAQ,EAAG,MAC1C,EAAS,EAAM,GAAI,EAAS,EAAM,GAAI,EAAS,EAAM,GAAI,EAAS,EAAM,GAAI,EAAS,EAAM,GAAI,EAAS,EAAM,GAAI,EAAS,EAAM,GAAI,EAAS,EAAM,GAC/I,EAAI,EAAG,EAAI,GAAY,WAAY,IAAK,CAC7C,GAAI,EAAI,GACJ,KAAK,KAAK,GACJ,GAAO,EAAI,GAAK,MAAS,GACrB,GAAO,EAAI,EAAI,GAAK,MAAS,GAC7B,GAAO,EAAI,EAAI,GAAK,MAAS,EAC9B,EAAO,EAAI,EAAI,GAAK,QAE5B,CACD,GAAI,GAAI,KAAK,KAAK,EAAI,GAClB,EAAS,KAAM,GAAO,GAAK,IAAS,KAAM,GAAO,GAAK,IAAQ,IAAM,GACxE,EAAI,KAAK,KAAK,EAAI,IAClB,GAAI,GAAS,KAAM,EAAM,GAAK,IAAS,KAAM,GAAO,GAAK,IAAQ,IAAM,EACvE,KAAK,KAAK,GACJ,GAAO,KAAK,KAAK,EAAI,GAAM,GAAO,GAAO,KAAK,KAAK,EAAI,IAAO,GAExE,GAAI,GAAW,OAAW,EAAM,GAAU,IACpC,KAAW,GAAO,GAAU,IAC5B,KAAW,GAAO,GAAU,IAC5B,GAAS,EAAW,CAAC,EAAS,GAChC,GACE,GAAW,IAAY,IAAI,GAAK,KAAK,KAAK,GAAM,GAAM,GACxD,EACA,EAAS,MAAW,EAAM,GAAU,IAClC,KAAW,GAAO,GAAU,IAC5B,KAAW,GAAO,GAAU,KAC5B,GAAS,EAAW,EAAS,EAAW,EAAS,GACnD,EACJ,EAAS,EACT,EAAS,EACT,EAAS,EACT,EAAU,EAAS,EAAM,EACzB,EAAS,EACT,EAAS,EACT,EAAS,EACT,EAAU,EAAK,EAAM,EAEzB,EAAM,IAAM,EACZ,EAAM,IAAM,EACZ,EAAM,IAAM,EACZ,EAAM,IAAM,EACZ,EAAM,IAAM,EACZ,EAAM,IAAM,EACZ,EAAM,IAAM,EACZ,EAAM,IAAM,GAET,KAEX,EAAQ,UAAY,IAIhB,GAAW,GAAqB,SAAU,EAAQ,EAAS,CAC/D,OAAO,eAAe,EAAS,aAAc,CAAE,MAAO,KACtD,EAAQ,OAAS,OAKjB,GAAI,GAAwB,UAAY,CACpC,WAAgB,EAAQ,CACpB,KAAK,OAAS,EACd,KAAK,KAAO,GAAI,IAAY,UAC5B,KAAK,QAET,SAAO,UAAU,OAAS,SAAU,EAAQ,CACxC,GAAK,EAxjIb,GAwjIgB,GAAM,aAAa,IAAW,KAAK,OAG3C,GAAI,CACA,KAAK,KAAK,OAAQ,AA5jI9B,GA4jIiC,GAAM,iBAAiB,UAEzC,EAAP,CACI,KAAK,MAAQ,IAMrB,EAAO,UAAU,WAAa,UAAY,CACtC,GAAI,KAAK,MACL,KAAM,MAAK,MAEf,MAAI,MAAK,MACA,MAAK,MAAM,UACZ,KAAK,MAAM,OAAO,KAAK,KAAK,UAEzB,KAAK,MAAM,UAEf,KAAK,KAAK,UAOrB,EAAO,UAAU,OAAS,UAAY,CAClC,MAAO,IAAY,UAAU,KAAM,OAAQ,OAAQ,UAAY,CAC3D,MAAO,IAAY,YAAY,KAAM,SAAU,EAAI,CAC/C,MAAO,CAAC,EAAc,KAAK,mBAIvC,EAAO,UAAU,MAAQ,UAAY,CAEjC,GADA,KAAK,KAAO,GAAI,IAAY,UACxB,KAAK,OAAQ,CACb,KAAK,MAAQ,GAAI,IAAY,UAC7B,GAAI,GAAQ,EAAiB,KAAK,QAC9B,EAAQ,GAAI,YAAW,GAAY,YACvC,EAAM,IAAI,GACV,OAAS,GAAI,EAAG,EAAI,GAAY,WAAY,IACxC,EAAM,IAAM,GACZ,EAAM,IAAM,GAEhB,KAAK,KAAK,OAAO,GACjB,KAAK,MAAM,OAAO,GAElB,OAAS,GAAI,EAAG,EAAI,EAAM,WAAY,IAClC,EAAM,GAAK,IAIhB,KAEX,EAAQ,OAAS,EACjB,WAA0B,EAAQ,CAC9B,GAAI,GAAS,AApnIjB,GAonIoB,GAAM,iBAAiB,GACvC,GAAI,EAAM,WAAa,GAAY,WAAY,CAC3C,GAAI,GAAa,GAAI,IAAY,UACjC,EAAW,OAAO,GAClB,EAAQ,EAAW,SAEvB,GAAI,GAAS,GAAI,YAAW,GAAY,YACxC,SAAO,IAAI,GACJ,KAKP,GAAU,GAAqB,SAAU,EAAQ,EAAS,CAC9D,OAAO,eAAe,EAAS,aAAc,CAAE,MAAO,KAEtD,GAAY,aAAa,GAAU,KAInC,AAgBA,GAAI,IAAkB,SAAS,EAAG,EAAG,CACjC,UAAkB,OAAO,gBACpB,CAAE,UAAW,aAAgB,QAAS,SAAU,EAAG,EAAG,CAAE,EAAE,UAAY,IACvE,SAAU,EAAG,EAAG,CAAE,OAAS,KAAK,GAAG,AAAI,EAAE,eAAe,IAAI,GAAE,GAAK,EAAE,KAClE,GAAgB,EAAG,IAG9B,YAAqB,EAAG,EAAG,CACvB,GAAgB,EAAG,GACnB,YAAc,CAAE,KAAK,YAAc,EACnC,EAAE,UAAY,IAAM,KAAO,OAAO,OAAO,GAAM,GAAG,UAAY,EAAE,UAAW,GAAI,IAGnF,GAAI,IAAa,UAAW,CACxB,UAAa,OAAO,QAAU,SAAkB,EAAG,CAC/C,OAAS,GAAG,EAAI,EAAG,EAAI,UAAU,OAAQ,EAAI,EAAG,IAAK,CACjD,EAAI,UAAU,GACd,OAAS,KAAK,GAAG,AAAI,OAAO,UAAU,eAAe,KAAK,EAAG,IAAI,GAAE,GAAK,EAAE,IAE9E,MAAO,IAEJ,GAAW,MAAM,KAAM,YAGlC,YAAkB,EAAG,EAAG,CACpB,GAAI,GAAI,GACR,OAAS,KAAK,GAAG,AAAI,OAAO,UAAU,eAAe,KAAK,EAAG,IAAM,EAAE,QAAQ,GAAK,GAC9E,GAAE,GAAK,EAAE,IACb,GAAI,GAAK,MAAQ,MAAO,QAAO,uBAA0B,WACrD,OAAS,GAAI,EAAG,EAAI,OAAO,sBAAsB,GAAI,EAAI,EAAE,OAAQ,IAC/D,AAAI,EAAE,QAAQ,EAAE,IAAM,GAAK,OAAO,UAAU,qBAAqB,KAAK,EAAG,EAAE,KACvE,GAAE,EAAE,IAAM,EAAE,EAAE,KAE1B,MAAO,GAGX,YAAsB,EAAY,EAAQ,EAAK,EAAM,CACjD,GAAI,GAAI,UAAU,OAAQ,EAAI,EAAI,EAAI,EAAS,IAAS,KAAO,EAAO,OAAO,yBAAyB,EAAQ,GAAO,EAAM,EAC3H,GAAI,MAAO,UAAY,UAAY,MAAO,SAAQ,UAAa,WAAY,EAAI,QAAQ,SAAS,EAAY,EAAQ,EAAK,OACpH,QAAS,GAAI,EAAW,OAAS,EAAG,GAAK,EAAG,IAAK,AAAI,GAAI,EAAW,KAAI,GAAK,GAAI,EAAI,EAAE,GAAK,EAAI,EAAI,EAAE,EAAQ,EAAK,GAAK,EAAE,EAAQ,KAAS,GAChJ,MAAO,GAAI,GAAK,GAAK,OAAO,eAAe,EAAQ,EAAK,GAAI,EAGhE,YAAmB,EAAY,EAAW,CACtC,MAAO,UAAU,EAAQ,EAAK,CAAE,EAAU,EAAQ,EAAK,IAG3D,YAAsB,EAAa,EAAe,CAC9C,GAAI,MAAO,UAAY,UAAY,MAAO,SAAQ,UAAa,WAAY,MAAO,SAAQ,SAAS,EAAa,GAGpH,YAAqB,EAAS,EAAY,EAAG,EAAW,CACpD,WAAe,EAAO,CAAE,MAAO,aAAiB,GAAI,EAAQ,GAAI,GAAE,SAAU,EAAS,CAAE,EAAQ,KAC/F,MAAO,IAAK,IAAM,GAAI,UAAU,SAAU,EAAS,EAAQ,CACvD,WAAmB,EAAO,CAAE,GAAI,CAAE,EAAK,EAAU,KAAK,UAAkB,EAAP,CAAY,EAAO,IACpF,WAAkB,EAAO,CAAE,GAAI,CAAE,EAAK,EAAU,MAAS,UAAkB,EAAP,CAAY,EAAO,IACvF,WAAc,EAAQ,CAAE,EAAO,KAAO,EAAQ,EAAO,OAAS,EAAM,EAAO,OAAO,KAAK,EAAW,GAClG,EAAM,GAAY,EAAU,MAAM,EAAS,GAAc,KAAK,UAItE,YAAuB,EAAS,EAAM,CAClC,GAAI,GAAI,CAAE,MAAO,EAAG,KAAM,UAAW,CAAE,GAAI,EAAE,GAAK,EAAG,KAAM,GAAE,GAAI,MAAO,GAAE,IAAO,KAAM,GAAI,IAAK,IAAM,EAAG,EAAG,EAAG,EAC/G,MAAO,GAAI,CAAE,KAAM,EAAK,GAAI,MAAS,EAAK,GAAI,OAAU,EAAK,IAAM,MAAO,SAAW,YAAe,GAAE,OAAO,UAAY,UAAW,CAAE,MAAO,QAAU,EACvJ,WAAc,EAAG,CAAE,MAAO,UAAU,EAAG,CAAE,MAAO,GAAK,CAAC,EAAG,KACzD,WAAc,EAAI,CACd,GAAI,EAAG,KAAM,IAAI,WAAU,mCAC3B,KAAO,GAAG,GAAI,CACV,GAAI,EAAI,EAAG,GAAM,GAAI,EAAG,GAAK,EAAI,EAAE,OAAY,EAAG,GAAK,EAAE,OAAc,IAAI,EAAE,SAAc,EAAE,KAAK,GAAI,GAAK,EAAE,OAAS,CAAE,GAAI,EAAE,KAAK,EAAG,EAAG,KAAK,KAAM,MAAO,GAE3J,OADI,EAAI,EAAG,GAAG,GAAK,CAAC,EAAG,GAAK,EAAG,EAAE,QACzB,EAAG,QACF,OAAQ,GAAG,EAAI,EAAI,UACnB,GAAG,SAAE,QAAgB,CAAE,MAAO,EAAG,GAAI,KAAM,QAC3C,GAAG,EAAE,QAAS,EAAI,EAAG,GAAI,EAAK,CAAC,GAAI,aACnC,GAAG,EAAK,EAAE,IAAI,MAAO,EAAE,KAAK,MAAO,iBAEpC,GAAM,EAAI,EAAE,KAAM,IAAI,EAAE,OAAS,GAAK,EAAE,EAAE,OAAS,KAAQ,GAAG,KAAO,GAAK,EAAG,KAAO,GAAI,CAAE,EAAI,EAAG,SACjG,GAAI,EAAG,KAAO,GAAM,EAAC,GAAM,EAAG,GAAK,EAAE,IAAM,EAAG,GAAK,EAAE,IAAM,CAAE,EAAE,MAAQ,EAAG,GAAI,MAC9E,GAAI,EAAG,KAAO,GAAK,EAAE,MAAQ,EAAE,GAAI,CAAE,EAAE,MAAQ,EAAE,GAAI,EAAI,EAAI,MAC7D,GAAI,GAAK,EAAE,MAAQ,EAAE,GAAI,CAAE,EAAE,MAAQ,EAAE,GAAI,EAAE,IAAI,KAAK,GAAK,MAC3D,AAAI,EAAE,IAAI,EAAE,IAAI,MAChB,EAAE,KAAK,MAAO,SAEtB,EAAK,EAAK,KAAK,EAAS,SACnB,EAAP,CAAY,EAAK,CAAC,EAAG,GAAI,EAAI,SAAK,CAAU,EAAI,EAAI,EACtD,GAAI,EAAG,GAAK,EAAG,KAAM,GAAG,GAAI,MAAO,CAAE,MAAO,EAAG,GAAK,EAAG,GAAK,OAAQ,KAAM,KAIlF,YAA2B,EAAG,EAAG,EAAG,EAAI,CACpC,AAAI,IAAO,QAAW,GAAK,GAC3B,EAAE,GAAM,EAAE,GAGd,YAAwB,EAAG,EAAS,CAChC,OAAS,KAAK,GAAG,AAAI,IAAM,WAAa,CAAC,EAAQ,eAAe,IAAI,GAAQ,GAAK,EAAE,IAGvF,YAAoB,EAAG,CACnB,GAAI,GAAI,MAAO,SAAW,YAAc,OAAO,SAAU,EAAI,GAAK,EAAE,GAAI,EAAI,EAC5E,GAAI,EAAG,MAAO,GAAE,KAAK,GACrB,GAAI,GAAK,MAAO,GAAE,QAAW,SAAU,MAAO,CAC1C,KAAM,UAAY,CACd,MAAI,IAAK,GAAK,EAAE,QAAQ,GAAI,QACrB,CAAE,MAAO,GAAK,EAAE,KAAM,KAAM,CAAC,KAG5C,KAAM,IAAI,WAAU,EAAI,0BAA4B,mCAGxD,YAAkB,EAAG,EAAG,CACpB,GAAI,GAAI,MAAO,SAAW,YAAc,EAAE,OAAO,UACjD,GAAI,CAAC,EAAG,MAAO,GACf,GAAI,GAAI,EAAE,KAAK,GAAI,EAAG,EAAK,GAAI,EAC/B,GAAI,CACA,KAAQ,KAAM,QAAU,KAAM,IAAM,CAAE,GAAI,EAAE,QAAQ,MAAM,EAAG,KAAK,EAAE,aAEjE,EAAP,CAAgB,EAAI,CAAE,MAAO,UAC7B,CACI,GAAI,CACA,AAAI,GAAK,CAAC,EAAE,MAAS,GAAI,EAAE,SAAY,EAAE,KAAK,UAElD,CAAU,GAAI,EAAG,KAAM,GAAE,OAE7B,MAAO,GAGX,aAAsB,CAClB,OAAS,GAAK,GAAI,EAAI,EAAG,EAAI,UAAU,OAAQ,IAC3C,EAAK,EAAG,OAAO,GAAS,UAAU,KACtC,MAAO,GAGX,aAA4B,CACxB,OAAS,GAAI,EAAG,EAAI,EAAG,EAAK,UAAU,OAAQ,EAAI,EAAI,IAAK,GAAK,UAAU,GAAG,OAC7E,OAAS,GAAI,MAAM,GAAI,EAAI,EAAG,EAAI,EAAG,EAAI,EAAI,IACzC,OAAS,GAAI,UAAU,GAAI,EAAI,EAAG,EAAK,EAAE,OAAQ,EAAI,EAAI,IAAK,IAC1D,EAAE,GAAK,EAAE,GACjB,MAAO,GAEX,YAAmB,EAAG,CAClB,MAAO,gBAAgB,IAAa,MAAK,EAAI,EAAG,MAAQ,GAAI,IAAU,GAG1E,YAA4B,EAAS,EAAY,EAAW,CACxD,GAAI,CAAC,OAAO,cAAe,KAAM,IAAI,WAAU,wCAC/C,GAAI,GAAI,EAAU,MAAM,EAAS,GAAc,IAAK,EAAG,EAAI,GAC3D,MAAO,GAAI,GAAI,EAAK,QAAS,EAAK,SAAU,EAAK,UAAW,EAAE,OAAO,eAAiB,UAAY,CAAE,MAAO,OAAS,EACpH,WAAc,EAAG,CAAE,AAAI,EAAE,IAAI,GAAE,GAAK,SAAU,EAAG,CAAE,MAAO,IAAI,SAAQ,SAAU,EAAG,EAAG,CAAE,EAAE,KAAK,CAAC,EAAG,EAAG,EAAG,IAAM,GAAK,EAAO,EAAG,OAC9H,WAAgB,EAAG,EAAG,CAAE,GAAI,CAAE,EAAK,EAAE,GAAG,UAAc,EAAP,CAAY,EAAO,EAAE,GAAG,GAAI,IAC3E,WAAc,EAAG,CAAE,EAAE,gBAAiB,IAAY,QAAQ,QAAQ,EAAE,MAAM,GAAG,KAAK,EAAS,GAAU,EAAO,EAAE,GAAG,GAAI,GACrH,WAAiB,EAAO,CAAE,EAAO,OAAQ,GACzC,WAAgB,EAAO,CAAE,EAAO,QAAS,GACzC,WAAgB,EAAG,EAAG,CAAE,AAAI,EAAE,GAAI,EAAE,QAAS,EAAE,QAAQ,EAAO,EAAE,GAAG,GAAI,EAAE,GAAG,KAGhF,YAA4B,EAAG,CAC3B,GAAI,GAAG,EACP,MAAO,GAAI,GAAI,EAAK,QAAS,EAAK,QAAS,SAAU,EAAG,CAAE,KAAM,KAAO,EAAK,UAAW,EAAE,OAAO,UAAY,UAAY,CAAE,MAAO,OAAS,EAC1I,WAAc,EAAG,EAAG,CAAE,EAAE,GAAK,EAAE,GAAK,SAAU,EAAG,CAAE,MAAQ,GAAI,CAAC,GAAK,CAAE,MAAO,GAAU,EAAE,GAAG,IAAK,KAAM,IAAM,UAAa,EAAI,EAAE,GAAK,GAAO,GAGjJ,YAAyB,EAAG,CACxB,GAAI,CAAC,OAAO,cAAe,KAAM,IAAI,WAAU,wCAC/C,GAAI,GAAI,EAAE,OAAO,eAAgB,EACjC,MAAO,GAAI,EAAE,KAAK,GAAM,GAAI,MAAO,KAAe,WAAa,GAAW,GAAK,EAAE,OAAO,YAAa,EAAI,GAAI,EAAK,QAAS,EAAK,SAAU,EAAK,UAAW,EAAE,OAAO,eAAiB,UAAY,CAAE,MAAO,OAAS,GAClN,WAAc,EAAG,CAAE,EAAE,GAAK,EAAE,IAAM,SAAU,EAAG,CAAE,MAAO,IAAI,SAAQ,SAAU,EAAS,EAAQ,CAAE,EAAI,EAAE,GAAG,GAAI,EAAO,EAAS,EAAQ,EAAE,KAAM,EAAE,UAChJ,WAAgB,EAAS,EAAQ,EAAG,EAAG,CAAE,QAAQ,QAAQ,GAAG,KAAK,SAAS,EAAG,CAAE,EAAQ,CAAE,MAAO,EAAG,KAAM,KAAS,IAGtH,YAAgC,EAAQ,EAAK,CACzC,MAAI,QAAO,eAAkB,OAAO,eAAe,EAAQ,MAAO,CAAE,MAAO,IAAiB,EAAO,IAAM,EAClG,EAEX,YAAwB,EAAK,CACzB,GAAI,GAAO,EAAI,WAAY,MAAO,GAClC,GAAI,GAAS,GACb,GAAI,GAAO,KAAM,OAAS,KAAK,GAAK,AAAI,OAAO,eAAe,KAAK,EAAK,IAAI,GAAO,GAAK,EAAI,IAC5F,SAAO,QAAU,EACV,EAGX,YAA2B,EAAK,CAC5B,MAAQ,IAAO,EAAI,WAAc,EAAM,CAAE,QAAS,GAGtD,YAAkC,EAAU,EAAY,CACpD,GAAI,CAAC,EAAW,IAAI,GAChB,KAAM,IAAI,WAAU,kDAExB,MAAO,GAAW,IAAI,GAG1B,YAAkC,EAAU,EAAY,EAAO,CAC3D,GAAI,CAAC,EAAW,IAAI,GAChB,KAAM,IAAI,WAAU,kDAExB,SAAW,IAAI,EAAU,GAClB,EAGX,GAAI,IAA2B,OAAO,OAAO,CACzC,UAAW,KACX,UAAW,MACP,WAAY,CAAE,MAAO,KACzB,OAAQ,GACR,WAAY,GACZ,QAAS,GACT,WAAY,GACZ,UAAW,GACX,YAAa,GACb,gBAAiB,GACjB,aAAc,GACd,SAAU,GACV,OAAQ,GACR,SAAU,GACV,eAAgB,GAChB,QAAS,GACT,iBAAkB,GAClB,iBAAkB,GAClB,cAAe,GACf,qBAAsB,GACtB,aAAc,GACd,gBAAiB,GACjB,uBAAwB,GACxB,uBAAwB,KAGxB,GAAsB,GAAqB,SAAU,EAAQ,EAAS,CAC1E,OAAO,eAAe,EAAS,aAAc,CAAE,MAAO,KACtD,EAAQ,oBAAsB,EAAQ,qBAAuB,EAAQ,qBAAuB,EAAQ,kBAAoB,OAExH,GAAI,GAAsB,CACtB,UACA,SACA,UACA,YACA,cACA,YACA,OACA,UAEJ,WAA2B,EAAQ,CAC/B,GAAI,EAAqB,IACrB,MAAO,GAAO,OAAO,QAAW,SAAU,CAC1C,GAAI,GAAS,EAAO,OAAO,OAC3B,MAAO,GAAqB,GAEhC,MAAO,GAEX,EAAQ,kBAAoB,EAC5B,WAA8B,EAAQ,CAClC,GAAI,MAAO,IAAW,UAAY,MAAO,GAAO,QAAW,SAAU,CACjE,GAAI,GAAkB,EAAO,OAAO,gBACpC,MAAO,OAAO,IAAoB,WAEtC,MAAO,GAEX,EAAQ,qBAAuB,EAC/B,WAA8B,EAAQ,CAClC,MAAQ,IACJ,EAAoB,MAAM,SAAU,EAAY,CAAE,MAAO,OAAO,GAAO,IAAgB,aAE/F,EAAQ,qBAAuB,EAC/B,WAA6B,EAAQ,CACjC,MAAO,IAAY,UAAU,KAAM,OAAQ,OAAQ,UAAY,CAC3D,GAAI,GAAK,EACT,MAAO,IAAY,YAAY,KAAM,SAAU,EAAI,CAC/C,OAAQ,EAAG,WACF,GACD,GAAI,CAAC,EAAqB,GACtB,MAAO,CAAC,EAAc,IAC1B,EAAG,MAAQ,MACV,GACD,SAAG,KAAK,KAAK,CAAC,EAAG,EAAG,CAAE,IACf,CAAC,EAAa,EAAO,YAAY,CAAE,KAAM,UAAW,OAAQ,KAAO,GAAO,CAAC,iBACjF,GACD,SAAM,EAAG,OACF,CAAC,EAAa,EAAO,QAAQ,CAC5B,KAAM,UACN,GAAI,GAAI,YAAW,MAAM,KACzB,eAAgB,GAAI,YAAW,MAAM,KACrC,UAAW,KACZ,EAAK,GAAI,YAAW,SAC1B,GACD,SAAkB,EAAG,OACd,CAAC,EAAc,EAAgB,aAAe,QACpD,GACD,SAAG,OACI,CAAC,EAAc,QACrB,GAAG,MAAO,CAAC,QAKhC,EAAQ,oBAAsB,IAI1B,GAAU,GAAqB,SAAU,EAAQ,EAAS,CAC9D,OAAO,eAAe,EAAS,aAAc,CAAE,MAAO,KAEtD,GAAY,aAAa,GAAqB,KAI9C,AAgBA,GAAI,IAAkB,SAAS,EAAG,EAAG,CACjC,UAAkB,OAAO,gBACpB,CAAE,UAAW,aAAgB,QAAS,SAAU,EAAG,EAAG,CAAE,EAAE,UAAY,IACvE,SAAU,EAAG,EAAG,CAAE,OAAS,KAAK,GAAG,AAAI,EAAE,eAAe,IAAI,GAAE,GAAK,EAAE,KAClE,GAAgB,EAAG,IAG9B,YAAqB,EAAG,EAAG,CACvB,GAAgB,EAAG,GACnB,YAAc,CAAE,KAAK,YAAc,EACnC,EAAE,UAAY,IAAM,KAAO,OAAO,OAAO,GAAM,GAAG,UAAY,EAAE,UAAW,GAAI,IAGnF,GAAI,IAAa,UAAW,CACxB,UAAa,OAAO,QAAU,SAAkB,EAAG,CAC/C,OAAS,GAAG,EAAI,EAAG,EAAI,UAAU,OAAQ,EAAI,EAAG,IAAK,CACjD,EAAI,UAAU,GACd,OAAS,KAAK,GAAG,AAAI,OAAO,UAAU,eAAe,KAAK,EAAG,IAAI,GAAE,GAAK,EAAE,IAE9E,MAAO,IAEJ,GAAW,MAAM,KAAM,YAGlC,YAAkB,EAAG,EAAG,CACpB,GAAI,GAAI,GACR,OAAS,KAAK,GAAG,AAAI,OAAO,UAAU,eAAe,KAAK,EAAG,IAAM,EAAE,QAAQ,GAAK,GAC9E,GAAE,GAAK,EAAE,IACb,GAAI,GAAK,MAAQ,MAAO,QAAO,uBAA0B,WACrD,OAAS,GAAI,EAAG,EAAI,OAAO,sBAAsB,GAAI,EAAI,EAAE,OAAQ,IAC/D,AAAI,EAAE,QAAQ,EAAE,IAAM,GAAK,OAAO,UAAU,qBAAqB,KAAK,EAAG,EAAE,KACvE,GAAE,EAAE,IAAM,EAAE,EAAE,KAE1B,MAAO,GAGX,YAAsB,EAAY,EAAQ,EAAK,EAAM,CACjD,GAAI,GAAI,UAAU,OAAQ,EAAI,EAAI,EAAI,EAAS,IAAS,KAAO,EAAO,OAAO,yBAAyB,EAAQ,GAAO,EAAM,EAC3H,GAAI,MAAO,UAAY,UAAY,MAAO,SAAQ,UAAa,WAAY,EAAI,QAAQ,SAAS,EAAY,EAAQ,EAAK,OACpH,QAAS,GAAI,EAAW,OAAS,EAAG,GAAK,EAAG,IAAK,AAAI,GAAI,EAAW,KAAI,GAAK,GAAI,EAAI,EAAE,GAAK,EAAI,EAAI,EAAE,EAAQ,EAAK,GAAK,EAAE,EAAQ,KAAS,GAChJ,MAAO,GAAI,GAAK,GAAK,OAAO,eAAe,EAAQ,EAAK,GAAI,EAGhE,YAAmB,EAAY,EAAW,CACtC,MAAO,UAAU,EAAQ,EAAK,CAAE,EAAU,EAAQ,EAAK,IAG3D,YAAsB,EAAa,EAAe,CAC9C,GAAI,MAAO,UAAY,UAAY,MAAO,SAAQ,UAAa,WAAY,MAAO,SAAQ,SAAS,EAAa,GAGpH,YAAqB,EAAS,EAAY,EAAG,EAAW,CACpD,WAAe,EAAO,CAAE,MAAO,aAAiB,GAAI,EAAQ,GAAI,GAAE,SAAU,EAAS,CAAE,EAAQ,KAC/F,MAAO,IAAK,IAAM,GAAI,UAAU,SAAU,EAAS,EAAQ,CACvD,WAAmB,EAAO,CAAE,GAAI,CAAE,EAAK,EAAU,KAAK,UAAkB,EAAP,CAAY,EAAO,IACpF,WAAkB,EAAO,CAAE,GAAI,CAAE,EAAK,EAAU,MAAS,UAAkB,EAAP,CAAY,EAAO,IACvF,WAAc,EAAQ,CAAE,EAAO,KAAO,EAAQ,EAAO,OAAS,EAAM,EAAO,OAAO,KAAK,EAAW,GAClG,EAAM,GAAY,EAAU,MAAM,EAAS,GAAc,KAAK,UAItE,YAAuB,EAAS,EAAM,CAClC,GAAI,GAAI,CAAE,MAAO,EAAG,KAAM,UAAW,CAAE,GAAI,EAAE,GAAK,EAAG,KAAM,GAAE,GAAI,MAAO,GAAE,IAAO,KAAM,GAAI,IAAK,IAAM,EAAG,EAAG,EAAG,EAC/G,MAAO,GAAI,CAAE,KAAM,EAAK,GAAI,MAAS,EAAK,GAAI,OAAU,EAAK,IAAM,MAAO,SAAW,YAAe,GAAE,OAAO,UAAY,UAAW,CAAE,MAAO,QAAU,EACvJ,WAAc,EAAG,CAAE,MAAO,UAAU,EAAG,CAAE,MAAO,GAAK,CAAC,EAAG,KACzD,WAAc,EAAI,CACd,GAAI,EAAG,KAAM,IAAI,WAAU,mCAC3B,KAAO,GAAG,GAAI,CACV,GAAI,EAAI,EAAG,GAAM,GAAI,EAAG,GAAK,EAAI,EAAE,OAAY,EAAG,GAAK,EAAE,OAAc,IAAI,EAAE,SAAc,EAAE,KAAK,GAAI,GAAK,EAAE,OAAS,CAAE,GAAI,EAAE,KAAK,EAAG,EAAG,KAAK,KAAM,MAAO,GAE3J,OADI,EAAI,EAAG,GAAG,GAAK,CAAC,EAAG,GAAK,EAAG,EAAE,QACzB,EAAG,QACF,OAAQ,GAAG,EAAI,EAAI,UACnB,GAAG,SAAE,QAAgB,CAAE,MAAO,EAAG,GAAI,KAAM,QAC3C,GAAG,EAAE,QAAS,EAAI,EAAG,GAAI,EAAK,CAAC,GAAI,aACnC,GAAG,EAAK,EAAE,IAAI,MAAO,EAAE,KAAK,MAAO,iBAEpC,GAAM,EAAI,EAAE,KAAM,IAAI,EAAE,OAAS,GAAK,EAAE,EAAE,OAAS,KAAQ,GAAG,KAAO,GAAK,EAAG,KAAO,GAAI,CAAE,EAAI,EAAG,SACjG,GAAI,EAAG,KAAO,GAAM,EAAC,GAAM,EAAG,GAAK,EAAE,IAAM,EAAG,GAAK,EAAE,IAAM,CAAE,EAAE,MAAQ,EAAG,GAAI,MAC9E,GAAI,EAAG,KAAO,GAAK,EAAE,MAAQ,EAAE,GAAI,CAAE,EAAE,MAAQ,EAAE,GAAI,EAAI,EAAI,MAC7D,GAAI,GAAK,EAAE,MAAQ,EAAE,GAAI,CAAE,EAAE,MAAQ,EAAE,GAAI,EAAE,IAAI,KAAK,GAAK,MAC3D,AAAI,EAAE,IAAI,EAAE,IAAI,MAChB,EAAE,KAAK,MAAO,SAEtB,EAAK,EAAK,KAAK,EAAS,SACnB,EAAP,CAAY,EAAK,CAAC,EAAG,GAAI,EAAI,SAAK,CAAU,EAAI,EAAI,EACtD,GAAI,EAAG,GAAK,EAAG,KAAM,GAAG,GAAI,MAAO,CAAE,MAAO,EAAG,GAAK,EAAG,GAAK,OAAQ,KAAM,KAIlF,YAA2B,EAAG,EAAG,EAAG,EAAI,CACpC,AAAI,IAAO,QAAW,GAAK,GAC3B,EAAE,GAAM,EAAE,GAGd,YAAwB,EAAG,EAAS,CAChC,OAAS,KAAK,GAAG,AAAI,IAAM,WAAa,CAAC,EAAQ,eAAe,IAAI,GAAQ,GAAK,EAAE,IAGvF,YAAoB,EAAG,CACnB,GAAI,GAAI,MAAO,SAAW,YAAc,OAAO,SAAU,EAAI,GAAK,EAAE,GAAI,EAAI,EAC5E,GAAI,EAAG,MAAO,GAAE,KAAK,GACrB,GAAI,GAAK,MAAO,GAAE,QAAW,SAAU,MAAO,CAC1C,KAAM,UAAY,CACd,MAAI,IAAK,GAAK,EAAE,QAAQ,GAAI,QACrB,CAAE,MAAO,GAAK,EAAE,KAAM,KAAM,CAAC,KAG5C,KAAM,IAAI,WAAU,EAAI,0BAA4B,mCAGxD,YAAkB,EAAG,EAAG,CACpB,GAAI,GAAI,MAAO,SAAW,YAAc,EAAE,OAAO,UACjD,GAAI,CAAC,EAAG,MAAO,GACf,GAAI,GAAI,EAAE,KAAK,GAAI,EAAG,EAAK,GAAI,EAC/B,GAAI,CACA,KAAQ,KAAM,QAAU,KAAM,IAAM,CAAE,GAAI,EAAE,QAAQ,MAAM,EAAG,KAAK,EAAE,aAEjE,EAAP,CAAgB,EAAI,CAAE,MAAO,UAC7B,CACI,GAAI,CACA,AAAI,GAAK,CAAC,EAAE,MAAS,GAAI,EAAE,SAAY,EAAE,KAAK,UAElD,CAAU,GAAI,EAAG,KAAM,GAAE,OAE7B,MAAO,GAGX,aAAsB,CAClB,OAAS,GAAK,GAAI,EAAI,EAAG,EAAI,UAAU,OAAQ,IAC3C,EAAK,EAAG,OAAO,GAAS,UAAU,KACtC,MAAO,GAGX,aAA4B,CACxB,OAAS,GAAI,EAAG,EAAI,EAAG,EAAK,UAAU,OAAQ,EAAI,EAAI,IAAK,GAAK,UAAU,GAAG,OAC7E,OAAS,GAAI,MAAM,GAAI,EAAI,EAAG,EAAI,EAAG,EAAI,EAAI,IACzC,OAAS,GAAI,UAAU,GAAI,EAAI,EAAG,EAAK,EAAE,OAAQ,EAAI,EAAI,IAAK,IAC1D,EAAE,GAAK,EAAE,GACjB,MAAO,GAEX,YAAmB,EAAG,CAClB,MAAO,gBAAgB,IAAa,MAAK,EAAI,EAAG,MAAQ,GAAI,IAAU,GAG1E,YAA4B,EAAS,EAAY,EAAW,CACxD,GAAI,CAAC,OAAO,cAAe,KAAM,IAAI,WAAU,wCAC/C,GAAI,GAAI,EAAU,MAAM,EAAS,GAAc,IAAK,EAAG,EAAI,GAC3D,MAAO,GAAI,GAAI,EAAK,QAAS,EAAK,SAAU,EAAK,UAAW,EAAE,OAAO,eAAiB,UAAY,CAAE,MAAO,OAAS,EACpH,WAAc,EAAG,CAAE,AAAI,EAAE,IAAI,GAAE,GAAK,SAAU,EAAG,CAAE,MAAO,IAAI,SAAQ,SAAU,EAAG,EAAG,CAAE,EAAE,KAAK,CAAC,EAAG,EAAG,EAAG,IAAM,GAAK,EAAO,EAAG,OAC9H,WAAgB,EAAG,EAAG,CAAE,GAAI,CAAE,EAAK,EAAE,GAAG,UAAc,EAAP,CAAY,EAAO,EAAE,GAAG,GAAI,IAC3E,WAAc,EAAG,CAAE,EAAE,gBAAiB,IAAY,QAAQ,QAAQ,EAAE,MAAM,GAAG,KAAK,EAAS,GAAU,EAAO,EAAE,GAAG,GAAI,GACrH,WAAiB,EAAO,CAAE,EAAO,OAAQ,GACzC,WAAgB,EAAO,CAAE,EAAO,QAAS,GACzC,WAAgB,EAAG,EAAG,CAAE,AAAI,EAAE,GAAI,EAAE,QAAS,EAAE,QAAQ,EAAO,EAAE,GAAG,GAAI,EAAE,GAAG,KAGhF,YAA4B,EAAG,CAC3B,GAAI,GAAG,EACP,MAAO,GAAI,GAAI,EAAK,QAAS,EAAK,QAAS,SAAU,EAAG,CAAE,KAAM,KAAO,EAAK,UAAW,EAAE,OAAO,UAAY,UAAY,CAAE,MAAO,OAAS,EAC1I,WAAc,EAAG,EAAG,CAAE,EAAE,GAAK,EAAE,GAAK,SAAU,EAAG,CAAE,MAAQ,GAAI,CAAC,GAAK,CAAE,MAAO,GAAU,EAAE,GAAG,IAAK,KAAM,IAAM,UAAa,EAAI,EAAE,GAAK,GAAO,GAGjJ,YAAyB,EAAG,CACxB,GAAI,CAAC,OAAO,cAAe,KAAM,IAAI,WAAU,wCAC/C,GAAI,GAAI,EAAE,OAAO,eAAgB,EACjC,MAAO,GAAI,EAAE,KAAK,GAAM,GAAI,MAAO,KAAe,WAAa,GAAW,GAAK,EAAE,OAAO,YAAa,EAAI,GAAI,EAAK,QAAS,EAAK,SAAU,EAAK,UAAW,EAAE,OAAO,eAAiB,UAAY,CAAE,MAAO,OAAS,GAClN,WAAc,EAAG,CAAE,EAAE,GAAK,EAAE,IAAM,SAAU,EAAG,CAAE,MAAO,IAAI,SAAQ,SAAU,EAAS,EAAQ,CAAE,EAAI,EAAE,GAAG,GAAI,EAAO,EAAS,EAAQ,EAAE,KAAM,EAAE,UAChJ,WAAgB,EAAS,EAAQ,EAAG,EAAG,CAAE,QAAQ,QAAQ,GAAG,KAAK,SAAS,EAAG,CAAE,EAAQ,CAAE,MAAO,EAAG,KAAM,KAAS,IAGtH,YAAgC,EAAQ,EAAK,CACzC,MAAI,QAAO,eAAkB,OAAO,eAAe,EAAQ,MAAO,CAAE,MAAO,IAAiB,EAAO,IAAM,EAClG,EAEX,YAAwB,EAAK,CACzB,GAAI,GAAO,EAAI,WAAY,MAAO,GAClC,GAAI,GAAS,GACb,GAAI,GAAO,KAAM,OAAS,KAAK,GAAK,AAAI,OAAO,eAAe,KAAK,EAAK,IAAI,GAAO,GAAK,EAAI,IAC5F,SAAO,QAAU,EACV,EAGX,YAA2B,EAAK,CAC5B,MAAQ,IAAO,EAAI,WAAc,EAAM,CAAE,QAAS,GAGtD,YAAkC,EAAU,EAAY,CACpD,GAAI,CAAC,EAAW,IAAI,GAChB,KAAM,IAAI,WAAU,kDAExB,MAAO,GAAW,IAAI,GAG1B,YAAkC,EAAU,EAAY,EAAO,CAC3D,GAAI,CAAC,EAAW,IAAI,GAChB,KAAM,IAAI,WAAU,kDAExB,SAAW,IAAI,EAAU,GAClB,EAGX,GAAI,IAA2B,OAAO,OAAO,CACzC,UAAW,KACX,UAAW,MACP,WAAY,CAAE,MAAO,KACzB,OAAQ,GACR,WAAY,GACZ,QAAS,GACT,WAAY,GACZ,UAAW,GACX,YAAa,GACb,gBAAiB,GACjB,aAAc,GACd,SAAU,GACV,OAAQ,GACR,SAAU,GACV,eAAgB,GAChB,QAAS,GACT,iBAAkB,GAClB,iBAAkB,GAClB,cAAe,GACf,qBAAsB,GACtB,aAAc,GACd,gBAAiB,GACjB,uBAAwB,GACxB,uBAAwB,KAGxB,GAAkB,GAAqB,SAAU,EAAQ,EAAS,CACtE,OAAO,eAAe,EAAS,aAAc,CAAE,MAAO,OAIlD,GAAM,GAAqB,SAAU,EAAQ,EAAS,CAC1D,OAAO,eAAe,EAAS,aAAc,CAAE,MAAO,OAIlD,GAAe,GAAqB,SAAU,EAAQ,EAAS,CACnE,OAAO,eAAe,EAAS,aAAc,CAAE,MAAO,OAIlD,GAAiB,GAAqB,SAAU,EAAQ,EAAS,CACrE,OAAO,eAAe,EAAS,aAAc,CAAE,MAAO,OAIlD,GAAW,GAAqB,SAAU,EAAQ,EAAS,CAC/D,OAAO,eAAe,EAAS,aAAc,CAAE,MAAO,KACtD,EAAQ,WAAa,OACrB,GAAI,GAAwB,CACxB,UACA,SACA,UACA,YACA,cACA,YACA,OACA,UAEJ,WAA8B,EAAQ,CAClC,MAAO,wBAA0B,IAAU,YAAc,GAM7D,WAAoB,EAAQ,CACxB,GAAI,EAAqB,IAAW,EAAO,SAAS,SAAW,OAAW,CACtE,GAAI,GAAK,EAAO,SAAU,EAAkB,EAAG,gBAAiB,EAAW,EAAG,OAC9E,MAAO,GACF,IAAI,SAAU,EAAY,CAAE,MAAO,GAAS,KAC5C,OAAO,GACP,MAAM,SAAU,EAAQ,CAAE,MAAO,OAAO,IAAW,aAE5D,MAAO,GAEX,EAAQ,WAAa,IAIjB,GAAU,GAAqB,SAAU,EAAQ,EAAS,CAC9D,OAAO,eAAe,EAAS,aAAc,CAAE,MAAO,KAEtD,GAAY,aAAa,GAAiB,GAC1C,GAAY,aAAa,GAAK,GAC9B,GAAY,aAAa,GAAc,GACvC,GAAY,aAAa,GAAgB,GACzC,GAAY,aAAa,GAAU,KAI/B,GAAsB,GAAqB,SAAU,EAAQ,EAAS,CAC1E,OAAO,eAAe,EAAS,aAAc,CAAE,MAAO,KACtD,EAAQ,OAAS,OAQjB,GAAI,GAAwB,UAAY,CACpC,WAAgB,EAAQ,CACpB,AAAK,AA3wJb,GA2wJgB,GAAQ,mBAAoB,AA3wJ5C,GA2wJ+C,GAAS,iBAC5C,KAAK,KAAO,GAAI,IAAgB,OAAO,GAEtC,AAAK,AA9wJlB,GA8wJqB,GAAQ,YAAa,AA9wJ1C,GA8wJ6C,GAAS,iBAC1C,KAAK,KAAO,GAAI,IAAW,OAAO,GAGlC,KAAK,KAAO,GAAI,IAAQ,OAAO,GAGvC,SAAO,UAAU,OAAS,SAAU,EAAM,EAAU,CAChD,KAAK,KAAK,OAAQ,AAtxJ1B,GAsxJ6B,GAAM,iBAAiB,KAEhD,EAAO,UAAU,OAAS,UAAY,CAClC,MAAO,MAAK,KAAK,UAErB,EAAO,UAAU,MAAQ,UAAY,CACjC,KAAK,KAAK,SAEP,KAEX,EAAQ,OAAS,IAIb,GAAU,GAAqB,SAAU,EAAQ,EAAS,CAC9D,OAAO,eAAe,EAAS,aAAc,CAAE,MAAO,KACtD,EAAQ,gBAAkB,EAAQ,WAAa,OAE/C,GAAY,aAAa,GAAqB,GAE9C,OAAO,eAAe,EAAS,aAAc,CAAE,WAAY,GAAM,IAAK,UAAY,CAAE,MAAO,IAAW,UAEtG,OAAO,eAAe,EAAS,kBAAmB,CAAE,WAAY,GAAM,IAAK,UAAY,CAAE,MAAO,IAAgB,YAM1G,GAAsB,CAC1B,cAAe,cACf,kBAAmB,UACnB,KAAM,OACN,WAAY,aACZ,OAAQ,SACR,SAAU,WACV,SAAU,WACV,SAAU,WACV,QAAS,UACT,MAAO,QACP,QAAS,UACT,gBAAiB,gBACjB,UAAW,YACX,oBAAqB,KACrB,WAAY,WACZ,QAAS,UACT,iBAAkB,OAClB,aAAc,KACd,sBAAuB,QACvB,MAAO,QACP,cAAe,cACf,UAAW,YACX,OAAQ,SACR,SAAU,WACV,GAAI,KACJ,OAAQ,SACR,OAAQ,SACR,SAAU,WACV,+BAAgC,mBAChC,UAAW,YACX,SAAU,WACV,MAAO,QACP,MAAO,QACP,aAAc,KACd,QAAS,UACT,gBAAiB,QACjB,OAAQ,SACR,iBAAkB,SAClB,KAAM,QAGF,GAAc,CAClB,YAAa,cACb,QAAS,kBACT,KAAM,OACN,WAAY,aACZ,OAAQ,SACR,SAAU,WACV,SAAU,WACV,SAAU,WACV,QAAS,UACT,MAAO,QACP,QAAS,UACT,UAAW,YACX,cAAe,gBACf,GAAI,oBACJ,SAAU,WACV,QAAS,UACT,KAAM,iBACN,GAAI,aACJ,MAAO,sBACP,MAAO,QACP,YAAa,cACb,UAAW,YACX,OAAQ,SACR,SAAU,WACV,GAAI,aACJ,OAAQ,kBACR,OAAQ,SACR,SAAU,WACV,iBAAkB,+BAClB,UAAW,YACX,SAAU,WACV,MAAO,QACP,MAAO,QACP,GAAI,aACJ,QAAS,UACT,MAAO,gBACP,OAAQ,SACR,OAAQ,kBAGJ,GAAgB,CACpB,OAAQ,SACR,OAAQ,SACR,QAAS,UACT,GAAI,MAGA,GAAS,CACb,aAAc,gBACd,QAAS,UACT,MAAO,QACP,IAAK,MACL,QAAS,UACT,MAAO,QACP,WAAY,aACZ,KAAM,OACN,MAAO,QACP,MAAO,QACP,SAAU,YACV,aAAc,gBACd,KAAM,QAGF,GAAa,CACjB,SAAU,WACV,MAAO,QACP,QAAS,UACT,OAAQ,SACR,MAAO,QACP,OAAQ,UAGV,OAAY,OAOH,eAAc,EAAQ,EAAI,CAC/B,GAAM,GAAQ,EAAG,MAAM,GACvB,MAAQ,IAAS,EAAM,OAAS,GAAK,EAAM,IAAO,SAS7C,gBAAe,EAAQ,EAAI,CAChC,GAAM,GAAQ,EAAG,MAAM,GACvB,MAAQ,IAAS,EAAM,OAAS,GAAK,EAAM,IAAO,SAU7C,qBAAoB,EAAQ,EAAI,EAAQ,CAC7C,GAAI,EAAO,KAAK,GACd,MAAO,SAKJ,uBAAsB,EAAS,CACpC,OAAQ,OACD,KAAM,MAAO,SACb,KAAM,MAAO,SACb,SAAU,MAAO,WACjB,SAAU,MAAO,SACjB,SAAU,MAAO,WACjB,SAAU,MAAO,YACjB,SAAU,MAAO,QACjB,SAAU,MAAO,QACjB,SAAU,MAAO,UACjB,UAAW,MAAO,aACd,cAwBN,qBAAoB,EAAS,CAClC,GAAM,GAAI,EAAQ,MAAM,KAAK,OAAO,EAAG,GAAG,IAAI,GAAK,SAAS,EAAG,KAAO,GAEtE,GADA,EAAE,KAAK,GACH,EAAE,KAAO,GACb,OAAQ,EAAE,QACH,GAAG,MAAO,cACV,GAAG,MAAO,mBACV,GAAG,MAAO,WACV,GAAG,MAAO,oBACV,GAAG,MAAO,gBACV,IAAI,MAAO,eACX,IAAI,MAAO,iBACX,IAAI,MAAO,aACX,IAAI,MAAO,kBACX,IAAI,MAAO,aACX,IAAI,MAAO,mBACP,cA4BN,uBAAsB,EAAS,CACpC,GAAM,GAAI,EAAQ,MAAM,KAAK,OAAO,EAAG,GAAG,IAAI,GAAK,SAAS,EAAG,KAAO,GAEtE,GADA,EAAE,KAAK,GACH,IAAE,KAAO,GAAK,EAAE,GAAK,GACzB,IAAI,EAAE,KAAO,GAAK,EAAE,GAAK,EAAG,MAAO,UACnC,GAAI,EAAE,KAAO,GAAK,EAAE,IAAM,EAAG,MAAO,QACpC,GAAI,EAAE,KAAO,GAAK,EAAE,GAAK,EAAG,MAAO,SACnC,GAAI,EAAE,KAAO,GAAK,EAAE,KAAO,EAAG,MAAO,QACrC,GAAI,EAAE,KAAO,GAAK,EAAE,GAAK,EAAG,MAAO,cACnC,GAAI,EAAE,KAAO,EAAG,MAAO,YACvB,GAAI,EAAE,KAAO,GAAK,EAAE,GAAK,EAAG,MAAO,qBACnC,GAAI,EAAE,KAAO,GAAK,EAAE,GAAK,EAAG,MAAO,aACnC,GAAI,EAAE,KAAO,GAAK,EAAE,IAAM,EAAG,MAAO,SACpC,GAAI,EAAE,KAAO,EAAG,MAAO,WACvB,GAAI,EAAE,KAAO,EAAG,MAAO,cACvB,GAAI,EAAE,KAAO,EAAG,MAAO,SACvB,GAAI,EAAE,KAAO,EAAG,MAAO,OACvB,GAAI,EAAE,KAAO,EAAG,MAAO,aAalB,qBAAoB,EAAS,CAClC,MAAO,GAAQ,MAAM,KAAK,aAoBrB,iBAAgB,EAAU,EAAU,EAAU,GAAO,CAE1D,GAAM,GAAoB,EAAM,oBAAoB,GAC9C,EAAoB,EAAM,oBAAoB,GAEhD,EAAY,KAAK,IAAI,EAAmB,GACxC,EAAgB,EAEd,EAAS,EAAM,IAAI,CAAC,EAAU,GAAW,AAAC,GAAY,CAC1D,GAAM,GAAQ,EAAY,EAAM,oBAAoB,GAG9C,EAAW,EAAU,GAAI,OAAM,EAAQ,GAAG,KAAK,MAGrD,MAAO,GAAM,IAAI,EAAS,MAAM,KAAM,GAAS,GAAI,OAAM,GAAK,EAAM,QAAQ,KAAK,KAAO,GAAO,YAUjG,IANI,GACF,GAAgB,EAAY,KAAK,IAAI,EAAmB,IAI1D,GAAa,EACN,GAAa,GAAe,CAEjC,GAAI,EAAO,GAAG,GAAa,EAAO,GAAG,GACnC,MAAO,GAGT,GAAI,EAAO,GAAG,KAAe,EAAO,GAAG,GAAY,CACjD,GAAI,IAAc,EAEhB,MAAO,GAGT,GAAa,UACJ,EAAO,GAAG,GAAa,EAAO,GAAG,GAC1C,MAAO,UAcN,KAAI,EAAK,EAAU,CACxB,GAAM,GAAS,GACX,EACJ,GAAI,MAAM,UAAU,IAClB,MAAO,OAAM,UAAU,IAAI,KAAK,EAAK,GAEvC,IAAK,EAAI,EAAG,EAAI,EAAI,OAAQ,GAAK,EAC/B,EAAO,KAAK,EAAS,EAAI,KAE3B,MAAO,SAUF,MAAK,EAAK,EAAW,CAC1B,GAAI,GACA,EACJ,GAAI,MAAM,UAAU,KAClB,MAAO,OAAM,UAAU,KAAK,KAAK,EAAK,GAExC,IAAK,EAAI,EAAG,EAAI,EAAI,OAAQ,EAAI,EAAG,GAAK,EAAG,CACzC,GAAM,GAAQ,EAAI,GAClB,GAAI,EAAU,EAAO,GACnB,MAAO,UAaN,QAAO,KAAQ,EAAW,CAC/B,GAAM,GAAS,EACX,EACA,EACJ,GAAI,OAAO,OACT,MAAO,QAAO,OAAO,EAAK,GAAG,GAE/B,IAAK,EAAI,EAAG,EAAI,EAAU,OAAQ,EAAI,EAAG,GAAK,EAAG,CAC/C,GAAM,GAAW,EAAU,GAC3B,AAAI,MAAO,IAAa,UAAY,IAAa,MAE/C,AADa,OAAO,KAAK,GACpB,QAAQ,AAAC,GAAQ,CACpB,EAAO,GAAO,EAAS,KAI7B,MAAO,SAYF,iBAAgB,EAAa,CAClC,MAAO,IAAoB,SAYtB,uBAAsB,EAAc,CACzC,MAAO,IAAY,IAAiB,KA6BlC,GAA0B,6BAE1B,GAAe,CAEnB,CACE,KAAM,CAAC,cACP,SAAS,EAAI,CACX,GAAM,GAAU,CACd,KAAM,aAEF,EAAU,EAAM,cAAc,2BAA4B,IAAO,EAAM,cAAc,GAAyB,GAEpH,MAAI,IACF,GAAQ,QAAU,GAGb,IAKX,CACE,KAAM,CAAC,UACP,SAAS,EAAI,CACX,GAAM,GAAU,CACd,KAAM,SAEF,EAAU,EAAM,cAAc,GAAyB,IAAO,EAAM,cAAc,kCAAmC,GAE3H,MAAI,IACF,GAAQ,QAAU,GAGb,IAKX,CACE,KAAM,CAAC,gBACP,SAAS,EAAI,CACX,GAAM,GAAU,CACd,KAAM,SAEF,EAAU,EAAM,cAAc,2BAA4B,IAAO,EAAM,cAAc,GAAyB,GAEpH,MAAI,IACF,GAAQ,QAAU,GAGb,IAGX,CACE,KAAM,CAAC,mBACP,SAAS,EAAI,CACX,GAAM,GAAU,CACd,KAAM,gCAEF,EAAU,EAAM,cAAc,GAAyB,IAAO,EAAM,cAAc,2CAA4C,GAEpI,MAAI,IACF,GAAQ,QAAU,GAGb,IAGX,CACE,KAAM,CAAC,UACP,SAAS,EAAI,CACX,GAAM,GAAU,CACd,KAAM,uBAEF,EAAU,EAAM,cAAc,GAAyB,IAAO,EAAM,cAAc,iCAAkC,GAE1H,MAAI,IACF,GAAQ,QAAU,GAGb,IAGX,CACE,KAAM,CAAC,cACP,SAAS,EAAI,CACX,GAAM,GAAU,CACd,KAAM,cAEF,EAAU,EAAM,cAAc,qCAAsC,IAAO,EAAM,cAAc,GAAyB,GAE9H,MAAI,IACF,GAAQ,QAAU,GAGb,IAGX,CACE,KAAM,CAAC,UACP,SAAS,EAAI,CACX,GAAM,GAAU,CACd,KAAM,SAEF,EAAU,EAAM,cAAc,iCAAkC,IAAO,EAAM,cAAc,GAAyB,GAE1H,MAAI,IACF,GAAQ,QAAU,GAGb,IAGX,CACE,KAAM,CAAC,UACP,SAAS,EAAI,CACX,GAAM,GAAU,CACd,KAAM,SAEF,EAAU,EAAM,cAAc,iCAAkC,IAAO,EAAM,cAAc,GAAyB,GAE1H,MAAI,IACF,GAAQ,QAAU,GAGb,IAGX,CACE,KAAM,CAAC,UACP,SAAS,EAAI,CACX,GAAM,GAAU,CACd,KAAM,eAEF,EAAU,EAAM,cAAc,GAAyB,IAAO,EAAM,cAAc,kCAAmC,GAE3H,MAAI,IACF,GAAQ,QAAU,GAGb,IAGX,CACE,KAAM,CAAC,yBACP,SAAS,EAAI,CACX,GAAM,GAAU,CACd,KAAM,eAEF,EAAU,EAAM,cAAc,gCAAiC,IAAO,EAAM,cAAc,GAAyB,GAEzH,MAAI,IACF,GAAQ,QAAU,GAGb,IAGX,CACE,KAAM,CAAC,cACP,SAAS,EAAI,CACX,GAAM,GAAU,CACd,KAAM,kBAEF,EAAU,EAAM,cAAc,sCAAuC,IAAO,EAAM,cAAc,GAAyB,GAE/H,MAAI,IACF,GAAQ,QAAU,GAGb,IAGX,CACE,KAAM,CAAC,cACP,SAAS,EAAI,CACX,GAAM,GAAU,CACd,KAAM,cAEF,EAAU,EAAM,cAAc,GAAyB,IAAO,EAAM,cAAc,sCAAuC,GAE/H,MAAI,IACF,GAAQ,QAAU,GAGb,IAGX,CACE,KAAM,CAAC,kBACP,SAAS,EAAI,CACX,GAAM,GAAU,CACd,KAAM,WAEF,EAAU,EAAM,cAAc,GAAyB,IAAO,EAAM,cAAc,0CAA2C,GAEnI,MAAI,IACF,GAAQ,QAAU,GAGb,IAGX,CACE,KAAM,CAAC,aACP,SAAS,EAAI,CACX,GAAM,GAAU,CACd,KAAM,YAEF,EAAU,EAAM,cAAc,GAAyB,IAAO,EAAM,cAAc,qCAAsC,GAE9H,MAAI,IACF,GAAQ,QAAU,GAGb,IAGX,CACE,KAAM,CAAC,WACP,SAAS,EAAI,CACX,GAAM,GAAU,CACd,KAAM,UAEF,EAAU,EAAM,cAAc,GAAyB,IAAO,EAAM,cAAc,mCAAoC,GAE5H,MAAI,IACF,GAAQ,QAAU,GAGb,IAGX,CACE,KAAM,CAAC,aACP,SAAS,EAAI,CACX,GAAM,GAAU,CACd,KAAM,YAEF,EAAU,EAAM,cAAc,GAAyB,IAAO,EAAM,cAAc,qCAAsC,GAE9H,MAAI,IACF,GAAQ,QAAU,GAGb,IAGX,CACE,KAAM,CAAC,aACP,SAAS,EAAI,CACX,GAAM,GAAU,CACd,KAAM,YAEF,EAAU,EAAM,cAAc,GAAyB,IAAO,EAAM,cAAc,qCAAsC,GAE9H,MAAI,IACF,GAAQ,QAAU,GAGb,IAGX,CACE,KAAM,CAAC,mBACP,SAAS,EAAI,CACX,GAAM,GAAU,CACd,KAAM,UAEF,EAAU,EAAM,cAAc,2CAA4C,IAAO,EAAM,cAAc,GAAyB,GAEpI,MAAI,IACF,GAAQ,QAAU,GAGb,IAGX,CACE,KAAM,CAAC,cACP,SAAS,EAAI,CACX,GAAM,GAAU,CACd,KAAO,iBAAkB,KAAK,GAAM,kBAAoB,cAEpD,EAAU,EAAM,cAAc,kDAAmD,IAAO,EAAM,cAAc,GAAyB,GAE3I,MAAI,IACF,GAAQ,QAAU,GAGb,IAGX,CACE,KAAM,CAAC,iBACP,SAAS,EAAI,CACX,GAAM,GAAU,CACd,KAAM,qBAEF,EAAU,EAAM,cAAc,iCAAkC,GAEtE,MAAI,IACF,GAAQ,QAAU,GAGb,IAGX,CACE,KAAM,CAAC,YACP,SAAS,EAAI,CACX,GAAM,GAAU,CACd,KAAM,kBAGF,EAAU,EAAM,cAAc,2BAA4B,GAEhE,MAAI,IACF,GAAQ,QAAU,GAGb,IAGX,CACE,KAAM,CAAC,kBACP,SAAS,EAAI,CACX,GAAM,GAAU,CACd,KAAM,kBAGF,EAAU,EAAM,eAAe,mCAAoC,GAEzE,MAAI,IACF,GAAQ,QAAU,GAGb,IAGX,CACE,KAAM,CAAC,YACP,SAAS,EAAI,CACX,GAAM,GAAU,CACd,KAAM,WAEF,EAAU,EAAM,cAAc,6BAA8B,GAElE,MAAI,IACF,GAAQ,QAAU,GAGb,IAGX,CACE,KAAM,CAAC,cACP,SAAS,EAAI,CACX,GAAM,GAAU,CACd,KAAM,aAEF,EAAU,EAAM,cAAc,+BAAgC,GAEpE,MAAI,IACF,GAAQ,QAAU,GAGb,IAGX,CACE,KAAM,CAAC,aACP,SAAS,EAAI,CACX,GAAM,GAAU,CACd,KAAM,YAGF,EAAU,EAAM,cAAc,qCAAsC,GAE1E,MAAI,IACF,GAAQ,QAAU,GAGb,IAGX,CACE,KAAM,CAAC,SACP,SAAS,EAAI,CACX,GAAM,GAAU,CACd,KAAM,eAEF,EAAU,EAAM,cAAc,0BAA2B,GAE/D,MAAI,IACF,GAAQ,QAAU,GAGb,IAGX,CACE,KAAM,CAAC,YACP,SAAS,EAAI,CACX,GAAM,GAAU,CACd,KAAM,aAEF,EAAU,EAAM,cAAc,+BAAgC,GAEpE,MAAI,IACF,GAAQ,QAAU,GAGb,IAGX,CACE,KAAM,CAAC,aACP,SAAS,EAAI,CACX,GAAM,GAAU,CACd,KAAM,YAEF,EAAU,EAAM,cAAc,8BAA+B,GAEnE,MAAI,IACF,GAAQ,QAAU,GAGb,IAGX,CACE,KAAM,CAAC,sBAAuB,gBAC9B,SAAS,EAAI,CACX,GAAM,GAAU,CACd,KAAM,cAEF,EAAU,EAAM,cAAc,GAAyB,IAAO,EAAM,cAAc,qCAAsC,GAE9H,MAAI,IACF,GAAQ,QAAU,GAGb,IAGX,CACE,KAAM,CAAC,mBACP,SAAS,EAAI,CACX,GAAM,GAAU,CACd,KAAM,iBAEF,EAAU,EAAM,cAAc,GAAyB,IAAO,EAAM,cAAc,0CAA2C,GAEnI,MAAI,IACF,GAAQ,QAAU,GAGb,IAGX,CACE,KAAM,CAAC,SACP,SAAS,EAAI,CACX,GAAM,GAAU,CACd,KAAM,QAEF,EAAU,EAAM,cAAc,4BAA6B,GAEjE,MAAI,IACF,GAAQ,QAAU,GAGb,IAGX,CACE,KAAM,CAAC,UACP,SAAS,EAAI,CACX,GAAM,GAAU,CACd,KAAM,SAEF,EAAU,EAAM,cAAc,0CAA2C,IAAO,EAAM,cAAc,GAAyB,GAEnI,MAAI,IACF,GAAQ,QAAU,GAGb,IAGX,CACE,KAAM,CAAC,aACP,SAAS,EAAI,CACX,GAAM,GAAU,CACd,KAAM,YAEF,EAAU,EAAM,cAAc,qCAAsC,IAAO,EAAM,cAAc,GAAyB,GAE9H,MAAI,IACF,GAAQ,QAAU,GAGb,IAGX,CACE,KAAM,CAAC,4BACP,SAAS,EAAI,CACX,GAAM,GAAU,CACd,KAAM,WAEF,EAAU,EAAM,cAAc,oDAAqD,GAEzF,MAAI,IACF,GAAQ,QAAU,GAGb,IAGX,CACE,KAAM,CAAC,aACP,SAAS,EAAI,CACX,GAAM,GAAU,CACd,KAAM,YAEF,EAAU,EAAM,cAAc,kCAAmC,GAEvE,MAAI,IACF,GAAQ,QAAU,GAGb,IAGX,CACE,KAAM,CAAC,gBACP,SAAS,EAAI,CACX,GAAM,GAAU,CACd,KAAM,QAEF,EAAU,EAAM,cAAc,wCAAyC,GAE7E,MAAI,IACF,GAAQ,QAAU,GAGb,IAGX,CACE,KAAM,CAAC,aACP,SAAS,EAAI,CACX,GAAM,GAAU,CACd,KAAM,YAEF,EAAU,EAAM,cAAc,qCAAsC,IAAO,EAAM,cAAc,GAAyB,GAE9H,MAAI,IACF,GAAQ,QAAU,GAGb,IAGX,CACE,KAAM,CAAC,sBACP,SAAS,EAAI,CACX,GAAM,GAAU,CACd,KAAM,UAEF,EAAU,EAAM,cAAc,2CAA4C,GAEhF,MAAI,IACF,GAAQ,QAAU,GAGb,IAGX,CACE,KAAM,CAAC,QACP,SAAS,EAAI,CACX,GAAM,GAAU,CACd,KAAM,iBAEF,EAAU,EAAM,cAAc,6BAA8B,GAElE,MAAI,IACF,GAAQ,QAAU,GAGb,IAKX,CACE,KAAK,EAAQ,CACX,GAAM,GAAiB,CAAC,EAAO,KAAK,iBAC9B,EAAa,EAAO,KAAK,YAC/B,MAAO,IAAkB,GAE3B,SAAS,EAAI,CACX,GAAM,GAAU,CACd,KAAM,mBAEF,EAAU,EAAM,cAAc,GAAyB,GAE7D,MAAI,IACF,GAAQ,QAAU,GAGb,IAKX,CACE,KAAM,CAAC,kBACP,SAAS,EAAI,CACX,GAAM,GAAU,CACd,KAAM,iBAEF,EAAU,EAAM,cAAc,GAAyB,GAE7D,MAAI,IACF,GAAQ,QAAU,GAGb,IAKX,CACE,KAAM,CAAC,uBACP,SAAS,EAAI,CACX,GAAM,GAAU,CACd,KAAM,UAEF,EAAU,EAAM,cAAc,GAAyB,GAE7D,MAAI,IACF,GAAQ,QAAU,GAGb,IAKX,CACE,KAAM,CAAC,OACP,SAAS,EAAI,CAKX,GAAM,GAA0B,eAC1B,EAAuB,yBAEvB,EAAS,AADO,EAAG,OAAO,SAAW,GACZ,EAAuB,EACtD,MAAO,CACL,KAAM,EAAM,cAAc,EAAQ,GAClC,QAAS,EAAM,eAAe,EAAQ,OAM1C,GAAgB,CAElB,CACE,KAAM,CAAC,aACP,SAAS,EAAI,CACX,GAAM,GAAU,EAAM,cAAc,wBAAyB,GAC7D,MAAO,CACL,KAAM,GAAO,KACb,aAMN,CACE,KAAM,CAAC,kBACP,SAAS,EAAI,CACX,GAAM,GAAU,EAAM,cAAc,yCAA0C,GAC9E,MAAO,CACL,KAAM,GAAO,aACb,aAMN,CACE,KAAM,CAAC,aACP,SAAS,EAAI,CACX,GAAM,GAAU,EAAM,cAAc,iCAAkC,GAChE,EAAc,EAAM,sBAAsB,GAEhD,MAAO,CACL,KAAM,GAAO,QACb,UACA,iBAMN,CACE,KAAM,CAAC,+BACP,SAAS,EAAI,CACX,GAAM,GAAS,CACb,KAAM,GAAO,KAET,EAAU,EAAM,eAAe,wBAAyB,GAC9D,MAAI,IACF,GAAO,QAAU,GAEZ,IAKX,CACE,KAAM,CAAC,cACP,SAAS,EAAI,CACX,GAAM,GAAU,EAAM,cAAc,6BAA8B,GAAI,QAAQ,SAAU,KAClF,EAAc,EAAM,oBAAoB,GAExC,EAAK,CACT,KAAM,GAAO,MACb,WAEF,MAAI,IACF,GAAG,YAAc,GAEZ,IAKX,CACE,KAAM,CAAC,uBACP,SAAS,EAAI,CACX,GAAM,GAAU,EAAM,cAAc,qCAAsC,GAAI,QAAQ,SAAU,KAEhG,MAAO,CACL,KAAM,GAAO,IACb,aAMN,CACE,KAAK,EAAQ,CACX,GAAM,GAAiB,CAAC,EAAO,KAAK,iBAC9B,EAAa,EAAO,KAAK,YAC/B,MAAO,IAAkB,GAE3B,SAAS,EAAI,CACX,GAAM,GAAU,EAAM,cAAc,8BAA+B,GAC7D,EAAc,EAAM,sBAAsB,GAC1C,EAAK,CACT,KAAM,GAAO,QACb,WAEF,MAAI,IACF,GAAG,YAAc,GAEZ,IAKX,CACE,KAAM,CAAC,mBACP,SAAS,EAAI,CACX,GAAM,GAAU,EAAM,cAAc,mCAAoC,GAClE,EAAK,CACT,KAAM,GAAO,OAGf,MAAI,IAAW,EAAQ,QACrB,GAAG,QAAU,GAER,IAKX,CACE,KAAM,CAAC,sBAAuB,gBAC9B,SAAS,EAAI,CACX,GAAM,GAAU,EAAM,cAAc,kCAAmC,IAClE,EAAM,cAAc,mCAAoC,IACxD,EAAM,cAAc,aAAc,GAEvC,MAAO,CACL,KAAM,GAAO,WACb,aAMN,CACE,KAAM,CAAC,SACP,SAAS,EAAI,CACX,GAAM,GAAU,EAAM,cAAc,uBAAwB,GAE5D,MAAO,CACL,KAAM,GAAO,KACb,aAMN,CACE,KAAM,CAAC,UACP,SAAS,EAAI,CACX,GAAM,GAAU,EAAM,cAAc,2BAA4B,GAEhE,MAAO,CACL,KAAM,GAAO,MACb,aAMN,CACE,KAAM,CAAC,UACP,UAAW,CACT,MAAO,CACL,KAAM,GAAO,SAMnB,CACE,KAAM,CAAC,QACP,UAAW,CACT,MAAO,CACL,KAAM,GAAO,YAMnB,CACE,KAAM,CAAC,iBACP,SAAS,EAAI,CACX,GAAM,GAAU,EAAM,cAAc,mCAAoC,GACxE,MAAO,CACL,KAAM,GAAO,aACb,cAWJ,GAAsB,CAExB,CACE,KAAM,CAAC,cACP,UAAW,CACT,MAAO,CACL,KAAM,MACN,OAAQ,YAMd,CACE,KAAM,CAAC,WACP,SAAS,EAAI,CACX,GAAM,GAAQ,EAAM,cAAc,aAAc,IAAO,OACjD,EAAW,CACf,KAAM,GAAc,OACpB,OAAQ,UAEV,MAAI,IACF,GAAS,MAAQ,GAEZ,IAKX,CACE,KAAM,CAAC,2BACP,UAAW,CACT,MAAO,CACL,KAAM,GAAc,OACpB,OAAQ,WAMd,CACE,KAAM,CAAC,SACP,UAAW,CACT,MAAO,CACL,KAAM,GAAc,OACpB,OAAQ,QACR,MAAO,UAMb,CACE,KAAM,CAAC,+BACP,UAAW,CACT,MAAO,CACL,KAAM,GAAc,OACpB,OAAQ,QACR,MAAO,UAMb,CACE,KAAM,CAAC,eACP,UAAW,CACT,MAAO,CACL,KAAM,GAAc,OACpB,OAAQ,SACR,MAAO,sBAMb,CACE,KAAM,CAAC,SACP,UAAW,CACT,MAAO,CACL,KAAM,GAAc,OACpB,OAAQ,YAMd,CACE,KAAM,CAAC,kBACP,UAAW,CACT,MAAO,CACL,KAAM,GAAc,UAM1B,CACE,KAAK,EAAQ,CACX,GAAM,GAAU,EAAO,KAAK,gBACtB,EAAc,EAAO,KAAK,uBAChC,MAAO,IAAW,CAAC,GAErB,SAAS,EAAI,CACX,GAAM,GAAQ,EAAM,cAAc,iBAAkB,GACpD,MAAO,CACL,KAAM,GAAc,OACpB,OAAQ,QACR,WAMN,CACE,KAAM,CAAC,mBAAoB,iBAC3B,UAAW,CACT,MAAO,CACL,KAAM,GAAc,OACpB,OAAQ,WAMd,CACE,KAAM,CAAC,aACP,UAAW,CACT,MAAO,CACL,KAAM,GAAc,UAM1B,CACE,KAAK,EAAQ,CACX,MAAO,GAAO,eAAe,MAAU,cAEzC,UAAW,CACT,MAAO,CACL,KAAM,GAAc,OACpB,OAAQ,gBAMd,CACE,KAAK,EAAQ,CACX,MAAO,GAAO,eAAe,MAAU,QAEzC,UAAW,CACT,MAAO,CACL,KAAM,GAAc,UAM1B,CACE,KAAK,EAAQ,CACX,MAAO,GAAO,mBAAqB,iBAErC,UAAW,CACT,MAAO,CACL,KAAM,GAAc,OACpB,OAAQ,eAMd,CACE,KAAK,EAAQ,CACX,GAAM,GAAiB,OAAO,OAAO,EAAO,gBAAgB,MAAM,KAAK,IACvE,MAAO,GAAO,UAAU,MAAU,WAAc,GAAkB,GAEpE,UAAW,CACT,MAAO,CACL,KAAM,GAAc,UAM1B,CACE,KAAK,EAAQ,CACX,MAAO,GAAO,UAAU,MAAU,WAEpC,UAAW,CACT,MAAO,CACL,KAAM,GAAc,UAM1B,CACE,KAAK,EAAQ,CACX,MAAO,GAAO,UAAU,MAAU,SAEpC,UAAW,CACT,MAAO,CACL,KAAM,GAAc,QACpB,OAAQ,WAMd,CACE,KAAK,EAAQ,CACX,MAAO,GAAO,UAAU,MAAU,WAEpC,UAAW,CACT,MAAO,CACL,KAAM,GAAc,WAM1B,CACE,KAAK,EAAQ,CACX,MAAO,GAAO,UAAU,MAAU,SAEpC,UAAW,CACT,MAAO,CACL,KAAM,GAAc,WAM1B,CACE,KAAK,EAAQ,CACX,MAAO,GAAO,UAAU,MAAU,iBAEpC,UAAW,CACT,MAAO,CACL,KAAM,GAAc,MAM1B,CACE,KAAK,EAAQ,CACX,MAAO,GAAO,UAAU,MAAU,QAEpC,UAAW,CACT,MAAO,CACL,KAAM,GAAc,OASxB,GAAqB,CAEvB,CACE,KAAK,EAAQ,CACX,MAAO,GAAO,eAAe,MAAU,kBAEzC,SAAS,EAAI,CAIX,GAHqB,WAAW,KAAK,GAInC,MAAO,CACL,KAAM,GAAW,OAKrB,GAAM,GAAU,EAAM,cAAc,0BAA2B,GAE/D,MAAO,CACL,KAAM,GAAW,SACjB,aAMN,CACE,KAAM,CAAC,YACP,SAAS,EAAI,CACX,GAAM,GAAS,CACb,KAAM,GAAW,SAGb,EAAU,EAAM,cAAc,6BAA8B,GAElE,MAAI,IACF,GAAO,QAAU,GAGZ,IAKX,CACE,KAAK,EAAQ,CACX,MAAO,GAAO,KAAK,YAErB,SAAS,EAAI,CACX,GAAM,GAAS,CACb,KAAM,GAAW,QAGb,EAAU,EAAM,cAAc,4BAA6B,GAEjE,MAAI,IACF,GAAO,QAAU,GAGZ,IAKX,CACE,KAAK,EAAQ,CACX,GAAM,GAAU,EAAO,KAAK,UACtB,EAAY,EAAO,KAAK,eAC9B,MAAO,IAAW,CAAC,GAErB,SAAS,EAAI,CACX,GAAM,GAAS,CACb,KAAM,GAAW,OAGb,EAAU,EAAM,cAAc,2BAA4B,GAEhE,MAAI,IACF,GAAO,QAAU,GAGZ,IAKX,CACE,KAAM,CAAC,4BACP,UAAW,CACT,MAAO,CACL,KAAM,GAAW,SAMvB,CACE,KAAM,CAAC,mBACP,SAAS,EAAI,CACX,GAAM,GAAS,CACb,KAAM,GAAW,QAGb,EAAU,EAAM,cAAc,4BAA6B,GAEjE,MAAI,IACF,GAAO,QAAU,GAGZ,KAQb,QAAa,CAaX,YAAY,EAAI,EAAc,GAAO,CACnC,GAAI,AAAmB,GAAO,MAAQ,IAAO,GAC3C,KAAM,IAAI,OAAM,sCAGlB,KAAK,IAAM,EAwBX,KAAK,aAAe,GAEhB,IAAgB,IAClB,KAAK,QAUT,OAAQ,CACN,MAAO,MAAK,IAQd,KAAK,EAAO,CACV,MAAO,GAAM,KAAK,KAAK,KAOzB,cAAe,CACb,KAAK,aAAa,QAAU,GAE5B,GAAM,GAAoB,EAAM,KAAK,GAAc,AAAC,GAAa,CAC/D,GAAI,MAAO,GAAS,MAAS,WAC3B,MAAO,GAAS,KAAK,MAGvB,GAAI,EAAS,eAAgB,OAC3B,MAAO,GAAS,KAAK,KAAK,GAAa,KAAK,KAAK,IAGnD,KAAM,IAAI,OAAM,0CAGlB,MAAI,IACF,MAAK,aAAa,QAAU,EAAkB,SAAS,KAAK,UAGvD,KAAK,aAAa,QAS3B,YAAa,CACX,MAAI,MAAK,aAAa,QACb,KAAK,aAAa,QAGpB,KAAK,eASd,eAAe,EAAa,CAC1B,MAAI,GACK,OAAO,KAAK,aAAa,MAAM,eAAiB,GAElD,KAAK,aAAa,MAAQ,GAUnC,mBAAoB,CAClB,MAAO,MAAK,aAAa,QAc3B,OAAQ,CACN,MAAI,MAAK,aAAa,GACb,KAAK,aAAa,GAGpB,KAAK,UAOd,SAAU,CACR,KAAK,aAAa,GAAK,GAEvB,GAAM,GAAK,EAAM,KAAK,GAAe,AAAC,GAAQ,CAC5C,GAAI,MAAO,GAAI,MAAS,WACtB,MAAO,GAAI,KAAK,MAGlB,GAAI,EAAI,eAAgB,OACtB,MAAO,GAAI,KAAK,KAAK,GAAa,KAAK,KAAK,IAG9C,KAAM,IAAI,OAAM,0CAGlB,MAAI,IACF,MAAK,aAAa,GAAK,EAAG,SAAS,KAAK,UAGnC,KAAK,aAAa,GAQ3B,UAAU,EAAa,CACrB,GAAM,CAAE,QAAS,KAAK,QAEtB,MAAI,GACK,OAAO,GAAM,eAAiB,GAGhC,GAAQ,GAOjB,cAAe,CACb,MAAO,MAAK,QAAQ,QAOtB,aAAc,CACZ,MAAI,MAAK,aAAa,SACb,KAAK,aAAa,SAGpB,KAAK,gBAQd,gBAAgB,EAAc,GAAO,CACnC,GAAM,CAAE,QAAS,KAAK,cAEtB,MAAI,GACK,OAAO,GAAM,eAAiB,GAGhC,GAAQ,GAOjB,eAAgB,CACd,KAAK,aAAa,SAAW,GAE7B,GAAM,GAAW,EAAM,KAAK,GAAqB,AAAC,GAAc,CAC9D,GAAI,MAAO,GAAU,MAAS,WAC5B,MAAO,GAAU,KAAK,MAGxB,GAAI,EAAU,eAAgB,OAC5B,MAAO,GAAU,KAAK,KAAK,GAAa,KAAK,KAAK,IAGpD,KAAM,IAAI,OAAM,0CAGlB,MAAI,IACF,MAAK,aAAa,SAAW,EAAS,SAAS,KAAK,UAG/C,KAAK,aAAa,SAO3B,WAAY,CACV,MAAI,MAAK,aAAa,OACb,KAAK,aAAa,OAGpB,KAAK,cASd,cAAc,EAAa,CACzB,MAAI,GACK,OAAO,KAAK,YAAY,MAAM,eAAiB,GAEjD,KAAK,YAAY,MAAQ,GAOlC,aAAc,CACZ,KAAK,aAAa,OAAS,GAE3B,GAAM,GAAS,EAAM,KAAK,GAAoB,AAAC,GAAY,CACzD,GAAI,MAAO,GAAQ,MAAS,WAC1B,MAAO,GAAQ,KAAK,MAGtB,GAAI,EAAQ,eAAgB,OAC1B,MAAO,GAAQ,KAAK,KAAK,GAAa,KAAK,KAAK,IAGlD,KAAM,IAAI,OAAM,0CAGlB,MAAI,IACF,MAAK,aAAa,OAAS,EAAO,SAAS,KAAK,UAG3C,KAAK,aAAa,OAO3B,OAAQ,CACN,YAAK,eACL,KAAK,UACL,KAAK,gBACL,KAAK,cAEE,KAOT,WAAY,CACV,MAAO,GAAM,OAAO,GAAI,KAAK,cAqB/B,UAAU,EAAW,CACnB,GAAM,GAAmB,GACrB,EAAwB,EACtB,EAAW,GACb,EAAkB,EAetB,GAXA,AAFuB,OAAO,KAAK,GAEpB,QAAQ,AAAC,GAAQ,CAC9B,GAAM,GAAoB,EAAU,GACpC,AAAI,MAAO,IAAsB,SAC/B,GAAS,GAAO,EAChB,GAAmB,GACV,MAAO,IAAsB,UACtC,GAAiB,GAAO,EACxB,GAAyB,KAIzB,EAAwB,EAAG,CAC7B,GAAM,GAAsB,OAAO,KAAK,GAClC,EAAuB,EAAM,KAAK,EAAqB,GAAS,KAAK,KAAK,IAEhF,GAAI,EAAsB,CACxB,GAAM,GAAW,KAAK,UAAU,EAAiB,IAEjD,GAAI,IAAa,OACf,MAAO,GAIX,GAAM,GAA6B,EAAM,KACvC,EACA,GAAS,KAAK,WAAW,IAE3B,GAAI,EAA4B,CAC9B,GAAM,GAAiB,KAAK,UAAU,EAAiB,IAEvD,GAAI,IAAmB,OACrB,MAAO,IAKb,GAAI,EAAkB,EAAG,CACvB,GAAM,GAAe,OAAO,KAAK,GAC3B,EAAqB,EAAM,KAAK,EAAc,GAAS,KAAK,UAAU,EAAM,KAElF,GAAI,IAAuB,OACzB,MAAO,MAAK,eAAe,EAAS,KAa1C,UAAU,EAAa,EAAiB,GAAO,CAC7C,GAAM,GAAqB,KAAK,iBAAiB,cAC7C,EAAmB,EAAY,cAC7B,EAAQ,EAAM,sBAAsB,GAE1C,MAAI,IAAkB,GACpB,GAAmB,EAAM,eAEpB,IAAqB,EAG9B,eAAe,EAAS,CACtB,GAAI,GAAkB,CAAC,GACnB,EAAoB,EACpB,EAAU,GAER,EAAwB,KAAK,oBAEnC,GAAI,MAAO,IAA0B,SAIrC,MAAI,GAAQ,KAAO,KAAO,EAAQ,KAAO,IACvC,GAAoB,EAAQ,OAAO,GACnC,AAAI,EAAQ,KAAO,IACjB,GAAU,GACV,EAAoB,EAAQ,OAAO,IAEnC,EAAkB,GAEpB,AAAI,EAAQ,KAAO,IACjB,EAAgB,KAAK,GAErB,EAAgB,KAAK,KAElB,AAAI,EAAQ,KAAO,IACxB,EAAoB,EAAQ,OAAO,GAC1B,EAAQ,KAAO,KACxB,GAAU,GACV,EAAoB,EAAQ,OAAO,IAG9B,EAAgB,QACrB,EAAM,gBAAgB,EAAuB,EAAmB,IAC9D,GAGN,KAAK,EAAQ,CACX,MAAO,MAAK,UAAU,MAAU,OAAO,GAAQ,cAGjD,WAAW,EAAc,CACvB,MAAO,MAAK,gBAAgB,MAAU,OAAO,GAAc,cAG7D,SAAS,EAAY,CACnB,MAAO,MAAK,cAAc,MAAU,OAAO,GAAY,cAUzD,GAAG,EAAU,EAAiB,GAAO,CACnC,MAAO,MAAK,UAAU,EAAU,IAAmB,KAAK,KAAK,IACxD,KAAK,WAAW,GAQvB,KAAK,EAAY,GAAI,CACnB,MAAO,GAAU,KAAK,GAAY,KAAK,GAAG,MAI9C,AAkBA,YAAa,OAcJ,WAAU,EAAI,EAAc,GAAO,CACxC,GAAI,MAAO,IAAO,SAChB,KAAM,IAAI,OAAM,gCAElB,MAAO,IAAI,IAAO,EAAI,SAYjB,OAAM,EAAI,CACf,MAAQ,IAAI,IAAO,GAAK,sBAGf,cAAc,CACvB,MAAO,cAGE,aAAa,CACtB,MAAO,cAGE,SAAS,CAClB,MAAO,cAGE,gBAAgB,CACzB,MAAO,MAIL,GAAmB,CAAC,CAAE,YAAW,mBAAoB,SAAY,CACnE,GAAM,GAAW,MAAO,SAAW,aAAe,QAAQ,WAAW,UAC/D,GAAO,MAAM,OAAO,UAAU,WAC9B,OACA,EAAW,CACb,CAAC,aAAc,GACf,CAAC,KAAM,OACP,CAAC,MAAM,GAAU,IAAI,MAAQ,UAAW,GAAU,IAAI,SACtD,CAAC,WACD,CAAC,aAAc,GAAG,GAAU,SAAS,MAAQ,aAAa,GAAU,SAAS,SAAW,cAE5F,MAAI,IACA,EAAS,KAAK,CAAC,OAAO,IAAa,IAEhC,GAGL,GAAkB,AAAC,GAAY,IAAM,QAAQ,OAAO,GAEpD,GAAsB,AAAC,GAAS,CAClC,GAAI,MAAO,IAAS,SAAU,CAC1B,GAAI,GAAM,EAAK,OACf,OAAS,GAAI,EAAM,EAAG,GAAK,EAAG,IAAK,CAC/B,GAAM,GAAO,EAAK,WAAW,GAC7B,AAAI,EAAO,KAAQ,GAAQ,KACvB,IACK,EAAO,MAAS,GAAQ,OAC7B,IAAO,GACP,GAAQ,OAAU,GAAQ,OAC1B,IAER,MAAO,OAEN,IAAI,MAAO,GAAK,YAAe,SAChC,MAAO,GAAK,WAEX,GAAI,MAAO,GAAK,MAAS,SAC1B,MAAO,GAAK,KAEhB,KAAM,IAAI,OAAM,sCAAsC,MAGpD,GAAwB,CAAC,YAAa,eAAgB,SAAU,WAAY,UAE5E,GAA4B,CAAC,CAAE,gBAAkB,KAAO,GAAQ,SAAY,CAC9E,GAAM,GAAO,MAAO,IAAiB,WAAa,KAAM,KAAiB,EACzE,OAAQ,GAAM,mBACL,OACD,MAAO,SAAQ,QAAQ,KAAoB,SAAW,gBACrD,aACA,gBACA,mBACA,eACA,SACD,MAAO,SAAQ,QAAQ,GAAM,yBAC5B,QACD,MAAO,SAAQ,QAAQ,kBAEvB,KAAM,IAAI,OAAM,gDAAgD,GAAsB,KAAK,cAAc,QAG/G,GAAkB,IAAM,CAI1B,GAAM,GAAW,AAHA,OAAO,SAAW,aAAe,QAAQ,WAAW,UAC/D,GAAO,MAAM,OAAO,UAAU,WAC9B,SACqB,UAAU,KACrC,MAAO,KAAa,UAAY,IAAa,UCnkOjD,GAAM,IAAqB,KAAO,IAAmB,CACjD,GAAM,GAAS,GAAgB,QAAU,GAIzC,GAHI,MAAO,GAAe,QAAW,UACjC,GAAe,OAAS,EAAO,QAAQ,KAAM,mBAAmB,MAAM,QAAQ,MAAO,mBAAmB,OAExG,GAAgB,IAChB,GAAI,EAAe,iBAAmB,GAClC,KAAM,IAAI,OAAM,6DAGnB,AAAI,EAAC,GAA0B,IAC/B,EAAO,QAAQ,OAAS,IAAM,CAAC,OAAO,EAAe,UAAU,WAAW,UAC3E,EAAO,gBAAkB,GACzB,EAAO,OAAS,IAChB,GAAe,eAAiB,IAEpC,MAAI,GAAe,gCACf,GAAe,+BAAiC,GAChD,EAAe,YAAc,IAE1B,GAEL,GAAiB,uCACjB,GAAqB,gBACrB,GAAe,OACf,GAA4B,AAAC,GAAe,GAAe,KAAK,IAAe,CAAC,GAAmB,KAAK,IAAe,CAAC,GAAa,KAAK,GAC1I,GAAkB,AAAC,GAAe,CACpC,GAAM,CAAC,EAAK,EAAW,EAAS,EAAQ,EAAS,GAAY,EAAW,MAAM,KACxE,EAAQ,IAAQ,OAAS,EAAW,MAAM,KAAK,QAAU,EACzD,EAAa,CAAC,EAAK,EAAW,EAAS,EAAS,GAAU,OAAO,SAAS,SAAW,EAC3F,GAAI,GAAS,CAAC,EACV,KAAM,IAAI,OAAM,gBAAgB,yBAEpC,MAAO,KAAQ,OAAS,CAAC,CAAC,GAAa,CAAC,CAAC,GAAW,CAAC,CAAC,GAAW,CAAC,CAAC,GAGjE,GAA4B,CAAC,EAAW,EAA2B,IAAW,CAChF,GAAM,GAAiB,SAAY,CAC/B,GAAM,GAAc,EAAO,IAAc,EAAO,GAChD,MAAI,OAAO,IAAgB,WAChB,IAEJ,GAEX,MAAI,KAAc,YAAc,IAA8B,WACnD,SAAY,CACf,GAAM,GAAW,KAAM,KACvB,GAAI,GAAY,MAAO,IAAa,SAAU,CAC1C,GAAI,OAAS,GACT,MAAO,GAAS,IAAI,KAExB,GAAI,YAAc,GAAU,CACxB,GAAM,CAAE,WAAU,WAAU,OAAM,QAAS,EAC3C,MAAO,GAAG,MAAa,IAAW,EAAO,IAAM,EAAO,KAAK,KAGnE,MAAO,IAGR,GAGL,GAA8B,MAAO,EAAc,EAAsB,EAAc,IAAY,CACrG,GAAM,GAAiB,KAAM,IAAc,EAAc,EAAsB,GAC/E,GAAI,MAAO,GAAa,kBAAqB,WACzC,KAAM,IAAI,OAAM,uCAGpB,MADiB,GAAa,iBAAiB,EAAgB,IAG7D,GAAgB,MAAO,EAAc,EAAsB,IAAiB,CAC9E,GAAM,GAAiB,GACjB,EAAe,GAAsB,sCAAwC,GACnF,OAAW,CAAC,EAAM,IAAgB,QAAO,QAAQ,GAC7C,OAAQ,EAAY,UACX,sBACD,EAAe,GAAQ,EAAY,MACnC,UACC,gBACD,EAAe,GAAQ,EAAa,EAAY,MAChD,UACC,0BACA,gBACD,EAAe,GAAQ,KAAM,IAA0B,EAAY,KAAM,EAAM,KAC/E,cAEA,KAAM,IAAI,OAAM,gDAAkD,KAAK,UAAU,IAG7F,MAAI,QAAO,KAAK,GAAc,SAAW,GACrC,OAAO,OAAO,EAAgB,GAE9B,OAAO,EAAa,WAAW,gBAAkB,MACjD,KAAM,IAAmB,GAEtB,GAGL,GAAqB,CAAC,CAAE,SAAQ,kBAC3B,CAAC,EAAM,IAAY,KAAO,IAAS,CACtC,GAAM,GAAW,KAAM,IAA4B,EAAK,MAAO,CAC3D,kCAAmC,CAC/B,MAAO,KAEZ,IAAK,GAAU,GAClB,EAAQ,WAAa,EACrB,EAAQ,YAAc,EAAS,YAAY,YAC3C,GAAM,GAAa,EAAQ,cAAc,GACzC,MAAI,IACA,GAAQ,eAAoB,EAAW,cACvC,EAAQ,gBAAqB,EAAW,aAErC,EAAK,IACL,KAKT,GAAyB,CAAC,EAAS,IAAiB,CAAC,EAAM,IAAY,KAAO,IAAS,CACzF,GAAM,CAAE,YAAa,KAAM,GAAK,GAChC,GAAI,CACA,GAAM,GAAS,KAAM,GAAa,EAAU,GAC5C,MAAO,CACH,WACA,OAAQ,SAGT,EAAP,CAII,GAHA,OAAO,eAAe,EAAO,YAAa,CACtC,MAAO,IAEP,CAAE,cAAe,IAAQ,CACzB,GAAM,GAAO,6GACb,EAAM,SAAW;AAAA,IAAS,EAE9B,KAAM,KAIR,GAAuB,CAAC,EAAS,IAAe,CAAC,EAAM,IAAY,KAAO,IAAS,CACrF,GAAM,GAAW,EAAQ,YAAY,KAAO,EAAQ,UAC9C,SAAY,EAAQ,UAAU,EAAQ,WAAW,KACjD,EAAQ,SACd,GAAI,CAAC,EACD,KAAM,IAAI,OAAM,yCAEpB,GAAM,GAAU,KAAM,GAAW,EAAK,MAAO,IAAK,EAAS,aAC3D,MAAO,GAAK,IACL,EACH,aAIF,GAA+B,CACjC,KAAM,yBACN,KAAM,cACN,KAAM,CAAC,gBACP,SAAU,IAER,GAA6B,CAC/B,KAAM,uBACN,KAAM,YACN,KAAM,CAAC,cACP,SAAU,IAEd,YAAwB,EAAQ,EAAY,EAAc,CACtD,MAAO,CACH,aAAc,AAAC,GAAiB,CAC5B,EAAa,IAAI,GAAuB,EAAQ,GAAe,IAC/D,EAAa,IAAI,GAAqB,EAAQ,GAAa,MAKvE,GAAM,IAA4B,CAC9B,KAAM,YACN,KAAM,CAAC,sBAAuB,cAAe,YAC7C,KAAM,uBACN,SAAU,GACV,SAAU,SACV,aAAc,GAA2B,MAEvC,GAAoB,CAAC,EAAQ,IAAkB,EACjD,aAAc,AAAC,GAAgB,CAC3B,EAAY,cAAc,GAAmB,CACzC,SACA,iBACA,OAIZ,YAA2B,EAAS,EAAW,QAAS,CACpD,MAAI,KAAa,SACN,GAAS,GAEb,GAAO,GAElB,YAA6B,EAAK,EAAU,CACxC,MAAI,KAAa,SACN,GAAsB,OAAO,GAAW,IAE5C,GAAsB,OAAO,GAAS,IAGjD,oBAAoC,WAAW,OACpC,YAAW,EAAQ,EAAW,QAAS,CAC1C,OAAQ,MAAO,QACN,SACD,MAAO,IAAoB,EAAQ,WAEnC,KAAM,IAAI,OAAM,+BAA+B,MAAO,uCAG3D,QAAO,EAAQ,CAClB,cAAO,eAAe,EAAQ,GAAsB,WAC7C,EAEX,kBAAkB,EAAW,QAAS,CAClC,MAAO,IAAkB,KAAM,KAIjC,GAAc,MAAO,EAAa,GAAI,YAAc,IAAY,CAClE,GAAI,YAAsB,YACtB,MAAO,IAAsB,OAAO,GAExC,GAAI,CAAC,EACD,MAAO,IAAsB,OAAO,GAAI,aAE5C,GAAM,GAAc,EAAQ,gBAAgB,GAC5C,MAAO,IAAsB,OAAO,KAAM,KAG9C,QAAc,CACV,aAAc,CACV,KAAK,gBAAkB,OAIzB,GAAe,AAAC,GAAU,CAC5B,OAAQ,OACC,OACD,MAAO,OACN,QACD,MAAO,WAEP,KAAM,IAAI,OAAM,kCAAkC,QAGxD,GAAe,AAAC,GAAU,CAC5B,GAAI,GAAU,KAGd,IAAI,MAAO,IAAU,SAAU,CAC3B,GAAM,GAAS,WAAW,GAC1B,GAAI,CAAC,OAAO,MAAM,GACd,MAAI,QAAO,KAAY,OAAO,IAC1B,GAAO,KAAK,GAAkB,wCAAwC,MAEnE,EAGf,GAAI,MAAO,IAAU,SACjB,MAAO,GAEX,KAAM,IAAI,WAAU,wBAAwB,MAAO,OAAU,OAE3D,GAAY,KAAK,KAAK,GAAK,IAAO,GAAI,GAAK,MAC3C,GAAgB,AAAC,GAAU,CAC7B,GAAM,GAAW,GAAa,GAC9B,GAAI,IAAa,QAAa,CAAC,OAAO,MAAM,IAAa,IAAa,UAAY,IAAa,WACvF,KAAK,IAAI,GAAY,GACrB,KAAM,IAAI,WAAU,8BAA8B,KAG1D,MAAO,IAEL,GAAa,AAAC,GAAU,CAC1B,GAAI,GAAU,KAGd,IAAI,OAAO,UAAU,IAAU,CAAC,OAAO,MAAM,GACzC,MAAO,GAEX,KAAM,IAAI,WAAU,yBAAyB,MAAO,OAAU,OAE5D,GAAc,AAAC,GAAU,GAAe,EAAO,IAC/C,GAAc,AAAC,GAAU,GAAe,EAAO,IAC/C,GAAa,AAAC,GAAU,GAAe,EAAO,GAC9C,GAAiB,CAAC,EAAO,IAAS,CACpC,GAAM,GAAW,GAAW,GAC5B,GAAI,IAAa,QAAa,GAAQ,EAAU,KAAU,EACtD,KAAM,IAAI,WAAU,YAAY,sBAAyB,KAE7D,MAAO,IAEL,GAAU,CAAC,EAAO,IAAS,CAC7B,OAAQ,OACC,IACD,MAAO,YAAW,GAAG,GAAO,OAC3B,IACD,MAAO,YAAW,GAAG,GAAO,OAC3B,GACD,MAAO,WAAU,GAAG,GAAO,KAGjC,GAAgB,CAAC,EAAO,IAAa,CACvC,GAAI,GAAU,KACV,KAAI,GACM,GAAI,WAAU,iCAAiC,KAEnD,GAAI,WAAU,6BAExB,MAAO,IAEL,GAAe,AAAC,GAAU,CAC5B,GAAI,GAAU,KACV,OAEJ,GAAI,MAAO,IAAU,UAAY,CAAC,MAAM,QAAQ,GAC5C,MAAO,GAEX,GAAM,GAAe,MAAM,QAAQ,GAAS,QAAU,MAAO,GAC7D,KAAM,IAAI,WAAU,wBAAwB,MAAiB,MAE3D,GAAe,AAAC,GAAU,CAC5B,GAAI,GAAU,KAGd,IAAI,MAAO,IAAU,SACjB,MAAO,GAEX,GAAI,CAAC,UAAW,SAAU,UAAU,SAAS,MAAO,IAChD,UAAO,KAAK,GAAkB,wBAAwB,MAAO,OAAU,MAChE,OAAO,GAElB,KAAM,IAAI,WAAU,wBAAwB,MAAO,OAAU,OAE3D,GAAoB,AAAC,GACnB,MAAO,IAAS,SACT,GAAa,GAAY,IAE7B,GAAa,GAElB,GAAqB,AAAC,GACpB,MAAO,IAAS,SACT,GAAc,GAAY,IAE9B,GAAc,GAEnB,GAAe,oEACf,GAAc,AAAC,GAAU,CAC3B,GAAM,GAAU,EAAM,MAAM,IAC5B,GAAI,IAAY,MAAQ,EAAQ,GAAG,SAAW,EAAM,OAChD,KAAM,IAAI,WAAU,0CAExB,MAAO,YAAW,IAEhB,GAAkB,AAAC,GACjB,MAAO,IAAU,SACV,GAAW,GAAY,IAE3B,GAAW,GAEhB,GAAmB,AAAC,GAClB,MAAO,IAAU,SACV,GAAY,GAAY,IAE5B,GAAY,GAEjB,GAAmB,AAAC,GAClB,MAAO,IAAU,SACV,GAAY,GAAY,IAE5B,GAAY,GAEjB,GAAkB,AAAC,GACjB,MAAO,IAAU,SACV,GAAW,GAAY,IAE3B,GAAW,GAEhB,GAAoB,AAAC,GAChB,OAAO,GAAI,WAAU,GAAS,OAAS,GACzC,MAAM;AAAA,GACN,MAAM,EAAG,GACT,OAAO,AAAC,GAAM,CAAC,EAAE,SAAS,sBAC1B,KAAK;AAAA,GAER,GAAS,CACX,KAAM,QAAQ,MAGZ,GAAO,CAAC,MAAO,MAAO,MAAO,MAAO,MAAO,MAAO,OAClD,GAAS,CAAC,MAAO,MAAO,MAAO,MAAO,MAAO,MAAO,MAAO,MAAO,MAAO,MAAO,MAAO,OAC7F,YAAyB,EAAM,CAC3B,GAAM,GAAO,EAAK,iBACZ,EAAQ,EAAK,cACb,EAAY,EAAK,YACjB,EAAgB,EAAK,aACrB,EAAW,EAAK,cAChB,EAAa,EAAK,gBAClB,EAAa,EAAK,gBAClB,EAAmB,EAAgB,GAAK,IAAI,IAAkB,GAAG,IACjE,EAAc,EAAW,GAAK,IAAI,IAAa,GAAG,IAClD,EAAgB,EAAa,GAAK,IAAI,IAAe,GAAG,IACxD,EAAgB,EAAa,GAAK,IAAI,IAAe,GAAG,IAC9D,MAAO,GAAG,GAAK,OAAe,KAAoB,GAAO,MAAU,KAAQ,KAAe,KAAiB,QAE/G,GAAM,IAAsB,GAAI,QAAO,6FACjC,GAAiC,AAAC,GAAU,CAC9C,GAAI,GAAU,KACV,OAEJ,GAAI,MAAO,IAAU,SACjB,KAAM,IAAI,WAAU,oDAExB,GAAM,GAAQ,GAAoB,KAAK,GACvC,GAAI,CAAC,EACD,KAAM,IAAI,WAAU,oCAExB,GAAM,CAAC,EAAG,EAAS,EAAU,EAAQ,EAAO,EAAS,EAAS,EAAwB,GAAa,EAC7F,EAAO,GAAiB,GAAmB,IAC3C,EAAQ,GAAe,EAAU,QAAS,EAAG,IAC7C,EAAM,GAAe,EAAQ,MAAO,EAAG,IACvC,EAAO,GAAU,EAAM,EAAO,EAAK,CAAE,QAAO,UAAS,UAAS,2BACpE,MAAI,GAAU,eAAiB,KAC3B,EAAK,QAAQ,EAAK,UAAY,GAA0B,IAErD,GAEL,GAAsB,AAAC,GAAU,CACnC,GAAI,GAAU,KACV,OAEJ,GAAI,GACJ,GAAI,MAAO,IAAU,SACjB,EAAgB,UAEX,MAAO,IAAU,SACtB,EAAgB,GAAkB,OAGlC,MAAM,IAAI,WAAU,+FAExB,GAAI,OAAO,MAAM,IAAkB,IAAkB,UAAY,IAAkB,UAC/E,KAAM,IAAI,WAAU,kEAExB,MAAO,IAAI,MAAK,KAAK,MAAM,EAAgB,OAEzC,GAAY,CAAC,EAAM,EAAO,EAAK,IAAS,CAC1C,GAAM,GAAgB,EAAQ,EAC9B,UAAmB,EAAM,EAAe,GACjC,GAAI,MAAK,KAAK,IAAI,EAAM,EAAe,EAAK,GAAe,EAAK,MAAO,OAAQ,EAAG,IAAK,GAAe,EAAK,QAAS,SAAU,EAAG,IAAK,GAAe,EAAK,QAAS,UAAW,EAAG,IAAK,GAAkB,EAAK,2BAElN,GAAgB,CAAC,GAAI,GAAI,GAAI,GAAI,GAAI,GAAI,GAAI,GAAI,GAAI,GAAI,GAAI,IAC7D,GAAqB,CAAC,EAAM,EAAO,IAAQ,CAC7C,GAAI,GAAU,GAAc,GAI5B,GAHI,IAAU,GAAK,GAAW,IAC1B,GAAU,IAEV,EAAM,EACN,KAAM,IAAI,WAAU,mBAAmB,GAAO,SAAa,MAAS,MAGtE,GAAa,AAAC,GACT,EAAO,GAAM,GAAM,GAAO,KAAQ,GAAK,EAAO,KAAQ,GAE3D,GAAiB,CAAC,EAAO,EAAM,EAAO,IAAU,CAClD,GAAM,GAAU,GAAgB,GAAmB,IACnD,GAAI,EAAU,GAAS,EAAU,EAC7B,KAAM,IAAI,WAAU,GAAG,qBAAwB,SAAa,gBAEhE,MAAO,IAEL,GAAoB,AAAC,GACnB,GAAU,KACH,EAEJ,GAAmB,KAAO,GAAS,IAExC,GAA4B,AAAC,GAAU,CACzC,GAAM,GAAe,EAAM,GACvB,EAAY,EAChB,GAAI,GAAgB,IAChB,EAAY,UAEP,GAAgB,IACrB,EAAY,OAGZ,MAAM,IAAI,WAAU,qBAAqB,yBAE7C,GAAM,GAAO,OAAO,EAAM,UAAU,EAAG,IACjC,EAAS,OAAO,EAAM,UAAU,EAAG,IACzC,MAAO,GAAa,GAAO,GAAK,GAAU,GAAK,KAE7C,GAAqB,AAAC,GAAU,CAClC,GAAI,GAAM,EACV,KAAO,EAAM,EAAM,OAAS,GAAK,EAAM,OAAO,KAAS,KACnD,IAEJ,MAAI,KAAQ,EACD,EAEJ,EAAM,MAAM,IAGvB,gBAA+B,MAAM,CACjC,YAAY,EAAS,CACjB,MAAM,EAAQ,SACd,OAAO,eAAe,KAAM,GAAiB,WAC7C,KAAK,KAAO,EAAQ,KACpB,KAAK,OAAS,EAAQ,OACtB,KAAK,UAAY,EAAQ,YAG3B,GAA2B,CAAC,EAAW,EAAY,KAAO,CAC5D,OAAO,QAAQ,GACV,OAAO,CAAC,CAAC,CAAE,KAAO,IAAM,QACxB,QAAQ,CAAC,CAAC,EAAG,KAAO,CACrB,AAAI,GAAU,IAAM,MAAa,EAAU,KAAO,KAC9C,GAAU,GAAK,KAGvB,GAAM,GAAU,EAAU,SAAW,EAAU,SAAW,eAC1D,SAAU,QAAU,EACpB,MAAO,GAAU,QACV,GAGL,GAAoB,CAAC,CAAE,SAAQ,aAAY,gBAAe,eAAgB,CAC5E,GAAM,GAAY,GAAoB,GAChC,EAAa,EAAU,eAAiB,EAAU,eAAiB,GAAK,OACxE,EAAW,GAAI,GAAc,CAC/B,KAAM,GAAY,MAAQ,GAAY,MAAQ,GAAa,GAAc,eACzE,OAAQ,SACR,cAEJ,KAAM,IAAyB,EAAU,IAEvC,GAAoB,AAAC,GAChB,CAAC,CAAE,SAAQ,aAAY,eAAgB,CAC1C,GAAkB,CAAE,SAAQ,aAAY,cAAe,EAAe,eAGxE,GAAsB,AAAC,GAAY,EACrC,eAAgB,EAAO,WACvB,UAAW,EAAO,QAAQ,qBAAuB,EAAO,QAAQ,sBAAwB,EAAO,QAAQ,oBACvG,kBAAmB,EAAO,QAAQ,cAClC,KAAM,EAAO,QAAQ,iBAGzB,YAAa,EAAM,EAAM,EAAM,CAC3B,GAAI,GACA,EACA,EACJ,GAAI,MAAO,IAAS,aAAe,MAAO,IAAS,YAC/C,EAAS,GACT,EAAe,MAEd,CAED,GADA,EAAS,EACL,MAAO,IAAS,WAChB,SAAS,EACT,EAAe,EACR,GAAc,EAAQ,EAAQ,GAGrC,EAAe,EAGvB,OAAW,KAAO,QAAO,KAAK,GAAe,CACzC,GAAI,CAAC,MAAM,QAAQ,EAAa,IAAO,CACnC,EAAO,GAAO,EAAa,GAC3B,SAEJ,GAAiB,EAAQ,KAAM,EAAc,GAEjD,MAAO,GAEX,GAAM,IAAO,CAAC,EAAQ,IAAiB,CACnC,GAAM,GAAM,GACZ,OAAW,KAAO,GACd,GAAiB,EAAK,EAAQ,EAAc,GAEhD,MAAO,IAEL,GAAgB,CAAC,EAAQ,EAAQ,IAC5B,GAAI,EAAQ,OAAO,QAAQ,GAAc,OAAO,CAAC,EAAe,CAAC,EAAK,KACzE,CAAI,MAAM,QAAQ,GACd,EAAc,GAAO,EAGrB,AAAI,MAAO,IAAU,WACjB,EAAc,GAAO,CAAC,EAAQ,KAG9B,EAAc,GAAO,CAAC,EAAQ,GAG/B,GACR,KAED,GAAmB,CAAC,EAAQ,EAAQ,EAAc,IAAc,CAClE,GAAI,IAAW,KAAM,CACjB,GAAI,GAAc,EAAa,GAC/B,AAAI,MAAO,IAAgB,YACvB,GAAc,CAAC,CAAE,IAErB,GAAM,CAAC,EAAS,GAAY,EAAU,GAAM,EAAY,GAAa,EACrE,AAAK,OAAO,IAAW,YAAc,EAAO,EAAO,KAAiB,MAAO,IAAW,YAAc,CAAC,CAAC,IAClG,GAAO,GAAa,EAAQ,EAAO,KAEvC,OAEJ,GAAI,CAAC,EAAQ,GAAS,EAAa,GACnC,GAAI,MAAO,IAAU,WAAY,CAC7B,GAAI,GACE,EAAsB,IAAW,QAAc,GAAS,MAAY,KACpE,EAAsB,MAAO,IAAW,YAAc,CAAC,CAAC,EAAO,SAAa,MAAO,IAAW,YAAc,CAAC,CAAC,EACpH,AAAI,EACA,EAAO,GAAa,EAEf,GACL,GAAO,GAAa,SAGvB,CACD,GAAM,GAAsB,IAAW,QAAa,GAAS,KACvD,EAAsB,MAAO,IAAW,YAAc,CAAC,CAAC,EAAO,IAAY,MAAO,IAAW,YAAc,CAAC,CAAC,EACnH,AAAI,IAAuB,IACvB,GAAO,GAAa,KAI1B,GAAa,AAAC,GAAM,GAAK,KACzB,GAAO,AAAC,GAAM,ECznBpB,GAAM,IAAwB,EACxB,GAAiB,GAAwB,EACzC,GAAkB,EAClB,GAAyB,GAAiB,GAAkB,EAClE,YAAsB,CAAE,aAAY,aAAY,UAAU,CACtD,GAAI,EAAa,GACb,KAAM,IAAI,OAAM,2EAEpB,GAAM,GAAO,GAAI,UAAS,EAAQ,EAAY,GACxC,EAAgB,EAAK,UAAU,EAAG,IACxC,GAAI,IAAe,EACf,KAAM,IAAI,OAAM,kEAEpB,GAAM,GAAe,EAAK,UAAU,GAAuB,IACrD,EAA0B,EAAK,UAAU,GAAgB,IACzD,EAA0B,EAAK,UAAU,EAAa,GAAiB,IACvE,EAAc,GAAI,IAAQ,QAAQ,OAAO,GAAI,YAAW,EAAQ,EAAY,KAClF,GAAI,IAA4B,EAAY,SACxC,KAAM,IAAI,OAAM,kDAAkD,oDAA0E,EAAY,aAG5J,GADA,EAAY,OAAO,GAAI,YAAW,EAAQ,EAAa,GAAgB,EAAc,IAAiB,MAClG,IAA4B,EAAY,SACxC,KAAM,IAAI,OAAM,yBAAyB,EAAY,iDAAiD,KAE1G,MAAO,CACH,QAAS,GAAI,UAAS,EAAQ,EAAa,GAAiB,GAAiB,GAC7E,KAAM,GAAI,YAAW,EAAQ,EAAa,GAAiB,GAAkB,EAAc,EAAgB,EAAgB,IAAiB,GAAkB,MAItK,YAAuB,CACnB,YAAY,EAAQ,EAAU,CAC1B,KAAK,iBAAmB,GAAI,IAAiB,EAAQ,GACrD,KAAK,cAAgB,GACrB,KAAK,cAAgB,GAEzB,KAAK,EAAS,CACV,KAAK,cAAc,KAAK,KAAK,OAAO,IAExC,aAAc,CACV,KAAK,cAAgB,GAEzB,YAAa,CACT,GAAM,GAAU,KAAK,cAAc,MAC7B,EAAgB,KAAK,cAC3B,MAAO,CACH,YAAa,CACT,MAAO,IAEX,eAAgB,CACZ,MAAO,KAInB,sBAAuB,CACnB,GAAM,GAAW,KAAK,cACtB,KAAK,cAAgB,GACrB,GAAM,GAAgB,KAAK,cAC3B,MAAO,CACH,aAAc,CACV,MAAO,IAEX,eAAgB,CACZ,MAAO,KAInB,OAAO,CAAE,QAAS,EAAY,QAAQ,CAClC,GAAM,GAAU,KAAK,iBAAiB,OAAO,GACvC,EAAS,EAAQ,WAAa,EAAK,WAAa,GAChD,EAAM,GAAI,YAAW,GACrB,EAAO,GAAI,UAAS,EAAI,OAAQ,EAAI,WAAY,EAAI,YACpD,EAAW,GAAI,IAAQ,MAC7B,SAAK,UAAU,EAAG,EAAQ,IAC1B,EAAK,UAAU,EAAG,EAAQ,WAAY,IACtC,EAAK,UAAU,EAAG,EAAS,OAAO,EAAI,SAAS,EAAG,IAAI,SAAU,IAChE,EAAI,IAAI,EAAS,IACjB,EAAI,IAAI,EAAM,EAAQ,WAAa,IACnC,EAAK,UAAU,EAAS,EAAG,EAAS,OAAO,EAAI,SAAS,EAAG,EAAS,IAAI,SAAU,IAC3E,EAEX,OAAO,EAAS,CACZ,GAAM,CAAE,UAAS,QAAS,GAAa,GACvC,MAAO,CAAE,QAAS,KAAK,iBAAiB,MAAM,GAAU,QAE5D,cAAc,EAAY,CACtB,MAAO,MAAK,iBAAiB,OAAO,KAI5C,QAA2B,CACvB,YAAY,EAAS,CACjB,KAAK,QAAU,GAElB,OAAO,gBAAiB,CACrB,MAAO,MAAK,sBAET,eAAgB,CACnB,aAAiB,KAAS,MAAK,QAAQ,YAEnC,KADgB,MAAK,QAAQ,QAAQ,OAAO,KAMxD,QAA2B,CACvB,YAAY,EAAS,CACjB,KAAK,QAAU,GAElB,OAAO,gBAAiB,CACrB,MAAO,MAAK,sBAET,eAAgB,CACnB,aAAiB,KAAO,MAAK,QAAQ,cAEjC,KADgB,MAAK,QAAQ,QAAQ,OAAO,GAGhD,AAAI,KAAK,QAAQ,iBACb,MAAM,IAAI,YAAW,MAKjC,QAAiC,CAC7B,YAAY,EAAS,CACjB,KAAK,QAAU,GAElB,OAAO,gBAAiB,CACrB,MAAO,MAAK,sBAET,eAAgB,CACnB,aAAiB,KAAW,MAAK,QAAQ,cAAe,CACpD,GAAM,GAAe,KAAM,MAAK,QAAQ,aAAa,GACrD,AAAI,IAAiB,QAErB,MAAM,OAKlB,QAAiC,CAC7B,YAAY,EAAS,CACjB,KAAK,QAAU,GAElB,OAAO,gBAAiB,CACrB,MAAO,MAAK,sBAET,eAAgB,CACnB,aAAiB,KAAS,MAAK,QAAQ,YAEnC,KADmB,MAAK,QAAQ,WAAW,KAMjD,GAAuB,AAAC,GAAsB,GAAI,MAAK,KAAK,MAAQ,GAEpE,GAAgB,CAAC,EAAW,IAAsB,KAAK,IAAI,GAAqB,GAAmB,UAAY,IAAc,IAE7H,GAA8B,CAAC,EAAW,IAA6B,CACzE,GAAM,GAAgB,KAAK,MAAM,GACjC,MAAI,IAAc,EAAe,GACtB,EAAgB,KAAK,MAEzB,GAGL,GAAoB,AAAC,GAAY,CAAC,EAAM,IAAY,eAAgB,EAAM,CAC5E,GAAI,CAAC,GAAY,WAAW,EAAK,SAC7B,MAAO,GAAK,GAChB,GAAM,GAAa,EAAQ,YAAY,YAAY,cAAc,GAC3D,EAAsB,GAAY,OAAS,SAAW,GAAY,kBAAkB,KAAK,KAAO,OAChG,EAAS,KAAM,GAAQ,OAAO,GAC9B,EAAS,KAAM,GAAK,IACnB,EACH,QAAS,KAAM,GAAO,KAAK,EAAK,QAAS,CACrC,YAAa,GAAqB,EAAQ,mBAC1C,cAAe,GAAuB,EAAQ,eAC9C,eAAgB,EAAQ,oBAE7B,MAAM,AAAC,GAAU,CAChB,GAAM,GAAa,EAAM,YAAc,GAAc,EAAM,WAC3D,KAAI,IACA,GAAQ,kBAAoB,GAA4B,EAAY,EAAQ,oBAE1E,IAEJ,EAAa,GAAc,EAAO,UACxC,MAAI,IACA,GAAQ,kBAAoB,GAA4B,EAAY,EAAQ,oBAEzE,GAEL,GAAgB,AAAC,GAAa,GAAa,WAAW,GAAY,EAAS,SAAS,MAAQ,EAAS,SAAS,KAAO,OACrH,GAA2B,CAC7B,KAAM,oBACN,KAAM,CAAC,YAAa,WACpB,SAAU,QACV,aAAc,kBACd,SAAU,IAER,GAAmB,AAAC,GAAa,EACnC,aAAc,AAAC,GAAgB,CAC3B,EAAY,cAAc,GAAkB,GAAU,OAIxD,GAA8B,CAAC,EAAgB,IAAY,CAC7D,GAAM,CAAE,gBAAe,oBAAmB,sBAAqB,uBAAsB,gBAAiB,EAChG,EAAmB,IAAkB,QACvC,IAAsB,QACtB,IAAwB,QACxB,IAAyB,QACzB,IAAiB,OACf,EAAS,EAAmB,EAAa,EAAqB,GAAkB,OAChF,EAAS,EAAe,YAC9B,MAAO,IAAI,gBAAe,MAChB,MAAK,EAAY,CACnB,GAAM,CAAE,QAAO,QAAS,KAAM,GAAO,OACrC,GAAI,EAAM,CAEN,GADA,EAAW,QAAQ;AAAA,GACf,EAAkB,CAClB,GAAM,GAAW,EAAc,KAAM,IACrC,EAAW,QAAQ,GAAG,KAAwB;AAAA,GAC9C,EAAW,QAAQ;AAAA,GAEvB,EAAW,YAGX,GAAW,QAAQ,GAAI,GAAkB,IAAU,GAAG,SAAS;AAAA,EAAU;AAAA,OAMnF,GAAsC,2CACtC,GAAiB,AAAC,GAAW,CAC/B,GAAI,CAAC,GAAe,IAAW,CAAC,GAAyB,GAAS,CAC9D,GAAM,GAAO,GAAQ,WAAW,aAAa,MAAQ,EACrD,KAAM,IAAI,OAAM,wEAAwE,KAE5F,GAAI,GAAc,GACZ,EAAuB,SAAY,CACrC,GAAI,EACA,KAAM,IAAI,OAAM,IAEpB,SAAc,GACP,KAAM,IAAgB,IAE3B,EAAkB,AAAC,GAAS,CAC9B,GAAI,MAAO,GAAK,QAAW,WACvB,KAAM,IAAI,OAAM;AAAA,2IAGpB,MAAO,GAAK,UAEhB,MAAO,QAAO,OAAO,EAAQ,CACzB,qBAAsB,EACtB,kBAAmB,KAAO,IAAa,CACnC,GAAM,GAAM,KAAM,KAClB,GAAI,IAAa,SACb,MAAO,IAAS,GAEf,GAAI,IAAa,MAClB,MAAO,IAAM,GAEZ,GAAI,IAAa,QAAa,IAAa,QAAU,IAAa,QACnE,MAAO,IAAO,GAEb,GAAI,MAAO,cAAgB,WAC5B,MAAO,IAAI,aAAY,GAAU,OAAO,GAGxC,KAAM,IAAI,OAAM,yEAGxB,qBAAsB,IAAM,CACxB,GAAI,EACA,KAAM,IAAI,OAAM,IAGpB,GADA,EAAc,GACV,GAAe,GACf,MAAO,GAAgB,GAEtB,GAAI,GAAyB,GAC9B,MAAO,GAGP,KAAM,IAAI,OAAM,+CAA+C,SAKzE,GAAiB,AAAC,GAAW,MAAO,OAAS,YAAc,YAAkB,MAC7E,GAA2B,AAAC,GAAW,MAAO,iBAAmB,YAAc,YAAkB,gBAEjG,GAAmB,6BAEzB,YAAoC,EAAK,CACrC,MAAO,oBAAmB,GAAK,QAAQ,WAAY,SAAU,EAAG,CAC5D,MAAO,IAAM,EAAE,WAAW,GAAG,SAAS,IAAI,gBAIlD,GAAM,IAAuB,AAAC,GAAe,MAAM,QAAQ,GAAc,EAAa,CAAC,GAEjF,GAAuB,AAAC,GAAQ,CAClC,GAAM,GAAe,QACrB,OAAW,KAAO,GACd,AAAI,EAAI,eAAe,IAAQ,EAAI,GAAK,KAAkB,OACtD,EAAI,GAAO,EAAI,GAAK,GAEf,MAAO,GAAI,IAAS,UAAY,EAAI,KAAS,MAClD,GAAI,GAAO,GAAqB,EAAI,KAG5C,MAAO,IAGL,GAAe,CAAC,EAAc,EAAO,EAAY,EAAoB,EAAU,IAAkB,CACnG,GAAI,GAAS,MAAQ,EAAM,KAAgB,OAAW,CAClD,GAAM,GAAa,IACnB,GAAI,EAAW,QAAU,EACrB,KAAM,IAAI,OAAM,8CAAgD,EAAa,KAEjF,EAAe,EAAa,QAAQ,EAAU,EACxC,EACG,MAAM,KACN,IAAI,AAAC,GAAY,GAA2B,IAC5C,KAAK,KACR,GAA2B,QAGjC,MAAM,IAAI,OAAM,2CAA6C,EAAa,KAE9E,MAAO,IAGX,YAAqC,EAAS,CAC1C,MAAO,AAAC,IAAS,KAAO,IAAS,CAC7B,GAAM,CAAE,WAAY,EACpB,MAAI,IAAY,WAAW,IAAY,EAAQ,MAAQ,EAAQ,UAAY,QACvE,GAAQ,QAAU,IACX,EAAQ,QACX,OAAQ,iBAGT,EAAK,IACL,EACH,aAIZ,GAAM,IAAqC,CACvC,KAAM,QACN,KAAM,CAAC,oBAAqB,iBAC5B,KAAM,8BACN,SAAU,IAER,GAA6B,AAAC,GAAa,EAC7C,aAAc,AAAC,GAAgB,CAC3B,EAAY,IAAI,GAA4B,GAAU,OAIxD,GAAwB,iBAC9B,aAAoC,CAChC,MAAO,CAAC,EAAM,IAAY,KAAO,IAAS,CACtC,GAAM,CAAE,WAAY,EACpB,GAAI,GAAY,WAAW,IACnB,CAAC,EAAQ,QAAQ,IAAwB,CACzC,GAAM,GAAU,wIAChB,AAAI,MAAO,IAAS,QAAQ,MAAS,WACjC,EAAQ,OAAO,KAAK,GAGpB,QAAQ,KAAK,GAIzB,MAAO,GAAK,IAAK,KAGzB,GAAM,IAA4C,CAC9C,KAAM,kBACN,KAAM,CAAC,+BACP,KAAM,oCACN,SAAU,IAER,GAAoC,AAAC,GAAY,EACnD,aAAc,AAAC,GAAgB,CAC3B,EAAY,IAAI,KAA4B,OAI9C,GAAkB,AAAC,GAAW,KAC7B,EACH,eAAgB,EAAM,gBAAkB,GACxC,sBAAuB,EAAM,uBAAyB,GACtD,+BAAgC,EAAM,gCAAkC,KAGtE,GAAW,AAAC,GAAQ,MAAO,IAAQ,UAAY,EAAI,QAAQ,UAAY,GAAK,EAAI,MAAM,KAAK,QAAU,EAE3G,aAAwC,CACpC,MAAO,AAAC,IAAS,KAAO,IAAS,CAC7B,GAAM,CAAE,MAAO,CAAE,WAAc,EAC/B,GAAI,MAAO,IAAW,UAAY,CAAC,GAAS,IAAW,EAAO,QAAQ,MAAQ,EAAG,CAC7E,GAAM,GAAM,GAAI,OAAM,gDAAgD,MACtE,QAAI,KAAO,oBACL,EAEV,MAAO,GAAK,IAAK,KAGzB,GAAM,IAAsC,CACxC,KAAM,aACN,KAAM,CAAC,wBACP,KAAM,+BACN,SAAU,IAER,GAA8B,AAAC,GAAY,EAC7C,aAAc,AAAC,GAAgB,CAC3B,EAAY,IAAI,KAAgC,OAIlD,GAAgC,AAAC,GAAW,KAC3C,EACH,sBAAuB,EAAM,yBAAyB,KAGpD,GAAkC,AAAC,GAC9B,KACA,EACH,gBAAiB,EAAQ,iBAAmB,GAC5C,qBAAsB,EAAQ,sBAAwB,GACtD,eAAgB,EAAQ,gBAAkB,GAC1C,sBAAuB,EAAQ,uBAAyB,GACxD,kBAAmB,EAAQ,mBAAqB,GAChD,+BAAgC,EAAQ,gCAAkC,GAC1E,mBAAoB,OAItB,GAAO,qBACP,GAAc,yEACd,GAAU,UACV,GAAU,CACd,MAAO,mEACP,YAAa,2BACb,aAAc,UACd,WAAY,0BACZ,qBAAsB,mEACtB,cAAe,6BACf,wBAAyB,4CACzB,MAAO,0CACP,eAAgB,4BAChB,kBAAmB,+DACnB,KAAM,iBACN,WAAY,2DACZ,YAAa,8BAET,GAAO,sBACP,GAAQ,0BACR,GAAS,qBACT,GAAc,GACd,GAAe,CACnB,2BAA4B,QAC5B,6BAA8B,QAC9B,wBAAyB,QACzB,sBAAuB,UACvB,oCAAqC,UACrC,sCAAuC,UACvC,sCAAuC,UACvC,yCAA0C,UAC1C,kCAAmC,UACnC,0CAA2C,UAC3C,6BAA8B,UAC9B,0CAA2C,UAC3C,6BAA8B,UAC9B,8BAA+B,UAC/B,2BAA4B,UAC5B,iCAAkC,UAClC,qCAAsC,UACtC,iBAAkB,UAClB,0BAA2B,UAC3B,mCAAoC,UACpC,gCAAiC,UACjC,uBAAwB,UACxB,0BAA2B,SAC3B,oCAAqC,SACrC,4CAA6C,SAC7C,iCAAkC,SAClC,6BAA8B,SAC9B,4BAA6B,SAC7B,oBAAqB,SACrB,2BAA4B,SAC5B,6BAA8B,SAC9B,iBAAkB,SAClB,oCAAqC,SACrC,8BAA+B,SAC/B,2BAA4B,SAC5B,2BAA4B,SAC5B,2BAA4B,SAC5B,+BAAgC,SAChC,4BAA6B,SAC7B,wBAAyB,SACzB,wBAAyB,SACzB,gBAAiB,SACjB,qBAAsB,SACtB,sBAAuB,SACvB,mCAAoC,SACpC,gCAAiC,SACjC,qCAAsC,SACtC,kCAAmC,SACnC,qBAAsB,SACtB,sBAAuB,SACvB,oBAAqB,SACrB,sBAAuB,SACvB,kBAAmB,QACnB,MAAO,UAEH,GAAkB,CACtB,iDAAkD,SAClD,mBAAoB,QACpB,cAAe,UACf,eAAgB,SAChB,cAAe,YACf,aAAc,QACd,gBAAiB,SACjB,OAAQ,QACR,QAAS,UACT,WAAY,UAER,GAAU,CACd,KAAM,YAEF,GAAgB,CACpB,OAAQ,CACN,eAAgB,CACd,wBAIA,GAAQ,CACZ,aAEI,GAAS,CACb,KAAM,8BACN,IAAK,sCAED,GAAU,aACV,GAAU,CACd,0BAA2B,mCAEvB,GAAW,mEACX,GAAa,CACjB,KAAM,MACN,IAAK,2CACL,UAAW,qBAET,GAAc,CAChB,KAAM,GACN,YAAa,GACb,QAAS,GACT,QAAS,GACT,KAAM,GACN,MAAO,GACP,OAAQ,GACR,YAAa,GACb,aAAc,GACd,gBAAiB,GACjB,QAAS,GACT,cAAe,GACf,MAAO,GACP,OAAQ,GACR,QAAS,GACT,QAAS,GACT,eAAgB,CAChB,0BAA2B,kCAE3B,SAAU,GACV,WAAY,IAGd,AAgBA,GAAI,IAAgB,SAAS,EAAG,EAAG,CAC/B,UAAgB,OAAO,gBAClB,CAAE,UAAW,aAAgB,QAAS,SAAU,EAAG,EAAG,CAAE,EAAE,UAAY,IACvE,SAAU,EAAG,EAAG,CAAE,OAAS,KAAK,GAAG,AAAI,EAAE,eAAe,IAAI,GAAE,GAAK,EAAE,KAClE,GAAc,EAAG,IAG5B,YAAmB,EAAG,EAAG,CACrB,GAAc,EAAG,GACjB,YAAc,CAAE,KAAK,YAAc,EACnC,EAAE,UAAY,IAAM,KAAO,OAAO,OAAO,GAAM,GAAG,UAAY,EAAE,UAAW,GAAI,IAGnF,GAAI,IAAW,UAAW,CACtB,UAAW,OAAO,QAAU,SAAkB,EAAG,CAC7C,OAAS,GAAG,EAAI,EAAG,EAAI,UAAU,OAAQ,EAAI,EAAG,IAAK,CACjD,EAAI,UAAU,GACd,OAAS,KAAK,GAAG,AAAI,OAAO,UAAU,eAAe,KAAK,EAAG,IAAI,GAAE,GAAK,EAAE,IAE9E,MAAO,IAEJ,GAAS,MAAM,KAAM,YAGhC,YAAgB,EAAG,EAAG,CAClB,GAAI,GAAI,GACR,OAAS,KAAK,GAAG,AAAI,OAAO,UAAU,eAAe,KAAK,EAAG,IAAM,EAAE,QAAQ,GAAK,GAC9E,GAAE,GAAK,EAAE,IACb,GAAI,GAAK,MAAQ,MAAO,QAAO,uBAA0B,WACrD,OAAS,GAAI,EAAG,EAAI,OAAO,sBAAsB,GAAI,EAAI,EAAE,OAAQ,IAC/D,AAAI,EAAE,QAAQ,EAAE,IAAM,GAAK,OAAO,UAAU,qBAAqB,KAAK,EAAG,EAAE,KACvE,GAAE,EAAE,IAAM,EAAE,EAAE,KAE1B,MAAO,GAGX,YAAoB,EAAY,EAAQ,EAAK,EAAM,CAC/C,GAAI,GAAI,UAAU,OAAQ,EAAI,EAAI,EAAI,EAAS,IAAS,KAAO,EAAO,OAAO,yBAAyB,EAAQ,GAAO,EAAM,EAC3H,GAAI,MAAO,UAAY,UAAY,MAAO,SAAQ,UAAa,WAAY,EAAI,QAAQ,SAAS,EAAY,EAAQ,EAAK,OACpH,QAAS,GAAI,EAAW,OAAS,EAAG,GAAK,EAAG,IAAK,AAAI,GAAI,EAAW,KAAI,GAAK,GAAI,EAAI,EAAE,GAAK,EAAI,EAAI,EAAE,EAAQ,EAAK,GAAK,EAAE,EAAQ,KAAS,GAChJ,MAAO,GAAI,GAAK,GAAK,OAAO,eAAe,EAAQ,EAAK,GAAI,EAGhE,YAAiB,EAAY,EAAW,CACpC,MAAO,UAAU,EAAQ,EAAK,CAAE,EAAU,EAAQ,EAAK,IAG3D,YAAoB,EAAa,EAAe,CAC5C,GAAI,MAAO,UAAY,UAAY,MAAO,SAAQ,UAAa,WAAY,MAAO,SAAQ,SAAS,EAAa,GAGpH,YAAmB,EAAS,EAAY,EAAG,EAAW,CAClD,WAAe,EAAO,CAAE,MAAO,aAAiB,GAAI,EAAQ,GAAI,GAAE,SAAU,EAAS,CAAE,EAAQ,KAC/F,MAAO,IAAK,IAAM,GAAI,UAAU,SAAU,EAAS,EAAQ,CACvD,WAAmB,EAAO,CAAE,GAAI,CAAE,EAAK,EAAU,KAAK,UAAkB,EAAP,CAAY,EAAO,IACpF,WAAkB,EAAO,CAAE,GAAI,CAAE,EAAK,EAAU,MAAS,UAAkB,EAAP,CAAY,EAAO,IACvF,WAAc,EAAQ,CAAE,EAAO,KAAO,EAAQ,EAAO,OAAS,EAAM,EAAO,OAAO,KAAK,EAAW,GAClG,EAAM,GAAY,EAAU,MAAM,EAAS,GAAc,KAAK,UAItE,YAAqB,EAAS,EAAM,CAChC,GAAI,GAAI,CAAE,MAAO,EAAG,KAAM,UAAW,CAAE,GAAI,EAAE,GAAK,EAAG,KAAM,GAAE,GAAI,MAAO,GAAE,IAAO,KAAM,GAAI,IAAK,IAAM,EAAG,EAAG,EAAG,EAC/G,MAAO,GAAI,CAAE,KAAM,EAAK,GAAI,MAAS,EAAK,GAAI,OAAU,EAAK,IAAM,MAAO,SAAW,YAAe,GAAE,OAAO,UAAY,UAAW,CAAE,MAAO,QAAU,EACvJ,WAAc,EAAG,CAAE,MAAO,UAAU,EAAG,CAAE,MAAO,GAAK,CAAC,EAAG,KACzD,WAAc,EAAI,CACd,GAAI,EAAG,KAAM,IAAI,WAAU,mCAC3B,KAAO,GAAG,GAAI,CACV,GAAI,EAAI,EAAG,GAAM,GAAI,EAAG,GAAK,EAAI,EAAE,OAAY,EAAG,GAAK,EAAE,OAAc,IAAI,EAAE,SAAc,EAAE,KAAK,GAAI,GAAK,EAAE,OAAS,CAAE,GAAI,EAAE,KAAK,EAAG,EAAG,KAAK,KAAM,MAAO,GAE3J,OADI,EAAI,EAAG,GAAG,GAAK,CAAC,EAAG,GAAK,EAAG,EAAE,QACzB,EAAG,QACF,OAAQ,GAAG,EAAI,EAAI,UACnB,GAAG,SAAE,QAAgB,CAAE,MAAO,EAAG,GAAI,KAAM,QAC3C,GAAG,EAAE,QAAS,EAAI,EAAG,GAAI,EAAK,CAAC,GAAI,aACnC,GAAG,EAAK,EAAE,IAAI,MAAO,EAAE,KAAK,MAAO,iBAEpC,GAAM,EAAI,EAAE,KAAM,IAAI,EAAE,OAAS,GAAK,EAAE,EAAE,OAAS,KAAQ,GAAG,KAAO,GAAK,EAAG,KAAO,GAAI,CAAE,EAAI,EAAG,SACjG,GAAI,EAAG,KAAO,GAAM,EAAC,GAAM,EAAG,GAAK,EAAE,IAAM,EAAG,GAAK,EAAE,IAAM,CAAE,EAAE,MAAQ,EAAG,GAAI,MAC9E,GAAI,EAAG,KAAO,GAAK,EAAE,MAAQ,EAAE,GAAI,CAAE,EAAE,MAAQ,EAAE,GAAI,EAAI,EAAI,MAC7D,GAAI,GAAK,EAAE,MAAQ,EAAE,GAAI,CAAE,EAAE,MAAQ,EAAE,GAAI,EAAE,IAAI,KAAK,GAAK,MAC3D,AAAI,EAAE,IAAI,EAAE,IAAI,MAChB,EAAE,KAAK,MAAO,SAEtB,EAAK,EAAK,KAAK,EAAS,SACnB,EAAP,CAAY,EAAK,CAAC,EAAG,GAAI,EAAI,SAAK,CAAU,EAAI,EAAI,EACtD,GAAI,EAAG,GAAK,EAAG,KAAM,GAAG,GAAI,MAAO,CAAE,MAAO,EAAG,GAAK,EAAG,GAAK,OAAQ,KAAM,KAIlF,YAAyB,EAAG,EAAG,EAAG,EAAI,CAClC,AAAI,IAAO,QAAW,GAAK,GAC3B,EAAE,GAAM,EAAE,GAGd,YAAsB,EAAG,EAAS,CAC9B,OAAS,KAAK,GAAG,AAAI,IAAM,WAAa,CAAC,EAAQ,eAAe,IAAI,GAAQ,GAAK,EAAE,IAGvF,YAAkB,EAAG,CACjB,GAAI,GAAI,MAAO,SAAW,YAAc,OAAO,SAAU,EAAI,GAAK,EAAE,GAAI,EAAI,EAC5E,GAAI,EAAG,MAAO,GAAE,KAAK,GACrB,GAAI,GAAK,MAAO,GAAE,QAAW,SAAU,MAAO,CAC1C,KAAM,UAAY,CACd,MAAI,IAAK,GAAK,EAAE,QAAQ,GAAI,QACrB,CAAE,MAAO,GAAK,EAAE,KAAM,KAAM,CAAC,KAG5C,KAAM,IAAI,WAAU,EAAI,0BAA4B,mCAGxD,YAAgB,EAAG,EAAG,CAClB,GAAI,GAAI,MAAO,SAAW,YAAc,EAAE,OAAO,UACjD,GAAI,CAAC,EAAG,MAAO,GACf,GAAI,GAAI,EAAE,KAAK,GAAI,EAAG,EAAK,GAAI,EAC/B,GAAI,CACA,KAAQ,KAAM,QAAU,KAAM,IAAM,CAAE,GAAI,EAAE,QAAQ,MAAM,EAAG,KAAK,EAAE,aAEjE,EAAP,CAAgB,EAAI,CAAE,MAAO,UAC7B,CACI,GAAI,CACA,AAAI,GAAK,CAAC,EAAE,MAAS,GAAI,EAAE,SAAY,EAAE,KAAK,UAElD,CAAU,GAAI,EAAG,KAAM,GAAE,OAE7B,MAAO,GAGX,aAAoB,CAChB,OAAS,GAAK,GAAI,EAAI,EAAG,EAAI,UAAU,OAAQ,IAC3C,EAAK,EAAG,OAAO,GAAO,UAAU,KACpC,MAAO,GAGX,aAA0B,CACtB,OAAS,GAAI,EAAG,EAAI,EAAG,EAAK,UAAU,OAAQ,EAAI,EAAI,IAAK,GAAK,UAAU,GAAG,OAC7E,OAAS,GAAI,MAAM,GAAI,EAAI,EAAG,EAAI,EAAG,EAAI,EAAI,IACzC,OAAS,GAAI,UAAU,GAAI,EAAI,EAAG,EAAK,EAAE,OAAQ,EAAI,EAAI,IAAK,IAC1D,EAAE,GAAK,EAAE,GACjB,MAAO,GAEX,YAAiB,EAAG,CAChB,MAAO,gBAAgB,IAAW,MAAK,EAAI,EAAG,MAAQ,GAAI,IAAQ,GAGtE,YAA0B,EAAS,EAAY,EAAW,CACtD,GAAI,CAAC,OAAO,cAAe,KAAM,IAAI,WAAU,wCAC/C,GAAI,GAAI,EAAU,MAAM,EAAS,GAAc,IAAK,EAAG,EAAI,GAC3D,MAAO,GAAI,GAAI,EAAK,QAAS,EAAK,SAAU,EAAK,UAAW,EAAE,OAAO,eAAiB,UAAY,CAAE,MAAO,OAAS,EACpH,WAAc,EAAG,CAAE,AAAI,EAAE,IAAI,GAAE,GAAK,SAAU,EAAG,CAAE,MAAO,IAAI,SAAQ,SAAU,EAAG,EAAG,CAAE,EAAE,KAAK,CAAC,EAAG,EAAG,EAAG,IAAM,GAAK,EAAO,EAAG,OAC9H,WAAgB,EAAG,EAAG,CAAE,GAAI,CAAE,EAAK,EAAE,GAAG,UAAc,EAAP,CAAY,EAAO,EAAE,GAAG,GAAI,IAC3E,WAAc,EAAG,CAAE,EAAE,gBAAiB,IAAU,QAAQ,QAAQ,EAAE,MAAM,GAAG,KAAK,EAAS,GAAU,EAAO,EAAE,GAAG,GAAI,GACnH,WAAiB,EAAO,CAAE,EAAO,OAAQ,GACzC,WAAgB,EAAO,CAAE,EAAO,QAAS,GACzC,WAAgB,EAAG,EAAG,CAAE,AAAI,EAAE,GAAI,EAAE,QAAS,EAAE,QAAQ,EAAO,EAAE,GAAG,GAAI,EAAE,GAAG,KAGhF,YAA0B,EAAG,CACzB,GAAI,GAAG,EACP,MAAO,GAAI,GAAI,EAAK,QAAS,EAAK,QAAS,SAAU,EAAG,CAAE,KAAM,KAAO,EAAK,UAAW,EAAE,OAAO,UAAY,UAAY,CAAE,MAAO,OAAS,EAC1I,WAAc,EAAG,EAAG,CAAE,EAAE,GAAK,EAAE,GAAK,SAAU,EAAG,CAAE,MAAQ,GAAI,CAAC,GAAK,CAAE,MAAO,GAAQ,EAAE,GAAG,IAAK,KAAM,IAAM,UAAa,EAAI,EAAE,GAAK,GAAO,GAG/I,YAAuB,EAAG,CACtB,GAAI,CAAC,OAAO,cAAe,KAAM,IAAI,WAAU,wCAC/C,GAAI,GAAI,EAAE,OAAO,eAAgB,EACjC,MAAO,GAAI,EAAE,KAAK,GAAM,GAAI,MAAO,KAAa,WAAa,GAAS,GAAK,EAAE,OAAO,YAAa,EAAI,GAAI,EAAK,QAAS,EAAK,SAAU,EAAK,UAAW,EAAE,OAAO,eAAiB,UAAY,CAAE,MAAO,OAAS,GAC9M,WAAc,EAAG,CAAE,EAAE,GAAK,EAAE,IAAM,SAAU,EAAG,CAAE,MAAO,IAAI,SAAQ,SAAU,EAAS,EAAQ,CAAE,EAAI,EAAE,GAAG,GAAI,EAAO,EAAS,EAAQ,EAAE,KAAM,EAAE,UAChJ,WAAgB,EAAS,EAAQ,EAAG,EAAG,CAAE,QAAQ,QAAQ,GAAG,KAAK,SAAS,EAAG,CAAE,EAAQ,CAAE,MAAO,EAAG,KAAM,KAAS,IAGtH,YAA8B,EAAQ,EAAK,CACvC,MAAI,QAAO,eAAkB,OAAO,eAAe,EAAQ,MAAO,CAAE,MAAO,IAAiB,EAAO,IAAM,EAClG,EAEX,YAAsB,EAAK,CACvB,GAAI,GAAO,EAAI,WAAY,MAAO,GAClC,GAAI,GAAS,GACb,GAAI,GAAO,KAAM,OAAS,KAAK,GAAK,AAAI,OAAO,eAAe,KAAK,EAAK,IAAI,GAAO,GAAK,EAAI,IAC5F,SAAO,QAAU,EACV,EAGX,YAAyB,EAAK,CAC1B,MAAQ,IAAO,EAAI,WAAc,EAAM,CAAE,QAAS,GAGtD,YAAgC,EAAU,EAAY,CAClD,GAAI,CAAC,EAAW,IAAI,GAChB,KAAM,IAAI,WAAU,kDAExB,MAAO,GAAW,IAAI,GAG1B,YAAgC,EAAU,EAAY,EAAO,CACzD,GAAI,CAAC,EAAW,IAAI,GAChB,KAAM,IAAI,WAAU,kDAExB,SAAW,IAAI,EAAU,GAClB,EAGX,GAAI,IAAyB,OAAO,OAAO,CACvC,UAAW,KACX,UAAW,MACP,WAAY,CAAE,MAAO,KACzB,OAAQ,GACR,WAAY,GACZ,QAAS,GACT,WAAY,GACZ,UAAW,GACX,YAAa,GACb,gBAAiB,GACjB,aAAc,GACd,SAAU,GACV,OAAQ,GACR,SAAU,GACV,eAAgB,GAChB,QAAS,GACT,iBAAkB,GAClB,iBAAkB,GAClB,cAAe,GACf,qBAAsB,GACtB,aAAc,GACd,gBAAiB,GACjB,uBAAwB,GACxB,uBAAwB,KAGxB,GAAgB,GAAqB,SAAU,EAAQ,EAAS,CACpE,OAAO,eAAe,EAAS,aAAc,CAAE,MAAO,KACtD,EAAQ,YAAc,OACtB,WAAqB,EAAM,CACvB,MAAI,OAAO,IAAS,SACT,EAAK,SAAW,EAEpB,EAAK,aAAe,EAE/B,EAAQ,YAAc,IAIlB,GAAY,GAAqB,SAAU,EAAQ,EAAS,CAChE,OAAO,eAAe,EAAS,aAAc,CAAE,MAAO,KACtD,EAAQ,iBAAmB,EAAQ,gBAAkB,EAAQ,WAAa,OAC1E,EAAQ,WAAa,CAAE,KAAM,SAC7B,EAAQ,gBAAkB,CACtB,KAAM,OACN,KAAM,EAAQ,YAElB,EAAQ,iBAAmB,GAAI,YAAW,CACtC,IACA,GACA,IACA,IACA,GACA,IACA,GACA,GACA,GACA,GACA,IACA,IACA,IACA,GACA,GACA,IACA,IACA,IACA,EACA,MAKA,GAAW,GAAqB,SAAU,EAAQ,EAAS,CAC/D,OAAO,eAAe,EAAS,aAAc,CAAE,MAAO,KACtD,EAAQ,KAAO,OAKf,GAAI,GAAsB,UAAY,CAClC,WAAc,EAAQ,CAClB,KAAK,OAAS,EACd,KAAK,QAET,SAAK,UAAU,OAAS,SAAU,EAAQ,CACtC,GAAI,GAAQ,KACZ,AAAK,AAh4Bb,GAg4BgB,GAAc,aAAa,IAGnC,MAAK,UAAY,KAAK,UAAU,KAAK,SAAU,EAAW,CACtD,SAAU,QAAU,UAAY,CAC5B,EAAM,UAAY,QAAQ,OAAO,GAAI,OAAM,qCAE/C,EAAU,QAAQ,EAAkB,IAC7B,IAEX,KAAK,UAAU,MAAM,UAAY,MAErC,EAAK,UAAU,OAAS,UAAY,CAChC,MAAO,MAAK,UAAU,KAAK,SAAU,EAAW,CAC5C,MAAO,IAAI,SAAQ,SAAU,EAAS,EAAQ,CAC1C,EAAU,QAAU,UAAY,CAC5B,EAAO,GAAI,OAAM,uCAErB,EAAU,WAAa,UAAY,CAC/B,AAAI,EAAU,QACV,EAAQ,GAAI,YAAW,EAAU,SAErC,EAAO,GAAI,OAAM,uCAErB,EAAU,cAItB,EAAK,UAAU,MAAQ,UAAY,CAC/B,AAAI,KAAK,OACL,MAAK,UAAY,EAAc,KAAK,QAAQ,KAAK,SAAU,EAAS,CAChE,MAAQ,AA/5BxB,GA+5B2B,GAAO,gBAAgB,SAAS,OAAO,KAAK,GAAU,gBAAiB,KAEtF,KAAK,UAAU,MAAM,UAAY,KAGjC,KAAK,UAAY,QAAQ,QAAS,AAp6B9C,GAo6BiD,GAAO,gBAAgB,SAAS,OAAO,OAAO,WAGpF,KAEX,EAAQ,KAAO,EACf,WAAuB,EAAQ,CAC3B,MAAO,IAAI,SAAQ,SAAU,EAAS,EAAQ,CAC1C,GAAI,GAAgB,AA56B5B,GA46B+B,GAAO,gBAAgB,SAAS,OAAO,UAAU,MAAO,EAAkB,GAAS,GAAU,gBAAiB,GAAO,CAAC,SAC7I,EAAa,WAAa,UAAY,CAClC,AAAI,EAAa,QACb,EAAQ,EAAa,QAEzB,EAAO,GAAI,OAAM,gDAErB,EAAa,QAAU,UAAY,CAC/B,EAAO,GAAI,OAAM,uCAI7B,WAA2B,EAAM,CAC7B,MAAI,OAAO,IAAS,SACR,AA17BhB,GA07BmB,GAAS,UAAU,GAE9B,YAAY,OAAO,GACZ,GAAI,YAAW,EAAK,OAAQ,EAAK,WAAY,EAAK,WAAa,WAAW,mBAE9E,GAAI,YAAW,MAKtB,GAAgB,GAAqB,SAAU,EAAQ,EAAS,CACpE,OAAO,eAAe,EAAS,aAAc,CAAE,MAAO,KACtD,EAAQ,KAAO,OAKf,GAAI,GAAsB,UAAY,CAClC,WAAc,EAAQ,CAClB,KAAK,OAAS,GAAI,YAAW,GACzB,IAAW,QACX,MAAK,IAAM,GAAI,SAAQ,SAAU,EAAS,EAAQ,CAC9C,AAAC,AAh9BjB,GAg9BoB,GAAO,gBACN,OAAO,OAAO,UAAU,MAAO,EAAgB,GAAS,GAAU,gBAAiB,GAAO,CAAC,SAC3F,KAAK,EAAS,KAEvB,KAAK,IAAI,MAAM,UAAY,KAGnC,SAAK,UAAU,OAAS,SAAU,EAAM,CACpC,GAAK,CAx9Bb,GAw9BgB,GAAc,aAAa,GAGnC,IAAI,GAAS,EAAgB,GACzB,EAAa,GAAI,YAAW,KAAK,OAAO,WAAa,EAAO,YAChE,EAAW,IAAI,KAAK,OAAQ,GAC5B,EAAW,IAAI,EAAQ,KAAK,OAAO,YACnC,KAAK,OAAS,IAElB,EAAK,UAAU,OAAS,UAAY,CAChC,GAAI,GAAQ,KACZ,MAAI,MAAK,IACE,KAAK,IAAI,KAAK,SAAU,EAAK,CAChC,MAAQ,AAr+BxB,GAq+B2B,GAAO,gBACb,OAAO,OAAO,KAAK,GAAU,gBAAiB,EAAK,EAAM,QACzD,KAAK,SAAU,EAAM,CAAE,MAAO,IAAI,YAAW,OAGrD,AA1+Bb,GA0+BgB,GAAc,aAAa,KAAK,QAC7B,QAAQ,QAAQ,GAAU,kBAE9B,QAAQ,UACV,KAAK,UAAY,CAAE,MAAQ,AA9+BxC,GA8+B2C,GAAO,gBAAgB,OAAO,OAAO,OAAO,GAAU,WAAY,EAAM,UACtG,KAAK,SAAU,EAAM,CAAE,MAAO,SAAQ,QAAQ,GAAI,YAAW,OAEtE,EAAK,UAAU,MAAQ,UAAY,CAC/B,KAAK,OAAS,GAAI,YAAW,IAE1B,KAEX,EAAQ,KAAO,EACf,WAAyB,EAAM,CAC3B,MAAI,OAAO,IAAS,SACR,AAz/BhB,GAy/BmB,GAAS,UAAU,GAE9B,YAAY,OAAO,GACZ,GAAI,YAAW,EAAK,OAAQ,EAAK,WAAY,EAAK,WAAa,WAAW,mBAE9E,GAAI,YAAW,MAKtB,GAAoB,GAAqB,SAAU,EAAQ,EAAS,CACxE,OAAO,eAAe,EAAS,aAAc,CAAE,MAAO,KACtD,EAAQ,KAAO,OAOf,GAAI,GAAsB,UAAY,CAClC,WAAc,EAAQ,CAClB,GAAK,AA9gCb,GA8gCgB,GAAQ,mBAAoB,AA9gC5C,GA8gC+C,GAAO,iBAC1C,KAAK,KAAO,GAAI,IAAc,KAAK,WAE7B,AAjhClB,GAihCqB,GAAQ,YAAa,AAjhC1C,GAihC6C,GAAO,iBACxC,KAAK,KAAO,GAAI,IAAS,KAAK,OAG9B,MAAM,IAAI,OAAM,sBAGxB,SAAK,UAAU,OAAS,SAAU,EAAM,EAAU,CAC9C,KAAK,KAAK,OAAQ,AAzhC1B,GAyhC6B,GAAQ,iBAAiB,KAElD,EAAK,UAAU,OAAS,UAAY,CAChC,MAAO,MAAK,KAAK,UAErB,EAAK,UAAU,MAAQ,UAAY,CAC/B,KAAK,KAAK,SAEP,KAEX,EAAQ,KAAO,IAIX,GAAQ,GAAqB,SAAU,EAAQ,EAAS,CAC5D,OAAO,eAAe,EAAS,aAAc,CAAE,MAAO,KACtD,EAAQ,cAAgB,EAAQ,SAAW,OAE3C,GAAU,aAAa,GAAmB,GAE1C,OAAO,eAAe,EAAS,WAAY,CAAE,WAAY,GAAM,IAAK,UAAY,CAAE,MAAO,IAAS,QAElG,OAAO,eAAe,EAAS,gBAAiB,CAAE,WAAY,GAAM,IAAK,UAAY,CAAE,MAAO,IAAc,UAI5G,YAA0B,EAAQ,CAC9B,GAAI,GAA4B,EAC5B,EAA8B,EAC9B,EAAiB,KACjB,EAAsB,KACpB,EAAkB,AAAC,GAAS,CAC9B,GAAI,MAAO,IAAS,SAChB,KAAM,IAAI,OAAM,uEAAyE,GAE7F,EAA4B,EAC5B,EAA8B,EAC9B,EAAiB,GAAI,YAAW,GAEhC,AAD2B,GAAI,UAAS,EAAe,QACpC,UAAU,EAAG,EAAM,KAEpC,EAAW,iBAAmB,CAChC,GAAM,GAAiB,EAAO,OAAO,iBACrC,OAAa,CACT,GAAM,CAAE,QAAO,QAAS,KAAM,GAAe,OAC7C,GAAI,EAAM,CACN,GAAK,EAGA,GAAI,IAA8B,EACnC,KAAM,OAGN,MAAM,IAAI,OAAM,yCANhB,QAQJ,OAEJ,GAAM,GAAc,EAAM,OACtB,EAAgB,EACpB,KAAO,EAAgB,GAAa,CAChC,GAAI,CAAC,EAAgB,CACjB,GAAM,GAAiB,EAAc,EACrC,AAAK,GACD,GAAsB,GAAI,YAAW,IAEzC,GAAM,GAAmB,KAAK,IAAI,EAAI,EAA6B,GAInE,GAHA,EAAoB,IAAI,EAAM,MAAM,EAAe,EAAgB,GAAmB,GACtF,GAA+B,EAC/B,GAAiB,EACb,EAA8B,EAC9B,MAEJ,EAAgB,GAAI,UAAS,EAAoB,QAAQ,UAAU,EAAG,KACtE,EAAsB,KAE1B,GAAM,GAAkB,KAAK,IAAI,EAA4B,EAA6B,EAAc,GACxG,EAAe,IAAI,EAAM,MAAM,EAAe,EAAgB,GAAkB,GAChF,GAA+B,EAC/B,GAAiB,EACb,GAA6B,IAA8B,GAC3D,MAAM,GACN,EAAiB,KACjB,EAA4B,EAC5B,EAA8B,MAK9C,MAAO,EACF,OAAO,eAAgB,GAIhC,YAAgC,EAAc,EAAQ,CAClD,MAAO,gBAAgB,EAAS,CAC5B,GAAM,CAAE,MAAO,GAAgB,EAAQ,QAAQ,iBAC/C,GAAI,IAAgB,QAAS,CACzB,GAAM,GAAiB,GAAI,OAAM,EAAQ,QAAQ,kBAAkB,OAAS,gBAC5E,QAAe,KAAO,EAAQ,QAAQ,eAAe,MAC/C,UAED,IAAgB,YAAa,CAClC,GAAM,GAAO,EAAQ,QAAQ,mBAAmB,MAC1C,EAAY,EAAG,GAAO,GACtB,EAAwB,KAAM,GAAa,GACjD,GAAI,EAAsB,SAAU,CAChC,GAAM,GAAQ,GAAI,OAAM,EAAO,EAAQ,OACvC,QAAM,KAAO,EACP,EAEV,KAAM,GAAsB,WAEvB,IAAgB,QAAS,CAC9B,GAAM,GAAQ,EACT,EAAQ,QAAQ,eAAe,OAAQ,GAEtC,EAAe,KAAM,GAAa,GACxC,MAAI,GAAa,SACb,OACG,MAGP,MAAM,OAAM,8BAA8B,EAAQ,QAAQ,eAAe,UAKrF,YAA4B,CACxB,YAAY,CAAE,cAAa,eAAe,CACtC,KAAK,iBAAmB,GAAI,IAAiB,EAAa,GAC1D,KAAK,WAAa,EAEtB,YAAY,EAAM,EAAc,CAC5B,GAAM,GAAc,GAAiB,GACrC,MAAO,IAAI,IAA2B,CAClC,cAAe,GAAI,IAAqB,CAAE,cAAa,QAAS,KAAK,mBACrE,aAAc,GAAuB,EAAc,KAAK,cAGhE,UAAU,EAAa,EAAY,CAC/B,MAAO,IAAI,IAAqB,CAC5B,cAAe,GAAI,IAA2B,CAAE,cAAa,eAC7D,QAAS,KAAK,iBACd,gBAAiB,OAKvB,GAA2B,AAAC,GAAoB,GACjD,OAAO,eAAgB,iBAAmB,CACvC,GAAM,GAAS,EAAe,YAC9B,GAAI,CACA,OAAa,CACT,GAAM,CAAE,OAAM,SAAU,KAAM,GAAO,OACrC,GAAI,EACA,OACJ,KAAM,WAGd,CACI,EAAO,kBAIb,GAA2B,AAAC,GAAkB,CAChD,GAAM,GAAW,EAAc,OAAO,iBACtC,MAAO,IAAI,gBAAe,MAChB,MAAK,EAAY,CACnB,GAAM,CAAE,OAAM,SAAU,KAAM,GAAS,OACvC,GAAI,EACA,MAAO,GAAW,QAEtB,EAAW,QAAQ,OAK/B,QAA8B,CAC1B,YAAY,CAAE,cAAa,eAAe,CACtC,KAAK,oBAAsB,GAAI,IAAsB,CACjD,cACA,gBAGR,YAAY,EAAM,EAAc,CAC5B,GAAM,GAAe,GAAiB,GAAQ,GAAyB,GAAQ,EAC/E,MAAO,MAAK,oBAAoB,YAAY,EAAc,GAE9D,UAAU,EAAO,EAAY,CACzB,GAAM,GAAqB,KAAK,oBAAoB,UAAU,EAAO,GACrE,MAAO,OAAO,iBAAmB,WAAa,GAAyB,GAAsB,IAG/F,GAAmB,AAAC,GAAS,MAAO,iBAAmB,YAAc,YAAgB,gBAErF,GAA2B,AAAC,GAAY,GAAI,IAAwB,GAE1E,YAAoB,EAAM,EAAS,EAAY,KAAO,KAAM,CACxD,MAAO,IAAI,SAAQ,CAAC,EAAS,IAAW,CACpC,GAAM,GAAa,GAAI,YACvB,EAAW,iBAAiB,QAAS,GACrC,EAAW,iBAAiB,QAAS,GACrC,GAAM,GAAO,EAAK,KACd,EAAiB,EACrB,YAAgB,CACZ,GAAI,GAAkB,EAAM,CACxB,IACA,OAEJ,EAAW,kBAAkB,EAAK,MAAM,EAAgB,KAAK,IAAI,EAAM,EAAiB,KAE5F,EAAW,iBAAiB,OAAQ,AAAC,GAAU,CAC3C,GAAM,GAAS,EAAM,OAAO,OAC5B,EAAQ,GAAI,YAAW,IACvB,GAAkB,EAAO,WACzB,MAEJ,MAIR,GAAM,IAAa,eAA0B,EAAU,EAAM,CACzD,GAAM,GAAO,GAAI,GACjB,YAAM,IAAW,EAAM,AAAC,GAAU,CAC9B,EAAK,OAAO,KAET,EAAK,UAGV,GAAa,GACb,GAAgB,GAChB,GAAO,CAAC,WAAY,WAAY,WAAY,WAElD,QAAU,CACN,aAAc,CACV,KAAK,QAET,OAAO,EAAY,CACf,GAAI,GAAY,GACZ,OAEC,GAAI,KAAK,SACV,KAAM,IAAI,OAAM,iDAEpB,GAAM,GAAO,GAAgB,GACzB,EAAW,EACX,CAAE,cAAe,EAErB,IADA,KAAK,aAAe,EACb,EAAa,GAChB,KAAK,OAAO,SAAS,KAAK,eAAgB,EAAK,MAC/C,IACI,KAAK,eAAiB,IACtB,MAAK,aACL,KAAK,aAAe,QAI1B,SAAS,CACX,GAAI,CAAC,KAAK,SAAU,CAChB,GAAM,CAAE,SAAQ,aAAc,EAAmB,eAAgB,KAC3D,EAAa,EAAc,EAEjC,GADA,EAAO,SAAS,KAAK,eAAgB,KACjC,EAAoB,IAAc,GAAa,EAAG,CAClD,OAAS,GAAI,KAAK,aAAc,EAAI,GAAY,IAC5C,EAAO,SAAS,EAAG,GAEvB,KAAK,aACL,KAAK,aAAe,EAExB,OAAS,GAAI,KAAK,aAAc,EAAI,GAAa,EAAG,IAChD,EAAO,SAAS,EAAG,GAEvB,EAAO,UAAU,GAAa,EAAG,IAAe,EAAG,IACnD,EAAO,UAAU,GAAa,EAAG,KAAK,MAAM,EAAa,YAAc,IACvE,KAAK,aACL,KAAK,SAAW,GAEpB,GAAM,GAAM,GAAI,UAAS,GAAI,aAAY,KACzC,OAAS,GAAI,EAAG,EAAI,EAAG,IACnB,EAAI,UAAU,EAAI,EAAG,KAAK,MAAM,GAAI,IAExC,MAAO,IAAI,YAAW,EAAI,OAAQ,EAAI,WAAY,EAAI,YAE1D,YAAa,CACT,GAAM,CAAE,SAAQ,SAAU,KACtB,EAAI,EAAM,GAAI,EAAI,EAAM,GAAI,EAAI,EAAM,GAAI,EAAI,EAAM,GACxD,EAAI,GAAG,EAAG,EAAG,EAAG,EAAG,EAAO,UAAU,EAAG,IAAO,EAAG,YACjD,EAAI,GAAG,EAAG,EAAG,EAAG,EAAG,EAAO,UAAU,EAAG,IAAO,GAAI,YAClD,EAAI,GAAG,EAAG,EAAG,EAAG,EAAG,EAAO,UAAU,EAAG,IAAO,GAAI,WAClD,EAAI,GAAG,EAAG,EAAG,EAAG,EAAG,EAAO,UAAU,GAAI,IAAO,GAAI,YACnD,EAAI,GAAG,EAAG,EAAG,EAAG,EAAG,EAAO,UAAU,GAAI,IAAO,EAAG,YAClD,EAAI,GAAG,EAAG,EAAG,EAAG,EAAG,EAAO,UAAU,GAAI,IAAO,GAAI,YACnD,EAAI,GAAG,EAAG,EAAG,EAAG,EAAG,EAAO,UAAU,GAAI,IAAO,GAAI,YACnD,EAAI,GAAG,EAAG,EAAG,EAAG,EAAG,EAAO,UAAU,GAAI,IAAO,GAAI,YACnD,EAAI,GAAG,EAAG,EAAG,EAAG,EAAG,EAAO,UAAU,GAAI,IAAO,EAAG,YAClD,EAAI,GAAG,EAAG,EAAG,EAAG,EAAG,EAAO,UAAU,GAAI,IAAO,GAAI,YACnD,EAAI,GAAG,EAAG,EAAG,EAAG,EAAG,EAAO,UAAU,GAAI,IAAO,GAAI,YACnD,EAAI,GAAG,EAAG,EAAG,EAAG,EAAG,EAAO,UAAU,GAAI,IAAO,GAAI,YACnD,EAAI,GAAG,EAAG,EAAG,EAAG,EAAG,EAAO,UAAU,GAAI,IAAO,EAAG,YAClD,EAAI,GAAG,EAAG,EAAG,EAAG,EAAG,EAAO,UAAU,GAAI,IAAO,GAAI,YACnD,EAAI,GAAG,EAAG,EAAG,EAAG,EAAG,EAAO,UAAU,GAAI,IAAO,GAAI,YACnD,EAAI,GAAG,EAAG,EAAG,EAAG,EAAG,EAAO,UAAU,GAAI,IAAO,GAAI,YACnD,EAAI,GAAG,EAAG,EAAG,EAAG,EAAG,EAAO,UAAU,EAAG,IAAO,EAAG,YACjD,EAAI,GAAG,EAAG,EAAG,EAAG,EAAG,EAAO,UAAU,GAAI,IAAO,EAAG,YAClD,EAAI,GAAG,EAAG,EAAG,EAAG,EAAG,EAAO,UAAU,GAAI,IAAO,GAAI,WACnD,EAAI,GAAG,EAAG,EAAG,EAAG,EAAG,EAAO,UAAU,EAAG,IAAO,GAAI,YAClD,EAAI,GAAG,EAAG,EAAG,EAAG,EAAG,EAAO,UAAU,GAAI,IAAO,EAAG,YAClD,EAAI,GAAG,EAAG,EAAG,EAAG,EAAG,EAAO,UAAU,GAAI,IAAO,EAAG,UAClD,EAAI,GAAG,EAAG,EAAG,EAAG,EAAG,EAAO,UAAU,GAAI,IAAO,GAAI,YACnD,EAAI,GAAG,EAAG,EAAG,EAAG,EAAG,EAAO,UAAU,GAAI,IAAO,GAAI,YACnD,EAAI,GAAG,EAAG,EAAG,EAAG,EAAG,EAAO,UAAU,GAAI,IAAO,EAAG,WAClD,EAAI,GAAG,EAAG,EAAG,EAAG,EAAG,EAAO,UAAU,GAAI,IAAO,EAAG,YAClD,EAAI,GAAG,EAAG,EAAG,EAAG,EAAG,EAAO,UAAU,GAAI,IAAO,GAAI,YACnD,EAAI,GAAG,EAAG,EAAG,EAAG,EAAG,EAAO,UAAU,GAAI,IAAO,GAAI,YACnD,EAAI,GAAG,EAAG,EAAG,EAAG,EAAG,EAAO,UAAU,GAAI,IAAO,EAAG,YAClD,EAAI,GAAG,EAAG,EAAG,EAAG,EAAG,EAAO,UAAU,EAAG,IAAO,EAAG,YACjD,EAAI,GAAG,EAAG,EAAG,EAAG,EAAG,EAAO,UAAU,GAAI,IAAO,GAAI,YACnD,EAAI,GAAG,EAAG,EAAG,EAAG,EAAG,EAAO,UAAU,GAAI,IAAO,GAAI,YACnD,EAAI,GAAG,EAAG,EAAG,EAAG,EAAG,EAAO,UAAU,GAAI,IAAO,EAAG,YAClD,EAAI,GAAG,EAAG,EAAG,EAAG,EAAG,EAAO,UAAU,GAAI,IAAO,GAAI,YACnD,EAAI,GAAG,EAAG,EAAG,EAAG,EAAG,EAAO,UAAU,GAAI,IAAO,GAAI,YACnD,EAAI,GAAG,EAAG,EAAG,EAAG,EAAG,EAAO,UAAU,GAAI,IAAO,GAAI,YACnD,EAAI,GAAG,EAAG,EAAG,EAAG,EAAG,EAAO,UAAU,EAAG,IAAO,EAAG,YACjD,EAAI,GAAG,EAAG,EAAG,EAAG,EAAG,EAAO,UAAU,GAAI,IAAO,GAAI,YACnD,EAAI,GAAG,EAAG,EAAG,EAAG,EAAG,EAAO,UAAU,GAAI,IAAO,GAAI,YACnD,EAAI,GAAG,EAAG,EAAG,EAAG,EAAG,EAAO,UAAU,GAAI,IAAO,GAAI,YACnD,EAAI,GAAG,EAAG,EAAG,EAAG,EAAG,EAAO,UAAU,GAAI,IAAO,EAAG,WAClD,EAAI,GAAG,EAAG,EAAG,EAAG,EAAG,EAAO,UAAU,EAAG,IAAO,GAAI,YAClD,EAAI,GAAG,EAAG,EAAG,EAAG,EAAG,EAAO,UAAU,GAAI,IAAO,GAAI,YACnD,EAAI,GAAG,EAAG,EAAG,EAAG,EAAG,EAAO,UAAU,GAAI,IAAO,GAAI,UACnD,EAAI,GAAG,EAAG,EAAG,EAAG,EAAG,EAAO,UAAU,GAAI,IAAO,EAAG,YAClD,EAAI,GAAG,EAAG,EAAG,EAAG,EAAG,EAAO,UAAU,GAAI,IAAO,GAAI,YACnD,EAAI,GAAG,EAAG,EAAG,EAAG,EAAG,EAAO,UAAU,GAAI,IAAO,GAAI,WACnD,EAAI,GAAG,EAAG,EAAG,EAAG,EAAG,EAAO,UAAU,EAAG,IAAO,GAAI,YAClD,EAAI,GAAG,EAAG,EAAG,EAAG,EAAG,EAAO,UAAU,EAAG,IAAO,EAAG,YACjD,EAAI,GAAG,EAAG,EAAG,EAAG,EAAG,EAAO,UAAU,GAAI,IAAO,GAAI,YACnD,EAAI,GAAG,EAAG,EAAG,EAAG,EAAG,EAAO,UAAU,GAAI,IAAO,GAAI,YACnD,EAAI,GAAG,EAAG,EAAG,EAAG,EAAG,EAAO,UAAU,GAAI,IAAO,GAAI,YACnD,EAAI,GAAG,EAAG,EAAG,EAAG,EAAG,EAAO,UAAU,GAAI,IAAO,EAAG,YAClD,EAAI,GAAG,EAAG,EAAG,EAAG,EAAG,EAAO,UAAU,GAAI,IAAO,GAAI,YACnD,EAAI,GAAG,EAAG,EAAG,EAAG,EAAG,EAAO,UAAU,GAAI,IAAO,GAAI,YACnD,EAAI,GAAG,EAAG,EAAG,EAAG,EAAG,EAAO,UAAU,EAAG,IAAO,GAAI,YAClD,EAAI,GAAG,EAAG,EAAG,EAAG,EAAG,EAAO,UAAU,GAAI,IAAO,EAAG,YAClD,EAAI,GAAG,EAAG,EAAG,EAAG,EAAG,EAAO,UAAU,GAAI,IAAO,GAAI,YACnD,EAAI,GAAG,EAAG,EAAG,EAAG,EAAG,EAAO,UAAU,GAAI,IAAO,GAAI,YACnD,EAAI,GAAG,EAAG,EAAG,EAAG,EAAG,EAAO,UAAU,GAAI,IAAO,GAAI,YACnD,EAAI,GAAG,EAAG,EAAG,EAAG,EAAG,EAAO,UAAU,GAAI,IAAO,EAAG,YAClD,EAAI,GAAG,EAAG,EAAG,EAAG,EAAG,EAAO,UAAU,GAAI,IAAO,GAAI,YACnD,EAAI,GAAG,EAAG,EAAG,EAAG,EAAG,EAAO,UAAU,EAAG,IAAO,GAAI,WAClD,EAAI,GAAG,EAAG,EAAG,EAAG,EAAG,EAAO,UAAU,GAAI,IAAO,GAAI,YACnD,EAAM,GAAM,EAAI,EAAM,GAAM,WAC5B,EAAM,GAAM,EAAI,EAAM,GAAM,WAC5B,EAAM,GAAM,EAAI,EAAM,GAAM,WAC5B,EAAM,GAAM,EAAI,EAAM,GAAM,WAEhC,OAAQ,CACJ,KAAK,MAAQ,YAAY,KAAK,IAC9B,KAAK,OAAS,GAAI,UAAS,GAAI,aAAY,KAC3C,KAAK,aAAe,EACpB,KAAK,YAAc,EACnB,KAAK,SAAW,KAGxB,YAAa,EAAG,EAAG,EAAG,EAAG,EAAG,EAAG,CAC3B,SAAO,GAAI,EAAK,YAAgB,GAAI,EAAK,YAAe,WAC9C,IAAK,EAAM,IAAO,GAAK,GAAO,EAAK,WAEjD,YAAY,EAAG,EAAG,EAAG,EAAG,EAAG,EAAG,EAAG,CAC7B,MAAO,IAAK,EAAI,EAAM,CAAC,EAAI,EAAI,EAAG,EAAG,EAAG,EAAG,GAE/C,YAAY,EAAG,EAAG,EAAG,EAAG,EAAG,EAAG,EAAG,CAC7B,MAAO,IAAK,EAAI,EAAM,EAAI,CAAC,EAAI,EAAG,EAAG,EAAG,EAAG,GAE/C,YAAY,EAAG,EAAG,EAAG,EAAG,EAAG,EAAG,EAAG,CAC7B,MAAO,IAAI,EAAI,EAAI,EAAG,EAAG,EAAG,EAAG,EAAG,GAEtC,YAAY,EAAG,EAAG,EAAG,EAAG,EAAG,EAAG,EAAG,CAC7B,MAAO,IAAI,EAAK,GAAI,CAAC,GAAI,EAAG,EAAG,EAAG,EAAG,GAEzC,YAAqB,EAAM,CACvB,MAAI,OAAO,IAAS,SACT,EAAK,SAAW,EAEpB,EAAK,aAAe,EAE/B,YAAyB,EAAM,CAC3B,MAAI,OAAO,IAAS,SACT,GAAS,GAEhB,YAAY,OAAO,GACZ,GAAI,YAAW,EAAK,OAAQ,EAAK,WAAY,EAAK,WAAa,WAAW,mBAE9E,GAAI,YAAW,GAG1B,YAA6B,CACzB,YAAY,EAAS,CACjB,KAAK,YAAc,GAAI,IAAY,GACnC,KAAK,cAAgB,OAEnB,MAAK,EAAe,EAAU,GAAI,CACpC,GAAI,EAAQ,gBAAkB,IAAK,CAC/B,GAAI,KAAK,cAAc,UAAY,OAC/B,KAAM,IAAI,OAAM,gGACpB,MAAO,MAAK,kBAAkB,KAAK,EAAe,GAEtD,MAAO,MAAK,YAAY,KAAK,EAAe,QAE1C,SAAQ,EAAiB,EAAU,GAAI,CACzC,GAAI,EAAQ,gBAAkB,IAAK,CAC/B,GAAI,KAAK,cAAc,UAAY,OAC/B,KAAM,IAAI,OAAM,gGACpB,MAAO,MAAK,kBAAkB,QAAQ,EAAiB,GAE3D,MAAO,MAAK,YAAY,QAAQ,EAAiB,GAErD,iBAAkB,CACd,GAAI,CAAC,KAAK,aAAc,CACpB,GAAI,GACJ,GAAI,CAEA,GADA,EAA+C,QAAQ,6BAA6B,YAChF,MAAO,IAAgB,WACvB,KAAM,IAAI,aAEX,EAAP,CACI,QAAE,QACE,GAAG,EAAE;AAAA;AAAA,uHAGH,EAEV,KAAK,aAAe,GAAI,GAAY,IAC7B,KAAK,cACR,iBAAkB,IAG1B,MAAO,MAAK,eAId,GAAK,WAAY,EAAK,OAAQ,EAAK,aAAc,EAAK,KAAM,EAAK,OAAQ,GAAK,MAAO,GAAK,SAAU,GAAK,MAAO,GAAK,aAAc,GAAK,cAAe,GAAK,wBAAyB,GAAK,cAAe,GAAK,gBAAiB,GAAK,UACpO,GAAI,GAAO,GAAI,GAAM,GAAI,QAAS,EAAI,OAAQ,GAAI,gBAAiB,GAAI,QAAS,GAAI,gBAAiB,GAAI,eAAgB,GAAI,UAAW,GAAI,OAAQ,GAAI,YAAa,GAAI,eAAgB,GAAI,eAAgB,GAAI,oBAAqB,GAAI,YAAa,GAAI,mBAAoB,GAAI,MAAO,GAAI,WAAY,GAAI,cAAe,EAAI,WAAY,GAAI,gCAAiC,GAAI,KAAM,GAAI,6DAA8D,GAAI,oDAAqD,GAAI,6DAA8D,GAAI,kDAAmD,GAAI,eAAgB,GAAI,YAAa,GAAI,UAAW,GAAI,GAAI,GAAI,mBAAoB,GAAI,cAAe,GAAI,kBAAmB,GAAI,mFAAoF,GAAI,gBAAiB,GAAI,cAAe,GAAI,YAAa,GAAI,yEAA0E,GAAI,8DAA+D,GAAI,2CAA4C,GAAI,yCAA0C,GAAI,EAAG,IAAK,IAAQ,GAAK,UAAY,GAAI,EAAG,IAAK,GAAM,QAAW,IAAQ,GAAK,WAAa,GAAI,EAAG,IAAK,IAAQ,GAAK,WAAa,GAAI,EAAG,GAAK,IAAI,GAAK,CAAC,EAAG,IAAK,cAAgB,KAAS,GAAI,EAAG,GAAK,IAAI,GAAK,CAAC,EAAG,IAAK,WAAa,KAAS,GAAI,EAAG,GAAK,IAAI,GAAK,CAAC,EAAG,IAAK,gBAAkB,KAAS,GAAI,EAAG,GAAK,IAAI,GAAK,CAAC,EAAG,IAAK,cAAiB,GAAI,EAAG,GAAK,IAAI,GAAK,CAAC,EAAG,IAAK,YAAc,IAAK,mBAAqB,GAAI,EAAG,GAAK,IAAI,GAAK,CAAC,EAAG,GAAK,IAAI,GAAK,CAAC,EAAG,IAAK,mBAAqB,KAAM,WAAa,GAAI,EAAG,GAAK,IAAI,GAAK,CAAC,EAAG,IAAK,YAAe,GAAI,EAAG,IAAK,UAAY,GAAK,EAAG,IAAK,IAAK,GAAK,EAAG,GAAK,CAAC,EAAG,GAAK,IAAI,GAAK,CAAC,OAAQ,IAAI,iEAAkE,GAAK,IAAK,GAAK,EAAG,GAAK,IAAI,GAAK,CAAC,KAAM,GAAK,EAAG,GAAK,IAAI,GAAK,CAAC,EAAG,IAAK,cAAgB,IAAK,OAAS,GAAK,EAAG,IAAK,CAAC,EAAG,IAAK,IAAO,IAAI,SAAU,IAAK,IAAI,IAAK,cAAiB,GAAK,GAAI,GAAK,EAAG,GAAK,IAAI,GAAK,CAAC,EAAG,IAAK,kBAAoB,KAAU,GAAK,EAAG,IAAK,kBAAoB,GAAK,EAAG,GAAK,IAAI,GAAK,CAAC,EAAG,IAAK,cAAgB,KAAU,GAAK,EAAG,GAAK,IAAI,GAAK,CAAC,EAAG,IAAK,UAAY,eAAiB,GAAK,EAAG,IAAK,CAAC,EAAG,IAAK,IAAO,IAAI,SAAU,IAAK,IAAI,IAAK,eAAkB,GAAK,EAAG,GAAK,IAAI,GAAK,CAAC,KAAO,GAAK,EAAG,GAAK,IAAI,GAAK,CAAC,EAAG,IAAK,qBAAuB,KAAS,GAAK,EAAG,IAAK,2EAA4E,IAAK,EAAG,IAAK,CAAC,EAAG,IAAK,IAAO,IAAI,SAAU,IAAK,IAAI,IAAK,eAAkB,IAAK,IAAM,GAAK,EAAG,IAAK,CAAC,EAAG,IAAK,IAAO,IAAI,SAAU,IAAK,IAAI,IAAK,cAAiB,GAAK,EAAG,GAAK,IAAI,GAAK,CAAC,EAAG,IAAK,qBAAuB,KAAU,GAAK,EAAG,GAAK,IAAI,GAAK,CAAC,EAAG,IAAK,gBAAkB,KAAU,GAAK,EAAG,IAAK,iEAAkE,IAAK,IAAK,IAAK,IAAM,GAAK,EAAG,GAAK,IAAI,GAAK,CAAC,EAAG,IAAK,WAAa,KAAU,GAAK,EAAG,IAAK,wEAAyE,IAAK,IAAK,IAAK,IAAM,GAAK,EAAG,IAAK,sEAAuE,IAAK,IAAK,IAAK,IAAM,GAAK,EAAG,GAAK,IAAI,GAAK,CAAC,EAAG,GAAK,IAAI,GAAK,CAAC,EAAG,IAAK,OAAS,SAAW,KAAS,GAAK,EAAG,IAAK,OAAS,GAAK,EAAG,GAAK,IAAI,GAAK,CAAC,EAAG,GAAK,IAAI,GAAK,CAAC,GAAI,SAAW,KAAU,GAAK,EAAG,IAAK,IAAI,IAAK,IAAK,IAAK,IAAM,GAAK,EAAG,IAAK,IAAI,IAAK,IAAK,IAAK,IAAM,GAAK,EAAG,GAAI,IAAK,GAAK,GAAK,GAAK,EAAG,IAAK,IAAI,IAAK,IAAK,IAAK,IAAM,GAAK,EAAG,IAAK,4DAA6D,IAAK,IAAK,IAAK,IAAM,GAAK,EAAG,IAAI,oDAAqD,GAAK,IAAK,GAAK,EAAG,IAAK,IAAK,GAAK,EAAG,IAAK,IAAK,GAAK,EAAG,GAAK,IAAI,GAAK,CAAC,GAAI,YAAc,GAAK,EAAG,IAAK,IAAK,GAAK,EAAG,GAAK,CAAC,KAAK,IAAI,gDAAiD,GAAK,IAAK,GAAK,EAAG,GAAK,CAAC,KAAK,IAAI,mDAAoD,GAAK,IAAK,GAAK,EAAG,GAAK,CAAC,EAAG,GAAK,IAAI,GAAK,CAAC,EAAG,IAAK,yBAA4B,EAAG,GAAK,IAAI,GAAK,CAAC,EAAG,IAAK,uBAAyB,OAAW,IAAI,sDAAuD,GAAK,IAAK,GAAK,EAAG,GAAK,CAAC,EAAG,GAAK,IAAI,GAAK,CAAC,EAAG,IAAK,kBAAqB,EAAG,GAAK,IAAI,GAAK,CAAC,EAAG,IAAK,gBAAkB,KAAU,EAAG,GAAK,IAAI,GAAK,CAAC,EAAG,GAAK,IAAI,GAAK,CAAC,EAAG,GAAK,IAAI,GAAK,CAAC,GAAI,WAAa,iBAAoB,IAAI,mIAAoI,GAAK,IAAK,GAAK,EAAG,GAAK,IAAI,GAAK,CAAC,EAAG,IAAK,mBAAqB,KAAM,GAAK,EAAG,GAAK,IAAI,GAAK,CAAC,GAAI,cAAgB,GAAK,EAAG,IAAK,CAAC,EAAG,IAAK,IAAO,IAAI,SAAU,IAAK,IAAI,IAAK,wBAA2B,GAAK,EAAG,IAAI,yGAA0G,GAAK,IAAK,GAAK,EAAG,IAAI,sGAAuG,GAAK,IAAK,GAAK,EAAG,IAAI,kEAAmE,GAAK,IAAK,GAAK,EAAG,IAAI,kHAAmH,GAAK,IAAK,GAAK,EAAG,IAAI,0FAA2F,GAAK,IAAK,GAAK,EAAG,IAAI,4GAA6G,GAAK,IAAK,GAAK,EAAG,IAAK,CAAC,EAAG,IAAK,IAAO,IAAI,SAAU,IAAK,IAAI,IAAK,wBAA2B,GAAK,EAAG,IAAK,CAAC,EAAG,IAAK,IAAO,IAAI,SAAU,IAAK,IAAI,IAAK,wBAA2B,GAAK,EAAG,GAAK,IAAI,GAAK,CAAC,KAAM,GAAK,EAAG,IAAK,uFAAwF,IAAK,IAAK,IAAK,IAAM,GAAK,EAAG,IAAK,6EAA8E,IAAK,IAAK,IAAK,IAAM,GAAK,EAAG,IAAK,kFAAmF,IAAK,IAAK,IAAK,IAAM,GAAK,EAAG,IAAK,IAAI,IAAK,IAAK,IAAK,IAAM,GAAK,EAAG,IAAK,wEAAyE,IAAK,IAAK,IAAK,IAAM,GAAK,EAAG,IAAK,2BAA6B,GAAK,EAAG,IAAK,CAAC,EAAG,IAAK,IAAO,IAAI,SAAU,IAAK,IAAI,IAAK,cAAiB,GAAK,EAAG,IAAK,kEAAmE,IAAK,IAAK,IAAK,IAAM,GAAK,EAAG,IAAK,wDAAyD,IAAK,IAAK,IAAK,IAAM,GAAK,EAAG,IAAK,6DAA8D,IAAK,IAAK,IAAK,IAAM,GAAK,EAAG,IAAK,IAAI,IAAK,IAAK,IAAK,IAAM,GAAK,EAAG,IAAK,mDAAoD,IAAK,IAAK,IAAK,IAAM,GAAK,CAAC,EAAG,IAAK,WAAa,GAAK,CAAC,EAAG,IAAK,aAAe,GAAK,CAAC,IAAI,GAAK,CAAC,EAAG,GAAK,IAAI,GAAK,CAAC,EAAG,IAAK,IAAK,MAAW,GAAK,CAAC,EAAG,GAAK,IAAI,GAAK,CAAC,EAAG,IAAK,IAAK,UAAY,GAAK,CAAC,GAAG,IAAK,GAAK,CAAC,IAAI,GAAK,CAAC,IAAI,GAAK,CAAC,EAAG,GAAK,IAAI,GAAK,CAAC,EAAG,IAAK,UAAY,MAAW,GAAK,CAAC,EAAG,GAAK,IAAI,GAAK,CAAC,EAAG,IAAK,UAAY,eAAiB,GAAK,CAAC,EAAG,GAAK,IAAI,GAAK,CAAC,GAAI,MAAO,GAAK,CAAC,EAAG,GAAK,IAAI,GAAK,CAAC,GAAI,kBAAmB,IAAK,IAAK,EAAG,GAAK,IAAI,GAAK,CAAC,EAAG,GAAK,IAAI,GAAK,CAAC,GAAI,QAAU,GAAK,CAAC,GAAI,iBAAkB,GAAK,CAAC,IAAI,GAAK,CAAC,IAAI,GAAK,CAAC,EAAG,GAAK,IAAI,GAAK,CAAC,EAAG,GAAK,IAAI,GAAK,CAAC,EAAG,GAAK,IAAI,GAAK,CAAC,GAAI,WAAa,QAAU,GAAK,CAAC,EAAG,GAAK,IAAI,GAAK,CAAC,EAAG,GAAK,IAAI,GAAK,CAAC,EAAG,GAAK,IAAI,GAAK,CAAC,GAAI,uBAA2B,GAAK,CAAC,GAAI,iBAAkB,GAAK,CAAC,EAAG,GAAK,IAAI,GAAK,CAAC,EAAG,GAAK,IAAI,GAAK,CAAC,GAAI,aAAe,IAAK,oBAAsB,GAAK,CAAC,EAAG,GAAK,IAAI,GAAK,CAAC,GAAI,EAAG,GAAK,IAAI,GAAK,CAAC,EAAG,IAAK,mBAAqB,QAAU,GAAK,CAAC,EAAG,GAAK,IAAI,GAAK,CAAC,EAAG,GAAK,IAAI,GAAK,CAAC,GAAI,WAAa,MAAU,GAAK,CAAC,EAAG,GAAK,IAAI,GAAK,CAAC,GAAI,MAAW,GAAK,CAAC,EAAG,GAAK,IAAI,GAAK,CAAC,GAAI,MAAW,GAAK,CAAC,IAAI,GAAK,CAAC,EAAG,GAAK,IAAI,GAAK,CAAC,EAAG,IAAK,UAAY,MACh9O,GAAQ,CAAE,QAAS,MAAO,WAAY,CAAE,OAAQ,GAAG,OAAQ,GAAG,QAAS,GAAG,aAAc,GAAG,SAAU,GAAG,eAAgB,GAAG,WAAY,GAAG,kBAAmB,GAAG,wBAAyB,GAAG,oBAAqB,GAAG,+BAAgC,GAAG,aAAc,IAAK,MAAO,CAAC,EAAG,GAAK,CAAC,EAAG,GAAK,IAAI,GAAK,MAAQ,GAAK,EAAG,MAAO,CAAC,EAAG,GAAK,CAAC,GAAG,IAAI,MAAO,uCAAwC,GAAK,IAAK,EAAG,GAAK,CAAC,GAAG,IAAI,MAAO,gEAAiE,GAAK,IAAK,EAAG,GAAK,CAAC,GAAG,IAAI,MAAO,kDAAmD,GAAK,IAAK,EAAG,GAAK,CAAC,GAAG,IAAI,MAAO,2DAA4D,GAAK,IAAK,EAAG,GAAK,CAAC,GAAG,GAAG,IAAI,MAAO,mCAAoC,GAAK,IAAK,EAAG,GAAK,CAAC,GAAG,EAAG,GAAK,IAAI,GAAK,CAAC,GAAG,GAAI,GAAI,KAAK,IAAK,IAAK,EAAG,GAAK,IAAI,GAAK,CAAC,GAAG,EAAG,GAAI,KAAK,IAAK,IAAK,EAAG,GAAK,IAAI,GAAK,CAAC,GAAG,EAAG,EAAG,KAAK,IAAK,IAAK,EAAG,GAAK,IAAI,GAAK,CAAC,GAAG,GAAI,GAAI,KAAK,IAAK,IAAK,EAAG,GAAK,IAAI,GAAK,IAAK,IAAK,mBAAqB,EAAG,GAAK,IAAI,GAAK,CAAC,EAAG,IAAK,IAAK,cAAgB,GAAK,EAAG,MAAO,CAAC,EAAG,GAAK,IAAK,GAAK,EAAG,MAAO,CAAC,EAAG,GAAK,CAAC,EAAG,GAAK,IAAI,GAAK,CAAC,GAAI,QAAU,GAAK,EAAG,MAAO,CAAC,EAAG,GAAK,IAAK,GAAK,EAAG,MAAO,CAAC,GAAI,EAAG,GAAK,GAAI,SAAU,EAAG,IAAK,wCAAyC,IAAK,IAAK,IAAK,KAAO,GAAK,KAAQ,CAAE,SAAU,EAAG,IAAK,yEAA0E,IAAK,IAAK,IAAK,KAAO,GAAK,KAAQ,EAAG,GAAK,CAAC,EAAG,GAAK,IAAI,GAAK,CAAC,GAAI,QAAU,GAAK,EAAG,MAAO,CAAC,EAAG,GAAK,IAAK,GAAK,EAAG,MAAO,CAAC,GAAI,EAAG,GAAK,GAAI,SAAU,EAAG,IAAK,mDAAoD,IAAK,IAAK,IAAK,KAAO,GAAK,KAAQ,CAAE,SAAU,EAAG,IAAK,oFAAqF,IAAK,IAAK,IAAK,KAAO,GAAK,KAAQ,CAAE,MAAO,sFAAyF,GAAK,MAAQ,CAAE,MAAO,wEAAyE,GAAK,MAAQ,EAAG,GAAK,IAAK,GAAK,EAAG,MAAO,CAAC,EAAG,GAAK,CAAC,GAAG,EAAG,GAAK,IAAI,GAAK,CAAC,EAAG,GAAK,IAAI,GAAK,CAAC,EAAG,GAAK,IAAI,GAAK,SAAa,MAAO,oDAAqD,GAAK,IAAK,EAAG,GAAK,CAAC,GAAI,EAAG,GAAK,IAAI,GAAK,CAAC,GAAG,OAAQ,GAAK,EAAG,MAAO,CAAC,EAAG,GAAK,IAAK,GAAK,EAAG,MAAO,CAAC,EAAG,GAAK,IAAK,GAAK,EAAG,MAAO,CAAC,EAAG,GAAK,CAAC,GAAG,IAAI,MAAO,+CAAgD,GAAK,IAAK,EAAG,GAAK,CAAC,GAAG,GAAG,GAAI,GAAI,IAAK,SAAU,EAAG,IAAK,4EAA6E,IAAK,IAAK,IAAK,KAAO,GAAK,GAAK,EAAG,GAAK,CAAC,GAAG,GAAG,GAAI,GAAI,GAAI,KAAM,GAAK,EAAG,MAAO,CAAC,CAAE,SAAU,IAAK,GAAK,KAAQ,EAAG,GAAK,CAAC,GAAG,GAAG,GAAI,GAAI,GAAI,IAAK,SAAU,IAAK,GAAK,GAAK,EAAG,GAAK,CAAC,GAAI,GAAG,GAAI,GAAI,IAAK,SAAU,EAAG,IAAK,kEAAmE,IAAK,IAAK,IAAK,KAAO,GAAK,GAAK,EAAG,GAAK,CAAC,GAAI,GAAG,GAAI,GAAI,GAAI,KAAM,GAAK,EAAG,MAAO,CAAC,CAAE,SAAU,IAAK,GAAK,KAAQ,EAAG,GAAK,CAAC,GAAI,GAAG,GAAI,GAAI,GAAI,IAAK,SAAU,IAAK,GAAK,GAAK,EAAG,GAAK,CAAC,GAAG,GAAI,GAAG,GAAI,IAAK,SAAU,EAAG,IAAK,kFAAmF,IAAK,IAAK,IAAK,KAAO,GAAK,GAAK,EAAG,GAAK,CAAC,GAAG,GAAI,GAAG,GAAI,GAAI,KAAM,GAAK,EAAG,MAAO,CAAC,CAAE,SAAU,IAAK,GAAK,KAAQ,EAAG,GAAK,CAAC,GAAG,GAAI,GAAG,GAAI,GAAI,IAAK,SAAU,IAAK,GAAK,GAAK,EAAG,GAAK,CAAC,GAAG,GAAI,GAAI,GAAI,IAAK,SAAU,EAAG,IAAK,uEAAwE,IAAK,IAAK,IAAK,KAAO,GAAK,GAAK,EAAG,GAAK,CAAC,GAAG,GAAI,GAAI,GAAI,GAAI,KAAM,GAAK,EAAG,MAAO,CAAC,CAAE,SAAU,IAAK,GAAK,KAAQ,EAAG,GAAK,CAAC,GAAG,GAAI,GAAI,GAAI,GAAI,IAAK,SAAU,IAAK,GAAK,GAAK,EAAG,GAAK,CAAC,GAAI,GAAI,GAAI,GAAG,GAAI,GAAI,IAAK,SAAU,EAAG,IAAK,IAAI,IAAK,IAAK,IAAK,KAAO,GAAK,GAAK,EAAG,GAAK,CAAC,GAAI,GAAI,GAAI,GAAG,GAAI,GAAI,IAAK,SAAU,EAAG,IAAK,IAAI,IAAK,IAAK,IAAK,KAAO,GAAK,GAAK,EAAG,GAAK,CAAC,GAAI,GAAI,GAAI,GAAG,GAAI,GAAI,GAAI,KAAM,GAAK,EAAG,MAAO,CAAC,EAAG,GAAK,GAAI,SAAU,IAAK,GAAK,GAAK,CAAE,SAAU,IAAK,GAAK,KAAQ,EAAG,GAAK,CAAC,GAAI,GAAI,GAAI,GAAG,GAAI,GAAI,GAAI,KAAM,GAAK,EAAG,MAAO,CAAC,EAAG,GAAK,GAAI,SAAU,IAAK,GAAK,GAAK,KAAO,EAAG,GAAK,CAAC,GAAI,GAAI,GAAI,GAAG,GAAI,GAAI,GAAI,IAAK,SAAU,IAAK,GAAK,GAAK,EAAG,GAAK,CAAC,GAAI,GAAI,GAAI,GAAG,GAAI,GAAI,GAAI,IAAK,SAAU,IAAK,GAAK,GAAK,EAAG,GAAK,CAAC,GAAI,GAAI,GAAG,GAAI,IAAK,SAAU,EAAG,IAAK,IAAI,IAAK,IAAK,IAAK,KAAO,GAAK,GAAK,EAAG,GAAK,CAAC,GAAI,GAAI,GAAG,GAAI,GAAI,KAAM,GAAK,EAAG,MAAO,CAAC,EAAG,GAAK,GAAI,SAAU,IAAK,GAAK,GAAK,CAAE,SAAU,IAAK,GAAK,KAAQ,EAAG,GAAK,CAAC,GAAI,GAAI,GAAG,GAAI,GAAI,IAAK,SAAU,IAAK,GAAK,GAAK,EAAG,GAAK,CAAC,GAAI,GAAI,GAAI,GAAI,IAAK,SAAU,EAAG,IAAK,IAAI,IAAK,IAAK,IAAK,KAAO,GAAK,GAAK,EAAG,GAAK,CAAC,GAAI,GAAI,GAAI,GAAI,GAAI,KAAM,GAAK,EAAG,MAAO,CAAC,EAAG,GAAK,GAAI,SAAU,EAAG,IAAK,IAAI,IAAK,IAAK,IAAK,KAAO,GAAK,GAAK,CAAE,SAAU,IAAK,GAAK,KAAQ,EAAG,GAAK,CAAC,GAAI,GAAI,GAAI,GAAI,GAAI,IAAK,SAAU,IAAK,GAAK,KAAQ,OAAU,EAAG,GAAK,CAAC,GAAG,GAAI,EAAG,GAAK,IAAI,GAAK,CAAC,EAAG,GAAK,IAAI,GAAK,CAAC,GAAI,WAAa,SAAW,EAAG,GAAK,IAAI,GAAK,CAAC,GAAG,KAAM,GAAI,GAAI,GAAI,KAAM,GAAK,EAAG,MAAO,CAAC,EAAG,GAAK,IAAK,GAAK,EAAG,MAAO,CAAC,EAAG,GAAK,IAAK,GAAK,EAAG,MAAO,CAAC,KAAO,OAAU,EAAG,GAAK,CAAC,GAAI,EAAG,GAAK,IAAI,GAAK,IAAK,IAAK,MAAO,GAAK,EAAG,MAAO,CAAC,EAAG,GAAK,CAAC,EAAG,GAAK,IAAI,GAAK,CAAC,GAAI,kBAAmB,IAAK,IAAK,EAAG,GAAK,IAAI,GAAK,CAAC,EAAG,GAAK,IAAI,GAAK,CAAC,GAAI,SAAW,GAAK,EAAG,MAAO,CAAC,EAAG,GAAK,CAAC,EAAG,GAAK,IAAI,GAAK,CAAC,GAAI,OAAQ,GAAK,EAAG,MAAO,CAAC,EAAG,GAAK,IAAK,GAAK,EAAG,MAAO,CAAC,EAAG,GAAK,IAAK,GAAK,EAAG,MAAO,CAAC,GAAI,GAAI,EAAG,GAAK,IAAK,GAAK,EAAG,MAAO,CAAC,GAAI,EAAG,GAAK,IAAK,GAAK,EAAG,MAAO,CAAC,GAAI,EAAG,GAAK,IAAK,GAAK,EAAG,MAAO,CAAC,EAAG,GAAK,IAAK,GAAK,EAAG,MAAO,CAAC,EAAG,GAAK,IAAK,GAAK,EAAG,MAAO,CAAC,EAAG,GAAK,IAAK,GAAK,EAAG,MAAO,CAAC,EAAG,GAAK,CAAC,EAAG,GAAK,IAAI,GAAK,CAAC,GAAI,MAAO,MAAO,mCAAoC,GAAK,IAAK,EAAG,GAAK,IAAK,GAAK,EAAG,MAAO,CAAC,EAAG,GAAK,IAAK,GAAK,EAAG,MAAO,CAAC,EAAG,GAAK,GAAI,SAAU,EAAG,IAAK,IAAI,IAAK,IAAK,IAAK,KAAO,GAAK,GAAK,EAAG,GAAK,GAAI,SAAU,EAAG,IAAK,wHAAyH,IAAK,IAAK,IAAK,KAAO,GAAK,GAAK,CAAE,SAAU,EAAG,IAAK,mHAAoH,IAAK,IAAK,IAAK,KAAO,GAAK,KAAQ,KAAO,KAAO,KAAO,SAAa,KAAO,CAAE,MAAO,+CAAgD,GAAK,MAAQ,KAAO,CAAE,MAAO,gGAAiG,GAAK,MAAQ,EAAG,GAAK,IAAK,GAAK,EAAG,MAAO,CAAC,EAAG,GAAK,IAAK,GAAK,EAAG,MAAO,CAAC,EAAG,GAAK,IAAK,GAAK,EAAG,MAAO,CAAC,EAAG,GAAK,IAAK,GAAK,EAAG,MAAO,CAAC,EAAG,GAAK,IAAK,GAAK,EAAG,MAAO,CAAC,GAAI,EAAG,GAAK,IAAK,GAAK,EAAG,MAAO,CAAC,GAAI,EAAG,GAAK,IAAK,GAAK,EAAG,MAAO,CAAC,EAAG,GAAK,IAAK,GAAK,EAAG,MAAO,CAAC,EAAG,GAAK,CAAC,EAAG,GAAK,IAAI,GAAK,CAAC,GAAI,6BAA+B,GAAK,EAAG,MAAO,CAAC,EAAG,GAAK,IAAK,GAAK,EAAG,MAAO,CAAC,EAAG,GAAK,CAAC,EAAG,GAAK,IAAI,GAAK,CAAC,GAAI,OAAQ,GAAK,EAAG,MAAO,CAAC,EAAG,GAAK,IAAK,GAAK,EAAG,MAAO,CAAC,EAAG,GAAK,IAAK,GAAK,EAAG,MAAO,CAAC,EAAG,GAAK,GAAI,MAAO,8CAA+C,GAAK,IAAK,EAAG,GAAK,CAAC,GAAG,IAAI,SAAU,EAAG,IAAK,gIAAiI,IAAK,IAAK,IAAK,KAAO,GAAK,GAAK,EAAG,GAAK,CAAC,GAAG,IAAK,SAAU,EAAG,IAAK,sHAAuH,IAAK,IAAK,IAAK,KAAO,GAAK,GAAK,EAAG,GAAK,CAAC,GAAI,IAAI,SAAU,EAAG,IAAK,2HAA4H,IAAK,IAAK,IAAK,KAAO,GAAK,GAAK,EAAG,GAAK,CAAC,GAAI,GAAI,GAAG,IAAK,SAAU,EAAG,IAAK,IAAI,IAAK,IAAK,IAAK,KAAO,GAAK,GAAK,EAAG,GAAK,CAAC,GAAI,IAAK,SAAU,EAAG,IAAK,iHAAkH,IAAK,IAAK,IAAK,KAAO,GAAK,KAAQ,KAAO,KAAO,CAAE,MAAO,+EAAgF,GAAK,MAAQ,KAAO,SAAa,SAAa,EAAG,GAAK,CAAC,EAAG,GAAK,IAAI,GAAK,CAAC,GAAI,OAAQ,GAAK,EAAG,MAAO,CAAC,EAAG,GAAK,GAAI,MAAO,uCAAwC,GAAK,IAAK,EAAG,GAAK,GAAI,MAAO,iCAAkC,GAAK,IAAK,EAAG,GAAK,GAAI,MAAO,0CAA2C,GAAK,IAAK,EAAG,GAAK,CAAC,EAAG,GAAK,IAAI,GAAK,CAAC,EAAG,IAAK,kCAAoC,MAAO,MAAO,uEAAwE,GAAK,IAAK,EAAG,GAAK,CAAC,EAAG,GAAK,IAAI,GAAK,IAAK,IAAK,MAAO,GAAK,EAAG,MAAO,CAAC,EAAG,GAAK,CAAC,EAAG,GAAK,IAAI,GAAK,CAAC,EAAG,GAAK,IAAI,GAAK,CAAC,EAAG,IAAK,IAAK,KAAM,EAAG,GAAK,IAAI,GAAK,CAAC,GAAI,kBAAqB,GAAK,EAAG,MAAO,CAAC,CAAE,SAAU,EAAG,IAAK,6EAA8E,IAAK,EAAG,IAAK,CAAC,EAAG,IAAK,GAAG,KAAM,UAAW,IAAK,GAAG,iBAAkB,CAAC,SAAY,IAAK,KAAO,GAAK,KAAQ,CAAE,MAAO,uHAAwH,GAAK,QAAW,CAAE,MAAO,6BAA8B,GAAK,MAAQ,KAAO,EAAG,GAAK,CAAC,EAAG,GAAK,IAAI,GAAK,CAAC,GAAI,OAAQ,GAAK,EAAG,MAAO,CAAC,EAAG,GAAK,GAAI,MAAO,2CAA4C,GAAK,IAAK,EAAG,GAAK,GAAI,MAAO,qCAAsC,GAAK,IAAK,EAAG,GAAK,GAAI,MAAO,8CAA+C,GAAK,IAAK,EAAG,GAAK,CAAC,EAAG,GAAK,IAAI,GAAK,CAAC,EAAG,GAAK,IAAI,GAAK,CAAC,GAAI,qBAAwB,MAAO,gEAAiE,GAAK,IAAK,EAAG,GAAK,CAAC,EAAG,GAAK,IAAI,GAAK,IAAK,IAAK,MAAO,GAAK,EAAG,MAAO,CAAC,EAAG,GAAK,IAAK,GAAK,EAAG,MAAO,CAAC,GAAI,EAAG,GAAK,IAAK,GAAK,EAAG,MAAO,CAAC,EAAG,GAAK,IAAK,GAAK,EAAG,MAAO,CAAC,EAAG,GAAK,IAAK,GAAK,EAAG,MAAO,CAAC,EAAG,GAAK,IAAK,GAAK,EAAG,MAAO,CAAC,EAAG,GAAK,IAAK,GAAK,EAAG,MAAO,CAAC,EAAG,GAAK,CAAC,EAAG,GAAK,IAAI,GAAK,IAAK,IAAK,MAAO,GAAK,EAAG,MAAO,CAAC,EAAG,GAAK,CAAC,EAAG,GAAK,IAAI,GAAK,CAAC,GAAI,kBAAmB,IAAK,MAAO,GAAK,EAAG,MAAO,CAAC,EAAG,GAAK,CAAC,EAAG,GAAK,IAAI,GAAK,CAAC,EAAG,IAAK,IAAK,OAAQ,GAAK,EAAG,MAAO,CAAC,EAAG,GAAK,GAAI,SAAU,EAAG,IAAK,+EAAgF,IAAK,IAAK,IAAK,KAAO,GAAK,GAAK,CAAE,SAAU,EAAG,IAAK,0HAA2H,IAAK,IAAK,IAAK,KAAO,GAAK,KAAQ,CAAE,MAAO,+DAAgE,GAAK,MAAQ,CAAE,MAAO,8CAA+C,GAAK,MAAQ,CAAE,MAAO,gDAAiD,GAAK,MAAQ,KAAO,KAAO,SAAa,CAAE,MAAO,4FAA6F,GAAK,MAAQ,CAAE,MAAO,2CAA4C,GAAK,MAAQ,CAAE,MAAO,gEAAiE,GAAK,MAAQ,CAAE,MAAO,sCAAuC,GAAK,MAAQ,EAAG,GAAK,CAAC,EAAG,GAAK,IAAI,GAAK,CAAC,GAAG,EAAG,EAAG,KAAK,IAAK,IAAK,EAAG,GAAK,IAAI,GAAK,CAAC,EAAG,IAAK,IAAK,SAAW,EAAG,GAAK,IAAI,GAAK,CAAC,EAAG,GAAK,IAAI,GAAK,CAAC,QAAW,MAAO,+CAAgD,GAAK,IAAK,EAAG,GAAK,CAAC,EAAG,GAAK,IAAI,GAAK,CAAC,GAAI,KAAM,IAAK,MAAO,yDAA0D,GAAK,IAAK,EAAG,GAAK,CAAC,EAAG,GAAK,aAAc,GAAK,IAAK,IAAK,wBAA0B,GAAK,EAAG,MAAO,CAAC,EAAG,GAAK,IAAK,GAAK,EAAG,MAAO,CAAC,EAAG,GAAK,CAAC,KAAM,GAAK,EAAG,MAAO,CAAC,EAAG,GAAK,CAAC,GAAG,GAAI,GAAG,IAAK,SAAU,EAAG,IAAK,wFAAyF,IAAK,IAAK,IAAK,KAAO,GAAK,GAAK,EAAG,GAAK,CAAC,GAAG,GAAI,GAAG,GAAI,KAAM,GAAK,EAAG,MAAO,CAAC,CAAE,SAAU,IAAK,GAAK,KAAQ,EAAG,GAAK,CAAC,GAAG,GAAI,GAAG,GAAI,IAAK,SAAU,IAAK,GAAK,GAAK,EAAG,GAAK,CAAC,GAAI,GAAI,GAAG,IAAK,SAAU,EAAG,IAAK,8EAA+E,IAAK,IAAK,IAAK,KAAO,GAAK,GAAK,EAAG,GAAK,CAAC,GAAI,GAAI,GAAG,GAAI,KAAM,GAAK,EAAG,MAAO,CAAC,CAAE,SAAU,IAAK,GAAK,KAAQ,EAAG,GAAK,CAAC,GAAI,GAAI,GAAG,GAAI,IAAK,SAAU,IAAK,GAAK,GAAK,EAAG,GAAK,CAAC,GAAG,GAAI,GAAI,IAAK,SAAU,EAAG,IAAK,mFAAoF,IAAK,IAAK,IAAK,KAAO,GAAK,GAAK,EAAG,GAAK,CAAC,GAAG,GAAI,GAAI,GAAI,KAAM,GAAK,EAAG,MAAO,CAAC,CAAE,SAAU,IAAK,GAAK,KAAQ,EAAG,GAAK,CAAC,GAAG,GAAI,GAAI,GAAI,IAAK,SAAU,IAAK,GAAK,GAAK,EAAG,GAAK,CAAC,GAAI,GAAG,GAAI,GAAI,IAAK,SAAU,EAAG,IAAK,IAAI,IAAK,IAAK,IAAK,KAAO,GAAK,GAAK,EAAG,GAAK,CAAC,GAAI,GAAG,GAAI,GAAI,GAAI,KAAM,GAAK,EAAG,MAAO,CAAC,EAAG,GAAK,GAAI,SAAU,IAAK,GAAK,GAAK,CAAE,SAAU,IAAK,GAAK,KAAQ,EAAG,GAAK,CAAC,GAAI,GAAG,GAAI,GAAI,GAAI,IAAK,SAAU,IAAK,GAAK,GAAK,EAAG,GAAK,CAAC,GAAI,GAAI,GAAI,IAAK,SAAU,EAAG,IAAK,IAAI,IAAK,IAAK,IAAK,KAAO,GAAK,GAAK,EAAG,GAAK,CAAC,GAAI,GAAI,GAAI,GAAI,KAAM,GAAK,EAAG,MAAO,CAAC,EAAG,GAAK,GAAI,SAAU,EAAG,IAAK,IAAI,IAAK,IAAK,IAAK,KAAO,GAAK,GAAK,CAAE,SAAU,IAAK,GAAK,KAAQ,EAAG,GAAK,CAAC,GAAI,GAAI,GAAI,GAAI,IAAK,SAAU,IAAK,GAAK,KAAQ,CAAE,MAAO,2DAA4D,GAAK,UAAc,EAAG,GAAK,CAAC,EAAG,GAAK,IAAI,GAAK,CAAC,KAAO,EAAG,GAAK,IAAI,GAAK,CAAC,GAAI,OAAQ,GAAK,EAAG,MAAO,CAAC,EAAG,GAAK,IAAK,GAAK,EAAG,MAAO,CAAC,EAAG,GAAK,IAAK,GAAK,EAAG,MAAO,CAAC,GAAI,GAAI,EAAG,GAAK,GAAI,SAAU,EAAG,IAAK,IAAI,IAAK,IAAK,IAAK,KAAO,GAAK,GAAK,EAAG,GAAK,GAAI,SAAU,EAAG,IAAK,sEAAuE,IAAK,IAAK,IAAK,KAAO,GAAK,GAAK,CAAE,SAAU,EAAG,IAAK,iEAAkE,IAAK,IAAK,IAAK,KAAO,GAAK,KAAQ,OAAU,EAAG,GAAK,CAAC,EAAG,GAAK,IAAI,GAAK,MAAQ,GAAK,EAAG,MAAO,CAAC,EAAG,GAAK,IAAK,GAAK,EAAG,MAAO,CAAC,EAAG,GAAK,IAAK,GAAK,EAAG,MAAO,CAAC,EAAG,GAAK,CAAC,GAAG,GAAG,GAAI,IAAK,SAAU,EAAG,IAAK,mEAAoE,IAAK,IAAK,IAAK,KAAO,GAAK,GAAK,EAAG,GAAK,CAAC,GAAG,GAAG,GAAI,GAAI,KAAM,GAAK,EAAG,MAAO,CAAC,CAAE,SAAU,IAAK,GAAK,KAAQ,EAAG,GAAK,CAAC,GAAG,GAAG,GAAI,GAAI,IAAK,SAAU,IAAK,GAAK,GAAK,EAAG,GAAK,CAAC,GAAG,GAAI,GAAI,IAAK,SAAU,EAAG,IAAK,yDAA0D,IAAK,IAAK,IAAK,KAAO,GAAK,GAAK,EAAG,GAAK,CAAC,GAAG,GAAI,GAAI,GAAI,KAAM,GAAK,EAAG,MAAO,CAAC,CAAE,SAAU,IAAK,GAAK,KAAQ,EAAG,GAAK,CAAC,GAAG,GAAI,GAAI,GAAI,IAAK,SAAU,IAAK,GAAK,GAAK,EAAG,GAAK,CAAC,GAAI,GAAG,GAAI,IAAK,SAAU,EAAG,IAAK,8DAA+D,IAAK,IAAK,IAAK,KAAO,GAAK,GAAK,EAAG,GAAK,CAAC,GAAI,GAAG,GAAI,GAAI,KAAM,GAAK,EAAG,MAAO,CAAC,CAAE,SAAU,IAAK,GAAK,KAAQ,EAAG,GAAK,CAAC,GAAI,GAAG,GAAI,GAAI,IAAK,SAAU,IAAK,GAAK,GAAK,EAAG,GAAK,CAAC,GAAI,GAAI,GAAG,GAAI,IAAK,SAAU,EAAG,IAAK,IAAI,IAAK,IAAK,IAAK,KAAO,GAAK,GAAK,EAAG,GAAK,CAAC,GAAI,GAAI,GAAG,GAAI,GAAI,KAAM,GAAK,EAAG,MAAO,CAAC,EAAG,GAAK,GAAI,SAAU,IAAK,GAAK,GAAK,CAAE,SAAU,IAAK,GAAK,KAAQ,EAAG,GAAK,CAAC,GAAI,GAAI,GAAG,GAAI,GAAI,IAAK,SAAU,IAAK,GAAK,GAAK,EAAG,GAAK,CAAC,GAAI,GAAI,GAAI,IAAK,SAAU,EAAG,IAAK,IAAI,IAAK,IAAK,IAAK,KAAO,GAAK,GAAK,EAAG,GAAK,CAAC,GAAI,GAAI,GAAI,GAAI,KAAM,GAAK,EAAG,MAAO,CAAC,EAAG,GAAK,GAAI,SAAU,EAAG,IAAK,IAAI,IAAK,IAAK,IAAK,KAAO,GAAK,GAAK,CAAE,SAAU,IAAK,GAAK,KAAQ,EAAG,GAAK,CAAC,GAAI,GAAI,GAAI,GAAI,IAAK,SAAU,IAAK,GAAK,KAAQ,SAAa,CAAE,MAAO,qDAAsD,GAAK,MAChic,GAAU,GAEV,GAA0B,CAAC,EAAgB,EAAU,KAChD,GAAgB,GAAS,CAC5B,eAAgB,EAChB,OAAQ,EAAQ,SAIlB,GAAmB,AAAC,GAAY,EAClC,WAAY,aACZ,cAAe,GAAQ,eAAiB,GACxC,cAAe,GAAQ,eAAiB,GACxC,kBAAmB,GAAQ,mBAAqB,GAChD,iBAAkB,GAAQ,kBAAoB,GAC9C,4BAA6B,GAAQ,6BAA+B,GACpE,OAAQ,GAAQ,QAAU,GAAI,IAC9B,eAAgB,GAAQ,gBAAkB,GAC1C,UAAW,GAAQ,WAAa,KAChC,kBAAmB,GAAQ,mBAAqB,GAChD,kBAAmB,GAAQ,mBAAqB,GAChD,UAAW,GAAQ,WAAa,GAChC,aAAc,GAAQ,cAAgB,GACtC,YAAa,GAAQ,aAAe,GACpC,YAAa,GAAQ,aAAe,KAGlC,GAAqB,AAAC,GAAW,CACnC,GAAM,GAAe,GAA0B,GACzC,EAAwB,IAAM,IAAe,KAAK,IAClD,EAAqB,GAAiB,GAC5C,MAAO,IACA,KACA,EACH,QAAS,UACT,eACA,kBAAmB,GAAQ,mBAAqB,GAChD,0BAA2B,GAAQ,2BAA8B,CAAC,GAAM,IAAM,QAAQ,OAAO,GAAI,OAAM,2BACvG,yBAA0B,GAAQ,0BAC9B,GAAiB,CAAE,UAAW,EAAmB,UAAW,cAAe,GAAY,UAC3F,yBAA0B,GAAQ,0BAA4B,GAC9D,YAAa,GAAQ,aAAe,GACpC,IAAK,GAAQ,KAAO,GACpB,OAAQ,GAAQ,QAAU,GAAgB,qBAC1C,eAAgB,GAAQ,gBAAkB,GAAI,IAAiB,GAC/D,UAAW,GAAQ,WAAc,UAAa,MAAM,MAAyB,WAAa,IAC1F,KAAM,GAAQ,MAAQ,GAAM,KAC5B,OAAQ,GAAQ,QAAU,GAAQ,OAClC,gBAAiB,GAAQ,iBAAmB,GAC5C,aAAc,GAAQ,cAAgB,GACtC,qBAAsB,GAAQ,sBAAyB,KAAM,QAAQ,QAAQ,KAC7E,gBAAiB,GAAQ,iBAAoB,KAAM,QAAQ,QAAQ,OAI3E,gBAAuB,GAAO,CAC1B,YAAY,EAAe,CACvB,GAAM,GAAY,GAAmB,GAC/B,EAAY,GAAgC,GAC5C,EAAY,GAAoB,GAChC,EAAY,GAAsB,GAClC,EAAY,GAAmB,GAC/B,EAAY,GAAwB,GACpC,EAAY,GAAqB,GACjC,EAAY,GAAgB,GAC5B,EAAY,GAAuB,GACnC,EAAY,GAA8B,GAChD,MAAM,GACN,KAAK,OAAS,EACd,KAAK,gBAAgB,IAAI,GAAe,KAAK,SAC7C,KAAK,gBAAgB,IAAI,GAAuB,KAAK,SACrD,KAAK,gBAAgB,IAAI,GAAoB,KAAK,SAClD,KAAK,gBAAgB,IAAI,GAAgB,KAAK,SAC9C,KAAK,gBAAgB,IAAI,GAA4B,KAAK,SAC1D,KAAK,gBAAgB,IAAI,GAAiB,KAAK,SAC/C,KAAK,gBAAgB,IAAI,GAA4B,KAAK,SAC1D,KAAK,gBAAgB,IAAI,GAA2B,KAAK,SACzD,KAAK,gBAAgB,IAAI,GAAmB,KAAK,SAErD,SAAU,CACN,MAAM,YAIV,GAAO,GAAqB,SAAU,EAAQ,EAAS,CAE3D,GAAM,GAAgB,gLAChB,EAAW,EAAgB,+CAC3B,EAAa,IAAM,EAAgB,KAAO,EAAW,KACrD,EAAY,GAAI,QAAO,IAAM,EAAa,KAE1C,EAAgB,SAAS,EAAQ,EAAO,CAC5C,GAAM,GAAU,GACZ,EAAQ,EAAM,KAAK,GACvB,KAAO,GAAO,CACZ,GAAM,GAAa,GACnB,EAAW,WAAa,EAAM,UAAY,EAAM,GAAG,OACnD,GAAM,GAAM,EAAM,OAClB,OAAS,GAAQ,EAAG,EAAQ,EAAK,IAC/B,EAAW,KAAK,EAAM,IAExB,EAAQ,KAAK,GACb,EAAQ,EAAM,KAAK,GAErB,MAAO,IAGH,EAAS,SAAS,EAAQ,CAC9B,GAAM,GAAQ,EAAU,KAAK,GAC7B,MAAO,CAAE,KAAU,MAAQ,MAAO,IAAU,cAG9C,EAAQ,QAAU,SAAS,EAAG,CAC5B,MAAO,OAAO,IAAM,aAGtB,EAAQ,cAAgB,SAAS,EAAK,CACpC,MAAO,QAAO,KAAK,GAAK,SAAW,GAQrC,EAAQ,MAAQ,SAAS,EAAQ,EAAG,EAAW,CAC7C,GAAI,EAAG,CACL,GAAM,GAAO,OAAO,KAAK,GACnB,EAAM,EAAK,OACjB,OAAS,GAAI,EAAG,EAAI,EAAK,IACvB,AAAI,IAAc,SAChB,EAAO,EAAK,IAAM,CAAE,EAAE,EAAK,KAE3B,EAAO,EAAK,IAAM,EAAE,EAAK,MASjC,EAAQ,SAAW,SAAS,EAAG,CAC7B,MAAI,GAAQ,QAAQ,GACX,EAEA,IAOX,EAAQ,OAAS,EACjB,EAAQ,cAAgB,EACxB,EAAQ,WAAa,IAGf,GAAiB,CACrB,uBAAwB,GACxB,aAAc,IAIZ,GAAa,SAAU,EAAS,EAAS,CAC3C,EAAU,OAAO,OAAO,GAAI,GAAgB,GAK5C,GAAM,GAAO,GACT,EAAW,GAGX,EAAc,GAElB,AAAI,EAAQ,KAAO,UAEjB,GAAU,EAAQ,OAAO,IAG3B,OAAS,GAAI,EAAG,EAAI,EAAQ,OAAQ,IAElC,GAAI,EAAQ,KAAO,KAAO,EAAQ,EAAE,KAAO,KAGzC,GAFA,GAAG,EACH,EAAI,GAAO,EAAQ,GACf,EAAE,IAAK,MAAO,WACV,EAAQ,KAAO,IAAK,CAG5B,GAAI,GAAc,EAGlB,GAFA,IAEI,EAAQ,KAAO,IAAK,CACtB,EAAI,GAAoB,EAAS,GACjC,aACK,CACL,GAAI,GAAa,GACjB,AAAI,EAAQ,KAAO,KAEjB,GAAa,GACb,KAGF,GAAI,GAAU,GACd,KAAO,EAAI,EAAQ,QACjB,EAAQ,KAAO,KACf,EAAQ,KAAO,KACf,EAAQ,KAAO,KACf,EAAQ,KAAO;AAAA,GACf,EAAQ,KAAO,KAAM,IAErB,GAAW,EAAQ,GAWrB,GATA,EAAU,EAAQ,OAGd,EAAQ,EAAQ,OAAS,KAAO,KAElC,GAAU,EAAQ,UAAU,EAAG,EAAQ,OAAS,GAEhD,KAEE,CAAC,GAAgB,GAAU,CAC7B,GAAI,GACJ,MAAI,GAAQ,OAAO,SAAW,EAC5B,EAAM,2BAEN,EAAM,QAAQ,EAAQ,wBAEjB,GAAe,aAAc,EAAK,GAAyB,EAAS,IAG7E,GAAM,GAAS,GAAiB,EAAS,GACzC,GAAI,IAAW,GACb,MAAO,IAAe,cAAe,mBAAmB,EAAQ,qBAAsB,GAAyB,EAAS,IAE1H,GAAI,GAAU,EAAO,MAGrB,GAFA,EAAI,EAAO,MAEP,EAAQ,EAAQ,OAAS,KAAO,IAAK,CAEvC,GAAM,GAAe,EAAI,EAAQ,OACjC,EAAU,EAAQ,UAAU,EAAG,EAAQ,OAAS,GAChD,GAAM,GAAU,GAAwB,EAAS,GACjD,GAAI,IAAY,GACd,EAAW,OAMX,OAAO,IAAe,EAAQ,IAAI,KAAM,EAAQ,IAAI,IAAK,GAAyB,EAAS,EAAe,EAAQ,IAAI,eAE/G,EACT,GAAK,EAAO,UAEL,IAAI,EAAQ,OAAO,OAAS,EACjC,MAAO,IAAe,aAAc,gBAAgB,EAAQ,+CAAgD,GAAyB,EAAS,IACzI,CACL,GAAM,GAAM,EAAK,MACjB,GAAI,IAAY,EAAI,QAAS,CAC3B,GAAI,GAAU,GAAyB,EAAS,EAAI,aACpD,MAAO,IAAe,aACpB,yBAAyB,EAAI,QAAQ,qBAAqB,EAAQ,KAAK,SAAS,EAAQ,IAAI,6BAA6B,EAAQ,KACjI,GAAyB,EAAS,IAItC,AAAI,EAAK,QAAU,GACjB,GAAc,SAdhB,OAAO,IAAe,aAAc,gBAAgB,EAAQ,iCAAkC,GAAyB,EAAS,QAiB7H,CACL,GAAM,GAAU,GAAwB,EAAS,GACjD,GAAI,IAAY,GAId,MAAO,IAAe,EAAQ,IAAI,KAAM,EAAQ,IAAI,IAAK,GAAyB,EAAS,EAAI,EAAQ,OAAS,EAAQ,IAAI,OAI9H,GAAI,IAAgB,GAClB,MAAO,IAAe,aAAc,sCAAuC,GAAyB,EAAS,IACxG,AAAG,EAAQ,aAAa,QAAQ,KAAa,IAClD,EAAK,KAAK,CAAC,UAAS,gBAEtB,EAAW,GAKb,IAAK,IAAK,EAAI,EAAQ,OAAQ,IAC5B,GAAI,EAAQ,KAAO,IACjB,GAAI,EAAQ,EAAI,KAAO,IAAK,CAE1B,IACA,EAAI,GAAoB,EAAS,GACjC,iBACS,EAAQ,EAAE,KAAO,KAE1B,GADA,EAAI,GAAO,EAAS,EAAE,GAClB,EAAE,IAAK,MAAO,OAElB,eAEO,EAAQ,KAAO,IAAK,CAC7B,GAAM,GAAW,GAAkB,EAAS,GAC5C,GAAI,GAAY,GACd,MAAO,IAAe,cAAe,4BAA6B,GAAyB,EAAS,IACtG,EAAI,UAEA,IAAgB,IAAQ,CAAC,GAAa,EAAQ,IAChD,MAAO,IAAe,aAAc,wBAAyB,GAAyB,EAAS,IAIrG,AAAI,EAAQ,KAAO,KACjB,SAGC,CACL,GAAK,GAAa,EAAQ,IACxB,SAEF,MAAO,IAAe,cAAe,SAAS,EAAQ,GAAG,qBAAsB,GAAyB,EAAS,IAIrH,GAAK,EAEC,IAAI,EAAK,QAAU,EACrB,MAAO,IAAe,aAAc,iBAAiB,EAAK,GAAG,QAAQ,KAAM,GAAyB,EAAS,EAAK,GAAG,cACnH,GAAI,EAAK,OAAS,EACpB,MAAO,IAAe,aAAc,YAChC,KAAK,UAAU,EAAK,IAAI,GAAK,EAAE,SAAU,KAAM,GAAG,QAAQ,SAAU,IACpE,WAAY,CAAC,KAAM,EAAG,IAAK,QANjC,OAAO,IAAe,aAAc,sBAAuB,GAS7D,MAAO,IAGT,YAAsB,EAAK,CACzB,MAAO,KAAS,KAAO,IAAS,KAAQ,IAAS;AAAA,GAAS,IAAS,KAOrE,YAAgB,EAAS,EAAG,CAC1B,GAAM,GAAQ,EACd,KAAO,EAAI,EAAQ,OAAQ,IACzB,GAAI,EAAQ,IAAM,KAAO,EAAQ,IAAM,IAAK,CAE1C,GAAM,GAAU,EAAQ,OAAO,EAAO,EAAI,GAC1C,GAAI,EAAI,GAAK,IAAY,MACvB,MAAO,IAAe,aAAc,6DAA8D,GAAyB,EAAS,IAC/H,GAAI,EAAQ,IAAM,KAAO,EAAQ,EAAI,IAAM,IAAK,CAErD,IACA,UAEA,UAIN,MAAO,GAGT,YAA6B,EAAS,EAAG,CACvC,GAAI,EAAQ,OAAS,EAAI,GAAK,EAAQ,EAAI,KAAO,KAAO,EAAQ,EAAI,KAAO,KAEzE,IAAK,GAAK,EAAG,EAAI,EAAQ,OAAQ,IAC/B,GAAI,EAAQ,KAAO,KAAO,EAAQ,EAAI,KAAO,KAAO,EAAQ,EAAI,KAAO,IAAK,CAC1E,GAAK,EACL,eAIJ,EAAQ,OAAS,EAAI,GACrB,EAAQ,EAAI,KAAO,KACnB,EAAQ,EAAI,KAAO,KACnB,EAAQ,EAAI,KAAO,KACnB,EAAQ,EAAI,KAAO,KACnB,EAAQ,EAAI,KAAO,KACnB,EAAQ,EAAI,KAAO,KACnB,EAAQ,EAAI,KAAO,IACnB,CACA,GAAI,GAAqB,EACzB,IAAK,GAAK,EAAG,EAAI,EAAQ,OAAQ,IAC/B,GAAI,EAAQ,KAAO,IACjB,YACS,EAAQ,KAAO,KACxB,KACI,IAAuB,GACzB,cAKN,EAAQ,OAAS,EAAI,GACrB,EAAQ,EAAI,KAAO,KACnB,EAAQ,EAAI,KAAO,KACnB,EAAQ,EAAI,KAAO,KACnB,EAAQ,EAAI,KAAO,KACnB,EAAQ,EAAI,KAAO,KACnB,EAAQ,EAAI,KAAO,KACnB,EAAQ,EAAI,KAAO,KAEnB,IAAK,GAAK,EAAG,EAAI,EAAQ,OAAQ,IAC/B,GAAI,EAAQ,KAAO,KAAO,EAAQ,EAAI,KAAO,KAAO,EAAQ,EAAI,KAAO,IAAK,CAC1E,GAAK,EACL,OAKN,MAAO,GAGT,GAAM,IAAc,IACd,GAAc,IAOpB,YAA0B,EAAS,EAAG,CACpC,GAAI,GAAU,GACV,EAAY,GACZ,EAAY,GAChB,KAAO,EAAI,EAAQ,OAAQ,IAAK,CAC9B,GAAI,EAAQ,KAAO,IAAe,EAAQ,KAAO,GAC/C,AAAI,IAAc,GAChB,EAAY,EAAQ,GACX,IAAc,EAAQ,IAC/B,GAAY,YAEL,EAAQ,KAAO,KACpB,IAAc,GAAI,CACpB,EAAY,GACZ,MAGJ,GAAW,EAAQ,GAErB,MAAI,KAAc,GACT,GAGF,CACL,MAAO,EACP,MAAO,EACP,UAAW,GAOf,GAAM,IAAoB,GAAI,QAAO,yDAA2D,KAIhG,YAAiC,EAAS,EAAS,CAKjD,GAAM,GAAU,GAAK,cAAc,EAAS,IACtC,EAAY,GAElB,OAAS,GAAI,EAAG,EAAI,EAAQ,OAAQ,IAAK,CACvC,GAAI,EAAQ,GAAG,GAAG,SAAW,EAE3B,MAAO,IAAe,cAAe,cAAc,EAAQ,GAAG,GAAG,8BAA+B,GAAqB,EAAQ,KACxH,GAAI,EAAQ,GAAG,KAAO,QAAa,EAAQ,GAAG,KAAO,OAC1D,MAAO,IAAe,cAAe,cAAc,EAAQ,GAAG,GAAG,sBAAuB,GAAqB,EAAQ,KAChH,GAAI,EAAQ,GAAG,KAAO,QAAa,CAAC,EAAQ,uBAEjD,MAAO,IAAe,cAAe,sBAAsB,EAAQ,GAAG,GAAG,oBAAqB,GAAqB,EAAQ,KAK7H,GAAM,GAAW,EAAQ,GAAG,GAC5B,GAAI,CAAC,GAAiB,GACpB,MAAO,IAAe,cAAe,cAAc,EAAS,wBAAyB,GAAqB,EAAQ,KAEpH,GAAI,CAAC,EAAU,eAAe,GAE5B,EAAU,GAAY,MAEtB,OAAO,IAAe,cAAe,cAAc,EAAS,iBAAkB,GAAqB,EAAQ,KAI/G,MAAO,GAGT,YAAiC,EAAS,EAAG,CAC3C,GAAI,GAAK,KAKT,IAJI,EAAQ,KAAO,KACjB,KACA,EAAK,cAEA,EAAI,EAAQ,OAAQ,IAAK,CAC9B,GAAI,EAAQ,KAAO,IACjB,MAAO,GACT,GAAI,CAAC,EAAQ,GAAG,MAAM,GACpB,MAEJ,MAAO,GAGT,YAA2B,EAAS,EAAG,CAGrC,GADA,IACI,EAAQ,KAAO,IACjB,MAAO,GACT,GAAI,EAAQ,KAAO,IACjB,WACO,GAAwB,EAAS,GAE1C,GAAI,GAAQ,EACZ,KAAO,EAAI,EAAQ,OAAQ,IAAK,IAC9B,GAAI,IAAQ,GAAG,MAAM,OAAS,EAAQ,IAEtC,IAAI,EAAQ,KAAO,IACjB,MACF,MAAO,GAET,MAAO,GAGT,YAAwB,EAAM,EAAS,EAAY,CACjD,MAAO,CACL,IAAK,CACH,KAAM,EACN,IAAK,EACL,KAAM,EAAW,MAAQ,EACzB,IAAK,EAAW,MAKtB,YAA0B,EAAU,CAClC,MAAO,IAAK,OAAO,GAKrB,YAAyB,EAAS,CAChC,MAAO,IAAK,OAAO,GAIrB,YAAkC,EAAS,EAAO,CAChD,GAAM,GAAQ,EAAQ,UAAU,EAAG,GAAO,MAAM,SAChD,MAAO,CACL,KAAM,EAAM,OAGZ,IAAK,EAAM,EAAM,OAAS,GAAG,OAAS,GAK1C,YAA8B,EAAO,CACnC,MAAO,GAAM,WAAa,EAAM,GAAG,OAGrC,GAAI,IAAY,CACf,SAAU,IAGL,GAAmB,CACrB,cAAe,GACf,oBAAqB,KACrB,oBAAqB,GACrB,aAAc,QACd,iBAAkB,GAClB,eAAgB,GAChB,uBAAwB,GAExB,cAAe,GACf,oBAAqB,GACrB,WAAY,GACZ,cAAe,GACf,mBAAoB,CAClB,IAAK,GACL,aAAc,GACd,UAAW,IAEb,kBAAmB,SAAS,EAAS,EAAK,CACxC,MAAO,IAET,wBAAyB,SAAS,EAAU,EAAK,CAC/C,MAAO,IAET,UAAW,GACX,qBAAsB,GACtB,QAAS,IAAM,GACf,gBAAiB,GACjB,aAAc,GACd,gBAAiB,GACjB,aAAc,GACd,kBAAmB,GACnB,aAAc,GACd,iBAAkB,GAClB,uBAAwB,GACxB,UAAW,SAAS,EAAS,EAAO,EAAM,CACxC,MAAO,KAKP,GAAe,SAAS,EAAS,CACnC,MAAO,QAAO,OAAO,GAAI,GAAkB,IAG3C,GAAiB,GACjB,GAAmB,GAEnB,GAAiB,CACpB,aAAc,GACd,eAAgB,IAGjB,QAAa,CACX,YAAY,EAAS,CACnB,KAAK,QAAU,EACf,KAAK,MAAQ,GACb,KAAK,MAAQ,GAEf,IAAI,EAAI,EAAI,CAEV,AAAG,IAAQ,aAAa,GAAM,cAC9B,KAAK,MAAM,KAAM,EAAE,GAAM,IAE3B,SAAS,EAAM,CACb,AAAG,EAAK,UAAY,aAAa,GAAK,QAAU,cAChD,AAAG,EAAK,OAAS,OAAO,KAAK,EAAK,OAAO,OAAS,EAChD,KAAK,MAAM,KAAM,EAAG,EAAK,SAAU,EAAK,OAAQ,MAAO,EAAK,QAE5D,KAAK,MAAM,KAAM,EAAG,EAAK,SAAU,EAAK,UAK1C,GAAU,GAGd,YAAqB,EAAS,EAAE,CAE5B,GAAM,GAAW,GACjB,GAAI,EAAQ,EAAI,KAAO,KAClB,EAAQ,EAAI,KAAO,KACnB,EAAQ,EAAI,KAAO,KACnB,EAAQ,EAAI,KAAO,KACnB,EAAQ,EAAI,KAAO,KACnB,EAAQ,EAAI,KAAO,IACxB,CACI,EAAI,EAAE,EACN,GAAI,GAAqB,EACrB,EAAU,GAAO,EAAU,GAC3B,EAAM,GACV,KAAK,EAAE,EAAQ,OAAO,IAClB,GAAI,EAAQ,KAAO,KAAO,CAAC,EAAS,CAChC,GAAI,GAAW,GAAS,EAAS,GAC7B,GAAK,EACL,CAAC,WAAY,IAAI,GAAK,GAAc,EAAQ,EAAE,GAC3C,IAAI,QAAQ,OAAS,IACpB,GAAU,GAAmB,aAAgB,CACzC,KAAO,OAAQ,IAAI,cAAc,KACjC,cAGH,GAAW,GAAU,EAAS,GAAK,GAAK,UACxC,GAAW,GAAU,EAAS,GAAK,GAAK,UACxC,GAAW,GAAW,EAAS,GAAI,GAAK,UACxC,GAAmC,EAAU,OACV,MAAM,IAAI,OAAM,mBAE5D,IACA,EAAM,WACC,EAAQ,KAAO,KAStB,GARA,AAAG,EACK,EAAQ,EAAI,KAAO,KAAO,EAAQ,EAAI,KAAO,KAC7C,GAAU,GACV,KAGJ,IAEA,IAAuB,EACzB,UAEA,AAAI,GAAQ,KAAO,IACrB,EAAU,GAEV,GAAO,EAAQ,GAGvB,GAAG,IAAuB,EACtB,KAAM,IAAI,OAAM,wBAGpB,MAAM,IAAI,OAAM,kCAEpB,MAAO,CAAC,WAAU,KAGtB,YAAuB,EAAQ,EAAE,CAW7B,GAAI,GAAa,GACjB,KAAO,EAAI,EAAQ,QAAW,EAAQ,KAAO,KAAO,EAAQ,KAAO,IAAO,IAGtE,GAAc,EAAQ,GAG1B,GADA,EAAa,EAAW,OACrB,EAAW,QAAQ,OAAS,GAAI,KAAM,IAAI,OAAM,sCAGnD,GAAM,GAAY,EAAQ,KACtB,EAAM,GACV,KAAO,EAAI,EAAQ,QAAU,EAAQ,KAAO,EAAY,IACpD,GAAO,EAAQ,GAEnB,MAAO,CAAC,EAAY,EAAK,GAG7B,YAAmB,EAAS,EAAE,CAC1B,MAAG,GAAQ,EAAE,KAAO,KACpB,EAAQ,EAAE,KAAO,KACjB,EAAQ,EAAE,KAAO,IAGrB,YAAkB,EAAS,EAAE,CACzB,MAAG,GAAQ,EAAE,KAAO,KACpB,EAAQ,EAAE,KAAO,KACjB,EAAQ,EAAE,KAAO,KACjB,EAAQ,EAAE,KAAO,KACjB,EAAQ,EAAE,KAAO,KACjB,EAAQ,EAAE,KAAO,KACjB,EAAQ,EAAE,KAAO,IAGrB,YAAmB,EAAS,EAAE,CAC1B,MAAG,GAAQ,EAAE,KAAO,KACpB,EAAQ,EAAE,KAAO,KACjB,EAAQ,EAAE,KAAO,KACjB,EAAQ,EAAE,KAAO,KACjB,EAAQ,EAAE,KAAO,KACjB,EAAQ,EAAE,KAAO,KACjB,EAAQ,EAAE,KAAO,KACjB,EAAQ,EAAE,KAAO,IAIrB,YAAmB,EAAS,EAAE,CAC1B,MAAG,GAAQ,EAAE,KAAO,KACpB,EAAQ,EAAE,KAAO,KACjB,EAAQ,EAAE,KAAO,KACjB,EAAQ,EAAE,KAAO,KACjB,EAAQ,EAAE,KAAO,KACjB,EAAQ,EAAE,KAAO,KACjB,EAAQ,EAAE,KAAO,KACjB,EAAQ,EAAE,KAAO,IAGrB,YAAoB,EAAS,EAAE,CAC3B,MAAG,GAAQ,EAAE,KAAO,KACpB,EAAQ,EAAE,KAAO,KACjB,EAAQ,EAAE,KAAO,KACjB,EAAQ,EAAE,KAAO,KACjB,EAAQ,EAAE,KAAO,KACjB,EAAQ,EAAE,KAAO,KACjB,EAAQ,EAAE,KAAO,KACjB,EAAQ,EAAE,KAAO,KACjB,EAAQ,EAAE,KAAO,IAIrB,YAA4B,EAAK,CAC7B,GAAI,GAAK,OAAO,GACnB,MAAO,GAEA,KAAM,IAAI,OAAM,uBAAuB,KAG/C,GAAI,IAAgB,GAEd,GAAW,wBACX,GAAW,8EAMjB,AAAI,CAAC,OAAO,UAAY,OAAO,UAC3B,QAAO,SAAW,OAAO,UAE7B,AAAI,CAAC,OAAO,YAAc,OAAO,YAC7B,QAAO,WAAa,OAAO,YAI/B,GAAM,IAAW,CACb,IAAO,GACP,aAAc,GACd,aAAc,IACd,UAAW,IAIf,YAAkB,EAAK,EAAU,GAAG,CAShC,GADA,EAAU,OAAO,OAAO,GAAI,GAAU,GACnC,CAAC,GAAO,MAAO,IAAQ,SAAW,MAAO,GAE5C,GAAI,GAAc,EAAI,OAKtB,GAAG,EAAQ,WAAa,QAAa,EAAQ,SAAS,KAAK,GAAa,MAAO,GAC1E,GAAI,EAAQ,KAAO,GAAS,KAAK,GAClC,MAAO,QAAO,SAAS,EAAY,IAKjC,CAEF,GAAM,GAAQ,GAAS,KAAK,GAC5B,GAAG,EAAM,CACL,GAAM,GAAO,EAAM,GACb,EAAe,EAAM,GACvB,EAAoB,GAAU,EAAM,IAGlC,EAAY,EAAM,IAAM,EAAM,GACpC,GAAG,CAAC,EAAQ,cAAgB,EAAa,OAAS,GAAK,GAAQ,EAAW,KAAO,IAAK,MAAO,GACxF,GAAG,CAAC,EAAQ,cAAgB,EAAa,OAAS,GAAK,CAAC,GAAQ,EAAW,KAAO,IAAK,MAAO,GAC9F,CACD,GAAM,GAAM,OAAO,GACb,EAAS,GAAK,EACpB,MAAG,GAAO,OAAO,UAAY,IAGpB,EAFF,EAAQ,UAAkB,EACjB,EAIP,EAAW,QAAQ,OAAS,GAQ9B,IAAW,KAAQ,IAAsB,IACpC,IAAW,GACV,GAAQ,IAAW,IAAI,EAFyB,EAG7C,EAGb,EAKI,IAAsB,GACjB,EAAK,IAAsB,EADK,EAE5B,EAGb,IAAe,GACV,IAAe,EAAK,EADK,EAO1B,OAKX,OAAO,IAUnB,YAAmB,EAAO,CACtB,MAAG,IAAU,EAAO,QAAQ,OAAS,IACjC,GAAS,EAAO,QAAQ,MAAO,IAC/B,AAAG,IAAW,IAAM,EAAS,IACxB,AAAG,EAAO,KAAO,IAAM,EAAS,IAAI,EACjC,EAAO,EAAO,OAAO,KAAO,KAAM,GAAS,EAAO,OAAO,EAAE,EAAO,OAAO,KAC1E,EAIf,GAAI,IAAS,GASP,GACJ,wFACC,QAAQ,QAAS,GAAK,YAKzB,QAAsB,CACpB,YAAY,EAAQ,CAClB,KAAK,QAAU,EACf,KAAK,YAAc,KACnB,KAAK,cAAgB,GACrB,KAAK,gBAAkB,GACvB,KAAK,aAAe,CAClB,KAAS,CAAE,MAAO,qBAAsB,IAAM,KAC9C,GAAO,CAAE,MAAO,mBAAoB,IAAM,KAC1C,GAAO,CAAE,MAAO,mBAAoB,IAAM,KAC1C,KAAS,CAAE,MAAO,qBAAsB,IAAM,MAEhD,KAAK,UAAY,CAAE,MAAO,oBAAqB,IAAM,KACrD,KAAK,aAAe,CAClB,MAAS,CAAE,MAAO,iBAAkB,IAAK,KAMzC,KAAS,CAAE,MAAO,iBAAkB,IAAK,KACzC,MAAU,CAAE,MAAO,kBAAmB,IAAK,KAC3C,IAAQ,CAAE,MAAO,gBAAiB,IAAK,KACvC,KAAS,CAAE,MAAO,kBAAmB,IAAK,KAC1C,UAAc,CAAE,MAAO,iBAAkB,IAAK,KAC9C,IAAQ,CAAE,MAAO,gBAAiB,IAAK,KACvC,IAAQ,CAAE,MAAO,iBAAkB,IAAK,MAE1C,KAAK,oBAAsB,GAC3B,KAAK,SAAW,GAChB,KAAK,cAAgB,GACrB,KAAK,iBAAmB,GACxB,KAAK,mBAAqB,GAC1B,KAAK,aAAe,GACpB,KAAK,qBAAuB,GAC5B,KAAK,iBAAmB,GACxB,KAAK,oBAAsB,GAC3B,KAAK,SAAW,KAKpB,YAA6B,EAAiB,CAC5C,GAAM,GAAU,OAAO,KAAK,GAC5B,OAAS,GAAI,EAAG,EAAI,EAAQ,OAAQ,IAAK,CACvC,GAAM,GAAM,EAAQ,GACpB,KAAK,aAAa,GAAO,CACtB,MAAO,GAAI,QAAO,IAAI,EAAI,IAAI,KAC9B,IAAM,EAAiB,KAc9B,YAAuB,EAAK,EAAS,EAAO,EAAU,EAAe,EAAY,EAAgB,CAC/F,GAAI,IAAQ,QACN,MAAK,QAAQ,YAAc,CAAC,GAC9B,GAAM,EAAI,QAET,EAAI,OAAS,GAAE,CAChB,AAAI,GAAgB,GAAM,KAAK,qBAAqB,IAEpD,GAAM,GAAS,KAAK,QAAQ,kBAAkB,EAAS,EAAK,EAAO,EAAe,GAClF,MAAG,IAAW,KAEL,EACA,MAAO,IAAW,MAAO,IAAO,IAAW,EAE3C,EACA,KAAK,QAAQ,WACb,GAAW,EAAK,KAAK,QAAQ,cAAe,KAAK,QAAQ,oBAG7D,AADgB,EAAI,SACL,EACT,GAAW,EAAK,KAAK,QAAQ,cAAe,KAAK,QAAQ,oBAEzD,GAOjB,YAA0B,EAAS,CACjC,GAAI,KAAK,QAAQ,eAAgB,CAC/B,GAAM,GAAO,EAAQ,MAAM,KACrB,EAAS,EAAQ,OAAO,KAAO,IAAM,IAAM,GACjD,GAAI,EAAK,KAAO,QACd,MAAO,GAET,AAAI,EAAK,SAAW,GAClB,GAAU,EAAS,EAAK,IAG5B,MAAO,GAKT,GAAM,IAAY,GAAI,QAAO,8CAAgD,MAE7E,YAA4B,EAAS,EAAO,EAAS,CACnD,GAAI,CAAC,KAAK,QAAQ,kBAAoB,MAAO,IAAY,SAAU,CAIjE,GAAM,GAAU,GAAK,cAAc,EAAS,IACtC,EAAM,EAAQ,OACd,EAAQ,GACd,OAAS,GAAI,EAAG,EAAI,EAAK,IAAK,CAC5B,GAAM,GAAW,KAAK,iBAAiB,EAAQ,GAAG,IAC9C,EAAS,EAAQ,GAAG,GACpB,EAAQ,KAAK,QAAQ,oBAAsB,EAC/C,GAAI,EAAS,OAKX,GAJI,KAAK,QAAQ,wBACf,GAAQ,KAAK,QAAQ,uBAAuB,IAE3C,IAAU,aAAa,GAAS,cAC/B,IAAW,OAAW,CACxB,AAAI,KAAK,QAAQ,YACf,GAAS,EAAO,QAElB,EAAS,KAAK,qBAAqB,GACnC,GAAM,GAAS,KAAK,QAAQ,wBAAwB,EAAU,EAAQ,GACtE,AAAG,GAAW,KAEZ,EAAM,GAAS,EACX,AAAG,MAAO,IAAW,MAAO,IAAU,IAAW,EAErD,EAAM,GAAS,EAGf,EAAM,GAAS,GACb,EACA,KAAK,QAAQ,oBACb,KAAK,QAAQ,wBAGZ,AAAI,MAAK,QAAQ,wBACtB,GAAM,GAAS,IAIrB,GAAI,CAAC,OAAO,KAAK,GAAO,OACtB,OAEF,GAAI,KAAK,QAAQ,oBAAqB,CACpC,GAAM,GAAiB,GACvB,SAAe,KAAK,QAAQ,qBAAuB,EAC5C,EAET,MAAO,IAIX,GAAM,IAAW,SAAS,EAAS,CACjC,EAAU,EAAQ,QAAQ,SAAU;AAAA,GACpC,GAAM,GAAS,GAAI,IAAQ,QACvB,EAAc,EACd,EAAW,GACX,EAAQ,GACZ,OAAQ,GAAE,EAAG,EAAG,EAAQ,OAAQ,IAE9B,GAAG,AADQ,EAAQ,KACT,IAGR,GAAI,EAAQ,EAAE,KAAO,IAAK,CACxB,GAAM,GAAa,GAAiB,EAAS,IAAK,EAAG,8BACjD,EAAU,EAAQ,UAAU,EAAE,EAAE,GAAY,OAEhD,GAAG,KAAK,QAAQ,eAAe,CAC7B,GAAM,GAAa,EAAQ,QAAQ,KACnC,AAAG,IAAe,IAChB,GAAU,EAAQ,OAAO,EAAW,IAIxC,AAAG,KAAK,QAAQ,kBACd,GAAU,KAAK,QAAQ,iBAAiB,IAGvC,GACD,GAAW,KAAK,oBAAoB,EAAU,EAAa,IAI7D,GAAM,GAAc,EAAM,UAAU,EAAM,YAAY,KAAK,GAC3D,GAAG,GAAW,KAAK,QAAQ,aAAa,QAAQ,KAAa,GAC3D,KAAM,IAAI,OAAM,kDAAkD,MAEpE,GAAI,GAAY,EAChB,AAAG,GAAe,KAAK,QAAQ,aAAa,QAAQ,KAAiB,GACnE,GAAY,EAAM,YAAY,IAAK,EAAM,YAAY,KAAK,GAC1D,KAAK,cAAc,OAEnB,EAAY,EAAM,YAAY,KAEhC,EAAQ,EAAM,UAAU,EAAG,GAE3B,EAAc,KAAK,cAAc,MACjC,EAAW,GACX,EAAI,UACK,EAAQ,EAAE,KAAO,IAAK,CAE/B,GAAI,GAAU,GAAW,EAAQ,EAAG,GAAO,MAC3C,GAAG,CAAC,EAAS,KAAM,IAAI,OAAM,yBAG7B,GADA,EAAW,KAAK,oBAAoB,EAAU,EAAa,GACtD,OAAK,QAAQ,mBAAqB,EAAQ,UAAY,QAAW,KAAK,QAAQ,cAAmB,CAEpG,GAAM,GAAY,GAAI,IAAQ,EAAQ,SACtC,EAAU,IAAI,KAAK,QAAQ,aAAc,IAEtC,EAAQ,UAAY,EAAQ,QAAU,EAAQ,gBAC/C,GAAU,MAAQ,KAAK,mBAAmB,EAAQ,OAAQ,EAAO,EAAQ,UAE3E,KAAK,SAAS,EAAa,EAAW,GAKxC,EAAI,EAAQ,WAAa,UACjB,EAAQ,OAAO,EAAI,EAAG,KAAO,MAAO,CAC5C,GAAM,GAAW,GAAiB,EAAS,MAAO,EAAE,EAAG,0BACvD,GAAG,KAAK,QAAQ,gBAAgB,CAC9B,GAAM,GAAU,EAAQ,UAAU,EAAI,EAAG,EAAW,GAEpD,EAAW,KAAK,oBAAoB,EAAU,EAAa,GAE3D,EAAY,IAAI,KAAK,QAAQ,gBAAiB,CAAE,EAAG,KAAK,QAAQ,cAAgB,KAElF,EAAI,UACK,EAAQ,OAAO,EAAI,EAAG,KAAO,KAAM,CAC5C,GAAM,GAAS,GAAc,EAAS,GACtC,KAAK,gBAAkB,EAAO,SAC9B,EAAI,EAAO,UACJ,EAAQ,OAAO,EAAI,EAAG,KAAO,KAAM,CAC1C,GAAM,GAAa,GAAiB,EAAS,MAAO,EAAG,wBAA0B,EAC3E,EAAS,EAAQ,UAAU,EAAI,EAAE,GAKvC,GAHA,EAAW,KAAK,oBAAoB,EAAU,EAAa,GAGxD,KAAK,QAAQ,cAGd,EAAY,IAAI,KAAK,QAAQ,cAAe,CAAE,EAAG,KAAK,QAAQ,cAAgB,SAC1E,CACJ,GAAI,GAAM,KAAK,cAAc,EAAQ,EAAY,QAAS,EAAO,GAAM,GAAO,IAC9E,AAAG,GAAO,MAAW,GAAM,IAC3B,EAAY,IAAI,KAAK,QAAQ,aAAc,GAG7C,EAAI,EAAa,MACb,CACJ,GAAI,GAAS,GAAW,EAAQ,EAAG,KAAK,QAAQ,gBAC5C,EAAS,EAAO,QAChB,EAAS,EAAO,OAChB,EAAiB,EAAO,eACxB,EAAa,EAAO,WAExB,AAAI,KAAK,QAAQ,kBACf,GAAU,KAAK,QAAQ,iBAAiB,IAItC,GAAe,GACd,EAAY,UAAY,QAEzB,GAAW,KAAK,oBAAoB,EAAU,EAAa,EAAO,KAKtE,GAAM,GAAU,EAQhB,GAPG,GAAW,KAAK,QAAQ,aAAa,QAAQ,EAAQ,WAAa,IACnE,GAAc,KAAK,cAAc,MACjC,EAAQ,EAAM,UAAU,EAAG,EAAM,YAAY,OAE5C,IAAY,EAAO,SACpB,IAAS,EAAQ,IAAM,EAAU,GAE/B,KAAK,aAAa,KAAK,QAAQ,UAAW,EAAO,GAAU,CAC7D,GAAI,GAAa,GAEjB,GAAG,EAAO,OAAS,GAAK,EAAO,YAAY,OAAS,EAAO,OAAS,EAClE,EAAI,EAAO,mBAGL,KAAK,QAAQ,aAAa,QAAQ,KAAa,GACrD,EAAI,EAAO,eAGR,CAEH,GAAM,GAAS,KAAK,iBAAiB,EAAS,EAAS,EAAa,GACpE,GAAG,CAAC,EAAQ,KAAM,IAAI,OAAM,qBAAqB,KACjD,EAAI,EAAO,EACX,EAAa,EAAO,WAGtB,GAAM,GAAY,GAAI,IAAQ,GAC9B,AAAG,IAAY,GAAU,GACvB,GAAU,MAAQ,KAAK,mBAAmB,EAAQ,EAAO,IAExD,GACD,GAAa,KAAK,cAAc,EAAY,EAAS,EAAO,GAAM,EAAgB,GAAM,KAG1F,EAAQ,EAAM,OAAO,EAAG,EAAM,YAAY,MAC1C,EAAU,IAAI,KAAK,QAAQ,aAAc,GAEzC,KAAK,SAAS,EAAa,EAAW,OAClC,CAEJ,GAAG,EAAO,OAAS,GAAK,EAAO,YAAY,OAAS,EAAO,OAAS,EAAE,CACpE,AAAG,EAAQ,EAAQ,OAAS,KAAO,IACjC,GAAU,EAAQ,OAAO,EAAG,EAAQ,OAAS,GAC7C,EAAS,GAET,EAAS,EAAO,OAAO,EAAG,EAAO,OAAS,GAGzC,KAAK,QAAQ,kBACd,GAAU,KAAK,QAAQ,iBAAiB,IAG1C,GAAM,GAAY,GAAI,IAAQ,GAC9B,AAAG,IAAY,GAAU,GACvB,GAAU,MAAQ,KAAK,mBAAmB,EAAQ,EAAO,IAE3D,KAAK,SAAS,EAAa,EAAW,GACtC,EAAQ,EAAM,OAAO,EAAG,EAAM,YAAY,UAGvC,CACH,GAAM,GAAY,GAAI,IAAS,GAC/B,KAAK,cAAc,KAAK,GAErB,IAAY,GAAU,GACvB,GAAU,MAAQ,KAAK,mBAAmB,EAAQ,EAAO,IAE3D,KAAK,SAAS,EAAa,EAAW,GACtC,EAAc,EAEhB,EAAW,GACX,EAAI,OAIR,IAAY,EAAQ,GAGxB,MAAO,GAAO,OAGhB,YAAkB,EAAa,EAAW,EAAM,CAC9C,GAAM,GAAS,KAAK,QAAQ,UAAU,EAAU,QAAS,EAAO,EAAU,OAC1E,AAAG,IAAW,IAAe,OAAO,IAAW,UAC7C,GAAU,QAAU,GACpB,EAAY,SAAS,IAMzB,GAAM,IAAuB,SAAS,EAAI,CAExC,GAAG,KAAK,QAAQ,gBAAgB,CAC9B,OAAQ,KAAc,MAAK,gBAAgB,CACzC,GAAM,GAAS,KAAK,gBAAgB,GACpC,EAAM,EAAI,QAAS,EAAO,KAAM,EAAO,KAEzC,OAAQ,KAAc,MAAK,aAAa,CACtC,GAAM,GAAS,KAAK,aAAa,GACjC,EAAM,EAAI,QAAS,EAAO,MAAO,EAAO,KAE1C,GAAG,KAAK,QAAQ,aACd,OAAQ,KAAc,MAAK,aAAa,CACtC,GAAM,GAAS,KAAK,aAAa,GACjC,EAAM,EAAI,QAAS,EAAO,MAAO,EAAO,KAG5C,EAAM,EAAI,QAAS,KAAK,UAAU,MAAO,KAAK,UAAU,KAE1D,MAAO,IAET,YAA6B,EAAU,EAAa,EAAO,EAAY,CACrE,MAAI,IACC,KAAe,QAAW,GAAa,OAAO,KAAK,EAAY,OAAO,SAAW,GAEpF,EAAW,KAAK,cAAc,EAC5B,EAAY,QACZ,EACA,GACA,EAAY,MAAQ,OAAO,KAAK,EAAY,OAAO,SAAW,EAAI,GAClE,GAEE,IAAa,QAAa,IAAa,IACzC,EAAY,IAAI,KAAK,QAAQ,aAAc,GAC7C,EAAW,IAEN,EAUT,YAAsB,EAAW,EAAO,EAAe,CACrD,GAAM,GAAc,KAAO,EAC3B,OAAW,KAAgB,GAAW,CACpC,GAAM,GAAc,EAAU,GAC9B,GAAI,IAAgB,GAAe,IAAU,EAAe,MAAO,GAErE,MAAO,GAST,YAAgC,EAAS,EAAG,EAAc,IAAI,CAC5D,GAAI,GACA,EAAS,GACb,OAAS,GAAQ,EAAG,EAAQ,EAAQ,OAAQ,IAAS,CACnD,GAAI,GAAK,EAAQ,GACjB,GAAI,EACA,AAAI,IAAO,GAAc,GAAe,YACjC,IAAO,KAAO,IAAO,IAC5B,EAAe,UACR,IAAO,EAAY,GAC5B,GAAG,EAAY,IACb,GAAG,EAAQ,EAAQ,KAAO,EAAY,GACpC,MAAO,CACL,KAAM,EACN,MAAO,OAIX,OAAO,CACL,KAAM,EACN,MAAO,OAGN,AAAI,KAAO,KAChB,GAAK,KAEP,GAAU,GAId,YAA0B,EAAS,EAAK,EAAG,EAAO,CAChD,GAAM,GAAe,EAAQ,QAAQ,EAAK,GAC1C,GAAG,IAAiB,GAClB,KAAM,IAAI,OAAM,GAEhB,MAAO,GAAe,EAAI,OAAS,EAIvC,YAAoB,EAAQ,EAAG,EAAgB,EAAc,IAAI,CAC/D,GAAM,GAAS,GAAuB,EAAS,EAAE,EAAG,GACpD,GAAG,CAAC,EAAQ,OACZ,GAAI,GAAS,EAAO,KACd,EAAa,EAAO,MACpB,EAAiB,EAAO,OAAO,MACjC,EAAU,EACV,EAAiB,GAMrB,GALG,IAAmB,IACpB,GAAU,EAAO,OAAO,EAAG,GAAgB,QAAQ,SAAU,IAC7D,EAAS,EAAO,OAAO,EAAiB,IAGvC,EAAe,CAChB,GAAM,GAAa,EAAQ,QAAQ,KACnC,AAAG,IAAe,IAChB,GAAU,EAAQ,OAAO,EAAW,GACpC,EAAiB,IAAY,EAAO,KAAK,OAAO,EAAa,IAIjE,MAAO,CACL,QAAS,EACT,OAAQ,EACR,WAAY,EACZ,eAAgB,GASpB,YAA0B,EAAS,EAAS,EAAE,CAC5C,GAAM,GAAa,EAEf,EAAe,EAEnB,KAAO,EAAI,EAAQ,OAAQ,IACzB,GAAI,EAAQ,KAAO,IACjB,GAAI,EAAQ,EAAE,KAAO,IAAK,CACtB,GAAM,GAAa,GAAiB,EAAS,IAAK,EAAG,GAAG,mBAExD,GAAG,AADgB,EAAQ,UAAU,EAAE,EAAE,GAAY,SACjC,GAClB,KACI,IAAiB,GACnB,MAAO,CACL,WAAY,EAAQ,UAAU,EAAY,GAC1C,EAAI,GAIV,EAAE,UACM,EAAQ,EAAE,KAAO,IAEzB,EADmB,GAAiB,EAAS,KAAM,EAAE,EAAG,mCAEhD,EAAQ,OAAO,EAAI,EAAG,KAAO,MAErC,EADmB,GAAiB,EAAS,MAAO,EAAE,EAAG,mCAEjD,EAAQ,OAAO,EAAI,EAAG,KAAO,KAErC,EADmB,GAAiB,EAAS,MAAO,EAAG,2BAA6B,MAE/E,CACL,GAAM,GAAU,GAAW,EAAS,EAAG,KAEvC,AAAI,GAEE,CADgB,IAAW,EAAQ,WACnB,GAAW,EAAQ,OAAO,EAAQ,OAAO,OAAO,KAAO,KACzE,IAEF,EAAE,EAAQ,aAOtB,YAAoB,EAAK,EAAa,EAAS,CAC7C,GAAI,GAAe,MAAO,IAAQ,SAAU,CAE1C,GAAM,GAAS,EAAI,OACnB,MAAG,KAAW,OAAgB,GACtB,IAAW,QAAiB,GACxB,GAAO,EAAK,OAExB,OAAI,IAAK,QAAQ,GACR,EAEA,GAMb,GAAI,IAAqB,GAQzB,YAAkB,EAAM,EAAQ,CAC9B,MAAO,IAAU,EAAM,GAUzB,YAAkB,EAAK,EAAS,EAAM,CACpC,GAAI,GACE,EAAgB,GACtB,OAAS,GAAI,EAAG,EAAI,EAAI,OAAQ,IAAK,CACnC,GAAM,GAAS,EAAI,GACb,EAAW,GAAS,GACtB,EAAW,GAIf,GAHA,AAAG,IAAU,OAAW,EAAW,EAC9B,EAAW,EAAQ,IAAM,EAE3B,IAAa,EAAQ,aACtB,AAAG,IAAS,OAAW,EAAO,EAAO,GAChC,GAAQ,GAAK,EAAO,OACrB,IAAG,IAAa,OACpB,SACI,GAAG,EAAO,GAAU,CAExB,GAAI,GAAM,GAAS,EAAO,GAAW,EAAS,GACxC,EAAS,GAAU,EAAK,GAE9B,AAAG,EAAO,MACR,GAAkB,EAAK,EAAO,MAAO,EAAU,GAC3C,AAAG,OAAO,KAAK,GAAK,SAAW,GAAK,EAAI,EAAQ,gBAAkB,QAAa,CAAC,EAAQ,qBAC5F,EAAM,EAAI,EAAQ,cACX,OAAO,KAAK,GAAK,SAAW,GACnC,CAAG,EAAQ,qBAAsB,EAAI,EAAQ,cAAgB,GACxD,EAAM,IAGb,AAAG,EAAc,KAAc,QAAa,EAAc,eAAe,GACnE,OAAM,QAAQ,EAAc,KAC5B,GAAc,GAAY,CAAE,EAAc,KAE9C,EAAc,GAAU,KAAK,IAI7B,AAAI,EAAQ,QAAQ,EAAU,EAAU,GACtC,EAAc,GAAY,CAAC,GAE3B,EAAc,GAAY,IAOlC,MAAG,OAAO,IAAS,SACd,EAAK,OAAS,GAAG,GAAc,EAAQ,cAAgB,GACnD,IAAS,QAAW,GAAc,EAAQ,cAAgB,GAC5D,EAGT,YAAkB,EAAI,CACpB,GAAM,GAAO,OAAO,KAAK,GACzB,OAAS,GAAI,EAAG,EAAI,EAAK,OAAQ,IAAK,CACpC,GAAM,GAAM,EAAK,GACjB,GAAG,IAAQ,KAAM,MAAO,IAI5B,YAA0B,EAAK,EAAS,EAAO,EAAQ,CACrD,GAAI,EAAS,CACX,GAAM,GAAO,OAAO,KAAK,GACnB,EAAM,EAAK,OACjB,OAAS,GAAI,EAAG,EAAI,EAAK,IAAK,CAC5B,GAAM,GAAW,EAAK,GACtB,AAAI,EAAQ,QAAQ,EAAU,EAAQ,IAAM,EAAU,GAAM,IAC1D,EAAI,GAAY,CAAE,EAAQ,IAE1B,EAAI,GAAY,EAAQ,KAMhC,YAAmB,EAAK,EAAQ,CAC9B,GAAM,CAAE,gBAAiB,EACnB,EAAY,OAAO,KAAK,GAAK,OAMnC,MAJI,OAAc,GAKhB,IAAc,GACb,GAAI,IAAiB,MAAO,GAAI,IAAkB,WAAa,EAAI,KAAkB,IAO1F,GAAI,IAAa,GAEb,GAAY,CACf,SAAU,IAGL,CAAE,aAAc,IAAkB,GAElC,CAAE,SAAU,IAAc,GAGhC,QAAe,CAEX,YAAY,EAAQ,CAChB,KAAK,iBAAmB,GACxB,KAAK,QAAU,GAAe,GAQlC,MAAM,EAAQ,EAAiB,CAC3B,GAAG,MAAO,IAAY,SAAe,GAAI,EAAQ,SAC7C,EAAU,EAAQ,eAElB,MAAM,IAAI,OAAM,mDAEpB,GAAI,EAAiB,CACjB,AAAG,IAAqB,IAAM,GAAmB,IAEjD,GAAM,GAAS,GAAU,SAAS,EAAS,GAC3C,GAAI,IAAW,GACb,KAAM,OAAO,GAAG,EAAO,IAAI,OAAO,EAAO,IAAI,QAAQ,EAAO,IAAI,OAGtE,GAAM,GAAmB,GAAI,IAAmB,KAAK,SACrD,EAAiB,oBAAoB,KAAK,kBAC1C,GAAM,GAAgB,EAAiB,SAAS,GAChD,MAAG,MAAK,QAAQ,eAAiB,IAAkB,OAAkB,EACzD,GAAW,EAAe,KAAK,SAQ/C,UAAU,EAAK,EAAM,CACjB,GAAG,EAAM,QAAQ,OAAS,GACtB,KAAM,IAAI,OAAM,+BACd,GAAG,EAAI,QAAQ,OAAS,IAAM,EAAI,QAAQ,OAAS,GACrD,KAAM,IAAI,OAAM,wEACd,GAAG,IAAU,IACf,KAAM,IAAI,OAAM,6CAEhB,KAAK,iBAAiB,GAAO,IAKrC,GAAc,GAEZ,GAAM;AAAA,EAQZ,YAAe,EAAQ,EAAS,CAC5B,GAAI,GAAc,GAClB,MAAI,GAAQ,QAAU,EAAQ,SAAS,OAAS,GAC5C,GAAc,IAEX,GAAS,EAAQ,EAAS,GAAI,GAGzC,YAAkB,EAAK,EAAS,EAAO,EAAa,CAChD,GAAI,GAAS,GACT,EAAuB,GAE3B,OAAS,GAAI,EAAG,EAAI,EAAI,OAAQ,IAAK,CACjC,GAAM,GAAS,EAAI,GACb,EAAU,GAAW,GACvB,EAAW,GAIf,GAHA,AAAI,EAAM,SAAW,EAAG,EAAW,EAC9B,EAAW,GAAG,KAAS,IAExB,IAAY,EAAQ,aAAc,CAClC,GAAI,GAAU,EAAO,GACrB,AAAK,GAAW,EAAU,IACtB,GAAU,EAAQ,kBAAkB,EAAS,GAC7C,EAAU,GAAuB,EAAS,IAE1C,GACA,IAAU,GAEd,GAAU,EACV,EAAuB,GACvB,iBACO,IAAY,EAAQ,cAAe,CAC1C,AAAI,GACA,IAAU,GAEd,GAAU,YAAY,EAAO,GAAS,GAAG,EAAQ,mBACjD,EAAuB,GACvB,iBACO,IAAY,EAAQ,gBAAiB,CAC5C,GAAU,EAAc,OAAO,EAAO,GAAS,GAAG,EAAQ,mBAC1D,EAAuB,GACvB,iBACO,EAAQ,KAAO,IAAK,CAC3B,GAAM,GAAS,GAAY,EAAO,MAAO,GACnC,EAAU,IAAY,OAAS,GAAK,EACtC,EAAiB,EAAO,GAAS,GAAG,EAAQ,cAChD,EAAiB,EAAe,SAAW,EAAI,IAAM,EAAiB,GACtE,GAAU,EAAU,IAAI,IAAU,IAAiB,MACnD,EAAuB,GACvB,SAEJ,GAAI,GAAgB,EACpB,AAAI,IAAkB,IAClB,IAAiB,EAAQ,UAE7B,GAAM,GAAS,GAAY,EAAO,MAAO,GACnC,EAAW,EAAc,IAAI,IAAU,IACvC,EAAW,GAAS,EAAO,GAAU,EAAS,EAAU,GAC9D,AAAI,EAAQ,aAAa,QAAQ,KAAa,GAC1C,AAAI,EAAQ,qBAAsB,GAAU,EAAW,IAClD,GAAU,EAAW,KACvB,AAAK,EAAC,GAAY,EAAS,SAAW,IAAM,EAAQ,kBACvD,GAAU,EAAW,KAClB,AAAI,GAAY,EAAS,SAAS,KACrC,GAAU,EAAW,IAAI,IAAW,MAAgB,KAEpD,IAAU,EAAW,IACrB,AAAI,GAAY,IAAgB,IAAO,GAAS,SAAS,OAAS,EAAS,SAAS,OAChF,GAAU,EAAc,EAAQ,SAAW,EAAW,EAEtD,GAAU,EAEd,GAAU,KAAK,MAEnB,EAAuB,GAG3B,MAAO,GAGX,YAAoB,EAAK,CACrB,GAAM,GAAO,OAAO,KAAK,GACzB,OAAS,GAAI,EAAG,EAAI,EAAK,OAAQ,IAAK,CAClC,GAAM,GAAM,EAAK,GACjB,GAAI,IAAQ,KAAM,MAAO,IAIjC,YAAqB,EAAS,EAAS,CACnC,GAAI,GAAU,GACd,GAAI,GAAW,CAAC,EAAQ,iBACpB,OAAS,KAAQ,GAAS,CACtB,GAAI,GAAU,EAAQ,wBAAwB,EAAM,EAAQ,IAC5D,EAAU,GAAuB,EAAS,GAC1C,AAAI,IAAY,IAAQ,EAAQ,0BAC5B,GAAW,IAAI,EAAK,OAAO,EAAQ,oBAAoB,UAEvD,GAAW,IAAI,EAAK,OAAO,EAAQ,oBAAoB,YAAY,KAI/E,MAAO,GAGX,YAAoB,EAAO,EAAS,CAChC,EAAQ,EAAM,OAAO,EAAG,EAAM,OAAS,EAAQ,aAAa,OAAS,GACrE,GAAI,GAAU,EAAM,OAAO,EAAM,YAAY,KAAO,GACpD,OAAS,KAAS,GAAQ,UACtB,GAAI,EAAQ,UAAU,KAAW,GAAS,EAAQ,UAAU,KAAW,KAAO,EAAS,MAAO,GAElG,MAAO,GAGX,YAAgC,EAAW,EAAS,CAChD,GAAI,GAAa,EAAU,OAAS,GAAK,EAAQ,gBAC7C,OAAS,GAAI,EAAG,EAAI,EAAQ,SAAS,OAAQ,IAAK,CAC9C,GAAM,GAAS,EAAQ,SAAS,GAChC,EAAY,EAAU,QAAQ,EAAO,MAAO,EAAO,KAG3D,MAAO,GAEX,GAAI,IAAgB,GAKd,GAAmB,CACvB,oBAAqB,KACrB,oBAAqB,GACrB,aAAc,QACd,iBAAkB,GAClB,cAAe,GACf,OAAQ,GACR,SAAU,KACV,kBAAmB,GACnB,qBAAsB,GACtB,0BAA2B,GAC3B,kBAAmB,SAAS,EAAK,EAAG,CAClC,MAAO,IAET,wBAAyB,SAAS,EAAU,EAAG,CAC7C,MAAO,IAET,cAAe,GACf,gBAAiB,GACjB,aAAc,GACd,SAAU,CACR,CAAE,MAAO,GAAI,QAAO,IAAK,KAAM,IAAK,SACpC,CAAE,MAAO,GAAI,QAAO,IAAK,KAAM,IAAK,QACpC,CAAE,MAAO,GAAI,QAAO,IAAK,KAAM,IAAK,QACpC,CAAE,MAAO,GAAI,QAAO,IAAM,KAAM,IAAK,UACrC,CAAE,MAAO,GAAI,QAAO,IAAM,KAAM,IAAK,WAEvC,gBAAiB,GACjB,UAAW,GAGX,aAAc,IAGhB,YAAiB,EAAS,CACxB,KAAK,QAAU,OAAO,OAAO,GAAI,GAAkB,GACnD,AAAI,KAAK,QAAQ,kBAAoB,KAAK,QAAQ,oBAChD,KAAK,YAAc,UAAgB,CACjC,MAAO,IAGT,MAAK,cAAgB,KAAK,QAAQ,oBAAoB,OACtD,KAAK,YAAc,IAGrB,KAAK,qBAAuB,GAE5B,AAAI,KAAK,QAAQ,OACf,MAAK,UAAY,GACjB,KAAK,WAAa;AAAA,EAClB,KAAK,QAAU;AAAA,GAEf,MAAK,UAAY,UAAW,CAC1B,MAAO,IAET,KAAK,WAAa,IAClB,KAAK,QAAU,IAInB,GAAQ,UAAU,MAAQ,SAAS,EAAM,CACvC,MAAG,MAAK,QAAQ,cACP,GAAc,EAAM,KAAK,SAE7B,OAAM,QAAQ,IAAS,KAAK,QAAQ,eAAiB,KAAK,QAAQ,cAAc,OAAS,GAC1F,GAAO,EACJ,KAAK,QAAQ,eAAiB,IAG5B,KAAK,IAAI,EAAM,GAAG,MAI7B,GAAQ,UAAU,IAAM,SAAS,EAAM,EAAO,CAC5C,GAAI,GAAU,GACV,EAAM,GACV,OAAS,KAAO,GACd,GAAI,MAAO,GAAK,IAAS,YAAoB,GAAI,EAAK,KAAS,KAC7D,AAAG,EAAI,KAAO,IAAK,GAAO,KAAK,UAAU,GAAS,IAAM,EAAM,IAAM,KAAK,WACpE,GAAO,KAAK,UAAU,GAAS,IAAM,EAAM,IAAM,KAAK,mBAElD,EAAK,YAAgB,MAC9B,GAAO,KAAK,iBAAiB,EAAK,GAAM,EAAK,GAAI,WACxC,MAAO,GAAK,IAAS,SAAU,CAExC,GAAM,GAAO,KAAK,YAAY,GAC9B,GAAI,EACF,GAAW,KAAK,iBAAiB,EAAM,GAAK,EAAK,YAG7C,IAAQ,KAAK,QAAQ,aAAc,CACrC,GAAI,GAAS,KAAK,QAAQ,kBAAkB,EAAK,GAAK,EAAK,IAC3D,GAAO,KAAK,qBAAqB,OAEjC,IAAO,KAAK,iBAAiB,EAAK,GAAM,EAAK,GAAI,WAG5C,MAAM,QAAQ,EAAK,IAAO,CAEnC,GAAM,GAAS,EAAK,GAAK,OACrB,EAAa,GACjB,OAAS,GAAI,EAAG,EAAI,EAAQ,IAAK,CAC/B,GAAM,GAAO,EAAK,GAAK,GACvB,AAAI,MAAO,IAAS,aAAoB,CAAI,IAAS,KACnD,AAAG,EAAI,KAAO,IAAK,GAAO,KAAK,UAAU,GAAS,IAAM,EAAM,IAAM,KAAK,WACpE,GAAO,KAAK,UAAU,GAAS,IAAM,EAAM,IAAM,KAAK,WAEtD,AAAI,MAAO,IAAS,SACzB,AAAG,KAAK,QAAQ,aACd,GAAc,KAAK,IAAI,EAAM,EAAQ,GAAG,IAExC,GAAc,KAAK,qBAAqB,EAAM,EAAK,GAGrD,GAAc,KAAK,iBAAiB,EAAM,EAAK,GAAI,IAGvD,AAAG,KAAK,QAAQ,cACd,GAAa,KAAK,gBAAgB,EAAY,EAAK,GAAI,IAEzD,GAAO,UAGH,KAAK,QAAQ,qBAAuB,IAAQ,KAAK,QAAQ,oBAAqB,CAChF,GAAM,GAAK,OAAO,KAAK,EAAK,IACtB,EAAI,EAAG,OACb,OAAS,GAAI,EAAG,EAAI,EAAG,IACrB,GAAW,KAAK,iBAAiB,EAAG,GAAI,GAAK,EAAK,GAAK,EAAG,SAG5D,IAAO,KAAK,qBAAqB,EAAK,GAAM,EAAK,GAIvD,MAAO,CAAC,QAAS,EAAS,IAAK,IAGjC,GAAQ,UAAU,iBAAmB,SAAS,EAAU,EAAI,CAG1D,MAFA,GAAM,KAAK,QAAQ,wBAAwB,EAAU,GAAK,GAC1D,EAAM,KAAK,qBAAqB,GAC5B,KAAK,QAAQ,2BAA6B,IAAQ,OAC7C,IAAM,EACD,IAAM,EAAW,KAAO,EAAM,KAG9C,YAA+B,EAAQ,EAAK,EAAO,CACjD,GAAM,GAAS,KAAK,IAAI,EAAQ,EAAQ,GACxC,MAAI,GAAO,KAAK,QAAQ,gBAAkB,QAAa,OAAO,KAAK,GAAQ,SAAW,EAC7E,KAAK,iBAAiB,EAAO,KAAK,QAAQ,cAAe,EAAK,EAAO,QAAS,GAE9E,KAAK,gBAAgB,EAAO,IAAK,EAAK,EAAO,QAAS,GAIjE,GAAQ,UAAU,gBAAkB,SAAS,EAAK,EAAK,EAAS,EAAO,CACrE,GAAG,IAAQ,GACT,MAAG,GAAI,KAAO,IAAa,KAAK,UAAU,GAAS,IAAM,EAAM,EAAS,IAAM,KAAK,WAE1E,KAAK,UAAU,GAAS,IAAM,EAAM,EAAU,KAAK,SAAS,GAAO,KAAK,WAE7E,CAEJ,GAAI,GAAY,KAAO,EAAM,KAAK,WAC9B,EAAgB,GAOpB,MALG,GAAI,KAAO,KACZ,GAAgB,IAChB,EAAY,IAGV,GAAW,EAAI,QAAQ,OAAS,GACzB,KAAK,UAAU,GAAS,IAAO,EAAM,EAAU,EAAgB,IAAM,EAAM,EAC3E,KAAK,QAAQ,kBAAoB,IAAS,IAAQ,KAAK,QAAQ,iBAAmB,EAAc,SAAW,EAC7G,KAAK,UAAU,GAAS,OAAO,OAAW,KAAK,QAGpD,KAAK,UAAU,GAAS,IAAM,EAAM,EAAU,EAAgB,KAAK,WACnE,EACA,KAAK,UAAU,GAAS,IAKhC,GAAQ,UAAU,SAAW,SAAS,EAAI,CACxC,GAAI,GAAW,GACf,MAAG,MAAK,QAAQ,aAAa,QAAQ,KAAS,GACxC,KAAK,QAAQ,sBAAsB,GAAW,KAC9C,AAAG,KAAK,QAAQ,kBACpB,EAAW,IAEX,EAAW,MAAM,IAEZ,GAGT,GAAQ,UAAU,iBAAmB,SAAS,EAAK,EAAK,EAAS,EAAO,CACtE,GAAI,KAAK,QAAQ,gBAAkB,IAAS,IAAQ,KAAK,QAAQ,cAC/D,MAAO,MAAK,UAAU,GAAS,YAAY,OAAY,KAAK,QACxD,GAAI,KAAK,QAAQ,kBAAoB,IAAS,IAAQ,KAAK,QAAQ,gBACvE,MAAO,MAAK,UAAU,GAAS,OAAO,OAAY,KAAK,QACnD,GAAG,EAAI,KAAO,IAClB,MAAQ,MAAK,UAAU,GAAS,IAAM,EAAM,EAAS,IAAM,KAAK,WAC5D,CACJ,GAAI,GAAY,KAAK,QAAQ,kBAAkB,EAAK,GAGpD,MAFA,GAAY,KAAK,qBAAqB,GAElC,IAAc,GACT,KAAK,UAAU,GAAS,IAAM,EAAM,EAAU,KAAK,SAAS,GAAO,KAAK,WAExE,KAAK,UAAU,GAAS,IAAM,EAAM,EAAU,IAClD,EACD,KAAO,EAAM,KAAK,aAK1B,GAAQ,UAAU,qBAAuB,SAAS,EAAU,CAC1D,GAAG,GAAa,EAAU,OAAS,GAAK,KAAK,QAAQ,gBACnD,OAAS,GAAE,EAAG,EAAE,KAAK,QAAQ,SAAS,OAAQ,IAAK,CACjD,GAAM,GAAS,KAAK,QAAQ,SAAS,GACrC,EAAY,EAAU,QAAQ,EAAO,MAAO,EAAO,KAGvD,MAAO,IAGT,YAAmB,EAAO,CACxB,MAAO,MAAK,QAAQ,SAAS,OAAO,GAGtC,YAAqB,EAAoB,CACvC,MAAI,GAAK,WAAW,KAAK,QAAQ,qBACxB,EAAK,OAAO,KAAK,eAEjB,GAIX,GAAI,IAAW,GAEX,GAAM,CACR,UAAW,GACX,aAAc,GACd,WAAY,IAGd,gBAAiC,GAAiB,CAC9C,YAAY,EAAS,CACjB,MAAM,GACN,OAAO,eAAe,KAAM,GAAmB,aAInD,GACJ,AAAC,UAAU,EAAiB,CACxB,EAAgB,MAAQ,CAAC,EAAO,IACxB,EAAM,SAAW,OACV,EAAQ,OAAO,EAAM,QAC5B,EAAM,MAAQ,OACP,EAAQ,IAAI,EAAM,KACzB,EAAM,MAAQ,OACP,EAAQ,IAAI,EAAM,KACtB,EAAQ,EAAE,EAAM,SAAS,GAAI,EAAM,SAAS,MAExD,IAAoB,IAAkB,KACzC,GAAI,IACJ,AAAC,UAAU,EAAqB,CAC5B,EAAoB,MAAQ,CAAC,EAAO,IAC5B,EAAM,SAAW,OACV,EAAQ,OAAO,EAAM,QAC5B,EAAM,MAAQ,OACP,EAAQ,IAAI,EAAM,KACzB,EAAM,wBAA0B,OACzB,EAAQ,sBAAsB,EAAM,uBAC3C,EAAM,qBAAuB,OACtB,EAAQ,mBAAmB,EAAM,oBACxC,EAAM,MAAQ,OACP,EAAQ,IAAI,EAAM,KACtB,EAAQ,EAAE,EAAM,SAAS,GAAI,EAAM,SAAS,MAExD,IAAwB,IAAsB,KACjD,GAAI,IACJ,AAAC,UAAU,EAAe,CACtB,EAAc,MAAQ,CAAC,EAAO,IACtB,EAAM,SAAW,OACV,EAAQ,OAAO,EAAM,QAC5B,EAAM,MAAQ,OACP,EAAQ,IAAI,EAAM,KACzB,EAAM,iBAAmB,OAClB,EAAQ,eAAe,EAAM,gBACpC,EAAM,MAAQ,OACP,EAAQ,IAAI,EAAM,KACtB,EAAQ,EAAE,EAAM,SAAS,GAAI,EAAM,SAAS,MAExD,IAAkB,IAAgB,KACrC,GAAI,IACJ,AAAC,UAAU,EAAuB,CAC9B,EAAsB,MAAQ,CAAC,EAAO,IAC9B,EAAM,SAAW,OACV,EAAQ,OAAO,EAAM,QAC5B,EAAM,MAAQ,OACP,EAAQ,IAAI,EAAM,KACzB,EAAM,MAAQ,OACP,EAAQ,IAAI,EAAM,KACtB,EAAQ,EAAE,EAAM,SAAS,GAAI,EAAM,SAAS,MAExD,IAA0B,IAAwB,KACrD,oBAA2B,GAAmB,CAC1C,YAAY,EAAM,CACd,MAAM,CACF,KAAM,eACN,OAAQ,YACL,IAEP,KAAK,KAAO,eACZ,KAAK,OAAS,SACd,OAAO,eAAe,KAAM,GAAa,aAG3C,GAAoC,AAAC,GAAS,KAC7C,KACC,EAAI,aAAe,CAAE,YAAa,OAClC,EAAI,yBAA2B,CAAE,wBAAyB,MAE5D,GAAqC,AAAC,GAAS,KAC9C,KACC,EAAI,gBAAkB,CAAE,eAAgB,OACxC,EAAI,aAAe,CAAE,YAAa,OAClC,EAAI,yBAA2B,CAAE,wBAAyB,MAG5D,GAAwB,MAAO,EAAO,IAAY,CACpD,GAAM,CAAE,WAAU,WAAW,QAAS,OAAM,KAAM,GAAa,KAAM,GAAQ,WACvE,EAAU,GAAI,GAAI,GAA2B,CAC/C,sBAAuB,EAAM,aAC7B,8BAA+B,EAAM,oBACrC,mCAAoC,CAChC,IAAM,GAA0B,EAAM,0BACtC,IAAO,GAAM,0BAA4B,IAAI,IAAI,AAAC,GAAW,GAAQ,KAAK,SAG9E,EAAiB,GAAG,GAAU,SAAS,KAAO,EAAS,MAAM,EAAG,IAAM,GAAY,MACtF,EAAiB,GAAa,EAAgB,EAAO,SAAU,IAAM,EAAM,OAAQ,WAAY,IAC/F,GAAM,GAAQ,GAAI,CACd,UAAW,CAAC,CAAE,EAAM,WACpB,gBAAiB,CAAC,CAAE,EAAM,cAC1B,OAAQ,CAAC,CAAE,EAAM,QACjB,WAAY,CAAC,IAAM,EAAM,UAAY,OAAQ,IAAM,EAAM,QAAQ,YACjE,OAAQ,CAAC,CAAE,EAAM,UAEjB,EACJ,MAAO,IAAI,IAAY,CACnB,WACA,WACA,OACA,OAAQ,MACR,UACA,KAAM,EACN,QACA,UAGF,GAAsB,MAAO,EAAO,IAAY,CAClD,GAAM,CAAE,WAAU,WAAW,QAAS,OAAM,KAAM,GAAa,KAAM,GAAQ,WACvE,EAAU,GAAI,GAAI,GAA2B,CAC/C,eAAgB,EAAM,aAAe,2BACrC,YAAa,EAAM,IACnB,gBAAiB,EAAM,aACvB,sBAAuB,EAAM,mBAC7B,mBAAoB,EAAM,gBAC1B,mBAAoB,EAAM,gBAC1B,iBAAkB,CAAC,IAAM,GAA0B,EAAM,eAAgB,IAAM,EAAM,cAAc,YACnG,cAAe,EAAM,WACrB,+BAAgC,EAAM,kBACtC,uBAAwB,EAAM,cAC9B,wBAAyB,EAAM,eAC/B,sBAAuB,EAAM,aAC7B,wBAAyB,EAAM,eAC/B,QAAS,CAAC,IAAM,GAA0B,EAAM,SAAU,IAAM,GAAgB,EAAM,SAAS,YAC/F,2BAA4B,EAAM,iBAClC,mBAAoB,EAAM,UAC1B,uBAAwB,EAAM,aAC9B,wBAAyB,EAAM,cAC/B,+BAAgC,EAAM,qBACtC,sBAAuB,EAAM,aAC7B,kCAAmC,EAAM,wBACzC,kDAAmD,EAAM,qBACzD,4CAA6C,EAAM,eACnD,gDAAiD,EAAM,kBACvD,8CAA+C,EAAM,YACrD,uCAAwC,EAAM,wBAC9C,kDAAmD,CAC/C,IAAM,GAA0B,EAAM,kBACtC,IAAM,EAAM,iBAAiB,YAEjC,sBAAuB,EAAM,aAC7B,gBAAiB,EAAM,QACvB,yBAA0B,EAAM,eAChC,sCAAuC,CACnC,IAAM,GAA0B,EAAM,2BACtC,IAAO,GAAM,0BAA0B,cAAc,MAAM,KAAK,GAAK,KAAK,YAE9E,+BAAgC,EAAM,0BACtC,8BAA+B,EAAM,uBACjC,EAAM,WAAa,QACnB,OAAO,KAAK,EAAM,UAAU,OAAO,CAAC,EAAK,IACrC,GAAI,cAAc,EAAO,iBAAmB,EAAM,SAAS,GACpD,GACR,MAEP,EAAiB,GAAG,GAAU,SAAS,KAAO,EAAS,MAAM,EAAG,IAAM,GAAY,YACtF,EAAiB,GAAa,EAAgB,EAAO,SAAU,IAAM,EAAM,OAAQ,WAAY,IAC/F,EAAiB,GAAa,EAAgB,EAAO,MAAO,IAAM,EAAM,IAAK,SAAU,IACvF,GAAM,GAAQ,GAAI,CACd,OAAQ,CAAC,CAAE,eAEX,EACJ,AAAI,EAAM,OAAS,QACf,GAAO,EAAM,MAEjB,GAAI,GACJ,MAAI,GAAM,OAAS,QACf,GAAW,EAAM,KACjB,EAAO,GAEJ,GAAI,IAAY,CACnB,WACA,WACA,OACA,OAAQ,MACR,UACA,KAAM,EACN,QACA,UAGF,GAAwB,MAAO,EAAQ,IAAY,CACrD,GAAI,EAAO,aAAe,KAAO,EAAO,YAAc,IAClD,MAAO,IAA2B,EAAQ,GAE9C,GAAM,GAAW,GAAI,CACjB,UAAW,GAAoB,GAC/B,eAAgB,CAAC,CAAE,EAAO,QAAQ,4BAEhC,EAAO,GAAc,GAAa,KAAM,IAAU,EAAO,KAAM,IAAW,QAChF,MAAI,GAAK,iBAAmB,GACxB,EAAS,eAAiB,GAErB,EAAK,iBAAsB,QAChC,GAAS,eAAiB,GAAoB,GAAqB,EAAK,kBAE5E,AAAI,EAAK,WAAa,GAClB,EAAS,SAAW,GAEf,EAAK,WAAgB,QAC1B,GAAS,SAAW,GAAc,GAAqB,EAAK,YAE5D,EAAK,YAAiB,QACtB,GAAS,UAAY,GAAa,EAAK,YAEvC,EAAK,eAAoB,QACzB,GAAS,aAAe,GAAa,EAAK,eAE1C,EAAK,cAAmB,QACxB,GAAS,YAAc,GAAa,EAAK,cAEzC,EAAK,SAAc,QACnB,GAAS,OAAS,GAAa,EAAK,SAEpC,EAAK,UAAe,QACpB,GAAS,QAAU,GAAiB,EAAK,UAEzC,EAAK,OAAY,QACjB,GAAS,KAAO,GAAa,EAAK,OAElC,EAAK,aAAkB,QACvB,GAAS,WAAa,GAAa,EAAK,aAExC,EAAK,SAAc,QACnB,GAAS,OAAS,GAAa,EAAK,SAEjC,GAEL,GAA6B,MAAO,EAAQ,IAAY,CAC1D,GAAM,GAAe,IACd,EACH,KAAM,KAAM,IAAe,EAAO,KAAM,IAEtC,EAAY,GAAqB,EAAQ,EAAa,MAC5D,OAAQ,OACC,mBACA,gCACD,KAAM,MAAM,IAAmB,WAE/B,GAAM,GAAa,EAAa,KAChC,MAAO,IAAkB,CACrB,SACA,aACA,gBAIV,GAAsB,MAAO,EAAQ,IAAY,CACnD,GAAI,EAAO,aAAe,KAAO,EAAO,YAAc,IAClD,MAAO,IAAyB,EAAQ,GAE5C,GAAM,GAAW,GAAI,CACjB,UAAW,GAAoB,GAC/B,WAAY,CAAC,CAAE,EAAO,QAAQ,qBAC9B,KAAM,CAAC,CAAE,EAAO,QAAQ,MACxB,cAAe,CAAC,CAAE,EAAO,QAAQ,yBACjC,eAAgB,CAAC,CAAE,EAAO,QAAQ,0BAClC,aAAc,CAAC,CAAE,EAAO,QAAQ,wBAChC,eAAgB,CAAC,CAAE,EAAO,QAAQ,0BAClC,qBAAsB,CAAC,CAAE,EAAO,QAAQ,iCACxC,UAAW,CAAC,CAAE,EAAO,QAAQ,qBAC7B,qBAAsB,CAAC,CAAE,EAAO,QAAQ,oDACxC,kBAAmB,CAAC,CAAE,EAAO,QAAQ,kDACrC,YAAa,CAAC,CAAE,EAAO,QAAQ,gDAC/B,wBAAyB,CAAC,CAAE,EAAO,QAAQ,yCAC3C,iBAAkB,CACd,IAAM,AAAW,EAAO,QAAQ,qDAA1B,OACN,IAAM,GAAa,EAAO,QAAQ,qDAEtC,eAAgB,CAAC,CAAE,EAAO,QAAQ,4BAEtC,YAAM,IAAY,EAAO,KAAM,GACxB,GAEL,GAA2B,MAAO,EAAQ,IAAY,CACxD,GAAM,GAAe,IACd,EACH,KAAM,KAAM,IAAe,EAAO,KAAM,IAEtC,EAAY,GAAqB,EAAQ,EAAa,MACtD,EAAa,EAAa,KAChC,MAAO,IAAkB,CACrB,SACA,aACA,eAGF,GAAoB,GAAkB,IACtC,GAAqB,MAAO,EAAc,IAAY,CACxD,GAAM,GAAW,GAAI,IACf,EAAO,EAAa,KACpB,EAAY,GAAI,IAAa,CAC/B,UAAW,GAAoB,MAC5B,IAEP,MAAO,IAAyB,EAAW,EAAa,OAEtD,GAA2B,CAAC,EAAQ,IAC9B,IAAU,IACb,OAAO,AAAC,GAAM,GAAK,MACnB,IAAI,AAAC,GACC,GAAa,IAGtB,GAAkB,CAAC,EAAQ,IAAY,CACzC,GAAM,GAAW,GACjB,MAAI,GAAO,SAAc,QACrB,GAAS,OAAS,GAAa,EAAO,SAEnC,GAEL,GAAsB,CAAC,EAAQ,IACzB,IAAU,IACb,OAAO,AAAC,GAAM,GAAK,MACnB,IAAI,AAAC,GACC,GAAgB,IAGzB,GAAa,CAAC,EAAQ,IAAY,CACpC,GAAM,GAAW,GACjB,MAAI,GAAO,MAAW,QAClB,GAAS,IAAM,GAAa,EAAO,MAEnC,EAAO,eAAoB,QAC3B,GAAS,aAAe,GAAc,GAA+B,EAAO,gBAE5E,EAAO,OAAY,QACnB,GAAS,KAAO,GAAa,EAAO,OAExC,AAAI,EAAO,oBAAsB,GAC7B,EAAS,kBAAoB,GAExB,EAAO,oBAAyB,QACrC,GAAS,kBAAoB,GAAyB,GAAqB,EAAO,qBAElF,EAAO,OAAY,QACnB,GAAS,KAAO,GAAgB,EAAO,OAEvC,EAAO,eAAoB,QAC3B,GAAS,aAAe,GAAa,EAAO,eAE5C,EAAO,QAAa,QACpB,GAAS,MAAQ,GAAS,EAAO,QAEjC,EAAO,gBAAqB,QAC5B,GAAS,cAAgB,GAAiB,EAAO,gBAE9C,GAEL,GAAgB,CAAC,EAAQ,IACnB,IAAU,IACb,OAAO,AAAC,GAAM,GAAK,MACnB,IAAI,AAAC,GACC,GAAW,IAGpB,GAAW,CAAC,EAAQ,IAAY,CAClC,GAAM,GAAW,GACjB,MAAI,GAAO,cAAmB,QAC1B,GAAS,YAAc,GAAa,EAAO,cAE3C,EAAO,KAAU,QACjB,GAAS,GAAK,GAAa,EAAO,KAE/B,GAEL,GAAmB,CAAC,EAAQ,IAAY,CAC1C,GAAM,GAAW,GACjB,MAAI,GAAO,sBAA2B,QAClC,GAAS,oBAAsB,GAAa,EAAO,sBAEnD,EAAO,oBAAyB,QAChC,GAAS,kBAAoB,GAAc,GAA+B,EAAO,qBAE9E,GAEL,GAAsB,AAAC,GAAY,EACrC,eAAgB,EAAO,WACvB,UAAW,EAAO,QAAQ,qBAAuB,EAAO,QAAQ,sBAAwB,EAAO,QAAQ,oBACvG,kBAAmB,EAAO,QAAQ,cAClC,KAAM,EAAO,QAAQ,iBAEnB,GAAoB,CAAC,EAAY,IAAY,GAAY,EAAY,GAAS,KAAK,AAAC,GAAS,EAAQ,YAAY,IACjH,GAA4B,AAAC,GAAU,AACzC,GAAU,MACV,IAAU,IACT,EAAC,OAAO,oBAAoB,GAAO,SAAS,WAAa,EAAM,QAAU,IACzE,EAAC,OAAO,oBAAoB,GAAO,SAAS,SAAW,EAAM,MAAQ,GACpE,GAAY,CAAC,EAAY,IAAY,GAAkB,EAAY,GAAS,KAAK,AAAC,GAAY,CAChG,GAAI,EAAQ,OAAQ,CAChB,GAAM,GAAS,GAAI,IAAI,UAAU,CAC7B,oBAAqB,GACrB,aAAc,GACd,iBAAkB,GAClB,kBAAmB,GACnB,cAAe,GACf,WAAY,GACZ,kBAAmB,CAAC,EAAG,IAAS,EAAI,SAAW,IAAM,EAAI,SAAS;AAAA,GAAQ,GAAK,SAEnF,EAAO,UAAU,MAAO,MACxB,EAAO,UAAU,MAAO;AAAA,GACxB,GAAM,GAAY,EAAO,MAAM,GACzB,EAAe,QACf,EAAM,OAAO,KAAK,GAAW,GAC7B,EAAoB,EAAU,GACpC,MAAI,GAAkB,IAClB,GAAkB,GAAO,EAAkB,GAC3C,MAAO,GAAkB,IAEtB,GAAqB,GAEhC,MAAO,KAEL,GAAiB,MAAO,EAAW,IAAY,CACjD,GAAM,GAAQ,KAAM,IAAU,EAAW,GACzC,MAAI,GAAM,OACN,GAAM,MAAM,QAAU,EAAM,MAAM,SAAW,EAAM,MAAM,SAEtD,GAEL,GAAuB,CAAC,EAAQ,IAAS,CAC3C,GAAI,GAAM,OAAS,OACf,MAAO,GAAK,KAEhB,GAAI,EAAO,YAAc,IACrB,MAAO,YAIf,YAAwB,EAAS,CAC7B,MAAO,AAAC,IAAS,KAAO,IAAS,CAC7B,GAAI,GAAQ,IAAK,EAAK,OAChB,EAAa,CACf,CACI,OAAQ,iBACR,KAAM,qBAEV,CACI,OAAQ,2BACR,KAAM,gCAGd,OAAW,KAAQ,GAAY,CAC3B,GAAM,GAAQ,EAAM,EAAK,QACzB,GAAI,EAAO,CACP,GAAM,GAAY,YAAY,OAAO,GAC/B,GAAI,YAAW,EAAM,OAAQ,EAAM,WAAY,EAAM,YACrD,MAAO,IAAU,SACb,EAAQ,YAAY,GACpB,GAAI,YAAW,GACnB,EAAU,EAAQ,cAAc,GAChC,EAAO,GAAI,GAAQ,IACzB,EAAK,OAAO,GACZ,EAAQ,IACD,GACF,EAAK,QAAS,GACd,EAAK,MAAO,EAAQ,cAAc,KAAM,GAAK,YAI1D,MAAO,GAAK,IACL,EACH,WAIZ,GAAM,IAAwB,CAC1B,KAAM,iBACN,KAAM,aACN,KAAM,CAAC,OACP,SAAU,IAER,GAAgB,AAAC,GAAY,EAC/B,aAAc,AAAC,GAAgB,CAC3B,EAAY,IAAI,GAAe,GAAS,OAI5C,GACJ,AAAC,UAAU,EAAmB,CAC1B,EAAkB,IAAS,MAC3B,EAAkB,MAAW,QAC7B,EAAkB,OAAY,SAC9B,EAAkB,KAAU,OAC5B,EAAkB,OAAY,WAC/B,IAAsB,IAAoB,KAC7C,GAAI,IACJ,AAAC,UAAU,EAAkB,CACzB,EAAiB,OAAY,SAC7B,EAAiB,QAAa,YAC/B,IAAqB,IAAmB,KAE3C,GAAM,IAA8B,CAChC,GAAkB,MAClB,GAAkB,OAClB,GAAkB,KAClB,GAAkB,QAEhB,GAA4B,CAC9B,GAAkB,MAClB,GAAkB,OAClB,GAAkB,KAClB,GAAkB,QAGhB,GAAiC,CAAC,EAAO,CAAE,0BAAyB,4BAA6B,CACnG,GAAI,CAAC,GAA0B,CAAC,EAAM,GAClC,MAAO,GAA0B,GAAkB,IAAM,OAE7D,GAAM,GAAoB,EAAM,GAChC,GAAI,CAAC,GAA4B,SAAS,GACtC,KAAM,IAAI,OAAM,2BAA2B,oDACrB,OAE1B,MAAO,IAGL,GAA0B,AAAC,GAAc,IAAc,GAAkB,IAAM,cAAgB,kBAAkB,EAAU,gBAE3H,GAAY,CAAC,EAAQ,IAAY,CACnC,GAAM,GAAe,EAAO,cAC5B,OAAW,KAAc,QAAO,KAAK,GACjC,GAAI,IAAiB,EAAW,cAC5B,MAAO,GAGf,MAAO,IAGL,GAAc,AAAC,GAAS,IAAS,QAAa,MAAO,IAAS,UAAY,CAAC,YAAY,OAAO,IAAS,CAAC,GAAc,GAE5H,AAgBA,GAAI,IAAkB,SAAS,EAAG,EAAG,CACjC,UAAkB,OAAO,gBACpB,CAAE,UAAW,aAAgB,QAAS,SAAU,EAAG,EAAG,CAAE,EAAE,UAAY,IACvE,SAAU,EAAG,EAAG,CAAE,OAAS,KAAK,GAAG,AAAI,EAAE,eAAe,IAAI,GAAE,GAAK,EAAE,KAClE,GAAgB,EAAG,IAG9B,YAAqB,EAAG,EAAG,CACvB,GAAgB,EAAG,GACnB,YAAc,CAAE,KAAK,YAAc,EACnC,EAAE,UAAY,IAAM,KAAO,OAAO,OAAO,GAAM,GAAG,UAAY,EAAE,UAAW,GAAI,IAGnF,GAAI,IAAa,UAAW,CACxB,UAAa,OAAO,QAAU,SAAkB,EAAG,CAC/C,OAAS,GAAG,EAAI,EAAG,EAAI,UAAU,OAAQ,EAAI,EAAG,IAAK,CACjD,EAAI,UAAU,GACd,OAAS,KAAK,GAAG,AAAI,OAAO,UAAU,eAAe,KAAK,EAAG,IAAI,GAAE,GAAK,EAAE,IAE9E,MAAO,IAEJ,GAAW,MAAM,KAAM,YAGlC,YAAkB,EAAG,EAAG,CACpB,GAAI,GAAI,GACR,OAAS,KAAK,GAAG,AAAI,OAAO,UAAU,eAAe,KAAK,EAAG,IAAM,EAAE,QAAQ,GAAK,GAC9E,GAAE,GAAK,EAAE,IACb,GAAI,GAAK,MAAQ,MAAO,QAAO,uBAA0B,WACrD,OAAS,GAAI,EAAG,EAAI,OAAO,sBAAsB,GAAI,EAAI,EAAE,OAAQ,IAC/D,AAAI,EAAE,QAAQ,EAAE,IAAM,GAAK,OAAO,UAAU,qBAAqB,KAAK,EAAG,EAAE,KACvE,GAAE,EAAE,IAAM,EAAE,EAAE,KAE1B,MAAO,GAGX,YAAsB,EAAY,EAAQ,EAAK,EAAM,CACjD,GAAI,GAAI,UAAU,OAAQ,EAAI,EAAI,EAAI,EAAS,IAAS,KAAO,EAAO,OAAO,yBAAyB,EAAQ,GAAO,EAAM,EAC3H,GAAI,MAAO,UAAY,UAAY,MAAO,SAAQ,UAAa,WAAY,EAAI,QAAQ,SAAS,EAAY,EAAQ,EAAK,OACpH,QAAS,GAAI,EAAW,OAAS,EAAG,GAAK,EAAG,IAAK,AAAI,GAAI,EAAW,KAAI,GAAK,GAAI,EAAI,EAAE,GAAK,EAAI,EAAI,EAAE,EAAQ,EAAK,GAAK,EAAE,EAAQ,KAAS,GAChJ,MAAO,GAAI,GAAK,GAAK,OAAO,eAAe,EAAQ,EAAK,GAAI,EAGhE,YAAmB,EAAY,EAAW,CACtC,MAAO,UAAU,EAAQ,EAAK,CAAE,EAAU,EAAQ,EAAK,IAG3D,YAAsB,EAAa,EAAe,CAC9C,GAAI,MAAO,UAAY,UAAY,MAAO,SAAQ,UAAa,WAAY,MAAO,SAAQ,SAAS,EAAa,GAGpH,YAAqB,EAAS,EAAY,EAAG,EAAW,CACpD,WAAe,EAAO,CAAE,MAAO,aAAiB,GAAI,EAAQ,GAAI,GAAE,SAAU,EAAS,CAAE,EAAQ,KAC/F,MAAO,IAAK,IAAM,GAAI,UAAU,SAAU,EAAS,EAAQ,CACvD,WAAmB,EAAO,CAAE,GAAI,CAAE,EAAK,EAAU,KAAK,UAAkB,EAAP,CAAY,EAAO,IACpF,WAAkB,EAAO,CAAE,GAAI,CAAE,EAAK,EAAU,MAAS,UAAkB,EAAP,CAAY,EAAO,IACvF,WAAc,EAAQ,CAAE,EAAO,KAAO,EAAQ,EAAO,OAAS,EAAM,EAAO,OAAO,KAAK,EAAW,GAClG,EAAM,GAAY,EAAU,MAAM,EAAS,GAAc,KAAK,UAItE,YAAuB,EAAS,EAAM,CAClC,GAAI,GAAI,CAAE,MAAO,EAAG,KAAM,UAAW,CAAE,GAAI,EAAE,GAAK,EAAG,KAAM,GAAE,GAAI,MAAO,GAAE,IAAO,KAAM,GAAI,IAAK,IAAM,EAAG,EAAG,EAAG,EAC/G,MAAO,GAAI,CAAE,KAAM,EAAK,GAAI,MAAS,EAAK,GAAI,OAAU,EAAK,IAAM,MAAO,SAAW,YAAe,GAAE,OAAO,UAAY,UAAW,CAAE,MAAO,QAAU,EACvJ,WAAc,EAAG,CAAE,MAAO,UAAU,EAAG,CAAE,MAAO,GAAK,CAAC,EAAG,KACzD,WAAc,EAAI,CACd,GAAI,EAAG,KAAM,IAAI,WAAU,mCAC3B,KAAO,GAAG,GAAI,CACV,GAAI,EAAI,EAAG,GAAM,GAAI,EAAG,GAAK,EAAI,EAAE,OAAY,EAAG,GAAK,EAAE,OAAc,IAAI,EAAE,SAAc,EAAE,KAAK,GAAI,GAAK,EAAE,OAAS,CAAE,GAAI,EAAE,KAAK,EAAG,EAAG,KAAK,KAAM,MAAO,GAE3J,OADI,EAAI,EAAG,GAAG,GAAK,CAAC,EAAG,GAAK,EAAG,EAAE,QACzB,EAAG,QACF,OAAQ,GAAG,EAAI,EAAI,UACnB,GAAG,SAAE,QAAgB,CAAE,MAAO,EAAG,GAAI,KAAM,QAC3C,GAAG,EAAE,QAAS,EAAI,EAAG,GAAI,EAAK,CAAC,GAAI,aACnC,GAAG,EAAK,EAAE,IAAI,MAAO,EAAE,KAAK,MAAO,iBAEpC,GAAM,EAAI,EAAE,KAAM,IAAI,EAAE,OAAS,GAAK,EAAE,EAAE,OAAS,KAAQ,GAAG,KAAO,GAAK,EAAG,KAAO,GAAI,CAAE,EAAI,EAAG,SACjG,GAAI,EAAG,KAAO,GAAM,EAAC,GAAM,EAAG,GAAK,EAAE,IAAM,EAAG,GAAK,EAAE,IAAM,CAAE,EAAE,MAAQ,EAAG,GAAI,MAC9E,GAAI,EAAG,KAAO,GAAK,EAAE,MAAQ,EAAE,GAAI,CAAE,EAAE,MAAQ,EAAE,GAAI,EAAI,EAAI,MAC7D,GAAI,GAAK,EAAE,MAAQ,EAAE,GAAI,CAAE,EAAE,MAAQ,EAAE,GAAI,EAAE,IAAI,KAAK,GAAK,MAC3D,AAAI,EAAE,IAAI,EAAE,IAAI,MAChB,EAAE,KAAK,MAAO,SAEtB,EAAK,EAAK,KAAK,EAAS,SACnB,EAAP,CAAY,EAAK,CAAC,EAAG,GAAI,EAAI,SAAK,CAAU,EAAI,EAAI,EACtD,GAAI,EAAG,GAAK,EAAG,KAAM,GAAG,GAAI,MAAO,CAAE,MAAO,EAAG,GAAK,EAAG,GAAK,OAAQ,KAAM,KAIlF,YAA2B,EAAG,EAAG,EAAG,EAAI,CACpC,AAAI,IAAO,QAAW,GAAK,GAC3B,EAAE,GAAM,EAAE,GAGd,YAAwB,EAAG,EAAS,CAChC,OAAS,KAAK,GAAG,AAAI,IAAM,WAAa,CAAC,EAAQ,eAAe,IAAI,GAAQ,GAAK,EAAE,IAGvF,YAAoB,EAAG,CACnB,GAAI,GAAI,MAAO,SAAW,YAAc,OAAO,SAAU,EAAI,GAAK,EAAE,GAAI,EAAI,EAC5E,GAAI,EAAG,MAAO,GAAE,KAAK,GACrB,GAAI,GAAK,MAAO,GAAE,QAAW,SAAU,MAAO,CAC1C,KAAM,UAAY,CACd,MAAI,IAAK,GAAK,EAAE,QAAQ,GAAI,QACrB,CAAE,MAAO,GAAK,EAAE,KAAM,KAAM,CAAC,KAG5C,KAAM,IAAI,WAAU,EAAI,0BAA4B,mCAGxD,YAAkB,EAAG,EAAG,CACpB,GAAI,GAAI,MAAO,SAAW,YAAc,EAAE,OAAO,UACjD,GAAI,CAAC,EAAG,MAAO,GACf,GAAI,GAAI,EAAE,KAAK,GAAI,EAAG,EAAK,GAAI,EAC/B,GAAI,CACA,KAAQ,KAAM,QAAU,KAAM,IAAM,CAAE,GAAI,EAAE,QAAQ,MAAM,EAAG,KAAK,EAAE,aAEjE,EAAP,CAAgB,EAAI,CAAE,MAAO,UAC7B,CACI,GAAI,CACA,AAAI,GAAK,CAAC,EAAE,MAAS,GAAI,EAAE,SAAY,EAAE,KAAK,UAElD,CAAU,GAAI,EAAG,KAAM,GAAE,OAE7B,MAAO,GAGX,aAAsB,CAClB,OAAS,GAAK,GAAI,EAAI,EAAG,EAAI,UAAU,OAAQ,IAC3C,EAAK,EAAG,OAAO,GAAS,UAAU,KACtC,MAAO,GAGX,aAA4B,CACxB,OAAS,GAAI,EAAG,EAAI,EAAG,EAAK,UAAU,OAAQ,EAAI,EAAI,IAAK,GAAK,UAAU,GAAG,OAC7E,OAAS,GAAI,MAAM,GAAI,EAAI,EAAG,EAAI,EAAG,EAAI,EAAI,IACzC,OAAS,GAAI,UAAU,GAAI,EAAI,EAAG,EAAK,EAAE,OAAQ,EAAI,EAAI,IAAK,IAC1D,EAAE,GAAK,EAAE,GACjB,MAAO,GAEX,YAAmB,EAAG,CAClB,MAAO,gBAAgB,IAAa,MAAK,EAAI,EAAG,MAAQ,GAAI,IAAU,GAG1E,YAA4B,EAAS,EAAY,EAAW,CACxD,GAAI,CAAC,OAAO,cAAe,KAAM,IAAI,WAAU,wCAC/C,GAAI,GAAI,EAAU,MAAM,EAAS,GAAc,IAAK,EAAG,EAAI,GAC3D,MAAO,GAAI,GAAI,EAAK,QAAS,EAAK,SAAU,EAAK,UAAW,EAAE,OAAO,eAAiB,UAAY,CAAE,MAAO,OAAS,EACpH,WAAc,EAAG,CAAE,AAAI,EAAE,IAAI,GAAE,GAAK,SAAU,EAAG,CAAE,MAAO,IAAI,SAAQ,SAAU,EAAG,EAAG,CAAE,EAAE,KAAK,CAAC,EAAG,EAAG,EAAG,IAAM,GAAK,EAAO,EAAG,OAC9H,WAAgB,EAAG,EAAG,CAAE,GAAI,CAAE,EAAK,EAAE,GAAG,UAAc,EAAP,CAAY,EAAO,EAAE,GAAG,GAAI,IAC3E,WAAc,EAAG,CAAE,EAAE,gBAAiB,IAAY,QAAQ,QAAQ,EAAE,MAAM,GAAG,KAAK,EAAS,GAAU,EAAO,EAAE,GAAG,GAAI,GACrH,WAAiB,EAAO,CAAE,EAAO,OAAQ,GACzC,WAAgB,EAAO,CAAE,EAAO,QAAS,GACzC,WAAgB,EAAG,EAAG,CAAE,AAAI,EAAE,GAAI,EAAE,QAAS,EAAE,QAAQ,EAAO,EAAE,GAAG,GAAI,EAAE,GAAG,KAGhF,YAA4B,EAAG,CAC3B,GAAI,GAAG,EACP,MAAO,GAAI,GAAI,EAAK,QAAS,EAAK,QAAS,SAAU,EAAG,CAAE,KAAM,KAAO,EAAK,UAAW,EAAE,OAAO,UAAY,UAAY,CAAE,MAAO,OAAS,EAC1I,WAAc,EAAG,EAAG,CAAE,EAAE,GAAK,EAAE,GAAK,SAAU,EAAG,CAAE,MAAQ,GAAI,CAAC,GAAK,CAAE,MAAO,GAAU,EAAE,GAAG,IAAK,KAAM,IAAM,UAAa,EAAI,EAAE,GAAK,GAAO,GAGjJ,YAAyB,EAAG,CACxB,GAAI,CAAC,OAAO,cAAe,KAAM,IAAI,WAAU,wCAC/C,GAAI,GAAI,EAAE,OAAO,eAAgB,EACjC,MAAO,GAAI,EAAE,KAAK,GAAM,GAAI,MAAO,KAAe,WAAa,GAAW,GAAK,EAAE,OAAO,YAAa,EAAI,GAAI,EAAK,QAAS,EAAK,SAAU,EAAK,UAAW,EAAE,OAAO,eAAiB,UAAY,CAAE,MAAO,OAAS,GAClN,WAAc,EAAG,CAAE,EAAE,GAAK,EAAE,IAAM,SAAU,EAAG,CAAE,MAAO,IAAI,SAAQ,SAAU,EAAS,EAAQ,CAAE,EAAI,EAAE,GAAG,GAAI,EAAO,EAAS,EAAQ,EAAE,KAAM,EAAE,UAChJ,WAAgB,EAAS,EAAQ,EAAG,EAAG,CAAE,QAAQ,QAAQ,GAAG,KAAK,SAAS,EAAG,CAAE,EAAQ,CAAE,MAAO,EAAG,KAAM,KAAS,IAGtH,YAAgC,EAAQ,EAAK,CACzC,MAAI,QAAO,eAAkB,OAAO,eAAe,EAAQ,MAAO,CAAE,MAAO,IAAiB,EAAO,IAAM,EAClG,EAEX,YAAwB,EAAK,CACzB,GAAI,GAAO,EAAI,WAAY,MAAO,GAClC,GAAI,GAAS,GACb,GAAI,GAAO,KAAM,OAAS,KAAK,GAAK,AAAI,OAAO,eAAe,KAAK,EAAK,IAAI,GAAO,GAAK,EAAI,IAC5F,SAAO,QAAU,EACV,EAGX,YAA2B,EAAK,CAC5B,MAAQ,IAAO,EAAI,WAAc,EAAM,CAAE,QAAS,GAGtD,YAAkC,EAAU,EAAY,CACpD,GAAI,CAAC,EAAW,IAAI,GAChB,KAAM,IAAI,WAAU,kDAExB,MAAO,GAAW,IAAI,GAG1B,YAAkC,EAAU,EAAY,EAAO,CAC3D,GAAI,CAAC,EAAW,IAAI,GAChB,KAAM,IAAI,WAAU,kDAExB,SAAW,IAAI,EAAU,GAClB,EAGX,GAAI,IAA2B,OAAO,OAAO,CACzC,UAAW,KACX,UAAW,MACP,WAAY,CAAE,MAAO,KACzB,OAAQ,GACR,WAAY,GACZ,QAAS,GACT,WAAY,GACZ,UAAW,GACX,YAAa,GACb,gBAAiB,GACjB,aAAc,GACd,SAAU,GACV,OAAQ,GACR,SAAU,GACV,eAAgB,GAChB,QAAS,GACT,iBAAkB,GAClB,iBAAkB,GAClB,cAAe,GACf,qBAAsB,GACtB,aAAc,GACd,gBAAiB,GACjB,uBAAwB,GACxB,uBAAwB,KAGxB,GAAa,GAAqB,SAAU,EAAQ,EAAS,CAGjE,OAAO,eAAe,EAAS,aAAc,CAAE,MAAO,KACtD,EAAQ,UAAY,OAIpB,GAAI,GAA2B,UAAY,CACvC,YAAqB,CACjB,KAAK,OAAS,GAAI,IAAQ,OAE9B,SAAU,UAAU,OAAS,SAAU,EAAQ,CAC3C,AAAK,AAvwIb,GAuwIgB,GAAQ,aAAa,IAE7B,KAAK,OAAO,OAAQ,AAzwI5B,GAywI+B,GAAQ,iBAAiB,KAEpD,EAAU,UAAU,OAAS,UAAY,CACrC,MAAO,IAAY,UAAU,KAAM,OAAQ,OAAQ,UAAY,CAC3D,MAAO,IAAY,YAAY,KAAM,SAAU,EAAI,CAC/C,MAAO,CAAC,EAAe,AA9wIvC,GA8wI0C,GAAQ,YAAY,KAAK,OAAO,gBAItE,EAAU,UAAU,MAAQ,UAAY,CACpC,KAAK,OAAS,GAAI,IAAQ,QAEvB,KAEX,EAAQ,UAAY,IAIhB,GAAU,GAAqB,SAAU,EAAQ,EAAS,CAG9D,OAAO,eAAe,EAAS,aAAc,CAAE,MAAO,KACtD,EAAQ,UAAY,EAAQ,OAAS,EAAQ,OAAS,OAGtD,WAAgB,EAAM,CAClB,MAAO,IAAI,KAAS,OAAO,GAAM,SAErC,EAAQ,OAAS,EACjB,GAAI,GAAwB,UAAY,CACpC,YAAkB,CACd,KAAK,SAAW,WAEpB,SAAO,UAAU,OAAS,SAAU,EAAM,CACtC,GAAI,GAAK,EACT,GAAI,CACA,OAAS,GAAS,GAAY,SAAS,GAAO,EAAW,EAAO,OAAQ,CAAC,EAAS,KAAM,EAAW,EAAO,OAAQ,CAC9G,GAAI,GAAO,EAAS,MACpB,KAAK,SACA,KAAK,WAAa,EAAK,EAAa,MAAK,SAAW,GAAQ,YAGlE,EAAP,CAAgB,EAAM,CAAE,MAAO,UAC/B,CACI,GAAI,CACA,AAAI,GAAY,CAAC,EAAS,MAAS,GAAK,EAAO,SAAS,EAAG,KAAK,UAEpE,CAAU,GAAI,EAAK,KAAM,GAAI,OAEjC,MAAO,OAEX,EAAO,UAAU,OAAS,UAAY,CAClC,MAAQ,MAAK,SAAW,cAAgB,GAErC,KAEX,EAAQ,OAAS,EAEjB,GAAI,GAAgB,CAChB,EAAY,WAAY,WAAY,UAAY,WAAY,UAAY,UAAY,WACpF,WAAY,WAAY,WAAY,WAAY,WAAY,WAAY,WAAY,WACpF,UAAY,WAAY,WAAY,SAAY,WAAY,UAAY,UAAY,WACpF,WAAY,WAAY,WAAY,WAAY,WAAY,WAAY,WAAY,WACpF,UAAY,WAAY,WAAY,UAAY,WAAY,UAAY,UAAY,WACpF,WAAY,WAAY,WAAY,WAAY,WAAY,WAAY,WAAY,WACpF,UAAY,WAAY,WAAY,UAAY,WAAY,SAAY,UAAY,WACpF,WAAY,WAAY,WAAY,WAAY,WAAY,WAAY,WAAY,WACpF,WAAY,WAAY,WAAY,WAAY,WAAY,WAAY,WAAY,WACpF,WAAY,UAAY,UAAY,WAAY,UAAY,WAAY,WAAY,UACpF,WAAY,WAAY,WAAY,WAAY,WAAY,WAAY,WAAY,WACpF,WAAY,UAAY,UAAY,WAAY,UAAY,WAAY,WAAY,UACpF,WAAY,WAAY,WAAY,WAAY,WAAY,WAAY,WAAY,WACpF,WAAY,UAAY,UAAY,WAAY,UAAY,WAAY,WAAY,WACpF,WAAY,WAAY,WAAY,WAAY,WAAY,WAAY,WAAY,WACpF,WAAY,UAAY,UAAY,WAAY,WAAY,WAAY,WAAY,UACpF,WAAY,WAAY,WAAY,WAAY,WAAY,WAAY,WAAY,WACpF,UAAY,WAAY,WAAY,UAAY,WAAY,WAAY,UAAY,WACpF,WAAY,WAAY,WAAY,WAAY,WAAY,WAAY,WAAY,WACpF,UAAY,WAAY,WAAY,UAAY,WAAY,UAAY,WAAY,WACpF,WAAY,WAAY,WAAY,WAAY,WAAY,WAAY,WAAY,WACpF,UAAY,WAAY,WAAY,WAAY,WAAY,UAAY,UAAY,WACpF,WAAY,WAAY,WAAY,WAAY,WAAY,WAAY,WAAY,WACpF,UAAY,WAAY,WAAY,UAAY,WAAY,UAAY,UAAY,WACpF,WAAY,UAAY,UAAY,WAAY,SAAY,WAAY,WAAY,UACpF,WAAY,WAAY,WAAY,WAAY,WAAY,WAAY,WAAY,WACpF,WAAY,UAAY,UAAY,WAAY,UAAY,WAAY,WAAY,UACpF,WAAY,WAAY,WAAY,WAAY,WAAY,WAAY,WAAY,WACpF,WAAY,UAAY,SAAY,WAAY,UAAY,WAAY,WAAY,UACpF,WAAY,WAAY,WAAY,WAAY,WAAY,WAAY,WAAY,WACpF,WAAY,SAAY,UAAY,WAAY,UAAY,WAAY,WAAY,UACpF,WAAY,WAAY,WAAY,WAAY,WAAY,WAAY,WAAY,YAEpF,EAAe,AAr2InB,GAq2IsB,GAAQ,iBAAiB,GAE/C,OAAO,eAAe,EAAS,YAAa,CAAE,WAAY,GAAM,IAAK,UAAY,CAAE,MAAO,IAAW,eAI/F,GAAkC,CAAC,EAAmB,IAAY,GACnE,GAAkB,KAAM,EAAO,KAC/B,GAAkB,OAAQ,GAAQ,UAClC,GAAkB,QAAS,GAAQ,WACnC,GAAkB,MAAO,EAAO,MAChC,GAAkB,QAAS,EAAO,SACrC,GAEI,GAAe,CAAC,EAAqB,IAAS,CAChD,GAAM,GAAO,GAAI,GACjB,SAAK,OAAO,GAAa,GAAQ,KAC1B,EAAK,UAGV,GAAc,MAAO,EAAM,CAAE,eAAc,sBAAqB,mBAAoB,CACtF,GAAM,GAAS,GAAY,GAAQ,EAAa,EAAqB,GAAQ,GAAa,EAAqB,GAC/G,MAAO,GAAc,KAAM,KAGzB,GAAsC,CAAC,EAAqB,KAAO,CACrE,GAAM,GAA0B,GAChC,OAAW,KAAa,IACpB,AAAI,CAAC,EAAmB,SAAS,IAAc,CAAC,GAA4B,SAAS,IAGrF,EAAwB,KAAK,GAEjC,MAAO,IAGL,GAA+B,MAAO,EAAU,CAAE,SAAQ,wBAAyB,CACrF,GAAM,GAAqB,GAAoC,GACzD,CAAE,KAAM,EAAc,QAAS,GAAoB,EACzD,OAAW,KAAa,GAAoB,CACxC,GAAM,GAAiB,GAAwB,GACzC,EAAuB,EAAgB,GAC7C,GAAI,EAAsB,CACtB,GAAM,GAAsB,GAAgC,EAAW,GACjE,CAAE,eAAc,iBAAkB,EAClC,EAAW,KAAM,IAAY,EAAc,CAAE,eAAc,sBAAqB,kBACtF,GAAI,IAAa,EACb,MAEJ,KAAM,IAAI,OAAM,gCAAgC,oBAA2B,0BAC/C,UAKlC,GAA8B,CAAC,EAAQ,IAAqB,AAAC,GAAS,KAAO,IAAS,CACxF,GAAI,CAAC,GAAY,WAAW,EAAK,SAC7B,MAAO,GAAK,GAEhB,GAAM,CAAE,WAAY,EACd,CAAE,KAAM,EAAa,WAAY,EACjC,CAAE,gBAAe,gBAAiB,EAClC,CAAE,QAAO,0BAAyB,0BAA2B,EAC7D,EAAoB,GAA+B,EAAO,CAC5D,0BACA,2BAEA,EAAc,EACd,EAAiB,EACrB,GAAI,EAAmB,CACnB,GAAM,GAAuB,GAAwB,GAC/C,EAAsB,GAAgC,EAAmB,GAC/E,GAAI,GAAY,GAAc,CAC1B,GAAM,CAAE,8BAA6B,qBAAsB,EAC3D,EAAc,EAA4B,EAAa,CACnD,gBACA,oBACA,uBACA,sBACA,iBAEJ,EAAiB,IACV,EACH,mBAAoB,EAAQ,oBACtB,GAAG,EAAQ,kCACX,cACN,oBAAqB,UACrB,+BAAgC,EAAQ,kBACxC,uBAAwB,qCACxB,gBAAiB,GAErB,MAAO,GAAe,0BAEjB,CAAC,GAAU,EAAsB,GAAU,CAChD,GAAM,GAAc,KAAM,IAAa,EAAqB,GAC5D,EAAiB,IACV,GACF,GAAuB,EAAc,KAIlD,GAAM,GAAS,KAAM,GAAK,IACnB,EACH,QAAS,IACF,EACH,QAAS,EACT,KAAM,KAGR,CAAE,8BAA6B,sBAAuB,EAC5D,MAAI,IAA+B,EAAM,KAAiC,WACtE,GAA6B,EAAO,SAAU,CAC1C,SACA,uBAGD,GAGL,GAAqC,CACvC,KAAM,8BACN,KAAM,QACN,KAAM,CAAC,iBACP,SAAU,IAER,GAA6B,CAAC,EAAQ,IAAsB,EAC9D,aAAc,AAAC,GAAgB,CAC3B,EAAY,IAAI,GAA4B,EAAQ,GAAmB,OAI/E,gBAAiC,GAAQ,OAC9B,mCAAmC,CACtC,MAAO,CACH,OAAQ,CAAE,KAAM,gBAAiB,KAAM,UACvC,eAAgB,CAAE,KAAM,sBAAuB,KAAM,kBACrD,aAAc,CAAE,KAAM,sBAAuB,KAAM,gBACnD,+BAAgC,CAAE,KAAM,sBAAuB,KAAM,kCACrE,WAAY,CAAE,KAAM,sBAAuB,KAAM,yBACjD,kBAAmB,CAAE,KAAM,gBAAiB,KAAM,qBAClD,QAAS,CAAE,KAAM,gBAAiB,KAAM,mBACxC,SAAU,CAAE,KAAM,gBAAiB,KAAM,YACzC,OAAQ,CAAE,KAAM,gBAAiB,KAAM,UACvC,aAAc,CAAE,KAAM,gBAAiB,KAAM,yBAGrD,YAAY,EAAO,CACf,QACA,KAAK,MAAQ,EAEjB,kBAAkB,EAAa,EAAe,EAAS,CACnD,KAAK,gBAAgB,IAAI,GAAe,EAAe,KAAK,UAAW,KAAK,cAC5E,KAAK,gBAAgB,IAAI,GAAkB,EAAe,GAAmB,qCAC7E,GAAM,GAAQ,EAAY,OAAO,KAAK,iBAChC,CAAE,UAAW,EAGb,EAA0B,CAC5B,SACA,WAJe,WAKf,YAJgB,qBAKhB,wBAAyB,AAAC,GAAM,EAChC,yBAA0B,AAAC,GAAM,GAE/B,CAAE,kBAAmB,EAC3B,MAAO,GAAM,QAAQ,AAAC,GAAY,EAAe,OAAO,EAAQ,QAAS,GAAW,IAAK,GAE7F,UAAU,EAAO,EAAS,CACtB,MAAO,IAAsB,EAAO,GAExC,YAAY,EAAQ,EAAS,CACzB,MAAO,IAAsB,EAAQ,KAI7C,gBAA+B,GAAQ,OAC5B,mCAAmC,CACtC,MAAO,CACH,OAAQ,CAAE,KAAM,gBAAiB,KAAM,UACvC,eAAgB,CAAE,KAAM,sBAAuB,KAAM,kBACrD,aAAc,CAAE,KAAM,sBAAuB,KAAM,gBACnD,+BAAgC,CAAE,KAAM,sBAAuB,KAAM,kCACrE,WAAY,CAAE,KAAM,sBAAuB,KAAM,yBACjD,kBAAmB,CAAE,KAAM,gBAAiB,KAAM,qBAClD,QAAS,CAAE,KAAM,gBAAiB,KAAM,mBACxC,SAAU,CAAE,KAAM,gBAAiB,KAAM,YACzC,OAAQ,CAAE,KAAM,gBAAiB,KAAM,UACvC,aAAc,CAAE,KAAM,gBAAiB,KAAM,yBAGrD,YAAY,EAAO,CACf,QACA,KAAK,MAAQ,EAEjB,kBAAkB,EAAa,EAAe,EAAS,CACnD,KAAK,gBAAgB,IAAI,GAAe,EAAe,KAAK,UAAW,KAAK,cAC5E,KAAK,gBAAgB,IAAI,GAAkB,EAAe,GAAiB,qCAC3E,KAAK,gBAAgB,IAAI,MACzB,KAAK,gBAAgB,IAAI,GAAc,IACvC,KAAK,gBAAgB,IAAI,GAA2B,EAAe,CAC/D,MAAO,KAAK,MACZ,uBAAwB,oBACxB,wBAAyB,MAE7B,GAAM,GAAQ,EAAY,OAAO,KAAK,iBAChC,CAAE,UAAW,EAGb,EAA0B,CAC5B,SACA,WAJe,WAKf,YAJgB,mBAKhB,wBAAyB,GACzB,yBAA0B,IAExB,CAAE,kBAAmB,EAC3B,MAAO,GAAM,QAAQ,AAAC,GAAY,EAAe,OAAO,EAAQ,QAAS,GAAW,IAAK,GAE7F,UAAU,EAAO,EAAS,CACtB,MAAO,IAAoB,EAAO,GAEtC,YAAY,EAAQ,EAAS,CACzB,MAAO,IAAoB,EAAQ,KC9jJ3C,GAAM,IAAkC,AAAC,GAC9B,KACA,EACH,qBAAsB,EAAQ,sBAAwB,GACtD,gBAAiB,EAAQ,iBAAmB,GAC5C,mBAAoB,qBAItB,GAAO,mCACP,GAAc,uFACd,GAAU,UACV,GAAU,CACd,MAAO,mEACP,YAAa,2BACb,aAAc,UACd,WAAY,0BACZ,qBAAsB,mEACtB,cAAe,6BACf,wBAAyB,4CACzB,MAAO,0CACP,eAAgB,4BAChB,kBAAmB,6EACnB,WAAY,4DAER,GAAO,sBACP,GAAQ,0BACR,GAAS,qBACT,GAAc,GACd,GAAe,CACnB,6BAA8B,QAC9B,wBAAyB,QACzB,sBAAuB,UACvB,oCAAqC,UACrC,kCAAmC,UACnC,6BAA8B,UAC9B,0CAA2C,UAC3C,8BAA+B,UAC/B,iCAAkC,UAClC,iBAAkB,UAClB,0BAA2B,UAC3B,mCAAoC,UACpC,gCAAiC,UACjC,0BAA2B,SAC3B,6BAA8B,SAC9B,oBAAqB,SACrB,6BAA8B,SAC9B,oCAAqC,SACrC,8BAA+B,SAC/B,2BAA4B,SAC5B,2BAA4B,SAC5B,2BAA4B,SAC5B,+BAAgC,SAChC,4BAA6B,SAC7B,wBAAyB,SACzB,wBAAyB,SACzB,gBAAiB,SACjB,qBAAsB,SACtB,sBAAuB,SACvB,mCAAoC,SACpC,gCAAiC,SACjC,qCAAsC,SACtC,kCAAmC,SACnC,qBAAsB,SACtB,oBAAqB,SACrB,MAAO,UAEH,GAAkB,CACtB,sBAAuB,UACvB,iDAAkD,SAClD,mBAAoB,QACpB,cAAe,UACf,eAAgB,SAChB,cAAe,YACf,aAAc,QACd,gBAAiB,SACjB,OAAQ,QACR,QAAS,UACT,WAAY,UAER,GAAU,CACd,KAAM,YAEF,GAAgB,CACpB,OAAQ,CACN,eAAgB,CACd,wBAIA,GAAQ,CACZ,aAEI,GAAS,CACb,KAAM,8BACN,IAAK,sCAED,GAAU,aACV,GAAU,CACd,0BAA2B,mCAEvB,GAAW,iFACX,GAAa,CACjB,KAAM,MACN,IAAK,2CACL,UAAW,mCAET,GAAc,CAChB,KAAM,GACN,YAAa,GACb,QAAS,GACT,QAAS,GACT,KAAM,GACN,MAAO,GACP,OAAQ,GACR,YAAa,GACb,aAAc,GACd,gBAAiB,GACjB,QAAS,GACT,cAAe,GACf,MAAO,GACP,OAAQ,GACR,QAAS,GACT,QAAS,GACT,eAAgB,CAChB,0BAA2B,kCAE3B,SAAU,GACV,WAAY,IAGR,GAAI,WAAY,GAAI,KAAM,GAAI,OAAQ,GAAI,MAC1C,GAAI,kBAAmB,GAAI,OAAQ,GAAI,QAAS,GAAI,WAAY,GAAI,EAAG,IAAI,GAAO,KAAQ,UAAY,GAAI,EAAG,IAAI,GAAM,QAAW,GAAO,KAAQ,WAAa,GAAI,EAAG,IAAI,YAAc,GAAI,EAAG,IAAI,iBAAkB,IAAI,CAAC,EAAG,IAAI,WAAa,KAAS,GAAI,EAAG,IAAI,iBAAkB,IAAI,CAAC,EAAG,IAAI,gBAAkB,KAAS,GAAI,GAAI,GAAI,EAAG,IAAI,iBAAkB,IAAI,CAAC,GAAM,EAAG,IAAI,WAAY,IAAI,CAAC,EAAG,IAAI,IAAK,mBAAsB,GAAI,EAAG,IAAI,iBAAkB,IAAI,CAAC,GAAM,EAAG,IAAI,WAAY,IAAI,CAAC,EAAG,IAAI,IAAK,wBAA2B,GAAI,CAAC,IAAI,GAAI,CAAC,IAAI,GAAI,CAAC,IACliB,GAAQ,CAAE,QAAS,MAAO,WAAY,CAAE,OAAQ,GAAG,aAAc,GAAG,QAAS,GAAG,SAAU,IAAK,MAAO,CAAC,CAAE,WAAY,CAAC,EAAG,IAAI,iBAAkB,IAAI,CAAC,EAAG,IAAI,WAAa,OAAQ,KAAM,KAAM,GAAG,MAAO,CAAC,CAAE,WAAY,CAAC,EAAG,IAAI,SAAU,IAAI,IAAK,EAAG,IAAI,YAAa,IAAI,GAAG,OAAQ,QAAU,KAAM,GAAG,MAAO,CAAC,CAAE,WAAY,GAAG,MAAO,oEAAqE,KAAM,IAAK,CAAE,KAAM,GAAG,MAAO,CAAC,CAAE,WAAY,GAAG,MAAO,yEAA0E,KAAM,IAAK,CAAE,SAAU,CAAE,IAAK,GAAG,WAAY,GAAG,QAAS,IAAK,KAAM,QAAW,CAAE,WAAY,CAAC,GAAG,IAAI,KAAM,GAAG,MAAO,CAAC,CAAE,WAAY,CAAC,GAAG,IAAI,KAAM,GAAG,MAAO,CAAC,CAAE,SAAU,CAAE,IAAK,8EAA+E,WAAY,GAAG,QAAS,IAAK,KAAM,MAAQ,CAAE,MAAO,kFAAmF,KAAM,MAAQ,CAAE,WAAY,GAAG,KAAM,GAAG,MAAO,CAAC,CAAE,WAAY,CAAC,IAAI,KAAM,GAAG,MAAO,CAAC,CAAE,KAAM,GAAG,MAAO,CAAC,CAAE,SAAU,CAAE,IAAK,qEAAsE,WAAY,GAAG,QAAS,IAAK,KAAM,QAAW,CAAE,MAAO,2DAA4D,KAAM,MAAQ,CAAE,WAAY,GAAG,KAAM,GAAG,MAAO,CAAC,CAAE,WAAY,CAAC,IAAI,KAAM,GAAG,MAAO,CAAC,CAAE,SAAU,CAAE,IAAK,yEAA0E,WAAY,GAAG,QAAS,IAAK,KAAM,MAAQ,CAAE,MAAO,qEAAsE,KAAM,MAAQ,CAAE,SAAU,CAAE,IAAK,gEAAiE,WAAY,GAAG,QAAS,IAAK,KAAM,QACpnD,GAAU,GAEV,GAA0B,CAAC,EAAgB,EAAU,KAChD,GAAgB,GAAS,CAC5B,eAAgB,EAChB,OAAQ,EAAQ,SAIlB,GAAmB,AAAC,GAAY,EAClC,WAAY,aACZ,cAAe,GAAQ,eAAiB,GACxC,cAAe,GAAQ,eAAiB,GACxC,kBAAmB,GAAQ,mBAAqB,GAChD,iBAAkB,GAAQ,kBAAoB,GAC9C,OAAQ,GAAQ,QAAU,GAAI,IAC9B,UAAW,GAAQ,WAAa,mBAChC,UAAW,GAAQ,WAAa,GAChC,YAAa,GAAQ,aAAe,GACpC,YAAa,GAAQ,aAAe,KAGlC,GAAqB,AAAC,GAAW,CACnC,GAAM,GAAe,GAA0B,GACzC,EAAwB,IAAM,IAAe,KAAK,IAClD,EAAqB,GAAiB,GAC5C,MAAO,IACA,KACA,EACH,QAAS,UACT,eACA,kBAAmB,GAAQ,mBAAqB,GAChD,0BAA2B,GAAQ,2BAA8B,CAAC,GAAM,IAAM,QAAQ,OAAO,GAAI,OAAM,2BACvG,yBAA0B,GAAQ,0BAC9B,GAAiB,CAAE,UAAW,EAAmB,UAAW,cAAe,GAAY,UAC3F,YAAa,GAAQ,aAAe,GACpC,OAAQ,GAAQ,QAAU,GAAgB,qBAC1C,eAAgB,GAAQ,gBAAkB,GAAI,IAAiB,GAC/D,UAAW,GAAQ,WAAc,UAAa,MAAM,MAAyB,WAAa,IAC1F,OAAQ,GAAQ,QAAU,GAAM,OAChC,gBAAiB,GAAQ,iBAAmB,GAC5C,qBAAsB,GAAQ,sBAAyB,KAAM,QAAQ,QAAQ,KAC7E,gBAAiB,GAAQ,iBAAoB,KAAM,QAAQ,QAAQ,OAI3E,gBAAoC,GAAO,CACvC,YAAY,EAAe,CACvB,GAAM,GAAY,GAAmB,GAC/B,EAAY,GAAgC,GAC5C,EAAY,GAAoB,GAChC,EAAY,GAAsB,GAClC,EAAY,GAAmB,GAC/B,EAAY,GAAwB,GACpC,EAAY,GAAqB,GACjC,EAAY,GAAuB,GACzC,MAAM,GACN,KAAK,OAAS,EACd,KAAK,gBAAgB,IAAI,GAAe,KAAK,SAC7C,KAAK,gBAAgB,IAAI,GAAuB,KAAK,SACrD,KAAK,gBAAgB,IAAI,GAAoB,KAAK,SAClD,KAAK,gBAAgB,IAAI,GAAgB,KAAK,SAC9C,KAAK,gBAAgB,IAAI,GAA4B,KAAK,SAC1D,KAAK,gBAAgB,IAAI,GAAmB,KAAK,SAErD,SAAU,CACN,MAAM,YC1Md,oBAA4B,MAAM,CAC9B,YAAY,EAAS,EAAc,GAAM,CACrC,MAAM,GACN,KAAK,YAAc,EACnB,KAAK,KAAO,gBACZ,OAAO,eAAe,KAAM,GAAc,iBAEvC,MAAK,EAAO,EAAc,GAAM,CACnC,MAAO,QAAO,OAAO,GAAI,MAAK,EAAM,QAAS,GAAc,KAInE,gBAAuC,GAAc,CACjD,YAAY,EAAS,EAAc,GAAM,CACrC,MAAM,EAAS,GACf,KAAK,YAAc,EACnB,KAAK,KAAO,2BACZ,OAAO,eAAe,KAAM,GAAyB,aAIvD,GAAQ,AAAC,GAAQ,CACnB,GAAI,GAAO,KACP,MAAO,GAEX,GAAI,MAAM,QAAQ,GACd,MAAO,GAAI,OAAO,AAAC,GAAM,GAAK,MAElC,GAAI,MAAO,IAAQ,SAAU,CACzB,GAAM,GAAS,GACf,OAAW,KAAO,QAAO,KAAK,GAC1B,AAAI,EAAI,IAAQ,MAGhB,GAAO,GAAO,GAAM,EAAI,KAE5B,MAAO,GAEX,MAAO,IAGX,gBAA8C,GAAiB,CAC3D,YAAY,EAAS,CACjB,MAAM,GACN,OAAO,eAAe,KAAM,GAAgC,aAIpE,gBAAqC,GAAgC,CACjE,YAAY,EAAM,CACd,MAAM,CACF,KAAM,yBACN,OAAQ,YACL,IAEP,KAAK,KAAO,yBACZ,KAAK,OAAS,SACd,OAAO,eAAe,KAAM,GAAuB,aAG3D,gBAAwC,GAAgC,CACpE,YAAY,EAAM,CACd,MAAM,CACF,KAAM,4BACN,OAAQ,YACL,IAEP,KAAK,KAAO,4BACZ,KAAK,OAAS,SACd,OAAO,eAAe,KAAM,GAA0B,aAG9D,gBAAqC,GAAgC,CACjE,YAAY,EAAM,CACd,MAAM,CACF,KAAM,yBACN,OAAQ,YACL,IAEP,KAAK,KAAO,yBACZ,KAAK,OAAS,SACd,OAAO,eAAe,KAAM,GAAuB,aAG3D,gBAAqC,GAAgC,CACjE,YAAY,EAAM,CACd,MAAM,CACF,KAAM,yBACN,OAAQ,YACL,IAEP,KAAK,KAAO,yBACZ,KAAK,OAAS,SACd,OAAO,eAAe,KAAM,GAAuB,aAG3D,gBAAwC,GAAgC,CACpE,YAAY,EAAM,CACd,MAAM,CACF,KAAM,4BACN,OAAQ,YACL,IAEP,KAAK,KAAO,4BACZ,KAAK,OAAS,SACd,OAAO,eAAe,KAAM,GAA0B,aAG9D,gBAAuC,GAAgC,CACnE,YAAY,EAAM,CACd,MAAM,CACF,KAAM,2BACN,OAAQ,YACL,IAEP,KAAK,KAAO,2BACZ,KAAK,OAAS,SACd,OAAO,eAAe,KAAM,GAAyB,aAG7D,gBAAwC,GAAgC,CACpE,YAAY,EAAM,CACd,MAAM,CACF,KAAM,4BACN,OAAQ,YACL,IAEP,KAAK,KAAO,4BACZ,KAAK,OAAS,SACd,OAAO,eAAe,KAAM,GAA0B,aAG9D,gBAAuC,GAAgC,CACnE,YAAY,EAAM,CACd,MAAM,CACF,KAAM,2BACN,OAAQ,YACL,IAEP,KAAK,KAAO,2BACZ,KAAK,OAAS,SACd,OAAO,eAAe,KAAM,GAAyB,aAG7D,gBAAwD,GAAgC,CACpF,YAAY,EAAM,CACd,MAAM,CACF,KAAM,4CACN,OAAQ,YACL,IAEP,KAAK,KAAO,4CACZ,KAAK,OAAS,SACd,OAAO,eAAe,KAAM,GAA0C,aAIxE,GAAsC,MAAO,EAAO,IAAY,CAClE,GAAM,GAAU,GAAc,6BAC1B,EACJ,SAAO,KAAK,UAAU,GAAM,IACrB,GAAoB,EAAS,EAAS,IAAK,OAAW,IAE3D,GAAkB,MAAO,EAAO,IAAY,CAC9C,GAAM,GAAU,GAAc,SAC1B,EACJ,SAAO,KAAK,UAAU,GAAM,IACrB,GAAoB,EAAS,EAAS,IAAK,OAAW,IAE3D,GAAsC,MAAO,EAAQ,IAAY,CACnE,GAAI,EAAO,YAAc,IACrB,MAAO,IAAyC,EAAQ,GAE5D,GAAM,GAAO,KAAM,IAAU,EAAO,KAAM,GACtC,EAAW,GACf,SAAW,GAAqC,GAC/B,CACb,UAAW,GAAoB,MAC5B,IAIL,GAA2C,MAAO,EAAQ,IAAY,CACxE,GAAM,GAAe,IACd,EACH,KAAM,KAAM,IAAe,EAAO,KAAM,IAEtC,EAAY,GAAsB,EAAQ,EAAa,MAC7D,OAAQ,OACC,+BACA,yDACD,KAAM,MAAM,IAA+B,OAC1C,6BACA,uDACD,KAAM,MAAM,IAA6B,OACxC,gDACA,0EACD,KAAM,MAAM,IAAgD,OAC3D,gCACA,0DACD,KAAM,MAAM,IAAgC,OAC3C,6BACA,uDACD,KAAM,MAAM,IAA6B,OACxC,gCACA,0DACD,KAAM,MAAM,IAAgC,OAC3C,gCACA,0DACD,KAAM,MAAM,IAAgC,OAC3C,+BACA,yDACD,KAAM,MAAM,IAA+B,WAE3C,GAAM,GAAa,EAAa,KAChC,MAAO,IAAkB,CACrB,SACA,aACA,gBAIV,GAAkB,MAAO,EAAQ,IAAY,CAC/C,GAAI,EAAO,YAAc,IACrB,MAAO,IAAqB,EAAQ,GAExC,GAAM,GAAO,KAAM,IAAU,EAAO,KAAM,GACtC,EAAW,GACf,SAAW,GAAM,GACA,CACb,UAAW,GAAoB,MAC5B,IAIL,GAAuB,MAAO,EAAQ,IAAY,CACpD,GAAM,GAAe,IACd,EACH,KAAM,KAAM,IAAe,EAAO,KAAM,IAEtC,EAAY,GAAsB,EAAQ,EAAa,MAC7D,OAAQ,OACC,+BACA,yDACD,KAAM,MAAM,IAA+B,OAC1C,6BACA,uDACD,KAAM,MAAM,IAA6B,OACxC,gCACA,0DACD,KAAM,MAAM,IAAgC,OAC3C,6BACA,uDACD,KAAM,MAAM,IAA6B,OACxC,6BACA,uDACD,KAAM,MAAM,IAA6B,OACxC,gCACA,0DACD,KAAM,MAAM,IAAgC,OAC3C,gCACA,0DACD,KAAM,MAAM,IAAgC,OAC3C,+BACA,yDACD,KAAM,MAAM,IAA+B,WAE3C,GAAM,GAAa,EAAa,KAChC,MAAO,IAAkB,CACrB,SACA,aACA,gBAIV,GAAiC,MAAO,EAAc,IAAY,CACpE,GAAM,GAAO,EAAa,KACpB,EAAe,GAAM,GACrB,EAAY,GAAI,IAAyB,CAC3C,UAAW,GAAoB,MAC5B,IAEP,MAAO,IAAyB,EAAW,IAEzC,GAA+B,MAAO,EAAc,IAAY,CAClE,GAAM,GAAO,EAAa,KACpB,EAAe,GAAM,GACrB,EAAY,GAAI,IAAuB,CACzC,UAAW,GAAoB,MAC5B,IAEP,MAAO,IAAyB,EAAW,IAEzC,GAAkD,MAAO,EAAc,IAAY,CACrF,GAAM,GAAO,EAAa,KACpB,EAAe,GAAM,GACrB,EAAY,GAAI,IAA0C,CAC5D,UAAW,GAAoB,MAC5B,IAEP,MAAO,IAAyB,EAAW,IAEzC,GAAkC,MAAO,EAAc,IAAY,CACrE,GAAM,GAAO,EAAa,KACpB,EAAe,GAAM,GACrB,EAAY,GAAI,IAA0B,CAC5C,UAAW,GAAoB,MAC5B,IAEP,MAAO,IAAyB,EAAW,IAEzC,GAA+B,MAAO,EAAc,IAAY,CAClE,GAAM,GAAO,EAAa,KACpB,EAAe,GAAM,GACrB,EAAY,GAAI,IAAuB,CACzC,UAAW,GAAoB,MAC5B,IAEP,MAAO,IAAyB,EAAW,IAEzC,GAA+B,MAAO,EAAc,IAAY,CAClE,GAAM,GAAO,EAAa,KACpB,EAAe,GAAM,GACrB,EAAY,GAAI,IAAuB,CACzC,UAAW,GAAoB,MAC5B,IAEP,MAAO,IAAyB,EAAW,IAEzC,GAAkC,MAAO,EAAc,IAAY,CACrE,GAAM,GAAO,EAAa,KACpB,EAAe,GAAM,GACrB,EAAY,GAAI,IAA0B,CAC5C,UAAW,GAAoB,MAC5B,IAEP,MAAO,IAAyB,EAAW,IAEzC,GAAkC,MAAO,EAAc,IAAY,CACrE,GAAM,GAAO,EAAa,KACpB,EAAe,GAAM,GACrB,EAAY,GAAI,IAA0B,CAC5C,UAAW,GAAoB,MAC5B,IAEP,MAAO,IAAyB,EAAW,IAEzC,GAAiC,MAAO,EAAc,IAAY,CACpE,GAAM,GAAO,EAAa,KACpB,EAAe,GAAM,GACrB,EAAY,GAAI,IAAyB,CAC3C,UAAW,GAAoB,MAC5B,IAEP,MAAO,IAAyB,EAAW,IAEzC,GAAiB,CAAC,EAAQ,IACrB,GAAK,EAAQ,CAChB,YAAa,GACb,WAAY,AAAC,GAAM,GAAc,GAAoB,GAAa,KAClE,UAAW,GACX,aAAc,KAGhB,GAAuC,CAAC,EAAQ,IAC3C,GAAK,EAAQ,CAChB,YAAa,AAAC,GAAM,GAAe,GACnC,WAAY,KAGd,GAAsB,AAAC,GAAY,EACrC,eAAgB,EAAO,WACvB,UAAW,EAAO,QAAQ,qBAAuB,EAAO,QAAQ,sBAAwB,EAAO,QAAQ,oBACvG,kBAAmB,EAAO,QAAQ,cAClC,KAAM,EAAO,QAAQ,iBAEnB,GAAoB,CAAC,EAAY,IAAY,GAAY,EAAY,GAAS,KAAK,AAAC,GAAS,EAAQ,YAAY,IACjH,GAAoB,GAAkB,IACtC,GAAsB,MAAO,EAAS,EAAS,EAAM,EAAkB,IAAS,CAClF,GAAM,CAAE,WAAU,WAAW,QAAS,OAAM,KAAM,GAAa,KAAM,GAAQ,WACvE,EAAW,CACb,WACA,WACA,OACA,OAAQ,OACR,KAAM,EAAS,SAAS,KAAO,EAAS,MAAM,EAAG,IAAM,EAAO,EAAW,EACzE,WAEJ,MAAI,KAAqB,QACrB,GAAS,SAAW,GAEpB,IAAS,QACT,GAAS,KAAO,GAEb,GAAI,IAAY,IAE3B,YAAuB,EAAW,CAC9B,MAAO,CACH,eAAgB,6BAChB,eAAgB,6BAA6B,KAGrD,GAAM,IAAY,CAAC,EAAY,IAAY,GAAkB,EAAY,GAAS,KAAK,AAAC,GAChF,EAAQ,OACD,KAAK,MAAM,GAEf,IAEL,GAAiB,MAAO,EAAW,IAAY,CACjD,GAAM,GAAQ,KAAM,IAAU,EAAW,GACzC,SAAM,QAAU,EAAM,SAAW,EAAM,QAChC,GAEL,GAAwB,CAAC,EAAQ,IAAS,CAC5C,GAAM,GAAU,CAAC,EAAQ,IAAQ,OAAO,KAAK,GAAQ,KAAK,AAAC,GAAM,EAAE,gBAAkB,EAAI,eACnF,EAAoB,AAAC,GAAa,CACpC,GAAI,GAAa,EACjB,MAAI,OAAO,IAAe,UACtB,GAAa,EAAW,YAExB,EAAW,QAAQ,MAAQ,GAC3B,GAAa,EAAW,MAAM,KAAK,IAEnC,EAAW,QAAQ,MAAQ,GAC3B,GAAa,EAAW,MAAM,KAAK,IAEnC,EAAW,QAAQ,MAAQ,GAC3B,GAAa,EAAW,MAAM,KAAK,IAEhC,GAEL,EAAY,EAAQ,EAAO,QAAS,oBAC1C,GAAI,IAAc,OACd,MAAO,GAAkB,EAAO,QAAQ,IAE5C,GAAI,EAAK,OAAS,OACd,MAAO,GAAkB,EAAK,MAElC,GAAI,EAAK,SAAc,OACnB,MAAO,GAAkB,EAAK,SAItC,gBAA+C,GAAQ,OAC5C,mCAAmC,CACtC,MAAO,CACH,QAAS,CAAE,KAAM,gBAAiB,KAAM,mBACxC,SAAU,CAAE,KAAM,gBAAiB,KAAM,YACzC,OAAQ,CAAE,KAAM,gBAAiB,KAAM,UACvC,aAAc,CAAE,KAAM,gBAAiB,KAAM,yBAGrD,YAAY,EAAO,CACf,QACA,KAAK,MAAQ,EAEjB,kBAAkB,EAAa,EAAe,EAAS,CACnD,KAAK,gBAAgB,IAAI,GAAe,EAAe,KAAK,UAAW,KAAK,cAC5E,KAAK,gBAAgB,IAAI,GAAkB,EAAe,GAAiC,qCAC3F,GAAM,GAAQ,EAAY,OAAO,KAAK,iBAChC,CAAE,UAAW,EAGb,EAA0B,CAC5B,SACA,WAJe,wBAKf,YAJgB,mCAKhB,wBAAyB,AAAC,GAAM,EAChC,yBAA0B,AAAC,GAAM,GAE/B,CAAE,kBAAmB,EAC3B,MAAO,GAAM,QAAQ,AAAC,GAAY,EAAe,OAAO,EAAQ,QAAS,GAAW,IAAK,GAE7F,UAAU,EAAO,EAAS,CACtB,MAAO,IAAoC,EAAO,GAEtD,YAAY,EAAQ,EAAS,CACzB,MAAO,IAAoC,EAAQ,KAI3D,gBAA2B,GAAQ,OACxB,mCAAmC,CACtC,MAAO,CACH,QAAS,CAAE,KAAM,gBAAiB,KAAM,mBACxC,SAAU,CAAE,KAAM,gBAAiB,KAAM,YACzC,OAAQ,CAAE,KAAM,gBAAiB,KAAM,UACvC,aAAc,CAAE,KAAM,gBAAiB,KAAM,yBAGrD,YAAY,EAAO,CACf,QACA,KAAK,MAAQ,EAEjB,kBAAkB,EAAa,EAAe,EAAS,CACnD,KAAK,gBAAgB,IAAI,GAAe,EAAe,KAAK,UAAW,KAAK,cAC5E,KAAK,gBAAgB,IAAI,GAAkB,EAAe,GAAa,qCACvE,GAAM,GAAQ,EAAY,OAAO,KAAK,iBAChC,CAAE,UAAW,EAGb,EAA0B,CAC5B,SACA,WAJe,wBAKf,YAJgB,eAKhB,wBAAyB,AAAC,GAAM,EAChC,yBAA0B,AAAC,GAAM,GAE/B,CAAE,kBAAmB,EAC3B,MAAO,GAAM,QAAQ,AAAC,GAAY,EAAe,OAAO,EAAQ,QAAS,GAAW,IAAK,GAE7F,UAAU,EAAO,EAAS,CACtB,MAAO,IAAgB,EAAO,GAElC,YAAY,EAAQ,EAAS,CACzB,MAAO,IAAgB,EAAQ,KAIvC,YAAuB,EAAQ,CAC3B,MAAO,SAAQ,IAAI,OAAO,KAAK,GAAQ,OAAO,CAAC,EAAK,IAAS,CACzD,GAAM,GAAkB,EAAO,GAC/B,MAAI,OAAO,IAAoB,SAC3B,EAAI,KAAK,CAAC,EAAM,IAGhB,EAAI,KAAK,IAAkB,KAAK,AAAC,GAAU,CAAC,EAAM,KAE/C,GACR,KAAK,KAAK,AAAC,GAAkB,EAAc,OAAO,CAAC,EAAQ,CAAC,EAAK,KAChE,GAAO,GAAO,EACP,GACR,KAGP,YAA6B,EAAY,CACrC,MAAO,UAAY,CACf,GAAM,CAAE,YAAa,CAAE,cAAc,KAA6B,aAAY,YAAY,KAA2B,gBAAkB,MAAiC,KAAM,GAAW,OAAO,KAAK,GAAI,IAAiC,CACtO,cAAe,EAAW,cAC1B,WAAY,EAAW,WACvB,OAAQ,EAAW,OAAS,KAAM,IAAc,EAAW,QAAU,UAEzE,MAAO,CACH,WAAY,EAAW,WACvB,YAAa,EACb,gBAAiB,EACjB,aAAc,EACd,WAAY,IAIxB,aAAqC,CACjC,KAAM,IAAI,IAAyB,2DAEvC,aAAqC,CACjC,KAAM,IAAI,IAAyB,yDAEvC,aAAmC,CAC/B,KAAM,IAAI,IAAyB,wDAGvC,GAAM,IAAa,cACnB,QAAuB,CACnB,YAAY,EAAS,2BAA4B,CAC7C,KAAK,OAAS,EAElB,QAAQ,EAAK,CACT,MAAO,MAAK,gBAAgB,WAAY,AAAC,GAAU,CAC/C,GAAM,GAAM,EAAM,IAAI,GACtB,MAAO,IAAI,SAAQ,AAAC,GAAY,CAC5B,EAAI,QAAU,IAAM,EAAQ,MAC5B,EAAI,UAAY,IAAM,EAAQ,EAAI,OAAS,EAAI,OAAO,MAAQ,UAEnE,MAAM,IAAM,MAEnB,WAAW,EAAK,CACZ,MAAO,MAAK,gBAAgB,YAAa,AAAC,GAAU,CAChD,GAAM,GAAM,EAAM,OAAO,GACzB,MAAO,IAAI,SAAQ,CAAC,EAAS,IAAW,CACpC,EAAI,QAAU,IAAM,EAAO,EAAI,OAC/B,EAAI,UAAY,IAAM,QAIlC,QAAQ,EAAI,EAAO,CACf,MAAO,MAAK,gBAAgB,YAAa,AAAC,GAAU,CAChD,GAAM,GAAM,EAAM,IAAI,CAAE,KAAI,UAC5B,MAAO,IAAI,SAAQ,CAAC,EAAS,IAAW,CACpC,EAAI,QAAU,IAAM,EAAO,EAAI,OAC/B,EAAI,UAAY,IAAM,QAIlC,OAAQ,CACJ,GAAM,GAAgB,KAAK,UAAU,KAAK,KAAK,OAAQ,GACvD,MAAO,IAAI,SAAQ,CAAC,EAAS,IAAW,CACpC,EAAc,UAAY,IAAM,CAC5B,EAAQ,EAAc,SAE1B,EAAc,QAAU,IAAM,CAC1B,EAAO,EAAc,QAEzB,EAAc,UAAY,IAAM,CAC5B,EAAO,GAAI,OAAM,yBAErB,EAAc,gBAAkB,IAAM,CAClC,GAAM,GAAK,EAAc,OACzB,EAAG,QAAU,IAAM,CACf,EAAO,GAAI,OAAM,mCAErB,EAAG,kBAAkB,GAAY,CAAE,QAAS,UAIxD,gBAAgB,EAAM,EAAQ,CAC1B,MAAO,MAAK,QAAQ,KAAK,AAAC,GAAO,CAC7B,GAAM,GAAK,EAAG,YAAY,GAAY,GACtC,SAAG,WAAa,IAAM,EAAG,QAClB,GAAI,SAAQ,CAAC,EAAS,IAAW,CACpC,EAAG,QAAU,IAAM,EAAO,EAAG,OAC7B,EAAQ,EAAO,EAAG,YAAY,QAC/B,MAAM,AAAC,GAAQ,CACd,QAAG,QACG,QAMtB,QAAsB,CAClB,YAAY,EAAQ,GAAI,CACpB,KAAK,MAAQ,EAEjB,QAAQ,EAAK,CACT,MAAI,KAAO,MAAK,MACL,KAAK,MAAM,GAEf,KAEX,WAAW,EAAK,CACZ,MAAO,MAAK,MAAM,GAEtB,QAAQ,EAAK,EAAO,CAChB,KAAK,MAAM,GAAO,IAIpB,GAAkB,GAAI,IAC5B,aAAwB,CACpB,MAAI,OAAO,OAAS,UAAY,KAAK,UAC1B,GAAI,IAEX,MAAO,SAAW,UAAY,OAAO,aAC9B,OAAO,aAEX,GAGX,YAAiC,CAAE,YAAW,QAAQ,KAAgB,SAAQ,gBAAe,iBAAgB,SAAQ,iBAAiB,CAAC,GAAU,OAAO,KAAK,GAAQ,SAAW,EAAI,YAAc,QAAc,CAC5M,GAAM,GAAW,EAAiB,oCAAoC,KAAkB,IAAmB,OACvG,EAAW,SAAY,CACvB,GAAI,GAAa,GAAa,KAAM,GAAM,QAAQ,GAClD,GAAI,CAAC,EAAY,CACb,GAAM,CAAE,aAAa,MAAuB,KAAM,GAAO,KAAK,GAAI,IAAa,CAC3E,UAAW,EACX,eAAgB,EAChB,OAAQ,EAAS,KAAM,IAAc,GAAU,UAEnD,EAAa,EACT,GACA,QAAQ,QAAQ,EAAM,QAAQ,EAAU,IAAa,MAAM,IAAM,IAGzE,SAAW,GAAoB,CAC3B,SACA,gBACA,SACA,eAEG,KAEX,MAAO,IAAM,IAAW,MAAM,KAAO,IAAQ,CACzC,KAAI,IACA,QAAQ,QAAQ,EAAM,WAAW,IAAW,MAAM,IAAM,IAEtD,IAGd,aAA4B,CACxB,KAAM,IAAI,IAAyB,yDC9qBvC,GAAM,IAAS,YACT,GAAmB,iDAGnB,GAAK,GAAI,IAAS,CACtB,OAAQ,GACR,YAAa,GAAwB,CACnC,OAAQ,GAAI,IAAsB,CAAE,OAAQ,KAC5C,eAAgB,OAGd,GAAkB,oBAExB,QAAkC,aAEnB,UAAS,EAAO,CAC3B,GAAI,CACF,GAAM,GAAiB,WACjB,EAAO,KAAM,IAAG,KAClB,GAAI,IAAmB,CACrB,OAAQ,EACR,OAAQ,MAGR,EAAO,EAAM,GACf,EAAgB,OACpB,OAAQ,EAAK,UACN,YACH,EAAgB,OAChB,UACG,aACH,EAAgB,OAChB,MAEJ,GAAM,GAAW,EAAiB,KAAW,EACvC,EAAe,CACnB,OAAQ,GACR,IAAK,EACL,YAAa,EAAK,KAClB,KAAM,GAER,GAAI,CACF,GAAM,GAAO,KAAM,IAAG,KAAK,GAAI,IAAiB,IAChD,MAAO,sCAAwC,GAAkB,IAAM,QAChE,EAAP,CACA,MAAO,OAAM;AAAA;AAAA,gEAER,EAAP,CACA,GAAI,CAAC,EAAM,OACT,MAAO,OAAM,+CAMN,UAAS,EAAO,CAC3B,GAAI,CACF,GAAM,GAAiB,WACjB,EAAO,KAAM,IAAG,KAClB,GAAI,IAAmB,CACrB,OAAQ,EACR,OAAQ,MAGR,EAAO,EAAM,GAGnB,GAAI,EAAK,KAAO,SACd,MAAO,OAAM;AAAA;AAAA,yEAaf,GAAI,GAAgB,OACpB,OAAQ,EAAK,UACN,YACH,EAAgB,OAChB,UACG,kBACH,EAAgB,OAChB,MAEJ,GAAM,GAAW,EAAiB,KAAW,EACvC,EAAe,CACnB,OAAQ,GACR,IAAK,EACL,YAAa,EAAK,KAClB,KAAM,GAER,GAAI,CACF,GAAM,GAAO,KAAM,IAAG,KAAK,GAAI,IAAiB,IAChD,MAAO,sCAAwC,GAAkB,IAAM,QAChE,EAAP,CACA,eAAQ,MAAM,GACP,MAAM;AAAA;AAAA,2DAER,EAAP,CACA,GAAI,CAAC,EAAM,OACT,MAAO,OAAM,qCA7Fd,GAAP,GCNA,YAAyB,EAAK,CAC7B,GAAI,GAEJ,MAAO,CACN,GAAI,CACH,EAAO,EAAQ,OAEf,EAAK,UAAY;AAAA;AAAA;AAAA;AAAA,4CAMjB,EAAK,EAAM,QAAS,2BAErB,EAAE,EAAQ,EAAQ,CACjB,EAAO,EAAQ,EAAM,IAEtB,EAAG,EACH,EAAG,EACH,EAAG,EACH,EAAE,EAAW,CACZ,AAAI,GAAW,EAAO,KAKzB,oBAA+B,EAAgB,CAC9C,YAAY,EAAS,CACpB,QACA,EAAK,KAAM,EAAS,KAAM,GAAiB,EAAgB,MAItD,GAAQ,GChCf,YAAyB,EAAK,CAC7B,GAAI,GACA,EACA,EAEJ,MAAO,CACN,GAAI,CACH,EAAM,EAAQ,OACd,EAAQ,EAAQ,SACX,GAAc,EAAM,IAAK,EAAkB,QAAoB,EAAI,GAAK,SAAS,EAAK,EAAO,MAAO,GACzG,EAAM,SAAW,GACjB,EAAM,YAAc,GACpB,EAAK,EAAO,QAAS,kBACrB,EAAK,EAAK,QAAS,6BAEpB,EAAE,EAAQ,EAAQ,CACjB,EAAO,EAAQ,EAAK,GACpB,EAAO,EAAK,IAEb,EAAE,EAAK,CAAC,GAAQ,CACf,AAAI,EAAkB,GAAK,CAAC,GAAc,EAAM,IAAK,EAAkB,QAAoB,EAAI,GAAK,SACnG,EAAK,EAAO,MAAO,IAGrB,EAAG,EACH,EAAG,EACH,EAAE,EAAW,CACZ,AAAI,GAAW,EAAO,KAKzB,YAAkB,EAAQ,EAAS,EAAc,CAChD,GAAI,CAAE,SAAU,EAEhB,SAAO,MAAQ,GAAW,CACzB,AAAI,SAAW,IAAS,EAAa,EAAG,EAAQ,EAAQ,QAGlD,CAAC,GAGT,oBAA2B,EAAgB,CAC1C,YAAY,EAAS,CACpB,QACA,EAAK,KAAM,EAAS,GAAU,GAAiB,EAAgB,CAAE,MAAO,MAInE,GAAQ,GCjDf,YAAyB,EAAK,CAC7B,GAAI,GACA,EACA,EAEJ,MAAO,CACN,GAAI,CACH,EAAM,EAAQ,OACd,EAAM,EAAQ,OACT,GAAc,EAAI,IAAK,EAA6B,EAAI,KAAK,EAAK,EAAK,MAAO,GACnF,EAAK,EAAK,MAAO,qBACjB,EAAK,EAAK,QAAS,iBACnB,EAAK,EAAK,QAAS,4BAEpB,EAAE,EAAQ,EAAQ,CACjB,EAAO,EAAQ,EAAK,GACpB,EAAO,EAAK,IAEb,EAAE,EAAK,CAAC,GAAQ,CACf,AAAI,EAAqB,GAAK,CAAC,GAAc,EAAI,IAAK,EAA6B,EAAI,KACtF,EAAK,EAAK,MAAO,IAGnB,EAAG,EACH,EAAG,EACH,EAAE,EAAW,CACZ,AAAI,GAAW,EAAO,KAKzB,YAAkB,EAAQ,EAAS,EAAc,CAChD,GAAI,CAAE,YAAa,EAEnB,SAAO,MAAQ,GAAW,CACzB,AAAI,YAAc,IAAS,EAAa,EAAG,EAAW,EAAQ,WAGxD,CAAC,GAGT,oBAA2B,EAAgB,CAC1C,YAAY,EAAS,CACpB,QACA,EAAK,KAAM,EAAS,GAAU,GAAiB,EAAgB,CAAE,SAAU,MAItE,GAAQ,GChDf,YAAyB,EAAK,CAC7B,GAAI,GACA,EACA,EAEJ,MAAO,CACN,GAAI,CACH,EAAM,EAAQ,OACd,EAAQ,EAAQ,SACX,GAAc,EAAM,IAAK,EAA+B,EAAI,KAAK,EAAK,EAAO,MAAO,GACzF,EAAM,SAAW,GACjB,EAAM,YAAc,GACpB,EAAK,EAAO,QAAS,kBACrB,EAAK,EAAK,QAAS,6BAEpB,EAAE,EAAQ,EAAQ,CACjB,EAAO,EAAQ,EAAK,GACpB,EAAO,EAAK,IAEb,EAAE,EAAK,CAAC,GAAQ,CACf,AAAI,EAAqB,GAAK,CAAC,GAAc,EAAM,IAAK,EAA+B,EAAI,KAC1F,EAAK,EAAO,MAAO,IAGrB,EAAG,EACH,EAAG,EACH,EAAE,EAAW,CACZ,AAAI,GAAW,EAAO,KAKzB,YAAkB,EAAQ,EAAS,EAAc,CAChD,GAAI,CAAE,YAAa,EAEnB,SAAO,MAAQ,GAAW,CACzB,AAAI,YAAc,IAAS,EAAa,EAAG,EAAW,EAAQ,WAGxD,CAAC,GAGT,oBAA2B,EAAgB,CAC1C,YAAY,EAAS,CACpB,QACA,EAAK,KAAM,EAAS,GAAU,GAAiB,EAAgB,CAAE,SAAU,MAItE,GAAQ,GCXf,YAA0B,EAAK,EAAM,EAAG,CACvC,GAAM,GAAY,EAAI,QACtB,SAAU,IAAM,EAAK,GACd,EAGR,YAA4B,EAAK,EAAM,EAAG,CACzC,GAAM,GAAY,EAAI,QACtB,SAAU,IAAM,EAAK,GACd,EAIR,YAAyB,EAAK,CAC7B,GAAI,GACA,EACA,EACA,EACA,EACA,EACA,EACA,EACA,EACA,EACA,EACA,EACA,EAAuB,EAAI,GAAG,MAAQ,GACtC,EACA,EACA,EACA,EACA,EACA,EAAwB,EAAI,GAAG,gBAAkB,GACjD,EACA,EACA,EACA,EACA,EACA,GACA,GACA,EACA,GACA,GACA,GACA,GACA,GACA,GACA,GACA,GACA,GACA,GACA,GACA,GACA,GACA,GACA,GACA,GACA,GACA,GACA,GACA,GACA,GACA,GACA,GACA,EACA,GACA,GACA,GACA,GACA,GACA,GACA,GACA,EACA,GACA,GACA,GACA,GACA,GACA,GACA,GACA,GACA,GACA,GACA,GACA,GACA,GACA,GACA,GACA,GACA,GACA,GACA,GACA,GACA,GACA,GACA,GACA,GACA,GACA,GACA,GACA,GACA,GACA,GACA,GACA,GACA,GACA,GACA,GACA,GAEJ,EAAa,GAAI,IAAW,CAC1B,MAAO,CACN,MAAO,sCACP,QAAS,CACR,QAAS,CACR,GACA,CAAC,CAAE,cAAe,EAAE,GAAI,KACxB,CAAC,CAAE,cAAc,CAAC,EAAG,GAAU,UAAY,KAG7C,QAAS,CAAE,UAId,YAA2B,GAAK,GAAO,CACtC,MAAgB,IAAI,GAAG,OAAO,MAAc,GACrC,GAGR,GAAI,IAAqB,GAAkB,EAAK,CAAC,GAAI,KACjD,GAAY,GAAmB,GAEnC,YAA6B,GAAK,GAAO,CACxC,MAA4B,IAAI,GAAW,GACpC,GAGR,GAAI,IAAuB,GAAoB,EAAK,CAAC,GAAI,KACrD,GAAY,GAAqB,GACjC,GAAyB,EAAI,GAAG,SAAS,MACzC,GAAc,GAElB,OAAS,IAAI,EAAG,GAAI,GAAW,OAAQ,IAAK,EAC3C,GAAY,IAAK,GAAkB,GAAiB,EAAK,GAAY,KAGtE,GAAgB,GAAI,IAAa,CAC/B,MAAO,CACN,MAAO,UACP,YAAa,mBACb,QAAS,CAAE,QAAS,CAAC,KACrB,QAAS,CAAE,UAId,GAAc,IAAI,QAA6B,EAAI,KAEnD,GAAI,IAAsB,CACzB,MAAO,UACP,YAAa,uCACb,SAAkC,EAAI,IACtC,QAAS,CAAE,QAAS,CAAC,KACrB,QAAS,CAAE,QAGZ,GAAgB,GAAI,IAAa,CAAE,MAAO,KAChB,EAAI,IAAI,IAClC,GAAc,IAAI,QAAsB,EAAI,KAC5C,GAAI,IAAyB,EAAI,KAAO,GAAkB,GACtD,GAAmC,EAAI,KAAO,GAAkB,GAEhE,GAAsB,CACzB,MAAO,UACP,YAAa,uCACb,SAAkC,EAAI,IACtC,QAAS,CAAE,QAAS,CAAC,KACrB,QAAS,CAAE,QAGZ,GAAgB,GAAI,IAAa,CAAE,MAAO,KAChB,EAAI,IAAI,IAClC,GAAc,IAAI,QAAsB,EAAI,KAC5C,GAAI,IAAyB,EAAI,KAAO,GAAkB,GACtD,GAAmC,EAAI,KAAO,GAAkB,GAEhE,GAAsB,CACzB,MAAO,UACP,MAAO,MACP,YAAa,yCACb,SAAgC,EAAI,IACpC,QAAS,CAAE,QAAS,CAAC,KACrB,QAAS,CAAE,QAGZ,UAAgB,GAAI,IAAa,CAAE,MAAO,KAChB,EAAI,IAAI,IAClC,GAAc,IAAI,QAA2B,EAAI,KACjD,GAAgB,GAAwC,EAAI,IAAI,IAEzD,CACN,GAAI,CACH,EAAQ,EAAQ,OAChB,EAAiB,EAAW,GAAG,UAC/B,EAAK,IACL,EAAQ,EAAQ,OAChB,EAAO,EAAQ,OACf,GAAU,IACV,EAAK,IACL,EAAO,EAAQ,OACf,EAAQ,EAAQ,SAChB,EAAK,IACL,EAAQ,EAAQ,OAChB,EAAK,EAAQ,MACb,EAAK,GAAK,GACV,EAAK,IACL,EAAM,EAAQ,MACd,GAAU,IACV,EAAK,IACL,EAAI,EAAQ,KACZ,EAAK,IACL,EAAO,EAAQ,OACf,EAAQ,EAAQ,QAChB,EAAM,YAAc,OACpB,EAAK,IACL,EAAU,EAAQ,UAElB,OAAS,IAAI,EAAG,GAAI,GAAY,OAAQ,IAAK,EAC5C,GAAY,IAAG,IAGhB,GAAK,IACL,GAAO,EAAQ,OACf,EAAQ,EAAQ,QAChB,EAAM,YAAc,MACpB,GAAM,IACN,GAAS,EAAQ,SACjB,GAAM,IACN,GAAO,EAAQ,OACf,GAAQ,EAAQ,QAChB,GAAM,YAAc,iDACpB,GAAM,IACN,GAAS,EAAQ,SACjB,GAAS,EAAQ,SACjB,GAAS,EAAQ,UACjB,GAAO,YAAc,4BACrB,GAAM,IACN,GAAS,EAAQ,SACjB,GAAS,EAAQ,SACjB,GAAM,GAAK,MACX,GAAM,IACN,GAAO,EAAQ,OACf,GAAQ,EAAQ,QAChB,GAAM,YAAc,kCACpB,GAAM,IACN,GAAO,EAAQ,OACf,GAAU,EAAQ,UAClB,GAAU,EAAQ,UAClB,GAAQ,YAAc,QACtB,GAAU,EAAQ,UAClB,GAAQ,YAAc,OACtB,GAAU,EAAQ,UAClB,GAAQ,YAAc,QACtB,GAAU,EAAQ,UAClB,GAAQ,YAAc,WACtB,EAAU,EAAQ,UAClB,EAAQ,YAAc,MACtB,GAAU,EAAQ,UAClB,GAAQ,YAAc,QACtB,GAAM,IACN,EAAiB,GAAc,GAAG,UAClC,GAAM,IACN,GAAQ,EAAQ,OAChB,GAAQ,EAAQ,QAChB,GAAM,YAAc,kCACpB,GAAM,IACN,EAAQ,EAAQ,OAChB,GAAO,EAAQ,OACf,GAAS,EAAQ,SACjB,GAAO,YAAc,KACrB,GAAM,IACN,GAAS,EAAQ,SACjB,GAAM,IACN,GAAO,EAAQ,OACf,GAAM,EAAQ,MACd,GAAI,YAAc,KAClB,GAAM,IACN,EAAiB,GAAc,GAAG,UAClC,GAAM,IACF,IAAW,GAAU,IACzB,GAAM,IACN,GAAO,EAAQ,OACX,IAAW,GAAU,IACzB,GAAM,IACN,GAAQ,EAAQ,OAChB,GAAQ,EAAQ,QAChB,GAAM,YAAc,2DACpB,GAAM,IACN,GAAQ,EAAQ,OAChB,GAAQ,EAAQ,OAChB,GAAS,EAAQ,SACjB,GAAO,YAAc,KACrB,GAAM,IACN,GAAS,EAAQ,SACjB,GAAM,IACN,GAAQ,EAAQ,OAChB,GAAM,EAAQ,MACd,GAAI,YAAc,KAClB,GAAM,IACN,EAAiB,GAAc,GAAG,UAClC,GAAM,IACF,IAAW,GAAU,IACzB,GAAM,IACN,GAAQ,EAAQ,OACZ,IAAW,GAAU,IACzB,GAAM,IACN,GAAQ,EAAQ,OAChB,EAAiB,GAAc,GAAG,UAClC,EAAM,SAAW,GACZ,GAAc,EAAM,IAAK,EAAkB,+BAA+B,EAAK,EAAO,MAAO,GAClG,EAAK,EAAO,QAAS,sBACrB,EAAK,EAAM,QAAS,2BACpB,EAAK,EAAM,QAAS,6BACpB,EAAK,EAAG,QAAS,8BACjB,EAAK,EAAO,QAAS,wBACrB,EAAK,EAAS,KAAM,WACpB,EAAK,EAAS,QAAS,kBACC,EAAI,KAAO,QAAQ,GAAoB,IAAiC,EAAI,IAAI,KAAK,IAC7G,EAAK,EAAM,QAAS,0BACpB,EAAK,EAAO,QAAS,wBACrB,EAAK,GAAQ,OAAQ,UACrB,EAAK,GAAQ,KAAM,OACnB,GAAO,MAAQ,IACf,EAAK,GAAQ,MAAO,KACpB,EAAK,GAAQ,MAAO,MACpB,EAAK,GAAQ,QAAS,kBACtB,EAAK,GAAM,QAAS,0BACpB,EAAK,GAAO,QAAS,wBACrB,EAAK,GAAQ,OAAQ,SACrB,EAAK,GAAQ,OAAQ,OACrB,GAAO,QAAU,MACjB,GAAO,MAAQ,GAAO,QACtB,EAAK,GAAQ,QAAS,kBACtB,GAAU,GAAQ,eAAgB,QAClC,EAAK,GAAQ,OAAQ,SACrB,EAAK,GAAQ,OAAQ,OACrB,GAAO,QAAU,KACjB,GAAO,MAAQ,GAAO,QACtB,EAAK,GAAQ,QAAS,kBACtB,GAAU,GAAQ,YAAa,UAC/B,EAAK,GAAM,QAAS,0BACpB,EAAK,GAAO,QAAS,yBACrB,GAAQ,QAAU,QAClB,GAAQ,MAAQ,GAAQ,QACxB,GAAQ,QAAU,OAClB,GAAQ,MAAQ,GAAQ,QACxB,GAAQ,QAAU,QAClB,GAAQ,MAAQ,GAAQ,QACxB,GAAQ,QAAU,WAClB,GAAQ,MAAQ,GAAQ,QACxB,EAAQ,QAAU,MAClB,EAAQ,MAAQ,EAAQ,QACxB,GAAQ,QAAU,QAClB,GAAQ,MAAQ,GAAQ,QACxB,EAAK,GAAS,KAAM,SACpB,EAAK,GAAS,QAAS,kBACvB,EAAK,GAAM,QAAS,yCACpB,EAAK,GAAM,QAAS,0BACpB,EAAK,GAAO,QAAS,yBACrB,EAAK,GAAQ,QAAS,+BACtB,EAAK,GAAQ,MAAO,aACpB,EAAK,GAAQ,KAAM,aACnB,EAAK,GAAQ,QAAS,4BACtB,EAAK,GAAQ,OAAQ,QACrB,EAAK,GAAQ,SAAU,WACvB,EAAK,GAAM,QAAS,uCACpB,EAAK,GAAK,QAAS,+BACnB,EAAK,GAAM,QAAS,0BACpB,EAAK,GAAM,QAAS,gCACpB,EAAK,EAAO,QAAS,0DACrB,EAAK,GAAO,QAAS,0BACrB,EAAK,GAAO,QAAS,yBACrB,EAAK,GAAQ,QAAS,+BACtB,EAAK,GAAQ,MAAO,aACpB,EAAK,GAAQ,KAAM,aACnB,EAAK,GAAQ,QAAS,4BACtB,EAAK,GAAQ,OAAQ,QACrB,EAAK,GAAQ,SAAU,WACvB,GAAO,SAAiC,EAAI,IAC5C,EAAK,GAAO,QAAS,uCACrB,EAAK,GAAK,QAAS,+BACnB,EAAK,GAAO,QAAS,0BACrB,EAAK,GAAO,QAAS,gCACrB,EAAK,GAAO,QAAS,0DACrB,EAAK,GAAO,QAAS,0BACrB,EAAK,GAAO,QAAS,oCACrB,EAAK,EAAO,QAAS,6BACrB,EAAK,EAAO,QAAS,iCACrB,EAAK,EAAO,QAAS,uBACrB,GAAc,EAAE,GAAQ,KAEzB,EAAE,GAAQ,GAAQ,CACjB,EAAO,GAAQ,EAAO,IACtB,EAAgB,EAAY,EAAO,MACnC,EAAO,EAAO,GACd,EAAO,EAAO,GACd,EAAO,EAAO,GACd,GAAU,EAAE,EAAM,MAClB,EAAO,EAAM,GACb,EAAO,EAAM,GACb,EAAO,EAAM,GACK,EAAI,IAAI,GAC1B,EAAO,EAAO,GACd,EAAO,EAAO,GACd,EAAO,EAAO,GACd,EAAO,EAAI,GACX,EAAO,EAAO,GACd,EAAO,EAAO,GACd,GAAU,EAAE,EAAK,MACjB,EAAO,EAAO,GACd,EAAO,EAAO,GACd,EAAE,UAAY,EACd,EAAO,EAAO,GACd,EAAO,EAAO,GACd,EAAO,EAAM,GACb,EAAO,EAAM,GACb,EAAO,EAAM,GAEb,OAAS,IAAI,EAAG,GAAI,GAAY,OAAQ,IAAK,EAC5C,AAAI,GAAY,KACf,GAAY,IAAG,EAAE,EAAS,MAIR,EAAI,IAAI,GAC5B,GAAc,EAA6B,EAAI,GAAI,IACnD,EAAO,EAAO,IACd,EAAO,EAAO,IACd,EAAO,GAAM,GACb,EAAO,GAAM,IACb,EAAO,GAAM,IACM,EAAI,IAAI,IAC3B,EAAO,EAAO,IACd,EAAO,EAAO,IACd,EAAO,GAAM,IACb,EAAO,GAAM,IACb,EAAO,GAAM,IACb,EAAO,GAAQ,IACf,GAAO,QAAU,GAAO,UAA2B,EAAI,GACvD,EAAO,GAAQ,IACf,EAAO,GAAM,IACb,EAAO,GAAM,IACb,EAAO,GAAQ,IACf,GAAO,QAAU,GAAO,UAA2B,EAAI,GACvD,EAAO,GAAQ,IACf,EAAO,EAAO,IACd,EAAO,EAAO,IACd,EAAO,GAAM,IACb,EAAO,GAAM,IACb,EAAO,GAAM,IACb,EAAO,GAAM,IACb,EAAO,GAAS,IAChB,EAAO,GAAS,IAChB,EAAO,GAAS,IAChB,EAAO,GAAS,IAChB,EAAO,GAAS,GAChB,EAAO,GAAS,IACI,EAAI,IAAI,IAC5B,EAAO,GAAM,IACb,EAAgB,GAAe,GAAM,MACrC,EAAO,EAAO,IACd,EAAO,EAAO,IACd,EAAO,GAAO,IACd,EAAO,GAAO,IACd,EAAO,GAAO,GACd,EAAO,EAAO,IACd,EAAO,GAAM,IACb,EAAO,GAAM,IACb,EAAO,GAAM,IACM,EAAI,IAAI,IAC3B,EAAO,EAAO,IACd,EAAO,EAAO,IACd,EAAO,GAAM,IACb,EAAO,GAAM,IACb,EAAgB,GAAe,GAAM,MACrC,EAAO,GAAM,IACT,IAAW,GAAU,EAAE,GAAM,MACjC,EAAO,EAAO,IACd,EAAO,EAAO,IACV,IAAW,GAAU,EAAE,GAAM,MACjC,EAAO,EAAO,IACd,EAAO,EAAO,IACd,EAAO,GAAO,IACd,EAAO,GAAO,IACd,EAAO,GAAO,IACd,EAAO,GAAO,IACd,EAAO,GAAO,IACd,EAAO,GAAO,IACd,EAAO,GAAO,IACK,EAAI,IAAI,IAC3B,EAAO,GAAO,IACd,EAAO,GAAO,IACd,EAAO,GAAO,IACd,EAAO,GAAO,IACd,EAAgB,GAAe,GAAO,MACtC,EAAO,GAAO,IACV,IAAW,GAAU,EAAE,GAAO,MAClC,EAAO,GAAO,IACd,EAAO,GAAO,IACV,IAAW,GAAU,EAAE,GAAO,MAClC,EAAO,EAAO,IACd,EAAO,EAAO,IACd,EAAgB,GAAe,GAAO,MACtC,GAAU,GAEL,IACJ,IAAU,CACT,GAAO,EAAO,iBAA6C,EAAI,KAC/D,GAAO,EAAS,SAAqC,EAAI,KACzD,GAAO,EAAS,SAAkC,EAAI,KACtD,GAAO,GAAQ,SAAoC,EAAI,KACvD,GAAO,GAAQ,SAAoC,EAAI,KACvD,GAAO,GAAQ,SAA6B,EAAI,KAChD,GAAO,GAAQ,SAA6B,EAAI,MAGjD,GAAU,KAGZ,EAAE,GAAK,GAAO,CACb,GAAM,IAAqB,GAoC3B,GAlCI,GAAM,GAA0B,YACnC,IAAmB,QAAU,CAAE,SAAO,SAGvC,EAAW,KAAK,IAEhB,AAAI,KAAwB,IAAqB,GAAkB,GAAK,MAAW,GAClF,GAAU,EAAE,GAAK,IAEjB,IAAU,EAAE,GACZ,GAAY,GAAmB,IAE3B,IACH,IAAU,IACV,GAAU,EAAE,EAAM,KAIf,EAAC,IAAW,GAAM,GAAiB,IAAM,IAAc,GAAuB,GAAI,GAAG,MAAQ,KAAK,GAAS,EAAI,GAEpH,AAAI,KAA0B,IAAuB,GAAoB,GAAK,MAAW,GACxF,GAAU,EAAE,GAAK,IAEjB,IAAU,EAAE,GACZ,GAAY,GAAqB,IAE7B,IACH,IAAU,IACV,GAAU,EAAE,EAAK,QAId,EAAC,IAAW,GAAM,GAAiB,IAAM,IAAe,GAAwB,GAAI,GAAG,gBAAkB,KAAK,GAAE,UAAY,GAE7H,GAAM,GAAiB,EAAG,CAC7B,GAAyB,GAAI,GAAG,SAAS,MACzC,GAAI,IAEJ,IAAK,GAAI,EAAG,GAAI,GAAW,OAAQ,IAAK,EAAG,CAC1C,GAAM,IAAY,GAAiB,GAAK,GAAY,IAEpD,AAAI,GAAY,IACf,GAAY,IAAG,EAAE,GAAW,IAE5B,IAAY,IAAK,GAAkB,IACnC,GAAY,IAAG,IACf,GAAY,IAAG,EAAE,EAAS,OAI5B,KAAO,GAAI,GAAY,OAAQ,IAAK,EACnC,GAAY,IAAG,EAAE,GAGlB,GAAY,OAAS,GAAW,OAGjC,AAAI,GAAM,GAAkC,IAC3C,GAAc,EAA6B,GAAI,IAG5C,GAAM,GAAoB,KAC7B,IAAO,QAAU,GAAO,UAA2B,GAAI,IAGpD,GAAM,GAAoB,KAC7B,IAAO,QAAU,GAAO,UAA2B,GAAI,IAGxD,GAAM,IAAwB,GAE9B,AAAI,GAAM,GAAiB,YAC1B,IAAsB,QAAU,CAAE,SAAO,SAG1C,GAAc,KAAK,IACnB,GAAM,IAAwB,GAC9B,AAAI,GAAM,GAA6B,MAAM,IAAsB,SAAmC,GAAI,KAEtG,GAAM,GAAiB,YAC1B,IAAsB,QAAU,CAAE,SAAO,SAG1C,GAAc,KAAK,IAEnB,AAAiB,GAAI,IACpB,AAAI,GACH,IAAU,EAAE,GAAK,IAEb,GAAM,GAAkB,OAC3B,EAAc,GAAW,IAG1B,IAAY,GAAkB,IAC9B,GAAU,IACV,EAAc,GAAW,GACzB,GAAU,EAAE,GAAM,OAET,IACV,MAEA,EAAe,GAAW,EAAG,EAAG,IAAM,CACrC,GAAY,OAGb,MAGD,AAA2B,GAAI,IAC9B,AAAI,GACC,GAAM,GAA4B,MACrC,EAAc,GAAW,GAG1B,IAAY,GAAkB,IAC9B,GAAU,IACV,EAAc,GAAW,GACzB,GAAU,EAAE,GAAM,OAET,IACV,MAEA,EAAe,GAAW,EAAG,EAAG,IAAM,CACrC,GAAY,OAGb,MAGG,EAAC,IAAW,GAAM,GAA2B,QAChD,IAAO,SAAiC,GAAI,KAG7C,GAAM,IAAwB,GAC9B,AAAI,GAAM,GAA6B,QAAQ,IAAsB,SAAmC,GAAI,KAExG,GAAM,GAAiB,YAC1B,IAAsB,QAAU,CAAE,SAAO,SAG1C,GAAc,KAAK,IAEnB,AAAiB,GAAI,IACpB,AAAI,GACH,IAAU,EAAE,GAAK,IAEb,GAAM,GAAkB,SAC3B,EAAc,GAAW,IAG1B,IAAY,GAAkB,IAC9B,GAAU,IACV,EAAc,GAAW,GACzB,GAAU,EAAE,GAAO,OAEV,IACV,MAEA,EAAe,GAAW,EAAG,EAAG,IAAM,CACrC,GAAY,OAGb,MAGD,AAA2B,GAAI,IAC9B,AAAI,GACC,GAAM,GAA4B,QACrC,EAAc,GAAW,GAG1B,IAAY,GAAkB,IAC9B,GAAU,IACV,EAAc,GAAW,GACzB,GAAU,EAAE,GAAO,OAEV,IACV,MAEA,EAAe,GAAW,EAAG,EAAG,IAAM,CACrC,GAAY,OAGb,MAGD,GAAM,IAAwB,GAC9B,AAAI,GAAM,GAA2B,SAAS,IAAsB,SAAiC,GAAI,KAErG,GAAM,GAAiB,YAC1B,IAAsB,QAAU,CAAE,SAAO,SAG1C,GAAc,KAAK,KAEpB,EAAE,GAAO,CACR,AAAI,IACJ,GAAc,EAAW,GAAG,SAAU,IACtC,EAAc,GAAc,GAAG,SAAU,IACzC,EAAc,GAAc,GAAG,SAAU,IACzC,EAAc,IACd,EAAc,IACd,EAAc,GAAc,GAAG,SAAU,IACzC,EAAc,IACd,EAAc,IACd,EAAc,GAAc,GAAG,SAAU,IACzC,GAAU,KAEX,EAAE,GAAO,CACR,EAAe,EAAW,GAAG,SAAU,IACvC,EAAe,GAAc,GAAG,SAAU,IAC1C,EAAe,GAAc,GAAG,SAAU,IAC1C,EAAe,IACf,EAAe,IACf,EAAe,GAAc,GAAG,SAAU,IAC1C,EAAe,IACf,EAAe,IACf,EAAe,GAAc,GAAG,SAAU,IAC1C,GAAU,IAEX,EAAE,GAAW,CACZ,AAAI,IAAW,EAAO,GACtB,EAAkB,GAClB,GAAU,IACQ,EAAI,IAAI,MAC1B,GAAU,IACV,GAAa,GAAa,IACN,EAAI,IAAI,MACT,EAAI,IAAI,MACP,EAAI,IAAI,MAC5B,EAAkB,IACC,EAAI,IAAI,MACD,EAAI,IAAI,MAClC,EAAkB,IACd,IAAW,GAAU,IACrB,IAAW,GAAU,IACN,EAAI,IAAI,MACD,EAAI,IAAI,MAClC,EAAkB,IACd,IAAW,GAAU,IACrB,IAAW,GAAU,IACC,EAAI,IAAI,MAClC,EAAkB,IAClB,GAAc,IACd,GAAU,GACV,GAAQ,MAMX,YAA2B,EAAK,CAC/B,GAAI,GACA,EACA,EACA,EACA,EAEJ,MAAO,CACN,GAAI,CACH,EAAO,EAAQ,OACf,EAAI,IACJ,EAAO,EAAQ,OACV,GAAc,EAAK,IAAK,EAAiB,yBAAyB,EAAK,EAAM,MAAO,GACzF,EAAK,EAAM,MAAO,IAClB,GAAU,EAAM,WAAY,YAC5B,GAAU,EAAM,OAAQ,KACxB,GAAU,EAAM,QAAS,SACpB,GAAc,EAAK,IAAK,EAAiB,yBAAyB,EAAK,EAAM,MAAO,GACzF,EAAK,EAAM,MAAO,IAClB,GAAU,EAAM,WAAY,YAC5B,GAAU,EAAM,QAAS,KACzB,GAAU,EAAM,SAAU,KAC1B,GAAU,EAAM,QAAS,UAE1B,EAAE,EAAQ,EAAQ,CACjB,EAAO,EAAQ,EAAM,GACrB,EAAO,EAAQ,EAAG,GAClB,EAAO,EAAQ,EAAM,IAEtB,EAAE,EAAW,CACZ,AAAI,GAAW,EAAO,GAClB,GAAW,EAAO,GAClB,GAAW,EAAO,KAMzB,YAA+B,EAAK,CACnC,GAAI,GACA,EAAuB,EAAI,KAAO,GAAkB,GAExD,MAAO,CACN,GAAI,CACH,AAAI,GAAU,EAAS,IACvB,EAAkB,MAEnB,EAAE,EAAQ,EAAQ,CACjB,AAAI,GAAU,EAAS,EAAE,EAAQ,GACjC,EAAO,EAAQ,EAAiB,IAEjC,EAAE,EAAK,EAAO,CACb,AAAgB,EAAI,IACf,GAGH,GAAW,GAAkB,GAC7B,EAAS,IACT,EAAS,EAAE,EAAgB,WAAY,IAE9B,GACV,GAAS,EAAE,GACX,EAAW,OAGb,EAAE,EAAW,CACZ,AAAI,GAAU,EAAS,EAAE,GACrB,GAAW,EAAO,KAMzB,YAA6B,EAAK,CACjC,GAAI,GACA,EAEJ,MAAO,CACN,GAAI,CACH,EAAM,EAAQ,OACd,EAAK,EAAK,QAAS,2BACd,GAAc,EAAI,IAAK,EAA6B,EAAI,KAAK,EAAK,EAAK,MAAO,GACnF,EAAK,EAAK,MAAO,KAElB,EAAE,EAAQ,EAAQ,CACjB,EAAO,EAAQ,EAAK,GACF,EAAI,IAAI,IAE3B,EAAE,EAAK,EAAO,CACb,AAAI,EAAM,GAAkB,GAAK,CAAC,GAAc,EAAI,IAAK,EAA6B,EAAI,KACzF,EAAK,EAAK,MAAO,IAGnB,EAAE,EAAW,CACZ,AAAI,GAAW,EAAO,GACJ,EAAI,IAAI,QAM7B,YAA2B,EAAK,CAC/B,GAAI,GACA,EACA,EACA,EACA,EAAuB,EAAI,GAAG,OAAO,MAAM,OAAS,GAAK,GAAkB,GAE/E,MAAO,CACN,GAAI,CACH,EAAM,EAAQ,OACd,EAAI,IACA,GAAU,EAAS,IACvB,EAAkB,KAClB,EAAK,EAAK,QAAS,2BACd,GAAc,EAAI,IAAK,EAA4B,EAAI,GAAG,OAAO,MAAM,GAAG,KAAK,iBAAiB,EAAK,EAAK,MAAO,GACtH,EAAK,EAAK,MAAO,KAElB,EAAE,EAAQ,EAAQ,CACjB,EAAO,EAAQ,EAAK,GACJ,EAAI,IAAI,GACxB,EAAO,EAAQ,EAAG,GACd,GAAU,EAAS,EAAE,EAAQ,GACjC,EAAO,EAAQ,EAAiB,IAEjC,EAAE,EAAK,EAAO,CACb,AAAI,EAAM,GAAiB,GAAK,CAAC,GAAc,EAAI,IAAK,EAA4B,EAAI,GAAG,OAAO,MAAM,GAAG,KAAK,iBAC/G,EAAK,EAAK,MAAO,GAGlB,AAAgB,EAAI,GAAG,OAAO,MAAM,OAAS,EAC5C,AAAI,EACH,EAAS,EAAE,EAAK,GAEhB,GAAW,GAAkB,GAC7B,EAAS,IACT,EAAS,EAAE,EAAgB,WAAY,IAE9B,GACV,GAAS,EAAE,GACX,EAAW,OAGb,EAAE,EAAW,CACZ,AAAI,GAAW,EAAO,GACN,EAAI,IAAI,MACpB,GAAW,EAAO,GAClB,GAAU,EAAS,EAAE,GACrB,GAAW,EAAO,KAMzB,YAA2B,EAAK,CAC/B,GAAI,GACA,EAA2B,EAAI,GAAG,OAAO,MACzC,EAAc,GAElB,OAAS,GAAI,EAAG,EAAI,EAAa,OAAQ,GAAK,EAC7C,EAAY,GAAK,GAAoB,GAAmB,EAAK,EAAc,IAG5E,MAAO,CACN,GAAI,CACH,EAAM,EAAQ,OAEd,OAAS,GAAI,EAAG,EAAI,EAAY,OAAQ,GAAK,EAC5C,EAAY,GAAG,IAGhB,EAAK,EAAK,QAAS,mCAEpB,EAAE,EAAQ,EAAQ,CACjB,EAAO,EAAQ,EAAK,GAEpB,OAAS,GAAI,EAAG,EAAI,EAAY,OAAQ,GAAK,EAC5C,AAAI,EAAY,IACf,EAAY,GAAG,EAAE,EAAK,OAIzB,EAAE,EAAK,EAAO,CACb,GAAI,EAAM,GAAiB,EAAI,EAAM,GAAyB,GAAI,CACjE,EAA2B,EAAI,GAAG,OAAO,MACzC,GAAI,GAEJ,IAAK,EAAI,EAAG,EAAI,EAAa,OAAQ,GAAK,EAAG,CAC5C,GAAM,GAAY,GAAmB,EAAK,EAAc,GAExD,AAAI,EAAY,GACf,EAAY,GAAG,EAAE,EAAW,GAE5B,GAAY,GAAK,GAAoB,GACrC,EAAY,GAAG,IACf,EAAY,GAAG,EAAE,EAAK,OAIxB,KAAO,EAAI,EAAY,OAAQ,GAAK,EACnC,EAAY,GAAG,EAAE,GAGlB,EAAY,OAAS,EAAa,SAGpC,EAAE,EAAW,CACZ,AAAI,GAAW,EAAO,GACtB,GAAa,EAAa,KAM7B,YAA6B,EAAK,CACjC,GAAI,GACA,EACA,EACA,EAEJ,MAAO,CACN,GAAI,CACH,EAAM,EAAQ,OACd,EAAK,EAAK,QAAS,4BACd,GAAc,EAAI,IAAK,EAA0B,EAAI,IAAI,KAAK,iBAAiB,EAAK,EAAK,MAAO,GACrG,EAAK,EAAK,MAAO,KAElB,EAAE,EAAQ,EAAQ,CACjB,EAAO,EAAQ,EAAK,GAEf,GACJ,GAAU,GAAO,EAAK,QAAS,UAAY,CAC1C,AAAI,GAAgC,EAAI,IAAc,EAAI,IAAI,KAAK,kBAAsC,EAAI,IAAc,EAAI,IAAI,KAAK,gBAAgB,MAAM,KAAM,aAGrK,EAAU,KAGZ,EAAE,EAAS,EAAO,CACjB,EAAM,EAEF,EAAM,GAAiB,GAAK,CAAC,GAAc,EAAI,IAAK,EAA0B,EAAI,IAAI,KAAK,iBAC9F,EAAK,EAAK,MAAO,IAGnB,EAAE,EAAW,CACZ,AAAI,GAAW,EAAO,GACtB,EAAU,GACV,MAMH,YAA2B,EAAK,CAC/B,GAAI,GACA,EAEJ,MAAO,CACN,GAAI,CACH,EAAK,GAAK,KACV,EAAK,GAAsB,EAAI,KAEhC,EAAE,EAAQ,EAAQ,CACjB,EAAO,EAAQ,EAAI,GACnB,EAAO,EAAQ,EAAI,IAEpB,EAAE,EAAK,EAAO,CACb,AAAI,EAAM,GAAsB,IAAI,GAAS,EAAqB,EAAI,KAEvE,EAAE,EAAW,CACZ,AAAI,GAAW,EAAO,GAClB,GAAW,EAAO,KAMzB,YAA2B,EAAK,CAC/B,GAAI,GACA,EACA,EACA,EACA,EACA,EACA,EAEJ,MAAO,CACN,GAAI,CACH,EAAQ,EAAQ,QAChB,EAAK,GAAK,KACV,EAAK,GAA6B,EAAI,IACtC,EAAK,IACL,EAAQ,EAAQ,QAChB,EAAK,GAAK,KACV,EAAK,GAAsB,EAAI,IAC/B,EAAK,EAAO,QAAS,gCACrB,EAAK,EAAO,QAAS,uBAEtB,EAAE,EAAQ,EAAQ,CACjB,EAAO,EAAQ,EAAO,GACtB,EAAO,EAAO,GACd,EAAO,EAAO,GACd,EAAO,EAAQ,EAAI,GACnB,EAAO,EAAQ,EAAO,GACtB,EAAO,EAAO,GACd,EAAO,EAAO,IAEf,EAAE,EAAK,EAAO,CACb,AAAI,EAAM,GAA6B,KAAK,GAAS,EAA4B,EAAI,IACjF,EAAM,GAAsB,IAAI,GAAS,EAAqB,EAAI,KAEvE,EAAE,EAAW,CACZ,AAAI,GAAW,EAAO,GAClB,GAAW,EAAO,GAClB,GAAW,EAAO,KAMzB,YAA2B,EAAK,CAC/B,GAAI,GACA,EAAsB,EAAI,IAAI,KAAK,MAAQ,GAC3C,EACA,EAEJ,MAAO,CACN,GAAI,CACH,EAAS,EAAQ,UACjB,EAAI,GAAK,GACT,EAAO,QAAU,EAAiC,EAAI,IAAI,KAC1D,EAAO,MAAQ,EAAO,SAEvB,EAAE,EAAQ,EAAQ,CACjB,EAAO,EAAQ,EAAQ,GACvB,EAAO,EAAQ,IAEhB,EAAE,EAAK,EAAO,CACb,AAAI,EAAM,GAAiB,GAAK,IAAa,GAAsB,EAAI,IAAI,KAAK,MAAQ,KAAK,GAAS,EAAG,GAErG,EAAM,GAAiB,GAAK,IAAwB,GAAiC,EAAI,IAAI,OAChG,GAAO,QAAU,EACjB,EAAO,MAAQ,EAAO,UAGxB,EAAE,EAAW,CACZ,AAAI,GAAW,EAAO,KAMzB,YAA2B,EAAK,CAC/B,GAAI,GACA,EAAuB,EAAI,IAAI,KAAK,kBAAoB,GAAkB,GAE9E,MAAO,CACN,GAAI,CACH,AAAI,GAAU,EAAS,IACvB,EAAkB,MAEnB,EAAE,EAAQ,EAAQ,CACjB,AAAI,GAAU,EAAS,EAAE,EAAQ,GACjC,EAAO,EAAQ,EAAiB,IAEjC,EAAE,EAAK,EAAO,CACb,AAAgB,EAAI,IAAI,KAAK,iBAC5B,AAAI,EACH,EAAS,EAAE,EAAK,GAEhB,GAAW,GAAkB,GAC7B,EAAS,IACT,EAAS,EAAE,EAAgB,WAAY,IAE9B,GACV,GAAS,EAAE,GACX,EAAW,OAGb,EAAE,EAAW,CACZ,AAAI,GAAU,EAAS,EAAE,GACrB,GAAW,EAAO,KAMzB,YAA+B,EAAK,CACnC,GAAI,GAEJ,MAAO,CACN,GAAI,CACH,EAAI,GAAK,YAEV,EAAE,EAAQ,EAAQ,CACjB,EAAO,EAAQ,EAAG,IAEnB,EAAE,EAAW,CACZ,AAAI,GAAW,EAAO,KAMzB,YAA+B,EAAK,CACnC,GAAI,GAEJ,MAAO,CACN,GAAI,CACH,EAAI,GAAK,oBAEV,EAAE,EAAQ,EAAQ,CACjB,EAAO,EAAQ,EAAG,IAEnB,EAAE,EAAW,CACZ,AAAI,GAAW,EAAO,KAMzB,YAA2B,EAAK,CAC/B,GAAI,GACA,EAEJ,SAAe,GAAI,IAAa,CAC9B,MAAO,CACN,MAAO,QACP,YAAa,mBACb,QAAS,CAAE,QAAS,CAAC,KACrB,QAAS,CAAE,UAId,EAAa,IAAI,QAAqC,EAAI,KAEnD,CACN,GAAI,CACH,EAAiB,EAAa,GAAG,WAElC,EAAE,EAAQ,EAAQ,CACjB,EAAgB,EAAc,EAAQ,GACtC,EAAU,IAEX,EAAE,EAAK,EAAO,CACb,GAAM,GAAuB,GAE7B,AAAI,EAAM,GAAiB,YAC1B,GAAqB,QAAU,CAAE,QAAO,QAGzC,EAAa,KAAK,IAEnB,EAAE,EAAO,CACR,AAAI,GACJ,GAAc,EAAa,GAAG,SAAU,GACxC,EAAU,KAEX,EAAE,EAAO,CACR,EAAe,EAAa,GAAG,SAAU,GACzC,EAAU,IAEX,EAAE,EAAW,CACZ,EAAkB,EAAc,KAMnC,YAA+B,EAAK,CACnC,GAAI,GAEJ,MAAO,CACN,GAAI,CACH,EAAI,GAAK,mBAEV,EAAE,EAAQ,EAAQ,CACjB,EAAO,EAAQ,EAAG,IAEnB,EAAE,EAAW,CACZ,AAAI,GAAW,EAAO,KAMzB,YAA2B,EAAK,CAC/B,GAAI,GACA,EACJ,SAAmB,GAAI,IAAiB,IAEjC,CACN,GAAI,CACH,EAAiB,EAAiB,GAAG,WAEtC,EAAE,EAAQ,EAAQ,CACjB,EAAgB,EAAkB,EAAQ,GAC1C,EAAU,IAEX,EAAE,EAAO,CACR,AAAI,GACJ,GAAc,EAAiB,GAAG,SAAU,GAC5C,EAAU,KAEX,EAAE,EAAO,CACR,EAAe,EAAiB,GAAG,SAAU,GAC7C,EAAU,IAEX,EAAE,EAAW,CACZ,EAAkB,EAAkB,KAMvC,YAA+B,EAAK,CACnC,GAAI,GAEJ,MAAO,CACN,GAAI,CACH,EAAI,GAAK,oBAEV,EAAE,EAAQ,EAAQ,CACjB,EAAO,EAAQ,EAAG,IAEnB,EAAE,EAAW,CACZ,AAAI,GAAW,EAAO,KAMzB,YAA2B,EAAK,CAC/B,GAAI,GACA,EAEJ,SAAe,GAAI,IAAa,CAC9B,MAAO,CACN,MAAO,QACP,YAAa,mBACb,QAAS,CAAE,QAAS,CAAC,KACrB,QAAS,CAAE,UAId,EAAa,IAAI,QAAqC,EAAI,KAEnD,CACN,GAAI,CACH,EAAiB,EAAa,GAAG,WAElC,EAAE,EAAQ,EAAQ,CACjB,EAAgB,EAAc,EAAQ,GACtC,EAAU,IAEX,EAAE,EAAK,EAAO,CACb,GAAM,GAAuB,GAE7B,AAAI,EAAM,GAAiB,YAC1B,GAAqB,QAAU,CAAE,QAAO,QAGzC,EAAa,KAAK,IAEnB,EAAE,EAAO,CACR,AAAI,GACJ,GAAc,EAAa,GAAG,SAAU,GACxC,EAAU,KAEX,EAAE,EAAO,CACR,EAAe,EAAa,GAAG,SAAU,GACzC,EAAU,IAEX,EAAE,EAAW,CACZ,EAAkB,EAAc,KAMnC,YAA+B,EAAK,CACnC,GAAI,GAEJ,MAAO,CACN,GAAI,CACH,EAAI,GAAK,mBAEV,EAAE,EAAQ,EAAQ,CACjB,EAAO,EAAQ,EAAG,IAEnB,EAAE,EAAW,CACZ,AAAI,GAAW,EAAO,KAMzB,YAA2B,EAAK,CAC/B,GAAI,GACA,EACJ,SAAmB,GAAI,IAAiB,IAEjC,CACN,GAAI,CACH,EAAiB,EAAiB,GAAG,WAEtC,EAAE,EAAQ,EAAQ,CACjB,EAAgB,EAAkB,EAAQ,GAC1C,EAAU,IAEX,EAAE,EAAO,CACR,AAAI,GACJ,GAAc,EAAiB,GAAG,SAAU,GAC5C,EAAU,KAEX,EAAE,EAAO,CACR,EAAe,EAAiB,GAAG,SAAU,GAC7C,EAAU,IAEX,EAAE,EAAW,CACZ,EAAkB,EAAkB,KAMvC,YAA6B,EAAK,CACjC,GAAI,GAEJ,MAAO,CACN,GAAI,CACH,EAAI,GAAK,gBAEV,EAAE,EAAQ,EAAQ,CACjB,EAAO,EAAQ,EAAG,IAEnB,EAAE,EAAW,CACZ,AAAI,GAAW,EAAO,KAKzB,YAAyB,EAAK,CAC7B,GAAI,GACA,EACA,EACA,EACA,EACA,EACA,EACJ,EAAS,GAAI,IAAO,IACpB,GAAI,GAAuB,EAAI,IAAM,GAAgB,GACrD,SAAS,GAAI,IAAO,IAEpB,EAAU,GAAI,IAAM,CAClB,MAAO,CACN,KAAiB,EAAI,IACrB,YAAa,MAIhB,EAAQ,IAAI,SAAgC,EAAI,KAEzC,CACN,GAAI,CACH,EAAiB,EAAO,GAAG,UAC3B,EAAK,IACD,GAAU,EAAS,IACvB,EAAK,IACL,EAAiB,EAAO,GAAG,UAC3B,EAAK,IACL,EAAiB,EAAQ,GAAG,WAE7B,EAAE,EAAQ,EAAQ,CACjB,EAAgB,EAAQ,EAAQ,GAChC,EAAO,EAAQ,EAAI,GACf,GAAU,EAAS,EAAE,EAAQ,GACjC,EAAO,EAAQ,EAAI,GACnB,EAAgB,EAAQ,EAAQ,GAChC,EAAO,EAAQ,EAAI,GACnB,EAAgB,EAAS,EAAQ,GACjC,EAAU,IAEX,EAAE,EAAK,EAAO,CACb,AAAgB,EAAI,GACnB,AAAI,EACH,GAAS,EAAE,EAAK,GAEZ,EAAM,GAAiB,GAC1B,EAAc,EAAU,IAGzB,GAAW,GAAgB,GAC3B,EAAS,IACT,EAAc,EAAU,GACxB,EAAS,EAAE,EAAG,WAAY,IAEjB,GACV,MAEA,EAAe,EAAU,EAAG,EAAG,IAAM,CACpC,EAAW,OAGZ,MAGD,GAAM,GAAkB,GACxB,AAAI,EAAM,GAAgB,SAAS,GAAgB,KAAkB,EAAI,KACzE,EAAQ,KAAK,IAEd,EAAE,EAAO,CACR,AAAI,GACJ,GAAc,EAAO,GAAG,SAAU,GAClC,EAAc,GACd,EAAc,EAAO,GAAG,SAAU,GAClC,EAAc,EAAQ,GAAG,SAAU,GACnC,EAAU,KAEX,EAAE,EAAO,CACR,EAAe,EAAO,GAAG,SAAU,GACnC,EAAe,GACf,EAAe,EAAO,GAAG,SAAU,GACnC,EAAe,EAAQ,GAAG,SAAU,GACpC,EAAU,IAEX,EAAE,EAAW,CACZ,EAAkB,EAAQ,GACtB,GAAW,EAAO,GAClB,GAAU,EAAS,EAAE,GACrB,GAAW,EAAO,GACtB,EAAkB,EAAQ,GACtB,GAAW,EAAO,GACtB,EAAkB,EAAS,KAK9B,YAAkB,EAAQ,EAAS,EAAc,CAChD,GAAI,GACJ,GAAoB,EAAQ,GAAO,IAAW,EAAa,GAAI,EAAS,KACxE,GAAI,CAAE,QAAS,EACX,EAEJ,OAAQ,OACF,QACJ,EAAW,0BACX,UACI,MACJ,EAAW,uBACX,UACI,QACJ,EAAW,yBACX,cAEA,EAAW,0BACX,MAGF,GAAI,GAEJ,GAAQ,SAAY,CAEnB,GAAI,IAAM,KAAM,IAAI,iBAAiB,GAErC,EAAa,EAAG,EAAU,GAAI,KAAK,SAAS,MAAM,GAAG,MACrD,EAAa,EAAG,EAAe,EAAQ,SAAS,MAAM,GAAG,KAAK,OAC9D,EAAa,EAAG,EAAsB,EAAQ,SAAS,MAAM,GAAG,KAAK,kBAGtE,GAAI,GACA,EAAa,KACb,EACA,EACA,EACA,EACA,EACA,EACA,EACA,EAAa,MACb,EACA,EACA,EAAsB,GACtB,EAAqB,GACrB,EACA,EACA,EAAoB,GACpB,EACA,GAAsB,GACtB,GAAqB,GACrB,EACA,GACA,GAAoB,GAExB,mBAAgC,CAE/B,EAAa,AADO,MAAM,IAAI,kBACH,KAAK,eAAe,SAAS,GAGzD,mBAA+B,CAC9B,GAAI,CAGH,AAAI,AAFW,MAAM,IAAI,YAAY,IAExB,KAAK,KAAK,OACtB,MAAM,MACN,GAAmB,UAEb,GAAN,CACD,KAAM,MACN,GAAmB,GAGpB,GAAI,CAAC,EAAY,CAChB,MAAM,yEACN,OAGD,AAAI,GAAY,EACf,MAAM,IAAI,cAAc,EAAY,EAAgB,GAAI,EAAI,MAAO,EAAY,EAAM,MAAO,EAAU,GACtG,EAAa,GAAI,EAAU,MAAQ,GAAI,GACvC,EAAa,GAAI,EAAW,MAC5B,EAAa,GAAI,EAAU,MAAQ,GAAI,GACvC,EAAa,GAAI,EAAW,MAC5B,OAAO,SAAS,KAAO,SAEvB,MAAM,oCAIR,aAA0B,CACzB,EAAa,GAAI,EAAsB,IAGxC,mBAA0B,CACzB,EAAa,GAAI,EAAqB,IACtC,EAAa,GAAI,EAAW,KAAM,IAAO,SAAS,EAAU,QAC5D,EAAa,GAAI,EAAqB,IACtC,EAAa,GAAI,EAAoB,IAGtC,aAA0B,CACzB,EAAa,GAAI,GAAsB,IAGxC,mBAA0B,CACzB,EAAa,GAAI,GAAqB,IACtC,EAAa,GAAI,EAAW,KAAM,IAAO,SAAS,EAAU,QAC5D,EAAa,GAAI,GAAqB,IACtC,EAAa,GAAI,GAAoB,IAGtC,aAAmC,CAClC,GAAM,IAAI,GAAK,GAAc,CAAE,SAAU,KAG1C,aAAmC,CAClC,GAAM,IAAI,GAAK,GAAc,CAAE,cAGhC,mBAAqC,CACpC,EAAa,EAAG,EAAe,EAAgB,OAC/C,EAAa,EAAG,EAAsB,EAAgB,gBAGvD,mBAAiC,CAChC,GAAM,IAAI,GAAK,GAAc,CAAE,MAAO,EAAM,SAG7C,mBAAmC,CAClC,GAAM,MAGP,kBAA+B,GAAK,CACnC,EAAa,EAAG,EAAU,IAAM,GAAK,GAGtC,GAAM,IAAmB,CAAC,IAE1B,YAAqB,GAAS,CAC7B,GAAkB,GAAU,UAAY,QAAQ,IAAM,CACrD,EAAY,GACZ,EAAa,EAAG,KAIlB,YAAuB,GAAS,CAC/B,GAAkB,GAAU,UAAY,QAAQ,IAAM,CACrD,EAAY,GACZ,EAAa,EAAG,KAIlB,GAAM,IAAyB,IAAM,EAAa,EAAG,EAAI,YAAc,GAAK,GAE5E,YAAuB,GAAS,CAC/B,GAAkB,GAAU,UAAY,QAAQ,IAAM,CACrD,EAAM,GACN,EAAa,EAAG,KAIlB,YAAyB,GAAS,CACjC,GAAkB,GAAU,UAAY,QAAQ,IAAM,CACrD,EAAU,GACV,EAAa,GAAI,KAInB,aAAkC,CACjC,EAAkB,GAAa,MAC/B,EAAa,EAAG,GAChB,EAAa,EAAG,GAGjB,YAAwB,GAAS,CAChC,GAAkB,GAAU,UAAY,QAAQ,IAAM,CACrD,EAAM,GACN,EAAa,EAAG,KAIlB,aAAiC,CAChC,EAAa,KAAK,QAClB,EAAa,EAAG,GAGjB,YAAiC,CAChC,EAAa,KAAK,QAClB,EAAa,EAAG,GAGjB,YAAyB,GAAS,CACjC,GAAkB,GAAU,UAAY,QAAQ,IAAM,CACrD,EAAQ,GACR,EAAa,EAAG,KAIlB,YAAwB,GAAS,CAChC,GAAkB,GAAU,UAAY,QAAQ,IAAM,CACrD,EAAY,GACZ,EAAa,GAAI,KAInB,YAA+B,GAAS,CACvC,GAAkB,GAAU,UAAY,QAAQ,IAAM,CACrD,EAAc,GACd,EAAa,GAAI,KAInB,YAAwB,GAAS,CAChC,GAAkB,GAAU,UAAY,QAAQ,IAAM,CACrD,EAAY,GACZ,EAAa,GAAI,KAInB,YAA+B,GAAS,CACvC,GAAkB,GAAU,UAAY,QAAQ,IAAM,CACrD,EAAc,GACd,EAAa,GAAI,KAInB,YAA+B,GAAS,CACvC,GAAkB,GAAU,UAAY,QAAQ,IAAM,CACrD,GAAkB,GAClB,EAAa,GAAI,MAInB,SAAO,MAAQ,IAAW,CACzB,AAAI,QAAU,KAAS,EAAa,GAAI,EAAO,GAAQ,OAGjD,CACN,EACA,EACA,EACA,EACA,EACA,EACA,EACA,EACA,EACA,EACA,EACA,EACA,EACA,EACA,EACA,EACA,EACA,EACA,GACA,GACA,EACA,GACA,GACA,EACA,EACA,GACA,GACA,GACA,GACA,GACA,GACA,GACA,GACA,GACA,GACA,GACA,EACA,GACA,GACA,GACA,GACA,GACA,GACA,GACA,GACA,GACA,EACA,GACA,GACA,GACA,GACA,GACA,IAIF,oBAAsB,EAAgB,CACrC,YAAY,EAAS,CACpB,QACA,EAAK,KAAM,EAAS,GAAU,GAAiB,EAAgB,CAAE,KAAM,IAAM,KAAM,CAAC,GAAI,OAInF,GAAQ,GCtzDf,YAA2B,EAAK,CAC/B,GAAI,GACA,EACA,EACA,EACA,EAEJ,MAAO,CACN,GAAI,CACH,EAAM,EAAQ,OACd,EAAK,EAAK,QAAS,0CACd,GAAc,EAAI,IAAK,EAAyC,EAAI,GAAG,KAAK,QAAQ,MAAM,cAAc,EAAK,EAAK,MAAO,GAC9H,EAAK,EAAK,MAAO,EAAyC,EAAI,GAAG,KAAK,QAEvE,EAAE,EAAQ,EAAQ,CACjB,EAAO,EAAQ,EAAK,GAEf,GACJ,GAAU,GAAO,EAAK,QAAS,UAAY,CAC1C,AAAI,GAAwC,EAAI,GAA4B,EAAI,GAAG,KAAK,QAAQ,MAAM,eAA2C,EAAI,GAA4B,EAAI,GAAG,KAAK,QAAQ,MAAM,aAAa,MAAM,KAAM,aAGrO,EAAU,KAGZ,EAAE,EAAS,EAAO,CACjB,EAAM,EAEF,EAAiC,GAAK,CAAC,GAAc,EAAI,IAAK,EAAyC,EAAI,GAAG,KAAK,QAAQ,MAAM,cACpI,EAAK,EAAK,MAAO,GAGd,EAAiC,GAAK,IAAmB,GAAyC,EAAI,GAAG,KAAK,QACjH,EAAK,EAAK,MAAO,IAGnB,EAAE,EAAW,CACZ,AAAI,GAAW,EAAO,GACtB,EAAU,GACV,MAMH,YAA2B,EAAK,CAC/B,GAAI,GACA,EAAoC,EAAI,GAAG,KAAK,iBAAiB,KAAK,IAAM,MAAQ,GACpF,EAEJ,MAAO,CACN,GAAI,CACH,EAAK,GAAK,WACV,EAAK,GAAK,IAEX,EAAE,EAAQ,EAAQ,CACjB,EAAO,EAAQ,EAAI,GACnB,EAAO,EAAQ,EAAI,IAEpB,EAAE,EAAK,EAAO,CACb,AAAI,EAAiC,GAAK,IAAc,GAAoC,EAAI,GAAG,KAAK,iBAAiB,KAAK,IAAM,MAAQ,KAAK,GAAS,EAAI,IAE/J,EAAE,EAAW,CACZ,AAAI,GAAW,EAAO,GAClB,GAAW,EAAO,KAMzB,YAAyB,EAAK,CAC7B,GAAI,GACA,EAAoC,EAAI,GAAG,KAAK,QAAQ,gBAAgB,KAAK,IAAQ,MAAQ,GAC7F,EAEJ,MAAO,CACN,GAAI,CACH,EAAK,GAAK,UACV,EAAK,GAAK,IAEX,EAAE,EAAQ,EAAQ,CACjB,EAAO,EAAQ,EAAI,GACnB,EAAO,EAAQ,EAAI,IAEpB,EAAE,EAAK,EAAO,CACb,AAAI,EAAiC,GAAK,IAAc,GAAoC,EAAI,GAAG,KAAK,QAAQ,gBAAgB,KAAK,IAAQ,MAAQ,KAAK,GAAS,EAAI,IAExK,EAAE,EAAW,CACZ,AAAI,GAAW,EAAO,GAClB,GAAW,EAAO,KAMzB,YAA+B,EAAK,CACnC,GAAI,GAEJ,MAAO,CACN,GAAI,CACH,EAAI,GAAK,eAEV,EAAE,EAAQ,EAAQ,CACjB,EAAO,EAAQ,EAAG,IAEnB,EAAE,EAAW,CACZ,AAAI,GAAW,EAAO,KAMzB,YAA+B,EAAK,CACnC,GAAI,GAEJ,MAAO,CACN,GAAI,CACH,EAAI,GAAK,eAEV,EAAE,EAAQ,EAAQ,CACjB,EAAO,EAAQ,EAAG,IAEnB,EAAE,EAAW,CACZ,AAAI,GAAW,EAAO,KAMzB,YAA6B,EAAK,CACjC,GAAI,GAEJ,MAAO,CACN,GAAI,CACH,EAAI,GAAK,WAEV,EAAE,EAAQ,EAAQ,CACjB,EAAO,EAAQ,EAAG,IAEnB,EAAE,EAAW,CACZ,AAAI,GAAW,EAAO,KAKzB,YAAyB,EAAK,CAC7B,GAAI,GACA,EACA,EACA,EACA,EACA,EAAoC,EAAI,GAAG,KAAK,MAAQ,GACxD,EACA,EACA,EACA,EACA,EACA,EACA,EACA,EACA,EACA,EACA,EACA,EACA,EACA,EAAqC,EAAI,GAAG,KAAK,QAAQ,OAAS,GAAkB,GACpF,EAAqC,EAAI,GAAG,KAAK,kBAAoB,GAAkB,GACvF,EAAqC,EAAI,GAAG,KAAK,QAAQ,iBAAmB,GAAgB,GAEhG,SAAgB,GAAI,IAAa,CAC/B,MAAO,CACN,MAAO,UACP,YAAa,mBACb,QAAS,CAAE,QAAS,CAAC,KACrB,QAAS,CAAE,UAId,EAAc,IAAI,QAAS,UAAY,CACtC,AAAI,GAAwC,EAAI,GAA4B,EAAI,GAAG,KAAK,iBAAiB,KAAK,IAAe,SAAqC,EAAI,GAA4B,EAAI,GAAG,KAAK,iBAAiB,KAAK,IAAe,OAAO,MAAM,KAAM,aAGvQ,EAAgB,GAAI,IAAa,CAC/B,MAAO,CACN,MAAO,UACP,YAAa,mBACb,QAAS,CAAE,QAAS,CAAC,KACrB,QAAS,CAAE,UAId,EAAc,IAAI,QAAS,UAAY,CACtC,AAAI,GAAwC,EAAI,GAA4B,EAAI,GAAG,KAAK,iBAAiB,KAAK,IAAiB,SAAqC,EAAI,GAA4B,EAAI,GAAG,KAAK,iBAAiB,KAAK,IAAiB,OAAO,MAAM,KAAM,aAG3Q,EAAgB,GAAI,IAAa,CAC/B,MAAO,CACN,MAAO,UACP,YAAa,mBACb,QAAS,CAAE,QAAS,CAAC,KACrB,QAAS,CAAE,UAId,EAAc,IAAI,QAAS,UAAY,CACtC,AAAI,GAA2B,EAAI,GAA4B,EAAI,MAAqB,EAAI,GAA4B,EAAI,IAAI,MAAM,KAAM,aAGtI,CACN,GAAI,CACH,EAAO,EAAQ,OACX,GAAW,EAAU,IACzB,EAAK,IACL,EAAO,EAAQ,OACf,EAAO,EAAQ,OACf,EAAK,EAAQ,KACb,EAAK,GAAK,GACV,EAAK,IACL,EAAK,EAAQ,KACT,GAAW,EAAU,IACzB,EAAK,IACL,EAAK,EAAQ,KACT,GAAW,EAAU,IACzB,EAAK,IACL,EAAO,EAAQ,OACf,EAAiB,EAAc,GAAG,UAClC,EAAK,IACL,EAAiB,EAAc,GAAG,UAClC,EAAK,IACL,EAAiB,EAAc,GAAG,UAClC,EAAK,EAAI,QAAS,uCAClB,EAAK,EAAI,QAAS,uCAClB,EAAK,EAAI,QAAS,sCAClB,EAAK,EAAM,QAAS,iDACpB,EAAK,EAAM,QAAS,sBACpB,EAAK,EAAM,QAAS,iCACpB,EAAK,EAAM,QAAS,6BAErB,EAAE,EAAQ,EAAQ,CACjB,EAAO,EAAQ,EAAM,GACjB,GAAW,EAAU,EAAE,EAAM,MACjC,EAAO,EAAM,GACb,EAAO,EAAM,GACb,EAAO,EAAM,GACb,EAAO,EAAM,GACb,EAAO,EAAI,GACX,EAAO,EAAM,GACb,EAAO,EAAM,GACT,GAAW,EAAU,EAAE,EAAI,MAC/B,EAAO,EAAM,GACb,EAAO,EAAM,GACT,GAAW,EAAU,EAAE,EAAI,MAC/B,EAAO,EAAM,GACb,EAAO,EAAM,GACb,EAAgB,EAAe,EAAM,MACrC,EAAO,EAAM,GACb,EAAgB,EAAe,EAAM,MACrC,EAAO,EAAM,GACb,EAAgB,EAAe,EAAM,MACrC,EAAU,IAEX,EAAE,EAAS,CAAC,GAAQ,CACnB,EAAM,EAEN,AAA6B,EAAI,GAAG,KAAK,QAAQ,MAChD,AAAI,EACH,EAAU,EAAE,EAAK,GAEjB,GAAY,GAAkB,GAC9B,EAAU,IACV,EAAU,EAAE,EAAM,IAET,GACV,GAAU,EAAE,GACZ,EAAY,MAGR,EAAC,GAAW,EAAiC,IAAM,IAAc,GAAoC,EAAI,GAAG,KAAK,MAAQ,KAAK,GAAS,EAAI,GAEhJ,AAA6B,EAAI,GAAG,KAAK,iBACxC,AAAI,EACH,EAAU,EAAE,EAAK,GAEjB,GAAY,GAAkB,GAC9B,EAAU,IACV,EAAU,EAAE,EAAI,OAEP,GACV,GAAU,EAAE,GACZ,EAAY,MAGb,AAA6B,EAAI,GAAG,KAAK,QAAQ,gBAChD,AAAI,EACH,EAAU,EAAE,EAAK,GAEjB,GAAY,GAAgB,GAC5B,EAAU,IACV,EAAU,EAAE,EAAI,OAEP,GACV,GAAU,EAAE,GACZ,EAAY,MAGb,GAAM,IAAwB,GAE9B,AAAI,EAAoB,IACvB,IAAsB,QAAU,CAAE,QAAO,QAG1C,EAAc,KAAK,IACnB,GAAM,IAAwB,GAE9B,AAAI,EAAoB,IACvB,IAAsB,QAAU,CAAE,QAAO,QAG1C,EAAc,KAAK,IACnB,GAAM,GAAwB,GAE9B,AAAI,EAAoB,IACvB,GAAsB,QAAU,CAAE,QAAO,QAG1C,EAAc,KAAK,IAEpB,EAAE,EAAO,CACR,AAAI,GACJ,GAAc,EAAc,GAAG,SAAU,GACzC,EAAc,EAAc,GAAG,SAAU,GACzC,EAAc,EAAc,GAAG,SAAU,GACzC,EAAU,KAEX,EAAE,EAAO,CACR,EAAe,EAAc,GAAG,SAAU,GAC1C,EAAe,EAAc,GAAG,SAAU,GAC1C,EAAe,EAAc,GAAG,SAAU,GAC1C,EAAU,IAEX,EAAE,EAAW,CACZ,AAAI,GAAW,EAAO,GAClB,GAAW,EAAU,IACrB,GAAW,EAAU,IACrB,GAAW,EAAU,IACzB,EAAkB,GAClB,EAAkB,GAClB,EAAkB,KAKrB,GAAM,IAAO,GAAmB,EAAgB,KAAO,SACjD,GAAS,GAAU,EAAO,MAAQ,OAClC,GAAgB,GAAmB,EAAgB,KAAO,YAC1D,GAAkB,GAAmB,EAAgB,KAAO,YAElE,YAAkB,EAAQ,EAAS,EAAc,CAChD,GAAM,GAAW,KACb,CAAE,wBAAyB,EAE/B,WAAoB,EAAc,CACjC,EAAS,aAAc,CAAE,aAAc,IAGxC,WAAiC,EAAK,CACrC,GAAM,IAAI,GAAK,GAAc,CAAE,SAAU,KAG1C,WAAiC,EAAK,CACrC,GAAM,IAAI,GAAK,GAAc,CAAE,SAAU,KAG1C,SAAO,MAAQ,GAAW,CACzB,AAAI,wBAA0B,IAAS,EAAa,EAAG,EAAuB,EAAQ,uBAGhF,CACN,EACA,EACA,EACA,GAIF,oBAAuB,EAAgB,CACtC,YAAY,EAAS,CACpB,QACA,EAAK,KAAM,EAAS,GAAU,GAAiB,EAAgB,CAAE,qBAAsB,MAIlF,GAAQ,GC/Yf,YAA6B,EAAK,CACjC,GAAI,GAEJ,MAAO,CACN,GAAI,CACH,EAAI,GAAK,wBAEV,EAAE,EAAQ,EAAQ,CACjB,EAAO,EAAQ,EAAG,IAEnB,EAAE,EAAW,CACZ,AAAI,GAAW,EAAO,KAKzB,YAAyB,EAAK,CAC7B,GAAI,GACA,EACA,EACA,EAAW,GAAgC,EAAI,GAAG,KAAK,KAAK,eAAiB,GAC7E,EACA,EACA,EAAwB,EAAI,GAAG,KAAK,KAAK,aAAe,GACxD,EACA,EACA,EACA,EACA,EACA,EACA,EACA,EAEJ,SAAe,GAAI,IAAa,CAC9B,MAAO,CACN,KAAM,GACN,MAAO,UACP,YAAa,4BACb,QAAS,CAAE,QAAS,CAAC,KACrB,QAAS,CAAE,UAId,EAAa,IAAI,QAAqC,EAAI,IAEnD,CACN,GAAI,CACH,EAAU,EAAQ,WAClB,EAAM,EAAQ,MACd,EAAK,GAAK,eACV,EAAK,GAAK,GACV,EAAK,IACL,EAAK,GAAK,GACV,EAAK,IACL,EAAI,EAAQ,KACZ,EAAE,YAAc,4CAChB,EAAK,IACL,EAAiB,EAAa,GAAG,UACjC,EAAK,IACL,EAAM,EAAQ,MACd,EAAI,UAAY,2EAChB,EAAK,EAAG,QAAS,gCACjB,EAAK,EAAK,QAAS,qDACnB,EAAK,EAAS,QAAS,iCAExB,EAAE,EAAQ,EAAQ,CACjB,EAAO,EAAQ,EAAS,GACxB,EAAO,EAAS,GAChB,EAAO,EAAK,GACZ,EAAO,EAAK,GACZ,EAAO,EAAK,GACZ,EAAO,EAAK,GACZ,EAAO,EAAS,GAChB,EAAO,EAAS,GAChB,EAAO,EAAS,GAChB,EAAgB,EAAc,EAAS,MACvC,EAAO,EAAS,GAChB,EAAO,EAAS,GAChB,EAAU,IAEX,EAAE,EAAK,CAAC,GAAQ,CACf,AAAK,EAAC,GAAW,EAAqB,IAAM,IAAc,GAAW,GAAgC,EAAI,GAAG,KAAK,KAAK,eAAiB,KAAK,GAAS,EAAI,GACpJ,EAAC,GAAW,EAAqB,IAAM,IAAc,GAAwB,EAAI,GAAG,KAAK,KAAK,aAAe,KAAK,GAAS,EAAI,GACpI,GAAM,GAAuB,GAE7B,AAAI,EAAoB,GACvB,GAAqB,QAAU,CAAE,QAAO,QAGzC,EAAa,KAAK,IAEnB,EAAE,EAAO,CACR,AAAI,GACJ,GAAc,EAAa,GAAG,SAAU,GACxC,EAAU,KAEX,EAAE,EAAO,CACR,EAAe,EAAa,GAAG,SAAU,GACzC,EAAU,IAEX,EAAE,EAAW,CACZ,AAAI,GAAW,EAAO,GACtB,EAAkB,KAKrB,YAA4B,EAAa,CACxC,MAAO,YAAW,GAAa,QAAQ,GAAG,WAG3C,YAAkB,EAAQ,EAAS,EAAc,CAChD,GAAI,CAAE,YAAa,EACf,CAAE,cAAe,EAErB,kBAAyC,CACxC,GAAI,CACH,GAAI,GAAM,KAAM,IAAI,kBAAkB,GACtC,OAAO,SAAS,KAAO,EAAI,KAAK,KAAK,aAC9B,EAAN,CACD,MAAM,IAIR,SAAO,MAAQ,GAAW,CACzB,AAAI,YAAc,IAAS,EAAa,EAAG,EAAW,EAAQ,UAC1D,cAAgB,IAAS,EAAa,EAAG,EAAa,EAAQ,aAG5D,CAAC,EAAU,EAAyB,GAG5C,oBAA2B,EAAgB,CAC1C,YAAY,EAAS,CACpB,QACA,EAAK,KAAM,EAAS,GAAU,GAAiB,EAAgB,CAAE,SAAU,EAAG,WAAY,MAIrF,GAAQ,GC5Hf,YAA0B,EAAK,EAAM,EAAG,CACvC,GAAM,GAAY,EAAI,QACtB,SAAU,GAAK,EAAK,GACb,EAIR,YAA2B,EAAK,CAC/B,GAAI,GAEJ,MAAO,CACN,GAAI,CACH,EAAI,GAAK,uBAEV,EAAE,EAAQ,EAAQ,CACjB,EAAO,EAAQ,EAAG,IAEnB,EAAE,EAAW,CACZ,AAAI,GAAW,EAAO,KAMzB,YAA2B,EAAK,CAC/B,GAAI,GAEJ,MAAO,CACN,GAAI,CACH,EAAI,GAAK,uBAEV,EAAE,EAAQ,EAAQ,CACjB,EAAO,EAAQ,EAAG,IAEnB,EAAE,EAAW,CACZ,AAAI,GAAW,EAAO,KAMzB,YAA2B,EAAK,CAC/B,GAAI,GAEJ,MAAO,CACN,GAAI,CACH,EAAI,GAAK,cAEV,EAAE,EAAQ,EAAQ,CACjB,EAAO,EAAQ,EAAG,IAEnB,EAAE,EAAW,CACZ,AAAI,GAAW,EAAO,KAMzB,YAAyB,EAAK,CAC7B,GAAI,GACA,EACA,EACA,EACA,EACA,EAAuB,EAAI,IAAuB,EAAI,KACtD,EACA,EACA,EAA0B,EAAI,GAAG,KAAK,KAAK,UAAU,MACrD,EAAc,GAElB,OAAS,GAAI,EAAG,EAAI,EAAW,OAAQ,GAAK,EAC3C,EAAY,GAAK,GAAkB,GAAiB,EAAK,EAAY,IAGtE,GAAM,GAAM,GAAK,EAAe,EAAY,GAAI,EAAG,EAAG,IAAM,CAC3D,EAAY,GAAK,OAGd,EAAW,GAAW,GAAkB,GAE5C,MAAO,CACN,GAAI,CACH,EAAU,EAAQ,WAClB,EAAQ,EAAQ,SAChB,EAAK,EAAQ,MAEb,EAAG,UAAY;AAAA;AAAA;AAAA,4BAKf,EAAK,IAEL,OAAS,GAAI,EAAG,EAAI,EAAY,OAAQ,GAAK,EAC5C,EAAY,GAAG,IAGhB,EAAK,IACD,GAAU,EAAS,IACvB,EAAkB,KAClB,EAAK,EAAO,QAAS,kCACrB,EAAK,EAAS,QAAS,uCAExB,EAAE,EAAQ,EAAQ,CACjB,EAAO,EAAQ,EAAS,GACxB,EAAO,EAAS,GAChB,EAAO,EAAO,GACd,EAAO,EAAO,GAEd,OAAS,GAAI,EAAG,EAAI,EAAY,OAAQ,GAAK,EAC5C,AAAI,EAAY,IACf,EAAY,GAAG,EAAE,EAAO,MAI1B,EAAO,EAAQ,EAAI,GACf,GAAU,EAAS,EAAE,EAAQ,GACjC,EAAO,EAAQ,EAAiB,GAChC,EAAU,IAEX,EAAE,EAAK,EAAO,CACb,GAAI,EAAuF,GAAI,CAC9F,EAA0B,EAAI,GAAG,KAAK,KAAK,UAAU,MACrD,GAAI,GAEJ,IAAK,EAAI,EAAG,EAAI,EAAW,OAAQ,GAAK,EAAG,CAC1C,GAAM,GAAY,GAAiB,EAAK,EAAY,GAEpD,AAAI,EAAY,GACf,GAAY,GAAG,EAAE,EAAW,GAC5B,EAAc,EAAY,GAAI,IAE9B,GAAY,GAAK,GAAkB,GACnC,EAAY,GAAG,IACf,EAAc,EAAY,GAAI,GAC9B,EAAY,GAAG,EAAE,EAAO,OAM1B,IAFA,KAEK,EAAI,EAAW,OAAQ,EAAI,EAAY,OAAQ,GAAK,EACxD,EAAI,GAGL,KAGD,AAAI,EAAqB,GAAG,GAAuB,EAAI,IAAuB,EAAI,MAElF,AAAI,EACH,AAAI,EACH,GAAS,EAAE,EAAK,GAEZ,EAAqB,GACxB,EAAc,EAAU,IAGzB,GAAW,GAAkB,GAC7B,EAAS,IACT,EAAc,EAAU,GACxB,EAAS,EAAE,EAAgB,WAAY,IAE9B,GACV,MAEA,EAAe,EAAU,EAAG,EAAG,IAAM,CACpC,EAAW,OAGZ,OAGF,EAAE,EAAO,CACR,GAAI,GAEJ,QAAS,GAAI,EAAG,EAAI,EAAW,OAAQ,GAAK,EAC3C,EAAc,EAAY,IAG3B,EAAc,GACd,EAAU,KAEX,EAAE,EAAO,CACR,EAAc,EAAY,OAAO,SAEjC,OAAS,GAAI,EAAG,EAAI,EAAY,OAAQ,GAAK,EAC5C,EAAe,EAAY,IAG5B,EAAe,GACf,EAAU,IAEX,EAAE,EAAW,CACZ,AAAI,GAAW,EAAO,GACtB,GAAa,EAAa,GACtB,GAAW,EAAO,GAClB,GAAU,EAAS,EAAE,GACrB,GAAW,EAAO,KAMzB,YAA2B,EAAK,CAC/B,GAAI,GACA,EACA,EACA,EACA,EACA,EACA,EAAW,GAAoC,EAAI,GAAG,KAAK,QAAQ,OAAS,GAC5E,EACA,EACA,EACA,EACA,EACA,EACA,EACA,EACA,EAAW,GAAoC,EAAI,GAAG,KAAK,QAAQ,MAAyB,EAAI,GAAG,KAAK,UAAY,GACpH,EACA,EACA,EACA,EACA,EAEJ,SAAW,GAAI,IAAS,CACtB,MAAO,CACN,qBAAuC,EAAI,MAI9C,EAAS,IAAI,aAAuC,EAAI,IAEjD,CACN,GAAI,CACH,EAAK,EAAQ,MACb,EAAM,EAAQ,MACd,EAAiB,EAAS,GAAG,UAC7B,EAAK,IACL,EAAM,EAAQ,MACd,EAAK,GAAK,KACV,EAAK,GAAK,GACV,EAAK,IACL,EAAM,EAAQ,MACd,EAAQ,EAAQ,SAChB,EAAK,IACL,EAAM,EAAQ,MACd,EAAK,GAAK,KACV,EAAK,GAAK,GACV,EAAK,IACL,EAAK,EAAK,QAAS,+BACnB,EAAK,EAAO,QAAS,gCACrB,EAAK,EAAO,OAAQ,UACpB,EAAM,MAAQ,EAAqC,EAAI,GAAG,KAAK,SAC/D,EAAK,EAAK,QAAS,+BACnB,EAAK,EAAK,QAAS,+BACnB,EAAK,EAAI,QAAS,2BAEnB,EAAE,EAAQ,EAAQ,CACjB,EAAO,EAAQ,EAAI,GACnB,EAAO,EAAI,GACX,EAAgB,EAAU,EAAK,MAC/B,EAAO,EAAI,GACX,EAAO,EAAI,GACX,EAAO,EAAK,GACZ,EAAO,EAAK,GACZ,EAAO,EAAI,GACX,EAAO,EAAI,GACX,EAAO,EAAK,GACZ,EAAO,EAAI,GACX,EAAO,EAAI,GACX,EAAO,EAAK,GACZ,EAAO,EAAK,GACZ,EAAO,EAAI,GACX,EAAU,GAEL,GACJ,GAAU,GAAO,EAAO,SAAU,UAAY,CAC7C,AAAI,GAAuC,EAAI,GAAoB,EAAI,GAAI,KAAK,SAAoC,EAAI,GAAoB,EAAI,GAAI,KAAK,OAAO,MAAM,KAAM,aAG7K,EAAU,KAGZ,EAAE,EAAS,EAAO,CACjB,EAAM,EACN,GAAM,GAAmB,GACzB,AAAI,EAAqB,GAAG,GAAiB,qBAAwC,EAAI,IACzF,EAAS,KAAK,GACT,EAAC,GAAW,EAAqB,IAAM,IAAc,GAAW,GAAoC,EAAI,GAAG,KAAK,QAAQ,OAAS,KAAK,GAAS,EAAI,GAEpJ,EAAC,GAAW,EAAqB,GAAK,IAAuB,GAAqC,EAAI,GAAG,KAAK,WAAa,EAAM,QAAU,IAC9I,GAAM,MAAQ,GAGV,EAAC,GAAW,EAAqB,IAAM,IAAc,GAAW,GAAoC,EAAI,GAAG,KAAK,QAAQ,MAAyB,EAAI,GAAG,KAAK,UAAY,KAAK,GAAS,EAAI,IAEjM,EAAE,EAAO,CACR,AAAI,GACJ,GAAc,EAAS,GAAG,SAAU,GACpC,EAAU,KAEX,EAAE,EAAO,CACR,EAAe,EAAS,GAAG,SAAU,GACrC,EAAU,IAEX,EAAE,EAAW,CACZ,AAAI,GAAW,EAAO,GACtB,EAAkB,GAClB,EAAU,GACV,MAMH,YAA2B,EAAK,CAC/B,GAAI,GACA,EAEJ,SAAe,GAAI,IAAa,CAC9B,MAAO,CACN,SAAuB,EAAI,GAC3B,WAA2B,EAAI,MAI3B,CACN,GAAI,CACH,EAAiB,EAAa,GAAG,WAElC,EAAE,EAAQ,EAAQ,CACjB,EAAgB,EAAc,EAAQ,GACtC,EAAU,IAEX,EAAE,EAAK,EAAO,CACb,GAAM,GAAuB,GAC7B,AAAI,EAAqB,GAAG,GAAqB,SAAwB,EAAI,IACzE,EAAuB,GAAG,GAAqB,WAA4B,EAAI,IACnF,EAAa,KAAK,IAEnB,EAAE,EAAO,CACR,AAAI,GACJ,GAAc,EAAa,GAAG,SAAU,GACxC,EAAU,KAEX,EAAE,EAAO,CACR,EAAe,EAAa,GAAG,SAAU,GACzC,EAAU,IAEX,EAAE,EAAW,CACZ,EAAkB,EAAc,KAKnC,YAAyB,EAAK,CAC7B,GAAI,GACA,EACA,EACA,EACA,EACA,EACA,EACA,EACA,EAAuB,EAAI,IAAuB,EAAI,KACtD,EACA,EACA,EACA,EACA,EACJ,EAAS,GAAI,IAAO,IAEpB,WAA2B,EAAK,EAAO,CAItC,GAHI,EAAqB,GAAG,GAAY,MACpC,EAAqB,GAAG,GAAY,MACpC,GAAa,MAAM,GAAY,CAAC,CAAe,GAAI,IAAuB,EAAI,OAC9E,EAAW,MAAO,IAEtB,GADI,GAAa,MAAM,GAAY,CAAC,CAAe,GAAI,IAAM,CAAkB,EAAI,OAC/E,EAAW,MAAO,IACtB,GAAI,CAAc,EAAI,GAAI,MAAO,IAGlC,GAAI,GAAqB,EAAkB,EAAK,IAC5C,EAAY,GAAsB,EAAmB,GACrD,EAAY,GAAW,GAAgB,GAC3C,SAAS,GAAI,IAAO,IAEpB,EAAU,GAAI,IAAM,CAClB,MAAO,CACN,KAAiB,EAAI,GACrB,YAAa,MAIhB,EAAQ,IAAI,SAAgC,EAAI,IAEzC,CACN,GAAI,CACH,EAAiB,EAAO,GAAG,UAC3B,EAAK,IACL,EAAM,EAAQ,OACd,EAAO,EAAQ,QACf,EAAK,EAAQ,MACT,GAAW,EAAU,IACzB,EAAK,IACD,GAAW,EAAU,IACzB,EAAK,IACL,EAAiB,EAAO,GAAG,UAC3B,EAAK,IACL,EAAiB,EAAQ,GAAG,UAC5B,EAAK,EAAI,QAAS,0CAClB,EAAK,EAAM,QAAS,2BACpB,EAAK,EAAK,QAAS,uBAEpB,EAAE,EAAQ,EAAQ,CACjB,EAAgB,EAAQ,EAAQ,GAChC,EAAO,EAAQ,EAAI,GACnB,EAAO,EAAQ,EAAK,GACpB,EAAO,EAAK,GACZ,EAAO,EAAM,GACT,GAAW,EAAU,EAAE,EAAI,MAC/B,EAAO,EAAM,GACT,GAAW,EAAU,EAAE,EAAM,MACjC,EAAO,EAAQ,EAAI,GACnB,EAAgB,EAAQ,EAAQ,GAChC,EAAO,EAAQ,EAAI,GACnB,EAAgB,EAAS,EAAQ,GACjC,EAAU,IAEX,EAAE,EAAK,CAAC,GAAQ,CACf,AAAI,IAAwB,GAAqB,EAAkB,EAAK,KACnE,IAAW,EAAU,EAAE,GAC3B,EAAY,GAAsB,EAAmB,GAEjD,GACH,GAAU,IACV,EAAU,EAAE,EAAI,QAId,EAAqB,GAAG,GAAuB,EAAI,IAAuB,EAAI,MAElF,AAAI,EACH,AAAI,EACH,GAAU,EAAE,EAAK,GAEb,EAAqB,GACxB,EAAc,EAAW,IAG1B,GAAY,GAAgB,GAC5B,EAAU,IACV,EAAc,EAAW,GACzB,EAAU,EAAE,EAAM,OAET,GACV,MAEA,EAAe,EAAW,EAAG,EAAG,IAAM,CACrC,EAAY,OAGb,MAGD,GAAM,GAAkB,GACxB,AAAI,EAAmB,GAAG,GAAgB,KAAkB,EAAI,IAChE,EAAQ,KAAK,IAEd,EAAE,EAAO,CACR,AAAI,GACJ,GAAc,EAAO,GAAG,SAAU,GAClC,EAAc,GACd,EAAc,EAAO,GAAG,SAAU,GAClC,EAAc,EAAQ,GAAG,SAAU,GACnC,EAAU,KAEX,EAAE,EAAO,CACR,EAAe,EAAO,GAAG,SAAU,GACnC,EAAe,GACf,EAAe,EAAO,GAAG,SAAU,GACnC,EAAe,EAAQ,GAAG,SAAU,GACpC,EAAU,IAEX,EAAE,EAAW,CACZ,EAAkB,EAAQ,GACtB,GAAW,EAAO,GAClB,GAAW,EAAO,GAElB,GACH,EAAU,IAGP,GAAW,EAAU,IACrB,GAAW,EAAO,GACtB,EAAkB,EAAQ,GACtB,GAAW,EAAO,GACtB,EAAkB,EAAS,KAK9B,YAA4B,EAAa,CACxC,MAAO,YAAW,GAAa,QAAQ,GAAG,WAG3C,YAAkB,EAAQ,EAAS,EAAc,CAChD,GAAI,GACJ,GAAoB,EAAQ,GAAO,GAAW,EAAa,EAAG,EAAS,IACvE,GAAI,GACA,EAEJ,GAAQ,SAAY,CACnB,EAAa,EAAG,EAAa,MAC7B,EAAa,EAAG,EAAW,KAAM,IAAI,YAAY,IACjD,QAAQ,IAAI,KAGb,iBAAkC,EAAc,CAC/C,GAAI,CACH,GAAI,GAAM,KAAM,IAAI,mBAAmB,EAAY,CAAC,EAAa,KAAK,KACtE,EAAa,EAAG,EAAS,KAAK,KAAK,UAAU,MAAQ,EAAS,KAAK,KAAK,UAAU,MAAM,OAAO,GAAQ,IAAS,GAAe,GAC/H,EAAa,EAAG,GAChB,GAAc,IAAI,EAAS,KAAK,KAAK,UAAU,MAAM,QACrD,IACA,QAAQ,IAAI,SACL,EAAN,CACD,QAAQ,IAAI,IAId,WAA8B,EAAO,CACpC,EAAmB,EAAM,OAAO,cAGjC,iBAAsC,EAAc,EAAa,CAChE,GAAI,CACH,GAAI,GAAe,EAClB,EAAmB,WACT,EAAc,EAAG,CAC3B,MAAM,0CACN,OAGD,GAAI,GAAQ,EAAa,KAAK,iBAAiB,KAAK,GAAmB,EAAgB,KAAO,UAAU,MACpG,EAAW,EAAa,KAAK,iBAAiB,KAAK,GAAmB,EAAgB,KAAO,aAAa,MAC1G,EAAW,EAAa,KAAK,iBAAiB,KAAK,GAAmB,EAAgB,KAAO,aAAa,MAC1G,EAAM,KAAM,IAAI,uBAAuB,EAAY,EAAa,KAAK,GAAI,EAAa,KAAK,SAAW,EAAa,EAAO,EAAa,KAAK,QAAQ,GAAI,EAAU,GACtK,EAAa,EAAG,GAChB,IACA,QAAQ,IAAI,SACL,EAAN,CACD,QAAQ,IAAI,IAId,YAA0B,CACzB,GAAI,GAAY,EAEhB,EAAS,KAAK,KAAK,UAAU,MAAM,QAAQ,GAAgB,CAE1D,GADmB,EAAa,KAAK,QAAQ,MAAQ,EAAa,KAAK,WAIxE,EAAa,EAAG,EAAS,KAAK,KAAK,cAAgB,EAAU,QAAQ,GAAG,WAAY,GAGrF,YAAwB,CACvB,MAAI,GAAS,KAAK,KAAK,UAAU,MAAM,OAAS,EAOjD,kBAAmC,CAClC,GAAM,MAGP,MAAO,CACN,EACA,EACA,EACA,EACA,EACA,EACA,GAIF,oBAAmB,EAAgB,CAClC,YAAY,EAAS,CACpB,QACA,EAAK,KAAM,EAAS,GAAU,GAAiB,EAAgB,MAI1D,GAAQ,GCzmBf,YAAyB,EAAK,CAC7B,GAAI,GACA,EACA,EACA,EACA,EACA,EACJ,SAAS,GAAI,IAAO,IACpB,EAAS,GAAI,IAAO,IAEb,CACN,GAAI,CACH,EAAiB,EAAO,GAAG,UAC3B,EAAK,IACL,EAAM,EAAQ,OAEd,EAAI,UAAY;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA,0DAyChB,EAAM,IACN,EAAiB,EAAO,GAAG,UAC3B,EAAK,EAAK,QAAS,4BAEpB,EAAE,EAAQ,EAAQ,CACjB,EAAgB,EAAQ,EAAQ,GAChC,EAAO,EAAQ,EAAI,GACnB,EAAO,EAAQ,EAAK,GACpB,EAAO,EAAQ,EAAK,GACpB,EAAgB,EAAQ,EAAQ,GAChC,EAAU,IAEX,EAAG,EACH,EAAE,EAAO,CACR,AAAI,GACJ,GAAc,EAAO,GAAG,SAAU,GAClC,EAAc,EAAO,GAAG,SAAU,GAClC,EAAU,KAEX,EAAE,EAAO,CACR,EAAe,EAAO,GAAG,SAAU,GACnC,EAAe,EAAO,GAAG,SAAU,GACnC,EAAU,IAEX,EAAE,EAAW,CACZ,EAAkB,EAAQ,GACtB,GAAW,EAAO,GAClB,GAAW,EAAO,GAClB,GAAW,EAAO,GACtB,EAAkB,EAAQ,KAK7B,oBAAiC,EAAgB,CAChD,YAAY,EAAS,CACpB,QACA,EAAK,KAAM,EAAS,KAAM,GAAiB,EAAgB,MAItD,GAAQ,GClGf,YAAyB,EAAK,CAC7B,GAAI,GACA,EACA,EACA,EACA,EACA,EACJ,SAAS,GAAI,IAAO,IACpB,EAAS,GAAI,IAAO,IAEb,CACN,GAAI,CACH,EAAiB,EAAO,GAAG,UAC3B,EAAK,IACL,EAAM,EAAQ,OAEd,EAAI,UAAY;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA,0DAchB,EAAM,IACN,EAAiB,EAAO,GAAG,UAC3B,EAAK,EAAK,QAAS,4BAEpB,EAAE,EAAQ,EAAQ,CACjB,EAAgB,EAAQ,EAAQ,GAChC,EAAO,EAAQ,EAAI,GACnB,EAAO,EAAQ,EAAK,GACpB,EAAO,EAAQ,EAAK,GACpB,EAAgB,EAAQ,EAAQ,GAChC,EAAU,IAEX,EAAG,EACH,EAAE,EAAO,CACR,AAAI,GACJ,GAAc,EAAO,GAAG,SAAU,GAClC,EAAc,EAAO,GAAG,SAAU,GAClC,EAAU,KAEX,EAAE,EAAO,CACR,EAAe,EAAO,GAAG,SAAU,GACnC,EAAe,EAAO,GAAG,SAAU,GACnC,EAAU,IAEX,EAAE,EAAW,CACZ,EAAkB,EAAQ,GACtB,GAAW,EAAO,GAClB,GAAW,EAAO,GAClB,GAAW,EAAO,GACtB,EAAkB,EAAQ,KAK7B,oBAA2B,EAAgB,CAC1C,YAAY,EAAS,CACpB,QACA,EAAK,KAAM,EAAS,KAAM,GAAiB,EAAgB,MAItD,GAAQ,GCvEf,YAAyB,EAAK,CAC7B,GAAI,GACA,EACA,EACA,EACA,EACA,EACJ,SAAS,GAAI,IAAO,IACpB,EAAS,GAAI,IAAO,IAEb,CACN,GAAI,CACH,EAAiB,EAAO,GAAG,UAC3B,EAAK,IACL,EAAM,EAAQ,OAEd,EAAI,UAAY;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA,0DAsEhB,EAAO,IACP,EAAiB,EAAO,GAAG,UAC3B,EAAK,EAAK,QAAS,4BAEpB,EAAE,EAAQ,EAAQ,CACjB,EAAgB,EAAQ,EAAQ,GAChC,EAAO,EAAQ,EAAI,GACnB,EAAO,EAAQ,EAAK,GACpB,EAAO,EAAQ,EAAM,GACrB,EAAgB,EAAQ,EAAQ,GAChC,EAAU,IAEX,EAAG,EACH,EAAE,EAAO,CACR,AAAI,GACJ,GAAc,EAAO,GAAG,SAAU,GAClC,EAAc,EAAO,GAAG,SAAU,GAClC,EAAU,KAEX,EAAE,EAAO,CACR,EAAe,EAAO,GAAG,SAAU,GACnC,EAAe,EAAO,GAAG,SAAU,GACnC,EAAU,IAEX,EAAE,EAAW,CACZ,EAAkB,EAAQ,GACtB,GAAW,EAAO,GAClB,GAAW,EAAO,GAClB,GAAW,EAAO,GACtB,EAAkB,EAAQ,KAK7B,oBAA4B,EAAgB,CAC3C,YAAY,EAAS,CACpB,QACA,EAAK,KAAM,EAAS,KAAM,GAAiB,EAAgB,MAItD,GAAQ,GC7Hf,YAAyB,EAAK,CAC7B,GAAI,GACA,EACA,EACA,EACA,EACA,EACA,EACA,EACA,EACA,EACA,EACA,EACA,EACA,EACA,EACA,EACA,EACA,EACA,EACA,EACA,EACA,EACA,EACA,EACA,GACA,GACA,EACA,GACA,GACA,GACA,GACA,GACA,GACA,GACA,GACA,GACA,GACA,GACA,GACA,GACA,GAEJ,MAAO,CACN,GAAI,CACH,EAAO,EAAQ,QACf,EAAO,EAAQ,OACf,EAAS,EAAQ,SACjB,EAAO,YAAc,OACrB,EAAK,IACL,EAAS,EAAQ,SACjB,EAAK,IACL,EAAO,EAAQ,OACf,EAAS,EAAQ,SACjB,EAAO,YAAc,UACrB,EAAK,IACL,EAAS,EAAQ,SACjB,EAAK,IACL,EAAS,EAAQ,SACjB,EAAK,IACL,EAAS,EAAQ,SACjB,EAAK,IACL,EAAS,EAAQ,SACjB,EAAK,IACL,EAAS,EAAQ,SACjB,EAAK,IACL,EAAO,EAAQ,OACf,EAAS,EAAQ,SACjB,EAAO,YAAc,gBACrB,EAAM,IACN,EAAS,EAAQ,SACjB,EAAM,IACN,GAAO,EAAQ,OACf,GAAS,EAAQ,SACjB,GAAO,YAAc,+CACrB,EAAM,IACN,GAAS,EAAQ,SACjB,GAAM,IACN,GAAS,EAAQ,SACjB,GAAM,IACN,GAAO,EAAQ,OACf,GAAS,EAAQ,SACjB,GAAO,YAAc,kEACrB,GAAM,IACN,GAAS,EAAQ,SACjB,GAAM,IACN,GAAO,EAAQ,OAEf,GAAK,UAAY;AAAA,8FAGjB,GAAM,IACN,GAAU,EAAQ,SAClB,EAAK,EAAQ,QAAS,0BACtB,EAAK,EAAQ,MAAO,QACpB,EAAO,SAAW,GAClB,EAAK,EAAQ,QAAS,sBACtB,EAAK,EAAQ,OAAQ,QACrB,EAAK,EAAQ,cAAe,QAC5B,EAAK,EAAQ,KAAM,QACnB,EAAK,EAAM,QAAS,iBACpB,EAAK,EAAQ,QAAS,0BACtB,EAAK,EAAQ,MAAO,iBACpB,EAAO,SAAW,GAClB,EAAK,EAAQ,QAAS,sBACtB,EAAK,EAAQ,KAAM,iBACnB,EAAK,EAAQ,OAAQ,QACrB,EAAK,EAAQ,cAAe,kBAC5B,EAAK,EAAQ,QAAS,sBACtB,EAAK,EAAQ,OAAQ,QACrB,EAAK,EAAQ,cAAe,yBAC5B,EAAO,SAAW,GAClB,EAAK,EAAQ,QAAS,sBACtB,EAAK,EAAQ,OAAQ,QACrB,EAAK,EAAQ,cAAe,QAC5B,EAAO,SAAW,GAClB,EAAK,EAAQ,QAAS,sBACtB,EAAK,EAAQ,OAAQ,QACrB,EAAK,EAAQ,cAAe,oBAC5B,EAAO,SAAW,GAClB,EAAK,EAAQ,QAAS,sBACtB,EAAK,EAAQ,OAAQ,QACrB,EAAK,EAAQ,cAAe,qBAC5B,EAAK,EAAM,QAAS,iBACpB,EAAK,EAAQ,QAAS,0BACtB,EAAK,EAAQ,MAAO,SACpB,EAAO,SAAW,GAClB,EAAK,EAAQ,QAAS,sBACtB,EAAK,EAAQ,KAAM,SACnB,EAAK,EAAQ,OAAQ,SACrB,EAAK,EAAQ,cAAe,SAC5B,EAAK,EAAM,QAAS,iBACpB,EAAK,GAAQ,MAAO,aACpB,EAAK,GAAQ,QAAS,0BACtB,EAAK,GAAQ,QAAS,8BACtB,EAAK,GAAQ,KAAM,aACnB,EAAK,GAAQ,OAAQ,QACrB,EAAK,GAAQ,cAAe,aAC5B,EAAK,GAAQ,QAAS,sBACtB,EAAK,GAAQ,KAAM,UACnB,EAAK,GAAQ,OAAQ,QACrB,EAAK,GAAQ,cAAe,UAC5B,EAAK,GAAM,QAAS,iBACpB,EAAK,GAAQ,MAAO,YACpB,EAAK,GAAQ,QAAS,0BACtB,GAAO,SAAW,GAClB,EAAK,GAAQ,QAAS,sBACtB,EAAK,GAAQ,KAAM,YACnB,EAAK,GAAQ,OAAQ,QACrB,EAAK,GAAQ,cAAe,IAC5B,EAAK,GAAM,QAAS,iBACpB,GAAU,GAAM,kBAAmB,OACnC,EAAK,GAAM,QAAS,iBACpB,EAAK,GAAS,QAAS,wBACvB,EAAK,GAAS,OAAQ,UACtB,GAAQ,MAAQ,SAChB,EAAK,EAAM,QAAS,kBAErB,EAAE,GAAQ,GAAQ,CACjB,EAAO,GAAQ,EAAM,IACrB,EAAO,EAAM,GACb,EAAO,EAAM,GACb,EAAO,EAAM,GACb,EAAO,EAAM,GACb,GAAgB,EAAiB,EAAI,GAAG,MACxC,EAAO,EAAM,GACb,EAAO,EAAM,GACb,EAAO,EAAM,GACb,EAAO,EAAM,GACb,EAAO,EAAM,GACb,GAAgB,EAAiB,EAAI,GAAG,gBACxC,EAAO,EAAM,GACb,EAAO,EAAM,GACb,GAAgB,EAAiB,EAAI,GAAG,gBACxC,EAAO,EAAM,GACb,EAAO,EAAM,GACb,GAAgB,EAAiB,EAAI,GAAG,cACxC,EAAO,EAAM,GACb,EAAO,EAAM,GACb,GAAgB,EAAiB,EAAI,GAAG,eACxC,EAAO,EAAM,GACb,EAAO,EAAM,GACb,GAAgB,EAAiB,EAAI,GAAG,gBACxC,EAAO,EAAM,GACb,EAAO,EAAM,GACb,EAAO,EAAM,GACb,EAAO,EAAM,GACb,EAAO,EAAM,GACb,GAAgB,EAAiB,EAAI,GAAG,OACxC,EAAO,EAAM,GACb,EAAO,EAAM,IACb,EAAO,GAAM,IACb,EAAO,GAAM,GACb,EAAO,GAAM,IACb,GAAgB,GAAiB,EAAI,GAAG,WACxC,EAAO,GAAM,IACb,EAAO,GAAM,IACb,GAAgB,GAAiB,EAAI,GAAG,QACxC,EAAO,EAAM,IACb,EAAO,EAAM,IACb,EAAO,GAAM,IACb,EAAO,GAAM,IACb,EAAO,GAAM,IACb,GAAgB,GAAiB,EAAI,GAAG,QACxC,EAAO,EAAM,IACb,EAAO,EAAM,IACb,EAAO,EAAM,IACb,EAAO,EAAM,IAER,IACJ,IAAU,CACT,GAAO,EAAQ,QAAkC,EAAI,IACrD,GAAO,EAAQ,QAAkC,EAAI,IACrD,GAAO,EAAQ,QAAkC,EAAI,IACrD,GAAO,EAAQ,QAAkC,EAAI,IACrD,GAAO,EAAQ,QAAkC,EAAI,IACrD,GAAO,EAAQ,QAAkC,EAAI,IACrD,GAAO,EAAQ,QAAkC,EAAI,IACrD,GAAO,GAAQ,QAAkC,EAAI,KACrD,GAAO,GAAQ,QAAkC,EAAI,KACrD,GAAO,GAAQ,QAAkC,EAAI,KACrD,GAAO,EAAM,SAAU,GAA6B,EAAI,MAGzD,GAAU,KAGZ,EAAE,GAAK,CAAC,IAAQ,CACf,AAAI,GAAiB,GAAK,EAAO,QAAmB,GAAI,GAAG,MAC1D,GAAgB,EAAiB,GAAI,GAAG,MAGrC,GAAiB,GAAK,EAAO,QAAmB,GAAI,GAAG,gBAC1D,GAAgB,EAAiB,GAAI,GAAG,gBAGrC,GAAiB,GAAK,EAAO,QAAmB,GAAI,GAAG,gBAC1D,GAAgB,EAAiB,GAAI,GAAG,gBAGrC,GAAiB,GAAK,EAAO,QAAmB,GAAI,GAAG,cAC1D,GAAgB,EAAiB,GAAI,GAAG,cAGrC,GAAiB,GAAK,EAAO,QAAmB,GAAI,GAAG,eAC1D,GAAgB,EAAiB,GAAI,GAAG,eAGrC,GAAiB,GAAK,EAAO,QAAmB,GAAI,GAAG,gBAC1D,GAAgB,EAAiB,GAAI,GAAG,gBAGrC,GAAiB,GAAK,EAAO,QAAmB,GAAI,GAAG,OAC1D,GAAgB,EAAiB,GAAI,GAAG,OAGrC,GAAiB,GAAK,GAAO,QAAmB,GAAI,GAAG,WAC1D,GAAgB,GAAiB,GAAI,GAAG,WAGrC,GAAiB,GAAK,GAAO,QAAmB,GAAI,GAAG,QAC1D,GAAgB,GAAiB,GAAI,GAAG,QAGrC,GAAiB,GAAK,GAAO,QAAmB,GAAI,GAAG,QAC1D,GAAgB,GAAiB,GAAI,GAAG,SAG1C,EAAG,EACH,EAAG,EACH,EAAE,GAAW,CACZ,AAAI,IAAW,EAAO,GACtB,GAAU,GACV,GAAQ,MAKX,YAAkB,EAAQ,EAAS,EAAc,CAChD,GAAI,CAAE,UAAW,EACX,EAAW,KAEb,EAAO,CACV,KAAM,GACN,eAAgB,GAChB,eAAgB,GAChB,aAAc,GACd,cAAe,GACf,eAAgB,GAChB,MAAO,GACP,UAAW,GACX,OAAQ,GACR,OAAQ,IAGH,EAAW,SAAY,CAC5B,GAAI,CAAC,EAAK,OAAO,QAAQ,OAAQ,KAAO,CAAC,EAAK,UAAU,QAAQ,OAAQ,IAAK,CAC5E,MAAM,4CACN,OAGD,EAAS,OAAQ,CAAE,KAAM,KAEzB,GAAI,CACH,GAAI,GAAM,KAAM,OAAM,AAAiB,GAA0B,0BAA2B,CAC3F,OAAQ,OACR,QAAS,CAAE,eAAgB,oBAC3B,KAAM,KAAK,UAAU,KAGtB,EAAM,KAAM,GAAI,OAChB,EAAS,OAAQ,CAAE,KAAM,KAEzB,AAAI,EAAI,OACP,AAAI,EAAI,SAAW,KAClB,EAAO,GAAO,EAAI,SAElB,EAAO,GAAM,EAAI,SAGlB,EAAO,GAAM,gDAEP,EAAN,CACD,QAAQ,IAAI,GACZ,EAAS,OAAQ,CAAE,KAAM,KACzB,EAAO,GAAM,4CAIf,YAAgC,CAC/B,EAAK,KAAO,KAAK,MACjB,EAAa,EAAG,GAGjB,YAAgC,CAC/B,EAAK,eAAiB,KAAK,MAC3B,EAAa,EAAG,GAGjB,YAAgC,CAC/B,EAAK,eAAiB,KAAK,MAC3B,EAAa,EAAG,GAGjB,YAAgC,CAC/B,EAAK,aAAe,KAAK,MACzB,EAAa,EAAG,GAGjB,YAAgC,CAC/B,EAAK,cAAgB,KAAK,MAC1B,EAAa,EAAG,GAGjB,YAAgC,CAC/B,EAAK,eAAiB,KAAK,MAC3B,EAAa,EAAG,GAGjB,YAAgC,CAC/B,EAAK,MAAQ,KAAK,MAClB,EAAa,EAAG,GAGjB,YAAgC,CAC/B,EAAK,UAAY,KAAK,MACtB,EAAa,EAAG,GAGjB,YAAgC,CAC/B,EAAK,OAAS,KAAK,MACnB,EAAa,EAAG,GAGjB,YAAgC,CAC/B,EAAK,OAAS,KAAK,MACnB,EAAa,EAAG,GAGjB,SAAO,MAAQ,GAAW,CACzB,AAAI,UAAY,IAAS,EAAa,EAAG,EAAS,EAAQ,SAGpD,CACN,EACA,EACA,EACA,EACA,EACA,EACA,EACA,EACA,EACA,EACA,EACA,EACA,GAIF,oBAA4B,EAAgB,CAC3C,YAAY,EAAS,CACpB,QACA,EAAK,KAAM,EAAS,GAAU,GAAiB,EAAgB,CAAE,OAAQ,MAIpE,GAAQ,GClaf,YAAyB,EAAK,CAC7B,GAAI,GAEJ,MAAO,CACN,GAAI,CACH,EAAO,EAAQ,OACf,EAAK,UAAY,mRACjB,EAAK,EAAM,QAAS,8BAErB,EAAE,EAAQ,EAAQ,CACjB,EAAO,EAAQ,EAAM,IAEtB,EAAG,EACH,EAAG,EACH,EAAG,EACH,EAAE,EAAW,CACZ,AAAI,GAAW,EAAO,KAKzB,oBAAqB,EAAgB,CACpC,YAAY,EAAS,CACpB,QACA,EAAK,KAAM,EAAS,KAAM,GAAiB,EAAgB,MAItD,GAAQ,GCVf,YAA6B,EAAK,CACjC,GAAI,GACA,EACA,EACA,EACA,EACA,EACA,EACA,EACA,EACJ,SAAgB,GAAI,IAAc,CAAE,MAAO,CAAE,OAAuB,EAAI,MACxE,EAAc,IAAI,OAA0B,EAAI,IAEzC,CACN,GAAI,CACH,EAAM,EAAQ,OACd,EAAK,EAAQ,MACb,EAAG,YAAc,wBACjB,EAAK,IACL,EAAI,EAAQ,KACZ,EAAE,YAAc,kEAChB,EAAK,IACL,EAAK,EAAQ,MACb,EAAK,IACL,EAAiB,EAAc,GAAG,UAClC,EAAK,EAAI,QAAS,kBAClB,EAAK,EAAG,QAAS,kBACjB,EAAK,EAAI,QAAS,wBAClB,EAAK,EAAK,QAAS,iCACnB,GAAU,EAAK,gBAAiB,UAEjC,EAAE,EAAQ,EAAQ,CACjB,EAAO,EAAQ,EAAK,GACpB,EAAO,EAAK,GACZ,EAAO,EAAK,GACZ,EAAO,EAAK,GACZ,EAAO,EAAK,GACZ,EAAO,EAAK,GACZ,EAAO,EAAK,GACZ,EAAgB,EAAe,EAAK,MACpC,EAAU,IAEX,EAAG,EACH,EAAE,EAAO,CACR,AAAI,GACJ,GAAc,EAAc,GAAG,SAAU,GACzC,EAAU,KAEX,EAAE,EAAO,CACR,EAAe,EAAc,GAAG,SAAU,GAC1C,EAAU,IAEX,EAAE,EAAW,CACZ,AAAI,GAAW,EAAO,GACtB,EAAkB,KAMrB,YAA2B,EAAK,CAC/B,GAAI,GAEJ,WAA6B,EAAK,EAAO,CACxC,MAAe,GAAI,GAAW,GACvB,GAGR,GAAI,GAAqB,EAAoB,EAAK,IAC9C,EAAW,EAAmB,GAElC,MAAO,CACN,GAAI,CACH,EAAS,IACT,EAAkB,MAEnB,EAAE,EAAQ,EAAQ,CACjB,EAAS,EAAE,EAAQ,GACnB,EAAO,EAAQ,EAAiB,IAEjC,EAAE,EAAK,EAAO,CACb,AAAI,IAAwB,GAAqB,EAAoB,EAAK,KAAW,EACpF,EAAS,EAAE,EAAK,GAEhB,GAAS,EAAE,GACX,EAAW,EAAmB,GAE1B,GACH,GAAS,IACT,EAAS,EAAE,EAAgB,WAAY,MAI1C,EAAG,EACH,EAAG,EACH,EAAE,EAAW,CACZ,EAAS,EAAE,GACP,GAAW,EAAO,KAMzB,YAAyB,EAAK,CAC7B,GAAI,GACA,EACA,EACJ,SAAS,GAAI,IAAO,IAEb,CACN,GAAI,CACH,EAAM,EAAQ,OACd,EAAiB,EAAO,GAAG,UAC3B,GAAU,EAAK,UAAW,QAC1B,GAAU,EAAK,kBAAmB,UAClC,GAAU,EAAK,aAAc,SAE9B,EAAE,EAAQ,EAAQ,CACjB,EAAO,EAAQ,EAAK,GACpB,EAAgB,EAAQ,EAAK,MAC7B,EAAU,IAEX,EAAG,EACH,EAAE,EAAO,CACR,AAAI,GACJ,GAAc,EAAO,GAAG,SAAU,GAClC,EAAU,KAEX,EAAE,EAAO,CACR,EAAe,EAAO,GAAG,SAAU,GACnC,EAAU,IAEX,EAAE,EAAW,CACZ,AAAI,GAAW,EAAO,GACtB,EAAkB,KAMrB,YAA2B,EAAK,CAC/B,GAAI,GACA,EACA,EACA,EACA,EAEJ,MAAO,CACN,GAAI,CACH,EAAM,EAAQ,OACd,EAAK,EAAQ,MACb,EAAG,YAAc,WACjB,EAAK,IACL,EAAI,EAAQ,KACZ,EAAK,GAAiB,EAAI,IAC1B,EAAK,EAAI,QAAS,kBAClB,EAAK,EAAG,QAAS,kBACjB,EAAK,EAAK,QAAS,+BAEpB,EAAE,EAAQ,EAAQ,CACjB,EAAO,EAAQ,EAAK,GACpB,EAAO,EAAK,GACZ,EAAO,EAAK,GACZ,EAAO,EAAK,GACZ,EAAO,EAAG,IAEX,EAAE,EAAK,EAAO,CACb,AAAI,EAAoB,GAAG,GAAS,EAAgB,EAAI,KAEzD,EAAE,EAAW,CACZ,AAAI,GAAW,EAAO,KAMzB,YAA2B,EAAK,CAC/B,GAAI,GACA,EACA,EACA,EACA,EAEJ,MAAO,CACN,GAAI,CACH,EAAM,EAAQ,OACd,EAAK,EAAQ,MACb,EAAG,YAAc,QACjB,EAAK,IACL,EAAI,EAAQ,KACZ,EAAK,GAAiB,EAAI,IAC1B,EAAK,EAAI,QAAS,kBAClB,EAAK,EAAG,QAAS,kBACjB,EAAK,EAAK,QAAS,6BAEpB,EAAE,EAAQ,EAAQ,CACjB,EAAO,EAAQ,EAAK,GACpB,EAAO,EAAK,GACZ,EAAO,EAAK,GACZ,EAAO,EAAK,GACZ,EAAO,EAAG,IAEX,EAAE,EAAK,EAAO,CACb,AAAI,EAAoB,GAAG,GAAS,EAAgB,EAAI,KAEzD,EAAE,EAAW,CACZ,AAAI,GAAW,EAAO,KAKzB,YAAyB,EAAK,CAC7B,GAAI,GACA,EACA,EACA,EACA,EACA,EACA,EACJ,EAAS,GAAI,IAAO,IACpB,GAAM,GAAoB,CAAC,GAAiB,GAAmB,IACzD,EAAY,GAElB,WAA2B,EAAK,EAAO,CACtC,MAAkB,GAAI,GAAW,EAClB,EAAI,GAAW,EACvB,EAGR,SAA2B,EAAkB,EAAK,IAClD,EAAW,EAAU,GAA4B,EAAkB,GAA0B,GAC7F,EAAS,GAAI,IAAO,IAEb,CACN,GAAI,CACH,EAAiB,EAAO,GAAG,UAC3B,EAAK,IACL,EAAS,IACT,EAAK,IACL,EAAiB,EAAO,GAAG,WAE5B,EAAE,EAAQ,EAAQ,CACjB,EAAgB,EAAQ,EAAQ,GAChC,EAAO,EAAQ,EAAI,GACnB,EAAU,GAA0B,EAAE,EAAQ,GAC9C,EAAO,EAAQ,EAAI,GACnB,EAAgB,EAAQ,EAAQ,GAChC,EAAU,IAEX,EAAE,EAAK,CAAC,GAAQ,CACf,GAAI,GAAuB,EAC3B,EAA2B,EAAkB,EAAK,GAElD,AAAI,IAA6B,EAChC,EAAU,GAA0B,EAAE,EAAK,GAE3C,MAEA,EAAe,EAAU,GAAuB,EAAG,EAAG,IAAM,CAC3D,EAAU,GAAwB,OAGnC,KACA,EAAW,EAAU,GAErB,AAAK,EAIJ,EAAS,EAAE,EAAK,GAHhB,GAAW,EAAU,GAA4B,EAAkB,GAA0B,GAC7F,EAAS,KAKV,EAAc,EAAU,GACxB,EAAS,EAAE,EAAG,WAAY,KAG5B,EAAE,EAAO,CACR,AAAI,GACJ,GAAc,EAAO,GAAG,SAAU,GAClC,EAAc,GACd,EAAc,EAAO,GAAG,SAAU,GAClC,EAAU,KAEX,EAAE,EAAO,CACR,EAAe,EAAO,GAAG,SAAU,GACnC,EAAe,GACf,EAAe,EAAO,GAAG,SAAU,GACnC,EAAU,IAEX,EAAE,EAAW,CACZ,EAAkB,EAAQ,GACtB,GAAW,EAAO,GACtB,EAAU,GAA0B,EAAE,GAClC,GAAW,EAAO,GACtB,EAAkB,EAAQ,KAK7B,YAAkB,EAAQ,EAAS,EAAc,CAChD,GAAI,GAAY,GACZ,EAAS,GACT,EAAS,GACT,EAAU,GASd,MAAO,CAAC,EAAW,EAAQ,EAAQ,EAPhB,CAAC,EAAK,IAAQ,CAChC,EAAa,EAAG,EAAS,IACzB,EAAa,EAAG,EAAS,GACzB,EAAa,EAAG,EAAU,IAGL,GAAS,EAAa,EAAG,EAAY,EAAM,OAAO,OAIzE,oBAA8B,EAAgB,CAC7C,YAAY,EAAS,CACpB,QACA,EAAK,KAAM,EAAS,GAAU,GAAiB,EAAgB,MAI1D,GAAQ,GC3Uf,YAAyB,EAAK,CAC7B,GAAI,GACA,EACA,EACA,EACA,EACA,EACJ,SAAS,GAAI,IAAO,IACpB,EAAS,GAAI,IAAO,IAEb,CACN,GAAI,CACH,EAAiB,EAAO,GAAG,UAC3B,EAAK,IACL,EAAM,EAAQ,OAEd,EAAI,UAAY;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA;AAAA,+QAwIhB,EAAO,IACP,EAAiB,EAAO,GAAG,UAC3B,EAAK,EAAK,QAAS,6BAEpB,EAAE,EAAQ,EAAQ,CACjB,EAAgB,EAAQ,EAAQ,GAChC,EAAO,EAAQ,EAAI,GACnB,EAAO,EAAQ,EAAK,GACpB,EAAO,EAAQ,EAAM,GACrB,EAAgB,EAAQ,EAAQ,GAChC,EAAU,IAEX,EAAG,EACH,EAAE,EAAO,CACR,AAAI,GACJ,GAAc,EAAO,GAAG,SAAU,GAClC,EAAc,EAAO,GAAG,SAAU,GAClC,EAAU,KAEX,EAAE,EAAO,CACR,EAAe,EAAO,GAAG,SAAU,GACnC,EAAe,EAAO,GAAG,SAAU,GACnC,EAAU,IAEX,EAAE,EAAW,CACZ,EAAkB,EAAQ,GACtB,GAAW,EAAO,GAClB,GAAW,EAAO,GAClB,GAAW,EAAO,GACtB,EAAkB,EAAQ,KAK7B,oBAAiC,EAAgB,CAChD,YAAY,EAAS,CACpB,QACA,EAAK,KAAM,EAAS,KAAM,GAAiB,EAAgB,MAItD,GAAQ,GCxLf,YAAgC,EAAK,CACpC,GAAI,GACA,EACJ,SAAQ,GAAI,IAAM,IAEX,CACN,GAAI,CACH,EAAiB,EAAM,GAAG,WAE3B,EAAE,EAAQ,EAAQ,CACjB,EAAgB,EAAO,EAAQ,GAC/B,EAAU,IAEX,EAAE,EAAO,CACR,AAAI,GACJ,GAAc,EAAM,GAAG,SAAU,GACjC,EAAU,KAEX,EAAE,EAAO,CACR,EAAe,EAAM,GAAG,SAAU,GAClC,EAAU,IAEX,EAAE,EAAW,CACZ,EAAkB,EAAO,KAM5B,YAA+B,EAAK,CACnC,GAAI,GACA,EAEJ,SAAU,GAAI,IAAQ,CACpB,MAAO,CACN,KAAM,mBAA8B,EAAI,GAAG,SAIvC,CACN,GAAI,CACH,EAAiB,EAAQ,GAAG,WAE7B,EAAE,EAAQ,EAAQ,CACjB,EAAgB,EAAS,EAAQ,GACjC,EAAU,IAEX,EAAE,EAAK,EAAO,CACb,GAAM,GAAkB,GACxB,AAAI,EAAmB,GAAG,GAAgB,KAAO,mBAA8B,EAAI,GAAG,OACtF,EAAQ,KAAK,IAEd,EAAE,EAAO,CACR,AAAI,GACJ,GAAc,EAAQ,GAAG,SAAU,GACnC,EAAU,KAEX,EAAE,EAAO,CACR,EAAe,EAAQ,GAAG,SAAU,GACpC,EAAU,IAEX,EAAE,EAAW,CACZ,EAAkB,EAAS,KAM9B,YAA+B,EAAK,CACnC,GAAI,GACA,EACJ,SAAqB,GAAI,IAAmB,IAErC,CACN,GAAI,CACH,EAAiB,EAAmB,GAAG,WAExC,EAAE,EAAQ,EAAQ,CACjB,EAAgB,EAAoB,EAAQ,GAC5C,EAAU,IAEX,EAAE,EAAO,CACR,AAAI,GACJ,GAAc,EAAmB,GAAG,SAAU,GAC9C,EAAU,KAEX,EAAE,EAAO,CACR,EAAe,EAAmB,GAAG,SAAU,GAC/C,EAAU,IAEX,EAAE,EAAW,CACZ,EAAkB,EAAoB,KAMzC,YAA+B,EAAK,CACnC,GAAI,GACA,EACJ,SAAe,GAAI,IAAa,IAEzB,CACN,GAAI,CACH,EAAiB,EAAa,GAAG,WAElC,EAAE,EAAQ,EAAQ,CACjB,EAAgB,EAAc,EAAQ,GACtC,EAAU,IAEX,EAAE,EAAO,CACR,AAAI,GACJ,GAAc,EAAa,GAAG,SAAU,GACxC,EAAU,KAEX,EAAE,EAAO,CACR,EAAe,EAAa,GAAG,SAAU,GACzC,EAAU,IAEX,EAAE,EAAW,CACZ,EAAkB,EAAc,KAMnC,YAA+B,EAAK,CACnC,GAAI,GACA,EACJ,SAAgB,GAAI,IAAc,IAE3B,CACN,GAAI,CACH,EAAiB,EAAc,GAAG,WAEnC,EAAE,EAAQ,EAAQ,CACjB,EAAgB,EAAe,EAAQ,GACvC,EAAU,IAEX,EAAE,EAAO,CACR,AAAI,GACJ,GAAc,EAAc,GAAG,SAAU,GACzC,EAAU,KAEX,EAAE,EAAO,CACR,EAAe,EAAc,GAAG,SAAU,GAC1C,EAAU,IAEX,EAAE,EAAW,CACZ,EAAkB,EAAe,KAMpC,YAA+B,EAAK,CACnC,GAAI,GACA,EACJ,SAAkB,GAAI,IAAgB,IAE/B,CACN,GAAI,CACH,EAAiB,EAAgB,GAAG,WAErC,EAAE,EAAQ,EAAQ,CACjB,EAAgB,EAAiB,EAAQ,GACzC,EAAU,IAEX,EAAE,EAAO,CACR,AAAI,GACJ,GAAc,EAAgB,GAAG,SAAU,GAC3C,EAAU,KAEX,EAAE,EAAO,CACR,EAAe,EAAgB,GAAG,SAAU,GAC5C,EAAU,IAEX,EAAE,EAAW,CACZ,EAAkB,EAAiB,KAMtC,YAA+B,EAAK,CACnC,GAAI,GACA,EACJ,SAAqB,GAAI,IAAmB,IAErC,CACN,GAAI,CACH,EAAiB,EAAmB,GAAG,WAExC,EAAE,EAAQ,EAAQ,CACjB,EAAgB,EAAoB,EAAQ,GAC5C,EAAU,IAEX,EAAE,EAAO,CACR,AAAI,GACJ,GAAc,EAAmB,GAAG,SAAU,GAC9C,EAAU,KAEX,EAAE,EAAO,CACR,EAAe,EAAmB,GAAG,SAAU,GAC/C,EAAU,IAEX,EAAE,EAAW,CACZ,EAAkB,EAAoB,KAMzC,YAA+B,EAAK,CACnC,GAAI,GAEJ,MAAO,CACN,GAAI,CACH,EAAI,GAAK,QAEV,EAAE,EAAQ,EAAQ,CACjB,EAAO,EAAQ,EAAG,IAEnB,EAAE,EAAW,CACZ,AAAI,GAAW,EAAO,KAMzB,YAA+B,EAAK,CACnC,GAAI,GACA,EACJ,SAAO,GAAI,IAAK,IAET,CACN,GAAI,CACH,EAAiB,EAAK,GAAG,WAE1B,EAAE,EAAQ,EAAQ,CACjB,EAAgB,EAAM,EAAQ,GAC9B,EAAU,IAEX,EAAE,EAAO,CACR,AAAI,GACJ,GAAc,EAAK,GAAG,SAAU,GAChC,EAAU,KAEX,EAAE,EAAO,CACR,EAAe,EAAK,GAAG,SAAU,GACjC,EAAU,IAEX,EAAE,EAAW,CACZ,EAAkB,EAAM,KAM3B,YAA+B,EAAK,CACnC,GAAI,GACA,EACJ,SAAW,GAAI,IAAS,CAAE,MAAO,CAAE,KAAM,UAElC,CACN,GAAI,CACH,EAAiB,EAAS,GAAG,WAE9B,EAAE,EAAQ,EAAQ,CACjB,EAAgB,EAAU,EAAQ,GAClC,EAAU,IAEX,EAAG,EACH,EAAE,EAAO,CACR,AAAI,GACJ,GAAc,EAAS,GAAG,SAAU,GACpC,EAAU,KAEX,EAAE,EAAO,CACR,EAAe,EAAS,GAAG,SAAU,GACrC,EAAU,IAEX,EAAE,EAAW,CACZ,EAAkB,EAAU,KAM/B,YAA6B,EAAK,CACjC,GAAI,GACA,EACA,EACA,EACA,EACA,EACA,EACA,EACA,EACA,EACA,EACA,EACA,EACA,EACA,EACA,EACA,EACA,EACA,EACA,EAEJ,SAAS,GAAI,IAAM,CACjB,MAAO,CACN,KAAM,IACN,QAAS,CAAE,QAAS,CAAC,KACrB,QAAS,CAAE,UAId,EAAS,GAAI,IAAM,CACjB,MAAO,CACN,KAAM,kBACN,QAAS,CACR,QAAS,CACR,GACA,CAAC,CAAE,YAAc,EAAE,EAAG,IACtB,CAAC,CAAE,YAAa,EAAS,EAAI,IAG/B,QAAS,CAAE,UAId,EAAS,GAAI,IAAM,CACjB,MAAO,CACN,KAAM,wBACN,QAAS,CAAE,QAAS,CAAC,KACrB,QAAS,CAAE,UAId,EAAS,GAAI,IAAM,CACjB,MAAO,CACN,KAAM,iBACN,QAAS,CAAE,QAAS,CAAC,KACrB,QAAS,CAAE,UAId,EAAS,GAAI,IAAM,CACjB,MAAO,CACN,KAAM,kBACN,QAAS,CAAE,QAAS,CAAC,KACrB,QAAS,CAAE,UAId,EAAS,GAAI,IAAM,CACjB,MAAO,CACN,KAAM,aACN,QAAS,CAAE,QAAS,CAAC,KACrB,QAAS,CAAE,UAId,EAAS,GAAI,IAAM,CACjB,MAAO,CACN,KAAM,uBACN,QAAS,CAAE,QAAS,CAAC,KACrB,QAAS,CAAE,UAId,EAAS,GAAI,IAAM,CACjB,MAAO,CACN,KAAM,OACN,QAAS,CAAE,QAAS,CAAC,KACrB,QAAS,CAAE,UAId,EAAS,GAAI,IAAM,CACjB,MAAO,CACN,KAAM,QACN,QAAS,CAAE,QAAS,CAAC,KACrB,QAAS,CAAE,UAId,EAAS,GAAI,IAAM,CACjB,MAAO,CACN,KAAM,KACN,QAAS,CAAE,QAAS,CAAC,KACrB,QAAS,CAAE,UAIP,CACN,GAAI,CACH,EAAiB,EAAO,GAAG,UAC3B,EAAK,IACL,EAAiB,EAAO,GAAG,UAC3B,EAAK,IACL,EAAiB,EAAO,GAAG,UAC3B,EAAK,IACL,EAAiB,EAAO,GAAG,UAC3B,EAAK,IACL,EAAiB,EAAO,GAAG,UAC3B,EAAK,IACL,EAAiB,EAAO,GAAG,UAC3B,EAAK,IACL,EAAiB,EAAO,GAAG,UAC3B,EAAK,IACL,EAAiB,EAAO,GAAG,UAC3B,EAAK,IACL,EAAiB,EAAO,GAAG,UAC3B,EAAK,IACL,EAAiB,EAAO,GAAG,WAE5B,EAAE,EAAQ,EAAQ,CACjB,EAAgB,EAAQ,EAAQ,GAChC,EAAO,EAAQ,EAAI,GACnB,EAAgB,EAAQ,EAAQ,GAChC,EAAO,EAAQ,EAAI,GACnB,EAAgB,EAAQ,EAAQ,GAChC,EAAO,EAAQ,EAAI,GACnB,EAAgB,EAAQ,EAAQ,GAChC,EAAO,EAAQ,EAAI,GACnB,EAAgB,EAAQ,EAAQ,GAChC,EAAO,EAAQ,EAAI,GACnB,EAAgB,EAAQ,EAAQ,GAChC,EAAO,EAAQ,EAAI,GACnB,EAAgB,EAAQ,EAAQ,GAChC,EAAO,EAAQ,EAAI,GACnB,EAAgB,EAAQ,EAAQ,GAChC,EAAO,EAAQ,EAAI,GACnB,EAAgB,EAAQ,EAAQ,GAChC,EAAO,EAAQ,EAAI,GACnB,EAAgB,EAAQ,EAAQ,GAChC,EAAU,IAEX,EAAE,EAAK,EAAO,CACb,GAAM,GAAiB,GAEvB,AAAI,EAAoB,GACvB,GAAe,QAAU,CAAE,QAAO,QAGnC,EAAO,KAAK,GACZ,GAAM,GAAiB,GAEvB,AAAI,EAA4B,GAC/B,GAAe,QAAU,CAAE,QAAO,QAGnC,EAAO,KAAK,GACZ,GAAM,IAAiB,GAEvB,AAAI,EAAoB,GACvB,IAAe,QAAU,CAAE,QAAO,QAGnC,EAAO,KAAK,IACZ,GAAM,IAAiB,GAEvB,AAAI,EAAoB,GACvB,IAAe,QAAU,CAAE,QAAO,QAGnC,EAAO,KAAK,IACZ,GAAM,GAAiB,GAEvB,AAAI,EAAoB,GACvB,GAAe,QAAU,CAAE,QAAO,QAGnC,EAAO,KAAK,GACZ,GAAM,IAAiB,GAEvB,AAAI,EAAoB,GACvB,IAAe,QAAU,CAAE,QAAO,QAGnC,EAAO,KAAK,IACZ,GAAM,IAAiB,GAEvB,AAAI,EAAoB,GACvB,IAAe,QAAU,CAAE,QAAO,QAGnC,EAAO,KAAK,IACZ,GAAM,IAAiB,GAEvB,AAAI,EAAoB,GACvB,IAAe,QAAU,CAAE,QAAO,QAGnC,EAAO,KAAK,IACZ,GAAM,IAAiB,GAEvB,AAAI,EAAoB,GACvB,IAAe,QAAU,CAAE,QAAO,QAGnC,EAAO,KAAK,IACZ,GAAM,IAAiB,GAEvB,AAAI,EAAoB,GACvB,IAAe,QAAU,CAAE,QAAO,QAGnC,EAAO,KAAK,KAEb,EAAE,EAAO,CACR,AAAI,GACJ,GAAc,EAAO,GAAG,SAAU,GAClC,EAAc,EAAO,GAAG,SAAU,GAClC,EAAc,EAAO,GAAG,SAAU,GAClC,EAAc,EAAO,GAAG,SAAU,GAClC,EAAc,EAAO,GAAG,SAAU,GAClC,EAAc,EAAO,GAAG,SAAU,GAClC,EAAc,EAAO,GAAG,SAAU,GAClC,EAAc,EAAO,GAAG,SAAU,GAClC,EAAc,EAAO,GAAG,SAAU,GAClC,EAAc,EAAO,GAAG,SAAU,GAClC,EAAU,KAEX,EAAE,EAAO,CACR,EAAe,EAAO,GAAG,SAAU,GACnC,EAAe,EAAO,GAAG,SAAU,GACnC,EAAe,EAAO,GAAG,SAAU,GACnC,EAAe,EAAO,GAAG,SAAU,GACnC,EAAe,EAAO,GAAG,SAAU,GACnC,EAAe,EAAO,GAAG,SAAU,GACnC,EAAe,EAAO,GAAG,SAAU,GACnC,EAAe,EAAO,GAAG,SAAU,GACnC,EAAe,EAAO,GAAG,SAAU,GACnC,EAAe,EAAO,GAAG,SAAU,GACnC,EAAU,IAEX,EAAE,EAAW,CACZ,EAAkB,EAAQ,GACtB,GAAW,EAAO,GACtB,EAAkB,EAAQ,GACtB,GAAW,EAAO,GACtB,EAAkB,EAAQ,GACtB,GAAW,EAAO,GACtB,EAAkB,EAAQ,GACtB,GAAW,EAAO,GACtB,EAAkB,EAAQ,GACtB,GAAW,EAAO,GACtB,EAAkB,EAAQ,GACtB,GAAW,EAAO,GACtB,EAAkB,EAAQ,GACtB,GAAW,EAAO,GACtB,EAAkB,EAAQ,GACtB,GAAW,EAAO,GACtB,EAAkB,EAAQ,GACtB,GAAW,EAAO,GACtB,EAAkB,EAAQ,KAK7B,YAAyB,EAAK,CAC7B,GAAI,GACA,EAEJ,SAAS,GAAI,IAAO,CAClB,MAAO,CACN,IAAa,EAAI,GACjB,QAAS,CAAE,QAAS,CAAC,KACrB,QAAS,CAAE,UAIP,CACN,GAAI,CACH,EAAiB,EAAO,GAAG,WAE5B,EAAE,EAAQ,EAAQ,CACjB,EAAgB,EAAQ,EAAQ,GAChC,EAAU,IAEX,EAAE,EAAK,CAAC,GAAQ,CACf,GAAM,GAAiB,GACvB,AAAI,EAAgB,GAAG,GAAe,IAAc,EAAI,IAEpD,EAAoB,GACvB,GAAe,QAAU,CAAE,QAAO,QAGnC,EAAO,KAAK,IAEb,EAAE,EAAO,CACR,AAAI,GACJ,GAAc,EAAO,GAAG,SAAU,GAClC,EAAU,KAEX,EAAE,EAAO,CACR,EAAe,EAAO,GAAG,SAAU,GACnC,EAAU,IAEX,EAAE,EAAW,CACZ,EAAkB,EAAQ,KAK7B,YAAkB,EAAQ,EAAS,EAAc,CAChD,GAAI,CAAE,MAAM,IAAO,EAEnB,SAAO,MAAQ,GAAW,CACzB,AAAI,OAAS,IAAS,EAAa,EAAG,EAAM,EAAQ,MAG9C,CAAC,GAGT,oBAAqB,EAAgB,CACpC,YAAY,EAAS,CACpB,QACA,EAAK,KAAM,EAAS,GAAU,GAAiB,EAAgB,CAAE,IAAK,MAIjE,GAAQ,GC1nBf,YAAyB,EAAK,CAC7B,GAAI,GACA,EACA,EACJ,SAAS,GAAI,IAAO,IAEb,CACN,GAAI,CACH,EAAO,EAAQ,QACf,EAAiB,EAAO,GAAG,UAC3B,GAAU,EAAM,SAAU,SAE3B,EAAE,EAAQ,EAAQ,CACjB,EAAO,EAAQ,EAAM,GACrB,EAAgB,EAAQ,EAAM,MAC9B,EAAU,IAEX,EAAG,EACH,EAAE,EAAO,CACR,AAAI,GACJ,GAAc,EAAO,GAAG,SAAU,GAClC,EAAU,KAEX,EAAE,EAAO,CACR,EAAe,EAAO,GAAG,SAAU,GACnC,EAAU,IAEX,EAAE,EAAW,CACZ,AAAI,GAAW,EAAO,GACtB,EAAkB,KAKrB,YAAkB,EAAQ,CACzB,UAAQ,IAAM,CACb,QAAQ,IAAI,wBAA2C,MAGjD,GAGR,oBAAkB,EAAgB,CACjC,YAAY,EAAS,CACpB,QACA,EAAK,KAAM,EAAS,GAAU,GAAiB,EAAgB,MAI1D,GAAQ,GCvEf,YAAY,IAAM,GAIlB,GAAI,IAAM,GAAI,IAAI,CAChB,OAAQ,SAAS,OAGZ,GAAQ",
  "names": []
}